\n 1\n

\n \n \n 1\n 1\n INTEGER|0s\n \n \n 1\n 2\n INTEGER|0s\n \n \n 1\n 3\n TEXT|0s\n \n \n 1\n 4\n VARCHAR(255)|0s\n \n \n 1\n 5\n VARCHAR(255)|0s\n \n \n 1\n 6\n DATE|0s\n \n \n 1\n 7\n INTEGER|0s\n \n \n submission_id\n id\n submission\n \n \n comment_id\n 1\n \n \n submission_id\n \n \n id\n 1\n \n \n 1\n TEXT|0s\n \n \n 2\n TEXT|0s\n \n \n 3\n TEXT|0s\n \n \n 4\n INT|0s\n \n \n 5\n TEXT|0s\n \n \n 1\n 1\n INTEGER|0s\n \n \n 1\n 2\n VARCHAR(255)|0s\n \n \n 1\n 3\n TEXT|0s\n \n \n 1\n 4\n TEXT|0s\n \n \n 1\n 5\n DATE|0s\n \n \n 1\n 6\n TEXT|0s\n \n \n 1\n 7\n INTEGER|0s\n \n \n submission_id\n 1\n \n \n id\n 1\n \n \n",[],[157,176,297],{"_104":305,"_96":306,"_158":307,"_160":177,"_161":139,"_162":308,"_164":165,"_106":309,"_101":29,"_167":215,"_169":310,"_170":25,"_171":-5,"_172":311,"_99":312},"0e650810-67fc-11f0-a99a-0224a6c84d84","76dbde40-6a6b-40df-b4fa-b86d3b434339.xml","0e6508ce-67fc-11f0-a99a-0224a6c84d84",532,["D",1753299271922],"\n\n \n \n 3.45.1\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n 1\n 1\n \n \n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n \n \n window\n \n \n window\n \n \n \n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n window\n \n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n 1\n \n \n \n \n \n 1\n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n window\n \n \n 1\n window\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n window\n \n \n 1\n window\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n window\n \n \n window\n \n \n \n window\n \n \n window\n \n \n window\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n aggregate\n \n \n 1\n \n \n \n \n \n 1\n 1\n \n \n window\n \n \n aggregate\n \n \n 1\n 1\n \n \n window\n \n \n 1\n \n \n aggregate\n \n \n window\n \n \n window\n \n \n 1\n \n \n 1\n \n \n \n \n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n \n 1\n \n \n 1\n \n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n \n \n \n 1\n \n \n window\n \n \n 1\n \n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n \n 1\n \n \n \n \n 1\n \n \n \n aggregate\n \n \n \n 1\n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n window\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n aggregate\n \n \n aggregate\n \n \n 1\n \n \n 1\n 2025-07-23.19:03:10\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n

\n 1\n

\n \n \n 1\n 1\n INTEGER|0s\n \n \n 1\n 2\n INTEGER|0s\n \n \n 1\n 3\n TEXT|0s\n \n \n 1\n 4\n VARCHAR(255)|0s\n \n \n 1\n 5\n VARCHAR(255)|0s\n \n \n 1\n 6\n DATE|0s\n \n \n 1\n 7\n INTEGER|0s\n \n \n submission_id\n id\n submission\n \n \n comment_id\n 1\n \n \n submission_id\n \n \n id\n 1\n \n \n 1\n TEXT|0s\n \n \n 2\n TEXT|0s\n \n \n 3\n TEXT|0s\n \n \n 4\n INT|0s\n \n \n 5\n TEXT|0s\n \n \n 1\n 1\n INTEGER|0s\n \n \n 1\n 2\n VARCHAR(255)|0s\n \n \n 1\n 3\n TEXT|0s\n \n \n 1\n 4\n TEXT|0s\n \n \n 1\n 5\n DATE|0s\n \n \n 1\n 6\n TEXT|0s\n \n \n 1\n 7\n INTEGER|0s\n \n \n submission_id\n 1\n \n \n id\n 1\n \n \n",[],[157,176,306],{"_104":314,"_96":315,"_158":316,"_160":177,"_161":139,"_162":317,"_164":165,"_106":318,"_101":29,"_167":215,"_169":319,"_170":25,"_171":-5,"_172":320,"_99":321},"0e7687ac-67fc-11f0-a559-0224a6c84d84","e722fc6f-0cd6-42b2-b0fb-98f42cbb2b23.xml","0e768892-67fc-11f0-a559-0224a6c84d84",533,["D",1753299272051],"\n\n \n \n 3.45.1\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n 1\n 1\n \n \n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n \n \n window\n \n \n window\n \n \n \n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n window\n \n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n 1\n \n \n \n \n \n 1\n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n window\n \n \n 1\n window\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n window\n \n \n 1\n window\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n 1\n 1\n \n \n window\n \n \n window\n \n \n \n window\n \n \n window\n \n \n window\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n aggregate\n \n \n 1\n \n \n \n \n \n 1\n 1\n \n \n window\n \n \n aggregate\n \n \n 1\n 1\n \n \n window\n \n \n 1\n \n \n aggregate\n \n \n window\n \n \n window\n \n \n 1\n \n \n 1\n \n \n \n \n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n \n 1\n \n \n 1\n \n \n \n \n window\n \n \n 1\n \n \n 1\n \n \n \n \n \n 1\n \n \n window\n \n \n 1\n \n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n \n \n 1\n \n \n \n \n 1\n \n \n \n aggregate\n \n \n \n 1\n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n window\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n window\n \n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n \n \n 1\n 1\n \n \n 1\n \n \n 1\n \n \n aggregate\n \n \n aggregate\n \n \n 1\n \n \n 1\n 2025-07-23.19:24:31\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n 2\n \n \n 3\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n 2\n \n \n R\n \n \n 1\n \n \n R\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n \n R\n \n \n 1\n \n

\n 1\n

\n \n \n 1\n TEXT|0s\n \n \n 2\n TEXT|0s\n \n \n 3\n TEXT|0s\n \n \n 4\n INT|0s\n \n \n 5\n TEXT|0s\n \n \n 1\n 1\n INTEGER|0s\n \n \n 1\n 2\n VARCHAR(255)|0s\n \n \n 1\n 3\n TEXT|0s\n \n \n 1\n 4\n TEXT|0s\n \n \n 1\n 5\n DATE|0s\n \n \n 1\n 6\n TEXT|0s\n \n \n 1\n 7\n INTEGER|0s\n \n \n 0\n 1\n 8\n INTEGER|0s\n \n \n 0\n 1\n 9\n INTEGER|0s\n \n \n 0.0\n 1\n 10\n REAL|0s\n \n \n submission_id\n 1\n \n \n id\n 1\n \n \n",[],[157,176,315],[157,176],{"_104":324,"_96":325,"_158":326,"_160":159,"_161":139,"_162":327,"_164":165,"_106":328,"_101":29,"_167":215,"_169":329,"_170":25,"_171":-5,"_172":330,"_99":331},"c6c9e88a-67f2-11f0-bf9d-0224a6c84d84",".gitignore","c6c9e97a-67f2-11f0-bf9d-0224a6c84d84",8,["D",1753295286293],"# Default ignored files\n/shelf/\n/workspace.xml\n# Editor-based HTTP Client requests\n/httpRequests/\n# Datasource local storage ignored files\n/dataSources/\n/dataSources.local.xml\n",[],[157,325],{"_104":333,"_96":334,"_158":335,"_160":159,"_161":139,"_162":336,"_164":165,"_106":337,"_101":119,"_167":215,"_169":338,"_170":25,"_171":-5,"_172":339,"_99":340},"0edcfcda-67fc-11f0-8d4e-0224a6c84d84","aita.iml","c7213734-67f2-11f0-bbbe-0224a6c84d84",546,["D",1753299272716],"\n\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n",[],[157,334],{"_104":342,"_96":343,"_158":344,"_160":159,"_161":139,"_162":345,"_164":165,"_106":346,"_101":29,"_167":215,"_169":347,"_170":25,"_171":-5,"_172":348,"_99":349},"0eabafcc-67fc-11f0-a99a-0224a6c84d84","dataSources.local.xml","0eabb06c-67fc-11f0-a99a-0224a6c84d84",540,["D",1753299272362],"\n\n \n \n \n "\n \n \n no-auth\n \n \n \n \n \n \n \n \n "\n \n \n no-auth\n \n \n \n \n \n \n \n \n "\n \n \n no-auth\n \n \n \n \n \n \n \n",[],[157,343],{"_104":351,"_96":352,"_158":353,"_160":159,"_161":139,"_162":354,"_164":165,"_106":355,"_101":29,"_167":215,"_169":356,"_170":25,"_171":-5,"_172":357,"_99":358},"0e96d6f6-67fc-11f0-9f6f-0224a6c84d84","dataSources.xml","0e96d7be-67fc-11f0-9f6f-0224a6c84d84",538,["D",1753299272261],"\n\n \n \n sqlite.xerial\n true\n org.sqlite.JDBC\n jdbc:sqlite:$PROJECT_DIR$/db/AmItheAsshole.sqlite\n $ProjectFileDir$\n \n \n sqlite.xerial\n true\n org.sqlite.JDBC\n jdbc:sqlite:$PROJECT_DIR$/db/top100.sqlite\n $ProjectFileDir$\n \n \n file://$APPLICATION_CONFIG_DIR$/jdbc-drivers/Xerial SQLiteJDBC/3.45.1/org/xerial/sqlite-jdbc/3.45.1.0/sqlite-jdbc-3.45.1.0.jar\n \n \n file://$APPLICATION_CONFIG_DIR$/jdbc-drivers/Xerial SQLiteJDBC/3.45.1/org/slf4j/slf4j-api/1.7.36/slf4j-api-1.7.36.jar\n \n \n \n \n sqlite.xerial\n true\n org.sqlite.JDBC\n jdbc:sqlite:$PROJECT_DIR$/db/top100_analyzed.sqlite\n $ProjectFileDir$\n \n \n file://$APPLICATION_CONFIG_DIR$/jdbc-drivers/Xerial SQLiteJDBC/3.45.1/org/xerial/sqlite-jdbc/3.45.1.0/sqlite-jdbc-3.45.1.0.jar\n \n \n file://$APPLICATION_CONFIG_DIR$/jdbc-drivers/Xerial SQLiteJDBC/3.45.1/org/slf4j/slf4j-api/1.7.36/slf4j-api-1.7.36.jar\n \n \n \n \n",[],[157,352],{"_104":360,"_96":361,"_158":362,"_160":159,"_161":139,"_162":363,"_164":165,"_106":364,"_101":29,"_167":215,"_169":365,"_170":25,"_171":-5,"_172":366,"_99":367},"0eb80862-67fc-11f0-a713-0224a6c84d84","misc.xml","0eb8090c-67fc-11f0-a713-0224a6c84d84",542,["D",1753299272448],"\n\n \n \n",[],[157,361],{"_104":369,"_96":370,"_158":371,"_160":159,"_161":139,"_162":372,"_164":165,"_106":373,"_101":29,"_167":215,"_169":374,"_170":25,"_171":-5,"_172":375,"_99":376},"c6e19070-67f2-11f0-8de0-0224a6c84d84","modules.xml","c6e19156-67f2-11f0-8de0-0224a6c84d84",10,["D",1753295286453],"\n\n \n \n \n \n \n",[],[157,370],{"_104":378,"_96":379,"_158":380,"_160":159,"_161":139,"_162":381,"_164":165,"_106":382,"_101":29,"_167":215,"_169":383,"_170":25,"_171":-5,"_172":384,"_99":385},"0ea5f690-67fc-11f0-a7d9-0224a6c84d84","sqldialects.xml","0ea5f794-67fc-11f0-a7d9-0224a6c84d84",539,["D",1753299272351],"\n\n \n \n \n \n",[],[157,379],{"_104":387,"_96":388,"_158":389,"_160":159,"_161":139,"_162":390,"_164":165,"_106":391,"_101":29,"_167":215,"_169":392,"_170":25,"_171":-5,"_172":393,"_99":394},"cac7dfdc-67f2-11f0-88e5-0224a6c84d84","vcs.xml","cac7e07c-67f2-11f0-88e5-0224a6c84d84",18,["D",1753295293025],"\n\n \n \n \n",[],[157,388],{"_104":396,"_96":397,"_158":398,"_160":159,"_161":139,"_162":399,"_164":165,"_106":400,"_101":401,"_167":215,"_169":402,"_170":25,"_171":-5,"_172":403,"_99":404},"0ecd9704-67fc-11f0-8d4e-0224a6c84d84","workspace.xml","c6ce163a-67f2-11f0-97a0-0224a6c84d84",545,["D",1753299272603],7,"\n\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n {\n "associatedIndex": 0\n}\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n 1753294466399\n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n \n file://$PROJECT_DIR$/local/extract_top_posts.py\n 137\n \n \n \n \n",[],[157,397],[157],{"_104":407,"_96":100,"_158":408,"_160":-5,"_161":139,"_162":409,"_164":165,"_106":410,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":411,"_99":4588},"f95b701c-67fb-11f0-95df-0224a6c84d84","f95b7300-67fb-11f0-95df-0224a6c84d84",32,["D",1753299236638],[412,507,4562,4570,4579],{"_104":413,"_96":414,"_158":415,"_160":408,"_161":139,"_162":416,"_164":165,"_106":417,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":418,"_99":506},"f98d1a18-67fb-11f0-928e-0224a6c84d84","bin","f98d1ae0-67fb-11f0-928e-0224a6c84d84",34,["D",1753299236960],[419,428,437,446,455,464,473,482,490,498],{"_104":420,"_96":421,"_158":422,"_160":415,"_161":139,"_162":423,"_164":165,"_106":424,"_101":29,"_167":215,"_169":425,"_170":25,"_171":-5,"_172":426,"_99":427},"03ebd53a-67fc-11f0-b770-0224a6c84d84","activate","03ebd62a-67fc-11f0-b770-0224a6c84d84",115,["D",1753299254365],"# This file must be used with \"source bin/activate\" *from bash*\n# you cannot run it directly\n\n\nif [ \"${BASH_SOURCE-}\" = \"$0\" ]; then\n echo \"You must source this script: \\$ source $0\" >&2\n exit 33\nfi\n\ndeactivate () {\n unset -f pydoc >/dev/null 2>&1 || true\n\n # reset old environment variables\n # ! [ -z ${VAR+_} ] returns true if VAR is declared at all\n if ! [ -z \"${_OLD_VIRTUAL_PATH:+_}\" ] ; then\n PATH=\"$_OLD_VIRTUAL_PATH\"\n export PATH\n unset _OLD_VIRTUAL_PATH\n fi\n if ! [ -z \"${_OLD_VIRTUAL_PYTHONHOME+_}\" ] ; then\n PYTHONHOME=\"$_OLD_VIRTUAL_PYTHONHOME\"\n export PYTHONHOME\n unset _OLD_VIRTUAL_PYTHONHOME\n fi\n\n # The hash command must be called to get it to forget past\n # commands. Without forgetting past commands the $PATH changes\n # we made may not be respected\n hash -r 2>/dev/null\n\n if ! [ -z \"${_OLD_VIRTUAL_PS1+_}\" ] ; then\n PS1=\"$_OLD_VIRTUAL_PS1\"\n export PS1\n unset _OLD_VIRTUAL_PS1\n fi\n\n unset VIRTUAL_ENV\n unset VIRTUAL_ENV_PROMPT\n if [ ! \"${1-}\" = \"nondestructive\" ] ; then\n # Self destruct!\n unset -f deactivate\n fi\n}\n\n# unset irrelevant variables\ndeactivate nondestructive\n\nVIRTUAL_ENV=/Users/joostvanoorschot/Development/aita/.venv\nif ([ \"$OSTYPE\" = \"cygwin\" ] || [ \"$OSTYPE\" = \"msys\" ]) && $(command -v cygpath &> /dev/null) ; then\n VIRTUAL_ENV=$(cygpath -u \"$VIRTUAL_ENV\")\nfi\nexport VIRTUAL_ENV\n\n_OLD_VIRTUAL_PATH=\"$PATH\"\nPATH=\"$VIRTUAL_ENV/\"bin\":$PATH\"\nexport PATH\n\nif [ \"x\"'' != x ] ; then\n VIRTUAL_ENV_PROMPT=''\nelse\n VIRTUAL_ENV_PROMPT=$(basename \"$VIRTUAL_ENV\")\nfi\nexport VIRTUAL_ENV_PROMPT\n\n# unset PYTHONHOME if set\nif ! [ -z \"${PYTHONHOME+_}\" ] ; then\n _OLD_VIRTUAL_PYTHONHOME=\"$PYTHONHOME\"\n unset PYTHONHOME\nfi\n\nif [ -z \"${VIRTUAL_ENV_DISABLE_PROMPT-}\" ] ; then\n _OLD_VIRTUAL_PS1=\"${PS1-}\"\n PS1=\"(${VIRTUAL_ENV_PROMPT}) ${PS1-}\"\n export PS1\nfi\n\n# Make sure to unalias pydoc if it's already there\nalias pydoc 2>/dev/null >/dev/null && unalias pydoc || true\n\npydoc () {\n python -m pydoc \"$@\"\n}\n\n# The hash command must be called to get it to forget past\n# commands. Without forgetting past commands the $PATH changes\n# we made may not be respected\nhash -r 2>/dev/null || true\n",[],[100,414,421],{"_104":429,"_96":430,"_158":431,"_160":415,"_161":139,"_162":432,"_164":165,"_106":433,"_101":29,"_167":215,"_169":434,"_170":25,"_171":-5,"_172":435,"_99":436},"03fbf438-67fc-11f0-84bb-0224a6c84d84","activate.csh","03fbf4e2-67fc-11f0-84bb-0224a6c84d84",119,["D",1753299254436],"# This file must be used with \"source bin/activate.csh\" *from csh*.\n# You cannot run it directly.\n# Created by Davide Di Blasi .\n\nset newline='\\\n'\n\nalias deactivate 'test $?_OLD_VIRTUAL_PATH != 0 && setenv PATH \"$_OLD_VIRTUAL_PATH:q\" && unset _OLD_VIRTUAL_PATH; rehash; test $?_OLD_VIRTUAL_PROMPT != 0 && set prompt=\"$_OLD_VIRTUAL_PROMPT:q\" && unset _OLD_VIRTUAL_PROMPT; unsetenv VIRTUAL_ENV; unsetenv VIRTUAL_ENV_PROMPT; test \"\\!:*\" != \"nondestructive\" && unalias deactivate && unalias pydoc'\n\n# Unset irrelevant variables.\ndeactivate nondestructive\n\nsetenv VIRTUAL_ENV /Users/joostvanoorschot/Development/aita/.venv\n\nset _OLD_VIRTUAL_PATH=\"$PATH:q\"\nsetenv PATH \"$VIRTUAL_ENV:q/\"bin\":$PATH:q\"\n\n\n\nif ('' != \"\") then\n setenv VIRTUAL_ENV_PROMPT ''\nelse\n setenv VIRTUAL_ENV_PROMPT \"$VIRTUAL_ENV:t:q\"\nendif\n\nif ( $?VIRTUAL_ENV_DISABLE_PROMPT ) then\n if ( $VIRTUAL_ENV_DISABLE_PROMPT == \"\" ) then\n set do_prompt = \"1\"\n else\n set do_prompt = \"0\"\n endif\nelse\n set do_prompt = \"1\"\nendif\n\nif ( $do_prompt == \"1\" ) then\n # Could be in a non-interactive environment,\n # in which case, $prompt is undefined and we wouldn't\n # care about the prompt anyway.\n if ( $?prompt ) then\n set _OLD_VIRTUAL_PROMPT=\"$prompt:q\"\n if ( \"$prompt:q\" =~ *\"$newline:q\"* ) then\n :\n else\n set prompt = '('\"$VIRTUAL_ENV_PROMPT:q\"') '\"$prompt:q\"\n endif\n endif\nendif\n\nunset env_name\nunset do_prompt\n\nalias pydoc python -m pydoc\n\nrehash\n",[],[100,414,430],{"_104":438,"_96":439,"_158":440,"_160":415,"_161":139,"_162":441,"_164":165,"_106":442,"_101":29,"_167":215,"_169":443,"_170":25,"_171":-5,"_172":444,"_99":445},"03dab0a2-67fc-11f0-928e-0224a6c84d84","activate.fish","03dab160-67fc-11f0-928e-0224a6c84d84",113,["D",1753299254233],"# This file must be used using `source bin/activate.fish` *within a running fish ( http://fishshell.com ) session*.\n# Do not run it directly.\n\nfunction _bashify_path -d \"Converts a fish path to something bash can recognize\"\n set fishy_path $argv\n set bashy_path $fishy_path[1]\n for path_part in $fishy_path[2..-1]\n set bashy_path \"$bashy_path:$path_part\"\n end\n echo $bashy_path\nend\n\nfunction _fishify_path -d \"Converts a bash path to something fish can recognize\"\n echo $argv | tr ':' '\\n'\nend\n\nfunction deactivate -d 'Exit virtualenv mode and return to the normal environment.'\n # reset old environment variables\n if test -n \"$_OLD_VIRTUAL_PATH\"\n # https://github.com/fish-shell/fish-shell/issues/436 altered PATH handling\n if test (echo $FISH_VERSION | head -c 1) -lt 3\n set -gx PATH (_fishify_path \"$_OLD_VIRTUAL_PATH\")\n else\n set -gx PATH $_OLD_VIRTUAL_PATH\n end\n set -e _OLD_VIRTUAL_PATH\n end\n\n if test -n \"$_OLD_VIRTUAL_PYTHONHOME\"\n set -gx PYTHONHOME \"$_OLD_VIRTUAL_PYTHONHOME\"\n set -e _OLD_VIRTUAL_PYTHONHOME\n end\n\n if test -n \"$_OLD_FISH_PROMPT_OVERRIDE\"\n and functions -q _old_fish_prompt\n # Set an empty local `$fish_function_path` to allow the removal of `fish_prompt` using `functions -e`.\n set -l fish_function_path\n\n # Erase virtualenv's `fish_prompt` and restore the original.\n functions -e fish_prompt\n functions -c _old_fish_prompt fish_prompt\n functions -e _old_fish_prompt\n set -e _OLD_FISH_PROMPT_OVERRIDE\n end\n\n set -e VIRTUAL_ENV\n set -e VIRTUAL_ENV_PROMPT\n\n if test \"$argv[1]\" != 'nondestructive'\n # Self-destruct!\n functions -e pydoc\n functions -e deactivate\n functions -e _bashify_path\n functions -e _fishify_path\n end\nend\n\n# Unset irrelevant variables.\ndeactivate nondestructive\n\nset -gx VIRTUAL_ENV /Users/joostvanoorschot/Development/aita/.venv\n\n# https://github.com/fish-shell/fish-shell/issues/436 altered PATH handling\nif test (echo $FISH_VERSION | head -c 1) -lt 3\n set -gx _OLD_VIRTUAL_PATH (_bashify_path $PATH)\nelse\n set -gx _OLD_VIRTUAL_PATH $PATH\nend\nset -gx PATH \"$VIRTUAL_ENV\"'/'bin $PATH\n\n# Prompt override provided?\n# If not, just use the environment name.\nif test -n ''\n set -gx VIRTUAL_ENV_PROMPT ''\nelse\n set -gx VIRTUAL_ENV_PROMPT (basename \"$VIRTUAL_ENV\")\nend\n\n# Unset `$PYTHONHOME` if set.\nif set -q PYTHONHOME\n set -gx _OLD_VIRTUAL_PYTHONHOME $PYTHONHOME\n set -e PYTHONHOME\nend\n\nfunction pydoc\n python -m pydoc $argv\nend\n\nif test -z \"$VIRTUAL_ENV_DISABLE_PROMPT\"\n # Copy the current `fish_prompt` function as `_old_fish_prompt`.\n functions -c fish_prompt _old_fish_prompt\n\n function fish_prompt\n # Run the user's prompt first; it might depend on (pipe)status.\n set -l prompt (_old_fish_prompt)\n\n printf '(%s) ' $VIRTUAL_ENV_PROMPT\n\n string join -- \\n $prompt # handle multi-line prompts\n end\n\n set -gx _OLD_FISH_PROMPT_OVERRIDE \"$VIRTUAL_ENV\"\nend\n",[],[100,414,439],{"_104":447,"_96":448,"_158":449,"_160":415,"_161":139,"_162":450,"_164":165,"_106":451,"_101":29,"_167":215,"_169":452,"_170":25,"_171":-5,"_172":453,"_99":454},"03f482fc-67fc-11f0-bfb3-0224a6c84d84","activate.nu","03f483f6-67fc-11f0-bfb3-0224a6c84d84",117,["D",1753299254385],"# virtualenv activation module\n# Activate with `overlay use activate.nu`\n# Deactivate with `deactivate`, as usual\n#\n# To customize the overlay name, you can call `overlay use activate.nu as foo`,\n# but then simply `deactivate` won't work because it is just an alias to hide\n# the \"activate\" overlay. You'd need to call `overlay hide foo` manually.\n\nexport-env {\n def is-string [x] {\n ($x | describe) == 'string'\n }\n\n def has-env [...names] {\n $names | each {|n|\n $n in $env\n } | all {|i| $i == true}\n }\n\n # Emulates a `test -z`, but better as it handles e.g 'false'\n def is-env-true [name: string] {\n if (has-env $name) {\n # Try to parse 'true', '0', '1', and fail if not convertible\n let parsed = (do -i { $env | get $name | into bool })\n if ($parsed | describe) == 'bool' {\n $parsed\n } else {\n not ($env | get -i $name | is-empty)\n }\n } else {\n false\n }\n }\n\n let virtual_env = r#'/Users/joostvanoorschot/Development/aita/.venv'#\n let bin = r#'bin'#\n\n let is_windows = ($nu.os-info.family) == 'windows'\n let path_name = (if (has-env 'Path') {\n 'Path'\n } else {\n 'PATH'\n }\n )\n\n let venv_path = ([$virtual_env $bin] | path join)\n let new_path = ($env | get $path_name | prepend $venv_path)\n\n # If there is no default prompt, then use the env name instead\n let virtual_env_prompt = (if (r#''# | is-empty) {\n ($virtual_env | path basename)\n } else {\n r#''#\n })\n\n let new_env = {\n $path_name : $new_path\n VIRTUAL_ENV : $virtual_env\n VIRTUAL_ENV_PROMPT : $virtual_env_prompt\n }\n\n let new_env = (if (is-env-true 'VIRTUAL_ENV_DISABLE_PROMPT') {\n $new_env\n } else {\n # Creating the new prompt for the session\n let virtual_prefix = $'(char lparen)($virtual_env_prompt)(char rparen) '\n\n # Back up the old prompt builder\n let old_prompt_command = (if (has-env 'PROMPT_COMMAND') {\n $env.PROMPT_COMMAND\n } else {\n ''\n })\n\n let new_prompt = (if (has-env 'PROMPT_COMMAND') {\n if 'closure' in ($old_prompt_command | describe) {\n {|| $'($virtual_prefix)(do $old_prompt_command)' }\n } else {\n {|| $'($virtual_prefix)($old_prompt_command)' }\n }\n } else {\n {|| $'($virtual_prefix)' }\n })\n\n $new_env | merge {\n PROMPT_COMMAND : $new_prompt\n VIRTUAL_PREFIX : $virtual_prefix\n }\n })\n\n # Environment variables that will be loaded as the virtual env\n load-env $new_env\n}\n\nexport alias pydoc = python -m pydoc\nexport alias deactivate = overlay hide activate\n",[],[100,414,448],{"_104":456,"_96":457,"_158":458,"_160":415,"_161":139,"_162":459,"_164":165,"_106":460,"_101":29,"_167":215,"_169":461,"_170":25,"_171":-5,"_172":462,"_99":463},"03ced994-67fc-11f0-bf1a-0224a6c84d84","activate.ps1","03ceda70-67fc-11f0-bf1a-0224a6c84d84",110,["D",1753299254173],"$script:THIS_PATH = $myinvocation.mycommand.path\n$script:BASE_DIR = Split-Path (Resolve-Path \"$THIS_PATH/..\") -Parent\n\nfunction global:deactivate([switch] $NonDestructive) {\n if (Test-Path variable:_OLD_VIRTUAL_PATH) {\n $env:PATH = $variable:_OLD_VIRTUAL_PATH\n Remove-Variable \"_OLD_VIRTUAL_PATH\" -Scope global\n }\n\n if (Test-Path function:_old_virtual_prompt) {\n $function:prompt = $function:_old_virtual_prompt\n Remove-Item function:\\_old_virtual_prompt\n }\n\n if ($env:VIRTUAL_ENV) {\n Remove-Item env:VIRTUAL_ENV -ErrorAction SilentlyContinue\n }\n\n if ($env:VIRTUAL_ENV_PROMPT) {\n Remove-Item env:VIRTUAL_ENV_PROMPT -ErrorAction SilentlyContinue\n }\n\n if (!$NonDestructive) {\n # Self destruct!\n Remove-Item function:deactivate\n Remove-Item function:pydoc\n }\n}\n\nfunction global:pydoc {\n python -m pydoc $args\n}\n\n# unset irrelevant variables\ndeactivate -nondestructive\n\n$VIRTUAL_ENV = $BASE_DIR\n$env:VIRTUAL_ENV = $VIRTUAL_ENV\n\nif ('' -ne \"\") {\n $env:VIRTUAL_ENV_PROMPT = ''\n}\nelse {\n $env:VIRTUAL_ENV_PROMPT = $( Split-Path $env:VIRTUAL_ENV -Leaf )\n}\n\nNew-Variable -Scope global -Name _OLD_VIRTUAL_PATH -Value $env:PATH\n\n$env:PATH = \"$env:VIRTUAL_ENV/\" + 'bin' + ':' + $env:PATH\nif (!$env:VIRTUAL_ENV_DISABLE_PROMPT) {\n function global:_old_virtual_prompt {\n \"\"\n }\n $function:_old_virtual_prompt = $function:prompt\n\n function global:prompt {\n # Add the custom prefix to the existing prompt\n $previous_prompt_value = & $function:_old_virtual_prompt\n (\"(\" + $env:VIRTUAL_ENV_PROMPT + \") \" + $previous_prompt_value)\n }\n}\n",[],[100,414,457],{"_104":465,"_96":466,"_158":467,"_160":415,"_161":139,"_162":468,"_164":165,"_106":469,"_101":29,"_167":215,"_169":470,"_170":25,"_171":-5,"_172":471,"_99":472},"03df2f4c-67fc-11f0-bf1a-0224a6c84d84","activate_this.py","03df3028-67fc-11f0-bf1a-0224a6c84d84",114,["D",1753299254268],"\"\"\"\nActivate virtualenv for current interpreter:\n\nimport runpy\nrunpy.run_path(this_file)\n\nThis can be used when you must use an existing Python interpreter, not the virtualenv bin/python.\n\"\"\" # noqa: D415\n\nfrom __future__ import annotations\n\nimport os\nimport site\nimport sys\n\ntry:\n abs_file = os.path.abspath(__file__)\nexcept NameError as exc:\n msg = \"You must use import runpy; runpy.run_path(this_file)\"\n raise AssertionError(msg) from exc\n\nbin_dir = os.path.dirname(abs_file)\nbase = bin_dir[: -len('bin') - 1] # strip away the bin part from the __file__, plus the path separator\n\n# prepend bin to PATH (this file is inside the bin directory)\nos.environ[\"PATH\"] = os.pathsep.join([bin_dir, *os.environ.get(\"PATH\", \"\").split(os.pathsep)])\nos.environ[\"VIRTUAL_ENV\"] = base # virtual env is right above bin directory\nos.environ[\"VIRTUAL_ENV_PROMPT\"] = '' or os.path.basename(base)\n\n# add the virtual environments libraries to the host python import mechanism\nprev_length = len(sys.path)\nfor lib in '../lib/python3.13/site-packages'.split(os.pathsep):\n path = os.path.realpath(os.path.join(bin_dir, lib))\n site.addsitedir(path.decode(\"utf-8\") if '' else path)\nsys.path[:] = sys.path[prev_length:] + sys.path[0:prev_length]\n\nsys.real_prefix = sys.prefix\nsys.prefix = base\n",[],[100,414,466],{"_104":474,"_96":475,"_158":476,"_160":415,"_161":139,"_162":477,"_164":165,"_106":478,"_101":29,"_167":215,"_169":479,"_170":25,"_171":-5,"_172":480,"_99":481},"03ee7754-67fc-11f0-a988-0224a6c84d84","pip","03ee77fe-67fc-11f0-a988-0224a6c84d84",116,["D",1753299254367],"#!/Users/joostvanoorschot/Development/aita/.venv/bin/python\n# -*- coding: utf-8 -*-\nimport re\nimport sys\nfrom pip._internal.cli.main import main\nif __name__ == '__main__':\n sys.argv[0] = re.sub(r'(-script\\.pyw|\\.exe)?$', '', sys.argv[0])\n sys.exit(main())\n",[],[100,414,475],{"_104":483,"_96":484,"_158":485,"_160":415,"_161":139,"_162":486,"_164":165,"_106":487,"_101":29,"_167":215,"_169":479,"_170":25,"_171":-5,"_172":488,"_99":489},"03f82cae-67fc-11f0-b654-0224a6c84d84","pip-3.13","03f82d58-67fc-11f0-b654-0224a6c84d84",118,["D",1753299254431],[],[100,414,484],{"_104":491,"_96":492,"_158":493,"_160":415,"_161":139,"_162":494,"_164":165,"_106":495,"_101":29,"_167":215,"_169":479,"_170":25,"_171":-5,"_172":496,"_99":497},"03d70664-67fc-11f0-a988-0224a6c84d84","pip3","03d70704-67fc-11f0-a988-0224a6c84d84",112,["D",1753299254224],[],[100,414,492],{"_104":499,"_96":500,"_158":501,"_160":415,"_161":139,"_162":502,"_164":165,"_106":503,"_101":29,"_167":215,"_169":479,"_170":25,"_171":-5,"_172":504,"_99":505},"03d44c4e-67fc-11f0-bfb3-0224a6c84d84","pip3.13","03d44d34-67fc-11f0-bfb3-0224a6c84d84",111,["D",1753299254173],[],[100,414,500],[100,414],{"_104":508,"_96":509,"_158":510,"_160":408,"_161":139,"_162":511,"_164":165,"_106":512,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":513,"_99":4561},"f9a6b176-67fb-11f0-b654-0224a6c84d84","lib","f9a6b252-67fb-11f0-b654-0224a6c84d84",35,["D",1753299237132],[514],{"_104":515,"_96":516,"_158":517,"_160":510,"_161":139,"_162":518,"_164":165,"_106":519,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":520,"_99":4560},"f9d5448c-67fb-11f0-9f6f-0224a6c84d84","python3.13","f9d54536-67fb-11f0-9f6f-0224a6c84d84",37,["D",1753299237437],[521],{"_104":522,"_96":523,"_158":524,"_160":517,"_161":139,"_162":525,"_164":165,"_106":526,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":527,"_99":4559},"fa3bb4d8-67fb-11f0-b5ac-0224a6c84d84","site-packages","fa3bb604-67fb-11f0-b5ac-0224a6c84d84",41,["D",1753299238110],[528,536,4455,4541,4550],{"_104":529,"_96":530,"_158":531,"_160":524,"_161":139,"_162":532,"_164":165,"_106":533,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":534,"_99":535},"fab8f79a-67fb-11f0-96d6-0224a6c84d84","__pycache__","fab8f844-67fb-11f0-96d6-0224a6c84d84",46,["D",1753299238930],[],[100,509,516,523,530],{"_104":537,"_96":475,"_158":538,"_160":524,"_161":139,"_162":539,"_164":165,"_106":540,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":541,"_99":4454},"fad2729c-67fb-11f0-a988-0224a6c84d84","fad27332-67fb-11f0-a988-0224a6c84d84",47,["D",1753299239095],[542,1959,4421,4429,4437,4446],{"_104":543,"_96":544,"_158":545,"_160":538,"_161":139,"_162":546,"_164":165,"_106":547,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":548,"_99":1958},"fb5a131e-67fb-11f0-b654-0224a6c84d84","_internal","fb5a13be-67fb-11f0-b654-0224a6c84d84",52,["D",1753299239986],[549,674,851,902,945,987,1072,1194,1271,1407,1477,1588,1820,1881,1889,1898,1906,1914,1923,1931,1940,1949],{"_104":550,"_96":551,"_158":552,"_160":545,"_161":139,"_162":553,"_164":165,"_106":554,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":555,"_99":673},"fc2b611c-67fb-11f0-9d2d-0224a6c84d84","cli","fc2b61da-67fb-11f0-9d2d-0224a6c84d84",60,["D",1753299241353],[556,565,574,583,592,601,610,619,628,637,646,655,664],{"_104":557,"_96":558,"_158":559,"_160":552,"_161":139,"_162":560,"_164":165,"_106":561,"_101":29,"_167":215,"_169":562,"_170":25,"_171":-5,"_172":563,"_99":564},"057fb0f6-67fc-11f0-95df-0224a6c84d84","__init__.py","057fb1be-67fc-11f0-95df-0224a6c84d84",183,["D",1753299256976],"\"\"\"Subpackage containing all of pip's command line interface related code\"\"\"\n\n# This file intentionally does not import submodules\n",[],[100,509,516,523,475,544,551,558],{"_104":566,"_96":567,"_158":568,"_160":552,"_161":139,"_162":569,"_164":165,"_106":570,"_101":29,"_167":215,"_169":571,"_170":25,"_171":-5,"_172":572,"_99":573},"0598869e-67fc-11f0-928e-0224a6c84d84","autocompletion.py","05988770-67fc-11f0-928e-0224a6c84d84",187,["D",1753299257169],"\"\"\"Logic that powers autocompletion installed by ``pip completion``.\"\"\"\n\nimport optparse\nimport os\nimport sys\nfrom itertools import chain\nfrom typing import Any, Iterable, List, Optional\n\nfrom pip._internal.cli.main_parser import create_main_parser\nfrom pip._internal.commands import commands_dict, create_command\nfrom pip._internal.metadata import get_default_environment\n\n\ndef autocomplete() -> None:\n \"\"\"Entry Point for completion of main and subcommand options.\"\"\"\n # Don't complete if user hasn't sourced bash_completion file.\n if \"PIP_AUTO_COMPLETE\" not in os.environ:\n return\n # Don't complete if autocompletion environment variables\n # are not present\n if not os.environ.get(\"COMP_WORDS\") or not os.environ.get(\"COMP_CWORD\"):\n return\n cwords = os.environ[\"COMP_WORDS\"].split()[1:]\n cword = int(os.environ[\"COMP_CWORD\"])\n try:\n current = cwords[cword - 1]\n except IndexError:\n current = \"\"\n\n parser = create_main_parser()\n subcommands = list(commands_dict)\n options = []\n\n # subcommand\n subcommand_name: Optional[str] = None\n for word in cwords:\n if word in subcommands:\n subcommand_name = word\n break\n # subcommand options\n if subcommand_name is not None:\n # special case: 'help' subcommand has no options\n if subcommand_name == \"help\":\n sys.exit(1)\n # special case: list locally installed dists for show and uninstall\n should_list_installed = not current.startswith(\"-\") and subcommand_name in [\n \"show\",\n \"uninstall\",\n ]\n if should_list_installed:\n env = get_default_environment()\n lc = current.lower()\n installed = [\n dist.canonical_name\n for dist in env.iter_installed_distributions(local_only=True)\n if dist.canonical_name.startswith(lc)\n and dist.canonical_name not in cwords[1:]\n ]\n # if there are no dists installed, fall back to option completion\n if installed:\n for dist in installed:\n print(dist)\n sys.exit(1)\n\n should_list_installables = (\n not current.startswith(\"-\") and subcommand_name == \"install\"\n )\n if should_list_installables:\n for path in auto_complete_paths(current, \"path\"):\n print(path)\n sys.exit(1)\n\n subcommand = create_command(subcommand_name)\n\n for opt in subcommand.parser.option_list_all:\n if opt.help != optparse.SUPPRESS_HELP:\n options += [\n (opt_str, opt.nargs) for opt_str in opt._long_opts + opt._short_opts\n ]\n\n # filter out previously specified options from available options\n prev_opts = [x.split(\"=\")[0] for x in cwords[1 : cword - 1]]\n options = [(x, v) for (x, v) in options if x not in prev_opts]\n # filter options by current input\n options = [(k, v) for k, v in options if k.startswith(current)]\n # get completion type given cwords and available subcommand options\n completion_type = get_path_completion_type(\n cwords,\n cword,\n subcommand.parser.option_list_all,\n )\n # get completion files and directories if ``completion_type`` is\n # ````, ```` or ````\n if completion_type:\n paths = auto_complete_paths(current, completion_type)\n options = [(path, 0) for path in paths]\n for option in options:\n opt_label = option[0]\n # append '=' to options which require args\n if option[1] and option[0][:2] == \"--\":\n opt_label += \"=\"\n print(opt_label)\n else:\n # show main parser options only when necessary\n\n opts = [i.option_list for i in parser.option_groups]\n opts.append(parser.option_list)\n flattened_opts = chain.from_iterable(opts)\n if current.startswith(\"-\"):\n for opt in flattened_opts:\n if opt.help != optparse.SUPPRESS_HELP:\n subcommands += opt._long_opts + opt._short_opts\n else:\n # get completion type given cwords and all available options\n completion_type = get_path_completion_type(cwords, cword, flattened_opts)\n if completion_type:\n subcommands = list(auto_complete_paths(current, completion_type))\n\n print(\" \".join([x for x in subcommands if x.startswith(current)]))\n sys.exit(1)\n\n\ndef get_path_completion_type(\n cwords: List[str], cword: int, opts: Iterable[Any]\n) -> Optional[str]:\n \"\"\"Get the type of path completion (``file``, ``dir``, ``path`` or None)\n\n :param cwords: same as the environmental variable ``COMP_WORDS``\n :param cword: same as the environmental variable ``COMP_CWORD``\n :param opts: The available options to check\n :return: path completion type (``file``, ``dir``, ``path`` or None)\n \"\"\"\n if cword < 2 or not cwords[cword - 2].startswith(\"-\"):\n return None\n for opt in opts:\n if opt.help == optparse.SUPPRESS_HELP:\n continue\n for o in str(opt).split(\"/\"):\n if cwords[cword - 2].split(\"=\")[0] == o:\n if not opt.metavar or any(\n x in (\"path\", \"file\", \"dir\") for x in opt.metavar.split(\"/\")\n ):\n return opt.metavar\n return None\n\n\ndef auto_complete_paths(current: str, completion_type: str) -> Iterable[str]:\n \"\"\"If ``completion_type`` is ``file`` or ``path``, list all regular files\n and directories starting with ``current``; otherwise only list directories\n starting with ``current``.\n\n :param current: The word to be completed\n :param completion_type: path completion type(``file``, ``path`` or ``dir``)\n :return: A generator of regular files and/or directories\n \"\"\"\n directory, filename = os.path.split(current)\n current_path = os.path.abspath(directory)\n # Don't complete paths if they can't be accessed\n if not os.access(current_path, os.R_OK):\n return\n filename = os.path.normcase(filename)\n # list all files that start with ``filename``\n file_list = (\n x for x in os.listdir(current_path) if os.path.normcase(x).startswith(filename)\n )\n for f in file_list:\n opt = os.path.join(current_path, f)\n comp_file = os.path.normcase(os.path.join(directory, f))\n # complete regular files when there is not ```` after option\n # complete directories when there is ````, ```` or\n # ````after option\n if completion_type != \"dir\" and os.path.isfile(opt):\n yield comp_file\n elif os.path.isdir(opt):\n yield os.path.join(comp_file, \"\")\n",[],[100,509,516,523,475,544,551,567],{"_104":575,"_96":576,"_158":577,"_160":552,"_161":139,"_162":578,"_164":165,"_106":579,"_101":29,"_167":215,"_169":580,"_170":25,"_171":-5,"_172":581,"_99":582},"059d47ba-67fc-11f0-aad3-0224a6c84d84","base_command.py","059d4864-67fc-11f0-aad3-0224a6c84d84",188,["D",1753299257203],"\"\"\"Base Command class, and related routines\"\"\"\n\nimport logging\nimport logging.config\nimport optparse\nimport os\nimport sys\nimport traceback\nfrom optparse import Values\nfrom typing import List, Optional, Tuple\n\nfrom pip._vendor.rich import reconfigure\nfrom pip._vendor.rich import traceback as rich_traceback\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.command_context import CommandContextMixIn\nfrom pip._internal.cli.parser import ConfigOptionParser, UpdatingDefaultsHelpFormatter\nfrom pip._internal.cli.status_codes import (\n ERROR,\n PREVIOUS_BUILD_DIR_ERROR,\n UNKNOWN_ERROR,\n VIRTUALENV_NOT_FOUND,\n)\nfrom pip._internal.exceptions import (\n BadCommand,\n CommandError,\n DiagnosticPipError,\n InstallationError,\n NetworkConnectionError,\n PreviousBuildDirError,\n)\nfrom pip._internal.utils.filesystem import check_path_owner\nfrom pip._internal.utils.logging import BrokenStdoutLoggingError, setup_logging\nfrom pip._internal.utils.misc import get_prog, normalize_path\nfrom pip._internal.utils.temp_dir import TempDirectoryTypeRegistry as TempDirRegistry\nfrom pip._internal.utils.temp_dir import global_tempdir_manager, tempdir_registry\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\n__all__ = [\"Command\"]\n\nlogger = logging.getLogger(__name__)\n\n\nclass Command(CommandContextMixIn):\n usage: str = \"\"\n ignore_require_venv: bool = False\n\n def __init__(self, name: str, summary: str, isolated: bool = False) -> None:\n super().__init__()\n\n self.name = name\n self.summary = summary\n self.parser = ConfigOptionParser(\n usage=self.usage,\n prog=f\"{get_prog()} {name}\",\n formatter=UpdatingDefaultsHelpFormatter(),\n add_help_option=False,\n name=name,\n description=self.__doc__,\n isolated=isolated,\n )\n\n self.tempdir_registry: Optional[TempDirRegistry] = None\n\n # Commands should add options to this option group\n optgroup_name = f\"{self.name.capitalize()} Options\"\n self.cmd_opts = optparse.OptionGroup(self.parser, optgroup_name)\n\n # Add the general options\n gen_opts = cmdoptions.make_option_group(\n cmdoptions.general_group,\n self.parser,\n )\n self.parser.add_option_group(gen_opts)\n\n self.add_options()\n\n def add_options(self) -> None:\n pass\n\n def handle_pip_version_check(self, options: Values) -> None:\n \"\"\"\n This is a no-op so that commands by default do not do the pip version\n check.\n \"\"\"\n # Make sure we do the pip version check if the index_group options\n # are present.\n assert not hasattr(options, \"no_index\")\n\n def run(self, options: Values, args: List[str]) -> int:\n raise NotImplementedError\n\n def _run_wrapper(self, level_number: int, options: Values, args: List[str]) -> int:\n def _inner_run() -> int:\n try:\n return self.run(options, args)\n finally:\n self.handle_pip_version_check(options)\n\n if options.debug_mode:\n rich_traceback.install(show_locals=True)\n return _inner_run()\n\n try:\n status = _inner_run()\n assert isinstance(status, int)\n return status\n except DiagnosticPipError as exc:\n logger.error(\"%s\", exc, extra={\"rich\": True})\n logger.debug(\"Exception information:\", exc_info=True)\n\n return ERROR\n except PreviousBuildDirError as exc:\n logger.critical(str(exc))\n logger.debug(\"Exception information:\", exc_info=True)\n\n return PREVIOUS_BUILD_DIR_ERROR\n except (\n InstallationError,\n BadCommand,\n NetworkConnectionError,\n ) as exc:\n logger.critical(str(exc))\n logger.debug(\"Exception information:\", exc_info=True)\n\n return ERROR\n except CommandError as exc:\n logger.critical(\"%s\", exc)\n logger.debug(\"Exception information:\", exc_info=True)\n\n return ERROR\n except BrokenStdoutLoggingError:\n # Bypass our logger and write any remaining messages to\n # stderr because stdout no longer works.\n print(\"ERROR: Pipe to stdout was broken\", file=sys.stderr)\n if level_number <= logging.DEBUG:\n traceback.print_exc(file=sys.stderr)\n\n return ERROR\n except KeyboardInterrupt:\n logger.critical(\"Operation cancelled by user\")\n logger.debug(\"Exception information:\", exc_info=True)\n\n return ERROR\n except BaseException:\n logger.critical(\"Exception:\", exc_info=True)\n\n return UNKNOWN_ERROR\n\n def parse_args(self, args: List[str]) -> Tuple[Values, List[str]]:\n # factored out for testability\n return self.parser.parse_args(args)\n\n def main(self, args: List[str]) -> int:\n try:\n with self.main_context():\n return self._main(args)\n finally:\n logging.shutdown()\n\n def _main(self, args: List[str]) -> int:\n # We must initialize this before the tempdir manager, otherwise the\n # configuration would not be accessible by the time we clean up the\n # tempdir manager.\n self.tempdir_registry = self.enter_context(tempdir_registry())\n # Intentionally set as early as possible so globally-managed temporary\n # directories are available to the rest of the code.\n self.enter_context(global_tempdir_manager())\n\n options, args = self.parse_args(args)\n\n # Set verbosity so that it can be used elsewhere.\n self.verbosity = options.verbose - options.quiet\n if options.debug_mode:\n self.verbosity = 2\n\n reconfigure(no_color=options.no_color)\n level_number = setup_logging(\n verbosity=self.verbosity,\n no_color=options.no_color,\n user_log_file=options.log,\n )\n\n always_enabled_features = set(options.features_enabled) & set(\n cmdoptions.ALWAYS_ENABLED_FEATURES\n )\n if always_enabled_features:\n logger.warning(\n \"The following features are always enabled: %s. \",\n \", \".join(sorted(always_enabled_features)),\n )\n\n # Make sure that the --python argument isn't specified after the\n # subcommand. We can tell, because if --python was specified,\n # we should only reach this point if we're running in the created\n # subprocess, which has the _PIP_RUNNING_IN_SUBPROCESS environment\n # variable set.\n if options.python and \"_PIP_RUNNING_IN_SUBPROCESS\" not in os.environ:\n logger.critical(\n \"The --python option must be placed before the pip subcommand name\"\n )\n sys.exit(ERROR)\n\n # TODO: Try to get these passing down from the command?\n # without resorting to os.environ to hold these.\n # This also affects isolated builds and it should.\n\n if options.no_input:\n os.environ[\"PIP_NO_INPUT\"] = \"1\"\n\n if options.exists_action:\n os.environ[\"PIP_EXISTS_ACTION\"] = \" \".join(options.exists_action)\n\n if options.require_venv and not self.ignore_require_venv:\n # If a venv is required check if it can really be found\n if not running_under_virtualenv():\n logger.critical(\"Could not find an activated virtualenv (required).\")\n sys.exit(VIRTUALENV_NOT_FOUND)\n\n if options.cache_dir:\n options.cache_dir = normalize_path(options.cache_dir)\n if not check_path_owner(options.cache_dir):\n logger.warning(\n \"The directory '%s' or its parent directory is not owned \"\n \"or is not writable by the current user. The cache \"\n \"has been disabled. Check the permissions and owner of \"\n \"that directory. If executing pip with sudo, you should \"\n \"use sudo's -H flag.\",\n options.cache_dir,\n )\n options.cache_dir = None\n\n return self._run_wrapper(level_number, options, args)\n",[],[100,509,516,523,475,544,551,576],{"_104":584,"_96":585,"_158":586,"_160":552,"_161":139,"_162":587,"_164":165,"_106":588,"_101":29,"_167":215,"_169":589,"_170":25,"_171":-5,"_172":590,"_99":591},"05757988-67fc-11f0-8737-0224a6c84d84","cmdoptions.py","05757a64-67fc-11f0-8737-0224a6c84d84",181,["D",1753299256909],"\"\"\"\nshared options and groups\n\nThe principle here is to define options once, but *not* instantiate them\nglobally. One reason being that options with action='append' can carry state\nbetween parses. pip parses general options twice internally, and shouldn't\npass on state. To be consistent, all options will follow this design.\n\"\"\"\n\n# The following comment should be removed at some point in the future.\n# mypy: strict-optional=False\n\nimport importlib.util\nimport logging\nimport os\nimport pathlib\nimport textwrap\nfrom functools import partial\nfrom optparse import SUPPRESS_HELP, Option, OptionGroup, OptionParser, Values\nfrom textwrap import dedent\nfrom typing import Any, Callable, Dict, Optional, Tuple\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.cli.parser import ConfigOptionParser\nfrom pip._internal.exceptions import CommandError\nfrom pip._internal.locations import USER_CACHE_DIR, get_src_prefix\nfrom pip._internal.models.format_control import FormatControl\nfrom pip._internal.models.index import PyPI\nfrom pip._internal.models.target_python import TargetPython\nfrom pip._internal.utils.hashes import STRONG_HASHES\nfrom pip._internal.utils.misc import strtobool\n\nlogger = logging.getLogger(__name__)\n\n\ndef raise_option_error(parser: OptionParser, option: Option, msg: str) -> None:\n \"\"\"\n Raise an option parsing error using parser.error().\n\n Args:\n parser: an OptionParser instance.\n option: an Option instance.\n msg: the error text.\n \"\"\"\n msg = f\"{option} error: {msg}\"\n msg = textwrap.fill(\" \".join(msg.split()))\n parser.error(msg)\n\n\ndef make_option_group(group: Dict[str, Any], parser: ConfigOptionParser) -> OptionGroup:\n \"\"\"\n Return an OptionGroup object\n group -- assumed to be dict with 'name' and 'options' keys\n parser -- an optparse Parser\n \"\"\"\n option_group = OptionGroup(parser, group[\"name\"])\n for option in group[\"options\"]:\n option_group.add_option(option())\n return option_group\n\n\ndef check_dist_restriction(options: Values, check_target: bool = False) -> None:\n \"\"\"Function for determining if custom platform options are allowed.\n\n :param options: The OptionParser options.\n :param check_target: Whether or not to check if --target is being used.\n \"\"\"\n dist_restriction_set = any(\n [\n options.python_version,\n options.platforms,\n options.abis,\n options.implementation,\n ]\n )\n\n binary_only = FormatControl(set(), {\":all:\"})\n sdist_dependencies_allowed = (\n options.format_control != binary_only and not options.ignore_dependencies\n )\n\n # Installations or downloads using dist restrictions must not combine\n # source distributions and dist-specific wheels, as they are not\n # guaranteed to be locally compatible.\n if dist_restriction_set and sdist_dependencies_allowed:\n raise CommandError(\n \"When restricting platform and interpreter constraints using \"\n \"--python-version, --platform, --abi, or --implementation, \"\n \"either --no-deps must be set, or --only-binary=:all: must be \"\n \"set and --no-binary must not be set (or must be set to \"\n \":none:).\"\n )\n\n if check_target:\n if not options.dry_run and dist_restriction_set and not options.target_dir:\n raise CommandError(\n \"Can not use any platform or abi specific options unless \"\n \"installing via '--target' or using '--dry-run'\"\n )\n\n\ndef _path_option_check(option: Option, opt: str, value: str) -> str:\n return os.path.expanduser(value)\n\n\ndef _package_name_option_check(option: Option, opt: str, value: str) -> str:\n return canonicalize_name(value)\n\n\nclass PipOption(Option):\n TYPES = Option.TYPES + (\"path\", \"package_name\")\n TYPE_CHECKER = Option.TYPE_CHECKER.copy()\n TYPE_CHECKER[\"package_name\"] = _package_name_option_check\n TYPE_CHECKER[\"path\"] = _path_option_check\n\n\n###########\n# options #\n###########\n\nhelp_: Callable[..., Option] = partial(\n Option,\n \"-h\",\n \"--help\",\n dest=\"help\",\n action=\"help\",\n help=\"Show help.\",\n)\n\ndebug_mode: Callable[..., Option] = partial(\n Option,\n \"--debug\",\n dest=\"debug_mode\",\n action=\"store_true\",\n default=False,\n help=(\n \"Let unhandled exceptions propagate outside the main subroutine, \"\n \"instead of logging them to stderr.\"\n ),\n)\n\nisolated_mode: Callable[..., Option] = partial(\n Option,\n \"--isolated\",\n dest=\"isolated_mode\",\n action=\"store_true\",\n default=False,\n help=(\n \"Run pip in an isolated mode, ignoring environment variables and user \"\n \"configuration.\"\n ),\n)\n\nrequire_virtualenv: Callable[..., Option] = partial(\n Option,\n \"--require-virtualenv\",\n \"--require-venv\",\n dest=\"require_venv\",\n action=\"store_true\",\n default=False,\n help=(\n \"Allow pip to only run in a virtual environment; \"\n \"exit with an error otherwise.\"\n ),\n)\n\noverride_externally_managed: Callable[..., Option] = partial(\n Option,\n \"--break-system-packages\",\n dest=\"override_externally_managed\",\n action=\"store_true\",\n help=\"Allow pip to modify an EXTERNALLY-MANAGED Python installation\",\n)\n\npython: Callable[..., Option] = partial(\n Option,\n \"--python\",\n dest=\"python\",\n help=\"Run pip with the specified Python interpreter.\",\n)\n\nverbose: Callable[..., Option] = partial(\n Option,\n \"-v\",\n \"--verbose\",\n dest=\"verbose\",\n action=\"count\",\n default=0,\n help=\"Give more output. Option is additive, and can be used up to 3 times.\",\n)\n\nno_color: Callable[..., Option] = partial(\n Option,\n \"--no-color\",\n dest=\"no_color\",\n action=\"store_true\",\n default=False,\n help=\"Suppress colored output.\",\n)\n\nversion: Callable[..., Option] = partial(\n Option,\n \"-V\",\n \"--version\",\n dest=\"version\",\n action=\"store_true\",\n help=\"Show version and exit.\",\n)\n\nquiet: Callable[..., Option] = partial(\n Option,\n \"-q\",\n \"--quiet\",\n dest=\"quiet\",\n action=\"count\",\n default=0,\n help=(\n \"Give less output. Option is additive, and can be used up to 3\"\n \" times (corresponding to WARNING, ERROR, and CRITICAL logging\"\n \" levels).\"\n ),\n)\n\nprogress_bar: Callable[..., Option] = partial(\n Option,\n \"--progress-bar\",\n dest=\"progress_bar\",\n type=\"choice\",\n choices=[\"on\", \"off\", \"raw\"],\n default=\"on\",\n help=\"Specify whether the progress bar should be used [on, off, raw] (default: on)\",\n)\n\nlog: Callable[..., Option] = partial(\n PipOption,\n \"--log\",\n \"--log-file\",\n \"--local-log\",\n dest=\"log\",\n metavar=\"path\",\n type=\"path\",\n help=\"Path to a verbose appending log.\",\n)\n\nno_input: Callable[..., Option] = partial(\n Option,\n # Don't ask for input\n \"--no-input\",\n dest=\"no_input\",\n action=\"store_true\",\n default=False,\n help=\"Disable prompting for input.\",\n)\n\nkeyring_provider: Callable[..., Option] = partial(\n Option,\n \"--keyring-provider\",\n dest=\"keyring_provider\",\n choices=[\"auto\", \"disabled\", \"import\", \"subprocess\"],\n default=\"auto\",\n help=(\n \"Enable the credential lookup via the keyring library if user input is allowed.\"\n \" Specify which mechanism to use [auto, disabled, import, subprocess].\"\n \" (default: %default)\"\n ),\n)\n\nproxy: Callable[..., Option] = partial(\n Option,\n \"--proxy\",\n dest=\"proxy\",\n type=\"str\",\n default=\"\",\n help=\"Specify a proxy in the form scheme://[user:passwd@]proxy.server:port.\",\n)\n\nretries: Callable[..., Option] = partial(\n Option,\n \"--retries\",\n dest=\"retries\",\n type=\"int\",\n default=5,\n help=\"Maximum attempts to establish a new HTTP connection. (default: %default)\",\n)\n\nresume_retries: Callable[..., Option] = partial(\n Option,\n \"--resume-retries\",\n dest=\"resume_retries\",\n type=\"int\",\n default=0,\n help=\"Maximum attempts to resume or restart an incomplete download. \"\n \"(default: %default)\",\n)\n\ntimeout: Callable[..., Option] = partial(\n Option,\n \"--timeout\",\n \"--default-timeout\",\n metavar=\"sec\",\n dest=\"timeout\",\n type=\"float\",\n default=15,\n help=\"Set the socket timeout (default %default seconds).\",\n)\n\n\ndef exists_action() -> Option:\n return Option(\n # Option when path already exist\n \"--exists-action\",\n dest=\"exists_action\",\n type=\"choice\",\n choices=[\"s\", \"i\", \"w\", \"b\", \"a\"],\n default=[],\n action=\"append\",\n metavar=\"action\",\n help=\"Default action when a path already exists: \"\n \"(s)witch, (i)gnore, (w)ipe, (b)ackup, (a)bort.\",\n )\n\n\ncert: Callable[..., Option] = partial(\n PipOption,\n \"--cert\",\n dest=\"cert\",\n type=\"path\",\n metavar=\"path\",\n help=(\n \"Path to PEM-encoded CA certificate bundle. \"\n \"If provided, overrides the default. \"\n \"See 'SSL Certificate Verification' in pip documentation \"\n \"for more information.\"\n ),\n)\n\nclient_cert: Callable[..., Option] = partial(\n PipOption,\n \"--client-cert\",\n dest=\"client_cert\",\n type=\"path\",\n default=None,\n metavar=\"path\",\n help=\"Path to SSL client certificate, a single file containing the \"\n \"private key and the certificate in PEM format.\",\n)\n\nindex_url: Callable[..., Option] = partial(\n Option,\n \"-i\",\n \"--index-url\",\n \"--pypi-url\",\n dest=\"index_url\",\n metavar=\"URL\",\n default=PyPI.simple_url,\n help=\"Base URL of the Python Package Index (default %default). \"\n \"This should point to a repository compliant with PEP 503 \"\n \"(the simple repository API) or a local directory laid out \"\n \"in the same format.\",\n)\n\n\ndef extra_index_url() -> Option:\n return Option(\n \"--extra-index-url\",\n dest=\"extra_index_urls\",\n metavar=\"URL\",\n action=\"append\",\n default=[],\n help=\"Extra URLs of package indexes to use in addition to \"\n \"--index-url. Should follow the same rules as \"\n \"--index-url.\",\n )\n\n\nno_index: Callable[..., Option] = partial(\n Option,\n \"--no-index\",\n dest=\"no_index\",\n action=\"store_true\",\n default=False,\n help=\"Ignore package index (only looking at --find-links URLs instead).\",\n)\n\n\ndef find_links() -> Option:\n return Option(\n \"-f\",\n \"--find-links\",\n dest=\"find_links\",\n action=\"append\",\n default=[],\n metavar=\"url\",\n help=\"If a URL or path to an html file, then parse for links to \"\n \"archives such as sdist (.tar.gz) or wheel (.whl) files. \"\n \"If a local path or file:// URL that's a directory, \"\n \"then look for archives in the directory listing. \"\n \"Links to VCS project URLs are not supported.\",\n )\n\n\ndef trusted_host() -> Option:\n return Option(\n \"--trusted-host\",\n dest=\"trusted_hosts\",\n action=\"append\",\n metavar=\"HOSTNAME\",\n default=[],\n help=\"Mark this host or host:port pair as trusted, even though it \"\n \"does not have valid or any HTTPS.\",\n )\n\n\ndef constraints() -> Option:\n return Option(\n \"-c\",\n \"--constraint\",\n dest=\"constraints\",\n action=\"append\",\n default=[],\n metavar=\"file\",\n help=\"Constrain versions using the given constraints file. \"\n \"This option can be used multiple times.\",\n )\n\n\ndef requirements() -> Option:\n return Option(\n \"-r\",\n \"--requirement\",\n dest=\"requirements\",\n action=\"append\",\n default=[],\n metavar=\"file\",\n help=\"Install from the given requirements file. \"\n \"This option can be used multiple times.\",\n )\n\n\ndef editable() -> Option:\n return Option(\n \"-e\",\n \"--editable\",\n dest=\"editables\",\n action=\"append\",\n default=[],\n metavar=\"path/url\",\n help=(\n \"Install a project in editable mode (i.e. setuptools \"\n '\"develop mode\") from a local project path or a VCS url.'\n ),\n )\n\n\ndef _handle_src(option: Option, opt_str: str, value: str, parser: OptionParser) -> None:\n value = os.path.abspath(value)\n setattr(parser.values, option.dest, value)\n\n\nsrc: Callable[..., Option] = partial(\n PipOption,\n \"--src\",\n \"--source\",\n \"--source-dir\",\n \"--source-directory\",\n dest=\"src_dir\",\n type=\"path\",\n metavar=\"dir\",\n default=get_src_prefix(),\n action=\"callback\",\n callback=_handle_src,\n help=\"Directory to check out editable projects into. \"\n 'The default in a virtualenv is \"/src\". '\n 'The default for global installs is \"/src\".',\n)\n\n\ndef _get_format_control(values: Values, option: Option) -> Any:\n \"\"\"Get a format_control object.\"\"\"\n return getattr(values, option.dest)\n\n\ndef _handle_no_binary(\n option: Option, opt_str: str, value: str, parser: OptionParser\n) -> None:\n existing = _get_format_control(parser.values, option)\n FormatControl.handle_mutual_excludes(\n value,\n existing.no_binary,\n existing.only_binary,\n )\n\n\ndef _handle_only_binary(\n option: Option, opt_str: str, value: str, parser: OptionParser\n) -> None:\n existing = _get_format_control(parser.values, option)\n FormatControl.handle_mutual_excludes(\n value,\n existing.only_binary,\n existing.no_binary,\n )\n\n\ndef no_binary() -> Option:\n format_control = FormatControl(set(), set())\n return Option(\n \"--no-binary\",\n dest=\"format_control\",\n action=\"callback\",\n callback=_handle_no_binary,\n type=\"str\",\n default=format_control,\n help=\"Do not use binary packages. Can be supplied multiple times, and \"\n 'each time adds to the existing value. Accepts either \":all:\" to '\n 'disable all binary packages, \":none:\" to empty the set (notice '\n \"the colons), or one or more package names with commas between \"\n \"them (no colons). Note that some packages are tricky to compile \"\n \"and may fail to install when this option is used on them.\",\n )\n\n\ndef only_binary() -> Option:\n format_control = FormatControl(set(), set())\n return Option(\n \"--only-binary\",\n dest=\"format_control\",\n action=\"callback\",\n callback=_handle_only_binary,\n type=\"str\",\n default=format_control,\n help=\"Do not use source packages. Can be supplied multiple times, and \"\n 'each time adds to the existing value. Accepts either \":all:\" to '\n 'disable all source packages, \":none:\" to empty the set, or one '\n \"or more package names with commas between them. Packages \"\n \"without binary distributions will fail to install when this \"\n \"option is used on them.\",\n )\n\n\nplatforms: Callable[..., Option] = partial(\n Option,\n \"--platform\",\n dest=\"platforms\",\n metavar=\"platform\",\n action=\"append\",\n default=None,\n help=(\n \"Only use wheels compatible with . Defaults to the \"\n \"platform of the running system. Use this option multiple times to \"\n \"specify multiple platforms supported by the target interpreter.\"\n ),\n)\n\n\n# This was made a separate function for unit-testing purposes.\ndef _convert_python_version(value: str) -> Tuple[Tuple[int, ...], Optional[str]]:\n \"\"\"\n Convert a version string like \"3\", \"37\", or \"3.7.3\" into a tuple of ints.\n\n :return: A 2-tuple (version_info, error_msg), where `error_msg` is\n non-None if and only if there was a parsing error.\n \"\"\"\n if not value:\n # The empty string is the same as not providing a value.\n return (None, None)\n\n parts = value.split(\".\")\n if len(parts) > 3:\n return ((), \"at most three version parts are allowed\")\n\n if len(parts) == 1:\n # Then we are in the case of \"3\" or \"37\".\n value = parts[0]\n if len(value) > 1:\n parts = [value[0], value[1:]]\n\n try:\n version_info = tuple(int(part) for part in parts)\n except ValueError:\n return ((), \"each version part must be an integer\")\n\n return (version_info, None)\n\n\ndef _handle_python_version(\n option: Option, opt_str: str, value: str, parser: OptionParser\n) -> None:\n \"\"\"\n Handle a provided --python-version value.\n \"\"\"\n version_info, error_msg = _convert_python_version(value)\n if error_msg is not None:\n msg = f\"invalid --python-version value: {value!r}: {error_msg}\"\n raise_option_error(parser, option=option, msg=msg)\n\n parser.values.python_version = version_info\n\n\npython_version: Callable[..., Option] = partial(\n Option,\n \"--python-version\",\n dest=\"python_version\",\n metavar=\"python_version\",\n action=\"callback\",\n callback=_handle_python_version,\n type=\"str\",\n default=None,\n help=dedent(\n \"\"\"\\\n The Python interpreter version to use for wheel and \"Requires-Python\"\n compatibility checks. Defaults to a version derived from the running\n interpreter. The version can be specified using up to three dot-separated\n integers (e.g. \"3\" for 3.0.0, \"3.7\" for 3.7.0, or \"3.7.3\"). A major-minor\n version can also be given as a string without dots (e.g. \"37\" for 3.7.0).\n \"\"\"\n ),\n)\n\n\nimplementation: Callable[..., Option] = partial(\n Option,\n \"--implementation\",\n dest=\"implementation\",\n metavar=\"implementation\",\n default=None,\n help=(\n \"Only use wheels compatible with Python \"\n \"implementation , e.g. 'pp', 'jy', 'cp', \"\n \" or 'ip'. If not specified, then the current \"\n \"interpreter implementation is used. Use 'py' to force \"\n \"implementation-agnostic wheels.\"\n ),\n)\n\n\nabis: Callable[..., Option] = partial(\n Option,\n \"--abi\",\n dest=\"abis\",\n metavar=\"abi\",\n action=\"append\",\n default=None,\n help=(\n \"Only use wheels compatible with Python abi , e.g. 'pypy_41'. \"\n \"If not specified, then the current interpreter abi tag is used. \"\n \"Use this option multiple times to specify multiple abis supported \"\n \"by the target interpreter. Generally you will need to specify \"\n \"--implementation, --platform, and --python-version when using this \"\n \"option.\"\n ),\n)\n\n\ndef add_target_python_options(cmd_opts: OptionGroup) -> None:\n cmd_opts.add_option(platforms())\n cmd_opts.add_option(python_version())\n cmd_opts.add_option(implementation())\n cmd_opts.add_option(abis())\n\n\ndef make_target_python(options: Values) -> TargetPython:\n target_python = TargetPython(\n platforms=options.platforms,\n py_version_info=options.python_version,\n abis=options.abis,\n implementation=options.implementation,\n )\n\n return target_python\n\n\ndef prefer_binary() -> Option:\n return Option(\n \"--prefer-binary\",\n dest=\"prefer_binary\",\n action=\"store_true\",\n default=False,\n help=(\n \"Prefer binary packages over source packages, even if the \"\n \"source packages are newer.\"\n ),\n )\n\n\ncache_dir: Callable[..., Option] = partial(\n PipOption,\n \"--cache-dir\",\n dest=\"cache_dir\",\n default=USER_CACHE_DIR,\n metavar=\"dir\",\n type=\"path\",\n help=\"Store the cache data in .\",\n)\n\n\ndef _handle_no_cache_dir(\n option: Option, opt: str, value: str, parser: OptionParser\n) -> None:\n \"\"\"\n Process a value provided for the --no-cache-dir option.\n\n This is an optparse.Option callback for the --no-cache-dir option.\n \"\"\"\n # The value argument will be None if --no-cache-dir is passed via the\n # command-line, since the option doesn't accept arguments. However,\n # the value can be non-None if the option is triggered e.g. by an\n # environment variable, like PIP_NO_CACHE_DIR=true.\n if value is not None:\n # Then parse the string value to get argument error-checking.\n try:\n strtobool(value)\n except ValueError as exc:\n raise_option_error(parser, option=option, msg=str(exc))\n\n # Originally, setting PIP_NO_CACHE_DIR to a value that strtobool()\n # converted to 0 (like \"false\" or \"no\") caused cache_dir to be disabled\n # rather than enabled (logic would say the latter). Thus, we disable\n # the cache directory not just on values that parse to True, but (for\n # backwards compatibility reasons) also on values that parse to False.\n # In other words, always set it to False if the option is provided in\n # some (valid) form.\n parser.values.cache_dir = False\n\n\nno_cache: Callable[..., Option] = partial(\n Option,\n \"--no-cache-dir\",\n dest=\"cache_dir\",\n action=\"callback\",\n callback=_handle_no_cache_dir,\n help=\"Disable the cache.\",\n)\n\nno_deps: Callable[..., Option] = partial(\n Option,\n \"--no-deps\",\n \"--no-dependencies\",\n dest=\"ignore_dependencies\",\n action=\"store_true\",\n default=False,\n help=\"Don't install package dependencies.\",\n)\n\n\ndef _handle_dependency_group(\n option: Option, opt: str, value: str, parser: OptionParser\n) -> None:\n \"\"\"\n Process a value provided for the --group option.\n\n Splits on the rightmost \":\", and validates that the path (if present) ends\n in `pyproject.toml`. Defaults the path to `pyproject.toml` when one is not given.\n\n `:` cannot appear in dependency group names, so this is a safe and simple parse.\n\n This is an optparse.Option callback for the dependency_groups option.\n \"\"\"\n path, sep, groupname = value.rpartition(\":\")\n if not sep:\n path = \"pyproject.toml\"\n else:\n # check for 'pyproject.toml' filenames using pathlib\n if pathlib.PurePath(path).name != \"pyproject.toml\":\n msg = \"group paths use 'pyproject.toml' filenames\"\n raise_option_error(parser, option=option, msg=msg)\n\n parser.values.dependency_groups.append((path, groupname))\n\n\ndependency_groups: Callable[..., Option] = partial(\n Option,\n \"--group\",\n dest=\"dependency_groups\",\n default=[],\n type=str,\n action=\"callback\",\n callback=_handle_dependency_group,\n metavar=\"[path:]group\",\n help='Install a named dependency-group from a \"pyproject.toml\" file. '\n 'If a path is given, the name of the file must be \"pyproject.toml\". '\n 'Defaults to using \"pyproject.toml\" in the current directory.',\n)\n\nignore_requires_python: Callable[..., Option] = partial(\n Option,\n \"--ignore-requires-python\",\n dest=\"ignore_requires_python\",\n action=\"store_true\",\n help=\"Ignore the Requires-Python information.\",\n)\n\nno_build_isolation: Callable[..., Option] = partial(\n Option,\n \"--no-build-isolation\",\n dest=\"build_isolation\",\n action=\"store_false\",\n default=True,\n help=\"Disable isolation when building a modern source distribution. \"\n \"Build dependencies specified by PEP 518 must be already installed \"\n \"if this option is used.\",\n)\n\ncheck_build_deps: Callable[..., Option] = partial(\n Option,\n \"--check-build-dependencies\",\n dest=\"check_build_deps\",\n action=\"store_true\",\n default=False,\n help=\"Check the build dependencies when PEP517 is used.\",\n)\n\n\ndef _handle_no_use_pep517(\n option: Option, opt: str, value: str, parser: OptionParser\n) -> None:\n \"\"\"\n Process a value provided for the --no-use-pep517 option.\n\n This is an optparse.Option callback for the no_use_pep517 option.\n \"\"\"\n # Since --no-use-pep517 doesn't accept arguments, the value argument\n # will be None if --no-use-pep517 is passed via the command-line.\n # However, the value can be non-None if the option is triggered e.g.\n # by an environment variable, for example \"PIP_NO_USE_PEP517=true\".\n if value is not None:\n msg = \"\"\"A value was passed for --no-use-pep517,\n probably using either the PIP_NO_USE_PEP517 environment variable\n or the \"no-use-pep517\" config file option. Use an appropriate value\n of the PIP_USE_PEP517 environment variable or the \"use-pep517\"\n config file option instead.\n \"\"\"\n raise_option_error(parser, option=option, msg=msg)\n\n # If user doesn't wish to use pep517, we check if setuptools is installed\n # and raise error if it is not.\n packages = (\"setuptools\",)\n if not all(importlib.util.find_spec(package) for package in packages):\n msg = (\n f\"It is not possible to use --no-use-pep517 \"\n f\"without {' and '.join(packages)} installed.\"\n )\n raise_option_error(parser, option=option, msg=msg)\n\n # Otherwise, --no-use-pep517 was passed via the command-line.\n parser.values.use_pep517 = False\n\n\nuse_pep517: Any = partial(\n Option,\n \"--use-pep517\",\n dest=\"use_pep517\",\n action=\"store_true\",\n default=None,\n help=\"Use PEP 517 for building source distributions \"\n \"(use --no-use-pep517 to force legacy behaviour).\",\n)\n\nno_use_pep517: Any = partial(\n Option,\n \"--no-use-pep517\",\n dest=\"use_pep517\",\n action=\"callback\",\n callback=_handle_no_use_pep517,\n default=None,\n help=SUPPRESS_HELP,\n)\n\n\ndef _handle_config_settings(\n option: Option, opt_str: str, value: str, parser: OptionParser\n) -> None:\n key, sep, val = value.partition(\"=\")\n if sep != \"=\":\n parser.error(f\"Arguments to {opt_str} must be of the form KEY=VAL\")\n dest = getattr(parser.values, option.dest)\n if dest is None:\n dest = {}\n setattr(parser.values, option.dest, dest)\n if key in dest:\n if isinstance(dest[key], list):\n dest[key].append(val)\n else:\n dest[key] = [dest[key], val]\n else:\n dest[key] = val\n\n\nconfig_settings: Callable[..., Option] = partial(\n Option,\n \"-C\",\n \"--config-settings\",\n dest=\"config_settings\",\n type=str,\n action=\"callback\",\n callback=_handle_config_settings,\n metavar=\"settings\",\n help=\"Configuration settings to be passed to the PEP 517 build backend. \"\n \"Settings take the form KEY=VALUE. Use multiple --config-settings options \"\n \"to pass multiple keys to the backend.\",\n)\n\nbuild_options: Callable[..., Option] = partial(\n Option,\n \"--build-option\",\n dest=\"build_options\",\n metavar=\"options\",\n action=\"append\",\n help=\"Extra arguments to be supplied to 'setup.py bdist_wheel'.\",\n)\n\nglobal_options: Callable[..., Option] = partial(\n Option,\n \"--global-option\",\n dest=\"global_options\",\n action=\"append\",\n metavar=\"options\",\n help=\"Extra global options to be supplied to the setup.py \"\n \"call before the install or bdist_wheel command.\",\n)\n\nno_clean: Callable[..., Option] = partial(\n Option,\n \"--no-clean\",\n action=\"store_true\",\n default=False,\n help=\"Don't clean up build directories.\",\n)\n\npre: Callable[..., Option] = partial(\n Option,\n \"--pre\",\n action=\"store_true\",\n default=False,\n help=\"Include pre-release and development versions. By default, \"\n \"pip only finds stable versions.\",\n)\n\njson: Callable[..., Option] = partial(\n Option,\n \"--json\",\n action=\"store_true\",\n default=False,\n help=\"Output data in a machine-readable JSON format.\",\n)\n\ndisable_pip_version_check: Callable[..., Option] = partial(\n Option,\n \"--disable-pip-version-check\",\n dest=\"disable_pip_version_check\",\n action=\"store_true\",\n default=False,\n help=\"Don't periodically check PyPI to determine whether a new version \"\n \"of pip is available for download. Implied with --no-index.\",\n)\n\nroot_user_action: Callable[..., Option] = partial(\n Option,\n \"--root-user-action\",\n dest=\"root_user_action\",\n default=\"warn\",\n choices=[\"warn\", \"ignore\"],\n help=\"Action if pip is run as a root user [warn, ignore] (default: warn)\",\n)\n\n\ndef _handle_merge_hash(\n option: Option, opt_str: str, value: str, parser: OptionParser\n) -> None:\n \"\"\"Given a value spelled \"algo:digest\", append the digest to a list\n pointed to in a dict by the algo name.\"\"\"\n if not parser.values.hashes:\n parser.values.hashes = {}\n try:\n algo, digest = value.split(\":\", 1)\n except ValueError:\n parser.error(\n f\"Arguments to {opt_str} must be a hash name \"\n \"followed by a value, like --hash=sha256:\"\n \"abcde...\"\n )\n if algo not in STRONG_HASHES:\n parser.error(\n \"Allowed hash algorithms for {} are {}.\".format(\n opt_str, \", \".join(STRONG_HASHES)\n )\n )\n parser.values.hashes.setdefault(algo, []).append(digest)\n\n\nhash: Callable[..., Option] = partial(\n Option,\n \"--hash\",\n # Hash values eventually end up in InstallRequirement.hashes due to\n # __dict__ copying in process_line().\n dest=\"hashes\",\n action=\"callback\",\n callback=_handle_merge_hash,\n type=\"string\",\n help=\"Verify that the package's archive matches this \"\n \"hash before installing. Example: --hash=sha256:abcdef...\",\n)\n\n\nrequire_hashes: Callable[..., Option] = partial(\n Option,\n \"--require-hashes\",\n dest=\"require_hashes\",\n action=\"store_true\",\n default=False,\n help=\"Require a hash to check each requirement against, for \"\n \"repeatable installs. This option is implied when any package in a \"\n \"requirements file has a --hash option.\",\n)\n\n\nlist_path: Callable[..., Option] = partial(\n PipOption,\n \"--path\",\n dest=\"path\",\n type=\"path\",\n action=\"append\",\n help=\"Restrict to the specified installation path for listing \"\n \"packages (can be used multiple times).\",\n)\n\n\ndef check_list_path_option(options: Values) -> None:\n if options.path and (options.user or options.local):\n raise CommandError(\"Cannot combine '--path' with '--user' or '--local'\")\n\n\nlist_exclude: Callable[..., Option] = partial(\n PipOption,\n \"--exclude\",\n dest=\"excludes\",\n action=\"append\",\n metavar=\"package\",\n type=\"package_name\",\n help=\"Exclude specified package from the output\",\n)\n\n\nno_python_version_warning: Callable[..., Option] = partial(\n Option,\n \"--no-python-version-warning\",\n dest=\"no_python_version_warning\",\n action=\"store_true\",\n default=False,\n help=SUPPRESS_HELP, # No-op, a hold-over from the Python 2->3 transition.\n)\n\n\n# Features that are now always on. A warning is printed if they are used.\nALWAYS_ENABLED_FEATURES = [\n \"truststore\", # always on since 24.2\n \"no-binary-enable-wheel-cache\", # always on since 23.1\n]\n\nuse_new_feature: Callable[..., Option] = partial(\n Option,\n \"--use-feature\",\n dest=\"features_enabled\",\n metavar=\"feature\",\n action=\"append\",\n default=[],\n choices=[\n \"fast-deps\",\n ]\n + ALWAYS_ENABLED_FEATURES,\n help=\"Enable new functionality, that may be backward incompatible.\",\n)\n\nuse_deprecated_feature: Callable[..., Option] = partial(\n Option,\n \"--use-deprecated\",\n dest=\"deprecated_features_enabled\",\n metavar=\"feature\",\n action=\"append\",\n default=[],\n choices=[\n \"legacy-resolver\",\n \"legacy-certs\",\n ],\n help=(\"Enable deprecated functionality, that will be removed in the future.\"),\n)\n\n##########\n# groups #\n##########\n\ngeneral_group: Dict[str, Any] = {\n \"name\": \"General Options\",\n \"options\": [\n help_,\n debug_mode,\n isolated_mode,\n require_virtualenv,\n python,\n verbose,\n version,\n quiet,\n log,\n no_input,\n keyring_provider,\n proxy,\n retries,\n timeout,\n exists_action,\n trusted_host,\n cert,\n client_cert,\n cache_dir,\n no_cache,\n disable_pip_version_check,\n no_color,\n no_python_version_warning,\n use_new_feature,\n use_deprecated_feature,\n resume_retries,\n ],\n}\n\nindex_group: Dict[str, Any] = {\n \"name\": \"Package Index Options\",\n \"options\": [\n index_url,\n extra_index_url,\n no_index,\n find_links,\n ],\n}\n",[],[100,509,516,523,475,544,551,585],{"_104":593,"_96":594,"_158":595,"_160":552,"_161":139,"_162":596,"_164":165,"_106":597,"_101":29,"_167":215,"_169":598,"_170":25,"_171":-5,"_172":599,"_99":600},"059324e2-67fc-11f0-80ec-0224a6c84d84","command_context.py","059325be-67fc-11f0-80ec-0224a6c84d84",186,["D",1753299257134],"from contextlib import ExitStack, contextmanager\nfrom typing import ContextManager, Generator, TypeVar\n\n_T = TypeVar(\"_T\", covariant=True)\n\n\nclass CommandContextMixIn:\n def __init__(self) -> None:\n super().__init__()\n self._in_main_context = False\n self._main_context = ExitStack()\n\n @contextmanager\n def main_context(self) -> Generator[None, None, None]:\n assert not self._in_main_context\n\n self._in_main_context = True\n try:\n with self._main_context:\n yield\n finally:\n self._in_main_context = False\n\n def enter_context(self, context_provider: ContextManager[_T]) -> _T:\n assert self._in_main_context\n\n return self._main_context.enter_context(context_provider)\n",[],[100,509,516,523,475,544,551,594],{"_104":602,"_96":603,"_158":604,"_160":552,"_161":139,"_162":605,"_164":165,"_106":606,"_101":29,"_167":215,"_169":607,"_170":25,"_171":-5,"_172":608,"_99":609},"057a45da-67fc-11f0-96d6-0224a6c84d84","index_command.py","057a4684-67fc-11f0-96d6-0224a6c84d84",182,["D",1753299256974],"\"\"\"\nContains command classes which may interact with an index / the network.\n\nUnlike its sister module, req_command, this module still uses lazy imports\nso commands which don't always hit the network (e.g. list w/o --outdated or\n--uptodate) don't need waste time importing PipSession and friends.\n\"\"\"\n\nimport logging\nimport os\nimport sys\nfrom functools import lru_cache\nfrom optparse import Values\nfrom typing import TYPE_CHECKING, List, Optional\n\nfrom pip._vendor import certifi\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.command_context import CommandContextMixIn\n\nif TYPE_CHECKING:\n from ssl import SSLContext\n\n from pip._internal.network.session import PipSession\n\nlogger = logging.getLogger(__name__)\n\n\n@lru_cache\ndef _create_truststore_ssl_context() -> Optional[\"SSLContext\"]:\n if sys.version_info < (3, 10):\n logger.debug(\"Disabling truststore because Python version isn't 3.10+\")\n return None\n\n try:\n import ssl\n except ImportError:\n logger.warning(\"Disabling truststore since ssl support is missing\")\n return None\n\n try:\n from pip._vendor import truststore\n except ImportError:\n logger.warning(\"Disabling truststore because platform isn't supported\")\n return None\n\n ctx = truststore.SSLContext(ssl.PROTOCOL_TLS_CLIENT)\n ctx.load_verify_locations(certifi.where())\n return ctx\n\n\nclass SessionCommandMixin(CommandContextMixIn):\n \"\"\"\n A class mixin for command classes needing _build_session().\n \"\"\"\n\n def __init__(self) -> None:\n super().__init__()\n self._session: Optional[PipSession] = None\n\n @classmethod\n def _get_index_urls(cls, options: Values) -> Optional[List[str]]:\n \"\"\"Return a list of index urls from user-provided options.\"\"\"\n index_urls = []\n if not getattr(options, \"no_index\", False):\n url = getattr(options, \"index_url\", None)\n if url:\n index_urls.append(url)\n urls = getattr(options, \"extra_index_urls\", None)\n if urls:\n index_urls.extend(urls)\n # Return None rather than an empty list\n return index_urls or None\n\n def get_default_session(self, options: Values) -> \"PipSession\":\n \"\"\"Get a default-managed session.\"\"\"\n if self._session is None:\n self._session = self.enter_context(self._build_session(options))\n # there's no type annotation on requests.Session, so it's\n # automatically ContextManager[Any] and self._session becomes Any,\n # then https://github.com/python/mypy/issues/7696 kicks in\n assert self._session is not None\n return self._session\n\n def _build_session(\n self,\n options: Values,\n retries: Optional[int] = None,\n timeout: Optional[int] = None,\n ) -> \"PipSession\":\n from pip._internal.network.session import PipSession\n\n cache_dir = options.cache_dir\n assert not cache_dir or os.path.isabs(cache_dir)\n\n if \"legacy-certs\" not in options.deprecated_features_enabled:\n ssl_context = _create_truststore_ssl_context()\n else:\n ssl_context = None\n\n session = PipSession(\n cache=os.path.join(cache_dir, \"http-v2\") if cache_dir else None,\n retries=retries if retries is not None else options.retries,\n trusted_hosts=options.trusted_hosts,\n index_urls=self._get_index_urls(options),\n ssl_context=ssl_context,\n )\n\n # Handle custom ca-bundles from the user\n if options.cert:\n session.verify = options.cert\n\n # Handle SSL client certificate\n if options.client_cert:\n session.cert = options.client_cert\n\n # Handle timeouts\n if options.timeout or timeout:\n session.timeout = timeout if timeout is not None else options.timeout\n\n # Handle configured proxies\n if options.proxy:\n session.proxies = {\n \"http\": options.proxy,\n \"https\": options.proxy,\n }\n session.trust_env = False\n session.pip_proxy = options.proxy\n\n # Determine if we can prompt the user for authentication or not\n session.auth.prompting = not options.no_input\n session.auth.keyring_provider = options.keyring_provider\n\n return session\n\n\ndef _pip_self_version_check(session: \"PipSession\", options: Values) -> None:\n from pip._internal.self_outdated_check import pip_self_version_check as check\n\n check(session, options)\n\n\nclass IndexGroupCommand(Command, SessionCommandMixin):\n \"\"\"\n Abstract base class for commands with the index_group options.\n\n This also corresponds to the commands that permit the pip version check.\n \"\"\"\n\n def handle_pip_version_check(self, options: Values) -> None:\n \"\"\"\n Do the pip version check if not disabled.\n\n This overrides the default behavior of not doing the check.\n \"\"\"\n # Make sure the index_group options are present.\n assert hasattr(options, \"no_index\")\n\n if options.disable_pip_version_check or options.no_index:\n return\n\n try:\n # Otherwise, check if we're using the latest version of pip available.\n session = self._build_session(\n options,\n retries=0,\n timeout=min(5, options.timeout),\n )\n with session:\n _pip_self_version_check(session, options)\n except Exception:\n logger.warning(\"There was an error checking the latest version of pip.\")\n logger.debug(\"See below for error\", exc_info=True)\n",[],[100,509,516,523,475,544,551,603],{"_104":611,"_96":612,"_158":613,"_160":552,"_161":139,"_162":614,"_164":165,"_106":615,"_101":29,"_167":215,"_169":616,"_170":25,"_171":-5,"_172":617,"_99":618},"05b3b8ec-67fc-11f0-95df-0224a6c84d84","main.py","05b3b9c8-67fc-11f0-95df-0224a6c84d84",192,["D",1753299257339],"\"\"\"Primary application entrypoint.\"\"\"\n\nimport locale\nimport logging\nimport os\nimport sys\nimport warnings\nfrom typing import List, Optional\n\nfrom pip._internal.cli.autocompletion import autocomplete\nfrom pip._internal.cli.main_parser import parse_command\nfrom pip._internal.commands import create_command\nfrom pip._internal.exceptions import PipError\nfrom pip._internal.utils import deprecation\n\nlogger = logging.getLogger(__name__)\n\n\n# Do not import and use main() directly! Using it directly is actively\n# discouraged by pip's maintainers. The name, location and behavior of\n# this function is subject to change, so calling it directly is not\n# portable across different pip versions.\n\n# In addition, running pip in-process is unsupported and unsafe. This is\n# elaborated in detail at\n# https://pip.pypa.io/en/stable/user_guide/#using-pip-from-your-program.\n# That document also provides suggestions that should work for nearly\n# all users that are considering importing and using main() directly.\n\n# However, we know that certain users will still want to invoke pip\n# in-process. If you understand and accept the implications of using pip\n# in an unsupported manner, the best approach is to use runpy to avoid\n# depending on the exact location of this entry point.\n\n# The following example shows how to use runpy to invoke pip in that\n# case:\n#\n# sys.argv = [\"pip\", your, args, here]\n# runpy.run_module(\"pip\", run_name=\"__main__\")\n#\n# Note that this will exit the process after running, unlike a direct\n# call to main. As it is not safe to do any processing after calling\n# main, this should not be an issue in practice.\n\n\ndef main(args: Optional[List[str]] = None) -> int:\n if args is None:\n args = sys.argv[1:]\n\n # Suppress the pkg_resources deprecation warning\n # Note - we use a module of .*pkg_resources to cover\n # the normal case (pip._vendor.pkg_resources) and the\n # devendored case (a bare pkg_resources)\n warnings.filterwarnings(\n action=\"ignore\", category=DeprecationWarning, module=\".*pkg_resources\"\n )\n\n # Configure our deprecation warnings to be sent through loggers\n deprecation.install_warning_logger()\n\n autocomplete()\n\n try:\n cmd_name, cmd_args = parse_command(args)\n except PipError as exc:\n sys.stderr.write(f\"ERROR: {exc}\")\n sys.stderr.write(os.linesep)\n sys.exit(1)\n\n # Needed for locale.getpreferredencoding(False) to work\n # in pip._internal.utils.encoding.auto_decode\n try:\n locale.setlocale(locale.LC_ALL, \"\")\n except locale.Error as e:\n # setlocale can apparently crash if locale are uninitialized\n logger.debug(\"Ignoring error %s when setting locale\", e)\n command = create_command(cmd_name, isolated=(\"--isolated\" in cmd_args))\n\n return command.main(cmd_args)\n",[],[100,509,516,523,475,544,551,612],{"_104":620,"_96":621,"_158":622,"_160":552,"_161":139,"_162":623,"_164":165,"_106":624,"_101":29,"_167":215,"_169":625,"_170":25,"_171":-5,"_172":626,"_99":627},"05a40302-67fc-11f0-85ab-0224a6c84d84","main_parser.py","05a403de-67fc-11f0-85ab-0224a6c84d84",189,["D",1753299257246],"\"\"\"A single place for constructing and exposing the main parser\"\"\"\n\nimport os\nimport subprocess\nimport sys\nfrom typing import List, Optional, Tuple\n\nfrom pip._internal.build_env import get_runnable_pip\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.parser import ConfigOptionParser, UpdatingDefaultsHelpFormatter\nfrom pip._internal.commands import commands_dict, get_similar_commands\nfrom pip._internal.exceptions import CommandError\nfrom pip._internal.utils.misc import get_pip_version, get_prog\n\n__all__ = [\"create_main_parser\", \"parse_command\"]\n\n\ndef create_main_parser() -> ConfigOptionParser:\n \"\"\"Creates and returns the main parser for pip's CLI\"\"\"\n\n parser = ConfigOptionParser(\n usage=\"\\n%prog [options]\",\n add_help_option=False,\n formatter=UpdatingDefaultsHelpFormatter(),\n name=\"global\",\n prog=get_prog(),\n )\n parser.disable_interspersed_args()\n\n parser.version = get_pip_version()\n\n # add the general options\n gen_opts = cmdoptions.make_option_group(cmdoptions.general_group, parser)\n parser.add_option_group(gen_opts)\n\n # so the help formatter knows\n parser.main = True # type: ignore\n\n # create command listing for description\n description = [\"\"] + [\n f\"{name:27} {command_info.summary}\"\n for name, command_info in commands_dict.items()\n ]\n parser.description = \"\\n\".join(description)\n\n return parser\n\n\ndef identify_python_interpreter(python: str) -> Optional[str]:\n # If the named file exists, use it.\n # If it's a directory, assume it's a virtual environment and\n # look for the environment's Python executable.\n if os.path.exists(python):\n if os.path.isdir(python):\n # bin/python for Unix, Scripts/python.exe for Windows\n # Try both in case of odd cases like cygwin.\n for exe in (\"bin/python\", \"Scripts/python.exe\"):\n py = os.path.join(python, exe)\n if os.path.exists(py):\n return py\n else:\n return python\n\n # Could not find the interpreter specified\n return None\n\n\ndef parse_command(args: List[str]) -> Tuple[str, List[str]]:\n parser = create_main_parser()\n\n # Note: parser calls disable_interspersed_args(), so the result of this\n # call is to split the initial args into the general options before the\n # subcommand and everything else.\n # For example:\n # args: ['--timeout=5', 'install', '--user', 'INITools']\n # general_options: ['--timeout==5']\n # args_else: ['install', '--user', 'INITools']\n general_options, args_else = parser.parse_args(args)\n\n # --python\n if general_options.python and \"_PIP_RUNNING_IN_SUBPROCESS\" not in os.environ:\n # Re-invoke pip using the specified Python interpreter\n interpreter = identify_python_interpreter(general_options.python)\n if interpreter is None:\n raise CommandError(\n f\"Could not locate Python interpreter {general_options.python}\"\n )\n\n pip_cmd = [\n interpreter,\n get_runnable_pip(),\n ]\n pip_cmd.extend(args)\n\n # Set a flag so the child doesn't re-invoke itself, causing\n # an infinite loop.\n os.environ[\"_PIP_RUNNING_IN_SUBPROCESS\"] = \"1\"\n returncode = 0\n try:\n proc = subprocess.run(pip_cmd)\n returncode = proc.returncode\n except (subprocess.SubprocessError, OSError) as exc:\n raise CommandError(f\"Failed to run pip under {interpreter}: {exc}\")\n sys.exit(returncode)\n\n # --version\n if general_options.version:\n sys.stdout.write(parser.version)\n sys.stdout.write(os.linesep)\n sys.exit()\n\n # pip || pip help -> print_help()\n if not args_else or (args_else[0] == \"help\" and len(args_else) == 1):\n parser.print_help()\n sys.exit()\n\n # the subcommand name\n cmd_name = args_else[0]\n\n if cmd_name not in commands_dict:\n guess = get_similar_commands(cmd_name)\n\n msg = [f'unknown command \"{cmd_name}\"']\n if guess:\n msg.append(f'maybe you meant \"{guess}\"')\n\n raise CommandError(\" - \".join(msg))\n\n # all the args without the subcommand\n cmd_args = args[:]\n cmd_args.remove(cmd_name)\n\n return cmd_name, cmd_args\n",[],[100,509,516,523,475,544,551,621],{"_104":629,"_96":630,"_158":631,"_160":552,"_161":139,"_162":632,"_164":165,"_106":633,"_101":29,"_167":215,"_169":634,"_170":25,"_171":-5,"_172":635,"_99":636},"05883e1a-67fc-11f0-85ab-0224a6c84d84","parser.py","05883ed8-67fc-11f0-85ab-0224a6c84d84",185,["D",1753299257063],"\"\"\"Base option parser setup\"\"\"\n\nimport logging\nimport optparse\nimport shutil\nimport sys\nimport textwrap\nfrom contextlib import suppress\nfrom typing import Any, Dict, Generator, List, NoReturn, Optional, Tuple\n\nfrom pip._internal.cli.status_codes import UNKNOWN_ERROR\nfrom pip._internal.configuration import Configuration, ConfigurationError\nfrom pip._internal.utils.misc import redact_auth_from_url, strtobool\n\nlogger = logging.getLogger(__name__)\n\n\nclass PrettyHelpFormatter(optparse.IndentedHelpFormatter):\n \"\"\"A prettier/less verbose help formatter for optparse.\"\"\"\n\n def __init__(self, *args: Any, **kwargs: Any) -> None:\n # help position must be aligned with __init__.parseopts.description\n kwargs[\"max_help_position\"] = 30\n kwargs[\"indent_increment\"] = 1\n kwargs[\"width\"] = shutil.get_terminal_size()[0] - 2\n super().__init__(*args, **kwargs)\n\n def format_option_strings(self, option: optparse.Option) -> str:\n return self._format_option_strings(option)\n\n def _format_option_strings(\n self, option: optparse.Option, mvarfmt: str = \" <{}>\", optsep: str = \", \"\n ) -> str:\n \"\"\"\n Return a comma-separated list of option strings and metavars.\n\n :param option: tuple of (short opt, long opt), e.g: ('-f', '--format')\n :param mvarfmt: metavar format string\n :param optsep: separator\n \"\"\"\n opts = []\n\n if option._short_opts:\n opts.append(option._short_opts[0])\n if option._long_opts:\n opts.append(option._long_opts[0])\n if len(opts) > 1:\n opts.insert(1, optsep)\n\n if option.takes_value():\n assert option.dest is not None\n metavar = option.metavar or option.dest.lower()\n opts.append(mvarfmt.format(metavar.lower()))\n\n return \"\".join(opts)\n\n def format_heading(self, heading: str) -> str:\n if heading == \"Options\":\n return \"\"\n return heading + \":\\n\"\n\n def format_usage(self, usage: str) -> str:\n \"\"\"\n Ensure there is only one newline between usage and the first heading\n if there is no description.\n \"\"\"\n msg = \"\\nUsage: {}\\n\".format(self.indent_lines(textwrap.dedent(usage), \" \"))\n return msg\n\n def format_description(self, description: Optional[str]) -> str:\n # leave full control over description to us\n if description:\n if hasattr(self.parser, \"main\"):\n label = \"Commands\"\n else:\n label = \"Description\"\n # some doc strings have initial newlines, some don't\n description = description.lstrip(\"\\n\")\n # some doc strings have final newlines and spaces, some don't\n description = description.rstrip()\n # dedent, then reindent\n description = self.indent_lines(textwrap.dedent(description), \" \")\n description = f\"{label}:\\n{description}\\n\"\n return description\n else:\n return \"\"\n\n def format_epilog(self, epilog: Optional[str]) -> str:\n # leave full control over epilog to us\n if epilog:\n return epilog\n else:\n return \"\"\n\n def indent_lines(self, text: str, indent: str) -> str:\n new_lines = [indent + line for line in text.split(\"\\n\")]\n return \"\\n\".join(new_lines)\n\n\nclass UpdatingDefaultsHelpFormatter(PrettyHelpFormatter):\n \"\"\"Custom help formatter for use in ConfigOptionParser.\n\n This is updates the defaults before expanding them, allowing\n them to show up correctly in the help listing.\n\n Also redact auth from url type options\n \"\"\"\n\n def expand_default(self, option: optparse.Option) -> str:\n default_values = None\n if self.parser is not None:\n assert isinstance(self.parser, ConfigOptionParser)\n self.parser._update_defaults(self.parser.defaults)\n assert option.dest is not None\n default_values = self.parser.defaults.get(option.dest)\n help_text = super().expand_default(option)\n\n if default_values and option.metavar == \"URL\":\n if isinstance(default_values, str):\n default_values = [default_values]\n\n # If its not a list, we should abort and just return the help text\n if not isinstance(default_values, list):\n default_values = []\n\n for val in default_values:\n help_text = help_text.replace(val, redact_auth_from_url(val))\n\n return help_text\n\n\nclass CustomOptionParser(optparse.OptionParser):\n def insert_option_group(\n self, idx: int, *args: Any, **kwargs: Any\n ) -> optparse.OptionGroup:\n \"\"\"Insert an OptionGroup at a given position.\"\"\"\n group = self.add_option_group(*args, **kwargs)\n\n self.option_groups.pop()\n self.option_groups.insert(idx, group)\n\n return group\n\n @property\n def option_list_all(self) -> List[optparse.Option]:\n \"\"\"Get a list of all options, including those in option groups.\"\"\"\n res = self.option_list[:]\n for i in self.option_groups:\n res.extend(i.option_list)\n\n return res\n\n\nclass ConfigOptionParser(CustomOptionParser):\n \"\"\"Custom option parser which updates its defaults by checking the\n configuration files and environmental variables\"\"\"\n\n def __init__(\n self,\n *args: Any,\n name: str,\n isolated: bool = False,\n **kwargs: Any,\n ) -> None:\n self.name = name\n self.config = Configuration(isolated)\n\n assert self.name\n super().__init__(*args, **kwargs)\n\n def check_default(self, option: optparse.Option, key: str, val: Any) -> Any:\n try:\n return option.check_value(key, val)\n except optparse.OptionValueError as exc:\n print(f\"An error occurred during configuration: {exc}\")\n sys.exit(3)\n\n def _get_ordered_configuration_items(\n self,\n ) -> Generator[Tuple[str, Any], None, None]:\n # Configuration gives keys in an unordered manner. Order them.\n override_order = [\"global\", self.name, \":env:\"]\n\n # Pool the options into different groups\n section_items: Dict[str, List[Tuple[str, Any]]] = {\n name: [] for name in override_order\n }\n for section_key, val in self.config.items():\n # ignore empty values\n if not val:\n logger.debug(\n \"Ignoring configuration key '%s' as it's value is empty.\",\n section_key,\n )\n continue\n\n section, key = section_key.split(\".\", 1)\n if section in override_order:\n section_items[section].append((key, val))\n\n # Yield each group in their override order\n for section in override_order:\n for key, val in section_items[section]:\n yield key, val\n\n def _update_defaults(self, defaults: Dict[str, Any]) -> Dict[str, Any]:\n \"\"\"Updates the given defaults with values from the config files and\n the environ. Does a little special handling for certain types of\n options (lists).\"\"\"\n\n # Accumulate complex default state.\n self.values = optparse.Values(self.defaults)\n late_eval = set()\n # Then set the options with those values\n for key, val in self._get_ordered_configuration_items():\n # '--' because configuration supports only long names\n option = self.get_option(\"--\" + key)\n\n # Ignore options not present in this parser. E.g. non-globals put\n # in [global] by users that want them to apply to all applicable\n # commands.\n if option is None:\n continue\n\n assert option.dest is not None\n\n if option.action in (\"store_true\", \"store_false\"):\n try:\n val = strtobool(val)\n except ValueError:\n self.error(\n f\"{val} is not a valid value for {key} option, \"\n \"please specify a boolean value like yes/no, \"\n \"true/false or 1/0 instead.\"\n )\n elif option.action == \"count\":\n with suppress(ValueError):\n val = strtobool(val)\n with suppress(ValueError):\n val = int(val)\n if not isinstance(val, int) or val < 0:\n self.error(\n f\"{val} is not a valid value for {key} option, \"\n \"please instead specify either a non-negative integer \"\n \"or a boolean value like yes/no or false/true \"\n \"which is equivalent to 1/0.\"\n )\n elif option.action == \"append\":\n val = val.split()\n val = [self.check_default(option, key, v) for v in val]\n elif option.action == \"callback\":\n assert option.callback is not None\n late_eval.add(option.dest)\n opt_str = option.get_opt_string()\n val = option.convert_value(opt_str, val)\n # From take_action\n args = option.callback_args or ()\n kwargs = option.callback_kwargs or {}\n option.callback(option, opt_str, val, self, *args, **kwargs)\n else:\n val = self.check_default(option, key, val)\n\n defaults[option.dest] = val\n\n for key in late_eval:\n defaults[key] = getattr(self.values, key)\n self.values = None\n return defaults\n\n def get_default_values(self) -> optparse.Values:\n \"\"\"Overriding to make updating the defaults after instantiation of\n the option parser possible, _update_defaults() does the dirty work.\"\"\"\n if not self.process_default_values:\n # Old, pre-Optik 1.5 behaviour.\n return optparse.Values(self.defaults)\n\n # Load the configuration, or error out in case of an error\n try:\n self.config.load()\n except ConfigurationError as err:\n self.exit(UNKNOWN_ERROR, str(err))\n\n defaults = self._update_defaults(self.defaults.copy()) # ours\n for option in self._get_all_options():\n assert option.dest is not None\n default = defaults.get(option.dest)\n if isinstance(default, str):\n opt_str = option.get_opt_string()\n defaults[option.dest] = option.check_value(opt_str, default)\n return optparse.Values(defaults)\n\n def error(self, msg: str) -> NoReturn:\n self.print_usage(sys.stderr)\n self.exit(UNKNOWN_ERROR, f\"{msg}\\n\")\n",[],[100,509,516,523,475,544,551,630],{"_104":638,"_96":639,"_158":640,"_160":552,"_161":139,"_162":641,"_164":165,"_106":642,"_101":29,"_167":215,"_169":643,"_170":25,"_171":-5,"_172":644,"_99":645},"05af0388-67fc-11f0-96d6-0224a6c84d84","progress_bars.py","05af046e-67fc-11f0-96d6-0224a6c84d84",191,["D",1753299257306],"import functools\nimport sys\nfrom typing import Callable, Generator, Iterable, Iterator, Optional, Tuple, TypeVar\n\nfrom pip._vendor.rich.progress import (\n BarColumn,\n DownloadColumn,\n FileSizeColumn,\n MofNCompleteColumn,\n Progress,\n ProgressColumn,\n SpinnerColumn,\n TextColumn,\n TimeElapsedColumn,\n TimeRemainingColumn,\n TransferSpeedColumn,\n)\n\nfrom pip._internal.cli.spinners import RateLimiter\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.logging import get_console, get_indentation\n\nT = TypeVar(\"T\")\nProgressRenderer = Callable[[Iterable[T]], Iterator[T]]\n\n\ndef _rich_download_progress_bar(\n iterable: Iterable[bytes],\n *,\n bar_type: str,\n size: Optional[int],\n initial_progress: Optional[int] = None,\n) -> Generator[bytes, None, None]:\n assert bar_type == \"on\", \"This should only be used in the default mode.\"\n\n if not size:\n total = float(\"inf\")\n columns: Tuple[ProgressColumn, ...] = (\n TextColumn(\"[progress.description]{task.description}\"),\n SpinnerColumn(\"line\", speed=1.5),\n FileSizeColumn(),\n TransferSpeedColumn(),\n TimeElapsedColumn(),\n )\n else:\n total = size\n columns = (\n TextColumn(\"[progress.description]{task.description}\"),\n BarColumn(),\n DownloadColumn(),\n TransferSpeedColumn(),\n TextColumn(\"eta\"),\n TimeRemainingColumn(),\n )\n\n progress = Progress(*columns, refresh_per_second=5)\n task_id = progress.add_task(\" \" * (get_indentation() + 2), total=total)\n if initial_progress is not None:\n progress.update(task_id, advance=initial_progress)\n with progress:\n for chunk in iterable:\n yield chunk\n progress.update(task_id, advance=len(chunk))\n\n\ndef _rich_install_progress_bar(\n iterable: Iterable[InstallRequirement], *, total: int\n) -> Iterator[InstallRequirement]:\n columns = (\n TextColumn(\"{task.fields[indent]}\"),\n BarColumn(),\n MofNCompleteColumn(),\n TextColumn(\"{task.description}\"),\n )\n console = get_console()\n\n bar = Progress(*columns, refresh_per_second=6, console=console, transient=True)\n # Hiding the progress bar at initialization forces a refresh cycle to occur\n # until the bar appears, avoiding very short flashes.\n task = bar.add_task(\"\", total=total, indent=\" \" * get_indentation(), visible=False)\n with bar:\n for req in iterable:\n bar.update(task, description=rf\"\\[{req.name}]\", visible=True)\n yield req\n bar.advance(task)\n\n\ndef _raw_progress_bar(\n iterable: Iterable[bytes],\n *,\n size: Optional[int],\n initial_progress: Optional[int] = None,\n) -> Generator[bytes, None, None]:\n def write_progress(current: int, total: int) -> None:\n sys.stdout.write(f\"Progress {current} of {total}\\n\")\n sys.stdout.flush()\n\n current = initial_progress or 0\n total = size or 0\n rate_limiter = RateLimiter(0.25)\n\n write_progress(current, total)\n for chunk in iterable:\n current += len(chunk)\n if rate_limiter.ready() or current == total:\n write_progress(current, total)\n rate_limiter.reset()\n yield chunk\n\n\ndef get_download_progress_renderer(\n *, bar_type: str, size: Optional[int] = None, initial_progress: Optional[int] = None\n) -> ProgressRenderer[bytes]:\n \"\"\"Get an object that can be used to render the download progress.\n\n Returns a callable, that takes an iterable to \"wrap\".\n \"\"\"\n if bar_type == \"on\":\n return functools.partial(\n _rich_download_progress_bar,\n bar_type=bar_type,\n size=size,\n initial_progress=initial_progress,\n )\n elif bar_type == \"raw\":\n return functools.partial(\n _raw_progress_bar,\n size=size,\n initial_progress=initial_progress,\n )\n else:\n return iter # no-op, when passed an iterator\n\n\ndef get_install_progress_renderer(\n *, bar_type: str, total: int\n) -> ProgressRenderer[InstallRequirement]:\n \"\"\"Get an object that can be used to render the install progress.\n Returns a callable, that takes an iterable to \"wrap\".\n \"\"\"\n if bar_type == \"on\":\n return functools.partial(_rich_install_progress_bar, total=total)\n else:\n return iter\n",[],[100,509,516,523,475,544,551,639],{"_104":647,"_96":648,"_158":649,"_160":552,"_161":139,"_162":650,"_164":165,"_106":651,"_101":29,"_167":215,"_169":652,"_170":25,"_171":-5,"_172":653,"_99":654},"05b6c67c-67fc-11f0-b87e-0224a6c84d84","req_command.py","05b6c76c-67fc-11f0-b87e-0224a6c84d84",193,["D",1753299257362],"\"\"\"Contains the RequirementCommand base class.\n\nThis class is in a separate module so the commands that do not always\nneed PackageFinder capability don't unnecessarily import the\nPackageFinder machinery and all its vendored dependencies, etc.\n\"\"\"\n\nimport logging\nfrom functools import partial\nfrom optparse import Values\nfrom typing import Any, List, Optional, Tuple\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.index_command import IndexGroupCommand\nfrom pip._internal.cli.index_command import SessionCommandMixin as SessionCommandMixin\nfrom pip._internal.exceptions import CommandError, PreviousBuildDirError\nfrom pip._internal.index.collector import LinkCollector\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.models.selection_prefs import SelectionPreferences\nfrom pip._internal.models.target_python import TargetPython\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.operations.build.build_tracker import BuildTracker\nfrom pip._internal.operations.prepare import RequirementPreparer\nfrom pip._internal.req.constructors import (\n install_req_from_editable,\n install_req_from_line,\n install_req_from_parsed_requirement,\n install_req_from_req_string,\n)\nfrom pip._internal.req.req_dependency_group import parse_dependency_groups\nfrom pip._internal.req.req_file import parse_requirements\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.resolution.base import BaseResolver\nfrom pip._internal.utils.temp_dir import (\n TempDirectory,\n TempDirectoryTypeRegistry,\n tempdir_kinds,\n)\n\nlogger = logging.getLogger(__name__)\n\n\nKEEPABLE_TEMPDIR_TYPES = [\n tempdir_kinds.BUILD_ENV,\n tempdir_kinds.EPHEM_WHEEL_CACHE,\n tempdir_kinds.REQ_BUILD,\n]\n\n\ndef with_cleanup(func: Any) -> Any:\n \"\"\"Decorator for common logic related to managing temporary\n directories.\n \"\"\"\n\n def configure_tempdir_registry(registry: TempDirectoryTypeRegistry) -> None:\n for t in KEEPABLE_TEMPDIR_TYPES:\n registry.set_delete(t, False)\n\n def wrapper(\n self: RequirementCommand, options: Values, args: List[Any]\n ) -> Optional[int]:\n assert self.tempdir_registry is not None\n if options.no_clean:\n configure_tempdir_registry(self.tempdir_registry)\n\n try:\n return func(self, options, args)\n except PreviousBuildDirError:\n # This kind of conflict can occur when the user passes an explicit\n # build directory with a pre-existing folder. In that case we do\n # not want to accidentally remove it.\n configure_tempdir_registry(self.tempdir_registry)\n raise\n\n return wrapper\n\n\nclass RequirementCommand(IndexGroupCommand):\n def __init__(self, *args: Any, **kw: Any) -> None:\n super().__init__(*args, **kw)\n\n self.cmd_opts.add_option(cmdoptions.dependency_groups())\n self.cmd_opts.add_option(cmdoptions.no_clean())\n\n @staticmethod\n def determine_resolver_variant(options: Values) -> str:\n \"\"\"Determines which resolver should be used, based on the given options.\"\"\"\n if \"legacy-resolver\" in options.deprecated_features_enabled:\n return \"legacy\"\n\n return \"resolvelib\"\n\n @classmethod\n def make_requirement_preparer(\n cls,\n temp_build_dir: TempDirectory,\n options: Values,\n build_tracker: BuildTracker,\n session: PipSession,\n finder: PackageFinder,\n use_user_site: bool,\n download_dir: Optional[str] = None,\n verbosity: int = 0,\n ) -> RequirementPreparer:\n \"\"\"\n Create a RequirementPreparer instance for the given parameters.\n \"\"\"\n temp_build_dir_path = temp_build_dir.path\n assert temp_build_dir_path is not None\n legacy_resolver = False\n\n resolver_variant = cls.determine_resolver_variant(options)\n if resolver_variant == \"resolvelib\":\n lazy_wheel = \"fast-deps\" in options.features_enabled\n if lazy_wheel:\n logger.warning(\n \"pip is using lazily downloaded wheels using HTTP \"\n \"range requests to obtain dependency information. \"\n \"This experimental feature is enabled through \"\n \"--use-feature=fast-deps and it is not ready for \"\n \"production.\"\n )\n else:\n legacy_resolver = True\n lazy_wheel = False\n if \"fast-deps\" in options.features_enabled:\n logger.warning(\n \"fast-deps has no effect when used with the legacy resolver.\"\n )\n\n return RequirementPreparer(\n build_dir=temp_build_dir_path,\n src_dir=options.src_dir,\n download_dir=download_dir,\n build_isolation=options.build_isolation,\n check_build_deps=options.check_build_deps,\n build_tracker=build_tracker,\n session=session,\n progress_bar=options.progress_bar,\n finder=finder,\n require_hashes=options.require_hashes,\n use_user_site=use_user_site,\n lazy_wheel=lazy_wheel,\n verbosity=verbosity,\n legacy_resolver=legacy_resolver,\n resume_retries=options.resume_retries,\n )\n\n @classmethod\n def make_resolver(\n cls,\n preparer: RequirementPreparer,\n finder: PackageFinder,\n options: Values,\n wheel_cache: Optional[WheelCache] = None,\n use_user_site: bool = False,\n ignore_installed: bool = True,\n ignore_requires_python: bool = False,\n force_reinstall: bool = False,\n upgrade_strategy: str = \"to-satisfy-only\",\n use_pep517: Optional[bool] = None,\n py_version_info: Optional[Tuple[int, ...]] = None,\n ) -> BaseResolver:\n \"\"\"\n Create a Resolver instance for the given parameters.\n \"\"\"\n make_install_req = partial(\n install_req_from_req_string,\n isolated=options.isolated_mode,\n use_pep517=use_pep517,\n )\n resolver_variant = cls.determine_resolver_variant(options)\n # The long import name and duplicated invocation is needed to convince\n # Mypy into correctly typechecking. Otherwise it would complain the\n # \"Resolver\" class being redefined.\n if resolver_variant == \"resolvelib\":\n import pip._internal.resolution.resolvelib.resolver\n\n return pip._internal.resolution.resolvelib.resolver.Resolver(\n preparer=preparer,\n finder=finder,\n wheel_cache=wheel_cache,\n make_install_req=make_install_req,\n use_user_site=use_user_site,\n ignore_dependencies=options.ignore_dependencies,\n ignore_installed=ignore_installed,\n ignore_requires_python=ignore_requires_python,\n force_reinstall=force_reinstall,\n upgrade_strategy=upgrade_strategy,\n py_version_info=py_version_info,\n )\n import pip._internal.resolution.legacy.resolver\n\n return pip._internal.resolution.legacy.resolver.Resolver(\n preparer=preparer,\n finder=finder,\n wheel_cache=wheel_cache,\n make_install_req=make_install_req,\n use_user_site=use_user_site,\n ignore_dependencies=options.ignore_dependencies,\n ignore_installed=ignore_installed,\n ignore_requires_python=ignore_requires_python,\n force_reinstall=force_reinstall,\n upgrade_strategy=upgrade_strategy,\n py_version_info=py_version_info,\n )\n\n def get_requirements(\n self,\n args: List[str],\n options: Values,\n finder: PackageFinder,\n session: PipSession,\n ) -> List[InstallRequirement]:\n \"\"\"\n Parse command-line arguments into the corresponding requirements.\n \"\"\"\n requirements: List[InstallRequirement] = []\n for filename in options.constraints:\n for parsed_req in parse_requirements(\n filename,\n constraint=True,\n finder=finder,\n options=options,\n session=session,\n ):\n req_to_add = install_req_from_parsed_requirement(\n parsed_req,\n isolated=options.isolated_mode,\n user_supplied=False,\n )\n requirements.append(req_to_add)\n\n for req in args:\n req_to_add = install_req_from_line(\n req,\n comes_from=None,\n isolated=options.isolated_mode,\n use_pep517=options.use_pep517,\n user_supplied=True,\n config_settings=getattr(options, \"config_settings\", None),\n )\n requirements.append(req_to_add)\n\n if options.dependency_groups:\n for req in parse_dependency_groups(options.dependency_groups):\n req_to_add = install_req_from_req_string(\n req,\n isolated=options.isolated_mode,\n use_pep517=options.use_pep517,\n user_supplied=True,\n )\n requirements.append(req_to_add)\n\n for req in options.editables:\n req_to_add = install_req_from_editable(\n req,\n user_supplied=True,\n isolated=options.isolated_mode,\n use_pep517=options.use_pep517,\n config_settings=getattr(options, \"config_settings\", None),\n )\n requirements.append(req_to_add)\n\n # NOTE: options.require_hashes may be set if --require-hashes is True\n for filename in options.requirements:\n for parsed_req in parse_requirements(\n filename, finder=finder, options=options, session=session\n ):\n req_to_add = install_req_from_parsed_requirement(\n parsed_req,\n isolated=options.isolated_mode,\n use_pep517=options.use_pep517,\n user_supplied=True,\n config_settings=(\n parsed_req.options.get(\"config_settings\")\n if parsed_req.options\n else None\n ),\n )\n requirements.append(req_to_add)\n\n # If any requirement has hash options, enable hash checking.\n if any(req.has_hash_options for req in requirements):\n options.require_hashes = True\n\n if not (\n args\n or options.editables\n or options.requirements\n or options.dependency_groups\n ):\n opts = {\"name\": self.name}\n if options.find_links:\n raise CommandError(\n \"You must give at least one requirement to {name} \"\n '(maybe you meant \"pip {name} {links}\"?)'.format(\n **dict(opts, links=\" \".join(options.find_links))\n )\n )\n else:\n raise CommandError(\n \"You must give at least one requirement to {name} \"\n '(see \"pip help {name}\")'.format(**opts)\n )\n\n return requirements\n\n @staticmethod\n def trace_basic_info(finder: PackageFinder) -> None:\n \"\"\"\n Trace basic information about the provided objects.\n \"\"\"\n # Display where finder is looking for packages\n search_scope = finder.search_scope\n locations = search_scope.get_formatted_locations()\n if locations:\n logger.info(locations)\n\n def _build_package_finder(\n self,\n options: Values,\n session: PipSession,\n target_python: Optional[TargetPython] = None,\n ignore_requires_python: Optional[bool] = None,\n ) -> PackageFinder:\n \"\"\"\n Create a package finder appropriate to this requirement command.\n\n :param ignore_requires_python: Whether to ignore incompatible\n \"Requires-Python\" values in links. Defaults to False.\n \"\"\"\n link_collector = LinkCollector.create(session, options=options)\n selection_prefs = SelectionPreferences(\n allow_yanked=True,\n format_control=options.format_control,\n allow_all_prereleases=options.pre,\n prefer_binary=options.prefer_binary,\n ignore_requires_python=ignore_requires_python,\n )\n\n return PackageFinder.create(\n link_collector=link_collector,\n selection_prefs=selection_prefs,\n target_python=target_python,\n )\n",[],[100,509,516,523,475,544,551,648],{"_104":656,"_96":657,"_158":658,"_160":552,"_161":139,"_162":659,"_164":165,"_106":660,"_101":29,"_167":215,"_169":661,"_170":25,"_171":-5,"_172":662,"_99":663},"05ab67dc-67fc-11f0-95df-0224a6c84d84","spinners.py","05ab68c2-67fc-11f0-95df-0224a6c84d84",190,["D",1753299257138],"import contextlib\nimport itertools\nimport logging\nimport sys\nimport time\nfrom typing import IO, Generator, Optional\n\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.logging import get_indentation\n\nlogger = logging.getLogger(__name__)\n\n\nclass SpinnerInterface:\n def spin(self) -> None:\n raise NotImplementedError()\n\n def finish(self, final_status: str) -> None:\n raise NotImplementedError()\n\n\nclass InteractiveSpinner(SpinnerInterface):\n def __init__(\n self,\n message: str,\n file: Optional[IO[str]] = None,\n spin_chars: str = \"-\\\\|/\",\n # Empirically, 8 updates/second looks nice\n min_update_interval_seconds: float = 0.125,\n ):\n self._message = message\n if file is None:\n file = sys.stdout\n self._file = file\n self._rate_limiter = RateLimiter(min_update_interval_seconds)\n self._finished = False\n\n self._spin_cycle = itertools.cycle(spin_chars)\n\n self._file.write(\" \" * get_indentation() + self._message + \" ... \")\n self._width = 0\n\n def _write(self, status: str) -> None:\n assert not self._finished\n # Erase what we wrote before by backspacing to the beginning, writing\n # spaces to overwrite the old text, and then backspacing again\n backup = \"\\b\" * self._width\n self._file.write(backup + \" \" * self._width + backup)\n # Now we have a blank slate to add our status\n self._file.write(status)\n self._width = len(status)\n self._file.flush()\n self._rate_limiter.reset()\n\n def spin(self) -> None:\n if self._finished:\n return\n if not self._rate_limiter.ready():\n return\n self._write(next(self._spin_cycle))\n\n def finish(self, final_status: str) -> None:\n if self._finished:\n return\n self._write(final_status)\n self._file.write(\"\\n\")\n self._file.flush()\n self._finished = True\n\n\n# Used for dumb terminals, non-interactive installs (no tty), etc.\n# We still print updates occasionally (once every 60 seconds by default) to\n# act as a keep-alive for systems like Travis-CI that take lack-of-output as\n# an indication that a task has frozen.\nclass NonInteractiveSpinner(SpinnerInterface):\n def __init__(self, message: str, min_update_interval_seconds: float = 60.0) -> None:\n self._message = message\n self._finished = False\n self._rate_limiter = RateLimiter(min_update_interval_seconds)\n self._update(\"started\")\n\n def _update(self, status: str) -> None:\n assert not self._finished\n self._rate_limiter.reset()\n logger.info(\"%s: %s\", self._message, status)\n\n def spin(self) -> None:\n if self._finished:\n return\n if not self._rate_limiter.ready():\n return\n self._update(\"still running...\")\n\n def finish(self, final_status: str) -> None:\n if self._finished:\n return\n self._update(f\"finished with status '{final_status}'\")\n self._finished = True\n\n\nclass RateLimiter:\n def __init__(self, min_update_interval_seconds: float) -> None:\n self._min_update_interval_seconds = min_update_interval_seconds\n self._last_update: float = 0\n\n def ready(self) -> bool:\n now = time.time()\n delta = now - self._last_update\n return delta >= self._min_update_interval_seconds\n\n def reset(self) -> None:\n self._last_update = time.time()\n\n\n@contextlib.contextmanager\ndef open_spinner(message: str) -> Generator[SpinnerInterface, None, None]:\n # Interactive spinner goes directly to sys.stdout rather than being routed\n # through the logging system, but it acts like it has level INFO,\n # i.e. it's only displayed if we're at level INFO or better.\n # Non-interactive spinner goes through the logging system, so it is always\n # in sync with logging configuration.\n if sys.stdout.isatty() and logger.getEffectiveLevel() <= logging.INFO:\n spinner: SpinnerInterface = InteractiveSpinner(message)\n else:\n spinner = NonInteractiveSpinner(message)\n try:\n with hidden_cursor(sys.stdout):\n yield spinner\n except KeyboardInterrupt:\n spinner.finish(\"canceled\")\n raise\n except Exception:\n spinner.finish(\"error\")\n raise\n else:\n spinner.finish(\"done\")\n\n\nHIDE_CURSOR = \"\\x1b[?25l\"\nSHOW_CURSOR = \"\\x1b[?25h\"\n\n\n@contextlib.contextmanager\ndef hidden_cursor(file: IO[str]) -> Generator[None, None, None]:\n # The Windows terminal does not support the hide/show cursor ANSI codes,\n # even via colorama. So don't even try.\n if WINDOWS:\n yield\n # We don't want to clutter the output with control characters if we're\n # writing to a file, or if the user is running with --quiet.\n # See https://github.com/pypa/pip/issues/3418\n elif not file.isatty() or logger.getEffectiveLevel() > logging.INFO:\n yield\n else:\n file.write(HIDE_CURSOR)\n try:\n yield\n finally:\n file.write(SHOW_CURSOR)\n",[],[100,509,516,523,475,544,551,657],{"_104":665,"_96":666,"_158":667,"_160":552,"_161":139,"_162":668,"_164":165,"_106":669,"_101":29,"_167":215,"_169":670,"_170":25,"_171":-5,"_172":671,"_99":672},"0584124a-67fc-11f0-8791-0224a6c84d84","status_codes.py","058412f4-67fc-11f0-8791-0224a6c84d84",184,["D",1753299257033],"SUCCESS = 0\nERROR = 1\nUNKNOWN_ERROR = 2\nVIRTUALENV_NOT_FOUND = 3\nPREVIOUS_BUILD_DIR_ERROR = 4\nNO_MATCHES_FOUND = 23\n",[],[100,509,516,523,475,544,551,666],[100,509,516,523,475,544,551],{"_104":675,"_96":676,"_158":677,"_160":545,"_161":139,"_162":144,"_164":165,"_106":678,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":679,"_99":850},"fd1cf540-67fb-11f0-a7d9-0224a6c84d84","commands","fd1cf612-67fb-11f0-a7d9-0224a6c84d84",["D",1753299242939],[680,688,697,706,715,724,733,742,751,760,769,778,787,796,805,814,823,832,841],{"_104":681,"_96":558,"_158":682,"_160":677,"_161":139,"_162":683,"_164":165,"_106":684,"_101":29,"_167":215,"_169":685,"_170":25,"_171":-5,"_172":686,"_99":687},"06f07010-67fc-11f0-9ab6-0224a6c84d84","06f070ce-67fc-11f0-9ab6-0224a6c84d84",247,["D",1753299259394],"\"\"\"\nPackage containing all pip commands\n\"\"\"\n\nimport importlib\nfrom collections import namedtuple\nfrom typing import Any, Dict, Optional\n\nfrom pip._internal.cli.base_command import Command\n\nCommandInfo = namedtuple(\"CommandInfo\", \"module_path, class_name, summary\")\n\n# This dictionary does a bunch of heavy lifting for help output:\n# - Enables avoiding additional (costly) imports for presenting `--help`.\n# - The ordering matters for help display.\n#\n# Even though the module path starts with the same \"pip._internal.commands\"\n# prefix, the full path makes testing easier (specifically when modifying\n# `commands_dict` in test setup / teardown).\ncommands_dict: Dict[str, CommandInfo] = {\n \"install\": CommandInfo(\n \"pip._internal.commands.install\",\n \"InstallCommand\",\n \"Install packages.\",\n ),\n \"lock\": CommandInfo(\n \"pip._internal.commands.lock\",\n \"LockCommand\",\n \"Generate a lock file.\",\n ),\n \"download\": CommandInfo(\n \"pip._internal.commands.download\",\n \"DownloadCommand\",\n \"Download packages.\",\n ),\n \"uninstall\": CommandInfo(\n \"pip._internal.commands.uninstall\",\n \"UninstallCommand\",\n \"Uninstall packages.\",\n ),\n \"freeze\": CommandInfo(\n \"pip._internal.commands.freeze\",\n \"FreezeCommand\",\n \"Output installed packages in requirements format.\",\n ),\n \"inspect\": CommandInfo(\n \"pip._internal.commands.inspect\",\n \"InspectCommand\",\n \"Inspect the python environment.\",\n ),\n \"list\": CommandInfo(\n \"pip._internal.commands.list\",\n \"ListCommand\",\n \"List installed packages.\",\n ),\n \"show\": CommandInfo(\n \"pip._internal.commands.show\",\n \"ShowCommand\",\n \"Show information about installed packages.\",\n ),\n \"check\": CommandInfo(\n \"pip._internal.commands.check\",\n \"CheckCommand\",\n \"Verify installed packages have compatible dependencies.\",\n ),\n \"config\": CommandInfo(\n \"pip._internal.commands.configuration\",\n \"ConfigurationCommand\",\n \"Manage local and global configuration.\",\n ),\n \"search\": CommandInfo(\n \"pip._internal.commands.search\",\n \"SearchCommand\",\n \"Search PyPI for packages.\",\n ),\n \"cache\": CommandInfo(\n \"pip._internal.commands.cache\",\n \"CacheCommand\",\n \"Inspect and manage pip's wheel cache.\",\n ),\n \"index\": CommandInfo(\n \"pip._internal.commands.index\",\n \"IndexCommand\",\n \"Inspect information available from package indexes.\",\n ),\n \"wheel\": CommandInfo(\n \"pip._internal.commands.wheel\",\n \"WheelCommand\",\n \"Build wheels from your requirements.\",\n ),\n \"hash\": CommandInfo(\n \"pip._internal.commands.hash\",\n \"HashCommand\",\n \"Compute hashes of package archives.\",\n ),\n \"completion\": CommandInfo(\n \"pip._internal.commands.completion\",\n \"CompletionCommand\",\n \"A helper command used for command completion.\",\n ),\n \"debug\": CommandInfo(\n \"pip._internal.commands.debug\",\n \"DebugCommand\",\n \"Show information useful for debugging.\",\n ),\n \"help\": CommandInfo(\n \"pip._internal.commands.help\",\n \"HelpCommand\",\n \"Show help for commands.\",\n ),\n}\n\n\ndef create_command(name: str, **kwargs: Any) -> Command:\n \"\"\"\n Create an instance of the Command class with the given name.\n \"\"\"\n module_path, class_name, summary = commands_dict[name]\n module = importlib.import_module(module_path)\n command_class = getattr(module, class_name)\n command = command_class(name=name, summary=summary, **kwargs)\n\n return command\n\n\ndef get_similar_commands(name: str) -> Optional[str]:\n \"\"\"Command name auto-correct.\"\"\"\n from difflib import get_close_matches\n\n name = name.lower()\n\n close_commands = get_close_matches(name, commands_dict.keys())\n\n if close_commands:\n return close_commands[0]\n else:\n return None\n",[],[100,509,516,523,475,544,676,558],{"_104":689,"_96":690,"_158":691,"_160":677,"_161":139,"_162":692,"_164":165,"_106":693,"_101":29,"_167":215,"_169":694,"_170":25,"_171":-5,"_172":695,"_99":696},"06ea9e24-67fc-11f0-9d2d-0224a6c84d84","cache.py","06ea9ef6-67fc-11f0-9d2d-0224a6c84d84",246,["D",1753299259371],"import os\nimport textwrap\nfrom optparse import Values\nfrom typing import Any, List\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.exceptions import CommandError, PipError\nfrom pip._internal.utils import filesystem\nfrom pip._internal.utils.logging import getLogger\nfrom pip._internal.utils.misc import format_size\n\nlogger = getLogger(__name__)\n\n\nclass CacheCommand(Command):\n \"\"\"\n Inspect and manage pip's wheel cache.\n\n Subcommands:\n\n - dir: Show the cache directory.\n - info: Show information about the cache.\n - list: List filenames of packages stored in the cache.\n - remove: Remove one or more package from the cache.\n - purge: Remove all items from the cache.\n\n ```` can be a glob expression or a package name.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog dir\n %prog info\n %prog list [] [--format=[human, abspath]]\n %prog remove \n %prog purge\n \"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"--format\",\n action=\"store\",\n dest=\"list_format\",\n default=\"human\",\n choices=(\"human\", \"abspath\"),\n help=\"Select the output format among: human (default) or abspath\",\n )\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n handlers = {\n \"dir\": self.get_cache_dir,\n \"info\": self.get_cache_info,\n \"list\": self.list_cache_items,\n \"remove\": self.remove_cache_items,\n \"purge\": self.purge_cache,\n }\n\n if not options.cache_dir:\n logger.error(\"pip cache commands can not function since cache is disabled.\")\n return ERROR\n\n # Determine action\n if not args or args[0] not in handlers:\n logger.error(\n \"Need an action (%s) to perform.\",\n \", \".join(sorted(handlers)),\n )\n return ERROR\n\n action = args[0]\n\n # Error handling happens here, not in the action-handlers.\n try:\n handlers[action](options, args[1:])\n except PipError as e:\n logger.error(e.args[0])\n return ERROR\n\n return SUCCESS\n\n def get_cache_dir(self, options: Values, args: List[Any]) -> None:\n if args:\n raise CommandError(\"Too many arguments\")\n\n logger.info(options.cache_dir)\n\n def get_cache_info(self, options: Values, args: List[Any]) -> None:\n if args:\n raise CommandError(\"Too many arguments\")\n\n num_http_files = len(self._find_http_files(options))\n num_packages = len(self._find_wheels(options, \"*\"))\n\n http_cache_location = self._cache_dir(options, \"http-v2\")\n old_http_cache_location = self._cache_dir(options, \"http\")\n wheels_cache_location = self._cache_dir(options, \"wheels\")\n http_cache_size = filesystem.format_size(\n filesystem.directory_size(http_cache_location)\n + filesystem.directory_size(old_http_cache_location)\n )\n wheels_cache_size = filesystem.format_directory_size(wheels_cache_location)\n\n message = (\n textwrap.dedent(\n \"\"\"\n Package index page cache location (pip v23.3+): {http_cache_location}\n Package index page cache location (older pips): {old_http_cache_location}\n Package index page cache size: {http_cache_size}\n Number of HTTP files: {num_http_files}\n Locally built wheels location: {wheels_cache_location}\n Locally built wheels size: {wheels_cache_size}\n Number of locally built wheels: {package_count}\n \"\"\" # noqa: E501\n )\n .format(\n http_cache_location=http_cache_location,\n old_http_cache_location=old_http_cache_location,\n http_cache_size=http_cache_size,\n num_http_files=num_http_files,\n wheels_cache_location=wheels_cache_location,\n package_count=num_packages,\n wheels_cache_size=wheels_cache_size,\n )\n .strip()\n )\n\n logger.info(message)\n\n def list_cache_items(self, options: Values, args: List[Any]) -> None:\n if len(args) > 1:\n raise CommandError(\"Too many arguments\")\n\n if args:\n pattern = args[0]\n else:\n pattern = \"*\"\n\n files = self._find_wheels(options, pattern)\n if options.list_format == \"human\":\n self.format_for_human(files)\n else:\n self.format_for_abspath(files)\n\n def format_for_human(self, files: List[str]) -> None:\n if not files:\n logger.info(\"No locally built wheels cached.\")\n return\n\n results = []\n for filename in files:\n wheel = os.path.basename(filename)\n size = filesystem.format_file_size(filename)\n results.append(f\" - {wheel} ({size})\")\n logger.info(\"Cache contents:\\n\")\n logger.info(\"\\n\".join(sorted(results)))\n\n def format_for_abspath(self, files: List[str]) -> None:\n if files:\n logger.info(\"\\n\".join(sorted(files)))\n\n def remove_cache_items(self, options: Values, args: List[Any]) -> None:\n if len(args) > 1:\n raise CommandError(\"Too many arguments\")\n\n if not args:\n raise CommandError(\"Please provide a pattern\")\n\n files = self._find_wheels(options, args[0])\n\n no_matching_msg = \"No matching packages\"\n if args[0] == \"*\":\n # Only fetch http files if no specific pattern given\n files += self._find_http_files(options)\n else:\n # Add the pattern to the log message\n no_matching_msg += f' for pattern \"{args[0]}\"'\n\n if not files:\n logger.warning(no_matching_msg)\n\n bytes_removed = 0\n for filename in files:\n bytes_removed += os.stat(filename).st_size\n os.unlink(filename)\n logger.verbose(\"Removed %s\", filename)\n logger.info(\"Files removed: %s (%s)\", len(files), format_size(bytes_removed))\n\n def purge_cache(self, options: Values, args: List[Any]) -> None:\n if args:\n raise CommandError(\"Too many arguments\")\n\n return self.remove_cache_items(options, [\"*\"])\n\n def _cache_dir(self, options: Values, subdir: str) -> str:\n return os.path.join(options.cache_dir, subdir)\n\n def _find_http_files(self, options: Values) -> List[str]:\n old_http_dir = self._cache_dir(options, \"http\")\n new_http_dir = self._cache_dir(options, \"http-v2\")\n return filesystem.find_files(old_http_dir, \"*\") + filesystem.find_files(\n new_http_dir, \"*\"\n )\n\n def _find_wheels(self, options: Values, pattern: str) -> List[str]:\n wheel_dir = self._cache_dir(options, \"wheels\")\n\n # The wheel filename format, as specified in PEP 427, is:\n # {distribution}-{version}(-{build})?-{python}-{abi}-{platform}.whl\n #\n # Additionally, non-alphanumeric values in the distribution are\n # normalized to underscores (_), meaning hyphens can never occur\n # before `-{version}`.\n #\n # Given that information:\n # - If the pattern we're given contains a hyphen (-), the user is\n # providing at least the version. Thus, we can just append `*.whl`\n # to match the rest of it.\n # - If the pattern we're given doesn't contain a hyphen (-), the\n # user is only providing the name. Thus, we append `-*.whl` to\n # match the hyphen before the version, followed by anything else.\n #\n # PEP 427: https://www.python.org/dev/peps/pep-0427/\n pattern = pattern + (\"*.whl\" if \"-\" in pattern else \"-*.whl\")\n\n return filesystem.find_files(wheel_dir, pattern)\n",[],[100,509,516,523,475,544,676,690],{"_104":698,"_96":699,"_158":700,"_160":677,"_161":139,"_162":701,"_164":165,"_106":702,"_101":29,"_167":215,"_169":703,"_170":25,"_171":-5,"_172":704,"_99":705},"06ce3842-67fc-11f0-bcbe-0224a6c84d84","check.py","06ce390a-67fc-11f0-bcbe-0224a6c84d84",241,["D",1753299259199],"import logging\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.metadata import get_default_environment\nfrom pip._internal.operations.check import (\n check_package_set,\n check_unsupported,\n create_package_set_from_installed,\n)\nfrom pip._internal.utils.compatibility_tags import get_supported\nfrom pip._internal.utils.misc import write_output\n\nlogger = logging.getLogger(__name__)\n\n\nclass CheckCommand(Command):\n \"\"\"Verify installed packages have compatible dependencies.\"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog [options]\"\"\"\n\n def run(self, options: Values, args: List[str]) -> int:\n package_set, parsing_probs = create_package_set_from_installed()\n missing, conflicting = check_package_set(package_set)\n unsupported = list(\n check_unsupported(\n get_default_environment().iter_installed_distributions(),\n get_supported(),\n )\n )\n\n for project_name in missing:\n version = package_set[project_name].version\n for dependency in missing[project_name]:\n write_output(\n \"%s %s requires %s, which is not installed.\",\n project_name,\n version,\n dependency[0],\n )\n\n for project_name in conflicting:\n version = package_set[project_name].version\n for dep_name, dep_version, req in conflicting[project_name]:\n write_output(\n \"%s %s has requirement %s, but you have %s %s.\",\n project_name,\n version,\n req,\n dep_name,\n dep_version,\n )\n for package in unsupported:\n write_output(\n \"%s %s is not supported on this platform\",\n package.raw_name,\n package.version,\n )\n if missing or conflicting or parsing_probs or unsupported:\n return ERROR\n else:\n write_output(\"No broken requirements found.\")\n return SUCCESS\n",[],[100,509,516,523,475,544,676,699],{"_104":707,"_96":708,"_158":709,"_160":677,"_161":139,"_162":710,"_164":165,"_106":711,"_101":29,"_167":215,"_169":712,"_170":25,"_171":-5,"_172":713,"_99":714},"06df6d06-67fc-11f0-b654-0224a6c84d84","completion.py","06df6dec-67fc-11f0-b654-0224a6c84d84",244,["D",1753299259279],"import sys\nimport textwrap\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.utils.misc import get_prog\n\nBASE_COMPLETION = \"\"\"\n# pip {shell} completion start{script}# pip {shell} completion end\n\"\"\"\n\nCOMPLETION_SCRIPTS = {\n \"bash\": \"\"\"\n _pip_completion()\n {{\n COMPREPLY=( $( COMP_WORDS=\"${{COMP_WORDS[*]}}\" \\\\\n COMP_CWORD=$COMP_CWORD \\\\\n PIP_AUTO_COMPLETE=1 $1 2>/dev/null ) )\n }}\n complete -o default -F _pip_completion {prog}\n \"\"\",\n \"zsh\": \"\"\"\n #compdef -P pip[0-9.]#\n __pip() {{\n compadd $( COMP_WORDS=\"$words[*]\" \\\\\n COMP_CWORD=$((CURRENT-1)) \\\\\n PIP_AUTO_COMPLETE=1 $words[1] 2>/dev/null )\n }}\n if [[ $zsh_eval_context[-1] == loadautofunc ]]; then\n # autoload from fpath, call function directly\n __pip \"$@\"\n else\n # eval/source/. command, register function for later\n compdef __pip -P 'pip[0-9.]#'\n fi\n \"\"\",\n \"fish\": \"\"\"\n function __fish_complete_pip\n set -lx COMP_WORDS \\\\\n (commandline --current-process --tokenize --cut-at-cursor) \\\\\n (commandline --current-token --cut-at-cursor)\n set -lx COMP_CWORD (math (count $COMP_WORDS) - 1)\n set -lx PIP_AUTO_COMPLETE 1\n set -l completions\n if string match -q '2.*' $version\n set completions (eval $COMP_WORDS[1])\n else\n set completions ($COMP_WORDS[1])\n end\n string split \\\\ -- $completions\n end\n complete -fa \"(__fish_complete_pip)\" -c {prog}\n \"\"\",\n \"powershell\": \"\"\"\n if ((Test-Path Function:\\\\TabExpansion) -and -not `\n (Test-Path Function:\\\\_pip_completeBackup)) {{\n Rename-Item Function:\\\\TabExpansion _pip_completeBackup\n }}\n function TabExpansion($line, $lastWord) {{\n $lastBlock = [regex]::Split($line, '[|;]')[-1].TrimStart()\n if ($lastBlock.StartsWith(\"{prog} \")) {{\n $Env:COMP_WORDS=$lastBlock\n $Env:COMP_CWORD=$lastBlock.Split().Length - 1\n $Env:PIP_AUTO_COMPLETE=1\n (& {prog}).Split()\n Remove-Item Env:COMP_WORDS\n Remove-Item Env:COMP_CWORD\n Remove-Item Env:PIP_AUTO_COMPLETE\n }}\n elseif (Test-Path Function:\\\\_pip_completeBackup) {{\n # Fall back on existing tab expansion\n _pip_completeBackup $line $lastWord\n }}\n }}\n \"\"\",\n}\n\n\nclass CompletionCommand(Command):\n \"\"\"A helper command to be used for command completion.\"\"\"\n\n ignore_require_venv = True\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"--bash\",\n \"-b\",\n action=\"store_const\",\n const=\"bash\",\n dest=\"shell\",\n help=\"Emit completion code for bash\",\n )\n self.cmd_opts.add_option(\n \"--zsh\",\n \"-z\",\n action=\"store_const\",\n const=\"zsh\",\n dest=\"shell\",\n help=\"Emit completion code for zsh\",\n )\n self.cmd_opts.add_option(\n \"--fish\",\n \"-f\",\n action=\"store_const\",\n const=\"fish\",\n dest=\"shell\",\n help=\"Emit completion code for fish\",\n )\n self.cmd_opts.add_option(\n \"--powershell\",\n \"-p\",\n action=\"store_const\",\n const=\"powershell\",\n dest=\"shell\",\n help=\"Emit completion code for powershell\",\n )\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n \"\"\"Prints the completion code of the given shell\"\"\"\n shells = COMPLETION_SCRIPTS.keys()\n shell_options = [\"--\" + shell for shell in sorted(shells)]\n if options.shell in shells:\n script = textwrap.dedent(\n COMPLETION_SCRIPTS.get(options.shell, \"\").format(prog=get_prog())\n )\n print(BASE_COMPLETION.format(script=script, shell=options.shell))\n return SUCCESS\n else:\n sys.stderr.write(\n \"ERROR: You must pass {}\\n\".format(\" or \".join(shell_options))\n )\n return SUCCESS\n",[],[100,509,516,523,475,544,676,708],{"_104":716,"_96":717,"_158":718,"_160":677,"_161":139,"_162":719,"_164":165,"_106":720,"_101":29,"_167":215,"_169":721,"_170":25,"_171":-5,"_172":722,"_99":723},"06c087ba-67fc-11f0-9ad5-0224a6c84d84","configuration.py","06c08896-67fc-11f0-9ad5-0224a6c84d84",239,["D",1753299259099],"import logging\nimport os\nimport subprocess\nfrom optparse import Values\nfrom typing import Any, List, Optional\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.configuration import (\n Configuration,\n Kind,\n get_configuration_files,\n kinds,\n)\nfrom pip._internal.exceptions import PipError\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import get_prog, write_output\n\nlogger = logging.getLogger(__name__)\n\n\nclass ConfigurationCommand(Command):\n \"\"\"\n Manage local and global configuration.\n\n Subcommands:\n\n - list: List the active configuration (or from the file specified)\n - edit: Edit the configuration file in an editor\n - get: Get the value associated with command.option\n - set: Set the command.option=value\n - unset: Unset the value associated with command.option\n - debug: List the configuration files and values defined under them\n\n Configuration keys should be dot separated command and option name,\n with the special prefix \"global\" affecting any command. For example,\n \"pip config set global.index-url https://example.org/\" would configure\n the index url for all commands, but \"pip config set download.timeout 10\"\n would configure a 10 second timeout only for \"pip download\" commands.\n\n If none of --user, --global and --site are passed, a virtual\n environment configuration file is used if one is active and the file\n exists. Otherwise, all modifications happen to the user file by\n default.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog [] list\n %prog [] [--editor ] edit\n\n %prog [] get command.option\n %prog [] set command.option value\n %prog [] unset command.option\n %prog [] debug\n \"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"--editor\",\n dest=\"editor\",\n action=\"store\",\n default=None,\n help=(\n \"Editor to use to edit the file. Uses VISUAL or EDITOR \"\n \"environment variables if not provided.\"\n ),\n )\n\n self.cmd_opts.add_option(\n \"--global\",\n dest=\"global_file\",\n action=\"store_true\",\n default=False,\n help=\"Use the system-wide configuration file only\",\n )\n\n self.cmd_opts.add_option(\n \"--user\",\n dest=\"user_file\",\n action=\"store_true\",\n default=False,\n help=\"Use the user configuration file only\",\n )\n\n self.cmd_opts.add_option(\n \"--site\",\n dest=\"site_file\",\n action=\"store_true\",\n default=False,\n help=\"Use the current environment configuration file only\",\n )\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n handlers = {\n \"list\": self.list_values,\n \"edit\": self.open_in_editor,\n \"get\": self.get_name,\n \"set\": self.set_name_value,\n \"unset\": self.unset_name,\n \"debug\": self.list_config_values,\n }\n\n # Determine action\n if not args or args[0] not in handlers:\n logger.error(\n \"Need an action (%s) to perform.\",\n \", \".join(sorted(handlers)),\n )\n return ERROR\n\n action = args[0]\n\n # Determine which configuration files are to be loaded\n # Depends on whether the command is modifying.\n try:\n load_only = self._determine_file(\n options, need_value=(action in [\"get\", \"set\", \"unset\", \"edit\"])\n )\n except PipError as e:\n logger.error(e.args[0])\n return ERROR\n\n # Load a new configuration\n self.configuration = Configuration(\n isolated=options.isolated_mode, load_only=load_only\n )\n self.configuration.load()\n\n # Error handling happens here, not in the action-handlers.\n try:\n handlers[action](options, args[1:])\n except PipError as e:\n logger.error(e.args[0])\n return ERROR\n\n return SUCCESS\n\n def _determine_file(self, options: Values, need_value: bool) -> Optional[Kind]:\n file_options = [\n key\n for key, value in (\n (kinds.USER, options.user_file),\n (kinds.GLOBAL, options.global_file),\n (kinds.SITE, options.site_file),\n )\n if value\n ]\n\n if not file_options:\n if not need_value:\n return None\n # Default to user, unless there's a site file.\n elif any(\n os.path.exists(site_config_file)\n for site_config_file in get_configuration_files()[kinds.SITE]\n ):\n return kinds.SITE\n else:\n return kinds.USER\n elif len(file_options) == 1:\n return file_options[0]\n\n raise PipError(\n \"Need exactly one file to operate upon \"\n \"(--user, --site, --global) to perform.\"\n )\n\n def list_values(self, options: Values, args: List[str]) -> None:\n self._get_n_args(args, \"list\", n=0)\n\n for key, value in sorted(self.configuration.items()):\n write_output(\"%s=%r\", key, value)\n\n def get_name(self, options: Values, args: List[str]) -> None:\n key = self._get_n_args(args, \"get [name]\", n=1)\n value = self.configuration.get_value(key)\n\n write_output(\"%s\", value)\n\n def set_name_value(self, options: Values, args: List[str]) -> None:\n key, value = self._get_n_args(args, \"set [name] [value]\", n=2)\n self.configuration.set_value(key, value)\n\n self._save_configuration()\n\n def unset_name(self, options: Values, args: List[str]) -> None:\n key = self._get_n_args(args, \"unset [name]\", n=1)\n self.configuration.unset_value(key)\n\n self._save_configuration()\n\n def list_config_values(self, options: Values, args: List[str]) -> None:\n \"\"\"List config key-value pairs across different config files\"\"\"\n self._get_n_args(args, \"debug\", n=0)\n\n self.print_env_var_values()\n # Iterate over config files and print if they exist, and the\n # key-value pairs present in them if they do\n for variant, files in sorted(self.configuration.iter_config_files()):\n write_output(\"%s:\", variant)\n for fname in files:\n with indent_log():\n file_exists = os.path.exists(fname)\n write_output(\"%s, exists: %r\", fname, file_exists)\n if file_exists:\n self.print_config_file_values(variant)\n\n def print_config_file_values(self, variant: Kind) -> None:\n \"\"\"Get key-value pairs from the file of a variant\"\"\"\n for name, value in self.configuration.get_values_in_config(variant).items():\n with indent_log():\n write_output(\"%s: %s\", name, value)\n\n def print_env_var_values(self) -> None:\n \"\"\"Get key-values pairs present as environment variables\"\"\"\n write_output(\"%s:\", \"env_var\")\n with indent_log():\n for key, value in sorted(self.configuration.get_environ_vars()):\n env_var = f\"PIP_{key.upper()}\"\n write_output(\"%s=%r\", env_var, value)\n\n def open_in_editor(self, options: Values, args: List[str]) -> None:\n editor = self._determine_editor(options)\n\n fname = self.configuration.get_file_to_edit()\n if fname is None:\n raise PipError(\"Could not determine appropriate file.\")\n elif '\"' in fname:\n # This shouldn't happen, unless we see a username like that.\n # If that happens, we'd appreciate a pull request fixing this.\n raise PipError(\n f'Can not open an editor for a file name containing \"\\n{fname}'\n )\n\n try:\n subprocess.check_call(f'{editor} \"{fname}\"', shell=True)\n except FileNotFoundError as e:\n if not e.filename:\n e.filename = editor\n raise\n except subprocess.CalledProcessError as e:\n raise PipError(f\"Editor Subprocess exited with exit code {e.returncode}\")\n\n def _get_n_args(self, args: List[str], example: str, n: int) -> Any:\n \"\"\"Helper to make sure the command got the right number of arguments\"\"\"\n if len(args) != n:\n msg = (\n f\"Got unexpected number of arguments, expected {n}. \"\n f'(example: \"{get_prog()} config {example}\")'\n )\n raise PipError(msg)\n\n if n == 1:\n return args[0]\n else:\n return args\n\n def _save_configuration(self) -> None:\n # We successfully ran a modifying command. Need to save the\n # configuration.\n try:\n self.configuration.save()\n except Exception:\n logger.exception(\n \"Unable to save configuration. Please report this as a bug.\"\n )\n raise PipError(\"Internal Error.\")\n\n def _determine_editor(self, options: Values) -> str:\n if options.editor is not None:\n return options.editor\n elif \"VISUAL\" in os.environ:\n return os.environ[\"VISUAL\"]\n elif \"EDITOR\" in os.environ:\n return os.environ[\"EDITOR\"]\n else:\n raise PipError(\"Could not determine editor to use.\")\n",[],[100,509,516,523,475,544,676,717],{"_104":725,"_96":726,"_158":727,"_160":677,"_161":139,"_162":728,"_164":165,"_106":729,"_101":29,"_167":215,"_169":730,"_170":25,"_171":-5,"_172":731,"_99":732},"06fe7444-67fc-11f0-9ab6-0224a6c84d84","debug.py","06fe74ee-67fc-11f0-9ab6-0224a6c84d84",250,["D",1753299259519],"import locale\nimport logging\nimport os\nimport sys\nfrom optparse import Values\nfrom types import ModuleType\nfrom typing import Any, Dict, List, Optional\n\nimport pip._vendor\nfrom pip._vendor.certifi import where\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.cmdoptions import make_target_python\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.configuration import Configuration\nfrom pip._internal.metadata import get_environment\nfrom pip._internal.utils.compat import open_text_resource\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import get_pip_version\n\nlogger = logging.getLogger(__name__)\n\n\ndef show_value(name: str, value: Any) -> None:\n logger.info(\"%s: %s\", name, value)\n\n\ndef show_sys_implementation() -> None:\n logger.info(\"sys.implementation:\")\n implementation_name = sys.implementation.name\n with indent_log():\n show_value(\"name\", implementation_name)\n\n\ndef create_vendor_txt_map() -> Dict[str, str]:\n with open_text_resource(\"pip._vendor\", \"vendor.txt\") as f:\n # Purge non version specifying lines.\n # Also, remove any space prefix or suffixes (including comments).\n lines = [\n line.strip().split(\" \", 1)[0] for line in f.readlines() if \"==\" in line\n ]\n\n # Transform into \"module\" -> version dict.\n return dict(line.split(\"==\", 1) for line in lines)\n\n\ndef get_module_from_module_name(module_name: str) -> Optional[ModuleType]:\n # Module name can be uppercase in vendor.txt for some reason...\n module_name = module_name.lower().replace(\"-\", \"_\")\n # PATCH: setuptools is actually only pkg_resources.\n if module_name == \"setuptools\":\n module_name = \"pkg_resources\"\n\n try:\n __import__(f\"pip._vendor.{module_name}\", globals(), locals(), level=0)\n return getattr(pip._vendor, module_name)\n except ImportError:\n # We allow 'truststore' to fail to import due\n # to being unavailable on Python 3.9 and earlier.\n if module_name == \"truststore\" and sys.version_info < (3, 10):\n return None\n raise\n\n\ndef get_vendor_version_from_module(module_name: str) -> Optional[str]:\n module = get_module_from_module_name(module_name)\n version = getattr(module, \"__version__\", None)\n\n if module and not version:\n # Try to find version in debundled module info.\n assert module.__file__ is not None\n env = get_environment([os.path.dirname(module.__file__)])\n dist = env.get_distribution(module_name)\n if dist:\n version = str(dist.version)\n\n return version\n\n\ndef show_actual_vendor_versions(vendor_txt_versions: Dict[str, str]) -> None:\n \"\"\"Log the actual version and print extra info if there is\n a conflict or if the actual version could not be imported.\n \"\"\"\n for module_name, expected_version in vendor_txt_versions.items():\n extra_message = \"\"\n actual_version = get_vendor_version_from_module(module_name)\n if not actual_version:\n extra_message = (\n \" (Unable to locate actual module version, using\"\n \" vendor.txt specified version)\"\n )\n actual_version = expected_version\n elif parse_version(actual_version) != parse_version(expected_version):\n extra_message = (\n \" (CONFLICT: vendor.txt suggests version should\"\n f\" be {expected_version})\"\n )\n logger.info(\"%s==%s%s\", module_name, actual_version, extra_message)\n\n\ndef show_vendor_versions() -> None:\n logger.info(\"vendored library versions:\")\n\n vendor_txt_versions = create_vendor_txt_map()\n with indent_log():\n show_actual_vendor_versions(vendor_txt_versions)\n\n\ndef show_tags(options: Values) -> None:\n tag_limit = 10\n\n target_python = make_target_python(options)\n tags = target_python.get_sorted_tags()\n\n # Display the target options that were explicitly provided.\n formatted_target = target_python.format_given()\n suffix = \"\"\n if formatted_target:\n suffix = f\" (target: {formatted_target})\"\n\n msg = f\"Compatible tags: {len(tags)}{suffix}\"\n logger.info(msg)\n\n if options.verbose < 1 and len(tags) > tag_limit:\n tags_limited = True\n tags = tags[:tag_limit]\n else:\n tags_limited = False\n\n with indent_log():\n for tag in tags:\n logger.info(str(tag))\n\n if tags_limited:\n msg = f\"...\\n[First {tag_limit} tags shown. Pass --verbose to show all.]\"\n logger.info(msg)\n\n\ndef ca_bundle_info(config: Configuration) -> str:\n levels = {key.split(\".\", 1)[0] for key, _ in config.items()}\n if not levels:\n return \"Not specified\"\n\n levels_that_override_global = [\"install\", \"wheel\", \"download\"]\n global_overriding_level = [\n level for level in levels if level in levels_that_override_global\n ]\n if not global_overriding_level:\n return \"global\"\n\n if \"global\" in levels:\n levels.remove(\"global\")\n return \", \".join(levels)\n\n\nclass DebugCommand(Command):\n \"\"\"\n Display debug information.\n \"\"\"\n\n usage = \"\"\"\n %prog \"\"\"\n ignore_require_venv = True\n\n def add_options(self) -> None:\n cmdoptions.add_target_python_options(self.cmd_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n self.parser.config.load()\n\n def run(self, options: Values, args: List[str]) -> int:\n logger.warning(\n \"This command is only meant for debugging. \"\n \"Do not use this with automation for parsing and getting these \"\n \"details, since the output and options of this command may \"\n \"change without notice.\"\n )\n show_value(\"pip version\", get_pip_version())\n show_value(\"sys.version\", sys.version)\n show_value(\"sys.executable\", sys.executable)\n show_value(\"sys.getdefaultencoding\", sys.getdefaultencoding())\n show_value(\"sys.getfilesystemencoding\", sys.getfilesystemencoding())\n show_value(\n \"locale.getpreferredencoding\",\n locale.getpreferredencoding(),\n )\n show_value(\"sys.platform\", sys.platform)\n show_sys_implementation()\n\n show_value(\"'cert' config value\", ca_bundle_info(self.parser.config))\n show_value(\"REQUESTS_CA_BUNDLE\", os.environ.get(\"REQUESTS_CA_BUNDLE\"))\n show_value(\"CURL_CA_BUNDLE\", os.environ.get(\"CURL_CA_BUNDLE\"))\n show_value(\"pip._vendor.certifi.where()\", where())\n show_value(\"pip._vendor.DEBUNDLED\", pip._vendor.DEBUNDLED)\n\n show_vendor_versions()\n\n show_tags(options)\n\n return SUCCESS\n",[],[100,509,516,523,475,544,676,726],{"_104":734,"_96":735,"_158":736,"_160":677,"_161":139,"_162":737,"_164":165,"_106":738,"_101":29,"_167":215,"_169":739,"_170":25,"_171":-5,"_172":740,"_99":741},"06e3683e-67fc-11f0-95df-0224a6c84d84","download.py","06e368fc-67fc-11f0-95df-0224a6c84d84",245,["D",1753299259329],"import logging\nimport os\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.cmdoptions import make_target_python\nfrom pip._internal.cli.req_command import RequirementCommand, with_cleanup\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.operations.build.build_tracker import get_build_tracker\nfrom pip._internal.req.req_install import check_legacy_setup_py_options\nfrom pip._internal.utils.misc import ensure_dir, normalize_path, write_output\nfrom pip._internal.utils.temp_dir import TempDirectory\n\nlogger = logging.getLogger(__name__)\n\n\nclass DownloadCommand(RequirementCommand):\n \"\"\"\n Download packages from:\n\n - PyPI (and other indexes) using requirement specifiers.\n - VCS project urls.\n - Local project directories.\n - Local or remote source archives.\n\n pip also supports downloading from \"requirements files\", which provide\n an easy way to specify a whole environment to be downloaded.\n \"\"\"\n\n usage = \"\"\"\n %prog [options] [package-index-options] ...\n %prog [options] -r [package-index-options] ...\n %prog [options] ...\n %prog [options] ...\n %prog [options] ...\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(cmdoptions.constraints())\n self.cmd_opts.add_option(cmdoptions.requirements())\n self.cmd_opts.add_option(cmdoptions.no_deps())\n self.cmd_opts.add_option(cmdoptions.global_options())\n self.cmd_opts.add_option(cmdoptions.no_binary())\n self.cmd_opts.add_option(cmdoptions.only_binary())\n self.cmd_opts.add_option(cmdoptions.prefer_binary())\n self.cmd_opts.add_option(cmdoptions.src())\n self.cmd_opts.add_option(cmdoptions.pre())\n self.cmd_opts.add_option(cmdoptions.require_hashes())\n self.cmd_opts.add_option(cmdoptions.progress_bar())\n self.cmd_opts.add_option(cmdoptions.no_build_isolation())\n self.cmd_opts.add_option(cmdoptions.use_pep517())\n self.cmd_opts.add_option(cmdoptions.no_use_pep517())\n self.cmd_opts.add_option(cmdoptions.check_build_deps())\n self.cmd_opts.add_option(cmdoptions.ignore_requires_python())\n\n self.cmd_opts.add_option(\n \"-d\",\n \"--dest\",\n \"--destination-dir\",\n \"--destination-directory\",\n dest=\"download_dir\",\n metavar=\"dir\",\n default=os.curdir,\n help=\"Download packages into .\",\n )\n\n cmdoptions.add_target_python_options(self.cmd_opts)\n\n index_opts = cmdoptions.make_option_group(\n cmdoptions.index_group,\n self.parser,\n )\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n @with_cleanup\n def run(self, options: Values, args: List[str]) -> int:\n options.ignore_installed = True\n # editable doesn't really make sense for `pip download`, but the bowels\n # of the RequirementSet code require that property.\n options.editables = []\n\n cmdoptions.check_dist_restriction(options)\n\n options.download_dir = normalize_path(options.download_dir)\n ensure_dir(options.download_dir)\n\n session = self.get_default_session(options)\n\n target_python = make_target_python(options)\n finder = self._build_package_finder(\n options=options,\n session=session,\n target_python=target_python,\n ignore_requires_python=options.ignore_requires_python,\n )\n\n build_tracker = self.enter_context(get_build_tracker())\n\n directory = TempDirectory(\n delete=not options.no_clean,\n kind=\"download\",\n globally_managed=True,\n )\n\n reqs = self.get_requirements(args, options, finder, session)\n check_legacy_setup_py_options(options, reqs)\n\n preparer = self.make_requirement_preparer(\n temp_build_dir=directory,\n options=options,\n build_tracker=build_tracker,\n session=session,\n finder=finder,\n download_dir=options.download_dir,\n use_user_site=False,\n verbosity=self.verbosity,\n )\n\n resolver = self.make_resolver(\n preparer=preparer,\n finder=finder,\n options=options,\n ignore_requires_python=options.ignore_requires_python,\n use_pep517=options.use_pep517,\n py_version_info=options.python_version,\n )\n\n self.trace_basic_info(finder)\n\n requirement_set = resolver.resolve(reqs, check_supported_wheels=True)\n\n downloaded: List[str] = []\n for req in requirement_set.requirements.values():\n if req.satisfied_by is None:\n assert req.name is not None\n preparer.save_linked_requirement(req)\n downloaded.append(req.name)\n\n preparer.prepare_linked_requirements_more(requirement_set.requirements.values())\n\n if downloaded:\n write_output(\"Successfully downloaded %s\", \" \".join(downloaded))\n\n return SUCCESS\n",[],[100,509,516,523,475,544,676,735],{"_104":743,"_96":744,"_158":745,"_160":677,"_161":139,"_162":746,"_164":165,"_106":747,"_101":29,"_167":215,"_169":748,"_170":25,"_171":-5,"_172":749,"_99":750},"07101564-67fc-11f0-805e-0224a6c84d84","freeze.py","07101618-67fc-11f0-805e-0224a6c84d84",253,["D",1753299259624],"import sys\nfrom optparse import Values\nfrom typing import AbstractSet, List\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.operations.freeze import freeze\nfrom pip._internal.utils.compat import stdlib_pkgs\n\n\ndef _should_suppress_build_backends() -> bool:\n return sys.version_info < (3, 12)\n\n\ndef _dev_pkgs() -> AbstractSet[str]:\n pkgs = {\"pip\"}\n\n if _should_suppress_build_backends():\n pkgs |= {\"setuptools\", \"distribute\", \"wheel\"}\n\n return pkgs\n\n\nclass FreezeCommand(Command):\n \"\"\"\n Output installed packages in requirements format.\n\n packages are listed in a case-insensitive sorted order.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog [options]\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-r\",\n \"--requirement\",\n dest=\"requirements\",\n action=\"append\",\n default=[],\n metavar=\"file\",\n help=(\n \"Use the order in the given requirements file and its \"\n \"comments when generating output. This option can be \"\n \"used multiple times.\"\n ),\n )\n self.cmd_opts.add_option(\n \"-l\",\n \"--local\",\n dest=\"local\",\n action=\"store_true\",\n default=False,\n help=(\n \"If in a virtualenv that has global access, do not output \"\n \"globally-installed packages.\"\n ),\n )\n self.cmd_opts.add_option(\n \"--user\",\n dest=\"user\",\n action=\"store_true\",\n default=False,\n help=\"Only output packages installed in user-site.\",\n )\n self.cmd_opts.add_option(cmdoptions.list_path())\n self.cmd_opts.add_option(\n \"--all\",\n dest=\"freeze_all\",\n action=\"store_true\",\n help=(\n \"Do not skip these packages in the output:\"\n \" {}\".format(\", \".join(_dev_pkgs()))\n ),\n )\n self.cmd_opts.add_option(\n \"--exclude-editable\",\n dest=\"exclude_editable\",\n action=\"store_true\",\n help=\"Exclude editable package from output.\",\n )\n self.cmd_opts.add_option(cmdoptions.list_exclude())\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n skip = set(stdlib_pkgs)\n if not options.freeze_all:\n skip.update(_dev_pkgs())\n\n if options.excludes:\n skip.update(options.excludes)\n\n cmdoptions.check_list_path_option(options)\n\n for line in freeze(\n requirement=options.requirements,\n local_only=options.local,\n user_only=options.user,\n paths=options.path,\n isolated=options.isolated_mode,\n skip=skip,\n exclude_editable=options.exclude_editable,\n ):\n sys.stdout.write(line + \"\\n\")\n return SUCCESS\n",[],[100,509,516,523,475,544,676,744],{"_104":752,"_96":753,"_158":754,"_160":677,"_161":139,"_162":755,"_164":165,"_106":756,"_101":29,"_167":215,"_169":757,"_170":25,"_171":-5,"_172":758,"_99":759},"06f49528-67fc-11f0-bcbe-0224a6c84d84","hash.py","06f495c8-67fc-11f0-bcbe-0224a6c84d84",248,["D",1753299259441],"import hashlib\nimport logging\nimport sys\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.utils.hashes import FAVORITE_HASH, STRONG_HASHES\nfrom pip._internal.utils.misc import read_chunks, write_output\n\nlogger = logging.getLogger(__name__)\n\n\nclass HashCommand(Command):\n \"\"\"\n Compute a hash of a local package archive.\n\n These can be used with --hash in a requirements file to do repeatable\n installs.\n \"\"\"\n\n usage = \"%prog [options] ...\"\n ignore_require_venv = True\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-a\",\n \"--algorithm\",\n dest=\"algorithm\",\n choices=STRONG_HASHES,\n action=\"store\",\n default=FAVORITE_HASH,\n help=\"The hash algorithm to use: one of {}\".format(\n \", \".join(STRONG_HASHES)\n ),\n )\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n if not args:\n self.parser.print_usage(sys.stderr)\n return ERROR\n\n algorithm = options.algorithm\n for path in args:\n write_output(\n \"%s:\\n--hash=%s:%s\", path, algorithm, _hash_of_file(path, algorithm)\n )\n return SUCCESS\n\n\ndef _hash_of_file(path: str, algorithm: str) -> str:\n \"\"\"Return the hash digest of a file.\"\"\"\n with open(path, \"rb\") as archive:\n hash = hashlib.new(algorithm)\n for chunk in read_chunks(archive):\n hash.update(chunk)\n return hash.hexdigest()\n",[],[100,509,516,523,475,544,676,753],{"_104":761,"_96":762,"_158":763,"_160":677,"_161":139,"_162":764,"_164":165,"_106":765,"_101":29,"_167":215,"_169":766,"_170":25,"_171":-5,"_172":767,"_99":768},"0721883a-67fc-11f0-96d6-0224a6c84d84","help.py","0721890c-67fc-11f0-96d6-0224a6c84d84",256,["D",1753299259747],"from optparse import Values\nfrom typing import List\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.exceptions import CommandError\n\n\nclass HelpCommand(Command):\n \"\"\"Show help for commands\"\"\"\n\n usage = \"\"\"\n %prog \"\"\"\n ignore_require_venv = True\n\n def run(self, options: Values, args: List[str]) -> int:\n from pip._internal.commands import (\n commands_dict,\n create_command,\n get_similar_commands,\n )\n\n try:\n # 'pip help' with no args is handled by pip.__init__.parseopt()\n cmd_name = args[0] # the command we need help for\n except IndexError:\n return SUCCESS\n\n if cmd_name not in commands_dict:\n guess = get_similar_commands(cmd_name)\n\n msg = [f'unknown command \"{cmd_name}\"']\n if guess:\n msg.append(f'maybe you meant \"{guess}\"')\n\n raise CommandError(\" - \".join(msg))\n\n command = create_command(cmd_name)\n command.parser.print_help()\n\n return SUCCESS\n",[],[100,509,516,523,475,544,676,762],{"_104":770,"_96":771,"_158":772,"_160":677,"_161":139,"_162":773,"_164":165,"_106":774,"_101":29,"_167":215,"_169":775,"_170":25,"_171":-5,"_172":776,"_99":777},"06d85b7e-67fc-11f0-9d2d-0224a6c84d84","index.py","06d85c50-67fc-11f0-9d2d-0224a6c84d84",243,["D",1753299259265],"import json\nimport logging\nfrom optparse import Values\nfrom typing import Any, Iterable, List, Optional\n\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.req_command import IndexGroupCommand\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.commands.search import (\n get_installed_distribution,\n print_dist_installation_info,\n)\nfrom pip._internal.exceptions import CommandError, DistributionNotFound, PipError\nfrom pip._internal.index.collector import LinkCollector\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.models.selection_prefs import SelectionPreferences\nfrom pip._internal.models.target_python import TargetPython\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.utils.misc import write_output\n\nlogger = logging.getLogger(__name__)\n\n\nclass IndexCommand(IndexGroupCommand):\n \"\"\"\n Inspect information available from package indexes.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog versions \n \"\"\"\n\n def add_options(self) -> None:\n cmdoptions.add_target_python_options(self.cmd_opts)\n\n self.cmd_opts.add_option(cmdoptions.ignore_requires_python())\n self.cmd_opts.add_option(cmdoptions.pre())\n self.cmd_opts.add_option(cmdoptions.json())\n self.cmd_opts.add_option(cmdoptions.no_binary())\n self.cmd_opts.add_option(cmdoptions.only_binary())\n\n index_opts = cmdoptions.make_option_group(\n cmdoptions.index_group,\n self.parser,\n )\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n handlers = {\n \"versions\": self.get_available_package_versions,\n }\n\n # Determine action\n if not args or args[0] not in handlers:\n logger.error(\n \"Need an action (%s) to perform.\",\n \", \".join(sorted(handlers)),\n )\n return ERROR\n\n action = args[0]\n\n # Error handling happens here, not in the action-handlers.\n try:\n handlers[action](options, args[1:])\n except PipError as e:\n logger.error(e.args[0])\n return ERROR\n\n return SUCCESS\n\n def _build_package_finder(\n self,\n options: Values,\n session: PipSession,\n target_python: Optional[TargetPython] = None,\n ignore_requires_python: Optional[bool] = None,\n ) -> PackageFinder:\n \"\"\"\n Create a package finder appropriate to the index command.\n \"\"\"\n link_collector = LinkCollector.create(session, options=options)\n\n # Pass allow_yanked=False to ignore yanked versions.\n selection_prefs = SelectionPreferences(\n allow_yanked=False,\n allow_all_prereleases=options.pre,\n ignore_requires_python=ignore_requires_python,\n )\n\n return PackageFinder.create(\n link_collector=link_collector,\n selection_prefs=selection_prefs,\n target_python=target_python,\n )\n\n def get_available_package_versions(self, options: Values, args: List[Any]) -> None:\n if len(args) != 1:\n raise CommandError(\"You need to specify exactly one argument\")\n\n target_python = cmdoptions.make_target_python(options)\n query = args[0]\n\n with self._build_session(options) as session:\n finder = self._build_package_finder(\n options=options,\n session=session,\n target_python=target_python,\n ignore_requires_python=options.ignore_requires_python,\n )\n\n versions: Iterable[Version] = (\n candidate.version for candidate in finder.find_all_candidates(query)\n )\n\n if not options.pre:\n # Remove prereleases\n versions = (\n version for version in versions if not version.is_prerelease\n )\n versions = set(versions)\n\n if not versions:\n raise DistributionNotFound(\n f\"No matching distribution found for {query}\"\n )\n\n formatted_versions = [str(ver) for ver in sorted(versions, reverse=True)]\n latest = formatted_versions[0]\n\n dist = get_installed_distribution(query)\n\n if options.json:\n structured_output = {\n \"name\": query,\n \"versions\": formatted_versions,\n \"latest\": latest,\n }\n\n if dist is not None:\n structured_output[\"installed_version\"] = str(dist.version)\n\n write_output(json.dumps(structured_output))\n\n else:\n write_output(f\"{query} ({latest})\")\n write_output(\"Available versions: {}\".format(\", \".join(formatted_versions)))\n print_dist_installation_info(latest, dist)\n",[],[100,509,516,523,475,544,676,771],{"_104":779,"_96":780,"_158":781,"_160":677,"_161":139,"_162":782,"_164":165,"_106":783,"_101":29,"_167":215,"_169":784,"_170":25,"_171":-5,"_172":785,"_99":786},"06f93d4e-67fc-11f0-ad3e-0224a6c84d84","inspect.py","06f93dee-67fc-11f0-ad3e-0224a6c84d84",249,["D",1753299259484],"import logging\nfrom optparse import Values\nfrom typing import Any, Dict, List\n\nfrom pip._vendor.packaging.markers import default_environment\nfrom pip._vendor.rich import print_json\n\nfrom pip import __version__\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.metadata import BaseDistribution, get_environment\nfrom pip._internal.utils.compat import stdlib_pkgs\nfrom pip._internal.utils.urls import path_to_url\n\nlogger = logging.getLogger(__name__)\n\n\nclass InspectCommand(Command):\n \"\"\"\n Inspect the content of a Python environment and produce a report in JSON format.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog [options]\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"--local\",\n action=\"store_true\",\n default=False,\n help=(\n \"If in a virtualenv that has global access, do not list \"\n \"globally-installed packages.\"\n ),\n )\n self.cmd_opts.add_option(\n \"--user\",\n dest=\"user\",\n action=\"store_true\",\n default=False,\n help=\"Only output packages installed in user-site.\",\n )\n self.cmd_opts.add_option(cmdoptions.list_path())\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n cmdoptions.check_list_path_option(options)\n dists = get_environment(options.path).iter_installed_distributions(\n local_only=options.local,\n user_only=options.user,\n skip=set(stdlib_pkgs),\n )\n output = {\n \"version\": \"1\",\n \"pip_version\": __version__,\n \"installed\": [self._dist_to_dict(dist) for dist in dists],\n \"environment\": default_environment(),\n # TODO tags? scheme?\n }\n print_json(data=output)\n return SUCCESS\n\n def _dist_to_dict(self, dist: BaseDistribution) -> Dict[str, Any]:\n res: Dict[str, Any] = {\n \"metadata\": dist.metadata_dict,\n \"metadata_location\": dist.info_location,\n }\n # direct_url. Note that we don't have download_info (as in the installation\n # report) since it is not recorded in installed metadata.\n direct_url = dist.direct_url\n if direct_url is not None:\n res[\"direct_url\"] = direct_url.to_dict()\n else:\n # Emulate direct_url for legacy editable installs.\n editable_project_location = dist.editable_project_location\n if editable_project_location is not None:\n res[\"direct_url\"] = {\n \"url\": path_to_url(editable_project_location),\n \"dir_info\": {\n \"editable\": True,\n },\n }\n # installer\n installer = dist.installer\n if dist.installer:\n res[\"installer\"] = installer\n # requested\n if dist.installed_with_dist_info:\n res[\"requested\"] = dist.requested\n return res\n",[],[100,509,516,523,475,544,676,780],{"_104":788,"_96":789,"_158":790,"_160":677,"_161":139,"_162":791,"_164":165,"_106":792,"_101":29,"_167":215,"_169":793,"_170":25,"_171":-5,"_172":794,"_99":795},"071706ee-67fc-11f0-b6cd-0224a6c84d84","install.py","07170784-67fc-11f0-b6cd-0224a6c84d84",255,["D",1753299259678],"import errno\nimport json\nimport operator\nimport os\nimport shutil\nimport site\nfrom optparse import SUPPRESS_HELP, Values\nfrom typing import List, Optional\n\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.requests.exceptions import InvalidProxyURL\nfrom pip._vendor.rich import print_json\n\n# Eagerly import self_outdated_check to avoid crashes. Otherwise,\n# this module would be imported *after* pip was replaced, resulting\n# in crashes if the new self_outdated_check module was incompatible\n# with the rest of pip that's already imported, or allowing a\n# wheel to execute arbitrary code on install by replacing\n# self_outdated_check.\nimport pip._internal.self_outdated_check # noqa: F401\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.cmdoptions import make_target_python\nfrom pip._internal.cli.req_command import (\n RequirementCommand,\n with_cleanup,\n)\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.exceptions import CommandError, InstallationError\nfrom pip._internal.locations import get_scheme\nfrom pip._internal.metadata import get_environment\nfrom pip._internal.models.installation_report import InstallationReport\nfrom pip._internal.operations.build.build_tracker import get_build_tracker\nfrom pip._internal.operations.check import ConflictDetails, check_install_conflicts\nfrom pip._internal.req import install_given_reqs\nfrom pip._internal.req.req_install import (\n InstallRequirement,\n check_legacy_setup_py_options,\n)\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.filesystem import test_writable_dir\nfrom pip._internal.utils.logging import getLogger\nfrom pip._internal.utils.misc import (\n check_externally_managed,\n ensure_dir,\n get_pip_version,\n protect_pip_from_modification_on_windows,\n warn_if_run_as_root,\n write_output,\n)\nfrom pip._internal.utils.temp_dir import TempDirectory\nfrom pip._internal.utils.virtualenv import (\n running_under_virtualenv,\n virtualenv_no_global,\n)\nfrom pip._internal.wheel_builder import build, should_build_for_install_command\n\nlogger = getLogger(__name__)\n\n\nclass InstallCommand(RequirementCommand):\n \"\"\"\n Install packages from:\n\n - PyPI (and other indexes) using requirement specifiers.\n - VCS project urls.\n - Local project directories.\n - Local or remote source archives.\n\n pip also supports installing from \"requirements files\", which provide\n an easy way to specify a whole environment to be installed.\n \"\"\"\n\n usage = \"\"\"\n %prog [options] [package-index-options] ...\n %prog [options] -r [package-index-options] ...\n %prog [options] [-e] ...\n %prog [options] [-e] ...\n %prog [options] ...\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(cmdoptions.requirements())\n self.cmd_opts.add_option(cmdoptions.constraints())\n self.cmd_opts.add_option(cmdoptions.no_deps())\n self.cmd_opts.add_option(cmdoptions.pre())\n\n self.cmd_opts.add_option(cmdoptions.editable())\n self.cmd_opts.add_option(\n \"--dry-run\",\n action=\"store_true\",\n dest=\"dry_run\",\n default=False,\n help=(\n \"Don't actually install anything, just print what would be. \"\n \"Can be used in combination with --ignore-installed \"\n \"to 'resolve' the requirements.\"\n ),\n )\n self.cmd_opts.add_option(\n \"-t\",\n \"--target\",\n dest=\"target_dir\",\n metavar=\"dir\",\n default=None,\n help=(\n \"Install packages into . \"\n \"By default this will not replace existing files/folders in \"\n \". Use --upgrade to replace existing packages in \"\n \"with new versions.\"\n ),\n )\n cmdoptions.add_target_python_options(self.cmd_opts)\n\n self.cmd_opts.add_option(\n \"--user\",\n dest=\"use_user_site\",\n action=\"store_true\",\n help=(\n \"Install to the Python user install directory for your \"\n \"platform. Typically ~/.local/, or %APPDATA%\\\\Python on \"\n \"Windows. (See the Python documentation for site.USER_BASE \"\n \"for full details.)\"\n ),\n )\n self.cmd_opts.add_option(\n \"--no-user\",\n dest=\"use_user_site\",\n action=\"store_false\",\n help=SUPPRESS_HELP,\n )\n self.cmd_opts.add_option(\n \"--root\",\n dest=\"root_path\",\n metavar=\"dir\",\n default=None,\n help=\"Install everything relative to this alternate root directory.\",\n )\n self.cmd_opts.add_option(\n \"--prefix\",\n dest=\"prefix_path\",\n metavar=\"dir\",\n default=None,\n help=(\n \"Installation prefix where lib, bin and other top-level \"\n \"folders are placed. Note that the resulting installation may \"\n \"contain scripts and other resources which reference the \"\n \"Python interpreter of pip, and not that of ``--prefix``. \"\n \"See also the ``--python`` option if the intention is to \"\n \"install packages into another (possibly pip-free) \"\n \"environment.\"\n ),\n )\n\n self.cmd_opts.add_option(cmdoptions.src())\n\n self.cmd_opts.add_option(\n \"-U\",\n \"--upgrade\",\n dest=\"upgrade\",\n action=\"store_true\",\n help=(\n \"Upgrade all specified packages to the newest available \"\n \"version. The handling of dependencies depends on the \"\n \"upgrade-strategy used.\"\n ),\n )\n\n self.cmd_opts.add_option(\n \"--upgrade-strategy\",\n dest=\"upgrade_strategy\",\n default=\"only-if-needed\",\n choices=[\"only-if-needed\", \"eager\"],\n help=(\n \"Determines how dependency upgrading should be handled \"\n \"[default: %default]. \"\n '\"eager\" - dependencies are upgraded regardless of '\n \"whether the currently installed version satisfies the \"\n \"requirements of the upgraded package(s). \"\n '\"only-if-needed\" - are upgraded only when they do not '\n \"satisfy the requirements of the upgraded package(s).\"\n ),\n )\n\n self.cmd_opts.add_option(\n \"--force-reinstall\",\n dest=\"force_reinstall\",\n action=\"store_true\",\n help=\"Reinstall all packages even if they are already up-to-date.\",\n )\n\n self.cmd_opts.add_option(\n \"-I\",\n \"--ignore-installed\",\n dest=\"ignore_installed\",\n action=\"store_true\",\n help=(\n \"Ignore the installed packages, overwriting them. \"\n \"This can break your system if the existing package \"\n \"is of a different version or was installed \"\n \"with a different package manager!\"\n ),\n )\n\n self.cmd_opts.add_option(cmdoptions.ignore_requires_python())\n self.cmd_opts.add_option(cmdoptions.no_build_isolation())\n self.cmd_opts.add_option(cmdoptions.use_pep517())\n self.cmd_opts.add_option(cmdoptions.no_use_pep517())\n self.cmd_opts.add_option(cmdoptions.check_build_deps())\n self.cmd_opts.add_option(cmdoptions.override_externally_managed())\n\n self.cmd_opts.add_option(cmdoptions.config_settings())\n self.cmd_opts.add_option(cmdoptions.global_options())\n\n self.cmd_opts.add_option(\n \"--compile\",\n action=\"store_true\",\n dest=\"compile\",\n default=True,\n help=\"Compile Python source files to bytecode\",\n )\n\n self.cmd_opts.add_option(\n \"--no-compile\",\n action=\"store_false\",\n dest=\"compile\",\n help=\"Do not compile Python source files to bytecode\",\n )\n\n self.cmd_opts.add_option(\n \"--no-warn-script-location\",\n action=\"store_false\",\n dest=\"warn_script_location\",\n default=True,\n help=\"Do not warn when installing scripts outside PATH\",\n )\n self.cmd_opts.add_option(\n \"--no-warn-conflicts\",\n action=\"store_false\",\n dest=\"warn_about_conflicts\",\n default=True,\n help=\"Do not warn about broken dependencies\",\n )\n self.cmd_opts.add_option(cmdoptions.no_binary())\n self.cmd_opts.add_option(cmdoptions.only_binary())\n self.cmd_opts.add_option(cmdoptions.prefer_binary())\n self.cmd_opts.add_option(cmdoptions.require_hashes())\n self.cmd_opts.add_option(cmdoptions.progress_bar())\n self.cmd_opts.add_option(cmdoptions.root_user_action())\n\n index_opts = cmdoptions.make_option_group(\n cmdoptions.index_group,\n self.parser,\n )\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n self.cmd_opts.add_option(\n \"--report\",\n dest=\"json_report_file\",\n metavar=\"file\",\n default=None,\n help=(\n \"Generate a JSON file describing what pip did to install \"\n \"the provided requirements. \"\n \"Can be used in combination with --dry-run and --ignore-installed \"\n \"to 'resolve' the requirements. \"\n \"When - is used as file name it writes to stdout. \"\n \"When writing to stdout, please combine with the --quiet option \"\n \"to avoid mixing pip logging output with JSON output.\"\n ),\n )\n\n @with_cleanup\n def run(self, options: Values, args: List[str]) -> int:\n if options.use_user_site and options.target_dir is not None:\n raise CommandError(\"Can not combine '--user' and '--target'\")\n\n # Check whether the environment we're installing into is externally\n # managed, as specified in PEP 668. Specifying --root, --target, or\n # --prefix disables the check, since there's no reliable way to locate\n # the EXTERNALLY-MANAGED file for those cases. An exception is also\n # made specifically for \"--dry-run --report\" for convenience.\n installing_into_current_environment = (\n not (options.dry_run and options.json_report_file)\n and options.root_path is None\n and options.target_dir is None\n and options.prefix_path is None\n )\n if (\n installing_into_current_environment\n and not options.override_externally_managed\n ):\n check_externally_managed()\n\n upgrade_strategy = \"to-satisfy-only\"\n if options.upgrade:\n upgrade_strategy = options.upgrade_strategy\n\n cmdoptions.check_dist_restriction(options, check_target=True)\n\n logger.verbose(\"Using %s\", get_pip_version())\n options.use_user_site = decide_user_install(\n options.use_user_site,\n prefix_path=options.prefix_path,\n target_dir=options.target_dir,\n root_path=options.root_path,\n isolated_mode=options.isolated_mode,\n )\n\n target_temp_dir: Optional[TempDirectory] = None\n target_temp_dir_path: Optional[str] = None\n if options.target_dir:\n options.ignore_installed = True\n options.target_dir = os.path.abspath(options.target_dir)\n if (\n # fmt: off\n os.path.exists(options.target_dir) and\n not os.path.isdir(options.target_dir)\n # fmt: on\n ):\n raise CommandError(\n \"Target path exists but is not a directory, will not continue.\"\n )\n\n # Create a target directory for using with the target option\n target_temp_dir = TempDirectory(kind=\"target\")\n target_temp_dir_path = target_temp_dir.path\n self.enter_context(target_temp_dir)\n\n global_options = options.global_options or []\n\n session = self.get_default_session(options)\n\n target_python = make_target_python(options)\n finder = self._build_package_finder(\n options=options,\n session=session,\n target_python=target_python,\n ignore_requires_python=options.ignore_requires_python,\n )\n build_tracker = self.enter_context(get_build_tracker())\n\n directory = TempDirectory(\n delete=not options.no_clean,\n kind=\"install\",\n globally_managed=True,\n )\n\n try:\n reqs = self.get_requirements(args, options, finder, session)\n check_legacy_setup_py_options(options, reqs)\n\n wheel_cache = WheelCache(options.cache_dir)\n\n # Only when installing is it permitted to use PEP 660.\n # In other circumstances (pip wheel, pip download) we generate\n # regular (i.e. non editable) metadata and wheels.\n for req in reqs:\n req.permit_editable_wheels = True\n\n preparer = self.make_requirement_preparer(\n temp_build_dir=directory,\n options=options,\n build_tracker=build_tracker,\n session=session,\n finder=finder,\n use_user_site=options.use_user_site,\n verbosity=self.verbosity,\n )\n resolver = self.make_resolver(\n preparer=preparer,\n finder=finder,\n options=options,\n wheel_cache=wheel_cache,\n use_user_site=options.use_user_site,\n ignore_installed=options.ignore_installed,\n ignore_requires_python=options.ignore_requires_python,\n force_reinstall=options.force_reinstall,\n upgrade_strategy=upgrade_strategy,\n use_pep517=options.use_pep517,\n py_version_info=options.python_version,\n )\n\n self.trace_basic_info(finder)\n\n requirement_set = resolver.resolve(\n reqs, check_supported_wheels=not options.target_dir\n )\n\n if options.json_report_file:\n report = InstallationReport(requirement_set.requirements_to_install)\n if options.json_report_file == \"-\":\n print_json(data=report.to_dict())\n else:\n with open(options.json_report_file, \"w\", encoding=\"utf-8\") as f:\n json.dump(report.to_dict(), f, indent=2, ensure_ascii=False)\n\n if options.dry_run:\n would_install_items = sorted(\n (r.metadata[\"name\"], r.metadata[\"version\"])\n for r in requirement_set.requirements_to_install\n )\n if would_install_items:\n write_output(\n \"Would install %s\",\n \" \".join(\"-\".join(item) for item in would_install_items),\n )\n return SUCCESS\n\n try:\n pip_req = requirement_set.get_requirement(\"pip\")\n except KeyError:\n modifying_pip = False\n else:\n # If we're not replacing an already installed pip,\n # we're not modifying it.\n modifying_pip = pip_req.satisfied_by is None\n protect_pip_from_modification_on_windows(modifying_pip=modifying_pip)\n\n reqs_to_build = [\n r\n for r in requirement_set.requirements_to_install\n if should_build_for_install_command(r)\n ]\n\n _, build_failures = build(\n reqs_to_build,\n wheel_cache=wheel_cache,\n verify=True,\n build_options=[],\n global_options=global_options,\n )\n\n if build_failures:\n raise InstallationError(\n \"Failed to build installable wheels for some \"\n \"pyproject.toml based projects ({})\".format(\n \", \".join(r.name for r in build_failures) # type: ignore\n )\n )\n\n to_install = resolver.get_installation_order(requirement_set)\n\n # Check for conflicts in the package set we're installing.\n conflicts: Optional[ConflictDetails] = None\n should_warn_about_conflicts = (\n not options.ignore_dependencies and options.warn_about_conflicts\n )\n if should_warn_about_conflicts:\n conflicts = self._determine_conflicts(to_install)\n\n # Don't warn about script install locations if\n # --target or --prefix has been specified\n warn_script_location = options.warn_script_location\n if options.target_dir or options.prefix_path:\n warn_script_location = False\n\n installed = install_given_reqs(\n to_install,\n global_options,\n root=options.root_path,\n home=target_temp_dir_path,\n prefix=options.prefix_path,\n warn_script_location=warn_script_location,\n use_user_site=options.use_user_site,\n pycompile=options.compile,\n progress_bar=options.progress_bar,\n )\n\n lib_locations = get_lib_location_guesses(\n user=options.use_user_site,\n home=target_temp_dir_path,\n root=options.root_path,\n prefix=options.prefix_path,\n isolated=options.isolated_mode,\n )\n env = get_environment(lib_locations)\n\n # Display a summary of installed packages, with extra care to\n # display a package name as it was requested by the user.\n installed.sort(key=operator.attrgetter(\"name\"))\n summary = []\n installed_versions = {}\n for distribution in env.iter_all_distributions():\n installed_versions[distribution.canonical_name] = distribution.version\n for package in installed:\n display_name = package.name\n version = installed_versions.get(canonicalize_name(display_name), None)\n if version:\n text = f\"{display_name}-{version}\"\n else:\n text = display_name\n summary.append(text)\n\n if conflicts is not None:\n self._warn_about_conflicts(\n conflicts,\n resolver_variant=self.determine_resolver_variant(options),\n )\n\n installed_desc = \" \".join(summary)\n if installed_desc:\n write_output(\n \"Successfully installed %s\",\n installed_desc,\n )\n except OSError as error:\n show_traceback = self.verbosity >= 1\n\n message = create_os_error_message(\n error,\n show_traceback,\n options.use_user_site,\n )\n logger.error(message, exc_info=show_traceback)\n\n return ERROR\n\n if options.target_dir:\n assert target_temp_dir\n self._handle_target_dir(\n options.target_dir, target_temp_dir, options.upgrade\n )\n if options.root_user_action == \"warn\":\n warn_if_run_as_root()\n return SUCCESS\n\n def _handle_target_dir(\n self, target_dir: str, target_temp_dir: TempDirectory, upgrade: bool\n ) -> None:\n ensure_dir(target_dir)\n\n # Checking both purelib and platlib directories for installed\n # packages to be moved to target directory\n lib_dir_list = []\n\n # Checking both purelib and platlib directories for installed\n # packages to be moved to target directory\n scheme = get_scheme(\"\", home=target_temp_dir.path)\n purelib_dir = scheme.purelib\n platlib_dir = scheme.platlib\n data_dir = scheme.data\n\n if os.path.exists(purelib_dir):\n lib_dir_list.append(purelib_dir)\n if os.path.exists(platlib_dir) and platlib_dir != purelib_dir:\n lib_dir_list.append(platlib_dir)\n if os.path.exists(data_dir):\n lib_dir_list.append(data_dir)\n\n for lib_dir in lib_dir_list:\n for item in os.listdir(lib_dir):\n if lib_dir == data_dir:\n ddir = os.path.join(data_dir, item)\n if any(s.startswith(ddir) for s in lib_dir_list[:-1]):\n continue\n target_item_dir = os.path.join(target_dir, item)\n if os.path.exists(target_item_dir):\n if not upgrade:\n logger.warning(\n \"Target directory %s already exists. Specify \"\n \"--upgrade to force replacement.\",\n target_item_dir,\n )\n continue\n if os.path.islink(target_item_dir):\n logger.warning(\n \"Target directory %s already exists and is \"\n \"a link. pip will not automatically replace \"\n \"links, please remove if replacement is \"\n \"desired.\",\n target_item_dir,\n )\n continue\n if os.path.isdir(target_item_dir):\n shutil.rmtree(target_item_dir)\n else:\n os.remove(target_item_dir)\n\n shutil.move(os.path.join(lib_dir, item), target_item_dir)\n\n def _determine_conflicts(\n self, to_install: List[InstallRequirement]\n ) -> Optional[ConflictDetails]:\n try:\n return check_install_conflicts(to_install)\n except Exception:\n logger.exception(\n \"Error while checking for conflicts. Please file an issue on \"\n \"pip's issue tracker: https://github.com/pypa/pip/issues/new\"\n )\n return None\n\n def _warn_about_conflicts(\n self, conflict_details: ConflictDetails, resolver_variant: str\n ) -> None:\n package_set, (missing, conflicting) = conflict_details\n if not missing and not conflicting:\n return\n\n parts: List[str] = []\n if resolver_variant == \"legacy\":\n parts.append(\n \"pip's legacy dependency resolver does not consider dependency \"\n \"conflicts when selecting packages. This behaviour is the \"\n \"source of the following dependency conflicts.\"\n )\n else:\n assert resolver_variant == \"resolvelib\"\n parts.append(\n \"pip's dependency resolver does not currently take into account \"\n \"all the packages that are installed. This behaviour is the \"\n \"source of the following dependency conflicts.\"\n )\n\n # NOTE: There is some duplication here, with commands/check.py\n for project_name in missing:\n version = package_set[project_name][0]\n for dependency in missing[project_name]:\n message = (\n f\"{project_name} {version} requires {dependency[1]}, \"\n \"which is not installed.\"\n )\n parts.append(message)\n\n for project_name in conflicting:\n version = package_set[project_name][0]\n for dep_name, dep_version, req in conflicting[project_name]:\n message = (\n \"{name} {version} requires {requirement}, but {you} have \"\n \"{dep_name} {dep_version} which is incompatible.\"\n ).format(\n name=project_name,\n version=version,\n requirement=req,\n dep_name=dep_name,\n dep_version=dep_version,\n you=(\"you\" if resolver_variant == \"resolvelib\" else \"you'll\"),\n )\n parts.append(message)\n\n logger.critical(\"\\n\".join(parts))\n\n\ndef get_lib_location_guesses(\n user: bool = False,\n home: Optional[str] = None,\n root: Optional[str] = None,\n isolated: bool = False,\n prefix: Optional[str] = None,\n) -> List[str]:\n scheme = get_scheme(\n \"\",\n user=user,\n home=home,\n root=root,\n isolated=isolated,\n prefix=prefix,\n )\n return [scheme.purelib, scheme.platlib]\n\n\ndef site_packages_writable(root: Optional[str], isolated: bool) -> bool:\n return all(\n test_writable_dir(d)\n for d in set(get_lib_location_guesses(root=root, isolated=isolated))\n )\n\n\ndef decide_user_install(\n use_user_site: Optional[bool],\n prefix_path: Optional[str] = None,\n target_dir: Optional[str] = None,\n root_path: Optional[str] = None,\n isolated_mode: bool = False,\n) -> bool:\n \"\"\"Determine whether to do a user install based on the input options.\n\n If use_user_site is False, no additional checks are done.\n If use_user_site is True, it is checked for compatibility with other\n options.\n If use_user_site is None, the default behaviour depends on the environment,\n which is provided by the other arguments.\n \"\"\"\n # In some cases (config from tox), use_user_site can be set to an integer\n # rather than a bool, which 'use_user_site is False' wouldn't catch.\n if (use_user_site is not None) and (not use_user_site):\n logger.debug(\"Non-user install by explicit request\")\n return False\n\n if use_user_site:\n if prefix_path:\n raise CommandError(\n \"Can not combine '--user' and '--prefix' as they imply \"\n \"different installation locations\"\n )\n if virtualenv_no_global():\n raise InstallationError(\n \"Can not perform a '--user' install. User site-packages \"\n \"are not visible in this virtualenv.\"\n )\n logger.debug(\"User install by explicit request\")\n return True\n\n # If we are here, user installs have not been explicitly requested/avoided\n assert use_user_site is None\n\n # user install incompatible with --prefix/--target\n if prefix_path or target_dir:\n logger.debug(\"Non-user install due to --prefix or --target option\")\n return False\n\n # If user installs are not enabled, choose a non-user install\n if not site.ENABLE_USER_SITE:\n logger.debug(\"Non-user install because user site-packages disabled\")\n return False\n\n # If we have permission for a non-user install, do that,\n # otherwise do a user install.\n if site_packages_writable(root=root_path, isolated=isolated_mode):\n logger.debug(\"Non-user install because site-packages writeable\")\n return False\n\n logger.info(\n \"Defaulting to user installation because normal site-packages \"\n \"is not writeable\"\n )\n return True\n\n\ndef create_os_error_message(\n error: OSError, show_traceback: bool, using_user_site: bool\n) -> str:\n \"\"\"Format an error message for an OSError\n\n It may occur anytime during the execution of the install command.\n \"\"\"\n parts = []\n\n # Mention the error if we are not going to show a traceback\n parts.append(\"Could not install packages due to an OSError\")\n if not show_traceback:\n parts.append(\": \")\n parts.append(str(error))\n else:\n parts.append(\".\")\n\n # Spilt the error indication from a helper message (if any)\n parts[-1] += \"\\n\"\n\n # Suggest useful actions to the user:\n # (1) using user site-packages or (2) verifying the permissions\n if error.errno == errno.EACCES:\n user_option_part = \"Consider using the `--user` option\"\n permissions_part = \"Check the permissions\"\n\n if not running_under_virtualenv() and not using_user_site:\n parts.extend(\n [\n user_option_part,\n \" or \",\n permissions_part.lower(),\n ]\n )\n else:\n parts.append(permissions_part)\n parts.append(\".\\n\")\n\n # Suggest to check \"pip config debug\" in case of invalid proxy\n if type(error) is InvalidProxyURL:\n parts.append(\n 'Consider checking your local proxy configuration with \"pip config debug\"'\n )\n parts.append(\".\\n\")\n\n # Suggest the user to enable Long Paths if path length is\n # more than 260\n if (\n WINDOWS\n and error.errno == errno.ENOENT\n and error.filename\n and len(error.filename) > 260\n ):\n parts.append(\n \"HINT: This error might have occurred since \"\n \"this system does not have Windows Long Path \"\n \"support enabled. You can find information on \"\n \"how to enable this at \"\n \"https://pip.pypa.io/warnings/enable-long-paths\\n\"\n )\n\n return \"\".join(parts).strip() + \"\\n\"\n",[],[100,509,516,523,475,544,676,789],{"_104":797,"_96":798,"_158":799,"_160":677,"_161":139,"_162":800,"_164":165,"_106":801,"_101":29,"_167":215,"_169":802,"_170":25,"_171":-5,"_172":803,"_99":804},"06d3aa16-67fc-11f0-ad3e-0224a6c84d84","list.py","06d3aac0-67fc-11f0-ad3e-0224a6c84d84",242,["D",1753299259204],"import json\nimport logging\nfrom email.parser import Parser\nfrom optparse import Values\nfrom typing import TYPE_CHECKING, Generator, List, Optional, Sequence, Tuple, cast\n\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.index_command import IndexGroupCommand\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.exceptions import CommandError\nfrom pip._internal.metadata import BaseDistribution, get_environment\nfrom pip._internal.models.selection_prefs import SelectionPreferences\nfrom pip._internal.utils.compat import stdlib_pkgs\nfrom pip._internal.utils.misc import tabulate, write_output\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n from pip._internal.network.session import PipSession\n\n class _DistWithLatestInfo(BaseDistribution):\n \"\"\"Give the distribution object a couple of extra fields.\n\n These will be populated during ``get_outdated()``. This is dirty but\n makes the rest of the code much cleaner.\n \"\"\"\n\n latest_version: Version\n latest_filetype: str\n\n _ProcessedDists = Sequence[_DistWithLatestInfo]\n\n\nlogger = logging.getLogger(__name__)\n\n\nclass ListCommand(IndexGroupCommand):\n \"\"\"\n List installed packages, including editables.\n\n Packages are listed in a case-insensitive sorted order.\n \"\"\"\n\n ignore_require_venv = True\n usage = \"\"\"\n %prog [options]\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-o\",\n \"--outdated\",\n action=\"store_true\",\n default=False,\n help=\"List outdated packages\",\n )\n self.cmd_opts.add_option(\n \"-u\",\n \"--uptodate\",\n action=\"store_true\",\n default=False,\n help=\"List uptodate packages\",\n )\n self.cmd_opts.add_option(\n \"-e\",\n \"--editable\",\n action=\"store_true\",\n default=False,\n help=\"List editable projects.\",\n )\n self.cmd_opts.add_option(\n \"-l\",\n \"--local\",\n action=\"store_true\",\n default=False,\n help=(\n \"If in a virtualenv that has global access, do not list \"\n \"globally-installed packages.\"\n ),\n )\n self.cmd_opts.add_option(\n \"--user\",\n dest=\"user\",\n action=\"store_true\",\n default=False,\n help=\"Only output packages installed in user-site.\",\n )\n self.cmd_opts.add_option(cmdoptions.list_path())\n self.cmd_opts.add_option(\n \"--pre\",\n action=\"store_true\",\n default=False,\n help=(\n \"Include pre-release and development versions. By default, \"\n \"pip only finds stable versions.\"\n ),\n )\n\n self.cmd_opts.add_option(\n \"--format\",\n action=\"store\",\n dest=\"list_format\",\n default=\"columns\",\n choices=(\"columns\", \"freeze\", \"json\"),\n help=(\n \"Select the output format among: columns (default), freeze, or json. \"\n \"The 'freeze' format cannot be used with the --outdated option.\"\n ),\n )\n\n self.cmd_opts.add_option(\n \"--not-required\",\n action=\"store_true\",\n dest=\"not_required\",\n help=\"List packages that are not dependencies of installed packages.\",\n )\n\n self.cmd_opts.add_option(\n \"--exclude-editable\",\n action=\"store_false\",\n dest=\"include_editable\",\n help=\"Exclude editable package from output.\",\n )\n self.cmd_opts.add_option(\n \"--include-editable\",\n action=\"store_true\",\n dest=\"include_editable\",\n help=\"Include editable package in output.\",\n default=True,\n )\n self.cmd_opts.add_option(cmdoptions.list_exclude())\n index_opts = cmdoptions.make_option_group(cmdoptions.index_group, self.parser)\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def handle_pip_version_check(self, options: Values) -> None:\n if options.outdated or options.uptodate:\n super().handle_pip_version_check(options)\n\n def _build_package_finder(\n self, options: Values, session: \"PipSession\"\n ) -> \"PackageFinder\":\n \"\"\"\n Create a package finder appropriate to this list command.\n \"\"\"\n # Lazy import the heavy index modules as most list invocations won't need 'em.\n from pip._internal.index.collector import LinkCollector\n from pip._internal.index.package_finder import PackageFinder\n\n link_collector = LinkCollector.create(session, options=options)\n\n # Pass allow_yanked=False to ignore yanked versions.\n selection_prefs = SelectionPreferences(\n allow_yanked=False,\n allow_all_prereleases=options.pre,\n )\n\n return PackageFinder.create(\n link_collector=link_collector,\n selection_prefs=selection_prefs,\n )\n\n def run(self, options: Values, args: List[str]) -> int:\n if options.outdated and options.uptodate:\n raise CommandError(\"Options --outdated and --uptodate cannot be combined.\")\n\n if options.outdated and options.list_format == \"freeze\":\n raise CommandError(\n \"List format 'freeze' cannot be used with the --outdated option.\"\n )\n\n cmdoptions.check_list_path_option(options)\n\n skip = set(stdlib_pkgs)\n if options.excludes:\n skip.update(canonicalize_name(n) for n in options.excludes)\n\n packages: _ProcessedDists = [\n cast(\"_DistWithLatestInfo\", d)\n for d in get_environment(options.path).iter_installed_distributions(\n local_only=options.local,\n user_only=options.user,\n editables_only=options.editable,\n include_editables=options.include_editable,\n skip=skip,\n )\n ]\n\n # get_not_required must be called firstly in order to find and\n # filter out all dependencies correctly. Otherwise a package\n # can't be identified as requirement because some parent packages\n # could be filtered out before.\n if options.not_required:\n packages = self.get_not_required(packages, options)\n\n if options.outdated:\n packages = self.get_outdated(packages, options)\n elif options.uptodate:\n packages = self.get_uptodate(packages, options)\n\n self.output_package_listing(packages, options)\n return SUCCESS\n\n def get_outdated(\n self, packages: \"_ProcessedDists\", options: Values\n ) -> \"_ProcessedDists\":\n return [\n dist\n for dist in self.iter_packages_latest_infos(packages, options)\n if dist.latest_version > dist.version\n ]\n\n def get_uptodate(\n self, packages: \"_ProcessedDists\", options: Values\n ) -> \"_ProcessedDists\":\n return [\n dist\n for dist in self.iter_packages_latest_infos(packages, options)\n if dist.latest_version == dist.version\n ]\n\n def get_not_required(\n self, packages: \"_ProcessedDists\", options: Values\n ) -> \"_ProcessedDists\":\n dep_keys = {\n canonicalize_name(dep.name)\n for dist in packages\n for dep in (dist.iter_dependencies() or ())\n }\n\n # Create a set to remove duplicate packages, and cast it to a list\n # to keep the return type consistent with get_outdated and\n # get_uptodate\n return list({pkg for pkg in packages if pkg.canonical_name not in dep_keys})\n\n def iter_packages_latest_infos(\n self, packages: \"_ProcessedDists\", options: Values\n ) -> Generator[\"_DistWithLatestInfo\", None, None]:\n with self._build_session(options) as session:\n finder = self._build_package_finder(options, session)\n\n def latest_info(\n dist: \"_DistWithLatestInfo\",\n ) -> Optional[\"_DistWithLatestInfo\"]:\n all_candidates = finder.find_all_candidates(dist.canonical_name)\n if not options.pre:\n # Remove prereleases\n all_candidates = [\n candidate\n for candidate in all_candidates\n if not candidate.version.is_prerelease\n ]\n\n evaluator = finder.make_candidate_evaluator(\n project_name=dist.canonical_name,\n )\n best_candidate = evaluator.sort_best_candidate(all_candidates)\n if best_candidate is None:\n return None\n\n remote_version = best_candidate.version\n if best_candidate.link.is_wheel:\n typ = \"wheel\"\n else:\n typ = \"sdist\"\n dist.latest_version = remote_version\n dist.latest_filetype = typ\n return dist\n\n for dist in map(latest_info, packages):\n if dist is not None:\n yield dist\n\n def output_package_listing(\n self, packages: \"_ProcessedDists\", options: Values\n ) -> None:\n packages = sorted(\n packages,\n key=lambda dist: dist.canonical_name,\n )\n if options.list_format == \"columns\" and packages:\n data, header = format_for_columns(packages, options)\n self.output_package_listing_columns(data, header)\n elif options.list_format == \"freeze\":\n for dist in packages:\n if options.verbose >= 1:\n write_output(\n \"%s==%s (%s)\", dist.raw_name, dist.version, dist.location\n )\n else:\n write_output(\"%s==%s\", dist.raw_name, dist.version)\n elif options.list_format == \"json\":\n write_output(format_for_json(packages, options))\n\n def output_package_listing_columns(\n self, data: List[List[str]], header: List[str]\n ) -> None:\n # insert the header first: we need to know the size of column names\n if len(data) > 0:\n data.insert(0, header)\n\n pkg_strings, sizes = tabulate(data)\n\n # Create and add a separator.\n if len(data) > 0:\n pkg_strings.insert(1, \" \".join(\"-\" * x for x in sizes))\n\n for val in pkg_strings:\n write_output(val)\n\n\ndef format_for_columns(\n pkgs: \"_ProcessedDists\", options: Values\n) -> Tuple[List[List[str]], List[str]]:\n \"\"\"\n Convert the package data into something usable\n by output_package_listing_columns.\n \"\"\"\n header = [\"Package\", \"Version\"]\n\n running_outdated = options.outdated\n if running_outdated:\n header.extend([\"Latest\", \"Type\"])\n\n def wheel_build_tag(dist: BaseDistribution) -> Optional[str]:\n try:\n wheel_file = dist.read_text(\"WHEEL\")\n except FileNotFoundError:\n return None\n return Parser().parsestr(wheel_file).get(\"Build\")\n\n build_tags = [wheel_build_tag(p) for p in pkgs]\n has_build_tags = any(build_tags)\n if has_build_tags:\n header.append(\"Build\")\n\n if options.verbose >= 1:\n header.append(\"Location\")\n if options.verbose >= 1:\n header.append(\"Installer\")\n\n has_editables = any(x.editable for x in pkgs)\n if has_editables:\n header.append(\"Editable project location\")\n\n data = []\n for i, proj in enumerate(pkgs):\n # if we're working on the 'outdated' list, separate out the\n # latest_version and type\n row = [proj.raw_name, proj.raw_version]\n\n if running_outdated:\n row.append(str(proj.latest_version))\n row.append(proj.latest_filetype)\n\n if has_build_tags:\n row.append(build_tags[i] or \"\")\n\n if has_editables:\n row.append(proj.editable_project_location or \"\")\n\n if options.verbose >= 1:\n row.append(proj.location or \"\")\n if options.verbose >= 1:\n row.append(proj.installer)\n\n data.append(row)\n\n return data, header\n\n\ndef format_for_json(packages: \"_ProcessedDists\", options: Values) -> str:\n data = []\n for dist in packages:\n info = {\n \"name\": dist.raw_name,\n \"version\": str(dist.version),\n }\n if options.verbose >= 1:\n info[\"location\"] = dist.location or \"\"\n info[\"installer\"] = dist.installer\n if options.outdated:\n info[\"latest_version\"] = str(dist.latest_version)\n info[\"latest_filetype\"] = dist.latest_filetype\n editable_project_location = dist.editable_project_location\n if editable_project_location:\n info[\"editable_project_location\"] = editable_project_location\n data.append(info)\n return json.dumps(data)\n",[],[100,509,516,523,475,544,676,798],{"_104":806,"_96":807,"_158":808,"_160":677,"_161":139,"_162":809,"_164":165,"_106":810,"_101":29,"_167":215,"_169":811,"_170":25,"_171":-5,"_172":812,"_99":813},"0709f8a0-67fc-11f0-8863-0224a6c84d84","lock.py","0709f94a-67fc-11f0-8863-0224a6c84d84",252,["D",1753299259593],"import sys\nfrom optparse import Values\nfrom pathlib import Path\nfrom typing import List\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.req_command import (\n RequirementCommand,\n with_cleanup,\n)\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.models.pylock import Pylock, is_valid_pylock_file_name\nfrom pip._internal.operations.build.build_tracker import get_build_tracker\nfrom pip._internal.req.req_install import (\n check_legacy_setup_py_options,\n)\nfrom pip._internal.utils.logging import getLogger\nfrom pip._internal.utils.misc import (\n get_pip_version,\n)\nfrom pip._internal.utils.temp_dir import TempDirectory\n\nlogger = getLogger(__name__)\n\n\nclass LockCommand(RequirementCommand):\n \"\"\"\n EXPERIMENTAL - Lock packages and their dependencies from:\n\n - PyPI (and other indexes) using requirement specifiers.\n - VCS project urls.\n - Local project directories.\n - Local or remote source archives.\n\n pip also supports locking from \"requirements files\", which provide an easy\n way to specify a whole environment to be installed.\n\n The generated lock file is only guaranteed to be valid for the current\n python version and platform.\n \"\"\"\n\n usage = \"\"\"\n %prog [options] [-e] ...\n %prog [options] [package-index-options] ...\n %prog [options] -r [package-index-options] ...\n %prog [options] ...\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n cmdoptions.PipOption(\n \"--output\",\n \"-o\",\n dest=\"output_file\",\n metavar=\"path\",\n type=\"path\",\n default=\"pylock.toml\",\n help=\"Lock file name (default=pylock.toml). Use - for stdout.\",\n )\n )\n self.cmd_opts.add_option(cmdoptions.requirements())\n self.cmd_opts.add_option(cmdoptions.constraints())\n self.cmd_opts.add_option(cmdoptions.no_deps())\n self.cmd_opts.add_option(cmdoptions.pre())\n\n self.cmd_opts.add_option(cmdoptions.editable())\n\n self.cmd_opts.add_option(cmdoptions.src())\n\n self.cmd_opts.add_option(cmdoptions.ignore_requires_python())\n self.cmd_opts.add_option(cmdoptions.no_build_isolation())\n self.cmd_opts.add_option(cmdoptions.use_pep517())\n self.cmd_opts.add_option(cmdoptions.no_use_pep517())\n self.cmd_opts.add_option(cmdoptions.check_build_deps())\n\n self.cmd_opts.add_option(cmdoptions.config_settings())\n\n self.cmd_opts.add_option(cmdoptions.no_binary())\n self.cmd_opts.add_option(cmdoptions.only_binary())\n self.cmd_opts.add_option(cmdoptions.prefer_binary())\n self.cmd_opts.add_option(cmdoptions.require_hashes())\n self.cmd_opts.add_option(cmdoptions.progress_bar())\n\n index_opts = cmdoptions.make_option_group(\n cmdoptions.index_group,\n self.parser,\n )\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n @with_cleanup\n def run(self, options: Values, args: List[str]) -> int:\n logger.verbose(\"Using %s\", get_pip_version())\n\n logger.warning(\n \"pip lock is currently an experimental command. \"\n \"It may be removed/changed in a future release \"\n \"without prior warning.\"\n )\n\n session = self.get_default_session(options)\n\n finder = self._build_package_finder(\n options=options,\n session=session,\n ignore_requires_python=options.ignore_requires_python,\n )\n build_tracker = self.enter_context(get_build_tracker())\n\n directory = TempDirectory(\n delete=not options.no_clean,\n kind=\"install\",\n globally_managed=True,\n )\n\n reqs = self.get_requirements(args, options, finder, session)\n check_legacy_setup_py_options(options, reqs)\n\n wheel_cache = WheelCache(options.cache_dir)\n\n # Only when installing is it permitted to use PEP 660.\n # In other circumstances (pip wheel, pip download) we generate\n # regular (i.e. non editable) metadata and wheels.\n for req in reqs:\n req.permit_editable_wheels = True\n\n preparer = self.make_requirement_preparer(\n temp_build_dir=directory,\n options=options,\n build_tracker=build_tracker,\n session=session,\n finder=finder,\n use_user_site=False,\n verbosity=self.verbosity,\n )\n resolver = self.make_resolver(\n preparer=preparer,\n finder=finder,\n options=options,\n wheel_cache=wheel_cache,\n use_user_site=False,\n ignore_installed=True,\n ignore_requires_python=options.ignore_requires_python,\n upgrade_strategy=\"to-satisfy-only\",\n use_pep517=options.use_pep517,\n )\n\n self.trace_basic_info(finder)\n\n requirement_set = resolver.resolve(reqs, check_supported_wheels=True)\n\n if options.output_file == \"-\":\n base_dir = Path.cwd()\n else:\n output_file_path = Path(options.output_file)\n if not is_valid_pylock_file_name(output_file_path):\n logger.warning(\n \"%s is not a valid lock file name.\",\n output_file_path,\n )\n base_dir = output_file_path.parent\n pylock_toml = Pylock.from_install_requirements(\n requirement_set.requirements.values(), base_dir=base_dir\n ).as_toml()\n if options.output_file == \"-\":\n sys.stdout.write(pylock_toml)\n else:\n output_file_path.write_text(pylock_toml, encoding=\"utf-8\")\n\n return SUCCESS\n",[],[100,509,516,523,475,544,676,807],{"_104":815,"_96":816,"_158":817,"_160":677,"_161":139,"_162":818,"_164":165,"_106":819,"_101":29,"_167":215,"_169":820,"_170":25,"_171":-5,"_172":821,"_99":822},"0713cbc8-67fc-11f0-aad3-0224a6c84d84","search.py","0713cc5e-67fc-11f0-aad3-0224a6c84d84",254,["D",1753299259646],"import logging\nimport shutil\nimport sys\nimport textwrap\nimport xmlrpc.client\nfrom collections import OrderedDict\nfrom optparse import Values\nfrom typing import Dict, List, Optional, TypedDict\n\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.req_command import SessionCommandMixin\nfrom pip._internal.cli.status_codes import NO_MATCHES_FOUND, SUCCESS\nfrom pip._internal.exceptions import CommandError\nfrom pip._internal.metadata import get_default_environment\nfrom pip._internal.metadata.base import BaseDistribution\nfrom pip._internal.models.index import PyPI\nfrom pip._internal.network.xmlrpc import PipXmlrpcTransport\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import write_output\n\n\nclass TransformedHit(TypedDict):\n name: str\n summary: str\n versions: List[str]\n\n\nlogger = logging.getLogger(__name__)\n\n\nclass SearchCommand(Command, SessionCommandMixin):\n \"\"\"Search for PyPI packages whose name or summary contains .\"\"\"\n\n usage = \"\"\"\n %prog [options] \"\"\"\n ignore_require_venv = True\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-i\",\n \"--index\",\n dest=\"index\",\n metavar=\"URL\",\n default=PyPI.pypi_url,\n help=\"Base URL of Python Package Index (default %default)\",\n )\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n if not args:\n raise CommandError(\"Missing required argument (search query).\")\n query = args\n pypi_hits = self.search(query, options)\n hits = transform_hits(pypi_hits)\n\n terminal_width = None\n if sys.stdout.isatty():\n terminal_width = shutil.get_terminal_size()[0]\n\n print_results(hits, terminal_width=terminal_width)\n if pypi_hits:\n return SUCCESS\n return NO_MATCHES_FOUND\n\n def search(self, query: List[str], options: Values) -> List[Dict[str, str]]:\n index_url = options.index\n\n session = self.get_default_session(options)\n\n transport = PipXmlrpcTransport(index_url, session)\n pypi = xmlrpc.client.ServerProxy(index_url, transport)\n try:\n hits = pypi.search({\"name\": query, \"summary\": query}, \"or\")\n except xmlrpc.client.Fault as fault:\n message = (\n f\"XMLRPC request failed [code: {fault.faultCode}]\\n{fault.faultString}\"\n )\n raise CommandError(message)\n assert isinstance(hits, list)\n return hits\n\n\ndef transform_hits(hits: List[Dict[str, str]]) -> List[\"TransformedHit\"]:\n \"\"\"\n The list from pypi is really a list of versions. We want a list of\n packages with the list of versions stored inline. This converts the\n list from pypi into one we can use.\n \"\"\"\n packages: Dict[str, TransformedHit] = OrderedDict()\n for hit in hits:\n name = hit[\"name\"]\n summary = hit[\"summary\"]\n version = hit[\"version\"]\n\n if name not in packages.keys():\n packages[name] = {\n \"name\": name,\n \"summary\": summary,\n \"versions\": [version],\n }\n else:\n packages[name][\"versions\"].append(version)\n\n # if this is the highest version, replace summary and score\n if version == highest_version(packages[name][\"versions\"]):\n packages[name][\"summary\"] = summary\n\n return list(packages.values())\n\n\ndef print_dist_installation_info(latest: str, dist: Optional[BaseDistribution]) -> None:\n if dist is not None:\n with indent_log():\n if dist.version == latest:\n write_output(\"INSTALLED: %s (latest)\", dist.version)\n else:\n write_output(\"INSTALLED: %s\", dist.version)\n if parse_version(latest).pre:\n write_output(\n \"LATEST: %s (pre-release; install\"\n \" with `pip install --pre`)\",\n latest,\n )\n else:\n write_output(\"LATEST: %s\", latest)\n\n\ndef get_installed_distribution(name: str) -> Optional[BaseDistribution]:\n env = get_default_environment()\n return env.get_distribution(name)\n\n\ndef print_results(\n hits: List[\"TransformedHit\"],\n name_column_width: Optional[int] = None,\n terminal_width: Optional[int] = None,\n) -> None:\n if not hits:\n return\n if name_column_width is None:\n name_column_width = (\n max(\n [\n len(hit[\"name\"]) + len(highest_version(hit.get(\"versions\", [\"-\"])))\n for hit in hits\n ]\n )\n + 4\n )\n\n for hit in hits:\n name = hit[\"name\"]\n summary = hit[\"summary\"] or \"\"\n latest = highest_version(hit.get(\"versions\", [\"-\"]))\n if terminal_width is not None:\n target_width = terminal_width - name_column_width - 5\n if target_width > 10:\n # wrap and indent summary to fit terminal\n summary_lines = textwrap.wrap(summary, target_width)\n summary = (\"\\n\" + \" \" * (name_column_width + 3)).join(summary_lines)\n\n name_latest = f\"{name} ({latest})\"\n line = f\"{name_latest:{name_column_width}} - {summary}\"\n try:\n write_output(line)\n dist = get_installed_distribution(name)\n print_dist_installation_info(latest, dist)\n except UnicodeEncodeError:\n pass\n\n\ndef highest_version(versions: List[str]) -> str:\n return max(versions, key=parse_version)\n",[],[100,509,516,523,475,544,676,816],{"_104":824,"_96":825,"_158":826,"_160":677,"_161":139,"_162":827,"_164":165,"_106":828,"_101":29,"_167":215,"_169":829,"_170":25,"_171":-5,"_172":830,"_99":831},"06c70f86-67fc-11f0-9ad5-0224a6c84d84","show.py","06c71058-67fc-11f0-9ad5-0224a6c84d84",240,["D",1753299259154],"import logging\nimport string\nfrom optparse import Values\nfrom typing import Generator, Iterable, Iterator, List, NamedTuple, Optional\n\nfrom pip._vendor.packaging.requirements import InvalidRequirement\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.status_codes import ERROR, SUCCESS\nfrom pip._internal.metadata import BaseDistribution, get_default_environment\nfrom pip._internal.utils.misc import write_output\n\nlogger = logging.getLogger(__name__)\n\n\ndef normalize_project_url_label(label: str) -> str:\n # This logic is from PEP 753 (Well-known Project URLs in Metadata).\n chars_to_remove = string.punctuation + string.whitespace\n removal_map = str.maketrans(\"\", \"\", chars_to_remove)\n return label.translate(removal_map).lower()\n\n\nclass ShowCommand(Command):\n \"\"\"\n Show information about one or more installed packages.\n\n The output is in RFC-compliant mail header format.\n \"\"\"\n\n usage = \"\"\"\n %prog [options] ...\"\"\"\n ignore_require_venv = True\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-f\",\n \"--files\",\n dest=\"files\",\n action=\"store_true\",\n default=False,\n help=\"Show the full list of installed files for each package.\",\n )\n\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n if not args:\n logger.warning(\"ERROR: Please provide a package name or names.\")\n return ERROR\n query = args\n\n results = search_packages_info(query)\n if not print_results(\n results, list_files=options.files, verbose=options.verbose\n ):\n return ERROR\n return SUCCESS\n\n\nclass _PackageInfo(NamedTuple):\n name: str\n version: str\n location: str\n editable_project_location: Optional[str]\n requires: List[str]\n required_by: List[str]\n installer: str\n metadata_version: str\n classifiers: List[str]\n summary: str\n homepage: str\n project_urls: List[str]\n author: str\n author_email: str\n license: str\n license_expression: str\n entry_points: List[str]\n files: Optional[List[str]]\n\n\ndef search_packages_info(query: List[str]) -> Generator[_PackageInfo, None, None]:\n \"\"\"\n Gather details from installed distributions. Print distribution name,\n version, location, and installed files. Installed files requires a\n pip generated 'installed-files.txt' in the distributions '.egg-info'\n directory.\n \"\"\"\n env = get_default_environment()\n\n installed = {dist.canonical_name: dist for dist in env.iter_all_distributions()}\n query_names = [canonicalize_name(name) for name in query]\n missing = sorted(\n [name for name, pkg in zip(query, query_names) if pkg not in installed]\n )\n if missing:\n logger.warning(\"Package(s) not found: %s\", \", \".join(missing))\n\n def _get_requiring_packages(current_dist: BaseDistribution) -> Iterator[str]:\n return (\n dist.metadata[\"Name\"] or \"UNKNOWN\"\n for dist in installed.values()\n if current_dist.canonical_name\n in {canonicalize_name(d.name) for d in dist.iter_dependencies()}\n )\n\n for query_name in query_names:\n try:\n dist = installed[query_name]\n except KeyError:\n continue\n\n try:\n requires = sorted(\n # Avoid duplicates in requirements (e.g. due to environment markers).\n {req.name for req in dist.iter_dependencies()},\n key=str.lower,\n )\n except InvalidRequirement:\n requires = sorted(dist.iter_raw_dependencies(), key=str.lower)\n\n try:\n required_by = sorted(_get_requiring_packages(dist), key=str.lower)\n except InvalidRequirement:\n required_by = [\"#N/A\"]\n\n try:\n entry_points_text = dist.read_text(\"entry_points.txt\")\n entry_points = entry_points_text.splitlines(keepends=False)\n except FileNotFoundError:\n entry_points = []\n\n files_iter = dist.iter_declared_entries()\n if files_iter is None:\n files: Optional[List[str]] = None\n else:\n files = sorted(files_iter)\n\n metadata = dist.metadata\n\n project_urls = metadata.get_all(\"Project-URL\", [])\n homepage = metadata.get(\"Home-page\", \"\")\n if not homepage:\n # It's common that there is a \"homepage\" Project-URL, but Home-page\n # remains unset (especially as PEP 621 doesn't surface the field).\n for url in project_urls:\n url_label, url = url.split(\",\", maxsplit=1)\n normalized_label = normalize_project_url_label(url_label)\n if normalized_label == \"homepage\":\n homepage = url.strip()\n break\n\n yield _PackageInfo(\n name=dist.raw_name,\n version=dist.raw_version,\n location=dist.location or \"\",\n editable_project_location=dist.editable_project_location,\n requires=requires,\n required_by=required_by,\n installer=dist.installer,\n metadata_version=dist.metadata_version or \"\",\n classifiers=metadata.get_all(\"Classifier\", []),\n summary=metadata.get(\"Summary\", \"\"),\n homepage=homepage,\n project_urls=project_urls,\n author=metadata.get(\"Author\", \"\"),\n author_email=metadata.get(\"Author-email\", \"\"),\n license=metadata.get(\"License\", \"\"),\n license_expression=metadata.get(\"License-Expression\", \"\"),\n entry_points=entry_points,\n files=files,\n )\n\n\ndef print_results(\n distributions: Iterable[_PackageInfo],\n list_files: bool,\n verbose: bool,\n) -> bool:\n \"\"\"\n Print the information from installed distributions found.\n \"\"\"\n results_printed = False\n for i, dist in enumerate(distributions):\n results_printed = True\n if i > 0:\n write_output(\"---\")\n\n metadata_version_tuple = tuple(map(int, dist.metadata_version.split(\".\")))\n\n write_output(\"Name: %s\", dist.name)\n write_output(\"Version: %s\", dist.version)\n write_output(\"Summary: %s\", dist.summary)\n write_output(\"Home-page: %s\", dist.homepage)\n write_output(\"Author: %s\", dist.author)\n write_output(\"Author-email: %s\", dist.author_email)\n if metadata_version_tuple >= (2, 4) and dist.license_expression:\n write_output(\"License-Expression: %s\", dist.license_expression)\n else:\n write_output(\"License: %s\", dist.license)\n write_output(\"Location: %s\", dist.location)\n if dist.editable_project_location is not None:\n write_output(\n \"Editable project location: %s\", dist.editable_project_location\n )\n write_output(\"Requires: %s\", \", \".join(dist.requires))\n write_output(\"Required-by: %s\", \", \".join(dist.required_by))\n\n if verbose:\n write_output(\"Metadata-Version: %s\", dist.metadata_version)\n write_output(\"Installer: %s\", dist.installer)\n write_output(\"Classifiers:\")\n for classifier in dist.classifiers:\n write_output(\" %s\", classifier)\n write_output(\"Entry-points:\")\n for entry in dist.entry_points:\n write_output(\" %s\", entry.strip())\n write_output(\"Project-URLs:\")\n for project_url in dist.project_urls:\n write_output(\" %s\", project_url)\n if list_files:\n write_output(\"Files:\")\n if dist.files is None:\n write_output(\"Cannot locate RECORD or installed-files.txt\")\n else:\n for line in dist.files:\n write_output(\" %s\", line.strip())\n return results_printed\n",[],[100,509,516,523,475,544,676,825],{"_104":833,"_96":834,"_158":835,"_160":677,"_161":139,"_162":836,"_164":165,"_106":837,"_101":29,"_167":215,"_169":838,"_170":25,"_171":-5,"_172":839,"_99":840},"0704e66c-67fc-11f0-9ad5-0224a6c84d84","uninstall.py","0704e73e-67fc-11f0-9ad5-0224a6c84d84",251,["D",1753299259559],"import logging\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.base_command import Command\nfrom pip._internal.cli.index_command import SessionCommandMixin\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.req import parse_requirements\nfrom pip._internal.req.constructors import (\n install_req_from_line,\n install_req_from_parsed_requirement,\n)\nfrom pip._internal.utils.misc import (\n check_externally_managed,\n protect_pip_from_modification_on_windows,\n warn_if_run_as_root,\n)\n\nlogger = logging.getLogger(__name__)\n\n\nclass UninstallCommand(Command, SessionCommandMixin):\n \"\"\"\n Uninstall packages.\n\n pip is able to uninstall most installed packages. Known exceptions are:\n\n - Pure distutils packages installed with ``python setup.py install``, which\n leave behind no metadata to determine what files were installed.\n - Script wrappers installed by ``python setup.py develop``.\n \"\"\"\n\n usage = \"\"\"\n %prog [options] ...\n %prog [options] -r ...\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-r\",\n \"--requirement\",\n dest=\"requirements\",\n action=\"append\",\n default=[],\n metavar=\"file\",\n help=(\n \"Uninstall all the packages listed in the given requirements \"\n \"file. This option can be used multiple times.\"\n ),\n )\n self.cmd_opts.add_option(\n \"-y\",\n \"--yes\",\n dest=\"yes\",\n action=\"store_true\",\n help=\"Don't ask for confirmation of uninstall deletions.\",\n )\n self.cmd_opts.add_option(cmdoptions.root_user_action())\n self.cmd_opts.add_option(cmdoptions.override_externally_managed())\n self.parser.insert_option_group(0, self.cmd_opts)\n\n def run(self, options: Values, args: List[str]) -> int:\n session = self.get_default_session(options)\n\n reqs_to_uninstall = {}\n for name in args:\n req = install_req_from_line(\n name,\n isolated=options.isolated_mode,\n )\n if req.name:\n reqs_to_uninstall[canonicalize_name(req.name)] = req\n else:\n logger.warning(\n \"Invalid requirement: %r ignored -\"\n \" the uninstall command expects named\"\n \" requirements.\",\n name,\n )\n for filename in options.requirements:\n for parsed_req in parse_requirements(\n filename, options=options, session=session\n ):\n req = install_req_from_parsed_requirement(\n parsed_req, isolated=options.isolated_mode\n )\n if req.name:\n reqs_to_uninstall[canonicalize_name(req.name)] = req\n if not reqs_to_uninstall:\n raise InstallationError(\n f\"You must give at least one requirement to {self.name} (see \"\n f'\"pip help {self.name}\")'\n )\n\n if not options.override_externally_managed:\n check_externally_managed()\n\n protect_pip_from_modification_on_windows(\n modifying_pip=\"pip\" in reqs_to_uninstall\n )\n\n for req in reqs_to_uninstall.values():\n uninstall_pathset = req.uninstall(\n auto_confirm=options.yes,\n verbose=self.verbosity > 0,\n )\n if uninstall_pathset:\n uninstall_pathset.commit()\n if options.root_user_action == \"warn\":\n warn_if_run_as_root()\n return SUCCESS\n",[],[100,509,516,523,475,544,676,834],{"_104":842,"_96":843,"_158":844,"_160":677,"_161":139,"_162":845,"_164":165,"_106":846,"_101":29,"_167":215,"_169":847,"_170":25,"_171":-5,"_172":848,"_99":849},"0724feac-67fc-11f0-b654-0224a6c84d84","wheel.py","0724ff42-67fc-11f0-b654-0224a6c84d84",257,["D",1753299259770],"import logging\nimport os\nimport shutil\nfrom optparse import Values\nfrom typing import List\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.cli.req_command import RequirementCommand, with_cleanup\nfrom pip._internal.cli.status_codes import SUCCESS\nfrom pip._internal.exceptions import CommandError\nfrom pip._internal.operations.build.build_tracker import get_build_tracker\nfrom pip._internal.req.req_install import (\n InstallRequirement,\n check_legacy_setup_py_options,\n)\nfrom pip._internal.utils.misc import ensure_dir, normalize_path\nfrom pip._internal.utils.temp_dir import TempDirectory\nfrom pip._internal.wheel_builder import build\n\nlogger = logging.getLogger(__name__)\n\n\nclass WheelCommand(RequirementCommand):\n \"\"\"\n Build Wheel archives for your requirements and dependencies.\n\n Wheel is a built-package format, and offers the advantage of not\n recompiling your software during every install. For more details, see the\n wheel docs: https://wheel.readthedocs.io/en/latest/\n\n 'pip wheel' uses the build system interface as described here:\n https://pip.pypa.io/en/stable/reference/build-system/\n\n \"\"\"\n\n usage = \"\"\"\n %prog [options] ...\n %prog [options] -r ...\n %prog [options] [-e] ...\n %prog [options] [-e] ...\n %prog [options] ...\"\"\"\n\n def add_options(self) -> None:\n self.cmd_opts.add_option(\n \"-w\",\n \"--wheel-dir\",\n dest=\"wheel_dir\",\n metavar=\"dir\",\n default=os.curdir,\n help=(\n \"Build wheels into , where the default is the \"\n \"current working directory.\"\n ),\n )\n self.cmd_opts.add_option(cmdoptions.no_binary())\n self.cmd_opts.add_option(cmdoptions.only_binary())\n self.cmd_opts.add_option(cmdoptions.prefer_binary())\n self.cmd_opts.add_option(cmdoptions.no_build_isolation())\n self.cmd_opts.add_option(cmdoptions.use_pep517())\n self.cmd_opts.add_option(cmdoptions.no_use_pep517())\n self.cmd_opts.add_option(cmdoptions.check_build_deps())\n self.cmd_opts.add_option(cmdoptions.constraints())\n self.cmd_opts.add_option(cmdoptions.editable())\n self.cmd_opts.add_option(cmdoptions.requirements())\n self.cmd_opts.add_option(cmdoptions.src())\n self.cmd_opts.add_option(cmdoptions.ignore_requires_python())\n self.cmd_opts.add_option(cmdoptions.no_deps())\n self.cmd_opts.add_option(cmdoptions.progress_bar())\n\n self.cmd_opts.add_option(\n \"--no-verify\",\n dest=\"no_verify\",\n action=\"store_true\",\n default=False,\n help=\"Don't verify if built wheel is valid.\",\n )\n\n self.cmd_opts.add_option(cmdoptions.config_settings())\n self.cmd_opts.add_option(cmdoptions.build_options())\n self.cmd_opts.add_option(cmdoptions.global_options())\n\n self.cmd_opts.add_option(\n \"--pre\",\n action=\"store_true\",\n default=False,\n help=(\n \"Include pre-release and development versions. By default, \"\n \"pip only finds stable versions.\"\n ),\n )\n\n self.cmd_opts.add_option(cmdoptions.require_hashes())\n\n index_opts = cmdoptions.make_option_group(\n cmdoptions.index_group,\n self.parser,\n )\n\n self.parser.insert_option_group(0, index_opts)\n self.parser.insert_option_group(0, self.cmd_opts)\n\n @with_cleanup\n def run(self, options: Values, args: List[str]) -> int:\n session = self.get_default_session(options)\n\n finder = self._build_package_finder(options, session)\n\n options.wheel_dir = normalize_path(options.wheel_dir)\n ensure_dir(options.wheel_dir)\n\n build_tracker = self.enter_context(get_build_tracker())\n\n directory = TempDirectory(\n delete=not options.no_clean,\n kind=\"wheel\",\n globally_managed=True,\n )\n\n reqs = self.get_requirements(args, options, finder, session)\n check_legacy_setup_py_options(options, reqs)\n\n wheel_cache = WheelCache(options.cache_dir)\n\n preparer = self.make_requirement_preparer(\n temp_build_dir=directory,\n options=options,\n build_tracker=build_tracker,\n session=session,\n finder=finder,\n download_dir=options.wheel_dir,\n use_user_site=False,\n verbosity=self.verbosity,\n )\n\n resolver = self.make_resolver(\n preparer=preparer,\n finder=finder,\n options=options,\n wheel_cache=wheel_cache,\n ignore_requires_python=options.ignore_requires_python,\n use_pep517=options.use_pep517,\n )\n\n self.trace_basic_info(finder)\n\n requirement_set = resolver.resolve(reqs, check_supported_wheels=True)\n\n reqs_to_build: List[InstallRequirement] = []\n for req in requirement_set.requirements.values():\n if req.is_wheel:\n preparer.save_linked_requirement(req)\n else:\n reqs_to_build.append(req)\n\n preparer.prepare_linked_requirements_more(requirement_set.requirements.values())\n\n # build wheels\n build_successes, build_failures = build(\n reqs_to_build,\n wheel_cache=wheel_cache,\n verify=(not options.no_verify),\n build_options=options.build_options or [],\n global_options=options.global_options or [],\n )\n for req in build_successes:\n assert req.link and req.link.is_wheel\n assert req.local_file_path\n # copy from cache to target directory\n try:\n shutil.copy(req.local_file_path, options.wheel_dir)\n except OSError as e:\n logger.warning(\n \"Building wheel for %s failed: %s\",\n req.name,\n e,\n )\n build_failures.append(req)\n if len(build_failures) != 0:\n raise CommandError(\"Failed to build one or more wheels\")\n\n return SUCCESS\n",[],[100,509,516,523,475,544,676,843],[100,509,516,523,475,544,676],{"_104":852,"_96":853,"_158":854,"_160":545,"_161":139,"_162":855,"_164":165,"_106":856,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":857,"_99":901},"fd5029ce-67fb-11f0-a319-0224a6c84d84","distributions","fd502a78-67fb-11f0-a319-0224a6c84d84",69,["D",1753299243272],[858,866,875,884,893],{"_104":859,"_96":558,"_158":860,"_160":854,"_161":139,"_162":861,"_164":165,"_106":862,"_101":29,"_167":215,"_169":863,"_170":25,"_171":-5,"_172":864,"_99":865},"07a2887c-67fc-11f0-9b65-0224a6c84d84","07a28926-67fc-11f0-9b65-0224a6c84d84",272,["D",1753299260428],"from pip._internal.distributions.base import AbstractDistribution\nfrom pip._internal.distributions.sdist import SourceDistribution\nfrom pip._internal.distributions.wheel import WheelDistribution\nfrom pip._internal.req.req_install import InstallRequirement\n\n\ndef make_distribution_for_install_requirement(\n install_req: InstallRequirement,\n) -> AbstractDistribution:\n \"\"\"Returns a Distribution for the given InstallRequirement\"\"\"\n # Editable requirements will always be source distributions. They use the\n # legacy logic until we create a modern standard for them.\n if install_req.editable:\n return SourceDistribution(install_req)\n\n # If it's a wheel, it's a WheelDistribution\n if install_req.is_wheel:\n return WheelDistribution(install_req)\n\n # Otherwise, a SourceDistribution\n return SourceDistribution(install_req)\n",[],[100,509,516,523,475,544,853,558],{"_104":867,"_96":868,"_158":869,"_160":854,"_161":139,"_162":870,"_164":165,"_106":871,"_101":29,"_167":215,"_169":872,"_170":25,"_171":-5,"_172":873,"_99":874},"0793eccc-67fc-11f0-8863-0224a6c84d84","base.py","0793ed80-67fc-11f0-8863-0224a6c84d84",270,["D",1753299260491],"import abc\nfrom typing import TYPE_CHECKING, Optional\n\nfrom pip._internal.metadata.base import BaseDistribution\nfrom pip._internal.req import InstallRequirement\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n\n\nclass AbstractDistribution(metaclass=abc.ABCMeta):\n \"\"\"A base class for handling installable artifacts.\n\n The requirements for anything installable are as follows:\n\n - we must be able to determine the requirement name\n (or we can't correctly handle the non-upgrade case).\n\n - for packages with setup requirements, we must also be able\n to determine their requirements without installing additional\n packages (for the same reason as run-time dependencies)\n\n - we must be able to create a Distribution object exposing the\n above metadata.\n\n - if we need to do work in the build tracker, we must be able to generate a unique\n string to identify the requirement in the build tracker.\n \"\"\"\n\n def __init__(self, req: InstallRequirement) -> None:\n super().__init__()\n self.req = req\n\n @abc.abstractproperty\n def build_tracker_id(self) -> Optional[str]:\n \"\"\"A string that uniquely identifies this requirement to the build tracker.\n\n If None, then this dist has no work to do in the build tracker, and\n ``.prepare_distribution_metadata()`` will not be called.\"\"\"\n raise NotImplementedError()\n\n @abc.abstractmethod\n def get_metadata_distribution(self) -> BaseDistribution:\n raise NotImplementedError()\n\n @abc.abstractmethod\n def prepare_distribution_metadata(\n self,\n finder: \"PackageFinder\",\n build_isolation: bool,\n check_build_deps: bool,\n ) -> None:\n raise NotImplementedError()\n",[],[100,509,516,523,475,544,853,868],{"_104":876,"_96":877,"_158":878,"_160":854,"_161":139,"_162":879,"_164":165,"_106":880,"_101":29,"_167":215,"_169":881,"_170":25,"_171":-5,"_172":882,"_99":883},"078e7288-67fc-11f0-95df-0224a6c84d84","installed.py","078e733c-67fc-11f0-95df-0224a6c84d84",269,["D",1753299260462],"from typing import Optional\n\nfrom pip._internal.distributions.base import AbstractDistribution\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.metadata import BaseDistribution\n\n\nclass InstalledDistribution(AbstractDistribution):\n \"\"\"Represents an installed package.\n\n This does not need any preparation as the required information has already\n been computed.\n \"\"\"\n\n @property\n def build_tracker_id(self) -> Optional[str]:\n return None\n\n def get_metadata_distribution(self) -> BaseDistribution:\n assert self.req.satisfied_by is not None, \"not actually installed\"\n return self.req.satisfied_by\n\n def prepare_distribution_metadata(\n self,\n finder: PackageFinder,\n build_isolation: bool,\n check_build_deps: bool,\n ) -> None:\n pass\n",[],[100,509,516,523,475,544,853,877],{"_104":885,"_96":886,"_158":887,"_160":854,"_161":139,"_162":888,"_164":165,"_106":889,"_101":29,"_167":215,"_169":890,"_170":25,"_171":-5,"_172":891,"_99":892},"0789ccba-67fc-11f0-aad3-0224a6c84d84","sdist.py","0789cd6e-67fc-11f0-aad3-0224a6c84d84",268,["D",1753299260426],"import logging\nfrom typing import TYPE_CHECKING, Iterable, Optional, Set, Tuple\n\nfrom pip._internal.build_env import BuildEnvironment\nfrom pip._internal.distributions.base import AbstractDistribution\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.metadata import BaseDistribution\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n\nlogger = logging.getLogger(__name__)\n\n\nclass SourceDistribution(AbstractDistribution):\n \"\"\"Represents a source distribution.\n\n The preparation step for these needs metadata for the packages to be\n generated, either using PEP 517 or using the legacy `setup.py egg_info`.\n \"\"\"\n\n @property\n def build_tracker_id(self) -> Optional[str]:\n \"\"\"Identify this requirement uniquely by its link.\"\"\"\n assert self.req.link\n return self.req.link.url_without_fragment\n\n def get_metadata_distribution(self) -> BaseDistribution:\n return self.req.get_dist()\n\n def prepare_distribution_metadata(\n self,\n finder: \"PackageFinder\",\n build_isolation: bool,\n check_build_deps: bool,\n ) -> None:\n # Load pyproject.toml, to determine whether PEP 517 is to be used\n self.req.load_pyproject_toml()\n\n # Set up the build isolation, if this requirement should be isolated\n should_isolate = self.req.use_pep517 and build_isolation\n if should_isolate:\n # Setup an isolated environment and install the build backend static\n # requirements in it.\n self._prepare_build_backend(finder)\n # Check that if the requirement is editable, it either supports PEP 660 or\n # has a setup.py or a setup.cfg. This cannot be done earlier because we need\n # to setup the build backend to verify it supports build_editable, nor can\n # it be done later, because we want to avoid installing build requirements\n # needlessly. Doing it here also works around setuptools generating\n # UNKNOWN.egg-info when running get_requires_for_build_wheel on a directory\n # without setup.py nor setup.cfg.\n self.req.isolated_editable_sanity_check()\n # Install the dynamic build requirements.\n self._install_build_reqs(finder)\n # Check if the current environment provides build dependencies\n should_check_deps = self.req.use_pep517 and check_build_deps\n if should_check_deps:\n pyproject_requires = self.req.pyproject_requires\n assert pyproject_requires is not None\n conflicting, missing = self.req.build_env.check_requirements(\n pyproject_requires\n )\n if conflicting:\n self._raise_conflicts(\"the backend dependencies\", conflicting)\n if missing:\n self._raise_missing_reqs(missing)\n self.req.prepare_metadata()\n\n def _prepare_build_backend(self, finder: \"PackageFinder\") -> None:\n # Isolate in a BuildEnvironment and install the build-time\n # requirements.\n pyproject_requires = self.req.pyproject_requires\n assert pyproject_requires is not None\n\n self.req.build_env = BuildEnvironment()\n self.req.build_env.install_requirements(\n finder, pyproject_requires, \"overlay\", kind=\"build dependencies\"\n )\n conflicting, missing = self.req.build_env.check_requirements(\n self.req.requirements_to_check\n )\n if conflicting:\n self._raise_conflicts(\"PEP 517/518 supported requirements\", conflicting)\n if missing:\n logger.warning(\n \"Missing build requirements in pyproject.toml for %s.\",\n self.req,\n )\n logger.warning(\n \"The project does not specify a build backend, and \"\n \"pip cannot fall back to setuptools without %s.\",\n \" and \".join(map(repr, sorted(missing))),\n )\n\n def _get_build_requires_wheel(self) -> Iterable[str]:\n with self.req.build_env:\n runner = runner_with_spinner_message(\"Getting requirements to build wheel\")\n backend = self.req.pep517_backend\n assert backend is not None\n with backend.subprocess_runner(runner):\n return backend.get_requires_for_build_wheel()\n\n def _get_build_requires_editable(self) -> Iterable[str]:\n with self.req.build_env:\n runner = runner_with_spinner_message(\n \"Getting requirements to build editable\"\n )\n backend = self.req.pep517_backend\n assert backend is not None\n with backend.subprocess_runner(runner):\n return backend.get_requires_for_build_editable()\n\n def _install_build_reqs(self, finder: \"PackageFinder\") -> None:\n # Install any extra build dependencies that the backend requests.\n # This must be done in a second pass, as the pyproject.toml\n # dependencies must be installed before we can call the backend.\n if (\n self.req.editable\n and self.req.permit_editable_wheels\n and self.req.supports_pyproject_editable\n ):\n build_reqs = self._get_build_requires_editable()\n else:\n build_reqs = self._get_build_requires_wheel()\n conflicting, missing = self.req.build_env.check_requirements(build_reqs)\n if conflicting:\n self._raise_conflicts(\"the backend dependencies\", conflicting)\n self.req.build_env.install_requirements(\n finder, missing, \"normal\", kind=\"backend dependencies\"\n )\n\n def _raise_conflicts(\n self, conflicting_with: str, conflicting_reqs: Set[Tuple[str, str]]\n ) -> None:\n format_string = (\n \"Some build dependencies for {requirement} \"\n \"conflict with {conflicting_with}: {description}.\"\n )\n error_message = format_string.format(\n requirement=self.req,\n conflicting_with=conflicting_with,\n description=\", \".join(\n f\"{installed} is incompatible with {wanted}\"\n for installed, wanted in sorted(conflicting_reqs)\n ),\n )\n raise InstallationError(error_message)\n\n def _raise_missing_reqs(self, missing: Set[str]) -> None:\n format_string = (\n \"Some build dependencies for {requirement} are missing: {missing}.\"\n )\n error_message = format_string.format(\n requirement=self.req, missing=\", \".join(map(repr, sorted(missing)))\n )\n raise InstallationError(error_message)\n",[],[100,509,516,523,475,544,853,886],{"_104":894,"_96":843,"_158":895,"_160":854,"_161":139,"_162":896,"_164":165,"_106":897,"_101":29,"_167":215,"_169":898,"_170":25,"_171":-5,"_172":899,"_99":900},"0798429a-67fc-11f0-9cad-0224a6c84d84","07984330-67fc-11f0-9cad-0224a6c84d84",271,["D",1753299260512],"from typing import TYPE_CHECKING, Optional\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.distributions.base import AbstractDistribution\nfrom pip._internal.metadata import (\n BaseDistribution,\n FilesystemWheel,\n get_wheel_distribution,\n)\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n\n\nclass WheelDistribution(AbstractDistribution):\n \"\"\"Represents a wheel distribution.\n\n This does not need any preparation as wheels can be directly unpacked.\n \"\"\"\n\n @property\n def build_tracker_id(self) -> Optional[str]:\n return None\n\n def get_metadata_distribution(self) -> BaseDistribution:\n \"\"\"Loads the metadata from the wheel file into memory and returns a\n Distribution that uses it, not relying on the wheel file or\n requirement.\n \"\"\"\n assert self.req.local_file_path, \"Set as part of preparation during download\"\n assert self.req.name, \"Wheels are never unnamed\"\n wheel = FilesystemWheel(self.req.local_file_path)\n return get_wheel_distribution(wheel, canonicalize_name(self.req.name))\n\n def prepare_distribution_metadata(\n self,\n finder: \"PackageFinder\",\n build_isolation: bool,\n check_build_deps: bool,\n ) -> None:\n pass\n",[],[100,509,516,523,475,544,853,843],[100,509,516,523,475,544,853],{"_104":903,"_96":904,"_158":905,"_160":545,"_161":139,"_162":906,"_164":165,"_106":907,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":908,"_99":944},"fd04b282-67fb-11f0-ad3e-0224a6c84d84","index","fd04b336-67fb-11f0-ad3e-0224a6c84d84",66,["D",1753299242781],[909,917,926,935],{"_104":910,"_96":558,"_158":911,"_160":905,"_161":139,"_162":912,"_164":165,"_106":913,"_101":29,"_167":215,"_169":914,"_170":25,"_171":-5,"_172":915,"_99":916},"06af43ce-67fc-11f0-9ab6-0224a6c84d84","06af4464-67fc-11f0-9ab6-0224a6c84d84",235,["D",1753299259000],"\"\"\"Index interaction code\"\"\"\n",[],[100,509,516,523,475,544,904,558],{"_104":918,"_96":919,"_158":920,"_160":905,"_161":139,"_162":921,"_164":165,"_106":922,"_101":29,"_167":215,"_169":923,"_170":25,"_171":-5,"_172":924,"_99":925},"06a529de-67fc-11f0-95df-0224a6c84d84","collector.py","06a52a7e-67fc-11f0-95df-0224a6c84d84",234,["D",1753299258931],"\"\"\"\nThe main purpose of this module is to expose LinkCollector.collect_sources().\n\"\"\"\n\nimport collections\nimport email.message\nimport functools\nimport itertools\nimport json\nimport logging\nimport os\nimport urllib.parse\nimport urllib.request\nfrom dataclasses import dataclass\nfrom html.parser import HTMLParser\nfrom optparse import Values\nfrom typing import (\n Callable,\n Dict,\n Iterable,\n List,\n MutableMapping,\n NamedTuple,\n Optional,\n Protocol,\n Sequence,\n Tuple,\n Union,\n)\n\nfrom pip._vendor import requests\nfrom pip._vendor.requests import Response\nfrom pip._vendor.requests.exceptions import RetryError, SSLError\n\nfrom pip._internal.exceptions import NetworkConnectionError\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.search_scope import SearchScope\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.network.utils import raise_for_status\nfrom pip._internal.utils.filetypes import is_archive_file\nfrom pip._internal.utils.misc import redact_auth_from_url\nfrom pip._internal.vcs import vcs\n\nfrom .sources import CandidatesFromPage, LinkSource, build_source\n\nlogger = logging.getLogger(__name__)\n\nResponseHeaders = MutableMapping[str, str]\n\n\ndef _match_vcs_scheme(url: str) -> Optional[str]:\n \"\"\"Look for VCS schemes in the URL.\n\n Returns the matched VCS scheme, or None if there's no match.\n \"\"\"\n for scheme in vcs.schemes:\n if url.lower().startswith(scheme) and url[len(scheme)] in \"+:\":\n return scheme\n return None\n\n\nclass _NotAPIContent(Exception):\n def __init__(self, content_type: str, request_desc: str) -> None:\n super().__init__(content_type, request_desc)\n self.content_type = content_type\n self.request_desc = request_desc\n\n\ndef _ensure_api_header(response: Response) -> None:\n \"\"\"\n Check the Content-Type header to ensure the response contains a Simple\n API Response.\n\n Raises `_NotAPIContent` if the content type is not a valid content-type.\n \"\"\"\n content_type = response.headers.get(\"Content-Type\", \"Unknown\")\n\n content_type_l = content_type.lower()\n if content_type_l.startswith(\n (\n \"text/html\",\n \"application/vnd.pypi.simple.v1+html\",\n \"application/vnd.pypi.simple.v1+json\",\n )\n ):\n return\n\n raise _NotAPIContent(content_type, response.request.method)\n\n\nclass _NotHTTP(Exception):\n pass\n\n\ndef _ensure_api_response(url: str, session: PipSession) -> None:\n \"\"\"\n Send a HEAD request to the URL, and ensure the response contains a simple\n API Response.\n\n Raises `_NotHTTP` if the URL is not available for a HEAD request, or\n `_NotAPIContent` if the content type is not a valid content type.\n \"\"\"\n scheme, netloc, path, query, fragment = urllib.parse.urlsplit(url)\n if scheme not in {\"http\", \"https\"}:\n raise _NotHTTP()\n\n resp = session.head(url, allow_redirects=True)\n raise_for_status(resp)\n\n _ensure_api_header(resp)\n\n\ndef _get_simple_response(url: str, session: PipSession) -> Response:\n \"\"\"Access an Simple API response with GET, and return the response.\n\n This consists of three parts:\n\n 1. If the URL looks suspiciously like an archive, send a HEAD first to\n check the Content-Type is HTML or Simple API, to avoid downloading a\n large file. Raise `_NotHTTP` if the content type cannot be determined, or\n `_NotAPIContent` if it is not HTML or a Simple API.\n 2. Actually perform the request. Raise HTTP exceptions on network failures.\n 3. Check the Content-Type header to make sure we got a Simple API response,\n and raise `_NotAPIContent` otherwise.\n \"\"\"\n if is_archive_file(Link(url).filename):\n _ensure_api_response(url, session=session)\n\n logger.debug(\"Getting page %s\", redact_auth_from_url(url))\n\n resp = session.get(\n url,\n headers={\n \"Accept\": \", \".join(\n [\n \"application/vnd.pypi.simple.v1+json\",\n \"application/vnd.pypi.simple.v1+html; q=0.1\",\n \"text/html; q=0.01\",\n ]\n ),\n # We don't want to blindly returned cached data for\n # /simple/, because authors generally expecting that\n # twine upload && pip install will function, but if\n # they've done a pip install in the last ~10 minutes\n # it won't. Thus by setting this to zero we will not\n # blindly use any cached data, however the benefit of\n # using max-age=0 instead of no-cache, is that we will\n # still support conditional requests, so we will still\n # minimize traffic sent in cases where the page hasn't\n # changed at all, we will just always incur the round\n # trip for the conditional GET now instead of only\n # once per 10 minutes.\n # For more information, please see pypa/pip#5670.\n \"Cache-Control\": \"max-age=0\",\n },\n )\n raise_for_status(resp)\n\n # The check for archives above only works if the url ends with\n # something that looks like an archive. However that is not a\n # requirement of an url. Unless we issue a HEAD request on every\n # url we cannot know ahead of time for sure if something is a\n # Simple API response or not. However we can check after we've\n # downloaded it.\n _ensure_api_header(resp)\n\n logger.debug(\n \"Fetched page %s as %s\",\n redact_auth_from_url(url),\n resp.headers.get(\"Content-Type\", \"Unknown\"),\n )\n\n return resp\n\n\ndef _get_encoding_from_headers(headers: ResponseHeaders) -> Optional[str]:\n \"\"\"Determine if we have any encoding information in our headers.\"\"\"\n if headers and \"Content-Type\" in headers:\n m = email.message.Message()\n m[\"content-type\"] = headers[\"Content-Type\"]\n charset = m.get_param(\"charset\")\n if charset:\n return str(charset)\n return None\n\n\nclass CacheablePageContent:\n def __init__(self, page: \"IndexContent\") -> None:\n assert page.cache_link_parsing\n self.page = page\n\n def __eq__(self, other: object) -> bool:\n return isinstance(other, type(self)) and self.page.url == other.page.url\n\n def __hash__(self) -> int:\n return hash(self.page.url)\n\n\nclass ParseLinks(Protocol):\n def __call__(self, page: \"IndexContent\") -> Iterable[Link]: ...\n\n\ndef with_cached_index_content(fn: ParseLinks) -> ParseLinks:\n \"\"\"\n Given a function that parses an Iterable[Link] from an IndexContent, cache the\n function's result (keyed by CacheablePageContent), unless the IndexContent\n `page` has `page.cache_link_parsing == False`.\n \"\"\"\n\n @functools.lru_cache(maxsize=None)\n def wrapper(cacheable_page: CacheablePageContent) -> List[Link]:\n return list(fn(cacheable_page.page))\n\n @functools.wraps(fn)\n def wrapper_wrapper(page: \"IndexContent\") -> List[Link]:\n if page.cache_link_parsing:\n return wrapper(CacheablePageContent(page))\n return list(fn(page))\n\n return wrapper_wrapper\n\n\n@with_cached_index_content\ndef parse_links(page: \"IndexContent\") -> Iterable[Link]:\n \"\"\"\n Parse a Simple API's Index Content, and yield its anchor elements as Link objects.\n \"\"\"\n\n content_type_l = page.content_type.lower()\n if content_type_l.startswith(\"application/vnd.pypi.simple.v1+json\"):\n data = json.loads(page.content)\n for file in data.get(\"files\", []):\n link = Link.from_json(file, page.url)\n if link is None:\n continue\n yield link\n return\n\n parser = HTMLLinkParser(page.url)\n encoding = page.encoding or \"utf-8\"\n parser.feed(page.content.decode(encoding))\n\n url = page.url\n base_url = parser.base_url or url\n for anchor in parser.anchors:\n link = Link.from_element(anchor, page_url=url, base_url=base_url)\n if link is None:\n continue\n yield link\n\n\n@dataclass(frozen=True)\nclass IndexContent:\n \"\"\"Represents one response (or page), along with its URL.\n\n :param encoding: the encoding to decode the given content.\n :param url: the URL from which the HTML was downloaded.\n :param cache_link_parsing: whether links parsed from this page's url\n should be cached. PyPI index urls should\n have this set to False, for example.\n \"\"\"\n\n content: bytes\n content_type: str\n encoding: Optional[str]\n url: str\n cache_link_parsing: bool = True\n\n def __str__(self) -> str:\n return redact_auth_from_url(self.url)\n\n\nclass HTMLLinkParser(HTMLParser):\n \"\"\"\n HTMLParser that keeps the first base HREF and a list of all anchor\n elements' attributes.\n \"\"\"\n\n def __init__(self, url: str) -> None:\n super().__init__(convert_charrefs=True)\n\n self.url: str = url\n self.base_url: Optional[str] = None\n self.anchors: List[Dict[str, Optional[str]]] = []\n\n def handle_starttag(self, tag: str, attrs: List[Tuple[str, Optional[str]]]) -> None:\n if tag == \"base\" and self.base_url is None:\n href = self.get_href(attrs)\n if href is not None:\n self.base_url = href\n elif tag == \"a\":\n self.anchors.append(dict(attrs))\n\n def get_href(self, attrs: List[Tuple[str, Optional[str]]]) -> Optional[str]:\n for name, value in attrs:\n if name == \"href\":\n return value\n return None\n\n\ndef _handle_get_simple_fail(\n link: Link,\n reason: Union[str, Exception],\n meth: Optional[Callable[..., None]] = None,\n) -> None:\n if meth is None:\n meth = logger.debug\n meth(\"Could not fetch URL %s: %s - skipping\", link, reason)\n\n\ndef _make_index_content(\n response: Response, cache_link_parsing: bool = True\n) -> IndexContent:\n encoding = _get_encoding_from_headers(response.headers)\n return IndexContent(\n response.content,\n response.headers[\"Content-Type\"],\n encoding=encoding,\n url=response.url,\n cache_link_parsing=cache_link_parsing,\n )\n\n\ndef _get_index_content(link: Link, *, session: PipSession) -> Optional[\"IndexContent\"]:\n url = link.url.split(\"#\", 1)[0]\n\n # Check for VCS schemes that do not support lookup as web pages.\n vcs_scheme = _match_vcs_scheme(url)\n if vcs_scheme:\n logger.warning(\n \"Cannot look at %s URL %s because it does not support lookup as web pages.\",\n vcs_scheme,\n link,\n )\n return None\n\n # Tack index.html onto file:// URLs that point to directories\n scheme, _, path, _, _, _ = urllib.parse.urlparse(url)\n if scheme == \"file\" and os.path.isdir(urllib.request.url2pathname(path)):\n # add trailing slash if not present so urljoin doesn't trim\n # final segment\n if not url.endswith(\"/\"):\n url += \"/\"\n # TODO: In the future, it would be nice if pip supported PEP 691\n # style responses in the file:// URLs, however there's no\n # standard file extension for application/vnd.pypi.simple.v1+json\n # so we'll need to come up with something on our own.\n url = urllib.parse.urljoin(url, \"index.html\")\n logger.debug(\" file: URL is directory, getting %s\", url)\n\n try:\n resp = _get_simple_response(url, session=session)\n except _NotHTTP:\n logger.warning(\n \"Skipping page %s because it looks like an archive, and cannot \"\n \"be checked by a HTTP HEAD request.\",\n link,\n )\n except _NotAPIContent as exc:\n logger.warning(\n \"Skipping page %s because the %s request got Content-Type: %s. \"\n \"The only supported Content-Types are application/vnd.pypi.simple.v1+json, \"\n \"application/vnd.pypi.simple.v1+html, and text/html\",\n link,\n exc.request_desc,\n exc.content_type,\n )\n except NetworkConnectionError as exc:\n _handle_get_simple_fail(link, exc)\n except RetryError as exc:\n _handle_get_simple_fail(link, exc)\n except SSLError as exc:\n reason = \"There was a problem confirming the ssl certificate: \"\n reason += str(exc)\n _handle_get_simple_fail(link, reason, meth=logger.info)\n except requests.ConnectionError as exc:\n _handle_get_simple_fail(link, f\"connection error: {exc}\")\n except requests.Timeout:\n _handle_get_simple_fail(link, \"timed out\")\n else:\n return _make_index_content(resp, cache_link_parsing=link.cache_link_parsing)\n return None\n\n\nclass CollectedSources(NamedTuple):\n find_links: Sequence[Optional[LinkSource]]\n index_urls: Sequence[Optional[LinkSource]]\n\n\nclass LinkCollector:\n \"\"\"\n Responsible for collecting Link objects from all configured locations,\n making network requests as needed.\n\n The class's main method is its collect_sources() method.\n \"\"\"\n\n def __init__(\n self,\n session: PipSession,\n search_scope: SearchScope,\n ) -> None:\n self.search_scope = search_scope\n self.session = session\n\n @classmethod\n def create(\n cls,\n session: PipSession,\n options: Values,\n suppress_no_index: bool = False,\n ) -> \"LinkCollector\":\n \"\"\"\n :param session: The Session to use to make requests.\n :param suppress_no_index: Whether to ignore the --no-index option\n when constructing the SearchScope object.\n \"\"\"\n index_urls = [options.index_url] + options.extra_index_urls\n if options.no_index and not suppress_no_index:\n logger.debug(\n \"Ignoring indexes: %s\",\n \",\".join(redact_auth_from_url(url) for url in index_urls),\n )\n index_urls = []\n\n # Make sure find_links is a list before passing to create().\n find_links = options.find_links or []\n\n search_scope = SearchScope.create(\n find_links=find_links,\n index_urls=index_urls,\n no_index=options.no_index,\n )\n link_collector = LinkCollector(\n session=session,\n search_scope=search_scope,\n )\n return link_collector\n\n @property\n def find_links(self) -> List[str]:\n return self.search_scope.find_links\n\n def fetch_response(self, location: Link) -> Optional[IndexContent]:\n \"\"\"\n Fetch an HTML page containing package links.\n \"\"\"\n return _get_index_content(location, session=self.session)\n\n def collect_sources(\n self,\n project_name: str,\n candidates_from_page: CandidatesFromPage,\n ) -> CollectedSources:\n # The OrderedDict calls deduplicate sources by URL.\n index_url_sources = collections.OrderedDict(\n build_source(\n loc,\n candidates_from_page=candidates_from_page,\n page_validator=self.session.is_secure_origin,\n expand_dir=False,\n cache_link_parsing=False,\n project_name=project_name,\n )\n for loc in self.search_scope.get_index_urls_locations(project_name)\n ).values()\n find_links_sources = collections.OrderedDict(\n build_source(\n loc,\n candidates_from_page=candidates_from_page,\n page_validator=self.session.is_secure_origin,\n expand_dir=True,\n cache_link_parsing=True,\n project_name=project_name,\n )\n for loc in self.find_links\n ).values()\n\n if logger.isEnabledFor(logging.DEBUG):\n lines = [\n f\"* {s.link}\"\n for s in itertools.chain(find_links_sources, index_url_sources)\n if s is not None and s.link is not None\n ]\n lines = [\n f\"{len(lines)} location(s) to search \"\n f\"for versions of {project_name}:\"\n ] + lines\n logger.debug(\"\\n\".join(lines))\n\n return CollectedSources(\n find_links=list(find_links_sources),\n index_urls=list(index_url_sources),\n )\n",[],[100,509,516,523,475,544,904,919],{"_104":927,"_96":928,"_158":929,"_160":905,"_161":139,"_162":930,"_164":165,"_106":931,"_101":29,"_167":215,"_169":932,"_170":25,"_171":-5,"_172":933,"_99":934},"06bc3eda-67fc-11f0-aad3-0224a6c84d84","package_finder.py","06bc40a6-67fc-11f0-aad3-0224a6c84d84",238,["D",1753299259009],"\"\"\"Routines related to PyPI, indexes\"\"\"\n\nimport enum\nimport functools\nimport itertools\nimport logging\nimport re\nfrom dataclasses import dataclass\nfrom typing import (\n TYPE_CHECKING,\n Dict,\n FrozenSet,\n Iterable,\n List,\n Optional,\n Set,\n Tuple,\n Union,\n)\n\nfrom pip._vendor.packaging import specifiers\nfrom pip._vendor.packaging.tags import Tag\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.packaging.version import InvalidVersion, _BaseVersion\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.exceptions import (\n BestVersionAlreadyInstalled,\n DistributionNotFound,\n InvalidWheelFilename,\n UnsupportedWheel,\n)\nfrom pip._internal.index.collector import LinkCollector, parse_links\nfrom pip._internal.models.candidate import InstallationCandidate\nfrom pip._internal.models.format_control import FormatControl\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.search_scope import SearchScope\nfrom pip._internal.models.selection_prefs import SelectionPreferences\nfrom pip._internal.models.target_python import TargetPython\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.req import InstallRequirement\nfrom pip._internal.utils._log import getLogger\nfrom pip._internal.utils.filetypes import WHEEL_EXTENSION\nfrom pip._internal.utils.hashes import Hashes\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import build_netloc\nfrom pip._internal.utils.packaging import check_requires_python\nfrom pip._internal.utils.unpacking import SUPPORTED_EXTENSIONS\n\nif TYPE_CHECKING:\n from pip._vendor.typing_extensions import TypeGuard\n\n__all__ = [\"FormatControl\", \"BestCandidateResult\", \"PackageFinder\"]\n\n\nlogger = getLogger(__name__)\n\nBuildTag = Union[Tuple[()], Tuple[int, str]]\nCandidateSortingKey = Tuple[int, int, int, _BaseVersion, Optional[int], BuildTag]\n\n\ndef _check_link_requires_python(\n link: Link,\n version_info: Tuple[int, int, int],\n ignore_requires_python: bool = False,\n) -> bool:\n \"\"\"\n Return whether the given Python version is compatible with a link's\n \"Requires-Python\" value.\n\n :param version_info: A 3-tuple of ints representing the Python\n major-minor-micro version to check.\n :param ignore_requires_python: Whether to ignore the \"Requires-Python\"\n value if the given Python version isn't compatible.\n \"\"\"\n try:\n is_compatible = check_requires_python(\n link.requires_python,\n version_info=version_info,\n )\n except specifiers.InvalidSpecifier:\n logger.debug(\n \"Ignoring invalid Requires-Python (%r) for link: %s\",\n link.requires_python,\n link,\n )\n else:\n if not is_compatible:\n version = \".\".join(map(str, version_info))\n if not ignore_requires_python:\n logger.verbose(\n \"Link requires a different Python (%s not in: %r): %s\",\n version,\n link.requires_python,\n link,\n )\n return False\n\n logger.debug(\n \"Ignoring failed Requires-Python check (%s not in: %r) for link: %s\",\n version,\n link.requires_python,\n link,\n )\n\n return True\n\n\nclass LinkType(enum.Enum):\n candidate = enum.auto()\n different_project = enum.auto()\n yanked = enum.auto()\n format_unsupported = enum.auto()\n format_invalid = enum.auto()\n platform_mismatch = enum.auto()\n requires_python_mismatch = enum.auto()\n\n\nclass LinkEvaluator:\n \"\"\"\n Responsible for evaluating links for a particular project.\n \"\"\"\n\n _py_version_re = re.compile(r\"-py([123]\\.?[0-9]?)$\")\n\n # Don't include an allow_yanked default value to make sure each call\n # site considers whether yanked releases are allowed. This also causes\n # that decision to be made explicit in the calling code, which helps\n # people when reading the code.\n def __init__(\n self,\n project_name: str,\n canonical_name: str,\n formats: FrozenSet[str],\n target_python: TargetPython,\n allow_yanked: bool,\n ignore_requires_python: Optional[bool] = None,\n ) -> None:\n \"\"\"\n :param project_name: The user supplied package name.\n :param canonical_name: The canonical package name.\n :param formats: The formats allowed for this package. Should be a set\n with 'binary' or 'source' or both in it.\n :param target_python: The target Python interpreter to use when\n evaluating link compatibility. This is used, for example, to\n check wheel compatibility, as well as when checking the Python\n version, e.g. the Python version embedded in a link filename\n (or egg fragment) and against an HTML link's optional PEP 503\n \"data-requires-python\" attribute.\n :param allow_yanked: Whether files marked as yanked (in the sense\n of PEP 592) are permitted to be candidates for install.\n :param ignore_requires_python: Whether to ignore incompatible\n PEP 503 \"data-requires-python\" values in HTML links. Defaults\n to False.\n \"\"\"\n if ignore_requires_python is None:\n ignore_requires_python = False\n\n self._allow_yanked = allow_yanked\n self._canonical_name = canonical_name\n self._ignore_requires_python = ignore_requires_python\n self._formats = formats\n self._target_python = target_python\n\n self.project_name = project_name\n\n def evaluate_link(self, link: Link) -> Tuple[LinkType, str]:\n \"\"\"\n Determine whether a link is a candidate for installation.\n\n :return: A tuple (result, detail), where *result* is an enum\n representing whether the evaluation found a candidate, or the reason\n why one is not found. If a candidate is found, *detail* will be the\n candidate's version string; if one is not found, it contains the\n reason the link fails to qualify.\n \"\"\"\n version = None\n if link.is_yanked and not self._allow_yanked:\n reason = link.yanked_reason or \"\"\n return (LinkType.yanked, f\"yanked for reason: {reason}\")\n\n if link.egg_fragment:\n egg_info = link.egg_fragment\n ext = link.ext\n else:\n egg_info, ext = link.splitext()\n if not ext:\n return (LinkType.format_unsupported, \"not a file\")\n if ext not in SUPPORTED_EXTENSIONS:\n return (\n LinkType.format_unsupported,\n f\"unsupported archive format: {ext}\",\n )\n if \"binary\" not in self._formats and ext == WHEEL_EXTENSION:\n reason = f\"No binaries permitted for {self.project_name}\"\n return (LinkType.format_unsupported, reason)\n if \"macosx10\" in link.path and ext == \".zip\":\n return (LinkType.format_unsupported, \"macosx10 one\")\n if ext == WHEEL_EXTENSION:\n try:\n wheel = Wheel(link.filename)\n except InvalidWheelFilename:\n return (\n LinkType.format_invalid,\n \"invalid wheel filename\",\n )\n if canonicalize_name(wheel.name) != self._canonical_name:\n reason = f\"wrong project name (not {self.project_name})\"\n return (LinkType.different_project, reason)\n\n supported_tags = self._target_python.get_unsorted_tags()\n if not wheel.supported(supported_tags):\n # Include the wheel's tags in the reason string to\n # simplify troubleshooting compatibility issues.\n file_tags = \", \".join(wheel.get_formatted_file_tags())\n reason = (\n f\"none of the wheel's tags ({file_tags}) are compatible \"\n f\"(run pip debug --verbose to show compatible tags)\"\n )\n return (LinkType.platform_mismatch, reason)\n\n version = wheel.version\n\n # This should be up by the self.ok_binary check, but see issue 2700.\n if \"source\" not in self._formats and ext != WHEEL_EXTENSION:\n reason = f\"No sources permitted for {self.project_name}\"\n return (LinkType.format_unsupported, reason)\n\n if not version:\n version = _extract_version_from_fragment(\n egg_info,\n self._canonical_name,\n )\n if not version:\n reason = f\"Missing project version for {self.project_name}\"\n return (LinkType.format_invalid, reason)\n\n match = self._py_version_re.search(version)\n if match:\n version = version[: match.start()]\n py_version = match.group(1)\n if py_version != self._target_python.py_version:\n return (\n LinkType.platform_mismatch,\n \"Python version is incorrect\",\n )\n\n supports_python = _check_link_requires_python(\n link,\n version_info=self._target_python.py_version_info,\n ignore_requires_python=self._ignore_requires_python,\n )\n if not supports_python:\n reason = f\"{version} Requires-Python {link.requires_python}\"\n return (LinkType.requires_python_mismatch, reason)\n\n logger.debug(\"Found link %s, version: %s\", link, version)\n\n return (LinkType.candidate, version)\n\n\ndef filter_unallowed_hashes(\n candidates: List[InstallationCandidate],\n hashes: Optional[Hashes],\n project_name: str,\n) -> List[InstallationCandidate]:\n \"\"\"\n Filter out candidates whose hashes aren't allowed, and return a new\n list of candidates.\n\n If at least one candidate has an allowed hash, then all candidates with\n either an allowed hash or no hash specified are returned. Otherwise,\n the given candidates are returned.\n\n Including the candidates with no hash specified when there is a match\n allows a warning to be logged if there is a more preferred candidate\n with no hash specified. Returning all candidates in the case of no\n matches lets pip report the hash of the candidate that would otherwise\n have been installed (e.g. permitting the user to more easily update\n their requirements file with the desired hash).\n \"\"\"\n if not hashes:\n logger.debug(\n \"Given no hashes to check %s links for project %r: \"\n \"discarding no candidates\",\n len(candidates),\n project_name,\n )\n # Make sure we're not returning back the given value.\n return list(candidates)\n\n matches_or_no_digest = []\n # Collect the non-matches for logging purposes.\n non_matches = []\n match_count = 0\n for candidate in candidates:\n link = candidate.link\n if not link.has_hash:\n pass\n elif link.is_hash_allowed(hashes=hashes):\n match_count += 1\n else:\n non_matches.append(candidate)\n continue\n\n matches_or_no_digest.append(candidate)\n\n if match_count:\n filtered = matches_or_no_digest\n else:\n # Make sure we're not returning back the given value.\n filtered = list(candidates)\n\n if len(filtered) == len(candidates):\n discard_message = \"discarding no candidates\"\n else:\n discard_message = \"discarding {} non-matches:\\n {}\".format(\n len(non_matches),\n \"\\n \".join(str(candidate.link) for candidate in non_matches),\n )\n\n logger.debug(\n \"Checked %s links for project %r against %s hashes \"\n \"(%s matches, %s no digest): %s\",\n len(candidates),\n project_name,\n hashes.digest_count,\n match_count,\n len(matches_or_no_digest) - match_count,\n discard_message,\n )\n\n return filtered\n\n\n@dataclass\nclass CandidatePreferences:\n \"\"\"\n Encapsulates some of the preferences for filtering and sorting\n InstallationCandidate objects.\n \"\"\"\n\n prefer_binary: bool = False\n allow_all_prereleases: bool = False\n\n\n@dataclass(frozen=True)\nclass BestCandidateResult:\n \"\"\"A collection of candidates, returned by `PackageFinder.find_best_candidate`.\n\n This class is only intended to be instantiated by CandidateEvaluator's\n `compute_best_candidate()` method.\n\n :param all_candidates: A sequence of all available candidates found.\n :param applicable_candidates: The applicable candidates.\n :param best_candidate: The most preferred candidate found, or None\n if no applicable candidates were found.\n \"\"\"\n\n all_candidates: List[InstallationCandidate]\n applicable_candidates: List[InstallationCandidate]\n best_candidate: Optional[InstallationCandidate]\n\n def __post_init__(self) -> None:\n assert set(self.applicable_candidates) <= set(self.all_candidates)\n\n if self.best_candidate is None:\n assert not self.applicable_candidates\n else:\n assert self.best_candidate in self.applicable_candidates\n\n\nclass CandidateEvaluator:\n \"\"\"\n Responsible for filtering and sorting candidates for installation based\n on what tags are valid.\n \"\"\"\n\n @classmethod\n def create(\n cls,\n project_name: str,\n target_python: Optional[TargetPython] = None,\n prefer_binary: bool = False,\n allow_all_prereleases: bool = False,\n specifier: Optional[specifiers.BaseSpecifier] = None,\n hashes: Optional[Hashes] = None,\n ) -> \"CandidateEvaluator\":\n \"\"\"Create a CandidateEvaluator object.\n\n :param target_python: The target Python interpreter to use when\n checking compatibility. If None (the default), a TargetPython\n object will be constructed from the running Python.\n :param specifier: An optional object implementing `filter`\n (e.g. `packaging.specifiers.SpecifierSet`) to filter applicable\n versions.\n :param hashes: An optional collection of allowed hashes.\n \"\"\"\n if target_python is None:\n target_python = TargetPython()\n if specifier is None:\n specifier = specifiers.SpecifierSet()\n\n supported_tags = target_python.get_sorted_tags()\n\n return cls(\n project_name=project_name,\n supported_tags=supported_tags,\n specifier=specifier,\n prefer_binary=prefer_binary,\n allow_all_prereleases=allow_all_prereleases,\n hashes=hashes,\n )\n\n def __init__(\n self,\n project_name: str,\n supported_tags: List[Tag],\n specifier: specifiers.BaseSpecifier,\n prefer_binary: bool = False,\n allow_all_prereleases: bool = False,\n hashes: Optional[Hashes] = None,\n ) -> None:\n \"\"\"\n :param supported_tags: The PEP 425 tags supported by the target\n Python in order of preference (most preferred first).\n \"\"\"\n self._allow_all_prereleases = allow_all_prereleases\n self._hashes = hashes\n self._prefer_binary = prefer_binary\n self._project_name = project_name\n self._specifier = specifier\n self._supported_tags = supported_tags\n # Since the index of the tag in the _supported_tags list is used\n # as a priority, precompute a map from tag to index/priority to be\n # used in wheel.find_most_preferred_tag.\n self._wheel_tag_preferences = {\n tag: idx for idx, tag in enumerate(supported_tags)\n }\n\n def get_applicable_candidates(\n self,\n candidates: List[InstallationCandidate],\n ) -> List[InstallationCandidate]:\n \"\"\"\n Return the applicable candidates from a list of candidates.\n \"\"\"\n # Using None infers from the specifier instead.\n allow_prereleases = self._allow_all_prereleases or None\n specifier = self._specifier\n\n # We turn the version object into a str here because otherwise\n # when we're debundled but setuptools isn't, Python will see\n # packaging.version.Version and\n # pkg_resources._vendor.packaging.version.Version as different\n # types. This way we'll use a str as a common data interchange\n # format. If we stop using the pkg_resources provided specifier\n # and start using our own, we can drop the cast to str().\n candidates_and_versions = [(c, str(c.version)) for c in candidates]\n versions = set(\n specifier.filter(\n (v for _, v in candidates_and_versions),\n prereleases=allow_prereleases,\n )\n )\n\n applicable_candidates = [c for c, v in candidates_and_versions if v in versions]\n filtered_applicable_candidates = filter_unallowed_hashes(\n candidates=applicable_candidates,\n hashes=self._hashes,\n project_name=self._project_name,\n )\n\n return sorted(filtered_applicable_candidates, key=self._sort_key)\n\n def _sort_key(self, candidate: InstallationCandidate) -> CandidateSortingKey:\n \"\"\"\n Function to pass as the `key` argument to a call to sorted() to sort\n InstallationCandidates by preference.\n\n Returns a tuple such that tuples sorting as greater using Python's\n default comparison operator are more preferred.\n\n The preference is as follows:\n\n First and foremost, candidates with allowed (matching) hashes are\n always preferred over candidates without matching hashes. This is\n because e.g. if the only candidate with an allowed hash is yanked,\n we still want to use that candidate.\n\n Second, excepting hash considerations, candidates that have been\n yanked (in the sense of PEP 592) are always less preferred than\n candidates that haven't been yanked. Then:\n\n If not finding wheels, they are sorted by version only.\n If finding wheels, then the sort order is by version, then:\n 1. existing installs\n 2. wheels ordered via Wheel.support_index_min(self._supported_tags)\n 3. source archives\n If prefer_binary was set, then all wheels are sorted above sources.\n\n Note: it was considered to embed this logic into the Link\n comparison operators, but then different sdist links\n with the same version, would have to be considered equal\n \"\"\"\n valid_tags = self._supported_tags\n support_num = len(valid_tags)\n build_tag: BuildTag = ()\n binary_preference = 0\n link = candidate.link\n if link.is_wheel:\n # can raise InvalidWheelFilename\n wheel = Wheel(link.filename)\n try:\n pri = -(\n wheel.find_most_preferred_tag(\n valid_tags, self._wheel_tag_preferences\n )\n )\n except ValueError:\n raise UnsupportedWheel(\n f\"{wheel.filename} is not a supported wheel for this platform. It \"\n \"can't be sorted.\"\n )\n if self._prefer_binary:\n binary_preference = 1\n build_tag = wheel.build_tag\n else: # sdist\n pri = -(support_num)\n has_allowed_hash = int(link.is_hash_allowed(self._hashes))\n yank_value = -1 * int(link.is_yanked) # -1 for yanked.\n return (\n has_allowed_hash,\n yank_value,\n binary_preference,\n candidate.version,\n pri,\n build_tag,\n )\n\n def sort_best_candidate(\n self,\n candidates: List[InstallationCandidate],\n ) -> Optional[InstallationCandidate]:\n \"\"\"\n Return the best candidate per the instance's sort order, or None if\n no candidate is acceptable.\n \"\"\"\n if not candidates:\n return None\n best_candidate = max(candidates, key=self._sort_key)\n return best_candidate\n\n def compute_best_candidate(\n self,\n candidates: List[InstallationCandidate],\n ) -> BestCandidateResult:\n \"\"\"\n Compute and return a `BestCandidateResult` instance.\n \"\"\"\n applicable_candidates = self.get_applicable_candidates(candidates)\n\n best_candidate = self.sort_best_candidate(applicable_candidates)\n\n return BestCandidateResult(\n candidates,\n applicable_candidates=applicable_candidates,\n best_candidate=best_candidate,\n )\n\n\nclass PackageFinder:\n \"\"\"This finds packages.\n\n This is meant to match easy_install's technique for looking for\n packages, by reading pages and looking for appropriate links.\n \"\"\"\n\n def __init__(\n self,\n link_collector: LinkCollector,\n target_python: TargetPython,\n allow_yanked: bool,\n format_control: Optional[FormatControl] = None,\n candidate_prefs: Optional[CandidatePreferences] = None,\n ignore_requires_python: Optional[bool] = None,\n ) -> None:\n \"\"\"\n This constructor is primarily meant to be used by the create() class\n method and from tests.\n\n :param format_control: A FormatControl object, used to control\n the selection of source packages / binary packages when consulting\n the index and links.\n :param candidate_prefs: Options to use when creating a\n CandidateEvaluator object.\n \"\"\"\n if candidate_prefs is None:\n candidate_prefs = CandidatePreferences()\n\n format_control = format_control or FormatControl(set(), set())\n\n self._allow_yanked = allow_yanked\n self._candidate_prefs = candidate_prefs\n self._ignore_requires_python = ignore_requires_python\n self._link_collector = link_collector\n self._target_python = target_python\n\n self.format_control = format_control\n\n # These are boring links that have already been logged somehow.\n self._logged_links: Set[Tuple[Link, LinkType, str]] = set()\n\n # Cache of the result of finding candidates\n self._all_candidates: Dict[str, List[InstallationCandidate]] = {}\n self._best_candidates: Dict[\n Tuple[str, Optional[specifiers.BaseSpecifier], Optional[Hashes]],\n BestCandidateResult,\n ] = {}\n\n # Don't include an allow_yanked default value to make sure each call\n # site considers whether yanked releases are allowed. This also causes\n # that decision to be made explicit in the calling code, which helps\n # people when reading the code.\n @classmethod\n def create(\n cls,\n link_collector: LinkCollector,\n selection_prefs: SelectionPreferences,\n target_python: Optional[TargetPython] = None,\n ) -> \"PackageFinder\":\n \"\"\"Create a PackageFinder.\n\n :param selection_prefs: The candidate selection preferences, as a\n SelectionPreferences object.\n :param target_python: The target Python interpreter to use when\n checking compatibility. If None (the default), a TargetPython\n object will be constructed from the running Python.\n \"\"\"\n if target_python is None:\n target_python = TargetPython()\n\n candidate_prefs = CandidatePreferences(\n prefer_binary=selection_prefs.prefer_binary,\n allow_all_prereleases=selection_prefs.allow_all_prereleases,\n )\n\n return cls(\n candidate_prefs=candidate_prefs,\n link_collector=link_collector,\n target_python=target_python,\n allow_yanked=selection_prefs.allow_yanked,\n format_control=selection_prefs.format_control,\n ignore_requires_python=selection_prefs.ignore_requires_python,\n )\n\n @property\n def target_python(self) -> TargetPython:\n return self._target_python\n\n @property\n def search_scope(self) -> SearchScope:\n return self._link_collector.search_scope\n\n @search_scope.setter\n def search_scope(self, search_scope: SearchScope) -> None:\n self._link_collector.search_scope = search_scope\n\n @property\n def find_links(self) -> List[str]:\n return self._link_collector.find_links\n\n @property\n def index_urls(self) -> List[str]:\n return self.search_scope.index_urls\n\n @property\n def proxy(self) -> Optional[str]:\n return self._link_collector.session.pip_proxy\n\n @property\n def trusted_hosts(self) -> Iterable[str]:\n for host_port in self._link_collector.session.pip_trusted_origins:\n yield build_netloc(*host_port)\n\n @property\n def custom_cert(self) -> Optional[str]:\n # session.verify is either a boolean (use default bundle/no SSL\n # verification) or a string path to a custom CA bundle to use. We only\n # care about the latter.\n verify = self._link_collector.session.verify\n return verify if isinstance(verify, str) else None\n\n @property\n def client_cert(self) -> Optional[str]:\n cert = self._link_collector.session.cert\n assert not isinstance(cert, tuple), \"pip only supports PEM client certs\"\n return cert\n\n @property\n def allow_all_prereleases(self) -> bool:\n return self._candidate_prefs.allow_all_prereleases\n\n def set_allow_all_prereleases(self) -> None:\n self._candidate_prefs.allow_all_prereleases = True\n\n @property\n def prefer_binary(self) -> bool:\n return self._candidate_prefs.prefer_binary\n\n def set_prefer_binary(self) -> None:\n self._candidate_prefs.prefer_binary = True\n\n def requires_python_skipped_reasons(self) -> List[str]:\n reasons = {\n detail\n for _, result, detail in self._logged_links\n if result == LinkType.requires_python_mismatch\n }\n return sorted(reasons)\n\n def make_link_evaluator(self, project_name: str) -> LinkEvaluator:\n canonical_name = canonicalize_name(project_name)\n formats = self.format_control.get_allowed_formats(canonical_name)\n\n return LinkEvaluator(\n project_name=project_name,\n canonical_name=canonical_name,\n formats=formats,\n target_python=self._target_python,\n allow_yanked=self._allow_yanked,\n ignore_requires_python=self._ignore_requires_python,\n )\n\n def _sort_links(self, links: Iterable[Link]) -> List[Link]:\n \"\"\"\n Returns elements of links in order, non-egg links first, egg links\n second, while eliminating duplicates\n \"\"\"\n eggs, no_eggs = [], []\n seen: Set[Link] = set()\n for link in links:\n if link not in seen:\n seen.add(link)\n if link.egg_fragment:\n eggs.append(link)\n else:\n no_eggs.append(link)\n return no_eggs + eggs\n\n def _log_skipped_link(self, link: Link, result: LinkType, detail: str) -> None:\n entry = (link, result, detail)\n if entry not in self._logged_links:\n # Put the link at the end so the reason is more visible and because\n # the link string is usually very long.\n logger.debug(\"Skipping link: %s: %s\", detail, link)\n self._logged_links.add(entry)\n\n def get_install_candidate(\n self, link_evaluator: LinkEvaluator, link: Link\n ) -> Optional[InstallationCandidate]:\n \"\"\"\n If the link is a candidate for install, convert it to an\n InstallationCandidate and return it. Otherwise, return None.\n \"\"\"\n result, detail = link_evaluator.evaluate_link(link)\n if result != LinkType.candidate:\n self._log_skipped_link(link, result, detail)\n return None\n\n try:\n return InstallationCandidate(\n name=link_evaluator.project_name,\n link=link,\n version=detail,\n )\n except InvalidVersion:\n return None\n\n def evaluate_links(\n self, link_evaluator: LinkEvaluator, links: Iterable[Link]\n ) -> List[InstallationCandidate]:\n \"\"\"\n Convert links that are candidates to InstallationCandidate objects.\n \"\"\"\n candidates = []\n for link in self._sort_links(links):\n candidate = self.get_install_candidate(link_evaluator, link)\n if candidate is not None:\n candidates.append(candidate)\n\n return candidates\n\n def process_project_url(\n self, project_url: Link, link_evaluator: LinkEvaluator\n ) -> List[InstallationCandidate]:\n logger.debug(\n \"Fetching project page and analyzing links: %s\",\n project_url,\n )\n index_response = self._link_collector.fetch_response(project_url)\n if index_response is None:\n return []\n\n page_links = list(parse_links(index_response))\n\n with indent_log():\n package_links = self.evaluate_links(\n link_evaluator,\n links=page_links,\n )\n\n return package_links\n\n def find_all_candidates(self, project_name: str) -> List[InstallationCandidate]:\n \"\"\"Find all available InstallationCandidate for project_name\n\n This checks index_urls and find_links.\n All versions found are returned as an InstallationCandidate list.\n\n See LinkEvaluator.evaluate_link() for details on which files\n are accepted.\n \"\"\"\n if project_name in self._all_candidates:\n return self._all_candidates[project_name]\n\n link_evaluator = self.make_link_evaluator(project_name)\n\n collected_sources = self._link_collector.collect_sources(\n project_name=project_name,\n candidates_from_page=functools.partial(\n self.process_project_url,\n link_evaluator=link_evaluator,\n ),\n )\n\n page_candidates_it = itertools.chain.from_iterable(\n source.page_candidates()\n for sources in collected_sources\n for source in sources\n if source is not None\n )\n page_candidates = list(page_candidates_it)\n\n file_links_it = itertools.chain.from_iterable(\n source.file_links()\n for sources in collected_sources\n for source in sources\n if source is not None\n )\n file_candidates = self.evaluate_links(\n link_evaluator,\n sorted(file_links_it, reverse=True),\n )\n\n if logger.isEnabledFor(logging.DEBUG) and file_candidates:\n paths = []\n for candidate in file_candidates:\n assert candidate.link.url # we need to have a URL\n try:\n paths.append(candidate.link.file_path)\n except Exception:\n paths.append(candidate.link.url) # it's not a local file\n\n logger.debug(\"Local files found: %s\", \", \".join(paths))\n\n # This is an intentional priority ordering\n self._all_candidates[project_name] = file_candidates + page_candidates\n\n return self._all_candidates[project_name]\n\n def make_candidate_evaluator(\n self,\n project_name: str,\n specifier: Optional[specifiers.BaseSpecifier] = None,\n hashes: Optional[Hashes] = None,\n ) -> CandidateEvaluator:\n \"\"\"Create a CandidateEvaluator object to use.\"\"\"\n candidate_prefs = self._candidate_prefs\n return CandidateEvaluator.create(\n project_name=project_name,\n target_python=self._target_python,\n prefer_binary=candidate_prefs.prefer_binary,\n allow_all_prereleases=candidate_prefs.allow_all_prereleases,\n specifier=specifier,\n hashes=hashes,\n )\n\n def find_best_candidate(\n self,\n project_name: str,\n specifier: Optional[specifiers.BaseSpecifier] = None,\n hashes: Optional[Hashes] = None,\n ) -> BestCandidateResult:\n \"\"\"Find matches for the given project and specifier.\n\n :param specifier: An optional object implementing `filter`\n (e.g. `packaging.specifiers.SpecifierSet`) to filter applicable\n versions.\n\n :return: A `BestCandidateResult` instance.\n \"\"\"\n if (project_name, specifier, hashes) in self._best_candidates:\n return self._best_candidates[project_name, specifier, hashes]\n\n candidates = self.find_all_candidates(project_name)\n candidate_evaluator = self.make_candidate_evaluator(\n project_name=project_name,\n specifier=specifier,\n hashes=hashes,\n )\n self._best_candidates[project_name, specifier, hashes] = (\n candidate_evaluator.compute_best_candidate(candidates)\n )\n\n return self._best_candidates[project_name, specifier, hashes]\n\n def find_requirement(\n self, req: InstallRequirement, upgrade: bool\n ) -> Optional[InstallationCandidate]:\n \"\"\"Try to find a Link matching req\n\n Expects req, an InstallRequirement and upgrade, a boolean\n Returns a InstallationCandidate if found,\n Raises DistributionNotFound or BestVersionAlreadyInstalled otherwise\n \"\"\"\n name = req.name\n assert name is not None, \"find_requirement() called with no name\"\n\n hashes = req.hashes(trust_internet=False)\n best_candidate_result = self.find_best_candidate(\n name,\n specifier=req.specifier,\n hashes=hashes,\n )\n best_candidate = best_candidate_result.best_candidate\n\n installed_version: Optional[_BaseVersion] = None\n if req.satisfied_by is not None:\n installed_version = req.satisfied_by.version\n\n def _format_versions(cand_iter: Iterable[InstallationCandidate]) -> str:\n # This repeated parse_version and str() conversion is needed to\n # handle different vendoring sources from pip and pkg_resources.\n # If we stop using the pkg_resources provided specifier and start\n # using our own, we can drop the cast to str().\n return (\n \", \".join(\n sorted(\n {str(c.version) for c in cand_iter},\n key=parse_version,\n )\n )\n or \"none\"\n )\n\n if installed_version is None and best_candidate is None:\n logger.critical(\n \"Could not find a version that satisfies the requirement %s \"\n \"(from versions: %s)\",\n req,\n _format_versions(best_candidate_result.all_candidates),\n )\n\n raise DistributionNotFound(f\"No matching distribution found for {req}\")\n\n def _should_install_candidate(\n candidate: Optional[InstallationCandidate],\n ) -> \"TypeGuard[InstallationCandidate]\":\n if installed_version is None:\n return True\n if best_candidate is None:\n return False\n return best_candidate.version > installed_version\n\n if not upgrade and installed_version is not None:\n if _should_install_candidate(best_candidate):\n logger.debug(\n \"Existing installed version (%s) satisfies requirement \"\n \"(most up-to-date version is %s)\",\n installed_version,\n best_candidate.version,\n )\n else:\n logger.debug(\n \"Existing installed version (%s) is most up-to-date and \"\n \"satisfies requirement\",\n installed_version,\n )\n return None\n\n if _should_install_candidate(best_candidate):\n logger.debug(\n \"Using version %s (newest of versions: %s)\",\n best_candidate.version,\n _format_versions(best_candidate_result.applicable_candidates),\n )\n return best_candidate\n\n # We have an existing version, and its the best version\n logger.debug(\n \"Installed version (%s) is most up-to-date (past versions: %s)\",\n installed_version,\n _format_versions(best_candidate_result.applicable_candidates),\n )\n raise BestVersionAlreadyInstalled\n\n\ndef _find_name_version_sep(fragment: str, canonical_name: str) -> int:\n \"\"\"Find the separator's index based on the package's canonical name.\n\n :param fragment: A + filename \"fragment\" (stem) or\n egg fragment.\n :param canonical_name: The package's canonical name.\n\n This function is needed since the canonicalized name does not necessarily\n have the same length as the egg info's name part. An example::\n\n >>> fragment = 'foo__bar-1.0'\n >>> canonical_name = 'foo-bar'\n >>> _find_name_version_sep(fragment, canonical_name)\n 8\n \"\"\"\n # Project name and version must be separated by one single dash. Find all\n # occurrences of dashes; if the string in front of it matches the canonical\n # name, this is the one separating the name and version parts.\n for i, c in enumerate(fragment):\n if c != \"-\":\n continue\n if canonicalize_name(fragment[:i]) == canonical_name:\n return i\n raise ValueError(f\"{fragment} does not match {canonical_name}\")\n\n\ndef _extract_version_from_fragment(fragment: str, canonical_name: str) -> Optional[str]:\n \"\"\"Parse the version string from a + filename\n \"fragment\" (stem) or egg fragment.\n\n :param fragment: The string to parse. E.g. foo-2.1\n :param canonical_name: The canonicalized name of the package this\n belongs to.\n \"\"\"\n try:\n version_start = _find_name_version_sep(fragment, canonical_name) + 1\n except ValueError:\n return None\n version = fragment[version_start:]\n if not version:\n return None\n return version\n",[],[100,509,516,523,475,544,904,928],{"_104":936,"_96":937,"_158":938,"_160":905,"_161":139,"_162":939,"_164":165,"_106":940,"_101":29,"_167":215,"_169":941,"_170":25,"_171":-5,"_172":942,"_99":943},"06b2168a-67fc-11f0-805e-0224a6c84d84","sources.py","06b2175c-67fc-11f0-805e-0224a6c84d84",236,["D",1753299259013],"import logging\nimport mimetypes\nimport os\nfrom collections import defaultdict\nfrom typing import Callable, Dict, Iterable, List, Optional, Tuple\n\nfrom pip._vendor.packaging.utils import (\n InvalidSdistFilename,\n InvalidWheelFilename,\n canonicalize_name,\n parse_sdist_filename,\n parse_wheel_filename,\n)\n\nfrom pip._internal.models.candidate import InstallationCandidate\nfrom pip._internal.models.link import Link\nfrom pip._internal.utils.urls import path_to_url, url_to_path\nfrom pip._internal.vcs import is_url\n\nlogger = logging.getLogger(__name__)\n\nFoundCandidates = Iterable[InstallationCandidate]\nFoundLinks = Iterable[Link]\nCandidatesFromPage = Callable[[Link], Iterable[InstallationCandidate]]\nPageValidator = Callable[[Link], bool]\n\n\nclass LinkSource:\n @property\n def link(self) -> Optional[Link]:\n \"\"\"Returns the underlying link, if there's one.\"\"\"\n raise NotImplementedError()\n\n def page_candidates(self) -> FoundCandidates:\n \"\"\"Candidates found by parsing an archive listing HTML file.\"\"\"\n raise NotImplementedError()\n\n def file_links(self) -> FoundLinks:\n \"\"\"Links found by specifying archives directly.\"\"\"\n raise NotImplementedError()\n\n\ndef _is_html_file(file_url: str) -> bool:\n return mimetypes.guess_type(file_url, strict=False)[0] == \"text/html\"\n\n\nclass _FlatDirectoryToUrls:\n \"\"\"Scans directory and caches results\"\"\"\n\n def __init__(self, path: str) -> None:\n self._path = path\n self._page_candidates: List[str] = []\n self._project_name_to_urls: Dict[str, List[str]] = defaultdict(list)\n self._scanned_directory = False\n\n def _scan_directory(self) -> None:\n \"\"\"Scans directory once and populates both page_candidates\n and project_name_to_urls at the same time\n \"\"\"\n for entry in os.scandir(self._path):\n url = path_to_url(entry.path)\n if _is_html_file(url):\n self._page_candidates.append(url)\n continue\n\n # File must have a valid wheel or sdist name,\n # otherwise not worth considering as a package\n try:\n project_filename = parse_wheel_filename(entry.name)[0]\n except InvalidWheelFilename:\n try:\n project_filename = parse_sdist_filename(entry.name)[0]\n except InvalidSdistFilename:\n continue\n\n self._project_name_to_urls[project_filename].append(url)\n self._scanned_directory = True\n\n @property\n def page_candidates(self) -> List[str]:\n if not self._scanned_directory:\n self._scan_directory()\n\n return self._page_candidates\n\n @property\n def project_name_to_urls(self) -> Dict[str, List[str]]:\n if not self._scanned_directory:\n self._scan_directory()\n\n return self._project_name_to_urls\n\n\nclass _FlatDirectorySource(LinkSource):\n \"\"\"Link source specified by ``--find-links=``.\n\n This looks the content of the directory, and returns:\n\n * ``page_candidates``: Links listed on each HTML file in the directory.\n * ``file_candidates``: Archives in the directory.\n \"\"\"\n\n _paths_to_urls: Dict[str, _FlatDirectoryToUrls] = {}\n\n def __init__(\n self,\n candidates_from_page: CandidatesFromPage,\n path: str,\n project_name: str,\n ) -> None:\n self._candidates_from_page = candidates_from_page\n self._project_name = canonicalize_name(project_name)\n\n # Get existing instance of _FlatDirectoryToUrls if it exists\n if path in self._paths_to_urls:\n self._path_to_urls = self._paths_to_urls[path]\n else:\n self._path_to_urls = _FlatDirectoryToUrls(path=path)\n self._paths_to_urls[path] = self._path_to_urls\n\n @property\n def link(self) -> Optional[Link]:\n return None\n\n def page_candidates(self) -> FoundCandidates:\n for url in self._path_to_urls.page_candidates:\n yield from self._candidates_from_page(Link(url))\n\n def file_links(self) -> FoundLinks:\n for url in self._path_to_urls.project_name_to_urls[self._project_name]:\n yield Link(url)\n\n\nclass _LocalFileSource(LinkSource):\n \"\"\"``--find-links=`` or ``--[extra-]index-url=``.\n\n If a URL is supplied, it must be a ``file:`` URL. If a path is supplied to\n the option, it is converted to a URL first. This returns:\n\n * ``page_candidates``: Links listed on an HTML file.\n * ``file_candidates``: The non-HTML file.\n \"\"\"\n\n def __init__(\n self,\n candidates_from_page: CandidatesFromPage,\n link: Link,\n ) -> None:\n self._candidates_from_page = candidates_from_page\n self._link = link\n\n @property\n def link(self) -> Optional[Link]:\n return self._link\n\n def page_candidates(self) -> FoundCandidates:\n if not _is_html_file(self._link.url):\n return\n yield from self._candidates_from_page(self._link)\n\n def file_links(self) -> FoundLinks:\n if _is_html_file(self._link.url):\n return\n yield self._link\n\n\nclass _RemoteFileSource(LinkSource):\n \"\"\"``--find-links=`` or ``--[extra-]index-url=``.\n\n This returns:\n\n * ``page_candidates``: Links listed on an HTML file.\n * ``file_candidates``: The non-HTML file.\n \"\"\"\n\n def __init__(\n self,\n candidates_from_page: CandidatesFromPage,\n page_validator: PageValidator,\n link: Link,\n ) -> None:\n self._candidates_from_page = candidates_from_page\n self._page_validator = page_validator\n self._link = link\n\n @property\n def link(self) -> Optional[Link]:\n return self._link\n\n def page_candidates(self) -> FoundCandidates:\n if not self._page_validator(self._link):\n return\n yield from self._candidates_from_page(self._link)\n\n def file_links(self) -> FoundLinks:\n yield self._link\n\n\nclass _IndexDirectorySource(LinkSource):\n \"\"\"``--[extra-]index-url=``.\n\n This is treated like a remote URL; ``candidates_from_page`` contains logic\n for this by appending ``index.html`` to the link.\n \"\"\"\n\n def __init__(\n self,\n candidates_from_page: CandidatesFromPage,\n link: Link,\n ) -> None:\n self._candidates_from_page = candidates_from_page\n self._link = link\n\n @property\n def link(self) -> Optional[Link]:\n return self._link\n\n def page_candidates(self) -> FoundCandidates:\n yield from self._candidates_from_page(self._link)\n\n def file_links(self) -> FoundLinks:\n return ()\n\n\ndef build_source(\n location: str,\n *,\n candidates_from_page: CandidatesFromPage,\n page_validator: PageValidator,\n expand_dir: bool,\n cache_link_parsing: bool,\n project_name: str,\n) -> Tuple[Optional[str], Optional[LinkSource]]:\n path: Optional[str] = None\n url: Optional[str] = None\n if os.path.exists(location): # Is a local path.\n url = path_to_url(location)\n path = location\n elif location.startswith(\"file:\"): # A file: URL.\n url = location\n path = url_to_path(location)\n elif is_url(location):\n url = location\n\n if url is None:\n msg = (\n \"Location '%s' is ignored: \"\n \"it is either a non-existing path or lacks a specific scheme.\"\n )\n logger.warning(msg, location)\n return (None, None)\n\n if path is None:\n source: LinkSource = _RemoteFileSource(\n candidates_from_page=candidates_from_page,\n page_validator=page_validator,\n link=Link(url, cache_link_parsing=cache_link_parsing),\n )\n return (url, source)\n\n if os.path.isdir(path):\n if expand_dir:\n source = _FlatDirectorySource(\n candidates_from_page=candidates_from_page,\n path=path,\n project_name=project_name,\n )\n else:\n source = _IndexDirectorySource(\n candidates_from_page=candidates_from_page,\n link=Link(url, cache_link_parsing=cache_link_parsing),\n )\n return (url, source)\n elif os.path.isfile(path):\n source = _LocalFileSource(\n candidates_from_page=candidates_from_page,\n link=Link(url, cache_link_parsing=cache_link_parsing),\n )\n return (url, source)\n logger.warning(\n \"Location '%s' is ignored: it is neither a file nor a directory.\",\n location,\n )\n return (url, None)\n",[],[100,509,516,523,475,544,904,937],[100,509,516,523,475,544,904],{"_104":946,"_96":947,"_158":948,"_160":545,"_161":139,"_162":949,"_164":165,"_106":950,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":951,"_99":986},"fceb31e0-67fb-11f0-bf1a-0224a6c84d84","locations","fceb32e4-67fb-11f0-bf1a-0224a6c84d84",65,["D",1753299242612],[952,960,969,978],{"_104":953,"_96":558,"_158":954,"_160":948,"_161":139,"_162":955,"_164":165,"_106":956,"_101":29,"_167":215,"_169":957,"_170":25,"_171":-5,"_172":958,"_99":959},"068b4320-67fc-11f0-9ad5-0224a6c84d84","068b43c0-67fc-11f0-9ad5-0224a6c84d84",229,["D",1753299258762],"import functools\nimport logging\nimport os\nimport pathlib\nimport sys\nimport sysconfig\nfrom typing import Any, Dict, Optional\n\nfrom pip._internal.models.scheme import SCHEME_KEYS, Scheme\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.deprecation import deprecated\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\nfrom . import _sysconfig\nfrom .base import (\n USER_CACHE_DIR,\n get_major_minor_version,\n get_src_prefix,\n is_osx_framework,\n site_packages,\n user_site,\n)\n\n__all__ = [\n \"USER_CACHE_DIR\",\n \"get_bin_prefix\",\n \"get_bin_user\",\n \"get_major_minor_version\",\n \"get_platlib\",\n \"get_purelib\",\n \"get_scheme\",\n \"get_src_prefix\",\n \"site_packages\",\n \"user_site\",\n]\n\n\nlogger = logging.getLogger(__name__)\n\n\n_PLATLIBDIR: str = getattr(sys, \"platlibdir\", \"lib\")\n\n_USE_SYSCONFIG_DEFAULT = sys.version_info >= (3, 10)\n\n\ndef _should_use_sysconfig() -> bool:\n \"\"\"This function determines the value of _USE_SYSCONFIG.\n\n By default, pip uses sysconfig on Python 3.10+.\n But Python distributors can override this decision by setting:\n sysconfig._PIP_USE_SYSCONFIG = True / False\n Rationale in https://github.com/pypa/pip/issues/10647\n\n This is a function for testability, but should be constant during any one\n run.\n \"\"\"\n return bool(getattr(sysconfig, \"_PIP_USE_SYSCONFIG\", _USE_SYSCONFIG_DEFAULT))\n\n\n_USE_SYSCONFIG = _should_use_sysconfig()\n\nif not _USE_SYSCONFIG:\n # Import distutils lazily to avoid deprecation warnings,\n # but import it soon enough that it is in memory and available during\n # a pip reinstall.\n from . import _distutils\n\n# Be noisy about incompatibilities if this platforms \"should\" be using\n# sysconfig, but is explicitly opting out and using distutils instead.\nif _USE_SYSCONFIG_DEFAULT and not _USE_SYSCONFIG:\n _MISMATCH_LEVEL = logging.WARNING\nelse:\n _MISMATCH_LEVEL = logging.DEBUG\n\n\ndef _looks_like_bpo_44860() -> bool:\n \"\"\"The resolution to bpo-44860 will change this incorrect platlib.\n\n See .\n \"\"\"\n from distutils.command.install import INSTALL_SCHEMES\n\n try:\n unix_user_platlib = INSTALL_SCHEMES[\"unix_user\"][\"platlib\"]\n except KeyError:\n return False\n return unix_user_platlib == \"$usersite\"\n\n\ndef _looks_like_red_hat_patched_platlib_purelib(scheme: Dict[str, str]) -> bool:\n platlib = scheme[\"platlib\"]\n if \"/$platlibdir/\" in platlib:\n platlib = platlib.replace(\"/$platlibdir/\", f\"/{_PLATLIBDIR}/\")\n if \"/lib64/\" not in platlib:\n return False\n unpatched = platlib.replace(\"/lib64/\", \"/lib/\")\n return unpatched.replace(\"$platbase/\", \"$base/\") == scheme[\"purelib\"]\n\n\n@functools.lru_cache(maxsize=None)\ndef _looks_like_red_hat_lib() -> bool:\n \"\"\"Red Hat patches platlib in unix_prefix and unix_home, but not purelib.\n\n This is the only way I can see to tell a Red Hat-patched Python.\n \"\"\"\n from distutils.command.install import INSTALL_SCHEMES\n\n return all(\n k in INSTALL_SCHEMES\n and _looks_like_red_hat_patched_platlib_purelib(INSTALL_SCHEMES[k])\n for k in (\"unix_prefix\", \"unix_home\")\n )\n\n\n@functools.lru_cache(maxsize=None)\ndef _looks_like_debian_scheme() -> bool:\n \"\"\"Debian adds two additional schemes.\"\"\"\n from distutils.command.install import INSTALL_SCHEMES\n\n return \"deb_system\" in INSTALL_SCHEMES and \"unix_local\" in INSTALL_SCHEMES\n\n\n@functools.lru_cache(maxsize=None)\ndef _looks_like_red_hat_scheme() -> bool:\n \"\"\"Red Hat patches ``sys.prefix`` and ``sys.exec_prefix``.\n\n Red Hat's ``00251-change-user-install-location.patch`` changes the install\n command's ``prefix`` and ``exec_prefix`` to append ``\"/local\"``. This is\n (fortunately?) done quite unconditionally, so we create a default command\n object without any configuration to detect this.\n \"\"\"\n from distutils.command.install import install\n from distutils.dist import Distribution\n\n cmd: Any = install(Distribution())\n cmd.finalize_options()\n return (\n cmd.exec_prefix == f\"{os.path.normpath(sys.exec_prefix)}/local\"\n and cmd.prefix == f\"{os.path.normpath(sys.prefix)}/local\"\n )\n\n\n@functools.lru_cache(maxsize=None)\ndef _looks_like_slackware_scheme() -> bool:\n \"\"\"Slackware patches sysconfig but fails to patch distutils and site.\n\n Slackware changes sysconfig's user scheme to use ``\"lib64\"`` for the lib\n path, but does not do the same to the site module.\n \"\"\"\n if user_site is None: # User-site not available.\n return False\n try:\n paths = sysconfig.get_paths(scheme=\"posix_user\", expand=False)\n except KeyError: # User-site not available.\n return False\n return \"/lib64/\" in paths[\"purelib\"] and \"/lib64/\" not in user_site\n\n\n@functools.lru_cache(maxsize=None)\ndef _looks_like_msys2_mingw_scheme() -> bool:\n \"\"\"MSYS2 patches distutils and sysconfig to use a UNIX-like scheme.\n\n However, MSYS2 incorrectly patches sysconfig ``nt`` scheme. The fix is\n likely going to be included in their 3.10 release, so we ignore the warning.\n See msys2/MINGW-packages#9319.\n\n MSYS2 MINGW's patch uses lowercase ``\"lib\"`` instead of the usual uppercase,\n and is missing the final ``\"site-packages\"``.\n \"\"\"\n paths = sysconfig.get_paths(\"nt\", expand=False)\n return all(\n \"Lib\" not in p and \"lib\" in p and not p.endswith(\"site-packages\")\n for p in (paths[key] for key in (\"platlib\", \"purelib\"))\n )\n\n\n@functools.lru_cache(maxsize=None)\ndef _warn_mismatched(old: pathlib.Path, new: pathlib.Path, *, key: str) -> None:\n issue_url = \"https://github.com/pypa/pip/issues/10151\"\n message = (\n \"Value for %s does not match. Please report this to <%s>\"\n \"\\ndistutils: %s\"\n \"\\nsysconfig: %s\"\n )\n logger.log(_MISMATCH_LEVEL, message, key, issue_url, old, new)\n\n\ndef _warn_if_mismatch(old: pathlib.Path, new: pathlib.Path, *, key: str) -> bool:\n if old == new:\n return False\n _warn_mismatched(old, new, key=key)\n return True\n\n\n@functools.lru_cache(maxsize=None)\ndef _log_context(\n *,\n user: bool = False,\n home: Optional[str] = None,\n root: Optional[str] = None,\n prefix: Optional[str] = None,\n) -> None:\n parts = [\n \"Additional context:\",\n \"user = %r\",\n \"home = %r\",\n \"root = %r\",\n \"prefix = %r\",\n ]\n\n logger.log(_MISMATCH_LEVEL, \"\\n\".join(parts), user, home, root, prefix)\n\n\ndef get_scheme(\n dist_name: str,\n user: bool = False,\n home: Optional[str] = None,\n root: Optional[str] = None,\n isolated: bool = False,\n prefix: Optional[str] = None,\n) -> Scheme:\n new = _sysconfig.get_scheme(\n dist_name,\n user=user,\n home=home,\n root=root,\n isolated=isolated,\n prefix=prefix,\n )\n if _USE_SYSCONFIG:\n return new\n\n old = _distutils.get_scheme(\n dist_name,\n user=user,\n home=home,\n root=root,\n isolated=isolated,\n prefix=prefix,\n )\n\n warning_contexts = []\n for k in SCHEME_KEYS:\n old_v = pathlib.Path(getattr(old, k))\n new_v = pathlib.Path(getattr(new, k))\n\n if old_v == new_v:\n continue\n\n # distutils incorrectly put PyPy packages under ``site-packages/python``\n # in the ``posix_home`` scheme, but PyPy devs said they expect the\n # directory name to be ``pypy`` instead. So we treat this as a bug fix\n # and not warn about it. See bpo-43307 and python/cpython#24628.\n skip_pypy_special_case = (\n sys.implementation.name == \"pypy\"\n and home is not None\n and k in (\"platlib\", \"purelib\")\n and old_v.parent == new_v.parent\n and old_v.name.startswith(\"python\")\n and new_v.name.startswith(\"pypy\")\n )\n if skip_pypy_special_case:\n continue\n\n # sysconfig's ``osx_framework_user`` does not include ``pythonX.Y`` in\n # the ``include`` value, but distutils's ``headers`` does. We'll let\n # CPython decide whether this is a bug or feature. See bpo-43948.\n skip_osx_framework_user_special_case = (\n user\n and is_osx_framework()\n and k == \"headers\"\n and old_v.parent.parent == new_v.parent\n and old_v.parent.name.startswith(\"python\")\n )\n if skip_osx_framework_user_special_case:\n continue\n\n # On Red Hat and derived Linux distributions, distutils is patched to\n # use \"lib64\" instead of \"lib\" for platlib.\n if k == \"platlib\" and _looks_like_red_hat_lib():\n continue\n\n # On Python 3.9+, sysconfig's posix_user scheme sets platlib against\n # sys.platlibdir, but distutils's unix_user incorrectly coninutes\n # using the same $usersite for both platlib and purelib. This creates a\n # mismatch when sys.platlibdir is not \"lib\".\n skip_bpo_44860 = (\n user\n and k == \"platlib\"\n and not WINDOWS\n and _PLATLIBDIR != \"lib\"\n and _looks_like_bpo_44860()\n )\n if skip_bpo_44860:\n continue\n\n # Slackware incorrectly patches posix_user to use lib64 instead of lib,\n # but not usersite to match the location.\n skip_slackware_user_scheme = (\n user\n and k in (\"platlib\", \"purelib\")\n and not WINDOWS\n and _looks_like_slackware_scheme()\n )\n if skip_slackware_user_scheme:\n continue\n\n # Both Debian and Red Hat patch Python to place the system site under\n # /usr/local instead of /usr. Debian also places lib in dist-packages\n # instead of site-packages, but the /usr/local check should cover it.\n skip_linux_system_special_case = (\n not (user or home or prefix or running_under_virtualenv())\n and old_v.parts[1:3] == (\"usr\", \"local\")\n and len(new_v.parts) > 1\n and new_v.parts[1] == \"usr\"\n and (len(new_v.parts) < 3 or new_v.parts[2] != \"local\")\n and (_looks_like_red_hat_scheme() or _looks_like_debian_scheme())\n )\n if skip_linux_system_special_case:\n continue\n\n # MSYS2 MINGW's sysconfig patch does not include the \"site-packages\"\n # part of the path. This is incorrect and will be fixed in MSYS.\n skip_msys2_mingw_bug = (\n WINDOWS and k in (\"platlib\", \"purelib\") and _looks_like_msys2_mingw_scheme()\n )\n if skip_msys2_mingw_bug:\n continue\n\n # CPython's POSIX install script invokes pip (via ensurepip) against the\n # interpreter located in the source tree, not the install site. This\n # triggers special logic in sysconfig that's not present in distutils.\n # https://github.com/python/cpython/blob/8c21941ddaf/Lib/sysconfig.py#L178-L194\n skip_cpython_build = (\n sysconfig.is_python_build(check_home=True)\n and not WINDOWS\n and k in (\"headers\", \"include\", \"platinclude\")\n )\n if skip_cpython_build:\n continue\n\n warning_contexts.append((old_v, new_v, f\"scheme.{k}\"))\n\n if not warning_contexts:\n return old\n\n # Check if this path mismatch is caused by distutils config files. Those\n # files will no longer work once we switch to sysconfig, so this raises a\n # deprecation message for them.\n default_old = _distutils.distutils_scheme(\n dist_name,\n user,\n home,\n root,\n isolated,\n prefix,\n ignore_config_files=True,\n )\n if any(default_old[k] != getattr(old, k) for k in SCHEME_KEYS):\n deprecated(\n reason=(\n \"Configuring installation scheme with distutils config files \"\n \"is deprecated and will no longer work in the near future. If you \"\n \"are using a Homebrew or Linuxbrew Python, please see discussion \"\n \"at https://github.com/Homebrew/homebrew-core/issues/76621\"\n ),\n replacement=None,\n gone_in=None,\n )\n return old\n\n # Post warnings about this mismatch so user can report them back.\n for old_v, new_v, key in warning_contexts:\n _warn_mismatched(old_v, new_v, key=key)\n _log_context(user=user, home=home, root=root, prefix=prefix)\n\n return old\n\n\ndef get_bin_prefix() -> str:\n new = _sysconfig.get_bin_prefix()\n if _USE_SYSCONFIG:\n return new\n\n old = _distutils.get_bin_prefix()\n if _warn_if_mismatch(pathlib.Path(old), pathlib.Path(new), key=\"bin_prefix\"):\n _log_context()\n return old\n\n\ndef get_bin_user() -> str:\n return _sysconfig.get_scheme(\"\", user=True).scripts\n\n\ndef _looks_like_deb_system_dist_packages(value: str) -> bool:\n \"\"\"Check if the value is Debian's APT-controlled dist-packages.\n\n Debian's ``distutils.sysconfig.get_python_lib()`` implementation returns the\n default package path controlled by APT, but does not patch ``sysconfig`` to\n do the same. This is similar to the bug worked around in ``get_scheme()``,\n but here the default is ``deb_system`` instead of ``unix_local``. Ultimately\n we can't do anything about this Debian bug, and this detection allows us to\n skip the warning when needed.\n \"\"\"\n if not _looks_like_debian_scheme():\n return False\n if value == \"/usr/lib/python3/dist-packages\":\n return True\n return False\n\n\ndef get_purelib() -> str:\n \"\"\"Return the default pure-Python lib location.\"\"\"\n new = _sysconfig.get_purelib()\n if _USE_SYSCONFIG:\n return new\n\n old = _distutils.get_purelib()\n if _looks_like_deb_system_dist_packages(old):\n return old\n if _warn_if_mismatch(pathlib.Path(old), pathlib.Path(new), key=\"purelib\"):\n _log_context()\n return old\n\n\ndef get_platlib() -> str:\n \"\"\"Return the default platform-shared lib location.\"\"\"\n new = _sysconfig.get_platlib()\n if _USE_SYSCONFIG:\n return new\n\n from . import _distutils\n\n old = _distutils.get_platlib()\n if _looks_like_deb_system_dist_packages(old):\n return old\n if _warn_if_mismatch(pathlib.Path(old), pathlib.Path(new), key=\"platlib\"):\n _log_context()\n return old\n",[],[100,509,516,523,475,544,947,558],{"_104":961,"_96":962,"_158":963,"_160":948,"_161":139,"_162":964,"_164":165,"_106":965,"_101":29,"_167":215,"_169":966,"_170":25,"_171":-5,"_172":967,"_99":968},"06981302-67fc-11f0-9bd1-0224a6c84d84","_distutils.py","069813a2-67fc-11f0-9bd1-0224a6c84d84",232,["D",1753299258848],"\"\"\"Locations where we look for configs, install stuff, etc\"\"\"\n\n# The following comment should be removed at some point in the future.\n# mypy: strict-optional=False\n\n# If pip's going to use distutils, it should not be using the copy that setuptools\n# might have injected into the environment. This is done by removing the injected\n# shim, if it's injected.\n#\n# See https://github.com/pypa/pip/issues/8761 for the original discussion and\n# rationale for why this is done within pip.\ntry:\n __import__(\"_distutils_hack\").remove_shim()\nexcept (ImportError, AttributeError):\n pass\n\nimport logging\nimport os\nimport sys\nfrom distutils.cmd import Command as DistutilsCommand\nfrom distutils.command.install import SCHEME_KEYS\nfrom distutils.command.install import install as distutils_install_command\nfrom distutils.sysconfig import get_python_lib\nfrom typing import Dict, List, Optional, Union\n\nfrom pip._internal.models.scheme import Scheme\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\nfrom .base import get_major_minor_version\n\nlogger = logging.getLogger(__name__)\n\n\ndef distutils_scheme(\n dist_name: str,\n user: bool = False,\n home: Optional[str] = None,\n root: Optional[str] = None,\n isolated: bool = False,\n prefix: Optional[str] = None,\n *,\n ignore_config_files: bool = False,\n) -> Dict[str, str]:\n \"\"\"\n Return a distutils install scheme\n \"\"\"\n from distutils.dist import Distribution\n\n dist_args: Dict[str, Union[str, List[str]]] = {\"name\": dist_name}\n if isolated:\n dist_args[\"script_args\"] = [\"--no-user-cfg\"]\n\n d = Distribution(dist_args)\n if not ignore_config_files:\n try:\n d.parse_config_files()\n except UnicodeDecodeError:\n paths = d.find_config_files()\n logger.warning(\n \"Ignore distutils configs in %s due to encoding errors.\",\n \", \".join(os.path.basename(p) for p in paths),\n )\n obj: Optional[DistutilsCommand] = None\n obj = d.get_command_obj(\"install\", create=True)\n assert obj is not None\n i: distutils_install_command = obj\n # NOTE: setting user or home has the side-effect of creating the home dir\n # or user base for installations during finalize_options()\n # ideally, we'd prefer a scheme class that has no side-effects.\n assert not (user and prefix), f\"user={user} prefix={prefix}\"\n assert not (home and prefix), f\"home={home} prefix={prefix}\"\n i.user = user or i.user\n if user or home:\n i.prefix = \"\"\n i.prefix = prefix or i.prefix\n i.home = home or i.home\n i.root = root or i.root\n i.finalize_options()\n\n scheme: Dict[str, str] = {}\n for key in SCHEME_KEYS:\n scheme[key] = getattr(i, \"install_\" + key)\n\n # install_lib specified in setup.cfg should install *everything*\n # into there (i.e. it takes precedence over both purelib and\n # platlib). Note, i.install_lib is *always* set after\n # finalize_options(); we only want to override here if the user\n # has explicitly requested it hence going back to the config\n if \"install_lib\" in d.get_option_dict(\"install\"):\n scheme.update({\"purelib\": i.install_lib, \"platlib\": i.install_lib})\n\n if running_under_virtualenv():\n if home:\n prefix = home\n elif user:\n prefix = i.install_userbase\n else:\n prefix = i.prefix\n scheme[\"headers\"] = os.path.join(\n prefix,\n \"include\",\n \"site\",\n f\"python{get_major_minor_version()}\",\n dist_name,\n )\n\n if root is not None:\n path_no_drive = os.path.splitdrive(os.path.abspath(scheme[\"headers\"]))[1]\n scheme[\"headers\"] = os.path.join(root, path_no_drive[1:])\n\n return scheme\n\n\ndef get_scheme(\n dist_name: str,\n user: bool = False,\n home: Optional[str] = None,\n root: Optional[str] = None,\n isolated: bool = False,\n prefix: Optional[str] = None,\n) -> Scheme:\n \"\"\"\n Get the \"scheme\" corresponding to the input parameters. The distutils\n documentation provides the context for the available schemes:\n https://docs.python.org/3/install/index.html#alternate-installation\n\n :param dist_name: the name of the package to retrieve the scheme for, used\n in the headers scheme path\n :param user: indicates to use the \"user\" scheme\n :param home: indicates to use the \"home\" scheme and provides the base\n directory for the same\n :param root: root under which other directories are re-based\n :param isolated: equivalent to --no-user-cfg, i.e. do not consider\n ~/.pydistutils.cfg (posix) or ~/pydistutils.cfg (non-posix) for\n scheme paths\n :param prefix: indicates to use the \"prefix\" scheme and provides the\n base directory for the same\n \"\"\"\n scheme = distutils_scheme(dist_name, user, home, root, isolated, prefix)\n return Scheme(\n platlib=scheme[\"platlib\"],\n purelib=scheme[\"purelib\"],\n headers=scheme[\"headers\"],\n scripts=scheme[\"scripts\"],\n data=scheme[\"data\"],\n )\n\n\ndef get_bin_prefix() -> str:\n # XXX: In old virtualenv versions, sys.prefix can contain '..' components,\n # so we need to call normpath to eliminate them.\n prefix = os.path.normpath(sys.prefix)\n if WINDOWS:\n bin_py = os.path.join(prefix, \"Scripts\")\n # buildout uses 'bin' on Windows too?\n if not os.path.exists(bin_py):\n bin_py = os.path.join(prefix, \"bin\")\n return bin_py\n # Forcing to use /usr/local/bin for standard macOS framework installs\n # Also log to ~/Library/Logs/ for use with the Console.app log viewer\n if sys.platform[:6] == \"darwin\" and prefix[:16] == \"/System/Library/\":\n return \"/usr/local/bin\"\n return os.path.join(prefix, \"bin\")\n\n\ndef get_purelib() -> str:\n return get_python_lib(plat_specific=False)\n\n\ndef get_platlib() -> str:\n return get_python_lib(plat_specific=True)\n",[],[100,509,516,523,475,544,947,962],{"_104":970,"_96":971,"_158":972,"_160":948,"_161":139,"_162":973,"_164":165,"_106":974,"_101":29,"_167":215,"_169":975,"_170":25,"_171":-5,"_172":976,"_99":977},"0694bf2c-67fc-11f0-aad3-0224a6c84d84","_sysconfig.py","0694bfd6-67fc-11f0-aad3-0224a6c84d84",231,["D",1753299258825],"import logging\nimport os\nimport sys\nimport sysconfig\nimport typing\n\nfrom pip._internal.exceptions import InvalidSchemeCombination, UserInstallationInvalid\nfrom pip._internal.models.scheme import SCHEME_KEYS, Scheme\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\nfrom .base import change_root, get_major_minor_version, is_osx_framework\n\nlogger = logging.getLogger(__name__)\n\n\n# Notes on _infer_* functions.\n# Unfortunately ``get_default_scheme()`` didn't exist before 3.10, so there's no\n# way to ask things like \"what is the '_prefix' scheme on this platform\". These\n# functions try to answer that with some heuristics while accounting for ad-hoc\n# platforms not covered by CPython's default sysconfig implementation. If the\n# ad-hoc implementation does not fully implement sysconfig, we'll fall back to\n# a POSIX scheme.\n\n_AVAILABLE_SCHEMES = set(sysconfig.get_scheme_names())\n\n_PREFERRED_SCHEME_API = getattr(sysconfig, \"get_preferred_scheme\", None)\n\n\ndef _should_use_osx_framework_prefix() -> bool:\n \"\"\"Check for Apple's ``osx_framework_library`` scheme.\n\n Python distributed by Apple's Command Line Tools has this special scheme\n that's used when:\n\n * This is a framework build.\n * We are installing into the system prefix.\n\n This does not account for ``pip install --prefix`` (also means we're not\n installing to the system prefix), which should use ``posix_prefix``, but\n logic here means ``_infer_prefix()`` outputs ``osx_framework_library``. But\n since ``prefix`` is not available for ``sysconfig.get_default_scheme()``,\n which is the stdlib replacement for ``_infer_prefix()``, presumably Apple\n wouldn't be able to magically switch between ``osx_framework_library`` and\n ``posix_prefix``. ``_infer_prefix()`` returning ``osx_framework_library``\n means its behavior is consistent whether we use the stdlib implementation\n or our own, and we deal with this special case in ``get_scheme()`` instead.\n \"\"\"\n return (\n \"osx_framework_library\" in _AVAILABLE_SCHEMES\n and not running_under_virtualenv()\n and is_osx_framework()\n )\n\n\ndef _infer_prefix() -> str:\n \"\"\"Try to find a prefix scheme for the current platform.\n\n This tries:\n\n * A special ``osx_framework_library`` for Python distributed by Apple's\n Command Line Tools, when not running in a virtual environment.\n * Implementation + OS, used by PyPy on Windows (``pypy_nt``).\n * Implementation without OS, used by PyPy on POSIX (``pypy``).\n * OS + \"prefix\", used by CPython on POSIX (``posix_prefix``).\n * Just the OS name, used by CPython on Windows (``nt``).\n\n If none of the above works, fall back to ``posix_prefix``.\n \"\"\"\n if _PREFERRED_SCHEME_API:\n return _PREFERRED_SCHEME_API(\"prefix\")\n if _should_use_osx_framework_prefix():\n return \"osx_framework_library\"\n implementation_suffixed = f\"{sys.implementation.name}_{os.name}\"\n if implementation_suffixed in _AVAILABLE_SCHEMES:\n return implementation_suffixed\n if sys.implementation.name in _AVAILABLE_SCHEMES:\n return sys.implementation.name\n suffixed = f\"{os.name}_prefix\"\n if suffixed in _AVAILABLE_SCHEMES:\n return suffixed\n if os.name in _AVAILABLE_SCHEMES: # On Windows, prefx is just called \"nt\".\n return os.name\n return \"posix_prefix\"\n\n\ndef _infer_user() -> str:\n \"\"\"Try to find a user scheme for the current platform.\"\"\"\n if _PREFERRED_SCHEME_API:\n return _PREFERRED_SCHEME_API(\"user\")\n if is_osx_framework() and not running_under_virtualenv():\n suffixed = \"osx_framework_user\"\n else:\n suffixed = f\"{os.name}_user\"\n if suffixed in _AVAILABLE_SCHEMES:\n return suffixed\n if \"posix_user\" not in _AVAILABLE_SCHEMES: # User scheme unavailable.\n raise UserInstallationInvalid()\n return \"posix_user\"\n\n\ndef _infer_home() -> str:\n \"\"\"Try to find a home for the current platform.\"\"\"\n if _PREFERRED_SCHEME_API:\n return _PREFERRED_SCHEME_API(\"home\")\n suffixed = f\"{os.name}_home\"\n if suffixed in _AVAILABLE_SCHEMES:\n return suffixed\n return \"posix_home\"\n\n\n# Update these keys if the user sets a custom home.\n_HOME_KEYS = [\n \"installed_base\",\n \"base\",\n \"installed_platbase\",\n \"platbase\",\n \"prefix\",\n \"exec_prefix\",\n]\nif sysconfig.get_config_var(\"userbase\") is not None:\n _HOME_KEYS.append(\"userbase\")\n\n\ndef get_scheme(\n dist_name: str,\n user: bool = False,\n home: typing.Optional[str] = None,\n root: typing.Optional[str] = None,\n isolated: bool = False,\n prefix: typing.Optional[str] = None,\n) -> Scheme:\n \"\"\"\n Get the \"scheme\" corresponding to the input parameters.\n\n :param dist_name: the name of the package to retrieve the scheme for, used\n in the headers scheme path\n :param user: indicates to use the \"user\" scheme\n :param home: indicates to use the \"home\" scheme\n :param root: root under which other directories are re-based\n :param isolated: ignored, but kept for distutils compatibility (where\n this controls whether the user-site pydistutils.cfg is honored)\n :param prefix: indicates to use the \"prefix\" scheme and provides the\n base directory for the same\n \"\"\"\n if user and prefix:\n raise InvalidSchemeCombination(\"--user\", \"--prefix\")\n if home and prefix:\n raise InvalidSchemeCombination(\"--home\", \"--prefix\")\n\n if home is not None:\n scheme_name = _infer_home()\n elif user:\n scheme_name = _infer_user()\n else:\n scheme_name = _infer_prefix()\n\n # Special case: When installing into a custom prefix, use posix_prefix\n # instead of osx_framework_library. See _should_use_osx_framework_prefix()\n # docstring for details.\n if prefix is not None and scheme_name == \"osx_framework_library\":\n scheme_name = \"posix_prefix\"\n\n if home is not None:\n variables = {k: home for k in _HOME_KEYS}\n elif prefix is not None:\n variables = {k: prefix for k in _HOME_KEYS}\n else:\n variables = {}\n\n paths = sysconfig.get_paths(scheme=scheme_name, vars=variables)\n\n # Logic here is very arbitrary, we're doing it for compatibility, don't ask.\n # 1. Pip historically uses a special header path in virtual environments.\n # 2. If the distribution name is not known, distutils uses 'UNKNOWN'. We\n # only do the same when not running in a virtual environment because\n # pip's historical header path logic (see point 1) did not do this.\n if running_under_virtualenv():\n if user:\n base = variables.get(\"userbase\", sys.prefix)\n else:\n base = variables.get(\"base\", sys.prefix)\n python_xy = f\"python{get_major_minor_version()}\"\n paths[\"include\"] = os.path.join(base, \"include\", \"site\", python_xy)\n elif not dist_name:\n dist_name = \"UNKNOWN\"\n\n scheme = Scheme(\n platlib=paths[\"platlib\"],\n purelib=paths[\"purelib\"],\n headers=os.path.join(paths[\"include\"], dist_name),\n scripts=paths[\"scripts\"],\n data=paths[\"data\"],\n )\n if root is not None:\n converted_keys = {}\n for key in SCHEME_KEYS:\n converted_keys[key] = change_root(root, getattr(scheme, key))\n scheme = Scheme(**converted_keys)\n return scheme\n\n\ndef get_bin_prefix() -> str:\n # Forcing to use /usr/local/bin for standard macOS framework installs.\n if sys.platform[:6] == \"darwin\" and sys.prefix[:16] == \"/System/Library/\":\n return \"/usr/local/bin\"\n return sysconfig.get_paths()[\"scripts\"]\n\n\ndef get_purelib() -> str:\n return sysconfig.get_paths()[\"purelib\"]\n\n\ndef get_platlib() -> str:\n return sysconfig.get_paths()[\"platlib\"]\n",[],[100,509,516,523,475,544,947,971],{"_104":979,"_96":868,"_158":980,"_160":948,"_161":139,"_162":981,"_164":165,"_106":982,"_101":29,"_167":215,"_169":983,"_170":25,"_171":-5,"_172":984,"_99":985},"069bc6d2-67fc-11f0-84bb-0224a6c84d84","069bc77c-67fc-11f0-84bb-0224a6c84d84",233,["D",1753299258871],"import functools\nimport os\nimport site\nimport sys\nimport sysconfig\nimport typing\n\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.utils import appdirs\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\n# Application Directories\nUSER_CACHE_DIR = appdirs.user_cache_dir(\"pip\")\n\n# FIXME doesn't account for venv linked to global site-packages\nsite_packages: str = sysconfig.get_path(\"purelib\")\n\n\ndef get_major_minor_version() -> str:\n \"\"\"\n Return the major-minor version of the current Python as a string, e.g.\n \"3.7\" or \"3.10\".\n \"\"\"\n return \"{}.{}\".format(*sys.version_info)\n\n\ndef change_root(new_root: str, pathname: str) -> str:\n \"\"\"Return 'pathname' with 'new_root' prepended.\n\n If 'pathname' is relative, this is equivalent to os.path.join(new_root, pathname).\n Otherwise, it requires making 'pathname' relative and then joining the\n two, which is tricky on DOS/Windows and Mac OS.\n\n This is borrowed from Python's standard library's distutils module.\n \"\"\"\n if os.name == \"posix\":\n if not os.path.isabs(pathname):\n return os.path.join(new_root, pathname)\n else:\n return os.path.join(new_root, pathname[1:])\n\n elif os.name == \"nt\":\n (drive, path) = os.path.splitdrive(pathname)\n if path[0] == \"\\\\\":\n path = path[1:]\n return os.path.join(new_root, path)\n\n else:\n raise InstallationError(\n f\"Unknown platform: {os.name}\\n\"\n \"Can not change root path prefix on unknown platform.\"\n )\n\n\ndef get_src_prefix() -> str:\n if running_under_virtualenv():\n src_prefix = os.path.join(sys.prefix, \"src\")\n else:\n # FIXME: keep src in cwd for now (it is not a temporary folder)\n try:\n src_prefix = os.path.join(os.getcwd(), \"src\")\n except OSError:\n # In case the current working directory has been renamed or deleted\n sys.exit(\"The folder you are executing pip from can no longer be found.\")\n\n # under macOS + virtualenv sys.prefix is not properly resolved\n # it is something like /path/to/python/bin/..\n return os.path.abspath(src_prefix)\n\n\ntry:\n # Use getusersitepackages if this is present, as it ensures that the\n # value is initialised properly.\n user_site: typing.Optional[str] = site.getusersitepackages()\nexcept AttributeError:\n user_site = site.USER_SITE\n\n\n@functools.lru_cache(maxsize=None)\ndef is_osx_framework() -> bool:\n return bool(sysconfig.get_config_var(\"PYTHONFRAMEWORK\"))\n",[],[100,509,516,523,475,544,947,868],[100,509,516,523,475,544,947],{"_104":988,"_96":989,"_158":990,"_160":545,"_161":139,"_162":991,"_164":165,"_106":992,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":993,"_99":1071},"fd3724f6-67fb-11f0-a7d9-0224a6c84d84","metadata","fd3725c8-67fb-11f0-a7d9-0224a6c84d84",68,["D",1753299243112],[994,1037,1045,1054,1062],{"_104":995,"_96":996,"_158":997,"_160":990,"_161":139,"_162":998,"_164":165,"_106":999,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1000,"_99":1036},"ffa25ec2-67fb-11f0-928e-0224a6c84d84","importlib","ffa25f94-67fb-11f0-928e-0224a6c84d84",93,["D",1753299247168],[1001,1009,1018,1027],{"_104":1002,"_96":558,"_158":1003,"_160":997,"_161":139,"_162":1004,"_164":165,"_106":1005,"_101":29,"_167":215,"_169":1006,"_170":25,"_171":-5,"_172":1007,"_99":1008},"076d1cbe-67fc-11f0-9cad-0224a6c84d84","076d1d9a-67fc-11f0-9cad-0224a6c84d84",264,["D",1753299260205],"from ._dists import Distribution\nfrom ._envs import Environment\n\n__all__ = [\"NAME\", \"Distribution\", \"Environment\"]\n\nNAME = \"importlib\"\n",[],[100,509,516,523,475,544,989,996,558],{"_104":1010,"_96":1011,"_158":1012,"_160":997,"_161":139,"_162":1013,"_164":165,"_106":1014,"_101":29,"_167":215,"_169":1015,"_170":25,"_171":-5,"_172":1016,"_99":1017},"07673bf0-67fc-11f0-8863-0224a6c84d84","_compat.py","07673cb8-67fc-11f0-8863-0224a6c84d84",263,["D",1753299260203],"import importlib.metadata\nimport os\nfrom typing import Any, Optional, Protocol, Tuple, cast\n\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\n\n\nclass BadMetadata(ValueError):\n def __init__(self, dist: importlib.metadata.Distribution, *, reason: str) -> None:\n self.dist = dist\n self.reason = reason\n\n def __str__(self) -> str:\n return f\"Bad metadata in {self.dist} ({self.reason})\"\n\n\nclass BasePath(Protocol):\n \"\"\"A protocol that various path objects conform.\n\n This exists because importlib.metadata uses both ``pathlib.Path`` and\n ``zipfile.Path``, and we need a common base for type hints (Union does not\n work well since ``zipfile.Path`` is too new for our linter setup).\n\n This does not mean to be exhaustive, but only contains things that present\n in both classes *that we need*.\n \"\"\"\n\n @property\n def name(self) -> str:\n raise NotImplementedError()\n\n @property\n def parent(self) -> \"BasePath\":\n raise NotImplementedError()\n\n\ndef get_info_location(d: importlib.metadata.Distribution) -> Optional[BasePath]:\n \"\"\"Find the path to the distribution's metadata directory.\n\n HACK: This relies on importlib.metadata's private ``_path`` attribute. Not\n all distributions exist on disk, so importlib.metadata is correct to not\n expose the attribute as public. But pip's code base is old and not as clean,\n so we do this to avoid having to rewrite too many things. Hopefully we can\n eliminate this some day.\n \"\"\"\n return getattr(d, \"_path\", None)\n\n\ndef parse_name_and_version_from_info_directory(\n dist: importlib.metadata.Distribution,\n) -> Tuple[Optional[str], Optional[str]]:\n \"\"\"Get a name and version from the metadata directory name.\n\n This is much faster than reading distribution metadata.\n \"\"\"\n info_location = get_info_location(dist)\n if info_location is None:\n return None, None\n\n stem, suffix = os.path.splitext(info_location.name)\n if suffix == \".dist-info\":\n name, sep, version = stem.partition(\"-\")\n if sep:\n return name, version\n\n if suffix == \".egg-info\":\n name = stem.split(\"-\", 1)[0]\n return name, None\n\n return None, None\n\n\ndef get_dist_canonical_name(dist: importlib.metadata.Distribution) -> NormalizedName:\n \"\"\"Get the distribution's normalized name.\n\n The ``name`` attribute is only available in Python 3.10 or later. We are\n targeting exactly that, but Mypy does not know this.\n \"\"\"\n if name := parse_name_and_version_from_info_directory(dist)[0]:\n return canonicalize_name(name)\n\n name = cast(Any, dist).name\n if not isinstance(name, str):\n raise BadMetadata(dist, reason=\"invalid metadata entry 'name'\")\n return canonicalize_name(name)\n",[],[100,509,516,523,475,544,989,996,1011],{"_104":1019,"_96":1020,"_158":1021,"_160":997,"_161":139,"_162":1022,"_164":165,"_106":1023,"_101":29,"_167":215,"_169":1024,"_170":25,"_171":-5,"_172":1025,"_99":1026},"0760b19a-67fc-11f0-a319-0224a6c84d84","_dists.py","0760b230-67fc-11f0-a319-0224a6c84d84",262,["D",1753299260121],"import email.message\nimport importlib.metadata\nimport pathlib\nimport zipfile\nfrom os import PathLike\nfrom typing import (\n Collection,\n Dict,\n Iterable,\n Iterator,\n Mapping,\n Optional,\n Sequence,\n Union,\n cast,\n)\n\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import Version\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.exceptions import InvalidWheel, UnsupportedWheel\nfrom pip._internal.metadata.base import (\n BaseDistribution,\n BaseEntryPoint,\n InfoPath,\n Wheel,\n)\nfrom pip._internal.utils.misc import normalize_path\nfrom pip._internal.utils.packaging import get_requirement\nfrom pip._internal.utils.temp_dir import TempDirectory\nfrom pip._internal.utils.wheel import parse_wheel, read_wheel_metadata_file\n\nfrom ._compat import (\n BasePath,\n get_dist_canonical_name,\n parse_name_and_version_from_info_directory,\n)\n\n\nclass WheelDistribution(importlib.metadata.Distribution):\n \"\"\"An ``importlib.metadata.Distribution`` read from a wheel.\n\n Although ``importlib.metadata.PathDistribution`` accepts ``zipfile.Path``,\n its implementation is too \"lazy\" for pip's needs (we can't keep the ZipFile\n handle open for the entire lifetime of the distribution object).\n\n This implementation eagerly reads the entire metadata directory into the\n memory instead, and operates from that.\n \"\"\"\n\n def __init__(\n self,\n files: Mapping[pathlib.PurePosixPath, bytes],\n info_location: pathlib.PurePosixPath,\n ) -> None:\n self._files = files\n self.info_location = info_location\n\n @classmethod\n def from_zipfile(\n cls,\n zf: zipfile.ZipFile,\n name: str,\n location: str,\n ) -> \"WheelDistribution\":\n info_dir, _ = parse_wheel(zf, name)\n paths = (\n (name, pathlib.PurePosixPath(name.split(\"/\", 1)[-1]))\n for name in zf.namelist()\n if name.startswith(f\"{info_dir}/\")\n )\n files = {\n relpath: read_wheel_metadata_file(zf, fullpath)\n for fullpath, relpath in paths\n }\n info_location = pathlib.PurePosixPath(location, info_dir)\n return cls(files, info_location)\n\n def iterdir(self, path: InfoPath) -> Iterator[pathlib.PurePosixPath]:\n # Only allow iterating through the metadata directory.\n if pathlib.PurePosixPath(str(path)) in self._files:\n return iter(self._files)\n raise FileNotFoundError(path)\n\n def read_text(self, filename: str) -> Optional[str]:\n try:\n data = self._files[pathlib.PurePosixPath(filename)]\n except KeyError:\n return None\n try:\n text = data.decode(\"utf-8\")\n except UnicodeDecodeError as e:\n wheel = self.info_location.parent\n error = f\"Error decoding metadata for {wheel}: {e} in {filename} file\"\n raise UnsupportedWheel(error)\n return text\n\n def locate_file(self, path: Union[str, \"PathLike[str]\"]) -> pathlib.Path:\n # This method doesn't make sense for our in-memory wheel, but the API\n # requires us to define it.\n raise NotImplementedError\n\n\nclass Distribution(BaseDistribution):\n def __init__(\n self,\n dist: importlib.metadata.Distribution,\n info_location: Optional[BasePath],\n installed_location: Optional[BasePath],\n ) -> None:\n self._dist = dist\n self._info_location = info_location\n self._installed_location = installed_location\n\n @classmethod\n def from_directory(cls, directory: str) -> BaseDistribution:\n info_location = pathlib.Path(directory)\n dist = importlib.metadata.Distribution.at(info_location)\n return cls(dist, info_location, info_location.parent)\n\n @classmethod\n def from_metadata_file_contents(\n cls,\n metadata_contents: bytes,\n filename: str,\n project_name: str,\n ) -> BaseDistribution:\n # Generate temp dir to contain the metadata file, and write the file contents.\n temp_dir = pathlib.Path(\n TempDirectory(kind=\"metadata\", globally_managed=True).path\n )\n metadata_path = temp_dir / \"METADATA\"\n metadata_path.write_bytes(metadata_contents)\n # Construct dist pointing to the newly created directory.\n dist = importlib.metadata.Distribution.at(metadata_path.parent)\n return cls(dist, metadata_path.parent, None)\n\n @classmethod\n def from_wheel(cls, wheel: Wheel, name: str) -> BaseDistribution:\n try:\n with wheel.as_zipfile() as zf:\n dist = WheelDistribution.from_zipfile(zf, name, wheel.location)\n except zipfile.BadZipFile as e:\n raise InvalidWheel(wheel.location, name) from e\n return cls(dist, dist.info_location, pathlib.PurePosixPath(wheel.location))\n\n @property\n def location(self) -> Optional[str]:\n if self._info_location is None:\n return None\n return str(self._info_location.parent)\n\n @property\n def info_location(self) -> Optional[str]:\n if self._info_location is None:\n return None\n return str(self._info_location)\n\n @property\n def installed_location(self) -> Optional[str]:\n if self._installed_location is None:\n return None\n return normalize_path(str(self._installed_location))\n\n @property\n def canonical_name(self) -> NormalizedName:\n return get_dist_canonical_name(self._dist)\n\n @property\n def version(self) -> Version:\n if version := parse_name_and_version_from_info_directory(self._dist)[1]:\n return parse_version(version)\n return parse_version(self._dist.version)\n\n @property\n def raw_version(self) -> str:\n return self._dist.version\n\n def is_file(self, path: InfoPath) -> bool:\n return self._dist.read_text(str(path)) is not None\n\n def iter_distutils_script_names(self) -> Iterator[str]:\n # A distutils installation is always \"flat\" (not in e.g. egg form), so\n # if this distribution's info location is NOT a pathlib.Path (but e.g.\n # zipfile.Path), it can never contain any distutils scripts.\n if not isinstance(self._info_location, pathlib.Path):\n return\n for child in self._info_location.joinpath(\"scripts\").iterdir():\n yield child.name\n\n def read_text(self, path: InfoPath) -> str:\n content = self._dist.read_text(str(path))\n if content is None:\n raise FileNotFoundError(path)\n return content\n\n def iter_entry_points(self) -> Iterable[BaseEntryPoint]:\n # importlib.metadata's EntryPoint structure satisfies BaseEntryPoint.\n return self._dist.entry_points\n\n def _metadata_impl(self) -> email.message.Message:\n # From Python 3.10+, importlib.metadata declares PackageMetadata as the\n # return type. This protocol is unfortunately a disaster now and misses\n # a ton of fields that we need, including get() and get_payload(). We\n # rely on the implementation that the object is actually a Message now,\n # until upstream can improve the protocol. (python/cpython#94952)\n return cast(email.message.Message, self._dist.metadata)\n\n def iter_provided_extras(self) -> Iterable[NormalizedName]:\n return [\n canonicalize_name(extra)\n for extra in self.metadata.get_all(\"Provides-Extra\", [])\n ]\n\n def iter_dependencies(self, extras: Collection[str] = ()) -> Iterable[Requirement]:\n contexts: Sequence[Dict[str, str]] = [{\"extra\": e} for e in extras]\n for req_string in self.metadata.get_all(\"Requires-Dist\", []):\n # strip() because email.message.Message.get_all() may return a leading \\n\n # in case a long header was wrapped.\n req = get_requirement(req_string.strip())\n if not req.marker:\n yield req\n elif not extras and req.marker.evaluate({\"extra\": \"\"}):\n yield req\n elif any(req.marker.evaluate(context) for context in contexts):\n yield req\n",[],[100,509,516,523,475,544,989,996,1020],{"_104":1028,"_96":1029,"_158":1030,"_160":997,"_161":139,"_162":1031,"_164":165,"_106":1032,"_101":29,"_167":215,"_169":1033,"_170":25,"_171":-5,"_172":1034,"_99":1035},"077923e2-67fc-11f0-b654-0224a6c84d84","_envs.py","07792540-67fc-11f0-b654-0224a6c84d84",266,["D",1753299260286],"import importlib.metadata\nimport logging\nimport os\nimport pathlib\nimport sys\nimport zipfile\nfrom typing import Iterator, List, Optional, Sequence, Set, Tuple\n\nfrom pip._vendor.packaging.utils import (\n InvalidWheelFilename,\n NormalizedName,\n canonicalize_name,\n parse_wheel_filename,\n)\n\nfrom pip._internal.metadata.base import BaseDistribution, BaseEnvironment\nfrom pip._internal.utils.filetypes import WHEEL_EXTENSION\n\nfrom ._compat import BadMetadata, BasePath, get_dist_canonical_name, get_info_location\nfrom ._dists import Distribution\n\nlogger = logging.getLogger(__name__)\n\n\ndef _looks_like_wheel(location: str) -> bool:\n if not location.endswith(WHEEL_EXTENSION):\n return False\n if not os.path.isfile(location):\n return False\n try:\n parse_wheel_filename(os.path.basename(location))\n except InvalidWheelFilename:\n return False\n return zipfile.is_zipfile(location)\n\n\nclass _DistributionFinder:\n \"\"\"Finder to locate distributions.\n\n The main purpose of this class is to memoize found distributions' names, so\n only one distribution is returned for each package name. At lot of pip code\n assumes this (because it is setuptools's behavior), and not doing the same\n can potentially cause a distribution in lower precedence path to override a\n higher precedence one if the caller is not careful.\n\n Eventually we probably want to make it possible to see lower precedence\n installations as well. It's useful feature, after all.\n \"\"\"\n\n FoundResult = Tuple[importlib.metadata.Distribution, Optional[BasePath]]\n\n def __init__(self) -> None:\n self._found_names: Set[NormalizedName] = set()\n\n def _find_impl(self, location: str) -> Iterator[FoundResult]:\n \"\"\"Find distributions in a location.\"\"\"\n # Skip looking inside a wheel. Since a package inside a wheel is not\n # always valid (due to .data directories etc.), its .dist-info entry\n # should not be considered an installed distribution.\n if _looks_like_wheel(location):\n return\n # To know exactly where we find a distribution, we have to feed in the\n # paths one by one, instead of dumping the list to importlib.metadata.\n for dist in importlib.metadata.distributions(path=[location]):\n info_location = get_info_location(dist)\n try:\n name = get_dist_canonical_name(dist)\n except BadMetadata as e:\n logger.warning(\"Skipping %s due to %s\", info_location, e.reason)\n continue\n if name in self._found_names:\n continue\n self._found_names.add(name)\n yield dist, info_location\n\n def find(self, location: str) -> Iterator[BaseDistribution]:\n \"\"\"Find distributions in a location.\n\n The path can be either a directory, or a ZIP archive.\n \"\"\"\n for dist, info_location in self._find_impl(location):\n if info_location is None:\n installed_location: Optional[BasePath] = None\n else:\n installed_location = info_location.parent\n yield Distribution(dist, info_location, installed_location)\n\n def find_legacy_editables(self, location: str) -> Iterator[BaseDistribution]:\n \"\"\"Read location in egg-link files and return distributions in there.\n\n The path should be a directory; otherwise this returns nothing. This\n follows how setuptools does this for compatibility. The first non-empty\n line in the egg-link is read as a path (resolved against the egg-link's\n containing directory if relative). Distributions found at that linked\n location are returned.\n \"\"\"\n path = pathlib.Path(location)\n if not path.is_dir():\n return\n for child in path.iterdir():\n if child.suffix != \".egg-link\":\n continue\n with child.open() as f:\n lines = (line.strip() for line in f)\n target_rel = next((line for line in lines if line), \"\")\n if not target_rel:\n continue\n target_location = str(path.joinpath(target_rel))\n for dist, info_location in self._find_impl(target_location):\n yield Distribution(dist, info_location, path)\n\n\nclass Environment(BaseEnvironment):\n def __init__(self, paths: Sequence[str]) -> None:\n self._paths = paths\n\n @classmethod\n def default(cls) -> BaseEnvironment:\n return cls(sys.path)\n\n @classmethod\n def from_paths(cls, paths: Optional[List[str]]) -> BaseEnvironment:\n if paths is None:\n return cls(sys.path)\n return cls(paths)\n\n def _iter_distributions(self) -> Iterator[BaseDistribution]:\n finder = _DistributionFinder()\n for location in self._paths:\n yield from finder.find(location)\n yield from finder.find_legacy_editables(location)\n\n def get_distribution(self, name: str) -> Optional[BaseDistribution]:\n canonical_name = canonicalize_name(name)\n matches = (\n distribution\n for distribution in self.iter_all_distributions()\n if distribution.canonical_name == canonical_name\n )\n return next(matches, None)\n",[],[100,509,516,523,475,544,989,996,1029],[100,509,516,523,475,544,989,996],{"_104":1038,"_96":558,"_158":1039,"_160":990,"_161":139,"_162":1040,"_164":165,"_106":1041,"_101":29,"_167":215,"_169":1042,"_170":25,"_171":-5,"_172":1043,"_99":1044},"075a42e2-67fc-11f0-bcbe-0224a6c84d84","075a43a0-67fc-11f0-bcbe-0224a6c84d84",261,["D",1753299259960],"import contextlib\nimport functools\nimport os\nimport sys\nfrom typing import List, Literal, Optional, Protocol, Type, cast\n\nfrom pip._internal.utils.deprecation import deprecated\nfrom pip._internal.utils.misc import strtobool\n\nfrom .base import BaseDistribution, BaseEnvironment, FilesystemWheel, MemoryWheel, Wheel\n\n__all__ = [\n \"BaseDistribution\",\n \"BaseEnvironment\",\n \"FilesystemWheel\",\n \"MemoryWheel\",\n \"Wheel\",\n \"get_default_environment\",\n \"get_environment\",\n \"get_wheel_distribution\",\n \"select_backend\",\n]\n\n\ndef _should_use_importlib_metadata() -> bool:\n \"\"\"Whether to use the ``importlib.metadata`` or ``pkg_resources`` backend.\n\n By default, pip uses ``importlib.metadata`` on Python 3.11+, and\n ``pkg_resources`` otherwise. Up to Python 3.13, This can be\n overridden by a couple of ways:\n\n * If environment variable ``_PIP_USE_IMPORTLIB_METADATA`` is set, it\n dictates whether ``importlib.metadata`` is used, for Python <3.14.\n * On Python 3.11, 3.12 and 3.13, Python distributors can patch\n ``importlib.metadata`` to add a global constant\n ``_PIP_USE_IMPORTLIB_METADATA = False``. This makes pip use\n ``pkg_resources`` (unless the user set the aforementioned environment\n variable to *True*).\n\n On Python 3.14+, the ``pkg_resources`` backend cannot be used.\n \"\"\"\n if sys.version_info >= (3, 14):\n # On Python >=3.14 we only support importlib.metadata.\n return True\n with contextlib.suppress(KeyError, ValueError):\n # On Python <3.14, if the environment variable is set, we obey what it says.\n return bool(strtobool(os.environ[\"_PIP_USE_IMPORTLIB_METADATA\"]))\n if sys.version_info < (3, 11):\n # On Python <3.11, we always use pkg_resources, unless the environment\n # variable was set.\n return False\n # On Python 3.11, 3.12 and 3.13, we check if the global constant is set.\n import importlib.metadata\n\n return bool(getattr(importlib.metadata, \"_PIP_USE_IMPORTLIB_METADATA\", True))\n\n\ndef _emit_pkg_resources_deprecation_if_needed() -> None:\n if sys.version_info < (3, 11):\n # All pip versions supporting Python<=3.11 will support pkg_resources,\n # and pkg_resources is the default for these, so let's not bother users.\n return\n\n import importlib.metadata\n\n if hasattr(importlib.metadata, \"_PIP_USE_IMPORTLIB_METADATA\"):\n # The Python distributor has set the global constant, so we don't\n # warn, since it is not a user decision.\n return\n\n # The user has decided to use pkg_resources, so we warn.\n deprecated(\n reason=\"Using the pkg_resources metadata backend is deprecated.\",\n replacement=(\n \"to use the default importlib.metadata backend, \"\n \"by unsetting the _PIP_USE_IMPORTLIB_METADATA environment variable\"\n ),\n gone_in=\"26.3\",\n issue=13317,\n )\n\n\nclass Backend(Protocol):\n NAME: 'Literal[\"importlib\", \"pkg_resources\"]'\n Distribution: Type[BaseDistribution]\n Environment: Type[BaseEnvironment]\n\n\n@functools.lru_cache(maxsize=None)\ndef select_backend() -> Backend:\n if _should_use_importlib_metadata():\n from . import importlib\n\n return cast(Backend, importlib)\n\n _emit_pkg_resources_deprecation_if_needed()\n\n from . import pkg_resources\n\n return cast(Backend, pkg_resources)\n\n\ndef get_default_environment() -> BaseEnvironment:\n \"\"\"Get the default representation for the current environment.\n\n This returns an Environment instance from the chosen backend. The default\n Environment instance should be built from ``sys.path`` and may use caching\n to share instance state across calls.\n \"\"\"\n return select_backend().Environment.default()\n\n\ndef get_environment(paths: Optional[List[str]]) -> BaseEnvironment:\n \"\"\"Get a representation of the environment specified by ``paths``.\n\n This returns an Environment instance from the chosen backend based on the\n given import paths. The backend must build a fresh instance representing\n the state of installed distributions when this function is called.\n \"\"\"\n return select_backend().Environment.from_paths(paths)\n\n\ndef get_directory_distribution(directory: str) -> BaseDistribution:\n \"\"\"Get the distribution metadata representation in the specified directory.\n\n This returns a Distribution instance from the chosen backend based on\n the given on-disk ``.dist-info`` directory.\n \"\"\"\n return select_backend().Distribution.from_directory(directory)\n\n\ndef get_wheel_distribution(wheel: Wheel, canonical_name: str) -> BaseDistribution:\n \"\"\"Get the representation of the specified wheel's distribution metadata.\n\n This returns a Distribution instance from the chosen backend based on\n the given wheel's ``.dist-info`` directory.\n\n :param canonical_name: Normalized project name of the given wheel.\n \"\"\"\n return select_backend().Distribution.from_wheel(wheel, canonical_name)\n\n\ndef get_metadata_distribution(\n metadata_contents: bytes,\n filename: str,\n canonical_name: str,\n) -> BaseDistribution:\n \"\"\"Get the dist representation of the specified METADATA file contents.\n\n This returns a Distribution instance from the chosen backend sourced from the data\n in `metadata_contents`.\n\n :param metadata_contents: Contents of a METADATA file within a dist, or one served\n via PEP 658.\n :param filename: Filename for the dist this metadata represents.\n :param canonical_name: Normalized project name of the given dist.\n \"\"\"\n return select_backend().Distribution.from_metadata_file_contents(\n metadata_contents,\n filename,\n canonical_name,\n )\n",[],[100,509,516,523,475,544,989,558],{"_104":1046,"_96":1047,"_158":1048,"_160":990,"_161":139,"_162":1049,"_164":165,"_106":1050,"_101":29,"_167":215,"_169":1051,"_170":25,"_171":-5,"_172":1052,"_99":1053},"0740dea6-67fc-11f0-8863-0224a6c84d84","_json.py","0740df6e-67fc-11f0-8863-0224a6c84d84",258,["D",1753299259952],"# Extracted from https://github.com/pfmoore/pkg_metadata\n\nfrom email.header import Header, decode_header, make_header\nfrom email.message import Message\nfrom typing import Any, Dict, List, Union, cast\n\nMETADATA_FIELDS = [\n # Name, Multiple-Use\n (\"Metadata-Version\", False),\n (\"Name\", False),\n (\"Version\", False),\n (\"Dynamic\", True),\n (\"Platform\", True),\n (\"Supported-Platform\", True),\n (\"Summary\", False),\n (\"Description\", False),\n (\"Description-Content-Type\", False),\n (\"Keywords\", False),\n (\"Home-page\", False),\n (\"Download-URL\", False),\n (\"Author\", False),\n (\"Author-email\", False),\n (\"Maintainer\", False),\n (\"Maintainer-email\", False),\n (\"License\", False),\n (\"License-Expression\", False),\n (\"License-File\", True),\n (\"Classifier\", True),\n (\"Requires-Dist\", True),\n (\"Requires-Python\", False),\n (\"Requires-External\", True),\n (\"Project-URL\", True),\n (\"Provides-Extra\", True),\n (\"Provides-Dist\", True),\n (\"Obsoletes-Dist\", True),\n]\n\n\ndef json_name(field: str) -> str:\n return field.lower().replace(\"-\", \"_\")\n\n\ndef msg_to_json(msg: Message) -> Dict[str, Any]:\n \"\"\"Convert a Message object into a JSON-compatible dictionary.\"\"\"\n\n def sanitise_header(h: Union[Header, str]) -> str:\n if isinstance(h, Header):\n chunks = []\n for bytes, encoding in decode_header(h):\n if encoding == \"unknown-8bit\":\n try:\n # See if UTF-8 works\n bytes.decode(\"utf-8\")\n encoding = \"utf-8\"\n except UnicodeDecodeError:\n # If not, latin1 at least won't fail\n encoding = \"latin1\"\n chunks.append((bytes, encoding))\n return str(make_header(chunks))\n return str(h)\n\n result = {}\n for field, multi in METADATA_FIELDS:\n if field not in msg:\n continue\n key = json_name(field)\n if multi:\n value: Union[str, List[str]] = [\n sanitise_header(v) for v in msg.get_all(field) # type: ignore\n ]\n else:\n value = sanitise_header(msg.get(field)) # type: ignore\n if key == \"keywords\":\n # Accept both comma-separated and space-separated\n # forms, for better compatibility with old data.\n if \",\" in value:\n value = [v.strip() for v in value.split(\",\")]\n else:\n value = value.split()\n result[key] = value\n\n payload = cast(str, msg.get_payload())\n if payload:\n result[\"description\"] = payload\n\n return result\n",[],[100,509,516,523,475,544,989,1047],{"_104":1055,"_96":868,"_158":1056,"_160":990,"_161":139,"_162":1057,"_164":165,"_106":1058,"_101":29,"_167":215,"_169":1059,"_170":25,"_171":-5,"_172":1060,"_99":1061},"077cefe0-67fc-11f0-9ab6-0224a6c84d84","077cf0e4-67fc-11f0-9ab6-0224a6c84d84",267,["D",1753299260348],"import csv\nimport email.message\nimport functools\nimport json\nimport logging\nimport pathlib\nimport re\nimport zipfile\nfrom typing import (\n IO,\n Any,\n Collection,\n Container,\n Dict,\n Iterable,\n Iterator,\n List,\n NamedTuple,\n Optional,\n Protocol,\n Tuple,\n Union,\n)\n\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.packaging.specifiers import InvalidSpecifier, SpecifierSet\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.exceptions import NoneMetadataError\nfrom pip._internal.locations import site_packages, user_site\nfrom pip._internal.models.direct_url import (\n DIRECT_URL_METADATA_NAME,\n DirectUrl,\n DirectUrlValidationError,\n)\nfrom pip._internal.utils.compat import stdlib_pkgs # TODO: Move definition here.\nfrom pip._internal.utils.egg_link import egg_link_path_from_sys_path\nfrom pip._internal.utils.misc import is_local, normalize_path\nfrom pip._internal.utils.urls import url_to_path\n\nfrom ._json import msg_to_json\n\nInfoPath = Union[str, pathlib.PurePath]\n\nlogger = logging.getLogger(__name__)\n\n\nclass BaseEntryPoint(Protocol):\n @property\n def name(self) -> str:\n raise NotImplementedError()\n\n @property\n def value(self) -> str:\n raise NotImplementedError()\n\n @property\n def group(self) -> str:\n raise NotImplementedError()\n\n\ndef _convert_installed_files_path(\n entry: Tuple[str, ...],\n info: Tuple[str, ...],\n) -> str:\n \"\"\"Convert a legacy installed-files.txt path into modern RECORD path.\n\n The legacy format stores paths relative to the info directory, while the\n modern format stores paths relative to the package root, e.g. the\n site-packages directory.\n\n :param entry: Path parts of the installed-files.txt entry.\n :param info: Path parts of the egg-info directory relative to package root.\n :returns: The converted entry.\n\n For best compatibility with symlinks, this does not use ``abspath()`` or\n ``Path.resolve()``, but tries to work with path parts:\n\n 1. While ``entry`` starts with ``..``, remove the equal amounts of parts\n from ``info``; if ``info`` is empty, start appending ``..`` instead.\n 2. Join the two directly.\n \"\"\"\n while entry and entry[0] == \"..\":\n if not info or info[-1] == \"..\":\n info += (\"..\",)\n else:\n info = info[:-1]\n entry = entry[1:]\n return str(pathlib.Path(*info, *entry))\n\n\nclass RequiresEntry(NamedTuple):\n requirement: str\n extra: str\n marker: str\n\n\nclass BaseDistribution(Protocol):\n @classmethod\n def from_directory(cls, directory: str) -> \"BaseDistribution\":\n \"\"\"Load the distribution from a metadata directory.\n\n :param directory: Path to a metadata directory, e.g. ``.dist-info``.\n \"\"\"\n raise NotImplementedError()\n\n @classmethod\n def from_metadata_file_contents(\n cls,\n metadata_contents: bytes,\n filename: str,\n project_name: str,\n ) -> \"BaseDistribution\":\n \"\"\"Load the distribution from the contents of a METADATA file.\n\n This is used to implement PEP 658 by generating a \"shallow\" dist object that can\n be used for resolution without downloading or building the actual dist yet.\n\n :param metadata_contents: The contents of a METADATA file.\n :param filename: File name for the dist with this metadata.\n :param project_name: Name of the project this dist represents.\n \"\"\"\n raise NotImplementedError()\n\n @classmethod\n def from_wheel(cls, wheel: \"Wheel\", name: str) -> \"BaseDistribution\":\n \"\"\"Load the distribution from a given wheel.\n\n :param wheel: A concrete wheel definition.\n :param name: File name of the wheel.\n\n :raises InvalidWheel: Whenever loading of the wheel causes a\n :py:exc:`zipfile.BadZipFile` exception to be thrown.\n :raises UnsupportedWheel: If the wheel is a valid zip, but malformed\n internally.\n \"\"\"\n raise NotImplementedError()\n\n def __repr__(self) -> str:\n return f\"{self.raw_name} {self.raw_version} ({self.location})\"\n\n def __str__(self) -> str:\n return f\"{self.raw_name} {self.raw_version}\"\n\n @property\n def location(self) -> Optional[str]:\n \"\"\"Where the distribution is loaded from.\n\n A string value is not necessarily a filesystem path, since distributions\n can be loaded from other sources, e.g. arbitrary zip archives. ``None``\n means the distribution is created in-memory.\n\n Do not canonicalize this value with e.g. ``pathlib.Path.resolve()``. If\n this is a symbolic link, we want to preserve the relative path between\n it and files in the distribution.\n \"\"\"\n raise NotImplementedError()\n\n @property\n def editable_project_location(self) -> Optional[str]:\n \"\"\"The project location for editable distributions.\n\n This is the directory where pyproject.toml or setup.py is located.\n None if the distribution is not installed in editable mode.\n \"\"\"\n # TODO: this property is relatively costly to compute, memoize it ?\n direct_url = self.direct_url\n if direct_url:\n if direct_url.is_local_editable():\n return url_to_path(direct_url.url)\n else:\n # Search for an .egg-link file by walking sys.path, as it was\n # done before by dist_is_editable().\n egg_link_path = egg_link_path_from_sys_path(self.raw_name)\n if egg_link_path:\n # TODO: get project location from second line of egg_link file\n # (https://github.com/pypa/pip/issues/10243)\n return self.location\n return None\n\n @property\n def installed_location(self) -> Optional[str]:\n \"\"\"The distribution's \"installed\" location.\n\n This should generally be a ``site-packages`` directory. This is\n usually ``dist.location``, except for legacy develop-installed packages,\n where ``dist.location`` is the source code location, and this is where\n the ``.egg-link`` file is.\n\n The returned location is normalized (in particular, with symlinks removed).\n \"\"\"\n raise NotImplementedError()\n\n @property\n def info_location(self) -> Optional[str]:\n \"\"\"Location of the .[egg|dist]-info directory or file.\n\n Similarly to ``location``, a string value is not necessarily a\n filesystem path. ``None`` means the distribution is created in-memory.\n\n For a modern .dist-info installation on disk, this should be something\n like ``{location}/{raw_name}-{version}.dist-info``.\n\n Do not canonicalize this value with e.g. ``pathlib.Path.resolve()``. If\n this is a symbolic link, we want to preserve the relative path between\n it and other files in the distribution.\n \"\"\"\n raise NotImplementedError()\n\n @property\n def installed_by_distutils(self) -> bool:\n \"\"\"Whether this distribution is installed with legacy distutils format.\n\n A distribution installed with \"raw\" distutils not patched by setuptools\n uses one single file at ``info_location`` to store metadata. We need to\n treat this specially on uninstallation.\n \"\"\"\n info_location = self.info_location\n if not info_location:\n return False\n return pathlib.Path(info_location).is_file()\n\n @property\n def installed_as_egg(self) -> bool:\n \"\"\"Whether this distribution is installed as an egg.\n\n This usually indicates the distribution was installed by (older versions\n of) easy_install.\n \"\"\"\n location = self.location\n if not location:\n return False\n # XXX if the distribution is a zipped egg, location has a trailing /\n # so we resort to pathlib.Path to check the suffix in a reliable way.\n return pathlib.Path(location).suffix == \".egg\"\n\n @property\n def installed_with_setuptools_egg_info(self) -> bool:\n \"\"\"Whether this distribution is installed with the ``.egg-info`` format.\n\n This usually indicates the distribution was installed with setuptools\n with an old pip version or with ``single-version-externally-managed``.\n\n Note that this ensure the metadata store is a directory. distutils can\n also installs an ``.egg-info``, but as a file, not a directory. This\n property is *False* for that case. Also see ``installed_by_distutils``.\n \"\"\"\n info_location = self.info_location\n if not info_location:\n return False\n if not info_location.endswith(\".egg-info\"):\n return False\n return pathlib.Path(info_location).is_dir()\n\n @property\n def installed_with_dist_info(self) -> bool:\n \"\"\"Whether this distribution is installed with the \"modern format\".\n\n This indicates a \"modern\" installation, e.g. storing metadata in the\n ``.dist-info`` directory. This applies to installations made by\n setuptools (but through pip, not directly), or anything using the\n standardized build backend interface (PEP 517).\n \"\"\"\n info_location = self.info_location\n if not info_location:\n return False\n if not info_location.endswith(\".dist-info\"):\n return False\n return pathlib.Path(info_location).is_dir()\n\n @property\n def canonical_name(self) -> NormalizedName:\n raise NotImplementedError()\n\n @property\n def version(self) -> Version:\n raise NotImplementedError()\n\n @property\n def raw_version(self) -> str:\n raise NotImplementedError()\n\n @property\n def setuptools_filename(self) -> str:\n \"\"\"Convert a project name to its setuptools-compatible filename.\n\n This is a copy of ``pkg_resources.to_filename()`` for compatibility.\n \"\"\"\n return self.raw_name.replace(\"-\", \"_\")\n\n @property\n def direct_url(self) -> Optional[DirectUrl]:\n \"\"\"Obtain a DirectUrl from this distribution.\n\n Returns None if the distribution has no `direct_url.json` metadata,\n or if `direct_url.json` is invalid.\n \"\"\"\n try:\n content = self.read_text(DIRECT_URL_METADATA_NAME)\n except FileNotFoundError:\n return None\n try:\n return DirectUrl.from_json(content)\n except (\n UnicodeDecodeError,\n json.JSONDecodeError,\n DirectUrlValidationError,\n ) as e:\n logger.warning(\n \"Error parsing %s for %s: %s\",\n DIRECT_URL_METADATA_NAME,\n self.canonical_name,\n e,\n )\n return None\n\n @property\n def installer(self) -> str:\n try:\n installer_text = self.read_text(\"INSTALLER\")\n except (OSError, ValueError, NoneMetadataError):\n return \"\" # Fail silently if the installer file cannot be read.\n for line in installer_text.splitlines():\n cleaned_line = line.strip()\n if cleaned_line:\n return cleaned_line\n return \"\"\n\n @property\n def requested(self) -> bool:\n return self.is_file(\"REQUESTED\")\n\n @property\n def editable(self) -> bool:\n return bool(self.editable_project_location)\n\n @property\n def local(self) -> bool:\n \"\"\"If distribution is installed in the current virtual environment.\n\n Always True if we're not in a virtualenv.\n \"\"\"\n if self.installed_location is None:\n return False\n return is_local(self.installed_location)\n\n @property\n def in_usersite(self) -> bool:\n if self.installed_location is None or user_site is None:\n return False\n return self.installed_location.startswith(normalize_path(user_site))\n\n @property\n def in_site_packages(self) -> bool:\n if self.installed_location is None or site_packages is None:\n return False\n return self.installed_location.startswith(normalize_path(site_packages))\n\n def is_file(self, path: InfoPath) -> bool:\n \"\"\"Check whether an entry in the info directory is a file.\"\"\"\n raise NotImplementedError()\n\n def iter_distutils_script_names(self) -> Iterator[str]:\n \"\"\"Find distutils 'scripts' entries metadata.\n\n If 'scripts' is supplied in ``setup.py``, distutils records those in the\n installed distribution's ``scripts`` directory, a file for each script.\n \"\"\"\n raise NotImplementedError()\n\n def read_text(self, path: InfoPath) -> str:\n \"\"\"Read a file in the info directory.\n\n :raise FileNotFoundError: If ``path`` does not exist in the directory.\n :raise NoneMetadataError: If ``path`` exists in the info directory, but\n cannot be read.\n \"\"\"\n raise NotImplementedError()\n\n def iter_entry_points(self) -> Iterable[BaseEntryPoint]:\n raise NotImplementedError()\n\n def _metadata_impl(self) -> email.message.Message:\n raise NotImplementedError()\n\n @functools.cached_property\n def metadata(self) -> email.message.Message:\n \"\"\"Metadata of distribution parsed from e.g. METADATA or PKG-INFO.\n\n This should return an empty message if the metadata file is unavailable.\n\n :raises NoneMetadataError: If the metadata file is available, but does\n not contain valid metadata.\n \"\"\"\n metadata = self._metadata_impl()\n self._add_egg_info_requires(metadata)\n return metadata\n\n @property\n def metadata_dict(self) -> Dict[str, Any]:\n \"\"\"PEP 566 compliant JSON-serializable representation of METADATA or PKG-INFO.\n\n This should return an empty dict if the metadata file is unavailable.\n\n :raises NoneMetadataError: If the metadata file is available, but does\n not contain valid metadata.\n \"\"\"\n return msg_to_json(self.metadata)\n\n @property\n def metadata_version(self) -> Optional[str]:\n \"\"\"Value of \"Metadata-Version:\" in distribution metadata, if available.\"\"\"\n return self.metadata.get(\"Metadata-Version\")\n\n @property\n def raw_name(self) -> str:\n \"\"\"Value of \"Name:\" in distribution metadata.\"\"\"\n # The metadata should NEVER be missing the Name: key, but if it somehow\n # does, fall back to the known canonical name.\n return self.metadata.get(\"Name\", self.canonical_name)\n\n @property\n def requires_python(self) -> SpecifierSet:\n \"\"\"Value of \"Requires-Python:\" in distribution metadata.\n\n If the key does not exist or contains an invalid value, an empty\n SpecifierSet should be returned.\n \"\"\"\n value = self.metadata.get(\"Requires-Python\")\n if value is None:\n return SpecifierSet()\n try:\n # Convert to str to satisfy the type checker; this can be a Header object.\n spec = SpecifierSet(str(value))\n except InvalidSpecifier as e:\n message = \"Package %r has an invalid Requires-Python: %s\"\n logger.warning(message, self.raw_name, e)\n return SpecifierSet()\n return spec\n\n def iter_dependencies(self, extras: Collection[str] = ()) -> Iterable[Requirement]:\n \"\"\"Dependencies of this distribution.\n\n For modern .dist-info distributions, this is the collection of\n \"Requires-Dist:\" entries in distribution metadata.\n \"\"\"\n raise NotImplementedError()\n\n def iter_raw_dependencies(self) -> Iterable[str]:\n \"\"\"Raw Requires-Dist metadata.\"\"\"\n return self.metadata.get_all(\"Requires-Dist\", [])\n\n def iter_provided_extras(self) -> Iterable[NormalizedName]:\n \"\"\"Extras provided by this distribution.\n\n For modern .dist-info distributions, this is the collection of\n \"Provides-Extra:\" entries in distribution metadata.\n\n The return value of this function is expected to be normalised names,\n per PEP 685, with the returned value being handled appropriately by\n `iter_dependencies`.\n \"\"\"\n raise NotImplementedError()\n\n def _iter_declared_entries_from_record(self) -> Optional[Iterator[str]]:\n try:\n text = self.read_text(\"RECORD\")\n except FileNotFoundError:\n return None\n # This extra Path-str cast normalizes entries.\n return (str(pathlib.Path(row[0])) for row in csv.reader(text.splitlines()))\n\n def _iter_declared_entries_from_legacy(self) -> Optional[Iterator[str]]:\n try:\n text = self.read_text(\"installed-files.txt\")\n except FileNotFoundError:\n return None\n paths = (p for p in text.splitlines(keepends=False) if p)\n root = self.location\n info = self.info_location\n if root is None or info is None:\n return paths\n try:\n info_rel = pathlib.Path(info).relative_to(root)\n except ValueError: # info is not relative to root.\n return paths\n if not info_rel.parts: # info *is* root.\n return paths\n return (\n _convert_installed_files_path(pathlib.Path(p).parts, info_rel.parts)\n for p in paths\n )\n\n def iter_declared_entries(self) -> Optional[Iterator[str]]:\n \"\"\"Iterate through file entries declared in this distribution.\n\n For modern .dist-info distributions, this is the files listed in the\n ``RECORD`` metadata file. For legacy setuptools distributions, this\n comes from ``installed-files.txt``, with entries normalized to be\n compatible with the format used by ``RECORD``.\n\n :return: An iterator for listed entries, or None if the distribution\n contains neither ``RECORD`` nor ``installed-files.txt``.\n \"\"\"\n return (\n self._iter_declared_entries_from_record()\n or self._iter_declared_entries_from_legacy()\n )\n\n def _iter_requires_txt_entries(self) -> Iterator[RequiresEntry]:\n \"\"\"Parse a ``requires.txt`` in an egg-info directory.\n\n This is an INI-ish format where an egg-info stores dependencies. A\n section name describes extra other environment markers, while each entry\n is an arbitrary string (not a key-value pair) representing a dependency\n as a requirement string (no markers).\n\n There is a construct in ``importlib.metadata`` called ``Sectioned`` that\n does mostly the same, but the format is currently considered private.\n \"\"\"\n try:\n content = self.read_text(\"requires.txt\")\n except FileNotFoundError:\n return\n extra = marker = \"\" # Section-less entries don't have markers.\n for line in content.splitlines():\n line = line.strip()\n if not line or line.startswith(\"#\"): # Comment; ignored.\n continue\n if line.startswith(\"[\") and line.endswith(\"]\"): # A section header.\n extra, _, marker = line.strip(\"[]\").partition(\":\")\n continue\n yield RequiresEntry(requirement=line, extra=extra, marker=marker)\n\n def _iter_egg_info_extras(self) -> Iterable[str]:\n \"\"\"Get extras from the egg-info directory.\"\"\"\n known_extras = {\"\"}\n for entry in self._iter_requires_txt_entries():\n extra = canonicalize_name(entry.extra)\n if extra in known_extras:\n continue\n known_extras.add(extra)\n yield extra\n\n def _iter_egg_info_dependencies(self) -> Iterable[str]:\n \"\"\"Get distribution dependencies from the egg-info directory.\n\n To ease parsing, this converts a legacy dependency entry into a PEP 508\n requirement string. Like ``_iter_requires_txt_entries()``, there is code\n in ``importlib.metadata`` that does mostly the same, but not do exactly\n what we need.\n\n Namely, ``importlib.metadata`` does not normalize the extra name before\n putting it into the requirement string, which causes marker comparison\n to fail because the dist-info format do normalize. This is consistent in\n all currently available PEP 517 backends, although not standardized.\n \"\"\"\n for entry in self._iter_requires_txt_entries():\n extra = canonicalize_name(entry.extra)\n if extra and entry.marker:\n marker = f'({entry.marker}) and extra == \"{extra}\"'\n elif extra:\n marker = f'extra == \"{extra}\"'\n elif entry.marker:\n marker = entry.marker\n else:\n marker = \"\"\n if marker:\n yield f\"{entry.requirement} ; {marker}\"\n else:\n yield entry.requirement\n\n def _add_egg_info_requires(self, metadata: email.message.Message) -> None:\n \"\"\"Add egg-info requires.txt information to the metadata.\"\"\"\n if not metadata.get_all(\"Requires-Dist\"):\n for dep in self._iter_egg_info_dependencies():\n metadata[\"Requires-Dist\"] = dep\n if not metadata.get_all(\"Provides-Extra\"):\n for extra in self._iter_egg_info_extras():\n metadata[\"Provides-Extra\"] = extra\n\n\nclass BaseEnvironment:\n \"\"\"An environment containing distributions to introspect.\"\"\"\n\n @classmethod\n def default(cls) -> \"BaseEnvironment\":\n raise NotImplementedError()\n\n @classmethod\n def from_paths(cls, paths: Optional[List[str]]) -> \"BaseEnvironment\":\n raise NotImplementedError()\n\n def get_distribution(self, name: str) -> Optional[\"BaseDistribution\"]:\n \"\"\"Given a requirement name, return the installed distributions.\n\n The name may not be normalized. The implementation must canonicalize\n it for lookup.\n \"\"\"\n raise NotImplementedError()\n\n def _iter_distributions(self) -> Iterator[\"BaseDistribution\"]:\n \"\"\"Iterate through installed distributions.\n\n This function should be implemented by subclass, but never called\n directly. Use the public ``iter_distribution()`` instead, which\n implements additional logic to make sure the distributions are valid.\n \"\"\"\n raise NotImplementedError()\n\n def iter_all_distributions(self) -> Iterator[BaseDistribution]:\n \"\"\"Iterate through all installed distributions without any filtering.\"\"\"\n for dist in self._iter_distributions():\n # Make sure the distribution actually comes from a valid Python\n # packaging distribution. Pip's AdjacentTempDirectory leaves folders\n # e.g. ``~atplotlib.dist-info`` if cleanup was interrupted. The\n # valid project name pattern is taken from PEP 508.\n project_name_valid = re.match(\n r\"^([A-Z0-9]|[A-Z0-9][A-Z0-9._-]*[A-Z0-9])$\",\n dist.canonical_name,\n flags=re.IGNORECASE,\n )\n if not project_name_valid:\n logger.warning(\n \"Ignoring invalid distribution %s (%s)\",\n dist.canonical_name,\n dist.location,\n )\n continue\n yield dist\n\n def iter_installed_distributions(\n self,\n local_only: bool = True,\n skip: Container[str] = stdlib_pkgs,\n include_editables: bool = True,\n editables_only: bool = False,\n user_only: bool = False,\n ) -> Iterator[BaseDistribution]:\n \"\"\"Return a list of installed distributions.\n\n This is based on ``iter_all_distributions()`` with additional filtering\n options. Note that ``iter_installed_distributions()`` without arguments\n is *not* equal to ``iter_all_distributions()``, since some of the\n configurations exclude packages by default.\n\n :param local_only: If True (default), only return installations\n local to the current virtualenv, if in a virtualenv.\n :param skip: An iterable of canonicalized project names to ignore;\n defaults to ``stdlib_pkgs``.\n :param include_editables: If False, don't report editables.\n :param editables_only: If True, only report editables.\n :param user_only: If True, only report installations in the user\n site directory.\n \"\"\"\n it = self.iter_all_distributions()\n if local_only:\n it = (d for d in it if d.local)\n if not include_editables:\n it = (d for d in it if not d.editable)\n if editables_only:\n it = (d for d in it if d.editable)\n if user_only:\n it = (d for d in it if d.in_usersite)\n return (d for d in it if d.canonical_name not in skip)\n\n\nclass Wheel(Protocol):\n location: str\n\n def as_zipfile(self) -> zipfile.ZipFile:\n raise NotImplementedError()\n\n\nclass FilesystemWheel(Wheel):\n def __init__(self, location: str) -> None:\n self.location = location\n\n def as_zipfile(self) -> zipfile.ZipFile:\n return zipfile.ZipFile(self.location, allowZip64=True)\n\n\nclass MemoryWheel(Wheel):\n def __init__(self, location: str, stream: IO[bytes]) -> None:\n self.location = location\n self.stream = stream\n\n def as_zipfile(self) -> zipfile.ZipFile:\n return zipfile.ZipFile(self.stream, allowZip64=True)\n",[],[100,509,516,523,475,544,989,868],{"_104":1063,"_96":1064,"_158":1065,"_160":990,"_161":139,"_162":1066,"_164":165,"_106":1067,"_101":29,"_167":215,"_169":1068,"_170":25,"_171":-5,"_172":1069,"_99":1070},"07731ef2-67fc-11f0-805e-0224a6c84d84","pkg_resources.py","07731f9c-67fc-11f0-805e-0224a6c84d84",265,["D",1753299259962],"import email.message\nimport email.parser\nimport logging\nimport os\nimport zipfile\nfrom typing import (\n Collection,\n Iterable,\n Iterator,\n List,\n Mapping,\n NamedTuple,\n Optional,\n)\n\nfrom pip._vendor import pkg_resources\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import Version\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.exceptions import InvalidWheel, NoneMetadataError, UnsupportedWheel\nfrom pip._internal.utils.egg_link import egg_link_path_from_location\nfrom pip._internal.utils.misc import display_path, normalize_path\nfrom pip._internal.utils.wheel import parse_wheel, read_wheel_metadata_file\n\nfrom .base import (\n BaseDistribution,\n BaseEntryPoint,\n BaseEnvironment,\n InfoPath,\n Wheel,\n)\n\n__all__ = [\"NAME\", \"Distribution\", \"Environment\"]\n\nlogger = logging.getLogger(__name__)\n\nNAME = \"pkg_resources\"\n\n\nclass EntryPoint(NamedTuple):\n name: str\n value: str\n group: str\n\n\nclass InMemoryMetadata:\n \"\"\"IMetadataProvider that reads metadata files from a dictionary.\n\n This also maps metadata decoding exceptions to our internal exception type.\n \"\"\"\n\n def __init__(self, metadata: Mapping[str, bytes], wheel_name: str) -> None:\n self._metadata = metadata\n self._wheel_name = wheel_name\n\n def has_metadata(self, name: str) -> bool:\n return name in self._metadata\n\n def get_metadata(self, name: str) -> str:\n try:\n return self._metadata[name].decode()\n except UnicodeDecodeError as e:\n # Augment the default error with the origin of the file.\n raise UnsupportedWheel(\n f\"Error decoding metadata for {self._wheel_name}: {e} in {name} file\"\n )\n\n def get_metadata_lines(self, name: str) -> Iterable[str]:\n return pkg_resources.yield_lines(self.get_metadata(name))\n\n def metadata_isdir(self, name: str) -> bool:\n return False\n\n def metadata_listdir(self, name: str) -> List[str]:\n return []\n\n def run_script(self, script_name: str, namespace: str) -> None:\n pass\n\n\nclass Distribution(BaseDistribution):\n def __init__(self, dist: pkg_resources.Distribution) -> None:\n self._dist = dist\n # This is populated lazily, to avoid loading metadata for all possible\n # distributions eagerly.\n self.__extra_mapping: Optional[Mapping[NormalizedName, str]] = None\n\n @property\n def _extra_mapping(self) -> Mapping[NormalizedName, str]:\n if self.__extra_mapping is None:\n self.__extra_mapping = {\n canonicalize_name(extra): extra for extra in self._dist.extras\n }\n\n return self.__extra_mapping\n\n @classmethod\n def from_directory(cls, directory: str) -> BaseDistribution:\n dist_dir = directory.rstrip(os.sep)\n\n # Build a PathMetadata object, from path to metadata. :wink:\n base_dir, dist_dir_name = os.path.split(dist_dir)\n metadata = pkg_resources.PathMetadata(base_dir, dist_dir)\n\n # Determine the correct Distribution object type.\n if dist_dir.endswith(\".egg-info\"):\n dist_cls = pkg_resources.Distribution\n dist_name = os.path.splitext(dist_dir_name)[0]\n else:\n assert dist_dir.endswith(\".dist-info\")\n dist_cls = pkg_resources.DistInfoDistribution\n dist_name = os.path.splitext(dist_dir_name)[0].split(\"-\")[0]\n\n dist = dist_cls(base_dir, project_name=dist_name, metadata=metadata)\n return cls(dist)\n\n @classmethod\n def from_metadata_file_contents(\n cls,\n metadata_contents: bytes,\n filename: str,\n project_name: str,\n ) -> BaseDistribution:\n metadata_dict = {\n \"METADATA\": metadata_contents,\n }\n dist = pkg_resources.DistInfoDistribution(\n location=filename,\n metadata=InMemoryMetadata(metadata_dict, filename),\n project_name=project_name,\n )\n return cls(dist)\n\n @classmethod\n def from_wheel(cls, wheel: Wheel, name: str) -> BaseDistribution:\n try:\n with wheel.as_zipfile() as zf:\n info_dir, _ = parse_wheel(zf, name)\n metadata_dict = {\n path.split(\"/\", 1)[-1]: read_wheel_metadata_file(zf, path)\n for path in zf.namelist()\n if path.startswith(f\"{info_dir}/\")\n }\n except zipfile.BadZipFile as e:\n raise InvalidWheel(wheel.location, name) from e\n except UnsupportedWheel as e:\n raise UnsupportedWheel(f\"{name} has an invalid wheel, {e}\")\n dist = pkg_resources.DistInfoDistribution(\n location=wheel.location,\n metadata=InMemoryMetadata(metadata_dict, wheel.location),\n project_name=name,\n )\n return cls(dist)\n\n @property\n def location(self) -> Optional[str]:\n return self._dist.location\n\n @property\n def installed_location(self) -> Optional[str]:\n egg_link = egg_link_path_from_location(self.raw_name)\n if egg_link:\n location = egg_link\n elif self.location:\n location = self.location\n else:\n return None\n return normalize_path(location)\n\n @property\n def info_location(self) -> Optional[str]:\n return self._dist.egg_info\n\n @property\n def installed_by_distutils(self) -> bool:\n # A distutils-installed distribution is provided by FileMetadata. This\n # provider has a \"path\" attribute not present anywhere else. Not the\n # best introspection logic, but pip has been doing this for a long time.\n try:\n return bool(self._dist._provider.path)\n except AttributeError:\n return False\n\n @property\n def canonical_name(self) -> NormalizedName:\n return canonicalize_name(self._dist.project_name)\n\n @property\n def version(self) -> Version:\n return parse_version(self._dist.version)\n\n @property\n def raw_version(self) -> str:\n return self._dist.version\n\n def is_file(self, path: InfoPath) -> bool:\n return self._dist.has_metadata(str(path))\n\n def iter_distutils_script_names(self) -> Iterator[str]:\n yield from self._dist.metadata_listdir(\"scripts\")\n\n def read_text(self, path: InfoPath) -> str:\n name = str(path)\n if not self._dist.has_metadata(name):\n raise FileNotFoundError(name)\n content = self._dist.get_metadata(name)\n if content is None:\n raise NoneMetadataError(self, name)\n return content\n\n def iter_entry_points(self) -> Iterable[BaseEntryPoint]:\n for group, entries in self._dist.get_entry_map().items():\n for name, entry_point in entries.items():\n name, _, value = str(entry_point).partition(\"=\")\n yield EntryPoint(name=name.strip(), value=value.strip(), group=group)\n\n def _metadata_impl(self) -> email.message.Message:\n \"\"\"\n :raises NoneMetadataError: if the distribution reports `has_metadata()`\n True but `get_metadata()` returns None.\n \"\"\"\n if isinstance(self._dist, pkg_resources.DistInfoDistribution):\n metadata_name = \"METADATA\"\n else:\n metadata_name = \"PKG-INFO\"\n try:\n metadata = self.read_text(metadata_name)\n except FileNotFoundError:\n if self.location:\n displaying_path = display_path(self.location)\n else:\n displaying_path = repr(self.location)\n logger.warning(\"No metadata found in %s\", displaying_path)\n metadata = \"\"\n feed_parser = email.parser.FeedParser()\n feed_parser.feed(metadata)\n return feed_parser.close()\n\n def iter_dependencies(self, extras: Collection[str] = ()) -> Iterable[Requirement]:\n if extras:\n relevant_extras = set(self._extra_mapping) & set(\n map(canonicalize_name, extras)\n )\n extras = [self._extra_mapping[extra] for extra in relevant_extras]\n return self._dist.requires(extras)\n\n def iter_provided_extras(self) -> Iterable[NormalizedName]:\n return self._extra_mapping.keys()\n\n\nclass Environment(BaseEnvironment):\n def __init__(self, ws: pkg_resources.WorkingSet) -> None:\n self._ws = ws\n\n @classmethod\n def default(cls) -> BaseEnvironment:\n return cls(pkg_resources.working_set)\n\n @classmethod\n def from_paths(cls, paths: Optional[List[str]]) -> BaseEnvironment:\n return cls(pkg_resources.WorkingSet(paths))\n\n def _iter_distributions(self) -> Iterator[BaseDistribution]:\n for dist in self._ws:\n yield Distribution(dist)\n\n def _search_distribution(self, name: str) -> Optional[BaseDistribution]:\n \"\"\"Find a distribution matching the ``name`` in the environment.\n\n This searches from *all* distributions available in the environment, to\n match the behavior of ``pkg_resources.get_distribution()``.\n \"\"\"\n canonical_name = canonicalize_name(name)\n for dist in self.iter_all_distributions():\n if dist.canonical_name == canonical_name:\n return dist\n return None\n\n def get_distribution(self, name: str) -> Optional[BaseDistribution]:\n # Search the distribution by looking through the working set.\n dist = self._search_distribution(name)\n if dist:\n return dist\n\n # If distribution could not be found, call working_set.require to\n # update the working set, and try to find the distribution again.\n # This might happen for e.g. when you install a package twice, once\n # using setup.py develop and again using setup.py install. Now when\n # running pip uninstall twice, the package gets removed from the\n # working set in the first uninstall, so we have to populate the\n # working set again so that pip knows about it and the packages gets\n # picked up and is successfully uninstalled the second time too.\n try:\n # We didn't pass in any version specifiers, so this can never\n # raise pkg_resources.VersionConflict.\n self._ws.require(name)\n except pkg_resources.DistributionNotFound:\n return None\n return self._search_distribution(name)\n",[],[100,509,516,523,475,544,989,1064],[100,509,516,523,475,544,989],{"_104":1073,"_96":1074,"_158":1075,"_160":545,"_161":139,"_162":1076,"_164":165,"_106":1077,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1078,"_99":1193},"fc10fdae-67fb-11f0-a7d9-0224a6c84d84","models","fc10fe9e-67fb-11f0-a7d9-0224a6c84d84",59,["D",1753299241184],[1079,1087,1096,1105,1114,1122,1131,1140,1149,1158,1167,1176,1185],{"_104":1080,"_96":558,"_158":1081,"_160":1075,"_161":139,"_162":1082,"_164":165,"_106":1083,"_101":29,"_167":215,"_169":1084,"_170":25,"_171":-5,"_172":1085,"_99":1086},"05509762-67fc-11f0-8737-0224a6c84d84","0550982a-67fc-11f0-8737-0224a6c84d84",175,["D",1753299256666],"\"\"\"A package that contains models that represent entities.\"\"\"\n",[],[100,509,516,523,475,544,1074,558],{"_104":1088,"_96":1089,"_158":1090,"_160":1075,"_161":139,"_162":1091,"_164":165,"_106":1092,"_101":29,"_167":215,"_169":1093,"_170":25,"_171":-5,"_172":1094,"_99":1095},"0558317a-67fc-11f0-8737-0224a6c84d84","candidate.py","05583242-67fc-11f0-8737-0224a6c84d84",176,["D",1753299256751],"from dataclasses import dataclass\n\nfrom pip._vendor.packaging.version import Version\nfrom pip._vendor.packaging.version import parse as parse_version\n\nfrom pip._internal.models.link import Link\n\n\n@dataclass(frozen=True)\nclass InstallationCandidate:\n \"\"\"Represents a potential \"candidate\" for installation.\"\"\"\n\n __slots__ = [\"name\", \"version\", \"link\"]\n\n name: str\n version: Version\n link: Link\n\n def __init__(self, name: str, version: str, link: Link) -> None:\n object.__setattr__(self, \"name\", name)\n object.__setattr__(self, \"version\", parse_version(version))\n object.__setattr__(self, \"link\", link)\n\n def __str__(self) -> str:\n return f\"{self.name!r} candidate (version {self.version} at {self.link})\"\n",[],[100,509,516,523,475,544,1074,1089],{"_104":1097,"_96":1098,"_158":1099,"_160":1075,"_161":139,"_162":1100,"_164":165,"_106":1101,"_101":29,"_167":215,"_169":1102,"_170":25,"_171":-5,"_172":1103,"_99":1104},"05325cd4-67fc-11f0-8d4e-0224a6c84d84","direct_url.py","05325d88-67fc-11f0-8d4e-0224a6c84d84",170,["D",1753299256499],"\"\"\"PEP 610\"\"\"\n\nimport json\nimport re\nimport urllib.parse\nfrom dataclasses import dataclass\nfrom typing import Any, ClassVar, Dict, Iterable, Optional, Type, TypeVar, Union\n\n__all__ = [\n \"DirectUrl\",\n \"DirectUrlValidationError\",\n \"DirInfo\",\n \"ArchiveInfo\",\n \"VcsInfo\",\n]\n\nT = TypeVar(\"T\")\n\nDIRECT_URL_METADATA_NAME = \"direct_url.json\"\nENV_VAR_RE = re.compile(r\"^\\$\\{[A-Za-z0-9-_]+\\}(:\\$\\{[A-Za-z0-9-_]+\\})?$\")\n\n\nclass DirectUrlValidationError(Exception):\n pass\n\n\ndef _get(\n d: Dict[str, Any], expected_type: Type[T], key: str, default: Optional[T] = None\n) -> Optional[T]:\n \"\"\"Get value from dictionary and verify expected type.\"\"\"\n if key not in d:\n return default\n value = d[key]\n if not isinstance(value, expected_type):\n raise DirectUrlValidationError(\n f\"{value!r} has unexpected type for {key} (expected {expected_type})\"\n )\n return value\n\n\ndef _get_required(\n d: Dict[str, Any], expected_type: Type[T], key: str, default: Optional[T] = None\n) -> T:\n value = _get(d, expected_type, key, default)\n if value is None:\n raise DirectUrlValidationError(f\"{key} must have a value\")\n return value\n\n\ndef _exactly_one_of(infos: Iterable[Optional[\"InfoType\"]]) -> \"InfoType\":\n infos = [info for info in infos if info is not None]\n if not infos:\n raise DirectUrlValidationError(\n \"missing one of archive_info, dir_info, vcs_info\"\n )\n if len(infos) > 1:\n raise DirectUrlValidationError(\n \"more than one of archive_info, dir_info, vcs_info\"\n )\n assert infos[0] is not None\n return infos[0]\n\n\ndef _filter_none(**kwargs: Any) -> Dict[str, Any]:\n \"\"\"Make dict excluding None values.\"\"\"\n return {k: v for k, v in kwargs.items() if v is not None}\n\n\n@dataclass\nclass VcsInfo:\n name: ClassVar = \"vcs_info\"\n\n vcs: str\n commit_id: str\n requested_revision: Optional[str] = None\n\n @classmethod\n def _from_dict(cls, d: Optional[Dict[str, Any]]) -> Optional[\"VcsInfo\"]:\n if d is None:\n return None\n return cls(\n vcs=_get_required(d, str, \"vcs\"),\n commit_id=_get_required(d, str, \"commit_id\"),\n requested_revision=_get(d, str, \"requested_revision\"),\n )\n\n def _to_dict(self) -> Dict[str, Any]:\n return _filter_none(\n vcs=self.vcs,\n requested_revision=self.requested_revision,\n commit_id=self.commit_id,\n )\n\n\nclass ArchiveInfo:\n name = \"archive_info\"\n\n def __init__(\n self,\n hash: Optional[str] = None,\n hashes: Optional[Dict[str, str]] = None,\n ) -> None:\n # set hashes before hash, since the hash setter will further populate hashes\n self.hashes = hashes\n self.hash = hash\n\n @property\n def hash(self) -> Optional[str]:\n return self._hash\n\n @hash.setter\n def hash(self, value: Optional[str]) -> None:\n if value is not None:\n # Auto-populate the hashes key to upgrade to the new format automatically.\n # We don't back-populate the legacy hash key from hashes.\n try:\n hash_name, hash_value = value.split(\"=\", 1)\n except ValueError:\n raise DirectUrlValidationError(\n f\"invalid archive_info.hash format: {value!r}\"\n )\n if self.hashes is None:\n self.hashes = {hash_name: hash_value}\n elif hash_name not in self.hashes:\n self.hashes = self.hashes.copy()\n self.hashes[hash_name] = hash_value\n self._hash = value\n\n @classmethod\n def _from_dict(cls, d: Optional[Dict[str, Any]]) -> Optional[\"ArchiveInfo\"]:\n if d is None:\n return None\n return cls(hash=_get(d, str, \"hash\"), hashes=_get(d, dict, \"hashes\"))\n\n def _to_dict(self) -> Dict[str, Any]:\n return _filter_none(hash=self.hash, hashes=self.hashes)\n\n\n@dataclass\nclass DirInfo:\n name: ClassVar = \"dir_info\"\n\n editable: bool = False\n\n @classmethod\n def _from_dict(cls, d: Optional[Dict[str, Any]]) -> Optional[\"DirInfo\"]:\n if d is None:\n return None\n return cls(editable=_get_required(d, bool, \"editable\", default=False))\n\n def _to_dict(self) -> Dict[str, Any]:\n return _filter_none(editable=self.editable or None)\n\n\nInfoType = Union[ArchiveInfo, DirInfo, VcsInfo]\n\n\n@dataclass\nclass DirectUrl:\n url: str\n info: InfoType\n subdirectory: Optional[str] = None\n\n def _remove_auth_from_netloc(self, netloc: str) -> str:\n if \"@\" not in netloc:\n return netloc\n user_pass, netloc_no_user_pass = netloc.split(\"@\", 1)\n if (\n isinstance(self.info, VcsInfo)\n and self.info.vcs == \"git\"\n and user_pass == \"git\"\n ):\n return netloc\n if ENV_VAR_RE.match(user_pass):\n return netloc\n return netloc_no_user_pass\n\n @property\n def redacted_url(self) -> str:\n \"\"\"url with user:password part removed unless it is formed with\n environment variables as specified in PEP 610, or it is ``git``\n in the case of a git URL.\n \"\"\"\n purl = urllib.parse.urlsplit(self.url)\n netloc = self._remove_auth_from_netloc(purl.netloc)\n surl = urllib.parse.urlunsplit(\n (purl.scheme, netloc, purl.path, purl.query, purl.fragment)\n )\n return surl\n\n def validate(self) -> None:\n self.from_dict(self.to_dict())\n\n @classmethod\n def from_dict(cls, d: Dict[str, Any]) -> \"DirectUrl\":\n return DirectUrl(\n url=_get_required(d, str, \"url\"),\n subdirectory=_get(d, str, \"subdirectory\"),\n info=_exactly_one_of(\n [\n ArchiveInfo._from_dict(_get(d, dict, \"archive_info\")),\n DirInfo._from_dict(_get(d, dict, \"dir_info\")),\n VcsInfo._from_dict(_get(d, dict, \"vcs_info\")),\n ]\n ),\n )\n\n def to_dict(self) -> Dict[str, Any]:\n res = _filter_none(\n url=self.redacted_url,\n subdirectory=self.subdirectory,\n )\n res[self.info.name] = self.info._to_dict()\n return res\n\n @classmethod\n def from_json(cls, s: str) -> \"DirectUrl\":\n return cls.from_dict(json.loads(s))\n\n def to_json(self) -> str:\n return json.dumps(self.to_dict(), sort_keys=True)\n\n def is_local_editable(self) -> bool:\n return isinstance(self.info, DirInfo) and self.info.editable\n",[],[100,509,516,523,475,544,1074,1098],{"_104":1106,"_96":1107,"_158":1108,"_160":1075,"_161":139,"_162":1109,"_164":165,"_106":1110,"_101":29,"_167":215,"_169":1111,"_170":25,"_171":-5,"_172":1112,"_99":1113},"055b2c72-67fc-11f0-85ab-0224a6c84d84","format_control.py","055b2d26-67fc-11f0-85ab-0224a6c84d84",177,["D",1753299256758],"from typing import FrozenSet, Optional, Set\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.exceptions import CommandError\n\n\nclass FormatControl:\n \"\"\"Helper for managing formats from which a package can be installed.\"\"\"\n\n __slots__ = [\"no_binary\", \"only_binary\"]\n\n def __init__(\n self,\n no_binary: Optional[Set[str]] = None,\n only_binary: Optional[Set[str]] = None,\n ) -> None:\n if no_binary is None:\n no_binary = set()\n if only_binary is None:\n only_binary = set()\n\n self.no_binary = no_binary\n self.only_binary = only_binary\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, self.__class__):\n return NotImplemented\n\n if self.__slots__ != other.__slots__:\n return False\n\n return all(getattr(self, k) == getattr(other, k) for k in self.__slots__)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({self.no_binary}, {self.only_binary})\"\n\n @staticmethod\n def handle_mutual_excludes(value: str, target: Set[str], other: Set[str]) -> None:\n if value.startswith(\"-\"):\n raise CommandError(\n \"--no-binary / --only-binary option requires 1 argument.\"\n )\n new = value.split(\",\")\n while \":all:\" in new:\n other.clear()\n target.clear()\n target.add(\":all:\")\n del new[: new.index(\":all:\") + 1]\n # Without a none, we want to discard everything as :all: covers it\n if \":none:\" not in new:\n return\n for name in new:\n if name == \":none:\":\n target.clear()\n continue\n name = canonicalize_name(name)\n other.discard(name)\n target.add(name)\n\n def get_allowed_formats(self, canonical_name: str) -> FrozenSet[str]:\n result = {\"binary\", \"source\"}\n if canonical_name in self.only_binary:\n result.discard(\"source\")\n elif canonical_name in self.no_binary:\n result.discard(\"binary\")\n elif \":all:\" in self.only_binary:\n result.discard(\"source\")\n elif \":all:\" in self.no_binary:\n result.discard(\"binary\")\n return frozenset(result)\n\n def disallow_binaries(self) -> None:\n self.handle_mutual_excludes(\n \":all:\",\n self.no_binary,\n self.only_binary,\n )\n",[],[100,509,516,523,475,544,1074,1107],{"_104":1115,"_96":771,"_158":1116,"_160":1075,"_161":139,"_162":1117,"_164":165,"_106":1118,"_101":29,"_167":215,"_169":1119,"_170":25,"_171":-5,"_172":1120,"_99":1121},"05361fcc-67fc-11f0-a082-0224a6c84d84","053620bc-67fc-11f0-a082-0224a6c84d84",171,["D",1753299256514],"import urllib.parse\n\n\nclass PackageIndex:\n \"\"\"Represents a Package Index and provides easier access to endpoints\"\"\"\n\n __slots__ = [\"url\", \"netloc\", \"simple_url\", \"pypi_url\", \"file_storage_domain\"]\n\n def __init__(self, url: str, file_storage_domain: str) -> None:\n super().__init__()\n self.url = url\n self.netloc = urllib.parse.urlsplit(url).netloc\n self.simple_url = self._url_for_path(\"simple\")\n self.pypi_url = self._url_for_path(\"pypi\")\n\n # This is part of a temporary hack used to block installs of PyPI\n # packages which depend on external urls only necessary until PyPI can\n # block such packages themselves\n self.file_storage_domain = file_storage_domain\n\n def _url_for_path(self, path: str) -> str:\n return urllib.parse.urljoin(self.url, path)\n\n\nPyPI = PackageIndex(\"https://pypi.org/\", file_storage_domain=\"files.pythonhosted.org\")\nTestPyPI = PackageIndex(\n \"https://test.pypi.org/\", file_storage_domain=\"test-files.pythonhosted.org\"\n)\n",[],[100,509,516,523,475,544,1074,771],{"_104":1123,"_96":1124,"_158":1125,"_160":1075,"_161":139,"_162":1126,"_164":165,"_106":1127,"_101":29,"_167":215,"_169":1128,"_170":25,"_171":-5,"_172":1129,"_99":1130},"05614ec2-67fc-11f0-8d4e-0224a6c84d84","installation_report.py","05615034-67fc-11f0-8d4e-0224a6c84d84",178,["D",1753299256809],"from typing import Any, Dict, Sequence\n\nfrom pip._vendor.packaging.markers import default_environment\n\nfrom pip import __version__\nfrom pip._internal.req.req_install import InstallRequirement\n\n\nclass InstallationReport:\n def __init__(self, install_requirements: Sequence[InstallRequirement]):\n self._install_requirements = install_requirements\n\n @classmethod\n def _install_req_to_dict(cls, ireq: InstallRequirement) -> Dict[str, Any]:\n assert ireq.download_info, f\"No download_info for {ireq}\"\n res = {\n # PEP 610 json for the download URL. download_info.archive_info.hashes may\n # be absent when the requirement was installed from the wheel cache\n # and the cache entry was populated by an older pip version that did not\n # record origin.json.\n \"download_info\": ireq.download_info.to_dict(),\n # is_direct is true if the requirement was a direct URL reference (which\n # includes editable requirements), and false if the requirement was\n # downloaded from a PEP 503 index or --find-links.\n \"is_direct\": ireq.is_direct,\n # is_yanked is true if the requirement was yanked from the index, but\n # was still selected by pip to conform to PEP 592.\n \"is_yanked\": ireq.link.is_yanked if ireq.link else False,\n # requested is true if the requirement was specified by the user (aka\n # top level requirement), and false if it was installed as a dependency of a\n # requirement. https://peps.python.org/pep-0376/#requested\n \"requested\": ireq.user_supplied,\n # PEP 566 json encoding for metadata\n # https://www.python.org/dev/peps/pep-0566/#json-compatible-metadata\n \"metadata\": ireq.get_dist().metadata_dict,\n }\n if ireq.user_supplied and ireq.extras:\n # For top level requirements, the list of requested extras, if any.\n res[\"requested_extras\"] = sorted(ireq.extras)\n return res\n\n def to_dict(self) -> Dict[str, Any]:\n return {\n \"version\": \"1\",\n \"pip_version\": __version__,\n \"install\": [\n self._install_req_to_dict(ireq) for ireq in self._install_requirements\n ],\n # https://peps.python.org/pep-0508/#environment-markers\n # TODO: currently, the resolver uses the default environment to evaluate\n # environment markers, so that is what we report here. In the future, it\n # should also take into account options such as --python-version or\n # --platform, perhaps under the form of an environment_override field?\n # https://github.com/pypa/pip/issues/11198\n \"environment\": default_environment(),\n }\n",[],[100,509,516,523,475,544,1074,1124],{"_104":1132,"_96":1133,"_158":1134,"_160":1075,"_161":139,"_162":1135,"_164":165,"_106":1136,"_101":29,"_167":215,"_169":1137,"_170":25,"_171":-5,"_172":1138,"_99":1139},"0523338a-67fc-11f0-9ad5-0224a6c84d84","link.py","05233434-67fc-11f0-9ad5-0224a6c84d84",168,["D",1753299256402],"import functools\nimport itertools\nimport logging\nimport os\nimport posixpath\nimport re\nimport urllib.parse\nfrom dataclasses import dataclass\nfrom typing import (\n TYPE_CHECKING,\n Any,\n Dict,\n List,\n Mapping,\n NamedTuple,\n Optional,\n Tuple,\n Union,\n)\n\nfrom pip._internal.utils.deprecation import deprecated\nfrom pip._internal.utils.filetypes import WHEEL_EXTENSION\nfrom pip._internal.utils.hashes import Hashes\nfrom pip._internal.utils.misc import (\n pairwise,\n redact_auth_from_url,\n split_auth_from_netloc,\n splitext,\n)\nfrom pip._internal.utils.urls import path_to_url, url_to_path\n\nif TYPE_CHECKING:\n from pip._internal.index.collector import IndexContent\n\nlogger = logging.getLogger(__name__)\n\n\n# Order matters, earlier hashes have a precedence over later hashes for what\n# we will pick to use.\n_SUPPORTED_HASHES = (\"sha512\", \"sha384\", \"sha256\", \"sha224\", \"sha1\", \"md5\")\n\n\n@dataclass(frozen=True)\nclass LinkHash:\n \"\"\"Links to content may have embedded hash values. This class parses those.\n\n `name` must be any member of `_SUPPORTED_HASHES`.\n\n This class can be converted to and from `ArchiveInfo`. While ArchiveInfo intends to\n be JSON-serializable to conform to PEP 610, this class contains the logic for\n parsing a hash name and value for correctness, and then checking whether that hash\n conforms to a schema with `.is_hash_allowed()`.\"\"\"\n\n name: str\n value: str\n\n _hash_url_fragment_re = re.compile(\n # NB: we do not validate that the second group (.*) is a valid hex\n # digest. Instead, we simply keep that string in this class, and then check it\n # against Hashes when hash-checking is needed. This is easier to debug than\n # proactively discarding an invalid hex digest, as we handle incorrect hashes\n # and malformed hashes in the same place.\n r\"[#&]({choices})=([^&]*)\".format(\n choices=\"|\".join(re.escape(hash_name) for hash_name in _SUPPORTED_HASHES)\n ),\n )\n\n def __post_init__(self) -> None:\n assert self.name in _SUPPORTED_HASHES\n\n @classmethod\n @functools.lru_cache(maxsize=None)\n def find_hash_url_fragment(cls, url: str) -> Optional[\"LinkHash\"]:\n \"\"\"Search a string for a checksum algorithm name and encoded output value.\"\"\"\n match = cls._hash_url_fragment_re.search(url)\n if match is None:\n return None\n name, value = match.groups()\n return cls(name=name, value=value)\n\n def as_dict(self) -> Dict[str, str]:\n return {self.name: self.value}\n\n def as_hashes(self) -> Hashes:\n \"\"\"Return a Hashes instance which checks only for the current hash.\"\"\"\n return Hashes({self.name: [self.value]})\n\n def is_hash_allowed(self, hashes: Optional[Hashes]) -> bool:\n \"\"\"\n Return True if the current hash is allowed by `hashes`.\n \"\"\"\n if hashes is None:\n return False\n return hashes.is_hash_allowed(self.name, hex_digest=self.value)\n\n\n@dataclass(frozen=True)\nclass MetadataFile:\n \"\"\"Information about a core metadata file associated with a distribution.\"\"\"\n\n hashes: Optional[Dict[str, str]]\n\n def __post_init__(self) -> None:\n if self.hashes is not None:\n assert all(name in _SUPPORTED_HASHES for name in self.hashes)\n\n\ndef supported_hashes(hashes: Optional[Dict[str, str]]) -> Optional[Dict[str, str]]:\n # Remove any unsupported hash types from the mapping. If this leaves no\n # supported hashes, return None\n if hashes is None:\n return None\n hashes = {n: v for n, v in hashes.items() if n in _SUPPORTED_HASHES}\n if not hashes:\n return None\n return hashes\n\n\ndef _clean_url_path_part(part: str) -> str:\n \"\"\"\n Clean a \"part\" of a URL path (i.e. after splitting on \"@\" characters).\n \"\"\"\n # We unquote prior to quoting to make sure nothing is double quoted.\n return urllib.parse.quote(urllib.parse.unquote(part))\n\n\ndef _clean_file_url_path(part: str) -> str:\n \"\"\"\n Clean the first part of a URL path that corresponds to a local\n filesystem path (i.e. the first part after splitting on \"@\" characters).\n \"\"\"\n # We unquote prior to quoting to make sure nothing is double quoted.\n # Also, on Windows the path part might contain a drive letter which\n # should not be quoted. On Linux where drive letters do not\n # exist, the colon should be quoted. We rely on urllib.request\n # to do the right thing here.\n return urllib.request.pathname2url(urllib.request.url2pathname(part))\n\n\n# percent-encoded: /\n_reserved_chars_re = re.compile(\"(@|%2F)\", re.IGNORECASE)\n\n\ndef _clean_url_path(path: str, is_local_path: bool) -> str:\n \"\"\"\n Clean the path portion of a URL.\n \"\"\"\n if is_local_path:\n clean_func = _clean_file_url_path\n else:\n clean_func = _clean_url_path_part\n\n # Split on the reserved characters prior to cleaning so that\n # revision strings in VCS URLs are properly preserved.\n parts = _reserved_chars_re.split(path)\n\n cleaned_parts = []\n for to_clean, reserved in pairwise(itertools.chain(parts, [\"\"])):\n cleaned_parts.append(clean_func(to_clean))\n # Normalize %xx escapes (e.g. %2f -> %2F)\n cleaned_parts.append(reserved.upper())\n\n return \"\".join(cleaned_parts)\n\n\ndef _ensure_quoted_url(url: str) -> str:\n \"\"\"\n Make sure a link is fully quoted.\n For example, if ' ' occurs in the URL, it will be replaced with \"%20\",\n and without double-quoting other characters.\n \"\"\"\n # Split the URL into parts according to the general structure\n # `scheme://netloc/path?query#fragment`.\n result = urllib.parse.urlsplit(url)\n # If the netloc is empty, then the URL refers to a local filesystem path.\n is_local_path = not result.netloc\n path = _clean_url_path(result.path, is_local_path=is_local_path)\n return urllib.parse.urlunsplit(result._replace(path=path))\n\n\ndef _absolute_link_url(base_url: str, url: str) -> str:\n \"\"\"\n A faster implementation of urllib.parse.urljoin with a shortcut\n for absolute http/https URLs.\n \"\"\"\n if url.startswith((\"https://\", \"http://\")):\n return url\n else:\n return urllib.parse.urljoin(base_url, url)\n\n\n@functools.total_ordering\nclass Link:\n \"\"\"Represents a parsed link from a Package Index's simple URL\"\"\"\n\n __slots__ = [\n \"_parsed_url\",\n \"_url\",\n \"_path\",\n \"_hashes\",\n \"comes_from\",\n \"requires_python\",\n \"yanked_reason\",\n \"metadata_file_data\",\n \"cache_link_parsing\",\n \"egg_fragment\",\n ]\n\n def __init__(\n self,\n url: str,\n comes_from: Optional[Union[str, \"IndexContent\"]] = None,\n requires_python: Optional[str] = None,\n yanked_reason: Optional[str] = None,\n metadata_file_data: Optional[MetadataFile] = None,\n cache_link_parsing: bool = True,\n hashes: Optional[Mapping[str, str]] = None,\n ) -> None:\n \"\"\"\n :param url: url of the resource pointed to (href of the link)\n :param comes_from: instance of IndexContent where the link was found,\n or string.\n :param requires_python: String containing the `Requires-Python`\n metadata field, specified in PEP 345. This may be specified by\n a data-requires-python attribute in the HTML link tag, as\n described in PEP 503.\n :param yanked_reason: the reason the file has been yanked, if the\n file has been yanked, or None if the file hasn't been yanked.\n This is the value of the \"data-yanked\" attribute, if present, in\n a simple repository HTML link. If the file has been yanked but\n no reason was provided, this should be the empty string. See\n PEP 592 for more information and the specification.\n :param metadata_file_data: the metadata attached to the file, or None if\n no such metadata is provided. This argument, if not None, indicates\n that a separate metadata file exists, and also optionally supplies\n hashes for that file.\n :param cache_link_parsing: A flag that is used elsewhere to determine\n whether resources retrieved from this link should be cached. PyPI\n URLs should generally have this set to False, for example.\n :param hashes: A mapping of hash names to digests to allow us to\n determine the validity of a download.\n \"\"\"\n\n # The comes_from, requires_python, and metadata_file_data arguments are\n # only used by classmethods of this class, and are not used in client\n # code directly.\n\n # url can be a UNC windows share\n if url.startswith(\"\\\\\\\\\"):\n url = path_to_url(url)\n\n self._parsed_url = urllib.parse.urlsplit(url)\n # Store the url as a private attribute to prevent accidentally\n # trying to set a new value.\n self._url = url\n # The .path property is hot, so calculate its value ahead of time.\n self._path = urllib.parse.unquote(self._parsed_url.path)\n\n link_hash = LinkHash.find_hash_url_fragment(url)\n hashes_from_link = {} if link_hash is None else link_hash.as_dict()\n if hashes is None:\n self._hashes = hashes_from_link\n else:\n self._hashes = {**hashes, **hashes_from_link}\n\n self.comes_from = comes_from\n self.requires_python = requires_python if requires_python else None\n self.yanked_reason = yanked_reason\n self.metadata_file_data = metadata_file_data\n\n self.cache_link_parsing = cache_link_parsing\n self.egg_fragment = self._egg_fragment()\n\n @classmethod\n def from_json(\n cls,\n file_data: Dict[str, Any],\n page_url: str,\n ) -> Optional[\"Link\"]:\n \"\"\"\n Convert an pypi json document from a simple repository page into a Link.\n \"\"\"\n file_url = file_data.get(\"url\")\n if file_url is None:\n return None\n\n url = _ensure_quoted_url(_absolute_link_url(page_url, file_url))\n pyrequire = file_data.get(\"requires-python\")\n yanked_reason = file_data.get(\"yanked\")\n hashes = file_data.get(\"hashes\", {})\n\n # PEP 714: Indexes must use the name core-metadata, but\n # clients should support the old name as a fallback for compatibility.\n metadata_info = file_data.get(\"core-metadata\")\n if metadata_info is None:\n metadata_info = file_data.get(\"dist-info-metadata\")\n\n # The metadata info value may be a boolean, or a dict of hashes.\n if isinstance(metadata_info, dict):\n # The file exists, and hashes have been supplied\n metadata_file_data = MetadataFile(supported_hashes(metadata_info))\n elif metadata_info:\n # The file exists, but there are no hashes\n metadata_file_data = MetadataFile(None)\n else:\n # False or not present: the file does not exist\n metadata_file_data = None\n\n # The Link.yanked_reason expects an empty string instead of a boolean.\n if yanked_reason and not isinstance(yanked_reason, str):\n yanked_reason = \"\"\n # The Link.yanked_reason expects None instead of False.\n elif not yanked_reason:\n yanked_reason = None\n\n return cls(\n url,\n comes_from=page_url,\n requires_python=pyrequire,\n yanked_reason=yanked_reason,\n hashes=hashes,\n metadata_file_data=metadata_file_data,\n )\n\n @classmethod\n def from_element(\n cls,\n anchor_attribs: Dict[str, Optional[str]],\n page_url: str,\n base_url: str,\n ) -> Optional[\"Link\"]:\n \"\"\"\n Convert an anchor element's attributes in a simple repository page to a Link.\n \"\"\"\n href = anchor_attribs.get(\"href\")\n if not href:\n return None\n\n url = _ensure_quoted_url(_absolute_link_url(base_url, href))\n pyrequire = anchor_attribs.get(\"data-requires-python\")\n yanked_reason = anchor_attribs.get(\"data-yanked\")\n\n # PEP 714: Indexes must use the name data-core-metadata, but\n # clients should support the old name as a fallback for compatibility.\n metadata_info = anchor_attribs.get(\"data-core-metadata\")\n if metadata_info is None:\n metadata_info = anchor_attribs.get(\"data-dist-info-metadata\")\n # The metadata info value may be the string \"true\", or a string of\n # the form \"hashname=hashval\"\n if metadata_info == \"true\":\n # The file exists, but there are no hashes\n metadata_file_data = MetadataFile(None)\n elif metadata_info is None:\n # The file does not exist\n metadata_file_data = None\n else:\n # The file exists, and hashes have been supplied\n hashname, sep, hashval = metadata_info.partition(\"=\")\n if sep == \"=\":\n metadata_file_data = MetadataFile(supported_hashes({hashname: hashval}))\n else:\n # Error - data is wrong. Treat as no hashes supplied.\n logger.debug(\n \"Index returned invalid data-dist-info-metadata value: %s\",\n metadata_info,\n )\n metadata_file_data = MetadataFile(None)\n\n return cls(\n url,\n comes_from=page_url,\n requires_python=pyrequire,\n yanked_reason=yanked_reason,\n metadata_file_data=metadata_file_data,\n )\n\n def __str__(self) -> str:\n if self.requires_python:\n rp = f\" (requires-python:{self.requires_python})\"\n else:\n rp = \"\"\n if self.comes_from:\n return f\"{self.redacted_url} (from {self.comes_from}){rp}\"\n else:\n return self.redacted_url\n\n def __repr__(self) -> str:\n return f\"\"\n\n def __hash__(self) -> int:\n return hash(self.url)\n\n def __eq__(self, other: Any) -> bool:\n if not isinstance(other, Link):\n return NotImplemented\n return self.url == other.url\n\n def __lt__(self, other: Any) -> bool:\n if not isinstance(other, Link):\n return NotImplemented\n return self.url < other.url\n\n @property\n def url(self) -> str:\n return self._url\n\n @property\n def redacted_url(self) -> str:\n return redact_auth_from_url(self.url)\n\n @property\n def filename(self) -> str:\n path = self.path.rstrip(\"/\")\n name = posixpath.basename(path)\n if not name:\n # Make sure we don't leak auth information if the netloc\n # includes a username and password.\n netloc, user_pass = split_auth_from_netloc(self.netloc)\n return netloc\n\n name = urllib.parse.unquote(name)\n assert name, f\"URL {self._url!r} produced no filename\"\n return name\n\n @property\n def file_path(self) -> str:\n return url_to_path(self.url)\n\n @property\n def scheme(self) -> str:\n return self._parsed_url.scheme\n\n @property\n def netloc(self) -> str:\n \"\"\"\n This can contain auth information.\n \"\"\"\n return self._parsed_url.netloc\n\n @property\n def path(self) -> str:\n return self._path\n\n def splitext(self) -> Tuple[str, str]:\n return splitext(posixpath.basename(self.path.rstrip(\"/\")))\n\n @property\n def ext(self) -> str:\n return self.splitext()[1]\n\n @property\n def url_without_fragment(self) -> str:\n scheme, netloc, path, query, fragment = self._parsed_url\n return urllib.parse.urlunsplit((scheme, netloc, path, query, \"\"))\n\n _egg_fragment_re = re.compile(r\"[#&]egg=([^&]*)\")\n\n # Per PEP 508.\n _project_name_re = re.compile(\n r\"^([A-Z0-9]|[A-Z0-9][A-Z0-9._-]*[A-Z0-9])$\", re.IGNORECASE\n )\n\n def _egg_fragment(self) -> Optional[str]:\n match = self._egg_fragment_re.search(self._url)\n if not match:\n return None\n\n # An egg fragment looks like a PEP 508 project name, along with\n # an optional extras specifier. Anything else is invalid.\n project_name = match.group(1)\n if not self._project_name_re.match(project_name):\n deprecated(\n reason=f\"{self} contains an egg fragment with a non-PEP 508 name.\",\n replacement=\"to use the req @ url syntax, and remove the egg fragment\",\n gone_in=\"25.2\",\n issue=13157,\n )\n\n return project_name\n\n _subdirectory_fragment_re = re.compile(r\"[#&]subdirectory=([^&]*)\")\n\n @property\n def subdirectory_fragment(self) -> Optional[str]:\n match = self._subdirectory_fragment_re.search(self._url)\n if not match:\n return None\n return match.group(1)\n\n def metadata_link(self) -> Optional[\"Link\"]:\n \"\"\"Return a link to the associated core metadata file (if any).\"\"\"\n if self.metadata_file_data is None:\n return None\n metadata_url = f\"{self.url_without_fragment}.metadata\"\n if self.metadata_file_data.hashes is None:\n return Link(metadata_url)\n return Link(metadata_url, hashes=self.metadata_file_data.hashes)\n\n def as_hashes(self) -> Hashes:\n return Hashes({k: [v] for k, v in self._hashes.items()})\n\n @property\n def hash(self) -> Optional[str]:\n return next(iter(self._hashes.values()), None)\n\n @property\n def hash_name(self) -> Optional[str]:\n return next(iter(self._hashes), None)\n\n @property\n def show_url(self) -> str:\n return posixpath.basename(self._url.split(\"#\", 1)[0].split(\"?\", 1)[0])\n\n @property\n def is_file(self) -> bool:\n return self.scheme == \"file\"\n\n def is_existing_dir(self) -> bool:\n return self.is_file and os.path.isdir(self.file_path)\n\n @property\n def is_wheel(self) -> bool:\n return self.ext == WHEEL_EXTENSION\n\n @property\n def is_vcs(self) -> bool:\n from pip._internal.vcs import vcs\n\n return self.scheme in vcs.all_schemes\n\n @property\n def is_yanked(self) -> bool:\n return self.yanked_reason is not None\n\n @property\n def has_hash(self) -> bool:\n return bool(self._hashes)\n\n def is_hash_allowed(self, hashes: Optional[Hashes]) -> bool:\n \"\"\"\n Return True if the link has a hash and it is allowed by `hashes`.\n \"\"\"\n if hashes is None:\n return False\n return any(hashes.is_hash_allowed(k, v) for k, v in self._hashes.items())\n\n\nclass _CleanResult(NamedTuple):\n \"\"\"Convert link for equivalency check.\n\n This is used in the resolver to check whether two URL-specified requirements\n likely point to the same distribution and can be considered equivalent. This\n equivalency logic avoids comparing URLs literally, which can be too strict\n (e.g. \"a=1&b=2\" vs \"b=2&a=1\") and produce conflicts unexpecting to users.\n\n Currently this does three things:\n\n 1. Drop the basic auth part. This is technically wrong since a server can\n serve different content based on auth, but if it does that, it is even\n impossible to guarantee two URLs without auth are equivalent, since\n the user can input different auth information when prompted. So the\n practical solution is to assume the auth doesn't affect the response.\n 2. Parse the query to avoid the ordering issue. Note that ordering under the\n same key in the query are NOT cleaned; i.e. \"a=1&a=2\" and \"a=2&a=1\" are\n still considered different.\n 3. Explicitly drop most of the fragment part, except ``subdirectory=`` and\n hash values, since it should have no impact the downloaded content. Note\n that this drops the \"egg=\" part historically used to denote the requested\n project (and extras), which is wrong in the strictest sense, but too many\n people are supplying it inconsistently to cause superfluous resolution\n conflicts, so we choose to also ignore them.\n \"\"\"\n\n parsed: urllib.parse.SplitResult\n query: Dict[str, List[str]]\n subdirectory: str\n hashes: Dict[str, str]\n\n\ndef _clean_link(link: Link) -> _CleanResult:\n parsed = link._parsed_url\n netloc = parsed.netloc.rsplit(\"@\", 1)[-1]\n # According to RFC 8089, an empty host in file: means localhost.\n if parsed.scheme == \"file\" and not netloc:\n netloc = \"localhost\"\n fragment = urllib.parse.parse_qs(parsed.fragment)\n if \"egg\" in fragment:\n logger.debug(\"Ignoring egg= fragment in %s\", link)\n try:\n # If there are multiple subdirectory values, use the first one.\n # This matches the behavior of Link.subdirectory_fragment.\n subdirectory = fragment[\"subdirectory\"][0]\n except (IndexError, KeyError):\n subdirectory = \"\"\n # If there are multiple hash values under the same algorithm, use the\n # first one. This matches the behavior of Link.hash_value.\n hashes = {k: fragment[k][0] for k in _SUPPORTED_HASHES if k in fragment}\n return _CleanResult(\n parsed=parsed._replace(netloc=netloc, query=\"\", fragment=\"\"),\n query=urllib.parse.parse_qs(parsed.query),\n subdirectory=subdirectory,\n hashes=hashes,\n )\n\n\n@functools.lru_cache(maxsize=None)\ndef links_equivalent(link1: Link, link2: Link) -> bool:\n return _clean_link(link1) == _clean_link(link2)\n",[],[100,509,516,523,475,544,1074,1133],{"_104":1141,"_96":1142,"_158":1143,"_160":1075,"_161":139,"_162":1144,"_164":165,"_106":1145,"_101":29,"_167":215,"_169":1146,"_170":25,"_171":-5,"_172":1147,"_99":1148},"05402ecc-67fc-11f0-85ab-0224a6c84d84","pylock.py","05402f9e-67fc-11f0-85ab-0224a6c84d84",172,["D",1753299256577],"import dataclasses\nimport re\nfrom dataclasses import dataclass\nfrom pathlib import Path\nfrom typing import Any, Dict, Iterable, List, Optional, Tuple\n\nfrom pip._vendor import tomli_w\nfrom pip._vendor.typing_extensions import Self\n\nfrom pip._internal.models.direct_url import ArchiveInfo, DirInfo, VcsInfo\nfrom pip._internal.models.link import Link\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.urls import url_to_path\n\nPYLOCK_FILE_NAME_RE = re.compile(r\"^pylock\\.([^.]+)\\.toml$\")\n\n\ndef is_valid_pylock_file_name(path: Path) -> bool:\n return path.name == \"pylock.toml\" or bool(re.match(PYLOCK_FILE_NAME_RE, path.name))\n\n\ndef _toml_dict_factory(data: List[Tuple[str, Any]]) -> Dict[str, Any]:\n return {key.replace(\"_\", \"-\"): value for key, value in data if value is not None}\n\n\n@dataclass\nclass PackageVcs:\n type: str\n url: Optional[str]\n # (not supported) path: Optional[str]\n requested_revision: Optional[str]\n commit_id: str\n subdirectory: Optional[str]\n\n\n@dataclass\nclass PackageDirectory:\n path: str\n editable: Optional[bool]\n subdirectory: Optional[str]\n\n\n@dataclass\nclass PackageArchive:\n url: Optional[str]\n # (not supported) path: Optional[str]\n # (not supported) size: Optional[int]\n # (not supported) upload_time: Optional[datetime]\n hashes: Dict[str, str]\n subdirectory: Optional[str]\n\n\n@dataclass\nclass PackageSdist:\n name: str\n # (not supported) upload_time: Optional[datetime]\n url: Optional[str]\n # (not supported) path: Optional[str]\n # (not supported) size: Optional[int]\n hashes: Dict[str, str]\n\n\n@dataclass\nclass PackageWheel:\n name: str\n # (not supported) upload_time: Optional[datetime]\n url: Optional[str]\n # (not supported) path: Optional[str]\n # (not supported) size: Optional[int]\n hashes: Dict[str, str]\n\n\n@dataclass\nclass Package:\n name: str\n version: Optional[str] = None\n # (not supported) marker: Optional[str]\n # (not supported) requires_python: Optional[str]\n # (not supported) dependencies\n vcs: Optional[PackageVcs] = None\n directory: Optional[PackageDirectory] = None\n archive: Optional[PackageArchive] = None\n # (not supported) index: Optional[str]\n sdist: Optional[PackageSdist] = None\n wheels: Optional[List[PackageWheel]] = None\n # (not supported) attestation_identities: Optional[List[Dict[str, Any]]]\n # (not supported) tool: Optional[Dict[str, Any]]\n\n @classmethod\n def from_install_requirement(cls, ireq: InstallRequirement, base_dir: Path) -> Self:\n base_dir = base_dir.resolve()\n dist = ireq.get_dist()\n download_info = ireq.download_info\n assert download_info\n package = cls(name=dist.canonical_name)\n if ireq.is_direct:\n if isinstance(download_info.info, VcsInfo):\n package.vcs = PackageVcs(\n type=download_info.info.vcs,\n url=download_info.url,\n requested_revision=download_info.info.requested_revision,\n commit_id=download_info.info.commit_id,\n subdirectory=download_info.subdirectory,\n )\n elif isinstance(download_info.info, DirInfo):\n package.directory = PackageDirectory(\n path=(\n Path(url_to_path(download_info.url))\n .resolve()\n .relative_to(base_dir)\n .as_posix()\n ),\n editable=(\n download_info.info.editable\n if download_info.info.editable\n else None\n ),\n subdirectory=download_info.subdirectory,\n )\n elif isinstance(download_info.info, ArchiveInfo):\n if not download_info.info.hashes:\n raise NotImplementedError()\n package.archive = PackageArchive(\n url=download_info.url,\n hashes=download_info.info.hashes,\n subdirectory=download_info.subdirectory,\n )\n else:\n # should never happen\n raise NotImplementedError()\n else:\n package.version = str(dist.version)\n if isinstance(download_info.info, ArchiveInfo):\n if not download_info.info.hashes:\n raise NotImplementedError()\n link = Link(download_info.url)\n if link.is_wheel:\n package.wheels = [\n PackageWheel(\n name=link.filename,\n url=download_info.url,\n hashes=download_info.info.hashes,\n )\n ]\n else:\n package.sdist = PackageSdist(\n name=link.filename,\n url=download_info.url,\n hashes=download_info.info.hashes,\n )\n else:\n # should never happen\n raise NotImplementedError()\n return package\n\n\n@dataclass\nclass Pylock:\n lock_version: str = \"1.0\"\n # (not supported) environments: Optional[List[str]]\n # (not supported) requires_python: Optional[str]\n # (not supported) extras: List[str] = []\n # (not supported) dependency_groups: List[str] = []\n created_by: str = \"pip\"\n packages: List[Package] = dataclasses.field(default_factory=list)\n # (not supported) tool: Optional[Dict[str, Any]]\n\n def as_toml(self) -> str:\n return tomli_w.dumps(dataclasses.asdict(self, dict_factory=_toml_dict_factory))\n\n @classmethod\n def from_install_requirements(\n cls, install_requirements: Iterable[InstallRequirement], base_dir: Path\n ) -> Self:\n return cls(\n packages=sorted(\n (\n Package.from_install_requirement(ireq, base_dir)\n for ireq in install_requirements\n ),\n key=lambda p: p.name,\n )\n )\n",[],[100,509,516,523,475,544,1074,1142],{"_104":1150,"_96":1151,"_158":1152,"_160":1075,"_161":139,"_162":1153,"_164":165,"_106":1154,"_101":29,"_167":215,"_169":1155,"_170":25,"_171":-5,"_172":1156,"_99":1157},"0569761a-67fc-11f0-8d4e-0224a6c84d84","scheme.py","056976ce-67fc-11f0-8d4e-0224a6c84d84",179,["D",1753299256863],"\"\"\"\nFor types associated with installation schemes.\n\nFor a general overview of available schemes and their context, see\nhttps://docs.python.org/3/install/index.html#alternate-installation.\n\"\"\"\n\nfrom dataclasses import dataclass\n\nSCHEME_KEYS = [\"platlib\", \"purelib\", \"headers\", \"scripts\", \"data\"]\n\n\n@dataclass(frozen=True)\nclass Scheme:\n \"\"\"A Scheme holds paths which are used as the base directories for\n artifacts associated with a Python package.\n \"\"\"\n\n __slots__ = SCHEME_KEYS\n\n platlib: str\n purelib: str\n headers: str\n scripts: str\n data: str\n",[],[100,509,516,523,475,544,1074,1151],{"_104":1159,"_96":1160,"_158":1161,"_160":1075,"_161":139,"_162":1162,"_164":165,"_106":1163,"_101":29,"_167":215,"_169":1164,"_170":25,"_171":-5,"_172":1165,"_99":1166},"054d267c-67fc-11f0-b6cd-0224a6c84d84","search_scope.py","054d2776-67fc-11f0-b6cd-0224a6c84d84",174,["D",1753299256675],"import itertools\nimport logging\nimport os\nimport posixpath\nimport urllib.parse\nfrom dataclasses import dataclass\nfrom typing import List\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.models.index import PyPI\nfrom pip._internal.utils.compat import has_tls\nfrom pip._internal.utils.misc import normalize_path, redact_auth_from_url\n\nlogger = logging.getLogger(__name__)\n\n\n@dataclass(frozen=True)\nclass SearchScope:\n \"\"\"\n Encapsulates the locations that pip is configured to search.\n \"\"\"\n\n __slots__ = [\"find_links\", \"index_urls\", \"no_index\"]\n\n find_links: List[str]\n index_urls: List[str]\n no_index: bool\n\n @classmethod\n def create(\n cls,\n find_links: List[str],\n index_urls: List[str],\n no_index: bool,\n ) -> \"SearchScope\":\n \"\"\"\n Create a SearchScope object after normalizing the `find_links`.\n \"\"\"\n # Build find_links. If an argument starts with ~, it may be\n # a local file relative to a home directory. So try normalizing\n # it and if it exists, use the normalized version.\n # This is deliberately conservative - it might be fine just to\n # blindly normalize anything starting with a ~...\n built_find_links: List[str] = []\n for link in find_links:\n if link.startswith(\"~\"):\n new_link = normalize_path(link)\n if os.path.exists(new_link):\n link = new_link\n built_find_links.append(link)\n\n # If we don't have TLS enabled, then WARN if anyplace we're looking\n # relies on TLS.\n if not has_tls():\n for link in itertools.chain(index_urls, built_find_links):\n parsed = urllib.parse.urlparse(link)\n if parsed.scheme == \"https\":\n logger.warning(\n \"pip is configured with locations that require \"\n \"TLS/SSL, however the ssl module in Python is not \"\n \"available.\"\n )\n break\n\n return cls(\n find_links=built_find_links,\n index_urls=index_urls,\n no_index=no_index,\n )\n\n def get_formatted_locations(self) -> str:\n lines = []\n redacted_index_urls = []\n if self.index_urls and self.index_urls != [PyPI.simple_url]:\n for url in self.index_urls:\n redacted_index_url = redact_auth_from_url(url)\n\n # Parse the URL\n purl = urllib.parse.urlsplit(redacted_index_url)\n\n # URL is generally invalid if scheme and netloc is missing\n # there are issues with Python and URL parsing, so this test\n # is a bit crude. See bpo-20271, bpo-23505. Python doesn't\n # always parse invalid URLs correctly - it should raise\n # exceptions for malformed URLs\n if not purl.scheme and not purl.netloc:\n logger.warning(\n 'The index url \"%s\" seems invalid, please provide a scheme.',\n redacted_index_url,\n )\n\n redacted_index_urls.append(redacted_index_url)\n\n lines.append(\n \"Looking in indexes: {}\".format(\", \".join(redacted_index_urls))\n )\n\n if self.find_links:\n lines.append(\n \"Looking in links: {}\".format(\n \", \".join(redact_auth_from_url(url) for url in self.find_links)\n )\n )\n return \"\\n\".join(lines)\n\n def get_index_urls_locations(self, project_name: str) -> List[str]:\n \"\"\"Returns the locations found via self.index_urls\n\n Checks the url_name on the main (first in the list) index and\n use this url_name to produce all locations\n \"\"\"\n\n def mkurl_pypi_url(url: str) -> str:\n loc = posixpath.join(\n url, urllib.parse.quote(canonicalize_name(project_name))\n )\n # For maximum compatibility with easy_install, ensure the path\n # ends in a trailing slash. Although this isn't in the spec\n # (and PyPI can handle it without the slash) some other index\n # implementations might break if they relied on easy_install's\n # behavior.\n if not loc.endswith(\"/\"):\n loc = loc + \"/\"\n return loc\n\n return [mkurl_pypi_url(url) for url in self.index_urls]\n",[],[100,509,516,523,475,544,1074,1160],{"_104":1168,"_96":1169,"_158":1170,"_160":1075,"_161":139,"_162":1171,"_164":165,"_106":1172,"_101":29,"_167":215,"_169":1173,"_170":25,"_171":-5,"_172":1174,"_99":1175},"05299f4a-67fc-11f0-b654-0224a6c84d84","selection_prefs.py","0529a044-67fc-11f0-b654-0224a6c84d84",169,["D",1753299256443],"from typing import Optional\n\nfrom pip._internal.models.format_control import FormatControl\n\n\n# TODO: This needs Python 3.10's improved slots support for dataclasses\n# to be converted into a dataclass.\nclass SelectionPreferences:\n \"\"\"\n Encapsulates the candidate selection preferences for downloading\n and installing files.\n \"\"\"\n\n __slots__ = [\n \"allow_yanked\",\n \"allow_all_prereleases\",\n \"format_control\",\n \"prefer_binary\",\n \"ignore_requires_python\",\n ]\n\n # Don't include an allow_yanked default value to make sure each call\n # site considers whether yanked releases are allowed. This also causes\n # that decision to be made explicit in the calling code, which helps\n # people when reading the code.\n def __init__(\n self,\n allow_yanked: bool,\n allow_all_prereleases: bool = False,\n format_control: Optional[FormatControl] = None,\n prefer_binary: bool = False,\n ignore_requires_python: Optional[bool] = None,\n ) -> None:\n \"\"\"Create a SelectionPreferences object.\n\n :param allow_yanked: Whether files marked as yanked (in the sense\n of PEP 592) are permitted to be candidates for install.\n :param format_control: A FormatControl object or None. Used to control\n the selection of source packages / binary packages when consulting\n the index and links.\n :param prefer_binary: Whether to prefer an old, but valid, binary\n dist over a new source dist.\n :param ignore_requires_python: Whether to ignore incompatible\n \"Requires-Python\" values in links. Defaults to False.\n \"\"\"\n if ignore_requires_python is None:\n ignore_requires_python = False\n\n self.allow_yanked = allow_yanked\n self.allow_all_prereleases = allow_all_prereleases\n self.format_control = format_control\n self.prefer_binary = prefer_binary\n self.ignore_requires_python = ignore_requires_python\n",[],[100,509,516,523,475,544,1074,1169],{"_104":1177,"_96":1178,"_158":1179,"_160":1075,"_161":139,"_162":1180,"_164":165,"_106":1181,"_101":29,"_167":215,"_169":1182,"_170":25,"_171":-5,"_172":1183,"_99":1184},"0547ea90-67fc-11f0-8791-0224a6c84d84","target_python.py","0547eb44-67fc-11f0-8791-0224a6c84d84",173,["D",1753299256507],"import sys\nfrom typing import List, Optional, Set, Tuple\n\nfrom pip._vendor.packaging.tags import Tag\n\nfrom pip._internal.utils.compatibility_tags import get_supported, version_info_to_nodot\nfrom pip._internal.utils.misc import normalize_version_info\n\n\nclass TargetPython:\n \"\"\"\n Encapsulates the properties of a Python interpreter one is targeting\n for a package install, download, etc.\n \"\"\"\n\n __slots__ = [\n \"_given_py_version_info\",\n \"abis\",\n \"implementation\",\n \"platforms\",\n \"py_version\",\n \"py_version_info\",\n \"_valid_tags\",\n \"_valid_tags_set\",\n ]\n\n def __init__(\n self,\n platforms: Optional[List[str]] = None,\n py_version_info: Optional[Tuple[int, ...]] = None,\n abis: Optional[List[str]] = None,\n implementation: Optional[str] = None,\n ) -> None:\n \"\"\"\n :param platforms: A list of strings or None. If None, searches for\n packages that are supported by the current system. Otherwise, will\n find packages that can be built on the platforms passed in. These\n packages will only be downloaded for distribution: they will\n not be built locally.\n :param py_version_info: An optional tuple of ints representing the\n Python version information to use (e.g. `sys.version_info[:3]`).\n This can have length 1, 2, or 3 when provided.\n :param abis: A list of strings or None. This is passed to\n compatibility_tags.py's get_supported() function as is.\n :param implementation: A string or None. This is passed to\n compatibility_tags.py's get_supported() function as is.\n \"\"\"\n # Store the given py_version_info for when we call get_supported().\n self._given_py_version_info = py_version_info\n\n if py_version_info is None:\n py_version_info = sys.version_info[:3]\n else:\n py_version_info = normalize_version_info(py_version_info)\n\n py_version = \".\".join(map(str, py_version_info[:2]))\n\n self.abis = abis\n self.implementation = implementation\n self.platforms = platforms\n self.py_version = py_version\n self.py_version_info = py_version_info\n\n # This is used to cache the return value of get_(un)sorted_tags.\n self._valid_tags: Optional[List[Tag]] = None\n self._valid_tags_set: Optional[Set[Tag]] = None\n\n def format_given(self) -> str:\n \"\"\"\n Format the given, non-None attributes for display.\n \"\"\"\n display_version = None\n if self._given_py_version_info is not None:\n display_version = \".\".join(\n str(part) for part in self._given_py_version_info\n )\n\n key_values = [\n (\"platforms\", self.platforms),\n (\"version_info\", display_version),\n (\"abis\", self.abis),\n (\"implementation\", self.implementation),\n ]\n return \" \".join(\n f\"{key}={value!r}\" for key, value in key_values if value is not None\n )\n\n def get_sorted_tags(self) -> List[Tag]:\n \"\"\"\n Return the supported PEP 425 tags to check wheel candidates against.\n\n The tags are returned in order of preference (most preferred first).\n \"\"\"\n if self._valid_tags is None:\n # Pass versions=None if no py_version_info was given since\n # versions=None uses special default logic.\n py_version_info = self._given_py_version_info\n if py_version_info is None:\n version = None\n else:\n version = version_info_to_nodot(py_version_info)\n\n tags = get_supported(\n version=version,\n platforms=self.platforms,\n abis=self.abis,\n impl=self.implementation,\n )\n self._valid_tags = tags\n\n return self._valid_tags\n\n def get_unsorted_tags(self) -> Set[Tag]:\n \"\"\"Exactly the same as get_sorted_tags, but returns a set.\n\n This is important for performance.\n \"\"\"\n if self._valid_tags_set is None:\n self._valid_tags_set = set(self.get_sorted_tags())\n\n return self._valid_tags_set\n",[],[100,509,516,523,475,544,1074,1178],{"_104":1186,"_96":843,"_158":1187,"_160":1075,"_161":139,"_162":1188,"_164":165,"_106":1189,"_101":29,"_167":215,"_169":1190,"_170":25,"_171":-5,"_172":1191,"_99":1192},"056d8bc4-67fc-11f0-bf1a-0224a6c84d84","056d8c96-67fc-11f0-bf1a-0224a6c84d84",180,["D",1753299256878],"\"\"\"Represents a wheel file and provides access to the various parts of the\nname that have meaning.\n\"\"\"\n\nimport re\nfrom typing import Dict, Iterable, List, Optional\n\nfrom pip._vendor.packaging.tags import Tag\nfrom pip._vendor.packaging.utils import BuildTag, parse_wheel_filename\nfrom pip._vendor.packaging.utils import (\n InvalidWheelFilename as _PackagingInvalidWheelFilename,\n)\n\nfrom pip._internal.exceptions import InvalidWheelFilename\nfrom pip._internal.utils.deprecation import deprecated\n\n\nclass Wheel:\n \"\"\"A wheel file\"\"\"\n\n legacy_wheel_file_re = re.compile(\n r\"\"\"^(?P(?P[^\\s-]+?)-(?P[^\\s-]*?))\n ((-(?P\\d[^-]*?))?-(?P[^\\s-]+?)-(?P[^\\s-]+?)-(?P[^\\s-]+?)\n \\.whl|\\.dist-info)$\"\"\",\n re.VERBOSE,\n )\n\n def __init__(self, filename: str) -> None:\n self.filename = filename\n\n # To make mypy happy specify type hints that can come from either\n # parse_wheel_filename or the legacy_wheel_file_re match.\n self.name: str\n self._build_tag: Optional[BuildTag] = None\n\n try:\n wheel_info = parse_wheel_filename(filename)\n self.name, _version, self._build_tag, self.file_tags = wheel_info\n self.version = str(_version)\n except _PackagingInvalidWheelFilename as e:\n # Check if the wheel filename is in the legacy format\n legacy_wheel_info = self.legacy_wheel_file_re.match(filename)\n if not legacy_wheel_info:\n raise InvalidWheelFilename(e.args[0]) from None\n\n deprecated(\n reason=(\n f\"Wheel filename {filename!r} is not correctly normalised. \"\n \"Future versions of pip will raise the following error:\\n\"\n f\"{e.args[0]}\\n\\n\"\n ),\n replacement=(\n \"to rename the wheel to use a correctly normalised \"\n \"name (this may require updating the version in \"\n \"the project metadata)\"\n ),\n gone_in=\"25.3\",\n issue=12938,\n )\n\n self.name = legacy_wheel_info.group(\"name\").replace(\"_\", \"-\")\n self.version = legacy_wheel_info.group(\"ver\").replace(\"_\", \"-\")\n\n # Generate the file tags from the legacy wheel filename\n pyversions = legacy_wheel_info.group(\"pyver\").split(\".\")\n abis = legacy_wheel_info.group(\"abi\").split(\".\")\n plats = legacy_wheel_info.group(\"plat\").split(\".\")\n self.file_tags = frozenset(\n Tag(interpreter=py, abi=abi, platform=plat)\n for py in pyversions\n for abi in abis\n for plat in plats\n )\n\n @property\n def build_tag(self) -> BuildTag:\n if self._build_tag is not None:\n return self._build_tag\n\n # Parse the build tag from the legacy wheel filename\n legacy_wheel_info = self.legacy_wheel_file_re.match(self.filename)\n assert legacy_wheel_info is not None, \"guaranteed by filename validation\"\n build_tag = legacy_wheel_info.group(\"build\")\n match = re.match(r\"^(\\d+)(.*)$\", build_tag)\n assert match is not None, \"guaranteed by filename validation\"\n build_tag_groups = match.groups()\n self._build_tag = (int(build_tag_groups[0]), build_tag_groups[1])\n\n return self._build_tag\n\n def get_formatted_file_tags(self) -> List[str]:\n \"\"\"Return the wheel's tags as a sorted list of strings.\"\"\"\n return sorted(str(tag) for tag in self.file_tags)\n\n def support_index_min(self, tags: List[Tag]) -> int:\n \"\"\"Return the lowest index that one of the wheel's file_tag combinations\n achieves in the given list of supported tags.\n\n For example, if there are 8 supported tags and one of the file tags\n is first in the list, then return 0.\n\n :param tags: the PEP 425 tags to check the wheel against, in order\n with most preferred first.\n\n :raises ValueError: If none of the wheel's file tags match one of\n the supported tags.\n \"\"\"\n try:\n return next(i for i, t in enumerate(tags) if t in self.file_tags)\n except StopIteration:\n raise ValueError()\n\n def find_most_preferred_tag(\n self, tags: List[Tag], tag_to_priority: Dict[Tag, int]\n ) -> int:\n \"\"\"Return the priority of the most preferred tag that one of the wheel's file\n tag combinations achieves in the given list of supported tags using the given\n tag_to_priority mapping, where lower priorities are more-preferred.\n\n This is used in place of support_index_min in some cases in order to avoid\n an expensive linear scan of a large list of tags.\n\n :param tags: the PEP 425 tags to check the wheel against.\n :param tag_to_priority: a mapping from tag to priority of that tag, where\n lower is more preferred.\n\n :raises ValueError: If none of the wheel's file tags match one of\n the supported tags.\n \"\"\"\n return min(\n tag_to_priority[tag] for tag in self.file_tags if tag in tag_to_priority\n )\n\n def supported(self, tags: Iterable[Tag]) -> bool:\n \"\"\"Return whether the wheel is compatible with one of the given tags.\n\n :param tags: the PEP 425 tags to check the wheel against.\n \"\"\"\n return not self.file_tags.isdisjoint(tags)\n",[],[100,509,516,523,475,544,1074,843],[100,509,516,523,475,544,1074],{"_104":1195,"_96":1196,"_158":1197,"_160":545,"_161":139,"_162":1198,"_164":165,"_106":1199,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1200,"_99":1270},"fbdfa740-67fb-11f0-928e-0224a6c84d84","network","fbdfa7fe-67fb-11f0-928e-0224a6c84d84",57,["D",1753299240858],[1201,1209,1218,1226,1234,1243,1252,1261],{"_104":1202,"_96":558,"_158":1203,"_160":1197,"_161":139,"_162":1204,"_164":165,"_106":1205,"_101":29,"_167":215,"_169":1206,"_170":25,"_171":-5,"_172":1207,"_99":1208},"0475ceca-67fc-11f0-9d2d-0224a6c84d84","0475cf9c-67fc-11f0-9d2d-0224a6c84d84",138,["D",1753299255265],"\"\"\"Contains purely network-related utilities.\"\"\"\n",[],[100,509,516,523,475,544,1196,558],{"_104":1210,"_96":1211,"_158":1212,"_160":1197,"_161":139,"_162":1213,"_164":165,"_106":1214,"_101":29,"_167":215,"_169":1215,"_170":25,"_171":-5,"_172":1216,"_99":1217},"04590de4-67fc-11f0-aedf-0224a6c84d84","auth.py","04590ea2-67fc-11f0-aedf-0224a6c84d84",133,["D",1753299255078],"\"\"\"Network Authentication Helpers\n\nContains interface (MultiDomainBasicAuth) and associated glue code for\nproviding credentials in the context of network requests.\n\"\"\"\n\nimport logging\nimport os\nimport shutil\nimport subprocess\nimport sysconfig\nimport typing\nimport urllib.parse\nfrom abc import ABC, abstractmethod\nfrom functools import lru_cache\nfrom os.path import commonprefix\nfrom pathlib import Path\nfrom typing import Any, Dict, List, NamedTuple, Optional, Tuple\n\nfrom pip._vendor.requests.auth import AuthBase, HTTPBasicAuth\nfrom pip._vendor.requests.models import Request, Response\nfrom pip._vendor.requests.utils import get_netrc_auth\n\nfrom pip._internal.utils.logging import getLogger\nfrom pip._internal.utils.misc import (\n ask,\n ask_input,\n ask_password,\n remove_auth_from_url,\n split_auth_netloc_from_url,\n)\nfrom pip._internal.vcs.versioncontrol import AuthInfo\n\nlogger = getLogger(__name__)\n\nKEYRING_DISABLED = False\n\n\nclass Credentials(NamedTuple):\n url: str\n username: str\n password: str\n\n\nclass KeyRingBaseProvider(ABC):\n \"\"\"Keyring base provider interface\"\"\"\n\n has_keyring: bool\n\n @abstractmethod\n def get_auth_info(\n self, url: str, username: Optional[str]\n ) -> Optional[AuthInfo]: ...\n\n @abstractmethod\n def save_auth_info(self, url: str, username: str, password: str) -> None: ...\n\n\nclass KeyRingNullProvider(KeyRingBaseProvider):\n \"\"\"Keyring null provider\"\"\"\n\n has_keyring = False\n\n def get_auth_info(self, url: str, username: Optional[str]) -> Optional[AuthInfo]:\n return None\n\n def save_auth_info(self, url: str, username: str, password: str) -> None:\n return None\n\n\nclass KeyRingPythonProvider(KeyRingBaseProvider):\n \"\"\"Keyring interface which uses locally imported `keyring`\"\"\"\n\n has_keyring = True\n\n def __init__(self) -> None:\n import keyring\n\n self.keyring = keyring\n\n def get_auth_info(self, url: str, username: Optional[str]) -> Optional[AuthInfo]:\n # Support keyring's get_credential interface which supports getting\n # credentials without a username. This is only available for\n # keyring>=15.2.0.\n if hasattr(self.keyring, \"get_credential\"):\n logger.debug(\"Getting credentials from keyring for %s\", url)\n cred = self.keyring.get_credential(url, username)\n if cred is not None:\n return cred.username, cred.password\n return None\n\n if username is not None:\n logger.debug(\"Getting password from keyring for %s\", url)\n password = self.keyring.get_password(url, username)\n if password:\n return username, password\n return None\n\n def save_auth_info(self, url: str, username: str, password: str) -> None:\n self.keyring.set_password(url, username, password)\n\n\nclass KeyRingCliProvider(KeyRingBaseProvider):\n \"\"\"Provider which uses `keyring` cli\n\n Instead of calling the keyring package installed alongside pip\n we call keyring on the command line which will enable pip to\n use which ever installation of keyring is available first in\n PATH.\n \"\"\"\n\n has_keyring = True\n\n def __init__(self, cmd: str) -> None:\n self.keyring = cmd\n\n def get_auth_info(self, url: str, username: Optional[str]) -> Optional[AuthInfo]:\n # This is the default implementation of keyring.get_credential\n # https://github.com/jaraco/keyring/blob/97689324abcf01bd1793d49063e7ca01e03d7d07/keyring/backend.py#L134-L139\n if username is not None:\n password = self._get_password(url, username)\n if password is not None:\n return username, password\n return None\n\n def save_auth_info(self, url: str, username: str, password: str) -> None:\n return self._set_password(url, username, password)\n\n def _get_password(self, service_name: str, username: str) -> Optional[str]:\n \"\"\"Mirror the implementation of keyring.get_password using cli\"\"\"\n if self.keyring is None:\n return None\n\n cmd = [self.keyring, \"get\", service_name, username]\n env = os.environ.copy()\n env[\"PYTHONIOENCODING\"] = \"utf-8\"\n res = subprocess.run(\n cmd,\n stdin=subprocess.DEVNULL,\n stdout=subprocess.PIPE,\n env=env,\n )\n if res.returncode:\n return None\n return res.stdout.decode(\"utf-8\").strip(os.linesep)\n\n def _set_password(self, service_name: str, username: str, password: str) -> None:\n \"\"\"Mirror the implementation of keyring.set_password using cli\"\"\"\n if self.keyring is None:\n return None\n env = os.environ.copy()\n env[\"PYTHONIOENCODING\"] = \"utf-8\"\n subprocess.run(\n [self.keyring, \"set\", service_name, username],\n input=f\"{password}{os.linesep}\".encode(),\n env=env,\n check=True,\n )\n return None\n\n\n@lru_cache(maxsize=None)\ndef get_keyring_provider(provider: str) -> KeyRingBaseProvider:\n logger.verbose(\"Keyring provider requested: %s\", provider)\n\n # keyring has previously failed and been disabled\n if KEYRING_DISABLED:\n provider = \"disabled\"\n if provider in [\"import\", \"auto\"]:\n try:\n impl = KeyRingPythonProvider()\n logger.verbose(\"Keyring provider set: import\")\n return impl\n except ImportError:\n pass\n except Exception as exc:\n # In the event of an unexpected exception\n # we should warn the user\n msg = \"Installed copy of keyring fails with exception %s\"\n if provider == \"auto\":\n msg = msg + \", trying to find a keyring executable as a fallback\"\n logger.warning(msg, exc, exc_info=logger.isEnabledFor(logging.DEBUG))\n if provider in [\"subprocess\", \"auto\"]:\n cli = shutil.which(\"keyring\")\n if cli and cli.startswith(sysconfig.get_path(\"scripts\")):\n # all code within this function is stolen from shutil.which implementation\n @typing.no_type_check\n def PATH_as_shutil_which_determines_it() -> str:\n path = os.environ.get(\"PATH\", None)\n if path is None:\n try:\n path = os.confstr(\"CS_PATH\")\n except (AttributeError, ValueError):\n # os.confstr() or CS_PATH is not available\n path = os.defpath\n # bpo-35755: Don't use os.defpath if the PATH environment variable is\n # set to an empty string\n\n return path\n\n scripts = Path(sysconfig.get_path(\"scripts\"))\n\n paths = []\n for path in PATH_as_shutil_which_determines_it().split(os.pathsep):\n p = Path(path)\n try:\n if not p.samefile(scripts):\n paths.append(path)\n except FileNotFoundError:\n pass\n\n path = os.pathsep.join(paths)\n\n cli = shutil.which(\"keyring\", path=path)\n\n if cli:\n logger.verbose(\"Keyring provider set: subprocess with executable %s\", cli)\n return KeyRingCliProvider(cli)\n\n logger.verbose(\"Keyring provider set: disabled\")\n return KeyRingNullProvider()\n\n\nclass MultiDomainBasicAuth(AuthBase):\n def __init__(\n self,\n prompting: bool = True,\n index_urls: Optional[List[str]] = None,\n keyring_provider: str = \"auto\",\n ) -> None:\n self.prompting = prompting\n self.index_urls = index_urls\n self.keyring_provider = keyring_provider # type: ignore[assignment]\n self.passwords: Dict[str, AuthInfo] = {}\n # When the user is prompted to enter credentials and keyring is\n # available, we will offer to save them. If the user accepts,\n # this value is set to the credentials they entered. After the\n # request authenticates, the caller should call\n # ``save_credentials`` to save these.\n self._credentials_to_save: Optional[Credentials] = None\n\n @property\n def keyring_provider(self) -> KeyRingBaseProvider:\n return get_keyring_provider(self._keyring_provider)\n\n @keyring_provider.setter\n def keyring_provider(self, provider: str) -> None:\n # The free function get_keyring_provider has been decorated with\n # functools.cache. If an exception occurs in get_keyring_auth that\n # cache will be cleared and keyring disabled, take that into account\n # if you want to remove this indirection.\n self._keyring_provider = provider\n\n @property\n def use_keyring(self) -> bool:\n # We won't use keyring when --no-input is passed unless\n # a specific provider is requested because it might require\n # user interaction\n return self.prompting or self._keyring_provider not in [\"auto\", \"disabled\"]\n\n def _get_keyring_auth(\n self,\n url: Optional[str],\n username: Optional[str],\n ) -> Optional[AuthInfo]:\n \"\"\"Return the tuple auth for a given url from keyring.\"\"\"\n # Do nothing if no url was provided\n if not url:\n return None\n\n try:\n return self.keyring_provider.get_auth_info(url, username)\n except Exception as exc:\n # Log the full exception (with stacktrace) at debug, so it'll only\n # show up when running in verbose mode.\n logger.debug(\"Keyring is skipped due to an exception\", exc_info=True)\n # Always log a shortened version of the exception.\n logger.warning(\n \"Keyring is skipped due to an exception: %s\",\n str(exc),\n )\n global KEYRING_DISABLED\n KEYRING_DISABLED = True\n get_keyring_provider.cache_clear()\n return None\n\n def _get_index_url(self, url: str) -> Optional[str]:\n \"\"\"Return the original index URL matching the requested URL.\n\n Cached or dynamically generated credentials may work against\n the original index URL rather than just the netloc.\n\n The provided url should have had its username and password\n removed already. If the original index url had credentials then\n they will be included in the return value.\n\n Returns None if no matching index was found, or if --no-index\n was specified by the user.\n \"\"\"\n if not url or not self.index_urls:\n return None\n\n url = remove_auth_from_url(url).rstrip(\"/\") + \"/\"\n parsed_url = urllib.parse.urlsplit(url)\n\n candidates = []\n\n for index in self.index_urls:\n index = index.rstrip(\"/\") + \"/\"\n parsed_index = urllib.parse.urlsplit(remove_auth_from_url(index))\n if parsed_url == parsed_index:\n return index\n\n if parsed_url.netloc != parsed_index.netloc:\n continue\n\n candidate = urllib.parse.urlsplit(index)\n candidates.append(candidate)\n\n if not candidates:\n return None\n\n candidates.sort(\n reverse=True,\n key=lambda candidate: commonprefix(\n [\n parsed_url.path,\n candidate.path,\n ]\n ).rfind(\"/\"),\n )\n\n return urllib.parse.urlunsplit(candidates[0])\n\n def _get_new_credentials(\n self,\n original_url: str,\n *,\n allow_netrc: bool = True,\n allow_keyring: bool = False,\n ) -> AuthInfo:\n \"\"\"Find and return credentials for the specified URL.\"\"\"\n # Split the credentials and netloc from the url.\n url, netloc, url_user_password = split_auth_netloc_from_url(\n original_url,\n )\n\n # Start with the credentials embedded in the url\n username, password = url_user_password\n if username is not None and password is not None:\n logger.debug(\"Found credentials in url for %s\", netloc)\n return url_user_password\n\n # Find a matching index url for this request\n index_url = self._get_index_url(url)\n if index_url:\n # Split the credentials from the url.\n index_info = split_auth_netloc_from_url(index_url)\n if index_info:\n index_url, _, index_url_user_password = index_info\n logger.debug(\"Found index url %s\", index_url)\n\n # If an index URL was found, try its embedded credentials\n if index_url and index_url_user_password[0] is not None:\n username, password = index_url_user_password\n if username is not None and password is not None:\n logger.debug(\"Found credentials in index url for %s\", netloc)\n return index_url_user_password\n\n # Get creds from netrc if we still don't have them\n if allow_netrc:\n netrc_auth = get_netrc_auth(original_url)\n if netrc_auth:\n logger.debug(\"Found credentials in netrc for %s\", netloc)\n return netrc_auth\n\n # If we don't have a password and keyring is available, use it.\n if allow_keyring:\n # The index url is more specific than the netloc, so try it first\n # fmt: off\n kr_auth = (\n self._get_keyring_auth(index_url, username) or\n self._get_keyring_auth(netloc, username)\n )\n # fmt: on\n if kr_auth:\n logger.debug(\"Found credentials in keyring for %s\", netloc)\n return kr_auth\n\n return username, password\n\n def _get_url_and_credentials(\n self, original_url: str\n ) -> Tuple[str, Optional[str], Optional[str]]:\n \"\"\"Return the credentials to use for the provided URL.\n\n If allowed, netrc and keyring may be used to obtain the\n correct credentials.\n\n Returns (url_without_credentials, username, password). Note\n that even if the original URL contains credentials, this\n function may return a different username and password.\n \"\"\"\n url, netloc, _ = split_auth_netloc_from_url(original_url)\n\n # Try to get credentials from original url\n username, password = self._get_new_credentials(original_url)\n\n # If credentials not found, use any stored credentials for this netloc.\n # Do this if either the username or the password is missing.\n # This accounts for the situation in which the user has specified\n # the username in the index url, but the password comes from keyring.\n if (username is None or password is None) and netloc in self.passwords:\n un, pw = self.passwords[netloc]\n # It is possible that the cached credentials are for a different username,\n # in which case the cache should be ignored.\n if username is None or username == un:\n username, password = un, pw\n\n if username is not None or password is not None:\n # Convert the username and password if they're None, so that\n # this netloc will show up as \"cached\" in the conditional above.\n # Further, HTTPBasicAuth doesn't accept None, so it makes sense to\n # cache the value that is going to be used.\n username = username or \"\"\n password = password or \"\"\n\n # Store any acquired credentials.\n self.passwords[netloc] = (username, password)\n\n assert (\n # Credentials were found\n (username is not None and password is not None)\n # Credentials were not found\n or (username is None and password is None)\n ), f\"Could not load credentials from url: {original_url}\"\n\n return url, username, password\n\n def __call__(self, req: Request) -> Request:\n # Get credentials for this request\n url, username, password = self._get_url_and_credentials(req.url)\n\n # Set the url of the request to the url without any credentials\n req.url = url\n\n if username is not None and password is not None:\n # Send the basic auth with this request\n req = HTTPBasicAuth(username, password)(req)\n\n # Attach a hook to handle 401 responses\n req.register_hook(\"response\", self.handle_401)\n\n return req\n\n # Factored out to allow for easy patching in tests\n def _prompt_for_password(\n self, netloc: str\n ) -> Tuple[Optional[str], Optional[str], bool]:\n username = ask_input(f\"User for {netloc}: \") if self.prompting else None\n if not username:\n return None, None, False\n if self.use_keyring:\n auth = self._get_keyring_auth(netloc, username)\n if auth and auth[0] is not None and auth[1] is not None:\n return auth[0], auth[1], False\n password = ask_password(\"Password: \")\n return username, password, True\n\n # Factored out to allow for easy patching in tests\n def _should_save_password_to_keyring(self) -> bool:\n if (\n not self.prompting\n or not self.use_keyring\n or not self.keyring_provider.has_keyring\n ):\n return False\n return ask(\"Save credentials to keyring [y/N]: \", [\"y\", \"n\"]) == \"y\"\n\n def handle_401(self, resp: Response, **kwargs: Any) -> Response:\n # We only care about 401 responses, anything else we want to just\n # pass through the actual response\n if resp.status_code != 401:\n return resp\n\n username, password = None, None\n\n # Query the keyring for credentials:\n if self.use_keyring:\n username, password = self._get_new_credentials(\n resp.url,\n allow_netrc=False,\n allow_keyring=True,\n )\n\n # We are not able to prompt the user so simply return the response\n if not self.prompting and not username and not password:\n return resp\n\n parsed = urllib.parse.urlparse(resp.url)\n\n # Prompt the user for a new username and password\n save = False\n if not username and not password:\n username, password, save = self._prompt_for_password(parsed.netloc)\n\n # Store the new username and password to use for future requests\n self._credentials_to_save = None\n if username is not None and password is not None:\n self.passwords[parsed.netloc] = (username, password)\n\n # Prompt to save the password to keyring\n if save and self._should_save_password_to_keyring():\n self._credentials_to_save = Credentials(\n url=parsed.netloc,\n username=username,\n password=password,\n )\n\n # Consume content and release the original connection to allow our new\n # request to reuse the same one.\n # The result of the assignment isn't used, it's just needed to consume\n # the content.\n _ = resp.content\n resp.raw.release_conn()\n\n # Add our new username and password to the request\n req = HTTPBasicAuth(username or \"\", password or \"\")(resp.request)\n req.register_hook(\"response\", self.warn_on_401)\n\n # On successful request, save the credentials that were used to\n # keyring. (Note that if the user responded \"no\" above, this member\n # is not set and nothing will be saved.)\n if self._credentials_to_save:\n req.register_hook(\"response\", self.save_credentials)\n\n # Send our new request\n new_resp = resp.connection.send(req, **kwargs)\n new_resp.history.append(resp)\n\n return new_resp\n\n def warn_on_401(self, resp: Response, **kwargs: Any) -> None:\n \"\"\"Response callback to warn about incorrect credentials.\"\"\"\n if resp.status_code == 401:\n logger.warning(\n \"401 Error, Credentials not correct for %s\",\n resp.request.url,\n )\n\n def save_credentials(self, resp: Response, **kwargs: Any) -> None:\n \"\"\"Response callback to save credentials on success.\"\"\"\n assert (\n self.keyring_provider.has_keyring\n ), \"should never reach here without keyring\"\n\n creds = self._credentials_to_save\n self._credentials_to_save = None\n if creds and resp.status_code < 400:\n try:\n logger.info(\"Saving credentials to keyring\")\n self.keyring_provider.save_auth_info(\n creds.url, creds.username, creds.password\n )\n except Exception:\n logger.exception(\"Failed to save credentials\")\n",[],[100,509,516,523,475,544,1196,1211],{"_104":1219,"_96":690,"_158":1220,"_160":1197,"_161":139,"_162":1221,"_164":165,"_106":1222,"_101":29,"_167":215,"_169":1223,"_170":25,"_171":-5,"_172":1224,"_99":1225},"046ee128-67fc-11f0-928e-0224a6c84d84","046ee1fa-67fc-11f0-928e-0224a6c84d84",137,["D",1753299255219],"\"\"\"HTTP cache implementation.\"\"\"\n\nimport os\nfrom contextlib import contextmanager\nfrom datetime import datetime\nfrom typing import BinaryIO, Generator, Optional, Union\n\nfrom pip._vendor.cachecontrol.cache import SeparateBodyBaseCache\nfrom pip._vendor.cachecontrol.caches import SeparateBodyFileCache\nfrom pip._vendor.requests.models import Response\n\nfrom pip._internal.utils.filesystem import adjacent_tmp_file, replace\nfrom pip._internal.utils.misc import ensure_dir\n\n\ndef is_from_cache(response: Response) -> bool:\n return getattr(response, \"from_cache\", False)\n\n\n@contextmanager\ndef suppressed_cache_errors() -> Generator[None, None, None]:\n \"\"\"If we can't access the cache then we can just skip caching and process\n requests as if caching wasn't enabled.\n \"\"\"\n try:\n yield\n except OSError:\n pass\n\n\nclass SafeFileCache(SeparateBodyBaseCache):\n \"\"\"\n A file based cache which is safe to use even when the target directory may\n not be accessible or writable.\n\n There is a race condition when two processes try to write and/or read the\n same entry at the same time, since each entry consists of two separate\n files (https://github.com/psf/cachecontrol/issues/324). We therefore have\n additional logic that makes sure that both files to be present before\n returning an entry; this fixes the read side of the race condition.\n\n For the write side, we assume that the server will only ever return the\n same data for the same URL, which ought to be the case for files pip is\n downloading. PyPI does not have a mechanism to swap out a wheel for\n another wheel, for example. If this assumption is not true, the\n CacheControl issue will need to be fixed.\n \"\"\"\n\n def __init__(self, directory: str) -> None:\n assert directory is not None, \"Cache directory must not be None.\"\n super().__init__()\n self.directory = directory\n\n def _get_cache_path(self, name: str) -> str:\n # From cachecontrol.caches.file_cache.FileCache._fn, brought into our\n # class for backwards-compatibility and to avoid using a non-public\n # method.\n hashed = SeparateBodyFileCache.encode(name)\n parts = list(hashed[:5]) + [hashed]\n return os.path.join(self.directory, *parts)\n\n def get(self, key: str) -> Optional[bytes]:\n # The cache entry is only valid if both metadata and body exist.\n metadata_path = self._get_cache_path(key)\n body_path = metadata_path + \".body\"\n if not (os.path.exists(metadata_path) and os.path.exists(body_path)):\n return None\n with suppressed_cache_errors():\n with open(metadata_path, \"rb\") as f:\n return f.read()\n\n def _write(self, path: str, data: bytes) -> None:\n with suppressed_cache_errors():\n ensure_dir(os.path.dirname(path))\n\n with adjacent_tmp_file(path) as f:\n f.write(data)\n # Inherit the read/write permissions of the cache directory\n # to enable multi-user cache use-cases.\n mode = (\n os.stat(self.directory).st_mode\n & 0o666 # select read/write permissions of cache directory\n | 0o600 # set owner read/write permissions\n )\n # Change permissions only if there is no risk of following a symlink.\n if os.chmod in os.supports_fd:\n os.chmod(f.fileno(), mode)\n elif os.chmod in os.supports_follow_symlinks:\n os.chmod(f.name, mode, follow_symlinks=False)\n\n replace(f.name, path)\n\n def set(\n self, key: str, value: bytes, expires: Union[int, datetime, None] = None\n ) -> None:\n path = self._get_cache_path(key)\n self._write(path, value)\n\n def delete(self, key: str) -> None:\n path = self._get_cache_path(key)\n with suppressed_cache_errors():\n os.remove(path)\n with suppressed_cache_errors():\n os.remove(path + \".body\")\n\n def get_body(self, key: str) -> Optional[BinaryIO]:\n # The cache entry is only valid if both metadata and body exist.\n metadata_path = self._get_cache_path(key)\n body_path = metadata_path + \".body\"\n if not (os.path.exists(metadata_path) and os.path.exists(body_path)):\n return None\n with suppressed_cache_errors():\n return open(body_path, \"rb\")\n\n def set_body(self, key: str, body: bytes) -> None:\n path = self._get_cache_path(key) + \".body\"\n self._write(path, body)\n",[],[100,509,516,523,475,544,1196,690],{"_104":1227,"_96":735,"_158":1228,"_160":1197,"_161":139,"_162":1229,"_164":165,"_106":1230,"_101":29,"_167":215,"_169":1231,"_170":25,"_171":-5,"_172":1232,"_99":1233},"0461f184-67fc-11f0-bf1a-0224a6c84d84","0461f22e-67fc-11f0-bf1a-0224a6c84d84",135,["D",1753299255125],"\"\"\"Download files with progress indicators.\"\"\"\n\nimport email.message\nimport logging\nimport mimetypes\nimport os\nfrom http import HTTPStatus\nfrom typing import BinaryIO, Iterable, Optional, Tuple\n\nfrom pip._vendor.requests.models import Response\nfrom pip._vendor.urllib3.exceptions import ReadTimeoutError\n\nfrom pip._internal.cli.progress_bars import get_download_progress_renderer\nfrom pip._internal.exceptions import IncompleteDownloadError, NetworkConnectionError\nfrom pip._internal.models.index import PyPI\nfrom pip._internal.models.link import Link\nfrom pip._internal.network.cache import is_from_cache\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.network.utils import HEADERS, raise_for_status, response_chunks\nfrom pip._internal.utils.misc import format_size, redact_auth_from_url, splitext\n\nlogger = logging.getLogger(__name__)\n\n\ndef _get_http_response_size(resp: Response) -> Optional[int]:\n try:\n return int(resp.headers[\"content-length\"])\n except (ValueError, KeyError, TypeError):\n return None\n\n\ndef _get_http_response_etag_or_last_modified(resp: Response) -> Optional[str]:\n \"\"\"\n Return either the ETag or Last-Modified header (or None if neither exists).\n The return value can be used in an If-Range header.\n \"\"\"\n return resp.headers.get(\"etag\", resp.headers.get(\"last-modified\"))\n\n\ndef _prepare_download(\n resp: Response,\n link: Link,\n progress_bar: str,\n total_length: Optional[int],\n range_start: Optional[int] = 0,\n) -> Iterable[bytes]:\n if link.netloc == PyPI.file_storage_domain:\n url = link.show_url\n else:\n url = link.url_without_fragment\n\n logged_url = redact_auth_from_url(url)\n\n if total_length:\n if range_start:\n logged_url = (\n f\"{logged_url} ({format_size(range_start)}/{format_size(total_length)})\"\n )\n else:\n logged_url = f\"{logged_url} ({format_size(total_length)})\"\n\n if is_from_cache(resp):\n logger.info(\"Using cached %s\", logged_url)\n elif range_start:\n logger.info(\"Resuming download %s\", logged_url)\n else:\n logger.info(\"Downloading %s\", logged_url)\n\n if logger.getEffectiveLevel() > logging.INFO:\n show_progress = False\n elif is_from_cache(resp):\n show_progress = False\n elif not total_length:\n show_progress = True\n elif total_length > (512 * 1024):\n show_progress = True\n else:\n show_progress = False\n\n chunks = response_chunks(resp)\n\n if not show_progress:\n return chunks\n\n renderer = get_download_progress_renderer(\n bar_type=progress_bar, size=total_length, initial_progress=range_start\n )\n return renderer(chunks)\n\n\ndef sanitize_content_filename(filename: str) -> str:\n \"\"\"\n Sanitize the \"filename\" value from a Content-Disposition header.\n \"\"\"\n return os.path.basename(filename)\n\n\ndef parse_content_disposition(content_disposition: str, default_filename: str) -> str:\n \"\"\"\n Parse the \"filename\" value from a Content-Disposition header, and\n return the default filename if the result is empty.\n \"\"\"\n m = email.message.Message()\n m[\"content-type\"] = content_disposition\n filename = m.get_param(\"filename\")\n if filename:\n # We need to sanitize the filename to prevent directory traversal\n # in case the filename contains \"..\" path parts.\n filename = sanitize_content_filename(str(filename))\n return filename or default_filename\n\n\ndef _get_http_response_filename(resp: Response, link: Link) -> str:\n \"\"\"Get an ideal filename from the given HTTP response, falling back to\n the link filename if not provided.\n \"\"\"\n filename = link.filename # fallback\n # Have a look at the Content-Disposition header for a better guess\n content_disposition = resp.headers.get(\"content-disposition\")\n if content_disposition:\n filename = parse_content_disposition(content_disposition, filename)\n ext: Optional[str] = splitext(filename)[1]\n if not ext:\n ext = mimetypes.guess_extension(resp.headers.get(\"content-type\", \"\"))\n if ext:\n filename += ext\n if not ext and link.url != resp.url:\n ext = os.path.splitext(resp.url)[1]\n if ext:\n filename += ext\n return filename\n\n\ndef _http_get_download(\n session: PipSession,\n link: Link,\n range_start: Optional[int] = 0,\n if_range: Optional[str] = None,\n) -> Response:\n target_url = link.url.split(\"#\", 1)[0]\n headers = HEADERS.copy()\n # request a partial download\n if range_start:\n headers[\"Range\"] = f\"bytes={range_start}-\"\n # make sure the file hasn't changed\n if if_range:\n headers[\"If-Range\"] = if_range\n try:\n resp = session.get(target_url, headers=headers, stream=True)\n raise_for_status(resp)\n except NetworkConnectionError as e:\n assert e.response is not None\n logger.critical(\"HTTP error %s while getting %s\", e.response.status_code, link)\n raise\n return resp\n\n\nclass Downloader:\n def __init__(\n self,\n session: PipSession,\n progress_bar: str,\n resume_retries: int,\n ) -> None:\n assert (\n resume_retries >= 0\n ), \"Number of max resume retries must be bigger or equal to zero\"\n self._session = session\n self._progress_bar = progress_bar\n self._resume_retries = resume_retries\n\n def __call__(self, link: Link, location: str) -> Tuple[str, str]:\n \"\"\"Download the file given by link into location.\"\"\"\n resp = _http_get_download(self._session, link)\n # NOTE: The original download size needs to be passed down everywhere\n # so if the download is resumed (with a HTTP Range request) the progress\n # bar will report the right size.\n total_length = _get_http_response_size(resp)\n content_type = resp.headers.get(\"Content-Type\", \"\")\n\n filename = _get_http_response_filename(resp, link)\n filepath = os.path.join(location, filename)\n\n with open(filepath, \"wb\") as content_file:\n bytes_received = self._process_response(\n resp, link, content_file, 0, total_length\n )\n # If possible, check for an incomplete download and attempt resuming.\n if total_length and bytes_received < total_length:\n self._attempt_resume(\n resp, link, content_file, total_length, bytes_received\n )\n\n return filepath, content_type\n\n def _process_response(\n self,\n resp: Response,\n link: Link,\n content_file: BinaryIO,\n bytes_received: int,\n total_length: Optional[int],\n ) -> int:\n \"\"\"Process the response and write the chunks to the file.\"\"\"\n chunks = _prepare_download(\n resp, link, self._progress_bar, total_length, range_start=bytes_received\n )\n return self._write_chunks_to_file(\n chunks, content_file, allow_partial=bool(total_length)\n )\n\n def _write_chunks_to_file(\n self, chunks: Iterable[bytes], content_file: BinaryIO, *, allow_partial: bool\n ) -> int:\n \"\"\"Write the chunks to the file and return the number of bytes received.\"\"\"\n bytes_received = 0\n try:\n for chunk in chunks:\n bytes_received += len(chunk)\n content_file.write(chunk)\n except ReadTimeoutError as e:\n # If partial downloads are OK (the download will be retried), don't bail.\n if not allow_partial:\n raise e\n\n # Ensuring bytes_received is returned to attempt resume\n logger.warning(\"Connection timed out while downloading.\")\n\n return bytes_received\n\n def _attempt_resume(\n self,\n resp: Response,\n link: Link,\n content_file: BinaryIO,\n total_length: Optional[int],\n bytes_received: int,\n ) -> None:\n \"\"\"Attempt to resume the download if connection was dropped.\"\"\"\n etag_or_last_modified = _get_http_response_etag_or_last_modified(resp)\n\n attempts_left = self._resume_retries\n while total_length and attempts_left and bytes_received < total_length:\n attempts_left -= 1\n\n logger.warning(\n \"Attempting to resume incomplete download (%s/%s, attempt %d)\",\n format_size(bytes_received),\n format_size(total_length),\n (self._resume_retries - attempts_left),\n )\n\n try:\n # Try to resume the download using a HTTP range request.\n resume_resp = _http_get_download(\n self._session,\n link,\n range_start=bytes_received,\n if_range=etag_or_last_modified,\n )\n\n # Fallback: if the server responded with 200 (i.e., the file has\n # since been modified or range requests are unsupported) or any\n # other unexpected status, restart the download from the beginning.\n must_restart = resume_resp.status_code != HTTPStatus.PARTIAL_CONTENT\n if must_restart:\n bytes_received, total_length, etag_or_last_modified = (\n self._reset_download_state(resume_resp, content_file)\n )\n\n bytes_received += self._process_response(\n resume_resp, link, content_file, bytes_received, total_length\n )\n except (ConnectionError, ReadTimeoutError, OSError):\n continue\n\n # No more resume attempts. Raise an error if the download is still incomplete.\n if total_length and bytes_received < total_length:\n os.remove(content_file.name)\n raise IncompleteDownloadError(\n link, bytes_received, total_length, retries=self._resume_retries\n )\n\n def _reset_download_state(\n self,\n resp: Response,\n content_file: BinaryIO,\n ) -> Tuple[int, Optional[int], Optional[str]]:\n \"\"\"Reset the download state to restart downloading from the beginning.\"\"\"\n content_file.seek(0)\n content_file.truncate()\n bytes_received = 0\n total_length = _get_http_response_size(resp)\n etag_or_last_modified = _get_http_response_etag_or_last_modified(resp)\n\n return bytes_received, total_length, etag_or_last_modified\n\n\nclass BatchDownloader:\n def __init__(\n self,\n session: PipSession,\n progress_bar: str,\n resume_retries: int,\n ) -> None:\n self._downloader = Downloader(session, progress_bar, resume_retries)\n\n def __call__(\n self, links: Iterable[Link], location: str\n ) -> Iterable[Tuple[Link, Tuple[str, str]]]:\n \"\"\"Download the files given by links into location.\"\"\"\n for link in links:\n filepath, content_type = self._downloader(link, location)\n yield link, (filepath, content_type)\n",[],[100,509,516,523,475,544,1196,735],{"_104":1235,"_96":1236,"_158":1237,"_160":1197,"_161":139,"_162":1238,"_164":165,"_106":1239,"_101":29,"_167":215,"_169":1240,"_170":25,"_171":-5,"_172":1241,"_99":1242},"047aa06c-67fc-11f0-a988-0224a6c84d84","lazy_wheel.py","047aa166-67fc-11f0-a988-0224a6c84d84",139,["D",1753299255297],"\"\"\"Lazy ZIP over HTTP\"\"\"\n\n__all__ = [\"HTTPRangeRequestUnsupported\", \"dist_from_wheel_url\"]\n\nfrom bisect import bisect_left, bisect_right\nfrom contextlib import contextmanager\nfrom tempfile import NamedTemporaryFile\nfrom typing import Any, Dict, Generator, List, Optional, Tuple\nfrom zipfile import BadZipFile, ZipFile\n\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.requests.models import CONTENT_CHUNK_SIZE, Response\n\nfrom pip._internal.metadata import BaseDistribution, MemoryWheel, get_wheel_distribution\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.network.utils import HEADERS, raise_for_status, response_chunks\n\n\nclass HTTPRangeRequestUnsupported(Exception):\n pass\n\n\ndef dist_from_wheel_url(name: str, url: str, session: PipSession) -> BaseDistribution:\n \"\"\"Return a distribution object from the given wheel URL.\n\n This uses HTTP range requests to only fetch the portion of the wheel\n containing metadata, just enough for the object to be constructed.\n If such requests are not supported, HTTPRangeRequestUnsupported\n is raised.\n \"\"\"\n with LazyZipOverHTTP(url, session) as zf:\n # For read-only ZIP files, ZipFile only needs methods read,\n # seek, seekable and tell, not the whole IO protocol.\n wheel = MemoryWheel(zf.name, zf) # type: ignore\n # After context manager exit, wheel.name\n # is an invalid file by intention.\n return get_wheel_distribution(wheel, canonicalize_name(name))\n\n\nclass LazyZipOverHTTP:\n \"\"\"File-like object mapped to a ZIP file over HTTP.\n\n This uses HTTP range requests to lazily fetch the file's content,\n which is supposed to be fed to ZipFile. If such requests are not\n supported by the server, raise HTTPRangeRequestUnsupported\n during initialization.\n \"\"\"\n\n def __init__(\n self, url: str, session: PipSession, chunk_size: int = CONTENT_CHUNK_SIZE\n ) -> None:\n head = session.head(url, headers=HEADERS)\n raise_for_status(head)\n assert head.status_code == 200\n self._session, self._url, self._chunk_size = session, url, chunk_size\n self._length = int(head.headers[\"Content-Length\"])\n self._file = NamedTemporaryFile()\n self.truncate(self._length)\n self._left: List[int] = []\n self._right: List[int] = []\n if \"bytes\" not in head.headers.get(\"Accept-Ranges\", \"none\"):\n raise HTTPRangeRequestUnsupported(\"range request is not supported\")\n self._check_zip()\n\n @property\n def mode(self) -> str:\n \"\"\"Opening mode, which is always rb.\"\"\"\n return \"rb\"\n\n @property\n def name(self) -> str:\n \"\"\"Path to the underlying file.\"\"\"\n return self._file.name\n\n def seekable(self) -> bool:\n \"\"\"Return whether random access is supported, which is True.\"\"\"\n return True\n\n def close(self) -> None:\n \"\"\"Close the file.\"\"\"\n self._file.close()\n\n @property\n def closed(self) -> bool:\n \"\"\"Whether the file is closed.\"\"\"\n return self._file.closed\n\n def read(self, size: int = -1) -> bytes:\n \"\"\"Read up to size bytes from the object and return them.\n\n As a convenience, if size is unspecified or -1,\n all bytes until EOF are returned. Fewer than\n size bytes may be returned if EOF is reached.\n \"\"\"\n download_size = max(size, self._chunk_size)\n start, length = self.tell(), self._length\n stop = length if size < 0 else min(start + download_size, length)\n start = max(0, stop - download_size)\n self._download(start, stop - 1)\n return self._file.read(size)\n\n def readable(self) -> bool:\n \"\"\"Return whether the file is readable, which is True.\"\"\"\n return True\n\n def seek(self, offset: int, whence: int = 0) -> int:\n \"\"\"Change stream position and return the new absolute position.\n\n Seek to offset relative position indicated by whence:\n * 0: Start of stream (the default). pos should be >= 0;\n * 1: Current position - pos may be negative;\n * 2: End of stream - pos usually negative.\n \"\"\"\n return self._file.seek(offset, whence)\n\n def tell(self) -> int:\n \"\"\"Return the current position.\"\"\"\n return self._file.tell()\n\n def truncate(self, size: Optional[int] = None) -> int:\n \"\"\"Resize the stream to the given size in bytes.\n\n If size is unspecified resize to the current position.\n The current stream position isn't changed.\n\n Return the new file size.\n \"\"\"\n return self._file.truncate(size)\n\n def writable(self) -> bool:\n \"\"\"Return False.\"\"\"\n return False\n\n def __enter__(self) -> \"LazyZipOverHTTP\":\n self._file.__enter__()\n return self\n\n def __exit__(self, *exc: Any) -> None:\n self._file.__exit__(*exc)\n\n @contextmanager\n def _stay(self) -> Generator[None, None, None]:\n \"\"\"Return a context manager keeping the position.\n\n At the end of the block, seek back to original position.\n \"\"\"\n pos = self.tell()\n try:\n yield\n finally:\n self.seek(pos)\n\n def _check_zip(self) -> None:\n \"\"\"Check and download until the file is a valid ZIP.\"\"\"\n end = self._length - 1\n for start in reversed(range(0, end, self._chunk_size)):\n self._download(start, end)\n with self._stay():\n try:\n # For read-only ZIP files, ZipFile only needs\n # methods read, seek, seekable and tell.\n ZipFile(self)\n except BadZipFile:\n pass\n else:\n break\n\n def _stream_response(\n self, start: int, end: int, base_headers: Dict[str, str] = HEADERS\n ) -> Response:\n \"\"\"Return HTTP response to a range request from start to end.\"\"\"\n headers = base_headers.copy()\n headers[\"Range\"] = f\"bytes={start}-{end}\"\n # TODO: Get range requests to be correctly cached\n headers[\"Cache-Control\"] = \"no-cache\"\n return self._session.get(self._url, headers=headers, stream=True)\n\n def _merge(\n self, start: int, end: int, left: int, right: int\n ) -> Generator[Tuple[int, int], None, None]:\n \"\"\"Return a generator of intervals to be fetched.\n\n Args:\n start (int): Start of needed interval\n end (int): End of needed interval\n left (int): Index of first overlapping downloaded data\n right (int): Index after last overlapping downloaded data\n \"\"\"\n lslice, rslice = self._left[left:right], self._right[left:right]\n i = start = min([start] + lslice[:1])\n end = max([end] + rslice[-1:])\n for j, k in zip(lslice, rslice):\n if j > i:\n yield i, j - 1\n i = k + 1\n if i <= end:\n yield i, end\n self._left[left:right], self._right[left:right] = [start], [end]\n\n def _download(self, start: int, end: int) -> None:\n \"\"\"Download bytes from start to end inclusively.\"\"\"\n with self._stay():\n left = bisect_left(self._right, start)\n right = bisect_right(self._left, end)\n for start, end in self._merge(start, end, left, right):\n response = self._stream_response(start, end)\n response.raise_for_status()\n self.seek(start)\n for chunk in response_chunks(response, self._chunk_size):\n self._file.write(chunk)\n",[],[100,509,516,523,475,544,1196,1236],{"_104":1244,"_96":1245,"_158":1246,"_160":1197,"_161":139,"_162":1247,"_164":165,"_106":1248,"_101":29,"_167":215,"_169":1249,"_170":25,"_171":-5,"_172":1250,"_99":1251},"0465606c-67fc-11f0-8cc3-0224a6c84d84","session.py","0465610c-67fc-11f0-8cc3-0224a6c84d84",136,["D",1753299255160],"\"\"\"PipSession and supporting code, containing all pip-specific\nnetwork request configuration and behavior.\n\"\"\"\n\nimport email.utils\nimport functools\nimport io\nimport ipaddress\nimport json\nimport logging\nimport mimetypes\nimport os\nimport platform\nimport shutil\nimport subprocess\nimport sys\nimport urllib.parse\nimport warnings\nfrom typing import (\n TYPE_CHECKING,\n Any,\n Dict,\n Generator,\n List,\n Mapping,\n Optional,\n Sequence,\n Tuple,\n Union,\n)\n\nfrom pip._vendor import requests, urllib3\nfrom pip._vendor.cachecontrol import CacheControlAdapter as _BaseCacheControlAdapter\nfrom pip._vendor.requests.adapters import DEFAULT_POOLBLOCK, BaseAdapter\nfrom pip._vendor.requests.adapters import HTTPAdapter as _BaseHTTPAdapter\nfrom pip._vendor.requests.models import PreparedRequest, Response\nfrom pip._vendor.requests.structures import CaseInsensitiveDict\nfrom pip._vendor.urllib3.connectionpool import ConnectionPool\nfrom pip._vendor.urllib3.exceptions import InsecureRequestWarning\n\nfrom pip import __version__\nfrom pip._internal.metadata import get_default_environment\nfrom pip._internal.models.link import Link\nfrom pip._internal.network.auth import MultiDomainBasicAuth\nfrom pip._internal.network.cache import SafeFileCache\n\n# Import ssl from compat so the initial import occurs in only one place.\nfrom pip._internal.utils.compat import has_tls\nfrom pip._internal.utils.glibc import libc_ver\nfrom pip._internal.utils.misc import build_url_from_netloc, parse_netloc\nfrom pip._internal.utils.urls import url_to_path\n\nif TYPE_CHECKING:\n from ssl import SSLContext\n\n from pip._vendor.urllib3.poolmanager import PoolManager\n\n\nlogger = logging.getLogger(__name__)\n\nSecureOrigin = Tuple[str, str, Optional[Union[int, str]]]\n\n\n# Ignore warning raised when using --trusted-host.\nwarnings.filterwarnings(\"ignore\", category=InsecureRequestWarning)\n\n\nSECURE_ORIGINS: List[SecureOrigin] = [\n # protocol, hostname, port\n # Taken from Chrome's list of secure origins (See: http://bit.ly/1qrySKC)\n (\"https\", \"*\", \"*\"),\n (\"*\", \"localhost\", \"*\"),\n (\"*\", \"127.0.0.0/8\", \"*\"),\n (\"*\", \"::1/128\", \"*\"),\n (\"file\", \"*\", None),\n # ssh is always secure.\n (\"ssh\", \"*\", \"*\"),\n]\n\n\n# These are environment variables present when running under various\n# CI systems. For each variable, some CI systems that use the variable\n# are indicated. The collection was chosen so that for each of a number\n# of popular systems, at least one of the environment variables is used.\n# This list is used to provide some indication of and lower bound for\n# CI traffic to PyPI. Thus, it is okay if the list is not comprehensive.\n# For more background, see: https://github.com/pypa/pip/issues/5499\nCI_ENVIRONMENT_VARIABLES = (\n # Azure Pipelines\n \"BUILD_BUILDID\",\n # Jenkins\n \"BUILD_ID\",\n # AppVeyor, CircleCI, Codeship, Gitlab CI, Shippable, Travis CI\n \"CI\",\n # Explicit environment variable.\n \"PIP_IS_CI\",\n)\n\n\ndef looks_like_ci() -> bool:\n \"\"\"\n Return whether it looks like pip is running under CI.\n \"\"\"\n # We don't use the method of checking for a tty (e.g. using isatty())\n # because some CI systems mimic a tty (e.g. Travis CI). Thus that\n # method doesn't provide definitive information in either direction.\n return any(name in os.environ for name in CI_ENVIRONMENT_VARIABLES)\n\n\n@functools.lru_cache(maxsize=1)\ndef user_agent() -> str:\n \"\"\"\n Return a string representing the user agent.\n \"\"\"\n data: Dict[str, Any] = {\n \"installer\": {\"name\": \"pip\", \"version\": __version__},\n \"python\": platform.python_version(),\n \"implementation\": {\n \"name\": platform.python_implementation(),\n },\n }\n\n if data[\"implementation\"][\"name\"] == \"CPython\":\n data[\"implementation\"][\"version\"] = platform.python_version()\n elif data[\"implementation\"][\"name\"] == \"PyPy\":\n pypy_version_info = sys.pypy_version_info # type: ignore\n if pypy_version_info.releaselevel == \"final\":\n pypy_version_info = pypy_version_info[:3]\n data[\"implementation\"][\"version\"] = \".\".join(\n [str(x) for x in pypy_version_info]\n )\n elif data[\"implementation\"][\"name\"] == \"Jython\":\n # Complete Guess\n data[\"implementation\"][\"version\"] = platform.python_version()\n elif data[\"implementation\"][\"name\"] == \"IronPython\":\n # Complete Guess\n data[\"implementation\"][\"version\"] = platform.python_version()\n\n if sys.platform.startswith(\"linux\"):\n from pip._vendor import distro\n\n linux_distribution = distro.name(), distro.version(), distro.codename()\n distro_infos: Dict[str, Any] = dict(\n filter(\n lambda x: x[1],\n zip([\"name\", \"version\", \"id\"], linux_distribution),\n )\n )\n libc = dict(\n filter(\n lambda x: x[1],\n zip([\"lib\", \"version\"], libc_ver()),\n )\n )\n if libc:\n distro_infos[\"libc\"] = libc\n if distro_infos:\n data[\"distro\"] = distro_infos\n\n if sys.platform.startswith(\"darwin\") and platform.mac_ver()[0]:\n data[\"distro\"] = {\"name\": \"macOS\", \"version\": platform.mac_ver()[0]}\n\n if platform.system():\n data.setdefault(\"system\", {})[\"name\"] = platform.system()\n\n if platform.release():\n data.setdefault(\"system\", {})[\"release\"] = platform.release()\n\n if platform.machine():\n data[\"cpu\"] = platform.machine()\n\n if has_tls():\n import _ssl as ssl\n\n data[\"openssl_version\"] = ssl.OPENSSL_VERSION\n\n setuptools_dist = get_default_environment().get_distribution(\"setuptools\")\n if setuptools_dist is not None:\n data[\"setuptools_version\"] = str(setuptools_dist.version)\n\n if shutil.which(\"rustc\") is not None:\n # If for any reason `rustc --version` fails, silently ignore it\n try:\n rustc_output = subprocess.check_output(\n [\"rustc\", \"--version\"], stderr=subprocess.STDOUT, timeout=0.5\n )\n except Exception:\n pass\n else:\n if rustc_output.startswith(b\"rustc \"):\n # The format of `rustc --version` is:\n # `b'rustc 1.52.1 (9bc8c42bb 2021-05-09)\\n'`\n # We extract just the middle (1.52.1) part\n data[\"rustc_version\"] = rustc_output.split(b\" \")[1].decode()\n\n # Use None rather than False so as not to give the impression that\n # pip knows it is not being run under CI. Rather, it is a null or\n # inconclusive result. Also, we include some value rather than no\n # value to make it easier to know that the check has been run.\n data[\"ci\"] = True if looks_like_ci() else None\n\n user_data = os.environ.get(\"PIP_USER_AGENT_USER_DATA\")\n if user_data is not None:\n data[\"user_data\"] = user_data\n\n return \"{data[installer][name]}/{data[installer][version]} {json}\".format(\n data=data,\n json=json.dumps(data, separators=(\",\", \":\"), sort_keys=True),\n )\n\n\nclass LocalFSAdapter(BaseAdapter):\n def send(\n self,\n request: PreparedRequest,\n stream: bool = False,\n timeout: Optional[Union[float, Tuple[float, float]]] = None,\n verify: Union[bool, str] = True,\n cert: Optional[Union[str, Tuple[str, str]]] = None,\n proxies: Optional[Mapping[str, str]] = None,\n ) -> Response:\n pathname = url_to_path(request.url)\n\n resp = Response()\n resp.status_code = 200\n resp.url = request.url\n\n try:\n stats = os.stat(pathname)\n except OSError as exc:\n # format the exception raised as a io.BytesIO object,\n # to return a better error message:\n resp.status_code = 404\n resp.reason = type(exc).__name__\n resp.raw = io.BytesIO(f\"{resp.reason}: {exc}\".encode())\n else:\n modified = email.utils.formatdate(stats.st_mtime, usegmt=True)\n content_type = mimetypes.guess_type(pathname)[0] or \"text/plain\"\n resp.headers = CaseInsensitiveDict(\n {\n \"Content-Type\": content_type,\n \"Content-Length\": stats.st_size,\n \"Last-Modified\": modified,\n }\n )\n\n resp.raw = open(pathname, \"rb\")\n resp.close = resp.raw.close\n\n return resp\n\n def close(self) -> None:\n pass\n\n\nclass _SSLContextAdapterMixin:\n \"\"\"Mixin to add the ``ssl_context`` constructor argument to HTTP adapters.\n\n The additional argument is forwarded directly to the pool manager. This allows us\n to dynamically decide what SSL store to use at runtime, which is used to implement\n the optional ``truststore`` backend.\n \"\"\"\n\n def __init__(\n self,\n *,\n ssl_context: Optional[\"SSLContext\"] = None,\n **kwargs: Any,\n ) -> None:\n self._ssl_context = ssl_context\n super().__init__(**kwargs)\n\n def init_poolmanager(\n self,\n connections: int,\n maxsize: int,\n block: bool = DEFAULT_POOLBLOCK,\n **pool_kwargs: Any,\n ) -> \"PoolManager\":\n if self._ssl_context is not None:\n pool_kwargs.setdefault(\"ssl_context\", self._ssl_context)\n return super().init_poolmanager( # type: ignore[misc]\n connections=connections,\n maxsize=maxsize,\n block=block,\n **pool_kwargs,\n )\n\n\nclass HTTPAdapter(_SSLContextAdapterMixin, _BaseHTTPAdapter):\n pass\n\n\nclass CacheControlAdapter(_SSLContextAdapterMixin, _BaseCacheControlAdapter):\n pass\n\n\nclass InsecureHTTPAdapter(HTTPAdapter):\n def cert_verify(\n self,\n conn: ConnectionPool,\n url: str,\n verify: Union[bool, str],\n cert: Optional[Union[str, Tuple[str, str]]],\n ) -> None:\n super().cert_verify(conn=conn, url=url, verify=False, cert=cert)\n\n\nclass InsecureCacheControlAdapter(CacheControlAdapter):\n def cert_verify(\n self,\n conn: ConnectionPool,\n url: str,\n verify: Union[bool, str],\n cert: Optional[Union[str, Tuple[str, str]]],\n ) -> None:\n super().cert_verify(conn=conn, url=url, verify=False, cert=cert)\n\n\nclass PipSession(requests.Session):\n timeout: Optional[int] = None\n\n def __init__(\n self,\n *args: Any,\n retries: int = 0,\n cache: Optional[str] = None,\n trusted_hosts: Sequence[str] = (),\n index_urls: Optional[List[str]] = None,\n ssl_context: Optional[\"SSLContext\"] = None,\n **kwargs: Any,\n ) -> None:\n \"\"\"\n :param trusted_hosts: Domains not to emit warnings for when not using\n HTTPS.\n \"\"\"\n super().__init__(*args, **kwargs)\n\n # Namespace the attribute with \"pip_\" just in case to prevent\n # possible conflicts with the base class.\n self.pip_trusted_origins: List[Tuple[str, Optional[int]]] = []\n self.pip_proxy = None\n\n # Attach our User Agent to the request\n self.headers[\"User-Agent\"] = user_agent()\n\n # Attach our Authentication handler to the session\n self.auth = MultiDomainBasicAuth(index_urls=index_urls)\n\n # Create our urllib3.Retry instance which will allow us to customize\n # how we handle retries.\n retries = urllib3.Retry(\n # Set the total number of retries that a particular request can\n # have.\n total=retries,\n # A 503 error from PyPI typically means that the Fastly -> Origin\n # connection got interrupted in some way. A 503 error in general\n # is typically considered a transient error so we'll go ahead and\n # retry it.\n # A 500 may indicate transient error in Amazon S3\n # A 502 may be a transient error from a CDN like CloudFlare or CloudFront\n # A 520 or 527 - may indicate transient error in CloudFlare\n status_forcelist=[500, 502, 503, 520, 527],\n # Add a small amount of back off between failed requests in\n # order to prevent hammering the service.\n backoff_factor=0.25,\n ) # type: ignore\n\n # Our Insecure HTTPAdapter disables HTTPS validation. It does not\n # support caching so we'll use it for all http:// URLs.\n # If caching is disabled, we will also use it for\n # https:// hosts that we've marked as ignoring\n # TLS errors for (trusted-hosts).\n insecure_adapter = InsecureHTTPAdapter(max_retries=retries)\n\n # We want to _only_ cache responses on securely fetched origins or when\n # the host is specified as trusted. We do this because\n # we can't validate the response of an insecurely/untrusted fetched\n # origin, and we don't want someone to be able to poison the cache and\n # require manual eviction from the cache to fix it.\n if cache:\n secure_adapter = CacheControlAdapter(\n cache=SafeFileCache(cache),\n max_retries=retries,\n ssl_context=ssl_context,\n )\n self._trusted_host_adapter = InsecureCacheControlAdapter(\n cache=SafeFileCache(cache),\n max_retries=retries,\n )\n else:\n secure_adapter = HTTPAdapter(max_retries=retries, ssl_context=ssl_context)\n self._trusted_host_adapter = insecure_adapter\n\n self.mount(\"https://\", secure_adapter)\n self.mount(\"http://\", insecure_adapter)\n\n # Enable file:// urls\n self.mount(\"file://\", LocalFSAdapter())\n\n for host in trusted_hosts:\n self.add_trusted_host(host, suppress_logging=True)\n\n def update_index_urls(self, new_index_urls: List[str]) -> None:\n \"\"\"\n :param new_index_urls: New index urls to update the authentication\n handler with.\n \"\"\"\n self.auth.index_urls = new_index_urls\n\n def add_trusted_host(\n self, host: str, source: Optional[str] = None, suppress_logging: bool = False\n ) -> None:\n \"\"\"\n :param host: It is okay to provide a host that has previously been\n added.\n :param source: An optional source string, for logging where the host\n string came from.\n \"\"\"\n if not suppress_logging:\n msg = f\"adding trusted host: {host!r}\"\n if source is not None:\n msg += f\" (from {source})\"\n logger.info(msg)\n\n parsed_host, parsed_port = parse_netloc(host)\n if parsed_host is None:\n raise ValueError(f\"Trusted host URL must include a host part: {host!r}\")\n if (parsed_host, parsed_port) not in self.pip_trusted_origins:\n self.pip_trusted_origins.append((parsed_host, parsed_port))\n\n self.mount(\n build_url_from_netloc(host, scheme=\"http\") + \"/\", self._trusted_host_adapter\n )\n self.mount(build_url_from_netloc(host) + \"/\", self._trusted_host_adapter)\n if not parsed_port:\n self.mount(\n build_url_from_netloc(host, scheme=\"http\") + \":\",\n self._trusted_host_adapter,\n )\n # Mount wildcard ports for the same host.\n self.mount(build_url_from_netloc(host) + \":\", self._trusted_host_adapter)\n\n def iter_secure_origins(self) -> Generator[SecureOrigin, None, None]:\n yield from SECURE_ORIGINS\n for host, port in self.pip_trusted_origins:\n yield (\"*\", host, \"*\" if port is None else port)\n\n def is_secure_origin(self, location: Link) -> bool:\n # Determine if this url used a secure transport mechanism\n parsed = urllib.parse.urlparse(str(location))\n origin_protocol, origin_host, origin_port = (\n parsed.scheme,\n parsed.hostname,\n parsed.port,\n )\n\n # The protocol to use to see if the protocol matches.\n # Don't count the repository type as part of the protocol: in\n # cases such as \"git+ssh\", only use \"ssh\". (I.e., Only verify against\n # the last scheme.)\n origin_protocol = origin_protocol.rsplit(\"+\", 1)[-1]\n\n # Determine if our origin is a secure origin by looking through our\n # hardcoded list of secure origins, as well as any additional ones\n # configured on this PackageFinder instance.\n for secure_origin in self.iter_secure_origins():\n secure_protocol, secure_host, secure_port = secure_origin\n if origin_protocol != secure_protocol and secure_protocol != \"*\":\n continue\n\n try:\n addr = ipaddress.ip_address(origin_host or \"\")\n network = ipaddress.ip_network(secure_host)\n except ValueError:\n # We don't have both a valid address or a valid network, so\n # we'll check this origin against hostnames.\n if (\n origin_host\n and origin_host.lower() != secure_host.lower()\n and secure_host != \"*\"\n ):\n continue\n else:\n # We have a valid address and network, so see if the address\n # is contained within the network.\n if addr not in network:\n continue\n\n # Check to see if the port matches.\n if (\n origin_port != secure_port\n and secure_port != \"*\"\n and secure_port is not None\n ):\n continue\n\n # If we've gotten here, then this origin matches the current\n # secure origin and we should return True\n return True\n\n # If we've gotten to this point, then the origin isn't secure and we\n # will not accept it as a valid location to search. We will however\n # log a warning that we are ignoring it.\n logger.warning(\n \"The repository located at %s is not a trusted or secure host and \"\n \"is being ignored. If this repository is available via HTTPS we \"\n \"recommend you use HTTPS instead, otherwise you may silence \"\n \"this warning and allow it anyway with '--trusted-host %s'.\",\n origin_host,\n origin_host,\n )\n\n return False\n\n def request(self, method: str, url: str, *args: Any, **kwargs: Any) -> Response:\n # Allow setting a default timeout on a session\n kwargs.setdefault(\"timeout\", self.timeout)\n # Allow setting a default proxies on a session\n kwargs.setdefault(\"proxies\", self.proxies)\n\n # Dispatch the actual request\n return super().request(method, url, *args, **kwargs)\n",[],[100,509,516,523,475,544,1196,1245],{"_104":1253,"_96":1254,"_158":1255,"_160":1197,"_161":139,"_162":1256,"_164":165,"_106":1257,"_101":29,"_167":215,"_169":1258,"_170":25,"_171":-5,"_172":1259,"_99":1260},"048d9b04-67fc-11f0-b654-0224a6c84d84","utils.py","048d9bb8-67fc-11f0-b654-0224a6c84d84",141,["D",1753299255267],"from typing import Dict, Generator\n\nfrom pip._vendor.requests.models import Response\n\nfrom pip._internal.exceptions import NetworkConnectionError\n\n# The following comments and HTTP headers were originally added by\n# Donald Stufft in git commit 22c562429a61bb77172039e480873fb239dd8c03.\n#\n# We use Accept-Encoding: identity here because requests defaults to\n# accepting compressed responses. This breaks in a variety of ways\n# depending on how the server is configured.\n# - Some servers will notice that the file isn't a compressible file\n# and will leave the file alone and with an empty Content-Encoding\n# - Some servers will notice that the file is already compressed and\n# will leave the file alone, adding a Content-Encoding: gzip header\n# - Some servers won't notice anything at all and will take a file\n# that's already been compressed and compress it again, and set\n# the Content-Encoding: gzip header\n# By setting this to request only the identity encoding we're hoping\n# to eliminate the third case. Hopefully there does not exist a server\n# which when given a file will notice it is already compressed and that\n# you're not asking for a compressed file and will then decompress it\n# before sending because if that's the case I don't think it'll ever be\n# possible to make this work.\nHEADERS: Dict[str, str] = {\"Accept-Encoding\": \"identity\"}\n\nDOWNLOAD_CHUNK_SIZE = 256 * 1024\n\n\ndef raise_for_status(resp: Response) -> None:\n http_error_msg = \"\"\n if isinstance(resp.reason, bytes):\n # We attempt to decode utf-8 first because some servers\n # choose to localize their reason strings. If the string\n # isn't utf-8, we fall back to iso-8859-1 for all other\n # encodings.\n try:\n reason = resp.reason.decode(\"utf-8\")\n except UnicodeDecodeError:\n reason = resp.reason.decode(\"iso-8859-1\")\n else:\n reason = resp.reason\n\n if 400 <= resp.status_code < 500:\n http_error_msg = (\n f\"{resp.status_code} Client Error: {reason} for url: {resp.url}\"\n )\n\n elif 500 <= resp.status_code < 600:\n http_error_msg = (\n f\"{resp.status_code} Server Error: {reason} for url: {resp.url}\"\n )\n\n if http_error_msg:\n raise NetworkConnectionError(http_error_msg, response=resp)\n\n\ndef response_chunks(\n response: Response, chunk_size: int = DOWNLOAD_CHUNK_SIZE\n) -> Generator[bytes, None, None]:\n \"\"\"Given a requests Response, provide the data chunks.\"\"\"\n try:\n # Special case for urllib3.\n for chunk in response.raw.stream(\n chunk_size,\n # We use decode_content=False here because we don't\n # want urllib3 to mess with the raw bytes we get\n # from the server. If we decompress inside of\n # urllib3 then we cannot verify the checksum\n # because the checksum will be of the compressed\n # file. This breakage will only occur if the\n # server adds a Content-Encoding header, which\n # depends on how the server was configured:\n # - Some servers will notice that the file isn't a\n # compressible file and will leave the file alone\n # and with an empty Content-Encoding\n # - Some servers will notice that the file is\n # already compressed and will leave the file\n # alone and will add a Content-Encoding: gzip\n # header\n # - Some servers won't notice anything at all and\n # will take a file that's already been compressed\n # and compress it again and set the\n # Content-Encoding: gzip header\n #\n # By setting this not to decode automatically we\n # hope to eliminate problems with the second case.\n decode_content=False,\n ):\n yield chunk\n except AttributeError:\n # Standard file-like object.\n while True:\n chunk = response.raw.read(chunk_size)\n if not chunk:\n break\n yield chunk\n",[],[100,509,516,523,475,544,1196,1254],{"_104":1262,"_96":1263,"_158":1264,"_160":1197,"_161":139,"_162":1265,"_164":165,"_106":1266,"_101":29,"_167":215,"_169":1267,"_170":25,"_171":-5,"_172":1268,"_99":1269},"045daf48-67fc-11f0-9ad5-0224a6c84d84","xmlrpc.py","045db178-67fc-11f0-9ad5-0224a6c84d84",134,["D",1753299255107],"\"\"\"xmlrpclib.Transport implementation\"\"\"\n\nimport logging\nimport urllib.parse\nimport xmlrpc.client\nfrom typing import TYPE_CHECKING, Tuple\n\nfrom pip._internal.exceptions import NetworkConnectionError\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.network.utils import raise_for_status\n\nif TYPE_CHECKING:\n from xmlrpc.client import _HostType, _Marshallable\n\n from _typeshed import SizedBuffer\n\nlogger = logging.getLogger(__name__)\n\n\nclass PipXmlrpcTransport(xmlrpc.client.Transport):\n \"\"\"Provide a `xmlrpclib.Transport` implementation via a `PipSession`\n object.\n \"\"\"\n\n def __init__(\n self, index_url: str, session: PipSession, use_datetime: bool = False\n ) -> None:\n super().__init__(use_datetime)\n index_parts = urllib.parse.urlparse(index_url)\n self._scheme = index_parts.scheme\n self._session = session\n\n def request(\n self,\n host: \"_HostType\",\n handler: str,\n request_body: \"SizedBuffer\",\n verbose: bool = False,\n ) -> Tuple[\"_Marshallable\", ...]:\n assert isinstance(host, str)\n parts = (self._scheme, host, handler, None, None, None)\n url = urllib.parse.urlunparse(parts)\n try:\n headers = {\"Content-Type\": \"text/xml\"}\n response = self._session.post(\n url,\n data=request_body,\n headers=headers,\n stream=True,\n )\n raise_for_status(response)\n self.verbose = verbose\n return self.parse_response(response.raw)\n except NetworkConnectionError as exc:\n assert exc.response\n logger.critical(\n \"HTTP error %s while getting %s\",\n exc.response.status_code,\n url,\n )\n raise\n",[],[100,509,516,523,475,544,1196,1263],[100,509,516,523,475,544,1196],{"_104":1272,"_96":1273,"_158":1274,"_160":545,"_161":139,"_162":1275,"_164":165,"_106":1276,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1277,"_99":1406},"fc4758f4-67fb-11f0-805e-0224a6c84d84","operations","fc4759b2-67fb-11f0-805e-0224a6c84d84",61,["D",1753299241540],[1278,1348,1381,1389,1397],{"_104":1279,"_96":1280,"_158":1281,"_160":1274,"_161":139,"_162":1282,"_164":165,"_106":1283,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1284,"_99":1347},"ff5a7f08-67fb-11f0-928e-0224a6c84d84","build","ff5a7fd0-67fb-11f0-928e-0224a6c84d84",90,["D",1753299246697],[1285,1294,1303,1312,1321,1329,1338],{"_104":1286,"_96":1287,"_158":1288,"_160":1281,"_161":139,"_162":1289,"_164":165,"_106":1290,"_101":29,"_167":215,"_169":1291,"_170":25,"_171":-5,"_172":1292,"_99":1293},"05ff1a44-67fc-11f0-9bd1-0224a6c84d84","build_tracker.py","05ff1b16-67fc-11f0-9bd1-0224a6c84d84",204,["D",1753299257847],"import contextlib\nimport hashlib\nimport logging\nimport os\nfrom types import TracebackType\nfrom typing import Dict, Generator, Optional, Type, Union\n\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.temp_dir import TempDirectory\n\nlogger = logging.getLogger(__name__)\n\n\n@contextlib.contextmanager\ndef update_env_context_manager(**changes: str) -> Generator[None, None, None]:\n target = os.environ\n\n # Save values from the target and change them.\n non_existent_marker = object()\n saved_values: Dict[str, Union[object, str]] = {}\n for name, new_value in changes.items():\n try:\n saved_values[name] = target[name]\n except KeyError:\n saved_values[name] = non_existent_marker\n target[name] = new_value\n\n try:\n yield\n finally:\n # Restore original values in the target.\n for name, original_value in saved_values.items():\n if original_value is non_existent_marker:\n del target[name]\n else:\n assert isinstance(original_value, str) # for mypy\n target[name] = original_value\n\n\n@contextlib.contextmanager\ndef get_build_tracker() -> Generator[\"BuildTracker\", None, None]:\n root = os.environ.get(\"PIP_BUILD_TRACKER\")\n with contextlib.ExitStack() as ctx:\n if root is None:\n root = ctx.enter_context(TempDirectory(kind=\"build-tracker\")).path\n ctx.enter_context(update_env_context_manager(PIP_BUILD_TRACKER=root))\n logger.debug(\"Initialized build tracking at %s\", root)\n\n with BuildTracker(root) as tracker:\n yield tracker\n\n\nclass TrackerId(str):\n \"\"\"Uniquely identifying string provided to the build tracker.\"\"\"\n\n\nclass BuildTracker:\n \"\"\"Ensure that an sdist cannot request itself as a setup requirement.\n\n When an sdist is prepared, it identifies its setup requirements in the\n context of ``BuildTracker.track()``. If a requirement shows up recursively, this\n raises an exception.\n\n This stops fork bombs embedded in malicious packages.\"\"\"\n\n def __init__(self, root: str) -> None:\n self._root = root\n self._entries: Dict[TrackerId, InstallRequirement] = {}\n logger.debug(\"Created build tracker: %s\", self._root)\n\n def __enter__(self) -> \"BuildTracker\":\n logger.debug(\"Entered build tracker: %s\", self._root)\n return self\n\n def __exit__(\n self,\n exc_type: Optional[Type[BaseException]],\n exc_val: Optional[BaseException],\n exc_tb: Optional[TracebackType],\n ) -> None:\n self.cleanup()\n\n def _entry_path(self, key: TrackerId) -> str:\n hashed = hashlib.sha224(key.encode()).hexdigest()\n return os.path.join(self._root, hashed)\n\n def add(self, req: InstallRequirement, key: TrackerId) -> None:\n \"\"\"Add an InstallRequirement to build tracking.\"\"\"\n\n # Get the file to write information about this requirement.\n entry_path = self._entry_path(key)\n\n # Try reading from the file. If it exists and can be read from, a build\n # is already in progress, so a LookupError is raised.\n try:\n with open(entry_path) as fp:\n contents = fp.read()\n except FileNotFoundError:\n pass\n else:\n message = f\"{req.link} is already being built: {contents}\"\n raise LookupError(message)\n\n # If we're here, req should really not be building already.\n assert key not in self._entries\n\n # Start tracking this requirement.\n with open(entry_path, \"w\", encoding=\"utf-8\") as fp:\n fp.write(str(req))\n self._entries[key] = req\n\n logger.debug(\"Added %s to build tracker %r\", req, self._root)\n\n def remove(self, req: InstallRequirement, key: TrackerId) -> None:\n \"\"\"Remove an InstallRequirement from build tracking.\"\"\"\n\n # Delete the created file and the corresponding entry.\n os.unlink(self._entry_path(key))\n del self._entries[key]\n\n logger.debug(\"Removed %s from build tracker %r\", req, self._root)\n\n def cleanup(self) -> None:\n for key, req in list(self._entries.items()):\n self.remove(req, key)\n\n logger.debug(\"Removed build tracker: %r\", self._root)\n\n @contextlib.contextmanager\n def track(self, req: InstallRequirement, key: str) -> Generator[None, None, None]:\n \"\"\"Ensure that `key` cannot install itself as a setup requirement.\n\n :raises LookupError: If `key` was already provided in a parent invocation of\n the context introduced by this method.\"\"\"\n tracker_id = TrackerId(key)\n self.add(req, tracker_id)\n yield\n self.remove(req, tracker_id)\n",[],[100,509,516,523,475,544,1273,1280,1287],{"_104":1295,"_96":1296,"_158":1297,"_160":1281,"_161":139,"_162":1298,"_164":165,"_106":1299,"_101":29,"_167":215,"_169":1300,"_170":25,"_171":-5,"_172":1301,"_99":1302},"05e6e74e-67fc-11f0-85ab-0224a6c84d84","metadata.py","05e6e7f8-67fc-11f0-85ab-0224a6c84d84",200,["D",1753299257652],"\"\"\"Metadata generation logic for source distributions.\"\"\"\n\nimport os\n\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller\n\nfrom pip._internal.build_env import BuildEnvironment\nfrom pip._internal.exceptions import (\n InstallationSubprocessError,\n MetadataGenerationFailed,\n)\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\nfrom pip._internal.utils.temp_dir import TempDirectory\n\n\ndef generate_metadata(\n build_env: BuildEnvironment, backend: BuildBackendHookCaller, details: str\n) -> str:\n \"\"\"Generate metadata using mechanisms described in PEP 517.\n\n Returns the generated metadata directory.\n \"\"\"\n metadata_tmpdir = TempDirectory(kind=\"modern-metadata\", globally_managed=True)\n\n metadata_dir = metadata_tmpdir.path\n\n with build_env:\n # Note that BuildBackendHookCaller implements a fallback for\n # prepare_metadata_for_build_wheel, so we don't have to\n # consider the possibility that this hook doesn't exist.\n runner = runner_with_spinner_message(\"Preparing metadata (pyproject.toml)\")\n with backend.subprocess_runner(runner):\n try:\n distinfo_dir = backend.prepare_metadata_for_build_wheel(metadata_dir)\n except InstallationSubprocessError as error:\n raise MetadataGenerationFailed(package_details=details) from error\n\n return os.path.join(metadata_dir, distinfo_dir)\n",[],[100,509,516,523,475,544,1273,1280,1296],{"_104":1304,"_96":1305,"_158":1306,"_160":1281,"_161":139,"_162":1307,"_164":165,"_106":1308,"_101":29,"_167":215,"_169":1309,"_170":25,"_171":-5,"_172":1310,"_99":1311},"05eb0928-67fc-11f0-8737-0224a6c84d84","metadata_editable.py","05eb09f0-67fc-11f0-8737-0224a6c84d84",201,["D",1753299257698],"\"\"\"Metadata generation logic for source distributions.\"\"\"\n\nimport os\n\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller\n\nfrom pip._internal.build_env import BuildEnvironment\nfrom pip._internal.exceptions import (\n InstallationSubprocessError,\n MetadataGenerationFailed,\n)\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\nfrom pip._internal.utils.temp_dir import TempDirectory\n\n\ndef generate_editable_metadata(\n build_env: BuildEnvironment, backend: BuildBackendHookCaller, details: str\n) -> str:\n \"\"\"Generate metadata using mechanisms described in PEP 660.\n\n Returns the generated metadata directory.\n \"\"\"\n metadata_tmpdir = TempDirectory(kind=\"modern-metadata\", globally_managed=True)\n\n metadata_dir = metadata_tmpdir.path\n\n with build_env:\n # Note that BuildBackendHookCaller implements a fallback for\n # prepare_metadata_for_build_wheel/editable, so we don't have to\n # consider the possibility that this hook doesn't exist.\n runner = runner_with_spinner_message(\n \"Preparing editable metadata (pyproject.toml)\"\n )\n with backend.subprocess_runner(runner):\n try:\n distinfo_dir = backend.prepare_metadata_for_build_editable(metadata_dir)\n except InstallationSubprocessError as error:\n raise MetadataGenerationFailed(package_details=details) from error\n\n assert distinfo_dir is not None\n return os.path.join(metadata_dir, distinfo_dir)\n",[],[100,509,516,523,475,544,1273,1280,1305],{"_104":1313,"_96":1314,"_158":1315,"_160":1281,"_161":139,"_162":1316,"_164":165,"_106":1317,"_101":29,"_167":215,"_169":1318,"_170":25,"_171":-5,"_172":1319,"_99":1320},"05f25e8a-67fc-11f0-b654-0224a6c84d84","metadata_legacy.py","05f26092-67fc-11f0-b654-0224a6c84d84",202,["D",1753299257759],"\"\"\"Metadata generation logic for legacy source distributions.\"\"\"\n\nimport logging\nimport os\n\nfrom pip._internal.build_env import BuildEnvironment\nfrom pip._internal.cli.spinners import open_spinner\nfrom pip._internal.exceptions import (\n InstallationError,\n InstallationSubprocessError,\n MetadataGenerationFailed,\n)\nfrom pip._internal.utils.setuptools_build import make_setuptools_egg_info_args\nfrom pip._internal.utils.subprocess import call_subprocess\nfrom pip._internal.utils.temp_dir import TempDirectory\n\nlogger = logging.getLogger(__name__)\n\n\ndef _find_egg_info(directory: str) -> str:\n \"\"\"Find an .egg-info subdirectory in `directory`.\"\"\"\n filenames = [f for f in os.listdir(directory) if f.endswith(\".egg-info\")]\n\n if not filenames:\n raise InstallationError(f\"No .egg-info directory found in {directory}\")\n\n if len(filenames) > 1:\n raise InstallationError(\n f\"More than one .egg-info directory found in {directory}\"\n )\n\n return os.path.join(directory, filenames[0])\n\n\ndef generate_metadata(\n build_env: BuildEnvironment,\n setup_py_path: str,\n source_dir: str,\n isolated: bool,\n details: str,\n) -> str:\n \"\"\"Generate metadata using setup.py-based defacto mechanisms.\n\n Returns the generated metadata directory.\n \"\"\"\n logger.debug(\n \"Running setup.py (path:%s) egg_info for package %s\",\n setup_py_path,\n details,\n )\n\n egg_info_dir = TempDirectory(kind=\"pip-egg-info\", globally_managed=True).path\n\n args = make_setuptools_egg_info_args(\n setup_py_path,\n egg_info_dir=egg_info_dir,\n no_user_config=isolated,\n )\n\n with build_env:\n with open_spinner(\"Preparing metadata (setup.py)\") as spinner:\n try:\n call_subprocess(\n args,\n cwd=source_dir,\n command_desc=\"python setup.py egg_info\",\n spinner=spinner,\n )\n except InstallationSubprocessError as error:\n raise MetadataGenerationFailed(package_details=details) from error\n\n # Return the .egg-info directory.\n return _find_egg_info(egg_info_dir)\n",[],[100,509,516,523,475,544,1273,1280,1314],{"_104":1322,"_96":843,"_158":1323,"_160":1281,"_161":139,"_162":1324,"_164":165,"_106":1325,"_101":29,"_167":215,"_169":1326,"_170":25,"_171":-5,"_172":1327,"_99":1328},"060185c2-67fc-11f0-b654-0224a6c84d84","06018676-67fc-11f0-b654-0224a6c84d84",205,["D",1753299257847],"import logging\nimport os\nfrom typing import Optional\n\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller\n\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\n\nlogger = logging.getLogger(__name__)\n\n\ndef build_wheel_pep517(\n name: str,\n backend: BuildBackendHookCaller,\n metadata_directory: str,\n tempd: str,\n) -> Optional[str]:\n \"\"\"Build one InstallRequirement using the PEP 517 build process.\n\n Returns path to wheel if successfully built. Otherwise, returns None.\n \"\"\"\n assert metadata_directory is not None\n try:\n logger.debug(\"Destination directory: %s\", tempd)\n\n runner = runner_with_spinner_message(\n f\"Building wheel for {name} (pyproject.toml)\"\n )\n with backend.subprocess_runner(runner):\n wheel_name = backend.build_wheel(\n tempd,\n metadata_directory=metadata_directory,\n )\n except Exception:\n logger.error(\"Failed building wheel for %s\", name)\n return None\n return os.path.join(tempd, wheel_name)\n",[],[100,509,516,523,475,544,1273,1280,843],{"_104":1330,"_96":1331,"_158":1332,"_160":1281,"_161":139,"_162":1333,"_164":165,"_106":1334,"_101":29,"_167":215,"_169":1335,"_170":25,"_171":-5,"_172":1336,"_99":1337},"05f73018-67fc-11f0-9bd1-0224a6c84d84","wheel_editable.py","05f730cc-67fc-11f0-9bd1-0224a6c84d84",203,["D",1753299257761],"import logging\nimport os\nfrom typing import Optional\n\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller, HookMissing\n\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\n\nlogger = logging.getLogger(__name__)\n\n\ndef build_wheel_editable(\n name: str,\n backend: BuildBackendHookCaller,\n metadata_directory: str,\n tempd: str,\n) -> Optional[str]:\n \"\"\"Build one InstallRequirement using the PEP 660 build process.\n\n Returns path to wheel if successfully built. Otherwise, returns None.\n \"\"\"\n assert metadata_directory is not None\n try:\n logger.debug(\"Destination directory: %s\", tempd)\n\n runner = runner_with_spinner_message(\n f\"Building editable for {name} (pyproject.toml)\"\n )\n with backend.subprocess_runner(runner):\n try:\n wheel_name = backend.build_editable(\n tempd,\n metadata_directory=metadata_directory,\n )\n except HookMissing as e:\n logger.error(\n \"Cannot build editable %s because the build \"\n \"backend does not have the %s hook\",\n name,\n e,\n )\n return None\n except Exception:\n logger.error(\"Failed building editable for %s\", name)\n return None\n return os.path.join(tempd, wheel_name)\n",[],[100,509,516,523,475,544,1273,1280,1331],{"_104":1339,"_96":1340,"_158":1341,"_160":1281,"_161":139,"_162":1342,"_164":165,"_106":1343,"_101":29,"_167":215,"_169":1344,"_170":25,"_171":-5,"_172":1345,"_99":1346},"05d8e6e4-67fc-11f0-9ad5-0224a6c84d84","wheel_legacy.py","05d8e784-67fc-11f0-9ad5-0224a6c84d84",198,["D",1753299257581],"import logging\nimport os.path\nfrom typing import List, Optional\n\nfrom pip._internal.cli.spinners import open_spinner\nfrom pip._internal.utils.deprecation import deprecated\nfrom pip._internal.utils.setuptools_build import make_setuptools_bdist_wheel_args\nfrom pip._internal.utils.subprocess import call_subprocess, format_command_args\n\nlogger = logging.getLogger(__name__)\n\n\ndef format_command_result(\n command_args: List[str],\n command_output: str,\n) -> str:\n \"\"\"Format command information for logging.\"\"\"\n command_desc = format_command_args(command_args)\n text = f\"Command arguments: {command_desc}\\n\"\n\n if not command_output:\n text += \"Command output: None\"\n elif logger.getEffectiveLevel() > logging.DEBUG:\n text += \"Command output: [use --verbose to show]\"\n else:\n if not command_output.endswith(\"\\n\"):\n command_output += \"\\n\"\n text += f\"Command output:\\n{command_output}\"\n\n return text\n\n\ndef get_legacy_build_wheel_path(\n names: List[str],\n temp_dir: str,\n name: str,\n command_args: List[str],\n command_output: str,\n) -> Optional[str]:\n \"\"\"Return the path to the wheel in the temporary build directory.\"\"\"\n # Sort for determinism.\n names = sorted(names)\n if not names:\n msg = f\"Legacy build of wheel for {name!r} created no files.\\n\"\n msg += format_command_result(command_args, command_output)\n logger.warning(msg)\n return None\n\n if len(names) > 1:\n msg = (\n f\"Legacy build of wheel for {name!r} created more than one file.\\n\"\n f\"Filenames (choosing first): {names}\\n\"\n )\n msg += format_command_result(command_args, command_output)\n logger.warning(msg)\n\n return os.path.join(temp_dir, names[0])\n\n\ndef build_wheel_legacy(\n name: str,\n setup_py_path: str,\n source_dir: str,\n global_options: List[str],\n build_options: List[str],\n tempd: str,\n) -> Optional[str]:\n \"\"\"Build one unpacked package using the \"legacy\" build process.\n\n Returns path to wheel if successfully built. Otherwise, returns None.\n \"\"\"\n deprecated(\n reason=(\n f\"Building {name!r} using the legacy setup.py bdist_wheel mechanism, \"\n \"which will be removed in a future version.\"\n ),\n replacement=(\n \"to use the standardized build interface by \"\n \"setting the `--use-pep517` option, \"\n \"(possibly combined with `--no-build-isolation`), \"\n f\"or adding a `pyproject.toml` file to the source tree of {name!r}\"\n ),\n gone_in=\"25.3\",\n issue=6334,\n )\n\n wheel_args = make_setuptools_bdist_wheel_args(\n setup_py_path,\n global_options=global_options,\n build_options=build_options,\n destination_dir=tempd,\n )\n\n spin_message = f\"Building wheel for {name} (setup.py)\"\n with open_spinner(spin_message) as spinner:\n logger.debug(\"Destination directory: %s\", tempd)\n\n try:\n output = call_subprocess(\n wheel_args,\n command_desc=\"python setup.py bdist_wheel\",\n cwd=source_dir,\n spinner=spinner,\n )\n except Exception:\n spinner.finish(\"error\")\n logger.error(\"Failed building wheel for %s\", name)\n return None\n\n names = os.listdir(tempd)\n wheel_path = get_legacy_build_wheel_path(\n names=names,\n temp_dir=tempd,\n name=name,\n command_args=wheel_args,\n command_output=output,\n )\n return wheel_path\n",[],[100,509,516,523,475,544,1273,1280,1340],[100,509,516,523,475,544,1273,1280],{"_104":1349,"_96":1350,"_158":1351,"_160":1274,"_161":139,"_162":1352,"_164":165,"_106":1353,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1354,"_99":1380},"ff41d660-67fb-11f0-bf1a-0224a6c84d84","install","ff41d71e-67fb-11f0-bf1a-0224a6c84d84",89,["D",1753299246538],[1355,1363,1372],{"_104":1356,"_96":558,"_158":1357,"_160":1351,"_161":139,"_162":1358,"_164":165,"_106":1359,"_101":29,"_167":215,"_169":1360,"_170":25,"_171":-5,"_172":1361,"_99":1362},"05e13c36-67fc-11f0-805e-0224a6c84d84","05e13ccc-67fc-11f0-805e-0224a6c84d84",199,["D",1753299257486],"\"\"\"For modules related to installing packages.\"\"\"\n",[],[100,509,516,523,475,544,1273,1350,558],{"_104":1364,"_96":1365,"_158":1366,"_160":1351,"_161":139,"_162":1367,"_164":165,"_106":1368,"_101":29,"_167":215,"_169":1369,"_170":25,"_171":-5,"_172":1370,"_99":1371},"05bd71d4-67fc-11f0-928e-0224a6c84d84","editable_legacy.py","05bd72a6-67fc-11f0-928e-0224a6c84d84",194,["D",1753299257410],"\"\"\"Legacy editable installation process, i.e. `setup.py develop`.\"\"\"\n\nimport logging\nfrom typing import Optional, Sequence\n\nfrom pip._internal.build_env import BuildEnvironment\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.setuptools_build import make_setuptools_develop_args\nfrom pip._internal.utils.subprocess import call_subprocess\n\nlogger = logging.getLogger(__name__)\n\n\ndef install_editable(\n *,\n global_options: Sequence[str],\n prefix: Optional[str],\n home: Optional[str],\n use_user_site: bool,\n name: str,\n setup_py_path: str,\n isolated: bool,\n build_env: BuildEnvironment,\n unpacked_source_directory: str,\n) -> None:\n \"\"\"Install a package in editable mode. Most arguments are pass-through\n to setuptools.\n \"\"\"\n logger.info(\"Running setup.py develop for %s\", name)\n\n args = make_setuptools_develop_args(\n setup_py_path,\n global_options=global_options,\n no_user_config=isolated,\n prefix=prefix,\n home=home,\n use_user_site=use_user_site,\n )\n\n with indent_log():\n with build_env:\n call_subprocess(\n args,\n command_desc=\"python setup.py develop\",\n cwd=unpacked_source_directory,\n )\n",[],[100,509,516,523,475,544,1273,1350,1365],{"_104":1373,"_96":843,"_158":1374,"_160":1351,"_161":139,"_162":1375,"_164":165,"_106":1376,"_101":29,"_167":215,"_169":1377,"_170":25,"_171":-5,"_172":1378,"_99":1379},"05c8851a-67fc-11f0-aad3-0224a6c84d84","05c885d8-67fc-11f0-aad3-0224a6c84d84",195,["D",1753299257486],"\"\"\"Support for installing and building the \"wheel\" binary package format.\"\"\"\n\nimport collections\nimport compileall\nimport contextlib\nimport csv\nimport importlib\nimport logging\nimport os.path\nimport re\nimport shutil\nimport sys\nimport warnings\nfrom base64 import urlsafe_b64encode\nfrom email.message import Message\nfrom itertools import chain, filterfalse, starmap\nfrom typing import (\n IO,\n Any,\n BinaryIO,\n Callable,\n Dict,\n Generator,\n Iterable,\n Iterator,\n List,\n NewType,\n Optional,\n Protocol,\n Sequence,\n Set,\n Tuple,\n Union,\n cast,\n)\nfrom zipfile import ZipFile, ZipInfo\n\nfrom pip._vendor.distlib.scripts import ScriptMaker\nfrom pip._vendor.distlib.util import get_export_entry\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.locations import get_major_minor_version\nfrom pip._internal.metadata import (\n BaseDistribution,\n FilesystemWheel,\n get_wheel_distribution,\n)\nfrom pip._internal.models.direct_url import DIRECT_URL_METADATA_NAME, DirectUrl\nfrom pip._internal.models.scheme import SCHEME_KEYS, Scheme\nfrom pip._internal.utils.filesystem import adjacent_tmp_file, replace\nfrom pip._internal.utils.misc import StreamWrapper, ensure_dir, hash_file, partition\nfrom pip._internal.utils.unpacking import (\n current_umask,\n is_within_directory,\n set_extracted_file_to_default_mode_plus_executable,\n zip_item_is_executable,\n)\nfrom pip._internal.utils.wheel import parse_wheel\n\n\nclass File(Protocol):\n src_record_path: \"RecordPath\"\n dest_path: str\n changed: bool\n\n def save(self) -> None:\n pass\n\n\nlogger = logging.getLogger(__name__)\n\nRecordPath = NewType(\"RecordPath\", str)\nInstalledCSVRow = Tuple[RecordPath, str, Union[int, str]]\n\n\ndef rehash(path: str, blocksize: int = 1 << 20) -> Tuple[str, str]:\n \"\"\"Return (encoded_digest, length) for path using hashlib.sha256()\"\"\"\n h, length = hash_file(path, blocksize)\n digest = \"sha256=\" + urlsafe_b64encode(h.digest()).decode(\"latin1\").rstrip(\"=\")\n return (digest, str(length))\n\n\ndef csv_io_kwargs(mode: str) -> Dict[str, Any]:\n \"\"\"Return keyword arguments to properly open a CSV file\n in the given mode.\n \"\"\"\n return {\"mode\": mode, \"newline\": \"\", \"encoding\": \"utf-8\"}\n\n\ndef fix_script(path: str) -> bool:\n \"\"\"Replace #!python with #!/path/to/python\n Return True if file was changed.\n \"\"\"\n # XXX RECORD hashes will need to be updated\n assert os.path.isfile(path)\n\n with open(path, \"rb\") as script:\n firstline = script.readline()\n if not firstline.startswith(b\"#!python\"):\n return False\n exename = sys.executable.encode(sys.getfilesystemencoding())\n firstline = b\"#!\" + exename + os.linesep.encode(\"ascii\")\n rest = script.read()\n with open(path, \"wb\") as script:\n script.write(firstline)\n script.write(rest)\n return True\n\n\ndef wheel_root_is_purelib(metadata: Message) -> bool:\n return metadata.get(\"Root-Is-Purelib\", \"\").lower() == \"true\"\n\n\ndef get_entrypoints(dist: BaseDistribution) -> Tuple[Dict[str, str], Dict[str, str]]:\n console_scripts = {}\n gui_scripts = {}\n for entry_point in dist.iter_entry_points():\n if entry_point.group == \"console_scripts\":\n console_scripts[entry_point.name] = entry_point.value\n elif entry_point.group == \"gui_scripts\":\n gui_scripts[entry_point.name] = entry_point.value\n return console_scripts, gui_scripts\n\n\ndef message_about_scripts_not_on_PATH(scripts: Sequence[str]) -> Optional[str]:\n \"\"\"Determine if any scripts are not on PATH and format a warning.\n Returns a warning message if one or more scripts are not on PATH,\n otherwise None.\n \"\"\"\n if not scripts:\n return None\n\n # Group scripts by the path they were installed in\n grouped_by_dir: Dict[str, Set[str]] = collections.defaultdict(set)\n for destfile in scripts:\n parent_dir = os.path.dirname(destfile)\n script_name = os.path.basename(destfile)\n grouped_by_dir[parent_dir].add(script_name)\n\n # We don't want to warn for directories that are on PATH.\n not_warn_dirs = [\n os.path.normcase(os.path.normpath(i)).rstrip(os.sep)\n for i in os.environ.get(\"PATH\", \"\").split(os.pathsep)\n ]\n # If an executable sits with sys.executable, we don't warn for it.\n # This covers the case of venv invocations without activating the venv.\n not_warn_dirs.append(\n os.path.normcase(os.path.normpath(os.path.dirname(sys.executable)))\n )\n warn_for: Dict[str, Set[str]] = {\n parent_dir: scripts\n for parent_dir, scripts in grouped_by_dir.items()\n if os.path.normcase(os.path.normpath(parent_dir)) not in not_warn_dirs\n }\n if not warn_for:\n return None\n\n # Format a message\n msg_lines = []\n for parent_dir, dir_scripts in warn_for.items():\n sorted_scripts: List[str] = sorted(dir_scripts)\n if len(sorted_scripts) == 1:\n start_text = f\"script {sorted_scripts[0]} is\"\n else:\n start_text = \"scripts {} are\".format(\n \", \".join(sorted_scripts[:-1]) + \" and \" + sorted_scripts[-1]\n )\n\n msg_lines.append(\n f\"The {start_text} installed in '{parent_dir}' which is not on PATH.\"\n )\n\n last_line_fmt = (\n \"Consider adding {} to PATH or, if you prefer \"\n \"to suppress this warning, use --no-warn-script-location.\"\n )\n if len(msg_lines) == 1:\n msg_lines.append(last_line_fmt.format(\"this directory\"))\n else:\n msg_lines.append(last_line_fmt.format(\"these directories\"))\n\n # Add a note if any directory starts with ~\n warn_for_tilde = any(\n i[0] == \"~\" for i in os.environ.get(\"PATH\", \"\").split(os.pathsep) if i\n )\n if warn_for_tilde:\n tilde_warning_msg = (\n \"NOTE: The current PATH contains path(s) starting with `~`, \"\n \"which may not be expanded by all applications.\"\n )\n msg_lines.append(tilde_warning_msg)\n\n # Returns the formatted multiline message\n return \"\\n\".join(msg_lines)\n\n\ndef _normalized_outrows(\n outrows: Iterable[InstalledCSVRow],\n) -> List[Tuple[str, str, str]]:\n \"\"\"Normalize the given rows of a RECORD file.\n\n Items in each row are converted into str. Rows are then sorted to make\n the value more predictable for tests.\n\n Each row is a 3-tuple (path, hash, size) and corresponds to a record of\n a RECORD file (see PEP 376 and PEP 427 for details). For the rows\n passed to this function, the size can be an integer as an int or string,\n or the empty string.\n \"\"\"\n # Normally, there should only be one row per path, in which case the\n # second and third elements don't come into play when sorting.\n # However, in cases in the wild where a path might happen to occur twice,\n # we don't want the sort operation to trigger an error (but still want\n # determinism). Since the third element can be an int or string, we\n # coerce each element to a string to avoid a TypeError in this case.\n # For additional background, see--\n # https://github.com/pypa/pip/issues/5868\n return sorted(\n (record_path, hash_, str(size)) for record_path, hash_, size in outrows\n )\n\n\ndef _record_to_fs_path(record_path: RecordPath, lib_dir: str) -> str:\n return os.path.join(lib_dir, record_path)\n\n\ndef _fs_to_record_path(path: str, lib_dir: str) -> RecordPath:\n # On Windows, do not handle relative paths if they belong to different\n # logical disks\n if os.path.splitdrive(path)[0].lower() == os.path.splitdrive(lib_dir)[0].lower():\n path = os.path.relpath(path, lib_dir)\n\n path = path.replace(os.path.sep, \"/\")\n return cast(\"RecordPath\", path)\n\n\ndef get_csv_rows_for_installed(\n old_csv_rows: List[List[str]],\n installed: Dict[RecordPath, RecordPath],\n changed: Set[RecordPath],\n generated: List[str],\n lib_dir: str,\n) -> List[InstalledCSVRow]:\n \"\"\"\n :param installed: A map from archive RECORD path to installation RECORD\n path.\n \"\"\"\n installed_rows: List[InstalledCSVRow] = []\n for row in old_csv_rows:\n if len(row) > 3:\n logger.warning(\"RECORD line has more than three elements: %s\", row)\n old_record_path = cast(\"RecordPath\", row[0])\n new_record_path = installed.pop(old_record_path, old_record_path)\n if new_record_path in changed:\n digest, length = rehash(_record_to_fs_path(new_record_path, lib_dir))\n else:\n digest = row[1] if len(row) > 1 else \"\"\n length = row[2] if len(row) > 2 else \"\"\n installed_rows.append((new_record_path, digest, length))\n for f in generated:\n path = _fs_to_record_path(f, lib_dir)\n digest, length = rehash(f)\n installed_rows.append((path, digest, length))\n return installed_rows + [\n (installed_record_path, \"\", \"\") for installed_record_path in installed.values()\n ]\n\n\ndef get_console_script_specs(console: Dict[str, str]) -> List[str]:\n \"\"\"\n Given the mapping from entrypoint name to callable, return the relevant\n console script specs.\n \"\"\"\n # Don't mutate caller's version\n console = console.copy()\n\n scripts_to_generate = []\n\n # Special case pip and setuptools to generate versioned wrappers\n #\n # The issue is that some projects (specifically, pip and setuptools) use\n # code in setup.py to create \"versioned\" entry points - pip2.7 on Python\n # 2.7, pip3.3 on Python 3.3, etc. But these entry points are baked into\n # the wheel metadata at build time, and so if the wheel is installed with\n # a *different* version of Python the entry points will be wrong. The\n # correct fix for this is to enhance the metadata to be able to describe\n # such versioned entry points.\n # Currently, projects using versioned entry points will either have\n # incorrect versioned entry points, or they will not be able to distribute\n # \"universal\" wheels (i.e., they will need a wheel per Python version).\n #\n # Because setuptools and pip are bundled with _ensurepip and virtualenv,\n # we need to use universal wheels. As a workaround, we\n # override the versioned entry points in the wheel and generate the\n # correct ones.\n #\n # To add the level of hack in this section of code, in order to support\n # ensurepip this code will look for an ``ENSUREPIP_OPTIONS`` environment\n # variable which will control which version scripts get installed.\n #\n # ENSUREPIP_OPTIONS=altinstall\n # - Only pipX.Y and easy_install-X.Y will be generated and installed\n # ENSUREPIP_OPTIONS=install\n # - pipX.Y, pipX, easy_install-X.Y will be generated and installed. Note\n # that this option is technically if ENSUREPIP_OPTIONS is set and is\n # not altinstall\n # DEFAULT\n # - The default behavior is to install pip, pipX, pipX.Y, easy_install\n # and easy_install-X.Y.\n pip_script = console.pop(\"pip\", None)\n if pip_script:\n if \"ENSUREPIP_OPTIONS\" not in os.environ:\n scripts_to_generate.append(\"pip = \" + pip_script)\n\n if os.environ.get(\"ENSUREPIP_OPTIONS\", \"\") != \"altinstall\":\n scripts_to_generate.append(f\"pip{sys.version_info[0]} = {pip_script}\")\n\n scripts_to_generate.append(f\"pip{get_major_minor_version()} = {pip_script}\")\n # Delete any other versioned pip entry points\n pip_ep = [k for k in console if re.match(r\"pip(\\d+(\\.\\d+)?)?$\", k)]\n for k in pip_ep:\n del console[k]\n easy_install_script = console.pop(\"easy_install\", None)\n if easy_install_script:\n if \"ENSUREPIP_OPTIONS\" not in os.environ:\n scripts_to_generate.append(\"easy_install = \" + easy_install_script)\n\n scripts_to_generate.append(\n f\"easy_install-{get_major_minor_version()} = {easy_install_script}\"\n )\n # Delete any other versioned easy_install entry points\n easy_install_ep = [\n k for k in console if re.match(r\"easy_install(-\\d+\\.\\d+)?$\", k)\n ]\n for k in easy_install_ep:\n del console[k]\n\n # Generate the console entry points specified in the wheel\n scripts_to_generate.extend(starmap(\"{} = {}\".format, console.items()))\n\n return scripts_to_generate\n\n\nclass ZipBackedFile:\n def __init__(\n self, src_record_path: RecordPath, dest_path: str, zip_file: ZipFile\n ) -> None:\n self.src_record_path = src_record_path\n self.dest_path = dest_path\n self._zip_file = zip_file\n self.changed = False\n\n def _getinfo(self) -> ZipInfo:\n return self._zip_file.getinfo(self.src_record_path)\n\n def save(self) -> None:\n # When we open the output file below, any existing file is truncated\n # before we start writing the new contents. This is fine in most\n # cases, but can cause a segfault if pip has loaded a shared\n # object (e.g. from pyopenssl through its vendored urllib3)\n # Since the shared object is mmap'd an attempt to call a\n # symbol in it will then cause a segfault. Unlinking the file\n # allows writing of new contents while allowing the process to\n # continue to use the old copy.\n if os.path.exists(self.dest_path):\n os.unlink(self.dest_path)\n\n zipinfo = self._getinfo()\n\n # optimization: the file is created by open(),\n # skip the decompression when there is 0 bytes to decompress.\n with open(self.dest_path, \"wb\") as dest:\n if zipinfo.file_size > 0:\n with self._zip_file.open(zipinfo) as f:\n blocksize = min(zipinfo.file_size, 1024 * 1024)\n shutil.copyfileobj(f, dest, blocksize)\n\n if zip_item_is_executable(zipinfo):\n set_extracted_file_to_default_mode_plus_executable(self.dest_path)\n\n\nclass ScriptFile:\n def __init__(self, file: \"File\") -> None:\n self._file = file\n self.src_record_path = self._file.src_record_path\n self.dest_path = self._file.dest_path\n self.changed = False\n\n def save(self) -> None:\n self._file.save()\n self.changed = fix_script(self.dest_path)\n\n\nclass MissingCallableSuffix(InstallationError):\n def __init__(self, entry_point: str) -> None:\n super().__init__(\n f\"Invalid script entry point: {entry_point} - A callable \"\n \"suffix is required. Cf https://packaging.python.org/\"\n \"specifications/entry-points/#use-for-scripts for more \"\n \"information.\"\n )\n\n\ndef _raise_for_invalid_entrypoint(specification: str) -> None:\n entry = get_export_entry(specification)\n if entry is not None and entry.suffix is None:\n raise MissingCallableSuffix(str(entry))\n\n\nclass PipScriptMaker(ScriptMaker):\n def make(\n self, specification: str, options: Optional[Dict[str, Any]] = None\n ) -> List[str]:\n _raise_for_invalid_entrypoint(specification)\n return super().make(specification, options)\n\n\ndef _install_wheel( # noqa: C901, PLR0915 function is too long\n name: str,\n wheel_zip: ZipFile,\n wheel_path: str,\n scheme: Scheme,\n pycompile: bool = True,\n warn_script_location: bool = True,\n direct_url: Optional[DirectUrl] = None,\n requested: bool = False,\n) -> None:\n \"\"\"Install a wheel.\n\n :param name: Name of the project to install\n :param wheel_zip: open ZipFile for wheel being installed\n :param scheme: Distutils scheme dictating the install directories\n :param req_description: String used in place of the requirement, for\n logging\n :param pycompile: Whether to byte-compile installed Python files\n :param warn_script_location: Whether to check that scripts are installed\n into a directory on PATH\n :raises UnsupportedWheel:\n * when the directory holds an unpacked wheel with incompatible\n Wheel-Version\n * when the .dist-info dir does not match the wheel\n \"\"\"\n info_dir, metadata = parse_wheel(wheel_zip, name)\n\n if wheel_root_is_purelib(metadata):\n lib_dir = scheme.purelib\n else:\n lib_dir = scheme.platlib\n\n # Record details of the files moved\n # installed = files copied from the wheel to the destination\n # changed = files changed while installing (scripts #! line typically)\n # generated = files newly generated during the install (script wrappers)\n installed: Dict[RecordPath, RecordPath] = {}\n changed: Set[RecordPath] = set()\n generated: List[str] = []\n\n def record_installed(\n srcfile: RecordPath, destfile: str, modified: bool = False\n ) -> None:\n \"\"\"Map archive RECORD paths to installation RECORD paths.\"\"\"\n newpath = _fs_to_record_path(destfile, lib_dir)\n installed[srcfile] = newpath\n if modified:\n changed.add(newpath)\n\n def is_dir_path(path: RecordPath) -> bool:\n return path.endswith(\"/\")\n\n def assert_no_path_traversal(dest_dir_path: str, target_path: str) -> None:\n if not is_within_directory(dest_dir_path, target_path):\n message = (\n \"The wheel {!r} has a file {!r} trying to install\"\n \" outside the target directory {!r}\"\n )\n raise InstallationError(\n message.format(wheel_path, target_path, dest_dir_path)\n )\n\n def root_scheme_file_maker(\n zip_file: ZipFile, dest: str\n ) -> Callable[[RecordPath], \"File\"]:\n def make_root_scheme_file(record_path: RecordPath) -> \"File\":\n normed_path = os.path.normpath(record_path)\n dest_path = os.path.join(dest, normed_path)\n assert_no_path_traversal(dest, dest_path)\n return ZipBackedFile(record_path, dest_path, zip_file)\n\n return make_root_scheme_file\n\n def data_scheme_file_maker(\n zip_file: ZipFile, scheme: Scheme\n ) -> Callable[[RecordPath], \"File\"]:\n scheme_paths = {key: getattr(scheme, key) for key in SCHEME_KEYS}\n\n def make_data_scheme_file(record_path: RecordPath) -> \"File\":\n normed_path = os.path.normpath(record_path)\n try:\n _, scheme_key, dest_subpath = normed_path.split(os.path.sep, 2)\n except ValueError:\n message = (\n f\"Unexpected file in {wheel_path}: {record_path!r}. .data directory\"\n \" contents should be named like: '/'.\"\n )\n raise InstallationError(message)\n\n try:\n scheme_path = scheme_paths[scheme_key]\n except KeyError:\n valid_scheme_keys = \", \".join(sorted(scheme_paths))\n message = (\n f\"Unknown scheme key used in {wheel_path}: {scheme_key} \"\n f\"(for file {record_path!r}). .data directory contents \"\n f\"should be in subdirectories named with a valid scheme \"\n f\"key ({valid_scheme_keys})\"\n )\n raise InstallationError(message)\n\n dest_path = os.path.join(scheme_path, dest_subpath)\n assert_no_path_traversal(scheme_path, dest_path)\n return ZipBackedFile(record_path, dest_path, zip_file)\n\n return make_data_scheme_file\n\n def is_data_scheme_path(path: RecordPath) -> bool:\n return path.split(\"/\", 1)[0].endswith(\".data\")\n\n paths = cast(List[RecordPath], wheel_zip.namelist())\n file_paths = filterfalse(is_dir_path, paths)\n root_scheme_paths, data_scheme_paths = partition(is_data_scheme_path, file_paths)\n\n make_root_scheme_file = root_scheme_file_maker(wheel_zip, lib_dir)\n files: Iterator[File] = map(make_root_scheme_file, root_scheme_paths)\n\n def is_script_scheme_path(path: RecordPath) -> bool:\n parts = path.split(\"/\", 2)\n return len(parts) > 2 and parts[0].endswith(\".data\") and parts[1] == \"scripts\"\n\n other_scheme_paths, script_scheme_paths = partition(\n is_script_scheme_path, data_scheme_paths\n )\n\n make_data_scheme_file = data_scheme_file_maker(wheel_zip, scheme)\n other_scheme_files = map(make_data_scheme_file, other_scheme_paths)\n files = chain(files, other_scheme_files)\n\n # Get the defined entry points\n distribution = get_wheel_distribution(\n FilesystemWheel(wheel_path),\n canonicalize_name(name),\n )\n console, gui = get_entrypoints(distribution)\n\n def is_entrypoint_wrapper(file: \"File\") -> bool:\n # EP, EP.exe and EP-script.py are scripts generated for\n # entry point EP by setuptools\n path = file.dest_path\n name = os.path.basename(path)\n if name.lower().endswith(\".exe\"):\n matchname = name[:-4]\n elif name.lower().endswith(\"-script.py\"):\n matchname = name[:-10]\n elif name.lower().endswith(\".pya\"):\n matchname = name[:-4]\n else:\n matchname = name\n # Ignore setuptools-generated scripts\n return matchname in console or matchname in gui\n\n script_scheme_files: Iterator[File] = map(\n make_data_scheme_file, script_scheme_paths\n )\n script_scheme_files = filterfalse(is_entrypoint_wrapper, script_scheme_files)\n script_scheme_files = map(ScriptFile, script_scheme_files)\n files = chain(files, script_scheme_files)\n\n existing_parents = set()\n for file in files:\n # directory creation is lazy and after file filtering\n # to ensure we don't install empty dirs; empty dirs can't be\n # uninstalled.\n parent_dir = os.path.dirname(file.dest_path)\n if parent_dir not in existing_parents:\n ensure_dir(parent_dir)\n existing_parents.add(parent_dir)\n file.save()\n record_installed(file.src_record_path, file.dest_path, file.changed)\n\n def pyc_source_file_paths() -> Generator[str, None, None]:\n # We de-duplicate installation paths, since there can be overlap (e.g.\n # file in .data maps to same location as file in wheel root).\n # Sorting installation paths makes it easier to reproduce and debug\n # issues related to permissions on existing files.\n for installed_path in sorted(set(installed.values())):\n full_installed_path = os.path.join(lib_dir, installed_path)\n if not os.path.isfile(full_installed_path):\n continue\n if not full_installed_path.endswith(\".py\"):\n continue\n yield full_installed_path\n\n def pyc_output_path(path: str) -> str:\n \"\"\"Return the path the pyc file would have been written to.\"\"\"\n return importlib.util.cache_from_source(path)\n\n # Compile all of the pyc files for the installed files\n if pycompile:\n with contextlib.redirect_stdout(\n StreamWrapper.from_stream(sys.stdout)\n ) as stdout:\n with warnings.catch_warnings():\n warnings.filterwarnings(\"ignore\")\n for path in pyc_source_file_paths():\n success = compileall.compile_file(path, force=True, quiet=True)\n if success:\n pyc_path = pyc_output_path(path)\n assert os.path.exists(pyc_path)\n pyc_record_path = cast(\n \"RecordPath\", pyc_path.replace(os.path.sep, \"/\")\n )\n record_installed(pyc_record_path, pyc_path)\n logger.debug(stdout.getvalue())\n\n maker = PipScriptMaker(None, scheme.scripts)\n\n # Ensure old scripts are overwritten.\n # See https://github.com/pypa/pip/issues/1800\n maker.clobber = True\n\n # Ensure we don't generate any variants for scripts because this is almost\n # never what somebody wants.\n # See https://bitbucket.org/pypa/distlib/issue/35/\n maker.variants = {\"\"}\n\n # This is required because otherwise distlib creates scripts that are not\n # executable.\n # See https://bitbucket.org/pypa/distlib/issue/32/\n maker.set_mode = True\n\n # Generate the console and GUI entry points specified in the wheel\n scripts_to_generate = get_console_script_specs(console)\n\n gui_scripts_to_generate = list(starmap(\"{} = {}\".format, gui.items()))\n\n generated_console_scripts = maker.make_multiple(scripts_to_generate)\n generated.extend(generated_console_scripts)\n\n generated.extend(maker.make_multiple(gui_scripts_to_generate, {\"gui\": True}))\n\n if warn_script_location:\n msg = message_about_scripts_not_on_PATH(generated_console_scripts)\n if msg is not None:\n logger.warning(msg)\n\n generated_file_mode = 0o666 & ~current_umask()\n\n @contextlib.contextmanager\n def _generate_file(path: str, **kwargs: Any) -> Generator[BinaryIO, None, None]:\n with adjacent_tmp_file(path, **kwargs) as f:\n yield f\n os.chmod(f.name, generated_file_mode)\n replace(f.name, path)\n\n dest_info_dir = os.path.join(lib_dir, info_dir)\n\n # Record pip as the installer\n installer_path = os.path.join(dest_info_dir, \"INSTALLER\")\n with _generate_file(installer_path) as installer_file:\n installer_file.write(b\"pip\\n\")\n generated.append(installer_path)\n\n # Record the PEP 610 direct URL reference\n if direct_url is not None:\n direct_url_path = os.path.join(dest_info_dir, DIRECT_URL_METADATA_NAME)\n with _generate_file(direct_url_path) as direct_url_file:\n direct_url_file.write(direct_url.to_json().encode(\"utf-8\"))\n generated.append(direct_url_path)\n\n # Record the REQUESTED file\n if requested:\n requested_path = os.path.join(dest_info_dir, \"REQUESTED\")\n with open(requested_path, \"wb\"):\n pass\n generated.append(requested_path)\n\n record_text = distribution.read_text(\"RECORD\")\n record_rows = list(csv.reader(record_text.splitlines()))\n\n rows = get_csv_rows_for_installed(\n record_rows,\n installed=installed,\n changed=changed,\n generated=generated,\n lib_dir=lib_dir,\n )\n\n # Record details of all files installed\n record_path = os.path.join(dest_info_dir, \"RECORD\")\n\n with _generate_file(record_path, **csv_io_kwargs(\"w\")) as record_file:\n # Explicitly cast to typing.IO[str] as a workaround for the mypy error:\n # \"writer\" has incompatible type \"BinaryIO\"; expected \"_Writer\"\n writer = csv.writer(cast(\"IO[str]\", record_file))\n writer.writerows(_normalized_outrows(rows))\n\n\n@contextlib.contextmanager\ndef req_error_context(req_description: str) -> Generator[None, None, None]:\n try:\n yield\n except InstallationError as e:\n message = f\"For req: {req_description}. {e.args[0]}\"\n raise InstallationError(message) from e\n\n\ndef install_wheel(\n name: str,\n wheel_path: str,\n scheme: Scheme,\n req_description: str,\n pycompile: bool = True,\n warn_script_location: bool = True,\n direct_url: Optional[DirectUrl] = None,\n requested: bool = False,\n) -> None:\n with ZipFile(wheel_path, allowZip64=True) as z:\n with req_error_context(req_description):\n _install_wheel(\n name=name,\n wheel_zip=z,\n wheel_path=wheel_path,\n scheme=scheme,\n pycompile=pycompile,\n warn_script_location=warn_script_location,\n direct_url=direct_url,\n requested=requested,\n )\n",[],[100,509,516,523,475,544,1273,1350,843],[100,509,516,523,475,544,1273,1350],{"_104":1382,"_96":699,"_158":1383,"_160":1274,"_161":139,"_162":1384,"_164":165,"_106":1385,"_101":29,"_167":215,"_169":1386,"_170":25,"_171":-5,"_172":1387,"_99":1388},"05cd5aea-67fc-11f0-928e-0224a6c84d84","05cd5ba8-67fc-11f0-928e-0224a6c84d84",196,["D",1753299257515],"\"\"\"Validation of dependencies of packages\"\"\"\n\nimport logging\nfrom contextlib import suppress\nfrom email.parser import Parser\nfrom functools import reduce\nfrom typing import (\n Callable,\n Dict,\n FrozenSet,\n Generator,\n Iterable,\n List,\n NamedTuple,\n Optional,\n Set,\n Tuple,\n)\n\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.packaging.tags import Tag, parse_tag\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.distributions import make_distribution_for_install_requirement\nfrom pip._internal.metadata import get_default_environment\nfrom pip._internal.metadata.base import BaseDistribution\nfrom pip._internal.req.req_install import InstallRequirement\n\nlogger = logging.getLogger(__name__)\n\n\nclass PackageDetails(NamedTuple):\n version: Version\n dependencies: List[Requirement]\n\n\n# Shorthands\nPackageSet = Dict[NormalizedName, PackageDetails]\nMissing = Tuple[NormalizedName, Requirement]\nConflicting = Tuple[NormalizedName, Version, Requirement]\n\nMissingDict = Dict[NormalizedName, List[Missing]]\nConflictingDict = Dict[NormalizedName, List[Conflicting]]\nCheckResult = Tuple[MissingDict, ConflictingDict]\nConflictDetails = Tuple[PackageSet, CheckResult]\n\n\ndef create_package_set_from_installed() -> Tuple[PackageSet, bool]:\n \"\"\"Converts a list of distributions into a PackageSet.\"\"\"\n package_set = {}\n problems = False\n env = get_default_environment()\n for dist in env.iter_installed_distributions(local_only=False, skip=()):\n name = dist.canonical_name\n try:\n dependencies = list(dist.iter_dependencies())\n package_set[name] = PackageDetails(dist.version, dependencies)\n except (OSError, ValueError) as e:\n # Don't crash on unreadable or broken metadata.\n logger.warning(\"Error parsing dependencies of %s: %s\", name, e)\n problems = True\n return package_set, problems\n\n\ndef check_package_set(\n package_set: PackageSet, should_ignore: Optional[Callable[[str], bool]] = None\n) -> CheckResult:\n \"\"\"Check if a package set is consistent\n\n If should_ignore is passed, it should be a callable that takes a\n package name and returns a boolean.\n \"\"\"\n\n missing = {}\n conflicting = {}\n\n for package_name, package_detail in package_set.items():\n # Info about dependencies of package_name\n missing_deps: Set[Missing] = set()\n conflicting_deps: Set[Conflicting] = set()\n\n if should_ignore and should_ignore(package_name):\n continue\n\n for req in package_detail.dependencies:\n name = canonicalize_name(req.name)\n\n # Check if it's missing\n if name not in package_set:\n missed = True\n if req.marker is not None:\n missed = req.marker.evaluate({\"extra\": \"\"})\n if missed:\n missing_deps.add((name, req))\n continue\n\n # Check if there's a conflict\n version = package_set[name].version\n if not req.specifier.contains(version, prereleases=True):\n conflicting_deps.add((name, version, req))\n\n if missing_deps:\n missing[package_name] = sorted(missing_deps, key=str)\n if conflicting_deps:\n conflicting[package_name] = sorted(conflicting_deps, key=str)\n\n return missing, conflicting\n\n\ndef check_install_conflicts(to_install: List[InstallRequirement]) -> ConflictDetails:\n \"\"\"For checking if the dependency graph would be consistent after \\\n installing given requirements\n \"\"\"\n # Start from the current state\n package_set, _ = create_package_set_from_installed()\n # Install packages\n would_be_installed = _simulate_installation_of(to_install, package_set)\n\n # Only warn about directly-dependent packages; create a whitelist of them\n whitelist = _create_whitelist(would_be_installed, package_set)\n\n return (\n package_set,\n check_package_set(\n package_set, should_ignore=lambda name: name not in whitelist\n ),\n )\n\n\ndef check_unsupported(\n packages: Iterable[BaseDistribution],\n supported_tags: Iterable[Tag],\n) -> Generator[BaseDistribution, None, None]:\n for p in packages:\n with suppress(FileNotFoundError):\n wheel_file = p.read_text(\"WHEEL\")\n wheel_tags: FrozenSet[Tag] = reduce(\n frozenset.union,\n map(parse_tag, Parser().parsestr(wheel_file).get_all(\"Tag\", [])),\n frozenset(),\n )\n if wheel_tags.isdisjoint(supported_tags):\n yield p\n\n\ndef _simulate_installation_of(\n to_install: List[InstallRequirement], package_set: PackageSet\n) -> Set[NormalizedName]:\n \"\"\"Computes the version of packages after installing to_install.\"\"\"\n # Keep track of packages that were installed\n installed = set()\n\n # Modify it as installing requirement_set would (assuming no errors)\n for inst_req in to_install:\n abstract_dist = make_distribution_for_install_requirement(inst_req)\n dist = abstract_dist.get_metadata_distribution()\n name = dist.canonical_name\n package_set[name] = PackageDetails(dist.version, list(dist.iter_dependencies()))\n\n installed.add(name)\n\n return installed\n\n\ndef _create_whitelist(\n would_be_installed: Set[NormalizedName], package_set: PackageSet\n) -> Set[NormalizedName]:\n packages_affected = set(would_be_installed)\n\n for package_name in package_set:\n if package_name in packages_affected:\n continue\n\n for req in package_set[package_name].dependencies:\n if canonicalize_name(req.name) in packages_affected:\n packages_affected.add(package_name)\n break\n\n return packages_affected\n",[],[100,509,516,523,475,544,1273,699],{"_104":1390,"_96":744,"_158":1391,"_160":1274,"_161":139,"_162":1392,"_164":165,"_106":1393,"_101":29,"_167":215,"_169":1394,"_170":25,"_171":-5,"_172":1395,"_99":1396},"05d43fa4-67fc-11f0-80ec-0224a6c84d84","05d44058-67fc-11f0-80ec-0224a6c84d84",197,["D",1753299257525],"import collections\nimport logging\nimport os\nfrom dataclasses import dataclass, field\nfrom typing import Container, Dict, Generator, Iterable, List, NamedTuple, Optional, Set\n\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import InvalidVersion\n\nfrom pip._internal.exceptions import BadCommand, InstallationError\nfrom pip._internal.metadata import BaseDistribution, get_environment\nfrom pip._internal.req.constructors import (\n install_req_from_editable,\n install_req_from_line,\n)\nfrom pip._internal.req.req_file import COMMENT_RE\nfrom pip._internal.utils.direct_url_helpers import direct_url_as_pep440_direct_reference\n\nlogger = logging.getLogger(__name__)\n\n\nclass _EditableInfo(NamedTuple):\n requirement: str\n comments: List[str]\n\n\ndef freeze(\n requirement: Optional[List[str]] = None,\n local_only: bool = False,\n user_only: bool = False,\n paths: Optional[List[str]] = None,\n isolated: bool = False,\n exclude_editable: bool = False,\n skip: Container[str] = (),\n) -> Generator[str, None, None]:\n installations: Dict[str, FrozenRequirement] = {}\n\n dists = get_environment(paths).iter_installed_distributions(\n local_only=local_only,\n skip=(),\n user_only=user_only,\n )\n for dist in dists:\n req = FrozenRequirement.from_dist(dist)\n if exclude_editable and req.editable:\n continue\n installations[req.canonical_name] = req\n\n if requirement:\n # the options that don't get turned into an InstallRequirement\n # should only be emitted once, even if the same option is in multiple\n # requirements files, so we need to keep track of what has been emitted\n # so that we don't emit it again if it's seen again\n emitted_options: Set[str] = set()\n # keep track of which files a requirement is in so that we can\n # give an accurate warning if a requirement appears multiple times.\n req_files: Dict[str, List[str]] = collections.defaultdict(list)\n for req_file_path in requirement:\n with open(req_file_path) as req_file:\n for line in req_file:\n if (\n not line.strip()\n or line.strip().startswith(\"#\")\n or line.startswith(\n (\n \"-r\",\n \"--requirement\",\n \"-f\",\n \"--find-links\",\n \"-i\",\n \"--index-url\",\n \"--pre\",\n \"--trusted-host\",\n \"--process-dependency-links\",\n \"--extra-index-url\",\n \"--use-feature\",\n )\n )\n ):\n line = line.rstrip()\n if line not in emitted_options:\n emitted_options.add(line)\n yield line\n continue\n\n if line.startswith(\"-e\") or line.startswith(\"--editable\"):\n if line.startswith(\"-e\"):\n line = line[2:].strip()\n else:\n line = line[len(\"--editable\") :].strip().lstrip(\"=\")\n line_req = install_req_from_editable(\n line,\n isolated=isolated,\n )\n else:\n line_req = install_req_from_line(\n COMMENT_RE.sub(\"\", line).strip(),\n isolated=isolated,\n )\n\n if not line_req.name:\n logger.info(\n \"Skipping line in requirement file [%s] because \"\n \"it's not clear what it would install: %s\",\n req_file_path,\n line.strip(),\n )\n logger.info(\n \" (add #egg=PackageName to the URL to avoid\"\n \" this warning)\"\n )\n else:\n line_req_canonical_name = canonicalize_name(line_req.name)\n if line_req_canonical_name not in installations:\n # either it's not installed, or it is installed\n # but has been processed already\n if not req_files[line_req.name]:\n logger.warning(\n \"Requirement file [%s] contains %s, but \"\n \"package %r is not installed\",\n req_file_path,\n COMMENT_RE.sub(\"\", line).strip(),\n line_req.name,\n )\n else:\n req_files[line_req.name].append(req_file_path)\n else:\n yield str(installations[line_req_canonical_name]).rstrip()\n del installations[line_req_canonical_name]\n req_files[line_req.name].append(req_file_path)\n\n # Warn about requirements that were included multiple times (in a\n # single requirements file or in different requirements files).\n for name, files in req_files.items():\n if len(files) > 1:\n logger.warning(\n \"Requirement %s included multiple times [%s]\",\n name,\n \", \".join(sorted(set(files))),\n )\n\n yield (\"## The following requirements were added by pip freeze:\")\n for installation in sorted(installations.values(), key=lambda x: x.name.lower()):\n if installation.canonical_name not in skip:\n yield str(installation).rstrip()\n\n\ndef _format_as_name_version(dist: BaseDistribution) -> str:\n try:\n dist_version = dist.version\n except InvalidVersion:\n # legacy version\n return f\"{dist.raw_name}==={dist.raw_version}\"\n else:\n return f\"{dist.raw_name}=={dist_version}\"\n\n\ndef _get_editable_info(dist: BaseDistribution) -> _EditableInfo:\n \"\"\"\n Compute and return values (req, comments) for use in\n FrozenRequirement.from_dist().\n \"\"\"\n editable_project_location = dist.editable_project_location\n assert editable_project_location\n location = os.path.normcase(os.path.abspath(editable_project_location))\n\n from pip._internal.vcs import RemoteNotFoundError, RemoteNotValidError, vcs\n\n vcs_backend = vcs.get_backend_for_dir(location)\n\n if vcs_backend is None:\n display = _format_as_name_version(dist)\n logger.debug(\n 'No VCS found for editable requirement \"%s\" in: %r',\n display,\n location,\n )\n return _EditableInfo(\n requirement=location,\n comments=[f\"# Editable install with no version control ({display})\"],\n )\n\n vcs_name = type(vcs_backend).__name__\n\n try:\n req = vcs_backend.get_src_requirement(location, dist.raw_name)\n except RemoteNotFoundError:\n display = _format_as_name_version(dist)\n return _EditableInfo(\n requirement=location,\n comments=[f\"# Editable {vcs_name} install with no remote ({display})\"],\n )\n except RemoteNotValidError as ex:\n display = _format_as_name_version(dist)\n return _EditableInfo(\n requirement=location,\n comments=[\n f\"# Editable {vcs_name} install ({display}) with either a deleted \"\n f\"local remote or invalid URI:\",\n f\"# '{ex.url}'\",\n ],\n )\n except BadCommand:\n logger.warning(\n \"cannot determine version of editable source in %s \"\n \"(%s command not found in path)\",\n location,\n vcs_backend.name,\n )\n return _EditableInfo(requirement=location, comments=[])\n except InstallationError as exc:\n logger.warning(\"Error when trying to get requirement for VCS system %s\", exc)\n else:\n return _EditableInfo(requirement=req, comments=[])\n\n logger.warning(\"Could not determine repository location of %s\", location)\n\n return _EditableInfo(\n requirement=location,\n comments=[\"## !! Could not determine repository location\"],\n )\n\n\n@dataclass(frozen=True)\nclass FrozenRequirement:\n name: str\n req: str\n editable: bool\n comments: Iterable[str] = field(default_factory=tuple)\n\n @property\n def canonical_name(self) -> NormalizedName:\n return canonicalize_name(self.name)\n\n @classmethod\n def from_dist(cls, dist: BaseDistribution) -> \"FrozenRequirement\":\n editable = dist.editable\n if editable:\n req, comments = _get_editable_info(dist)\n else:\n comments = []\n direct_url = dist.direct_url\n if direct_url:\n # if PEP 610 metadata is present, use it\n req = direct_url_as_pep440_direct_reference(direct_url, dist.raw_name)\n else:\n # name==version requirement\n req = _format_as_name_version(dist)\n\n return cls(dist.raw_name, req, editable, comments=comments)\n\n def __str__(self) -> str:\n req = self.req\n if self.editable:\n req = f\"-e {req}\"\n return \"\\n\".join(list(self.comments) + [str(req)]) + \"\\n\"\n",[],[100,509,516,523,475,544,1273,744],{"_104":1398,"_96":1399,"_158":1400,"_160":1274,"_161":139,"_162":1401,"_164":165,"_106":1402,"_101":29,"_167":215,"_169":1403,"_170":25,"_171":-5,"_172":1404,"_99":1405},"06058e74-67fc-11f0-928e-0224a6c84d84","prepare.py","06058f46-67fc-11f0-928e-0224a6c84d84",206,["D",1753299257883],"\"\"\"Prepares a distribution for installation\"\"\"\n\n# The following comment should be removed at some point in the future.\n# mypy: strict-optional=False\n\nimport mimetypes\nimport os\nimport shutil\nfrom dataclasses import dataclass\nfrom pathlib import Path\nfrom typing import Dict, Iterable, List, Optional\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.distributions import make_distribution_for_install_requirement\nfrom pip._internal.distributions.installed import InstalledDistribution\nfrom pip._internal.exceptions import (\n DirectoryUrlHashUnsupported,\n HashMismatch,\n HashUnpinned,\n InstallationError,\n MetadataInconsistent,\n NetworkConnectionError,\n VcsHashUnsupported,\n)\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.metadata import BaseDistribution, get_metadata_distribution\nfrom pip._internal.models.direct_url import ArchiveInfo\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.network.download import BatchDownloader, Downloader\nfrom pip._internal.network.lazy_wheel import (\n HTTPRangeRequestUnsupported,\n dist_from_wheel_url,\n)\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.operations.build.build_tracker import BuildTracker\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils._log import getLogger\nfrom pip._internal.utils.direct_url_helpers import (\n direct_url_for_editable,\n direct_url_from_link,\n)\nfrom pip._internal.utils.hashes import Hashes, MissingHashes\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import (\n display_path,\n hash_file,\n hide_url,\n redact_auth_from_requirement,\n)\nfrom pip._internal.utils.temp_dir import TempDirectory\nfrom pip._internal.utils.unpacking import unpack_file\nfrom pip._internal.vcs import vcs\n\nlogger = getLogger(__name__)\n\n\ndef _get_prepared_distribution(\n req: InstallRequirement,\n build_tracker: BuildTracker,\n finder: PackageFinder,\n build_isolation: bool,\n check_build_deps: bool,\n) -> BaseDistribution:\n \"\"\"Prepare a distribution for installation.\"\"\"\n abstract_dist = make_distribution_for_install_requirement(req)\n tracker_id = abstract_dist.build_tracker_id\n if tracker_id is not None:\n with build_tracker.track(req, tracker_id):\n abstract_dist.prepare_distribution_metadata(\n finder, build_isolation, check_build_deps\n )\n return abstract_dist.get_metadata_distribution()\n\n\ndef unpack_vcs_link(link: Link, location: str, verbosity: int) -> None:\n vcs_backend = vcs.get_backend_for_scheme(link.scheme)\n assert vcs_backend is not None\n vcs_backend.unpack(location, url=hide_url(link.url), verbosity=verbosity)\n\n\n@dataclass\nclass File:\n path: str\n content_type: Optional[str] = None\n\n def __post_init__(self) -> None:\n if self.content_type is None:\n # Try to guess the file's MIME type. If the system MIME tables\n # can't be loaded, give up.\n try:\n self.content_type = mimetypes.guess_type(self.path)[0]\n except OSError:\n pass\n\n\ndef get_http_url(\n link: Link,\n download: Downloader,\n download_dir: Optional[str] = None,\n hashes: Optional[Hashes] = None,\n) -> File:\n temp_dir = TempDirectory(kind=\"unpack\", globally_managed=True)\n # If a download dir is specified, is the file already downloaded there?\n already_downloaded_path = None\n if download_dir:\n already_downloaded_path = _check_download_dir(link, download_dir, hashes)\n\n if already_downloaded_path:\n from_path = already_downloaded_path\n content_type = None\n else:\n # let's download to a tmp dir\n from_path, content_type = download(link, temp_dir.path)\n if hashes:\n hashes.check_against_path(from_path)\n\n return File(from_path, content_type)\n\n\ndef get_file_url(\n link: Link, download_dir: Optional[str] = None, hashes: Optional[Hashes] = None\n) -> File:\n \"\"\"Get file and optionally check its hash.\"\"\"\n # If a download dir is specified, is the file already there and valid?\n already_downloaded_path = None\n if download_dir:\n already_downloaded_path = _check_download_dir(link, download_dir, hashes)\n\n if already_downloaded_path:\n from_path = already_downloaded_path\n else:\n from_path = link.file_path\n\n # If --require-hashes is off, `hashes` is either empty, the\n # link's embedded hash, or MissingHashes; it is required to\n # match. If --require-hashes is on, we are satisfied by any\n # hash in `hashes` matching: a URL-based or an option-based\n # one; no internet-sourced hash will be in `hashes`.\n if hashes:\n hashes.check_against_path(from_path)\n return File(from_path, None)\n\n\ndef unpack_url(\n link: Link,\n location: str,\n download: Downloader,\n verbosity: int,\n download_dir: Optional[str] = None,\n hashes: Optional[Hashes] = None,\n) -> Optional[File]:\n \"\"\"Unpack link into location, downloading if required.\n\n :param hashes: A Hashes object, one of whose embedded hashes must match,\n or HashMismatch will be raised. If the Hashes is empty, no matches are\n required, and unhashable types of requirements (like VCS ones, which\n would ordinarily raise HashUnsupported) are allowed.\n \"\"\"\n # non-editable vcs urls\n if link.is_vcs:\n unpack_vcs_link(link, location, verbosity=verbosity)\n return None\n\n assert not link.is_existing_dir()\n\n # file urls\n if link.is_file:\n file = get_file_url(link, download_dir, hashes=hashes)\n\n # http urls\n else:\n file = get_http_url(\n link,\n download,\n download_dir,\n hashes=hashes,\n )\n\n # unpack the archive to the build dir location. even when only downloading\n # archives, they have to be unpacked to parse dependencies, except wheels\n if not link.is_wheel:\n unpack_file(file.path, location, file.content_type)\n\n return file\n\n\ndef _check_download_dir(\n link: Link,\n download_dir: str,\n hashes: Optional[Hashes],\n warn_on_hash_mismatch: bool = True,\n) -> Optional[str]:\n \"\"\"Check download_dir for previously downloaded file with correct hash\n If a correct file is found return its path else None\n \"\"\"\n download_path = os.path.join(download_dir, link.filename)\n\n if not os.path.exists(download_path):\n return None\n\n # If already downloaded, does its hash match?\n logger.info(\"File was already downloaded %s\", download_path)\n if hashes:\n try:\n hashes.check_against_path(download_path)\n except HashMismatch:\n if warn_on_hash_mismatch:\n logger.warning(\n \"Previously-downloaded file %s has bad hash. Re-downloading.\",\n download_path,\n )\n os.unlink(download_path)\n return None\n return download_path\n\n\nclass RequirementPreparer:\n \"\"\"Prepares a Requirement\"\"\"\n\n def __init__(\n self,\n build_dir: str,\n download_dir: Optional[str],\n src_dir: str,\n build_isolation: bool,\n check_build_deps: bool,\n build_tracker: BuildTracker,\n session: PipSession,\n progress_bar: str,\n finder: PackageFinder,\n require_hashes: bool,\n use_user_site: bool,\n lazy_wheel: bool,\n verbosity: int,\n legacy_resolver: bool,\n resume_retries: int,\n ) -> None:\n super().__init__()\n\n self.src_dir = src_dir\n self.build_dir = build_dir\n self.build_tracker = build_tracker\n self._session = session\n self._download = Downloader(session, progress_bar, resume_retries)\n self._batch_download = BatchDownloader(session, progress_bar, resume_retries)\n self.finder = finder\n\n # Where still-packed archives should be written to. If None, they are\n # not saved, and are deleted immediately after unpacking.\n self.download_dir = download_dir\n\n # Is build isolation allowed?\n self.build_isolation = build_isolation\n\n # Should check build dependencies?\n self.check_build_deps = check_build_deps\n\n # Should hash-checking be required?\n self.require_hashes = require_hashes\n\n # Should install in user site-packages?\n self.use_user_site = use_user_site\n\n # Should wheels be downloaded lazily?\n self.use_lazy_wheel = lazy_wheel\n\n # How verbose should underlying tooling be?\n self.verbosity = verbosity\n\n # Are we using the legacy resolver?\n self.legacy_resolver = legacy_resolver\n\n # Memoized downloaded files, as mapping of url: path.\n self._downloaded: Dict[str, str] = {}\n\n # Previous \"header\" printed for a link-based InstallRequirement\n self._previous_requirement_header = (\"\", \"\")\n\n def _log_preparing_link(self, req: InstallRequirement) -> None:\n \"\"\"Provide context for the requirement being prepared.\"\"\"\n if req.link.is_file and not req.is_wheel_from_cache:\n message = \"Processing %s\"\n information = str(display_path(req.link.file_path))\n else:\n message = \"Collecting %s\"\n information = redact_auth_from_requirement(req.req) if req.req else str(req)\n\n # If we used req.req, inject requirement source if available (this\n # would already be included if we used req directly)\n if req.req and req.comes_from:\n if isinstance(req.comes_from, str):\n comes_from: Optional[str] = req.comes_from\n else:\n comes_from = req.comes_from.from_path()\n if comes_from:\n information += f\" (from {comes_from})\"\n\n if (message, information) != self._previous_requirement_header:\n self._previous_requirement_header = (message, information)\n logger.info(message, information)\n\n if req.is_wheel_from_cache:\n with indent_log():\n logger.info(\"Using cached %s\", req.link.filename)\n\n def _ensure_link_req_src_dir(\n self, req: InstallRequirement, parallel_builds: bool\n ) -> None:\n \"\"\"Ensure source_dir of a linked InstallRequirement.\"\"\"\n # Since source_dir is only set for editable requirements.\n if req.link.is_wheel:\n # We don't need to unpack wheels, so no need for a source\n # directory.\n return\n assert req.source_dir is None\n if req.link.is_existing_dir():\n # build local directories in-tree\n req.source_dir = req.link.file_path\n return\n\n # We always delete unpacked sdists after pip runs.\n req.ensure_has_source_dir(\n self.build_dir,\n autodelete=True,\n parallel_builds=parallel_builds,\n )\n req.ensure_pristine_source_checkout()\n\n def _get_linked_req_hashes(self, req: InstallRequirement) -> Hashes:\n # By the time this is called, the requirement's link should have\n # been checked so we can tell what kind of requirements req is\n # and raise some more informative errors than otherwise.\n # (For example, we can raise VcsHashUnsupported for a VCS URL\n # rather than HashMissing.)\n if not self.require_hashes:\n return req.hashes(trust_internet=True)\n\n # We could check these first 2 conditions inside unpack_url\n # and save repetition of conditions, but then we would\n # report less-useful error messages for unhashable\n # requirements, complaining that there's no hash provided.\n if req.link.is_vcs:\n raise VcsHashUnsupported()\n if req.link.is_existing_dir():\n raise DirectoryUrlHashUnsupported()\n\n # Unpinned packages are asking for trouble when a new version\n # is uploaded. This isn't a security check, but it saves users\n # a surprising hash mismatch in the future.\n # file:/// URLs aren't pinnable, so don't complain about them\n # not being pinned.\n if not req.is_direct and not req.is_pinned:\n raise HashUnpinned()\n\n # If known-good hashes are missing for this requirement,\n # shim it with a facade object that will provoke hash\n # computation and then raise a HashMissing exception\n # showing the user what the hash should be.\n return req.hashes(trust_internet=False) or MissingHashes()\n\n def _fetch_metadata_only(\n self,\n req: InstallRequirement,\n ) -> Optional[BaseDistribution]:\n if self.legacy_resolver:\n logger.debug(\n \"Metadata-only fetching is not used in the legacy resolver\",\n )\n return None\n if self.require_hashes:\n logger.debug(\n \"Metadata-only fetching is not used as hash checking is required\",\n )\n return None\n # Try PEP 658 metadata first, then fall back to lazy wheel if unavailable.\n return self._fetch_metadata_using_link_data_attr(\n req\n ) or self._fetch_metadata_using_lazy_wheel(req.link)\n\n def _fetch_metadata_using_link_data_attr(\n self,\n req: InstallRequirement,\n ) -> Optional[BaseDistribution]:\n \"\"\"Fetch metadata from the data-dist-info-metadata attribute, if possible.\"\"\"\n # (1) Get the link to the metadata file, if provided by the backend.\n metadata_link = req.link.metadata_link()\n if metadata_link is None:\n return None\n assert req.req is not None\n logger.verbose(\n \"Obtaining dependency information for %s from %s\",\n req.req,\n metadata_link,\n )\n # (2) Download the contents of the METADATA file, separate from the dist itself.\n metadata_file = get_http_url(\n metadata_link,\n self._download,\n hashes=metadata_link.as_hashes(),\n )\n with open(metadata_file.path, \"rb\") as f:\n metadata_contents = f.read()\n # (3) Generate a dist just from those file contents.\n metadata_dist = get_metadata_distribution(\n metadata_contents,\n req.link.filename,\n req.req.name,\n )\n # (4) Ensure the Name: field from the METADATA file matches the name from the\n # install requirement.\n #\n # NB: raw_name will fall back to the name from the install requirement if\n # the Name: field is not present, but it's noted in the raw_name docstring\n # that that should NEVER happen anyway.\n if canonicalize_name(metadata_dist.raw_name) != canonicalize_name(req.req.name):\n raise MetadataInconsistent(\n req, \"Name\", req.req.name, metadata_dist.raw_name\n )\n return metadata_dist\n\n def _fetch_metadata_using_lazy_wheel(\n self,\n link: Link,\n ) -> Optional[BaseDistribution]:\n \"\"\"Fetch metadata using lazy wheel, if possible.\"\"\"\n # --use-feature=fast-deps must be provided.\n if not self.use_lazy_wheel:\n return None\n if link.is_file or not link.is_wheel:\n logger.debug(\n \"Lazy wheel is not used as %r does not point to a remote wheel\",\n link,\n )\n return None\n\n wheel = Wheel(link.filename)\n name = canonicalize_name(wheel.name)\n logger.info(\n \"Obtaining dependency information from %s %s\",\n name,\n wheel.version,\n )\n url = link.url.split(\"#\", 1)[0]\n try:\n return dist_from_wheel_url(name, url, self._session)\n except HTTPRangeRequestUnsupported:\n logger.debug(\"%s does not support range requests\", url)\n return None\n\n def _complete_partial_requirements(\n self,\n partially_downloaded_reqs: Iterable[InstallRequirement],\n parallel_builds: bool = False,\n ) -> None:\n \"\"\"Download any requirements which were only fetched by metadata.\"\"\"\n # Download to a temporary directory. These will be copied over as\n # needed for downstream 'download', 'wheel', and 'install' commands.\n temp_dir = TempDirectory(kind=\"unpack\", globally_managed=True).path\n\n # Map each link to the requirement that owns it. This allows us to set\n # `req.local_file_path` on the appropriate requirement after passing\n # all the links at once into BatchDownloader.\n links_to_fully_download: Dict[Link, InstallRequirement] = {}\n for req in partially_downloaded_reqs:\n assert req.link\n links_to_fully_download[req.link] = req\n\n batch_download = self._batch_download(\n links_to_fully_download.keys(),\n temp_dir,\n )\n for link, (filepath, _) in batch_download:\n logger.debug(\"Downloading link %s to %s\", link, filepath)\n req = links_to_fully_download[link]\n # Record the downloaded file path so wheel reqs can extract a Distribution\n # in .get_dist().\n req.local_file_path = filepath\n # Record that the file is downloaded so we don't do it again in\n # _prepare_linked_requirement().\n self._downloaded[req.link.url] = filepath\n\n # If this is an sdist, we need to unpack it after downloading, but the\n # .source_dir won't be set up until we are in _prepare_linked_requirement().\n # Add the downloaded archive to the install requirement to unpack after\n # preparing the source dir.\n if not req.is_wheel:\n req.needs_unpacked_archive(Path(filepath))\n\n # This step is necessary to ensure all lazy wheels are processed\n # successfully by the 'download', 'wheel', and 'install' commands.\n for req in partially_downloaded_reqs:\n self._prepare_linked_requirement(req, parallel_builds)\n\n def prepare_linked_requirement(\n self, req: InstallRequirement, parallel_builds: bool = False\n ) -> BaseDistribution:\n \"\"\"Prepare a requirement to be obtained from req.link.\"\"\"\n assert req.link\n self._log_preparing_link(req)\n with indent_log():\n # Check if the relevant file is already available\n # in the download directory\n file_path = None\n if self.download_dir is not None and req.link.is_wheel:\n hashes = self._get_linked_req_hashes(req)\n file_path = _check_download_dir(\n req.link,\n self.download_dir,\n hashes,\n # When a locally built wheel has been found in cache, we don't warn\n # about re-downloading when the already downloaded wheel hash does\n # not match. This is because the hash must be checked against the\n # original link, not the cached link. It that case the already\n # downloaded file will be removed and re-fetched from cache (which\n # implies a hash check against the cache entry's origin.json).\n warn_on_hash_mismatch=not req.is_wheel_from_cache,\n )\n\n if file_path is not None:\n # The file is already available, so mark it as downloaded\n self._downloaded[req.link.url] = file_path\n else:\n # The file is not available, attempt to fetch only metadata\n metadata_dist = self._fetch_metadata_only(req)\n if metadata_dist is not None:\n req.needs_more_preparation = True\n return metadata_dist\n\n # None of the optimizations worked, fully prepare the requirement\n return self._prepare_linked_requirement(req, parallel_builds)\n\n def prepare_linked_requirements_more(\n self, reqs: Iterable[InstallRequirement], parallel_builds: bool = False\n ) -> None:\n \"\"\"Prepare linked requirements more, if needed.\"\"\"\n reqs = [req for req in reqs if req.needs_more_preparation]\n for req in reqs:\n # Determine if any of these requirements were already downloaded.\n if self.download_dir is not None and req.link.is_wheel:\n hashes = self._get_linked_req_hashes(req)\n file_path = _check_download_dir(req.link, self.download_dir, hashes)\n if file_path is not None:\n self._downloaded[req.link.url] = file_path\n req.needs_more_preparation = False\n\n # Prepare requirements we found were already downloaded for some\n # reason. The other downloads will be completed separately.\n partially_downloaded_reqs: List[InstallRequirement] = []\n for req in reqs:\n if req.needs_more_preparation:\n partially_downloaded_reqs.append(req)\n else:\n self._prepare_linked_requirement(req, parallel_builds)\n\n # TODO: separate this part out from RequirementPreparer when the v1\n # resolver can be removed!\n self._complete_partial_requirements(\n partially_downloaded_reqs,\n parallel_builds=parallel_builds,\n )\n\n def _prepare_linked_requirement(\n self, req: InstallRequirement, parallel_builds: bool\n ) -> BaseDistribution:\n assert req.link\n link = req.link\n\n hashes = self._get_linked_req_hashes(req)\n\n if hashes and req.is_wheel_from_cache:\n assert req.download_info is not None\n assert link.is_wheel\n assert link.is_file\n # We need to verify hashes, and we have found the requirement in the cache\n # of locally built wheels.\n if (\n isinstance(req.download_info.info, ArchiveInfo)\n and req.download_info.info.hashes\n and hashes.has_one_of(req.download_info.info.hashes)\n ):\n # At this point we know the requirement was built from a hashable source\n # artifact, and we verified that the cache entry's hash of the original\n # artifact matches one of the hashes we expect. We don't verify hashes\n # against the cached wheel, because the wheel is not the original.\n hashes = None\n else:\n logger.warning(\n \"The hashes of the source archive found in cache entry \"\n \"don't match, ignoring cached built wheel \"\n \"and re-downloading source.\"\n )\n req.link = req.cached_wheel_source_link\n link = req.link\n\n self._ensure_link_req_src_dir(req, parallel_builds)\n\n if link.is_existing_dir():\n local_file = None\n elif link.url not in self._downloaded:\n try:\n local_file = unpack_url(\n link,\n req.source_dir,\n self._download,\n self.verbosity,\n self.download_dir,\n hashes,\n )\n except NetworkConnectionError as exc:\n raise InstallationError(\n f\"Could not install requirement {req} because of HTTP \"\n f\"error {exc} for URL {link}\"\n )\n else:\n file_path = self._downloaded[link.url]\n if hashes:\n hashes.check_against_path(file_path)\n local_file = File(file_path, content_type=None)\n\n # If download_info is set, we got it from the wheel cache.\n if req.download_info is None:\n # Editables don't go through this function (see\n # prepare_editable_requirement).\n assert not req.editable\n req.download_info = direct_url_from_link(link, req.source_dir)\n # Make sure we have a hash in download_info. If we got it as part of the\n # URL, it will have been verified and we can rely on it. Otherwise we\n # compute it from the downloaded file.\n # FIXME: https://github.com/pypa/pip/issues/11943\n if (\n isinstance(req.download_info.info, ArchiveInfo)\n and not req.download_info.info.hashes\n and local_file\n ):\n hash = hash_file(local_file.path)[0].hexdigest()\n # We populate info.hash for backward compatibility.\n # This will automatically populate info.hashes.\n req.download_info.info.hash = f\"sha256={hash}\"\n\n # For use in later processing,\n # preserve the file path on the requirement.\n if local_file:\n req.local_file_path = local_file.path\n\n dist = _get_prepared_distribution(\n req,\n self.build_tracker,\n self.finder,\n self.build_isolation,\n self.check_build_deps,\n )\n return dist\n\n def save_linked_requirement(self, req: InstallRequirement) -> None:\n assert self.download_dir is not None\n assert req.link is not None\n link = req.link\n if link.is_vcs or (link.is_existing_dir() and req.editable):\n # Make a .zip of the source_dir we already created.\n req.archive(self.download_dir)\n return\n\n if link.is_existing_dir():\n logger.debug(\n \"Not copying link to destination directory \"\n \"since it is a directory: %s\",\n link,\n )\n return\n if req.local_file_path is None:\n # No distribution was downloaded for this requirement.\n return\n\n download_location = os.path.join(self.download_dir, link.filename)\n if not os.path.exists(download_location):\n shutil.copy(req.local_file_path, download_location)\n download_path = display_path(download_location)\n logger.info(\"Saved %s\", download_path)\n\n def prepare_editable_requirement(\n self,\n req: InstallRequirement,\n ) -> BaseDistribution:\n \"\"\"Prepare an editable requirement.\"\"\"\n assert req.editable, \"cannot prepare a non-editable req as editable\"\n\n logger.info(\"Obtaining %s\", req)\n\n with indent_log():\n if self.require_hashes:\n raise InstallationError(\n f\"The editable requirement {req} cannot be installed when \"\n \"requiring hashes, because there is no single file to \"\n \"hash.\"\n )\n req.ensure_has_source_dir(self.src_dir)\n req.update_editable()\n assert req.source_dir\n req.download_info = direct_url_for_editable(req.unpacked_source_directory)\n\n dist = _get_prepared_distribution(\n req,\n self.build_tracker,\n self.finder,\n self.build_isolation,\n self.check_build_deps,\n )\n\n req.check_if_exists(self.use_user_site)\n\n return dist\n\n def prepare_installed_requirement(\n self,\n req: InstallRequirement,\n skip_reason: str,\n ) -> BaseDistribution:\n \"\"\"Prepare an already-installed requirement.\"\"\"\n assert req.satisfied_by, \"req should have been satisfied but isn't\"\n assert skip_reason is not None, (\n \"did not get skip reason skipped but req.satisfied_by \"\n f\"is set to {req.satisfied_by}\"\n )\n logger.info(\n \"Requirement %s: %s (%s)\", skip_reason, req, req.satisfied_by.version\n )\n with indent_log():\n if self.require_hashes:\n logger.debug(\n \"Since it is already installed, we are trusting this \"\n \"package without checking its hash. To ensure a \"\n \"completely repeatable environment, install into an \"\n \"empty virtualenv.\"\n )\n return InstalledDistribution(req).get_metadata_distribution()\n",[],[100,509,516,523,475,544,1273,1399],[100,509,516,523,475,544,1273],{"_104":1408,"_96":1409,"_158":1410,"_160":545,"_161":139,"_162":1411,"_164":165,"_106":1412,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1413,"_99":1476},"fc9ecf6c-67fb-11f0-aedf-0224a6c84d84","req","fc9ed002-67fb-11f0-aedf-0224a6c84d84",62,["D",1753299242113],[1414,1422,1431,1440,1449,1458,1467],{"_104":1415,"_96":558,"_158":1416,"_160":1410,"_161":139,"_162":1417,"_164":165,"_106":1418,"_101":29,"_167":215,"_169":1419,"_170":25,"_171":-5,"_172":1420,"_99":1421},"061eba16-67fc-11f0-9ad5-0224a6c84d84","061ebb06-67fc-11f0-9ad5-0224a6c84d84",210,["D",1753299258037],"import collections\nimport logging\nfrom dataclasses import dataclass\nfrom typing import Generator, List, Optional, Sequence, Tuple\n\nfrom pip._internal.cli.progress_bars import get_install_progress_renderer\nfrom pip._internal.utils.logging import indent_log\n\nfrom .req_file import parse_requirements\nfrom .req_install import InstallRequirement\nfrom .req_set import RequirementSet\n\n__all__ = [\n \"RequirementSet\",\n \"InstallRequirement\",\n \"parse_requirements\",\n \"install_given_reqs\",\n]\n\nlogger = logging.getLogger(__name__)\n\n\n@dataclass(frozen=True)\nclass InstallationResult:\n name: str\n\n\ndef _validate_requirements(\n requirements: List[InstallRequirement],\n) -> Generator[Tuple[str, InstallRequirement], None, None]:\n for req in requirements:\n assert req.name, f\"invalid to-be-installed requirement: {req}\"\n yield req.name, req\n\n\ndef install_given_reqs(\n requirements: List[InstallRequirement],\n global_options: Sequence[str],\n root: Optional[str],\n home: Optional[str],\n prefix: Optional[str],\n warn_script_location: bool,\n use_user_site: bool,\n pycompile: bool,\n progress_bar: str,\n) -> List[InstallationResult]:\n \"\"\"\n Install everything in the given list.\n\n (to be called after having downloaded and unpacked the packages)\n \"\"\"\n to_install = collections.OrderedDict(_validate_requirements(requirements))\n\n if to_install:\n logger.info(\n \"Installing collected packages: %s\",\n \", \".join(to_install.keys()),\n )\n\n installed = []\n\n show_progress = logger.isEnabledFor(logging.INFO) and len(to_install) > 1\n\n items = iter(to_install.values())\n if show_progress:\n renderer = get_install_progress_renderer(\n bar_type=progress_bar, total=len(to_install)\n )\n items = renderer(items)\n\n with indent_log():\n for requirement in items:\n req_name = requirement.name\n assert req_name is not None\n if requirement.should_reinstall:\n logger.info(\"Attempting uninstall: %s\", req_name)\n with indent_log():\n uninstalled_pathset = requirement.uninstall(auto_confirm=True)\n else:\n uninstalled_pathset = None\n\n try:\n requirement.install(\n global_options,\n root=root,\n home=home,\n prefix=prefix,\n warn_script_location=warn_script_location,\n use_user_site=use_user_site,\n pycompile=pycompile,\n )\n except Exception:\n # if install did not succeed, rollback previous uninstall\n if uninstalled_pathset and not requirement.install_succeeded:\n uninstalled_pathset.rollback()\n raise\n else:\n if uninstalled_pathset and requirement.install_succeeded:\n uninstalled_pathset.commit()\n\n installed.append(InstallationResult(req_name))\n\n return installed\n",[],[100,509,516,523,475,544,1409,558],{"_104":1423,"_96":1424,"_158":1425,"_160":1410,"_161":139,"_162":1426,"_164":165,"_106":1427,"_101":29,"_167":215,"_169":1428,"_170":25,"_171":-5,"_172":1429,"_99":1430},"0630c698-67fc-11f0-bf1a-0224a6c84d84","constructors.py","0630c774-67fc-11f0-bf1a-0224a6c84d84",213,["D",1753299258170],"\"\"\"Backing implementation for InstallRequirement's various constructors\n\nThe idea here is that these formed a major chunk of InstallRequirement's size\nso, moving them and support code dedicated to them outside of that class\nhelps creates for better understandability for the rest of the code.\n\nThese are meant to be used elsewhere within pip to create instances of\nInstallRequirement.\n\"\"\"\n\nimport copy\nimport logging\nimport os\nimport re\nfrom dataclasses import dataclass\nfrom typing import Collection, Dict, List, Optional, Set, Tuple, Union\n\nfrom pip._vendor.packaging.markers import Marker\nfrom pip._vendor.packaging.requirements import InvalidRequirement, Requirement\nfrom pip._vendor.packaging.specifiers import Specifier\n\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.models.index import PyPI, TestPyPI\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.req.req_file import ParsedRequirement\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.filetypes import is_archive_file\nfrom pip._internal.utils.misc import is_installable_dir\nfrom pip._internal.utils.packaging import get_requirement\nfrom pip._internal.utils.urls import path_to_url\nfrom pip._internal.vcs import is_url, vcs\n\n__all__ = [\n \"install_req_from_editable\",\n \"install_req_from_line\",\n \"parse_editable\",\n]\n\nlogger = logging.getLogger(__name__)\noperators = Specifier._operators.keys()\n\n\ndef _strip_extras(path: str) -> Tuple[str, Optional[str]]:\n m = re.match(r\"^(.+)(\\[[^\\]]+\\])$\", path)\n extras = None\n if m:\n path_no_extras = m.group(1)\n extras = m.group(2)\n else:\n path_no_extras = path\n\n return path_no_extras, extras\n\n\ndef convert_extras(extras: Optional[str]) -> Set[str]:\n if not extras:\n return set()\n return get_requirement(\"placeholder\" + extras.lower()).extras\n\n\ndef _set_requirement_extras(req: Requirement, new_extras: Set[str]) -> Requirement:\n \"\"\"\n Returns a new requirement based on the given one, with the supplied extras. If the\n given requirement already has extras those are replaced (or dropped if no new extras\n are given).\n \"\"\"\n match: Optional[re.Match[str]] = re.fullmatch(\n # see https://peps.python.org/pep-0508/#complete-grammar\n r\"([\\w\\t .-]+)(\\[[^\\]]*\\])?(.*)\",\n str(req),\n flags=re.ASCII,\n )\n # ireq.req is a valid requirement so the regex should always match\n assert (\n match is not None\n ), f\"regex match on requirement {req} failed, this should never happen\"\n pre: Optional[str] = match.group(1)\n post: Optional[str] = match.group(3)\n assert (\n pre is not None and post is not None\n ), f\"regex group selection for requirement {req} failed, this should never happen\"\n extras: str = \"[{}]\".format(\",\".join(sorted(new_extras)) if new_extras else \"\")\n return get_requirement(f\"{pre}{extras}{post}\")\n\n\ndef parse_editable(editable_req: str) -> Tuple[Optional[str], str, Set[str]]:\n \"\"\"Parses an editable requirement into:\n - a requirement name\n - an URL\n - extras\n - editable options\n Accepted requirements:\n svn+http://blahblah@rev#egg=Foobar[baz]&subdirectory=version_subdir\n .[some_extra]\n \"\"\"\n\n url = editable_req\n\n # If a file path is specified with extras, strip off the extras.\n url_no_extras, extras = _strip_extras(url)\n\n if os.path.isdir(url_no_extras):\n # Treating it as code that has already been checked out\n url_no_extras = path_to_url(url_no_extras)\n\n if url_no_extras.lower().startswith(\"file:\"):\n package_name = Link(url_no_extras).egg_fragment\n if extras:\n return (\n package_name,\n url_no_extras,\n get_requirement(\"placeholder\" + extras.lower()).extras,\n )\n else:\n return package_name, url_no_extras, set()\n\n for version_control in vcs:\n if url.lower().startswith(f\"{version_control}:\"):\n url = f\"{version_control}+{url}\"\n break\n\n link = Link(url)\n\n if not link.is_vcs:\n backends = \", \".join(vcs.all_schemes)\n raise InstallationError(\n f\"{editable_req} is not a valid editable requirement. \"\n f\"It should either be a path to a local project or a VCS URL \"\n f\"(beginning with {backends}).\"\n )\n\n package_name = link.egg_fragment\n if not package_name:\n raise InstallationError(\n f\"Could not detect requirement name for '{editable_req}', \"\n \"please specify one with #egg=your_package_name\"\n )\n return package_name, url, set()\n\n\ndef check_first_requirement_in_file(filename: str) -> None:\n \"\"\"Check if file is parsable as a requirements file.\n\n This is heavily based on ``pkg_resources.parse_requirements``, but\n simplified to just check the first meaningful line.\n\n :raises InvalidRequirement: If the first meaningful line cannot be parsed\n as an requirement.\n \"\"\"\n with open(filename, encoding=\"utf-8\", errors=\"ignore\") as f:\n # Create a steppable iterator, so we can handle \\-continuations.\n lines = (\n line\n for line in (line.strip() for line in f)\n if line and not line.startswith(\"#\") # Skip blank lines/comments.\n )\n\n for line in lines:\n # Drop comments -- a hash without a space may be in a URL.\n if \" #\" in line:\n line = line[: line.find(\" #\")]\n # If there is a line continuation, drop it, and append the next line.\n if line.endswith(\"\\\\\"):\n line = line[:-2].strip() + next(lines, \"\")\n get_requirement(line)\n return\n\n\ndef deduce_helpful_msg(req: str) -> str:\n \"\"\"Returns helpful msg in case requirements file does not exist,\n or cannot be parsed.\n\n :params req: Requirements file path\n \"\"\"\n if not os.path.exists(req):\n return f\" File '{req}' does not exist.\"\n msg = \" The path does exist. \"\n # Try to parse and check if it is a requirements file.\n try:\n check_first_requirement_in_file(req)\n except InvalidRequirement:\n logger.debug(\"Cannot parse '%s' as requirements file\", req)\n else:\n msg += (\n f\"The argument you provided \"\n f\"({req}) appears to be a\"\n f\" requirements file. If that is the\"\n f\" case, use the '-r' flag to install\"\n f\" the packages specified within it.\"\n )\n return msg\n\n\n@dataclass(frozen=True)\nclass RequirementParts:\n requirement: Optional[Requirement]\n link: Optional[Link]\n markers: Optional[Marker]\n extras: Set[str]\n\n\ndef parse_req_from_editable(editable_req: str) -> RequirementParts:\n name, url, extras_override = parse_editable(editable_req)\n\n if name is not None:\n try:\n req: Optional[Requirement] = get_requirement(name)\n except InvalidRequirement as exc:\n raise InstallationError(f\"Invalid requirement: {name!r}: {exc}\")\n else:\n req = None\n\n link = Link(url)\n\n return RequirementParts(req, link, None, extras_override)\n\n\n# ---- The actual constructors follow ----\n\n\ndef install_req_from_editable(\n editable_req: str,\n comes_from: Optional[Union[InstallRequirement, str]] = None,\n *,\n use_pep517: Optional[bool] = None,\n isolated: bool = False,\n global_options: Optional[List[str]] = None,\n hash_options: Optional[Dict[str, List[str]]] = None,\n constraint: bool = False,\n user_supplied: bool = False,\n permit_editable_wheels: bool = False,\n config_settings: Optional[Dict[str, Union[str, List[str]]]] = None,\n) -> InstallRequirement:\n parts = parse_req_from_editable(editable_req)\n\n return InstallRequirement(\n parts.requirement,\n comes_from=comes_from,\n user_supplied=user_supplied,\n editable=True,\n permit_editable_wheels=permit_editable_wheels,\n link=parts.link,\n constraint=constraint,\n use_pep517=use_pep517,\n isolated=isolated,\n global_options=global_options,\n hash_options=hash_options,\n config_settings=config_settings,\n extras=parts.extras,\n )\n\n\ndef _looks_like_path(name: str) -> bool:\n \"\"\"Checks whether the string \"looks like\" a path on the filesystem.\n\n This does not check whether the target actually exists, only judge from the\n appearance.\n\n Returns true if any of the following conditions is true:\n * a path separator is found (either os.path.sep or os.path.altsep);\n * a dot is found (which represents the current directory).\n \"\"\"\n if os.path.sep in name:\n return True\n if os.path.altsep is not None and os.path.altsep in name:\n return True\n if name.startswith(\".\"):\n return True\n return False\n\n\ndef _get_url_from_path(path: str, name: str) -> Optional[str]:\n \"\"\"\n First, it checks whether a provided path is an installable directory. If it\n is, returns the path.\n\n If false, check if the path is an archive file (such as a .whl).\n The function checks if the path is a file. If false, if the path has\n an @, it will treat it as a PEP 440 URL requirement and return the path.\n \"\"\"\n if _looks_like_path(name) and os.path.isdir(path):\n if is_installable_dir(path):\n return path_to_url(path)\n # TODO: The is_installable_dir test here might not be necessary\n # now that it is done in load_pyproject_toml too.\n raise InstallationError(\n f\"Directory {name!r} is not installable. Neither 'setup.py' \"\n \"nor 'pyproject.toml' found.\"\n )\n if not is_archive_file(path):\n return None\n if os.path.isfile(path):\n return path_to_url(path)\n urlreq_parts = name.split(\"@\", 1)\n if len(urlreq_parts) >= 2 and not _looks_like_path(urlreq_parts[0]):\n # If the path contains '@' and the part before it does not look\n # like a path, try to treat it as a PEP 440 URL req instead.\n return None\n logger.warning(\n \"Requirement %r looks like a filename, but the file does not exist\",\n name,\n )\n return path_to_url(path)\n\n\ndef parse_req_from_line(name: str, line_source: Optional[str]) -> RequirementParts:\n if is_url(name):\n marker_sep = \"; \"\n else:\n marker_sep = \";\"\n if marker_sep in name:\n name, markers_as_string = name.split(marker_sep, 1)\n markers_as_string = markers_as_string.strip()\n if not markers_as_string:\n markers = None\n else:\n markers = Marker(markers_as_string)\n else:\n markers = None\n name = name.strip()\n req_as_string = None\n path = os.path.normpath(os.path.abspath(name))\n link = None\n extras_as_string = None\n\n if is_url(name):\n link = Link(name)\n else:\n p, extras_as_string = _strip_extras(path)\n url = _get_url_from_path(p, name)\n if url is not None:\n link = Link(url)\n\n # it's a local file, dir, or url\n if link:\n # Handle relative file URLs\n if link.scheme == \"file\" and re.search(r\"\\.\\./\", link.url):\n link = Link(path_to_url(os.path.normpath(os.path.abspath(link.path))))\n # wheel file\n if link.is_wheel:\n wheel = Wheel(link.filename) # can raise InvalidWheelFilename\n req_as_string = f\"{wheel.name}=={wheel.version}\"\n else:\n # set the req to the egg fragment. when it's not there, this\n # will become an 'unnamed' requirement\n req_as_string = link.egg_fragment\n\n # a requirement specifier\n else:\n req_as_string = name\n\n extras = convert_extras(extras_as_string)\n\n def with_source(text: str) -> str:\n if not line_source:\n return text\n return f\"{text} (from {line_source})\"\n\n def _parse_req_string(req_as_string: str) -> Requirement:\n try:\n return get_requirement(req_as_string)\n except InvalidRequirement as exc:\n if os.path.sep in req_as_string:\n add_msg = \"It looks like a path.\"\n add_msg += deduce_helpful_msg(req_as_string)\n elif \"=\" in req_as_string and not any(\n op in req_as_string for op in operators\n ):\n add_msg = \"= is not a valid operator. Did you mean == ?\"\n else:\n add_msg = \"\"\n msg = with_source(f\"Invalid requirement: {req_as_string!r}: {exc}\")\n if add_msg:\n msg += f\"\\nHint: {add_msg}\"\n raise InstallationError(msg)\n\n if req_as_string is not None:\n req: Optional[Requirement] = _parse_req_string(req_as_string)\n else:\n req = None\n\n return RequirementParts(req, link, markers, extras)\n\n\ndef install_req_from_line(\n name: str,\n comes_from: Optional[Union[str, InstallRequirement]] = None,\n *,\n use_pep517: Optional[bool] = None,\n isolated: bool = False,\n global_options: Optional[List[str]] = None,\n hash_options: Optional[Dict[str, List[str]]] = None,\n constraint: bool = False,\n line_source: Optional[str] = None,\n user_supplied: bool = False,\n config_settings: Optional[Dict[str, Union[str, List[str]]]] = None,\n) -> InstallRequirement:\n \"\"\"Creates an InstallRequirement from a name, which might be a\n requirement, directory containing 'setup.py', filename, or URL.\n\n :param line_source: An optional string describing where the line is from,\n for logging purposes in case of an error.\n \"\"\"\n parts = parse_req_from_line(name, line_source)\n\n return InstallRequirement(\n parts.requirement,\n comes_from,\n link=parts.link,\n markers=parts.markers,\n use_pep517=use_pep517,\n isolated=isolated,\n global_options=global_options,\n hash_options=hash_options,\n config_settings=config_settings,\n constraint=constraint,\n extras=parts.extras,\n user_supplied=user_supplied,\n )\n\n\ndef install_req_from_req_string(\n req_string: str,\n comes_from: Optional[InstallRequirement] = None,\n isolated: bool = False,\n use_pep517: Optional[bool] = None,\n user_supplied: bool = False,\n) -> InstallRequirement:\n try:\n req = get_requirement(req_string)\n except InvalidRequirement as exc:\n raise InstallationError(f\"Invalid requirement: {req_string!r}: {exc}\")\n\n domains_not_allowed = [\n PyPI.file_storage_domain,\n TestPyPI.file_storage_domain,\n ]\n if (\n req.url\n and comes_from\n and comes_from.link\n and comes_from.link.netloc in domains_not_allowed\n ):\n # Explicitly disallow pypi packages that depend on external urls\n raise InstallationError(\n \"Packages installed from PyPI cannot depend on packages \"\n \"which are not also hosted on PyPI.\\n\"\n f\"{comes_from.name} depends on {req} \"\n )\n\n return InstallRequirement(\n req,\n comes_from,\n isolated=isolated,\n use_pep517=use_pep517,\n user_supplied=user_supplied,\n )\n\n\ndef install_req_from_parsed_requirement(\n parsed_req: ParsedRequirement,\n isolated: bool = False,\n use_pep517: Optional[bool] = None,\n user_supplied: bool = False,\n config_settings: Optional[Dict[str, Union[str, List[str]]]] = None,\n) -> InstallRequirement:\n if parsed_req.is_editable:\n req = install_req_from_editable(\n parsed_req.requirement,\n comes_from=parsed_req.comes_from,\n use_pep517=use_pep517,\n constraint=parsed_req.constraint,\n isolated=isolated,\n user_supplied=user_supplied,\n config_settings=config_settings,\n )\n\n else:\n req = install_req_from_line(\n parsed_req.requirement,\n comes_from=parsed_req.comes_from,\n use_pep517=use_pep517,\n isolated=isolated,\n global_options=(\n parsed_req.options.get(\"global_options\", [])\n if parsed_req.options\n else []\n ),\n hash_options=(\n parsed_req.options.get(\"hashes\", {}) if parsed_req.options else {}\n ),\n constraint=parsed_req.constraint,\n line_source=parsed_req.line_source,\n user_supplied=user_supplied,\n config_settings=config_settings,\n )\n return req\n\n\ndef install_req_from_link_and_ireq(\n link: Link, ireq: InstallRequirement\n) -> InstallRequirement:\n return InstallRequirement(\n req=ireq.req,\n comes_from=ireq.comes_from,\n editable=ireq.editable,\n link=link,\n markers=ireq.markers,\n use_pep517=ireq.use_pep517,\n isolated=ireq.isolated,\n global_options=ireq.global_options,\n hash_options=ireq.hash_options,\n config_settings=ireq.config_settings,\n user_supplied=ireq.user_supplied,\n )\n\n\ndef install_req_drop_extras(ireq: InstallRequirement) -> InstallRequirement:\n \"\"\"\n Creates a new InstallationRequirement using the given template but without\n any extras. Sets the original requirement as the new one's parent\n (comes_from).\n \"\"\"\n return InstallRequirement(\n req=(\n _set_requirement_extras(ireq.req, set()) if ireq.req is not None else None\n ),\n comes_from=ireq,\n editable=ireq.editable,\n link=ireq.link,\n markers=ireq.markers,\n use_pep517=ireq.use_pep517,\n isolated=ireq.isolated,\n global_options=ireq.global_options,\n hash_options=ireq.hash_options,\n constraint=ireq.constraint,\n extras=[],\n config_settings=ireq.config_settings,\n user_supplied=ireq.user_supplied,\n permit_editable_wheels=ireq.permit_editable_wheels,\n )\n\n\ndef install_req_extend_extras(\n ireq: InstallRequirement,\n extras: Collection[str],\n) -> InstallRequirement:\n \"\"\"\n Returns a copy of an installation requirement with some additional extras.\n Makes a shallow copy of the ireq object.\n \"\"\"\n result = copy.copy(ireq)\n result.extras = {*ireq.extras, *extras}\n result.req = (\n _set_requirement_extras(ireq.req, result.extras)\n if ireq.req is not None\n else None\n )\n return result\n",[],[100,509,516,523,475,544,1409,1424],{"_104":1432,"_96":1433,"_158":1434,"_160":1410,"_161":139,"_162":1435,"_164":165,"_106":1436,"_101":29,"_167":215,"_169":1437,"_170":25,"_171":-5,"_172":1438,"_99":1439},"06242d5c-67fc-11f0-80ec-0224a6c84d84","req_dependency_group.py","06242dfc-67fc-11f0-80ec-0224a6c84d84",211,["D",1753299258073],"import sys\nfrom typing import Any, Dict, Iterable, Iterator, List, Tuple\n\nif sys.version_info >= (3, 11):\n import tomllib\nelse:\n from pip._vendor import tomli as tomllib\n\nfrom pip._vendor.dependency_groups import DependencyGroupResolver\n\nfrom pip._internal.exceptions import InstallationError\n\n\ndef parse_dependency_groups(groups: List[Tuple[str, str]]) -> List[str]:\n \"\"\"\n Parse dependency groups data as provided via the CLI, in a `[path:]group` syntax.\n\n Raises InstallationErrors if anything goes wrong.\n \"\"\"\n resolvers = _build_resolvers(path for (path, _) in groups)\n return list(_resolve_all_groups(resolvers, groups))\n\n\ndef _resolve_all_groups(\n resolvers: Dict[str, DependencyGroupResolver], groups: List[Tuple[str, str]]\n) -> Iterator[str]:\n \"\"\"\n Run all resolution, converting any error from `DependencyGroupResolver` into\n an InstallationError.\n \"\"\"\n for path, groupname in groups:\n resolver = resolvers[path]\n try:\n yield from (str(req) for req in resolver.resolve(groupname))\n except (ValueError, TypeError, LookupError) as e:\n raise InstallationError(\n f\"[dependency-groups] resolution failed for '{groupname}' \"\n f\"from '{path}': {e}\"\n ) from e\n\n\ndef _build_resolvers(paths: Iterable[str]) -> Dict[str, Any]:\n resolvers = {}\n for path in paths:\n if path in resolvers:\n continue\n\n pyproject = _load_pyproject(path)\n if \"dependency-groups\" not in pyproject:\n raise InstallationError(\n f\"[dependency-groups] table was missing from '{path}'. \"\n \"Cannot resolve '--group' option.\"\n )\n raw_dependency_groups = pyproject[\"dependency-groups\"]\n if not isinstance(raw_dependency_groups, dict):\n raise InstallationError(\n f\"[dependency-groups] table was malformed in {path}. \"\n \"Cannot resolve '--group' option.\"\n )\n\n resolvers[path] = DependencyGroupResolver(raw_dependency_groups)\n return resolvers\n\n\ndef _load_pyproject(path: str) -> Dict[str, Any]:\n \"\"\"\n This helper loads a pyproject.toml as TOML.\n\n It raises an InstallationError if the operation fails.\n \"\"\"\n try:\n with open(path, \"rb\") as fp:\n return tomllib.load(fp)\n except FileNotFoundError:\n raise InstallationError(f\"{path} not found. Cannot resolve '--group' option.\")\n except tomllib.TOMLDecodeError as e:\n raise InstallationError(f\"Error parsing {path}: {e}\") from e\n except OSError as e:\n raise InstallationError(f\"Error reading {path}: {e}\") from e\n",[],[100,509,516,523,475,544,1409,1433],{"_104":1441,"_96":1442,"_158":1443,"_160":1410,"_161":139,"_162":1444,"_164":165,"_106":1445,"_101":29,"_167":215,"_169":1446,"_170":25,"_171":-5,"_172":1447,"_99":1448},"06284054-67fc-11f0-8737-0224a6c84d84","req_file.py","062840fe-67fc-11f0-8737-0224a6c84d84",212,["D",1753299258100],"\"\"\"\nRequirements file parsing\n\"\"\"\n\nimport codecs\nimport locale\nimport logging\nimport optparse\nimport os\nimport re\nimport shlex\nimport sys\nimport urllib.parse\nfrom dataclasses import dataclass\nfrom optparse import Values\nfrom typing import (\n TYPE_CHECKING,\n Any,\n Callable,\n Dict,\n Generator,\n Iterable,\n List,\n NoReturn,\n Optional,\n Tuple,\n)\n\nfrom pip._internal.cli import cmdoptions\nfrom pip._internal.exceptions import InstallationError, RequirementsFileParseError\nfrom pip._internal.models.search_scope import SearchScope\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n from pip._internal.network.session import PipSession\n\n__all__ = [\"parse_requirements\"]\n\nReqFileLines = Iterable[Tuple[int, str]]\n\nLineParser = Callable[[str], Tuple[str, Values]]\n\nSCHEME_RE = re.compile(r\"^(http|https|file):\", re.I)\nCOMMENT_RE = re.compile(r\"(^|\\s+)#.*$\")\n\n# Matches environment variable-style values in '${MY_VARIABLE_1}' with the\n# variable name consisting of only uppercase letters, digits or the '_'\n# (underscore). This follows the POSIX standard defined in IEEE Std 1003.1,\n# 2013 Edition.\nENV_VAR_RE = re.compile(r\"(?P\\$\\{(?P[A-Z0-9_]+)\\})\")\n\nSUPPORTED_OPTIONS: List[Callable[..., optparse.Option]] = [\n cmdoptions.index_url,\n cmdoptions.extra_index_url,\n cmdoptions.no_index,\n cmdoptions.constraints,\n cmdoptions.requirements,\n cmdoptions.editable,\n cmdoptions.find_links,\n cmdoptions.no_binary,\n cmdoptions.only_binary,\n cmdoptions.prefer_binary,\n cmdoptions.require_hashes,\n cmdoptions.pre,\n cmdoptions.trusted_host,\n cmdoptions.use_new_feature,\n]\n\n# options to be passed to requirements\nSUPPORTED_OPTIONS_REQ: List[Callable[..., optparse.Option]] = [\n cmdoptions.global_options,\n cmdoptions.hash,\n cmdoptions.config_settings,\n]\n\nSUPPORTED_OPTIONS_EDITABLE_REQ: List[Callable[..., optparse.Option]] = [\n cmdoptions.config_settings,\n]\n\n\n# the 'dest' string values\nSUPPORTED_OPTIONS_REQ_DEST = [str(o().dest) for o in SUPPORTED_OPTIONS_REQ]\nSUPPORTED_OPTIONS_EDITABLE_REQ_DEST = [\n str(o().dest) for o in SUPPORTED_OPTIONS_EDITABLE_REQ\n]\n\n# order of BOMS is important: codecs.BOM_UTF16_LE is a prefix of codecs.BOM_UTF32_LE\n# so data.startswith(BOM_UTF16_LE) would be true for UTF32_LE data\nBOMS: List[Tuple[bytes, str]] = [\n (codecs.BOM_UTF8, \"utf-8\"),\n (codecs.BOM_UTF32, \"utf-32\"),\n (codecs.BOM_UTF32_BE, \"utf-32-be\"),\n (codecs.BOM_UTF32_LE, \"utf-32-le\"),\n (codecs.BOM_UTF16, \"utf-16\"),\n (codecs.BOM_UTF16_BE, \"utf-16-be\"),\n (codecs.BOM_UTF16_LE, \"utf-16-le\"),\n]\n\nPEP263_ENCODING_RE = re.compile(rb\"coding[:=]\\s*([-\\w.]+)\")\nDEFAULT_ENCODING = \"utf-8\"\n\nlogger = logging.getLogger(__name__)\n\n\n@dataclass(frozen=True)\nclass ParsedRequirement:\n # TODO: replace this with slots=True when dropping Python 3.9 support.\n __slots__ = (\n \"requirement\",\n \"is_editable\",\n \"comes_from\",\n \"constraint\",\n \"options\",\n \"line_source\",\n )\n\n requirement: str\n is_editable: bool\n comes_from: str\n constraint: bool\n options: Optional[Dict[str, Any]]\n line_source: Optional[str]\n\n\n@dataclass(frozen=True)\nclass ParsedLine:\n __slots__ = (\"filename\", \"lineno\", \"args\", \"opts\", \"constraint\")\n\n filename: str\n lineno: int\n args: str\n opts: Values\n constraint: bool\n\n @property\n def is_editable(self) -> bool:\n return bool(self.opts.editables)\n\n @property\n def requirement(self) -> Optional[str]:\n if self.args:\n return self.args\n elif self.is_editable:\n # We don't support multiple -e on one line\n return self.opts.editables[0]\n return None\n\n\ndef parse_requirements(\n filename: str,\n session: \"PipSession\",\n finder: Optional[\"PackageFinder\"] = None,\n options: Optional[optparse.Values] = None,\n constraint: bool = False,\n) -> Generator[ParsedRequirement, None, None]:\n \"\"\"Parse a requirements file and yield ParsedRequirement instances.\n\n :param filename: Path or url of requirements file.\n :param session: PipSession instance.\n :param finder: Instance of pip.index.PackageFinder.\n :param options: cli options.\n :param constraint: If true, parsing a constraint file rather than\n requirements file.\n \"\"\"\n line_parser = get_line_parser(finder)\n parser = RequirementsFileParser(session, line_parser)\n\n for parsed_line in parser.parse(filename, constraint):\n parsed_req = handle_line(\n parsed_line, options=options, finder=finder, session=session\n )\n if parsed_req is not None:\n yield parsed_req\n\n\ndef preprocess(content: str) -> ReqFileLines:\n \"\"\"Split, filter, and join lines, and return a line iterator\n\n :param content: the content of the requirements file\n \"\"\"\n lines_enum: ReqFileLines = enumerate(content.splitlines(), start=1)\n lines_enum = join_lines(lines_enum)\n lines_enum = ignore_comments(lines_enum)\n lines_enum = expand_env_variables(lines_enum)\n return lines_enum\n\n\ndef handle_requirement_line(\n line: ParsedLine,\n options: Optional[optparse.Values] = None,\n) -> ParsedRequirement:\n # preserve for the nested code path\n line_comes_from = \"{} {} (line {})\".format(\n \"-c\" if line.constraint else \"-r\",\n line.filename,\n line.lineno,\n )\n\n assert line.requirement is not None\n\n # get the options that apply to requirements\n if line.is_editable:\n supported_dest = SUPPORTED_OPTIONS_EDITABLE_REQ_DEST\n else:\n supported_dest = SUPPORTED_OPTIONS_REQ_DEST\n req_options = {}\n for dest in supported_dest:\n if dest in line.opts.__dict__ and line.opts.__dict__[dest]:\n req_options[dest] = line.opts.__dict__[dest]\n\n line_source = f\"line {line.lineno} of {line.filename}\"\n return ParsedRequirement(\n requirement=line.requirement,\n is_editable=line.is_editable,\n comes_from=line_comes_from,\n constraint=line.constraint,\n options=req_options,\n line_source=line_source,\n )\n\n\ndef handle_option_line(\n opts: Values,\n filename: str,\n lineno: int,\n finder: Optional[\"PackageFinder\"] = None,\n options: Optional[optparse.Values] = None,\n session: Optional[\"PipSession\"] = None,\n) -> None:\n if opts.hashes:\n logger.warning(\n \"%s line %s has --hash but no requirement, and will be ignored.\",\n filename,\n lineno,\n )\n\n if options:\n # percolate options upward\n if opts.require_hashes:\n options.require_hashes = opts.require_hashes\n if opts.features_enabled:\n options.features_enabled.extend(\n f for f in opts.features_enabled if f not in options.features_enabled\n )\n\n # set finder options\n if finder:\n find_links = finder.find_links\n index_urls = finder.index_urls\n no_index = finder.search_scope.no_index\n if opts.no_index is True:\n no_index = True\n index_urls = []\n if opts.index_url and not no_index:\n index_urls = [opts.index_url]\n if opts.extra_index_urls and not no_index:\n index_urls.extend(opts.extra_index_urls)\n if opts.find_links:\n # FIXME: it would be nice to keep track of the source\n # of the find_links: support a find-links local path\n # relative to a requirements file.\n value = opts.find_links[0]\n req_dir = os.path.dirname(os.path.abspath(filename))\n relative_to_reqs_file = os.path.join(req_dir, value)\n if os.path.exists(relative_to_reqs_file):\n value = relative_to_reqs_file\n find_links.append(value)\n\n if session:\n # We need to update the auth urls in session\n session.update_index_urls(index_urls)\n\n search_scope = SearchScope(\n find_links=find_links,\n index_urls=index_urls,\n no_index=no_index,\n )\n finder.search_scope = search_scope\n\n if opts.pre:\n finder.set_allow_all_prereleases()\n\n if opts.prefer_binary:\n finder.set_prefer_binary()\n\n if session:\n for host in opts.trusted_hosts or []:\n source = f\"line {lineno} of {filename}\"\n session.add_trusted_host(host, source=source)\n\n\ndef handle_line(\n line: ParsedLine,\n options: Optional[optparse.Values] = None,\n finder: Optional[\"PackageFinder\"] = None,\n session: Optional[\"PipSession\"] = None,\n) -> Optional[ParsedRequirement]:\n \"\"\"Handle a single parsed requirements line; This can result in\n creating/yielding requirements, or updating the finder.\n\n :param line: The parsed line to be processed.\n :param options: CLI options.\n :param finder: The finder - updated by non-requirement lines.\n :param session: The session - updated by non-requirement lines.\n\n Returns a ParsedRequirement object if the line is a requirement line,\n otherwise returns None.\n\n For lines that contain requirements, the only options that have an effect\n are from SUPPORTED_OPTIONS_REQ, and they are scoped to the\n requirement. Other options from SUPPORTED_OPTIONS may be present, but are\n ignored.\n\n For lines that do not contain requirements, the only options that have an\n effect are from SUPPORTED_OPTIONS. Options from SUPPORTED_OPTIONS_REQ may\n be present, but are ignored. These lines may contain multiple options\n (although our docs imply only one is supported), and all our parsed and\n affect the finder.\n \"\"\"\n\n if line.requirement is not None:\n parsed_req = handle_requirement_line(line, options)\n return parsed_req\n else:\n handle_option_line(\n line.opts,\n line.filename,\n line.lineno,\n finder,\n options,\n session,\n )\n return None\n\n\nclass RequirementsFileParser:\n def __init__(\n self,\n session: \"PipSession\",\n line_parser: LineParser,\n ) -> None:\n self._session = session\n self._line_parser = line_parser\n\n def parse(\n self, filename: str, constraint: bool\n ) -> Generator[ParsedLine, None, None]:\n \"\"\"Parse a given file, yielding parsed lines.\"\"\"\n yield from self._parse_and_recurse(\n filename, constraint, [{os.path.abspath(filename): None}]\n )\n\n def _parse_and_recurse(\n self,\n filename: str,\n constraint: bool,\n parsed_files_stack: List[Dict[str, Optional[str]]],\n ) -> Generator[ParsedLine, None, None]:\n for line in self._parse_file(filename, constraint):\n if line.requirement is None and (\n line.opts.requirements or line.opts.constraints\n ):\n # parse a nested requirements file\n if line.opts.requirements:\n req_path = line.opts.requirements[0]\n nested_constraint = False\n else:\n req_path = line.opts.constraints[0]\n nested_constraint = True\n\n # original file is over http\n if SCHEME_RE.search(filename):\n # do a url join so relative paths work\n req_path = urllib.parse.urljoin(filename, req_path)\n # original file and nested file are paths\n elif not SCHEME_RE.search(req_path):\n # do a join so relative paths work\n # and then abspath so that we can identify recursive references\n req_path = os.path.abspath(\n os.path.join(\n os.path.dirname(filename),\n req_path,\n )\n )\n parsed_files = parsed_files_stack[0]\n if req_path in parsed_files:\n initial_file = parsed_files[req_path]\n tail = (\n f\" and again in {initial_file}\"\n if initial_file is not None\n else \"\"\n )\n raise RequirementsFileParseError(\n f\"{req_path} recursively references itself in {filename}{tail}\"\n )\n # Keeping a track where was each file first included in\n new_parsed_files = parsed_files.copy()\n new_parsed_files[req_path] = filename\n yield from self._parse_and_recurse(\n req_path, nested_constraint, [new_parsed_files, *parsed_files_stack]\n )\n else:\n yield line\n\n def _parse_file(\n self, filename: str, constraint: bool\n ) -> Generator[ParsedLine, None, None]:\n _, content = get_file_content(filename, self._session)\n\n lines_enum = preprocess(content)\n\n for line_number, line in lines_enum:\n try:\n args_str, opts = self._line_parser(line)\n except OptionParsingError as e:\n # add offending line\n msg = f\"Invalid requirement: {line}\\n{e.msg}\"\n raise RequirementsFileParseError(msg)\n\n yield ParsedLine(\n filename,\n line_number,\n args_str,\n opts,\n constraint,\n )\n\n\ndef get_line_parser(finder: Optional[\"PackageFinder\"]) -> LineParser:\n def parse_line(line: str) -> Tuple[str, Values]:\n # Build new parser for each line since it accumulates appendable\n # options.\n parser = build_parser()\n defaults = parser.get_default_values()\n defaults.index_url = None\n if finder:\n defaults.format_control = finder.format_control\n\n args_str, options_str = break_args_options(line)\n\n try:\n options = shlex.split(options_str)\n except ValueError as e:\n raise OptionParsingError(f\"Could not split options: {options_str}\") from e\n\n opts, _ = parser.parse_args(options, defaults)\n\n return args_str, opts\n\n return parse_line\n\n\ndef break_args_options(line: str) -> Tuple[str, str]:\n \"\"\"Break up the line into an args and options string. We only want to shlex\n (and then optparse) the options, not the args. args can contain markers\n which are corrupted by shlex.\n \"\"\"\n tokens = line.split(\" \")\n args = []\n options = tokens[:]\n for token in tokens:\n if token.startswith(\"-\") or token.startswith(\"--\"):\n break\n else:\n args.append(token)\n options.pop(0)\n return \" \".join(args), \" \".join(options)\n\n\nclass OptionParsingError(Exception):\n def __init__(self, msg: str) -> None:\n self.msg = msg\n\n\ndef build_parser() -> optparse.OptionParser:\n \"\"\"\n Return a parser for parsing requirement lines\n \"\"\"\n parser = optparse.OptionParser(add_help_option=False)\n\n option_factories = SUPPORTED_OPTIONS + SUPPORTED_OPTIONS_REQ\n for option_factory in option_factories:\n option = option_factory()\n parser.add_option(option)\n\n # By default optparse sys.exits on parsing errors. We want to wrap\n # that in our own exception.\n def parser_exit(self: Any, msg: str) -> \"NoReturn\":\n raise OptionParsingError(msg)\n\n # NOTE: mypy disallows assigning to a method\n # https://github.com/python/mypy/issues/2427\n parser.exit = parser_exit # type: ignore\n\n return parser\n\n\ndef join_lines(lines_enum: ReqFileLines) -> ReqFileLines:\n \"\"\"Joins a line ending in '\\' with the previous line (except when following\n comments). The joined line takes on the index of the first line.\n \"\"\"\n primary_line_number = None\n new_line: List[str] = []\n for line_number, line in lines_enum:\n if not line.endswith(\"\\\\\") or COMMENT_RE.match(line):\n if COMMENT_RE.match(line):\n # this ensures comments are always matched later\n line = \" \" + line\n if new_line:\n new_line.append(line)\n assert primary_line_number is not None\n yield primary_line_number, \"\".join(new_line)\n new_line = []\n else:\n yield line_number, line\n else:\n if not new_line:\n primary_line_number = line_number\n new_line.append(line.strip(\"\\\\\"))\n\n # last line contains \\\n if new_line:\n assert primary_line_number is not None\n yield primary_line_number, \"\".join(new_line)\n\n # TODO: handle space after '\\'.\n\n\ndef ignore_comments(lines_enum: ReqFileLines) -> ReqFileLines:\n \"\"\"\n Strips comments and filter empty lines.\n \"\"\"\n for line_number, line in lines_enum:\n line = COMMENT_RE.sub(\"\", line)\n line = line.strip()\n if line:\n yield line_number, line\n\n\ndef expand_env_variables(lines_enum: ReqFileLines) -> ReqFileLines:\n \"\"\"Replace all environment variables that can be retrieved via `os.getenv`.\n\n The only allowed format for environment variables defined in the\n requirement file is `${MY_VARIABLE_1}` to ensure two things:\n\n 1. Strings that contain a `$` aren't accidentally (partially) expanded.\n 2. Ensure consistency across platforms for requirement files.\n\n These points are the result of a discussion on the `github pull\n request #3514 `_.\n\n Valid characters in variable names follow the `POSIX standard\n `_ and are limited\n to uppercase letter, digits and the `_` (underscore).\n \"\"\"\n for line_number, line in lines_enum:\n for env_var, var_name in ENV_VAR_RE.findall(line):\n value = os.getenv(var_name)\n if not value:\n continue\n\n line = line.replace(env_var, value)\n\n yield line_number, line\n\n\ndef get_file_content(url: str, session: \"PipSession\") -> Tuple[str, str]:\n \"\"\"Gets the content of a file; it may be a filename, file: URL, or\n http: URL. Returns (location, content). Content is unicode.\n Respects # -*- coding: declarations on the retrieved files.\n\n :param url: File path or url.\n :param session: PipSession instance.\n \"\"\"\n scheme = urllib.parse.urlsplit(url).scheme\n # Pip has special support for file:// URLs (LocalFSAdapter).\n if scheme in [\"http\", \"https\", \"file\"]:\n # Delay importing heavy network modules until absolutely necessary.\n from pip._internal.network.utils import raise_for_status\n\n resp = session.get(url)\n raise_for_status(resp)\n return resp.url, resp.text\n\n # Assume this is a bare path.\n try:\n with open(url, \"rb\") as f:\n raw_content = f.read()\n except OSError as exc:\n raise InstallationError(f\"Could not open requirements file: {exc}\")\n\n content = _decode_req_file(raw_content, url)\n\n return url, content\n\n\ndef _decode_req_file(data: bytes, url: str) -> str:\n for bom, encoding in BOMS:\n if data.startswith(bom):\n return data[len(bom) :].decode(encoding)\n\n for line in data.split(b\"\\n\")[:2]:\n if line[0:1] == b\"#\":\n result = PEP263_ENCODING_RE.search(line)\n if result is not None:\n encoding = result.groups()[0].decode(\"ascii\")\n return data.decode(encoding)\n\n try:\n return data.decode(DEFAULT_ENCODING)\n except UnicodeDecodeError:\n locale_encoding = locale.getpreferredencoding(False) or sys.getdefaultencoding()\n logging.warning(\n \"unable to decode data from %s with default encoding %s, \"\n \"falling back to encoding from locale: %s. \"\n \"If this is intentional you should specify the encoding with a \"\n \"PEP-263 style comment, e.g. '# -*- coding: %s -*-'\",\n url,\n DEFAULT_ENCODING,\n locale_encoding,\n locale_encoding,\n )\n return data.decode(locale_encoding)\n",[],[100,509,516,523,475,544,1409,1442],{"_104":1450,"_96":1451,"_158":1452,"_160":1410,"_161":139,"_162":1453,"_164":165,"_106":1454,"_101":29,"_167":215,"_169":1455,"_170":25,"_171":-5,"_172":1456,"_99":1457},"060c4660-67fc-11f0-85ab-0224a6c84d84","req_install.py","060c4732-67fc-11f0-85ab-0224a6c84d84",207,["D",1753299257929],"import functools\nimport logging\nimport os\nimport shutil\nimport sys\nimport uuid\nimport zipfile\nfrom optparse import Values\nfrom pathlib import Path\nfrom typing import Any, Collection, Dict, Iterable, List, Optional, Sequence, Union\n\nfrom pip._vendor.packaging.markers import Marker\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.packaging.specifiers import SpecifierSet\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.packaging.version import Version\nfrom pip._vendor.packaging.version import parse as parse_version\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller\n\nfrom pip._internal.build_env import BuildEnvironment, NoOpBuildEnvironment\nfrom pip._internal.exceptions import InstallationError, PreviousBuildDirError\nfrom pip._internal.locations import get_scheme\nfrom pip._internal.metadata import (\n BaseDistribution,\n get_default_environment,\n get_directory_distribution,\n get_wheel_distribution,\n)\nfrom pip._internal.metadata.base import FilesystemWheel\nfrom pip._internal.models.direct_url import DirectUrl\nfrom pip._internal.models.link import Link\nfrom pip._internal.operations.build.metadata import generate_metadata\nfrom pip._internal.operations.build.metadata_editable import generate_editable_metadata\nfrom pip._internal.operations.build.metadata_legacy import (\n generate_metadata as generate_metadata_legacy,\n)\nfrom pip._internal.operations.install.editable_legacy import (\n install_editable as install_editable_legacy,\n)\nfrom pip._internal.operations.install.wheel import install_wheel\nfrom pip._internal.pyproject import load_pyproject_toml, make_pyproject_path\nfrom pip._internal.req.req_uninstall import UninstallPathSet\nfrom pip._internal.utils.deprecation import deprecated\nfrom pip._internal.utils.hashes import Hashes\nfrom pip._internal.utils.misc import (\n ConfiguredBuildBackendHookCaller,\n ask_path_exists,\n backup_dir,\n display_path,\n hide_url,\n is_installable_dir,\n redact_auth_from_requirement,\n redact_auth_from_url,\n)\nfrom pip._internal.utils.packaging import get_requirement\nfrom pip._internal.utils.subprocess import runner_with_spinner_message\nfrom pip._internal.utils.temp_dir import TempDirectory, tempdir_kinds\nfrom pip._internal.utils.unpacking import unpack_file\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\nfrom pip._internal.vcs import vcs\n\nlogger = logging.getLogger(__name__)\n\n\nclass InstallRequirement:\n \"\"\"\n Represents something that may be installed later on, may have information\n about where to fetch the relevant requirement and also contains logic for\n installing the said requirement.\n \"\"\"\n\n def __init__(\n self,\n req: Optional[Requirement],\n comes_from: Optional[Union[str, \"InstallRequirement\"]],\n editable: bool = False,\n link: Optional[Link] = None,\n markers: Optional[Marker] = None,\n use_pep517: Optional[bool] = None,\n isolated: bool = False,\n *,\n global_options: Optional[List[str]] = None,\n hash_options: Optional[Dict[str, List[str]]] = None,\n config_settings: Optional[Dict[str, Union[str, List[str]]]] = None,\n constraint: bool = False,\n extras: Collection[str] = (),\n user_supplied: bool = False,\n permit_editable_wheels: bool = False,\n ) -> None:\n assert req is None or isinstance(req, Requirement), req\n self.req = req\n self.comes_from = comes_from\n self.constraint = constraint\n self.editable = editable\n self.permit_editable_wheels = permit_editable_wheels\n\n # source_dir is the local directory where the linked requirement is\n # located, or unpacked. In case unpacking is needed, creating and\n # populating source_dir is done by the RequirementPreparer. Note this\n # is not necessarily the directory where pyproject.toml or setup.py is\n # located - that one is obtained via unpacked_source_directory.\n self.source_dir: Optional[str] = None\n if self.editable:\n assert link\n if link.is_file:\n self.source_dir = os.path.normpath(os.path.abspath(link.file_path))\n\n # original_link is the direct URL that was provided by the user for the\n # requirement, either directly or via a constraints file.\n if link is None and req and req.url:\n # PEP 508 URL requirement\n link = Link(req.url)\n self.link = self.original_link = link\n\n # When this InstallRequirement is a wheel obtained from the cache of locally\n # built wheels, this is the source link corresponding to the cache entry, which\n # was used to download and build the cached wheel.\n self.cached_wheel_source_link: Optional[Link] = None\n\n # Information about the location of the artifact that was downloaded . This\n # property is guaranteed to be set in resolver results.\n self.download_info: Optional[DirectUrl] = None\n\n # Path to any downloaded or already-existing package.\n self.local_file_path: Optional[str] = None\n if self.link and self.link.is_file:\n self.local_file_path = self.link.file_path\n\n if extras:\n self.extras = extras\n elif req:\n self.extras = req.extras\n else:\n self.extras = set()\n if markers is None and req:\n markers = req.marker\n self.markers = markers\n\n # This holds the Distribution object if this requirement is already installed.\n self.satisfied_by: Optional[BaseDistribution] = None\n # Whether the installation process should try to uninstall an existing\n # distribution before installing this requirement.\n self.should_reinstall = False\n # Temporary build location\n self._temp_build_dir: Optional[TempDirectory] = None\n # Set to True after successful installation\n self.install_succeeded: Optional[bool] = None\n # Supplied options\n self.global_options = global_options if global_options else []\n self.hash_options = hash_options if hash_options else {}\n self.config_settings = config_settings\n # Set to True after successful preparation of this requirement\n self.prepared = False\n # User supplied requirement are explicitly requested for installation\n # by the user via CLI arguments or requirements files, as opposed to,\n # e.g. dependencies, extras or constraints.\n self.user_supplied = user_supplied\n\n self.isolated = isolated\n self.build_env: BuildEnvironment = NoOpBuildEnvironment()\n\n # For PEP 517, the directory where we request the project metadata\n # gets stored. We need this to pass to build_wheel, so the backend\n # can ensure that the wheel matches the metadata (see the PEP for\n # details).\n self.metadata_directory: Optional[str] = None\n\n # The static build requirements (from pyproject.toml)\n self.pyproject_requires: Optional[List[str]] = None\n\n # Build requirements that we will check are available\n self.requirements_to_check: List[str] = []\n\n # The PEP 517 backend we should use to build the project\n self.pep517_backend: Optional[BuildBackendHookCaller] = None\n\n # Are we using PEP 517 for this requirement?\n # After pyproject.toml has been loaded, the only valid values are True\n # and False. Before loading, None is valid (meaning \"use the default\").\n # Setting an explicit value before loading pyproject.toml is supported,\n # but after loading this flag should be treated as read only.\n self.use_pep517 = use_pep517\n\n # If config settings are provided, enforce PEP 517.\n if self.config_settings:\n if self.use_pep517 is False:\n logger.warning(\n \"--no-use-pep517 ignored for %s \"\n \"because --config-settings are specified.\",\n self,\n )\n self.use_pep517 = True\n\n # This requirement needs more preparation before it can be built\n self.needs_more_preparation = False\n\n # This requirement needs to be unpacked before it can be installed.\n self._archive_source: Optional[Path] = None\n\n def __str__(self) -> str:\n if self.req:\n s = redact_auth_from_requirement(self.req)\n if self.link:\n s += f\" from {redact_auth_from_url(self.link.url)}\"\n elif self.link:\n s = redact_auth_from_url(self.link.url)\n else:\n s = \"\"\n if self.satisfied_by is not None:\n if self.satisfied_by.location is not None:\n location = display_path(self.satisfied_by.location)\n else:\n location = \"\"\n s += f\" in {location}\"\n if self.comes_from:\n if isinstance(self.comes_from, str):\n comes_from: Optional[str] = self.comes_from\n else:\n comes_from = self.comes_from.from_path()\n if comes_from:\n s += f\" (from {comes_from})\"\n return s\n\n def __repr__(self) -> str:\n return (\n f\"<{self.__class__.__name__} object: \"\n f\"{str(self)} editable={self.editable!r}>\"\n )\n\n def format_debug(self) -> str:\n \"\"\"An un-tested helper for getting state, for debugging.\"\"\"\n attributes = vars(self)\n names = sorted(attributes)\n\n state = (f\"{attr}={attributes[attr]!r}\" for attr in sorted(names))\n return \"<{name} object: {{{state}}}>\".format(\n name=self.__class__.__name__,\n state=\", \".join(state),\n )\n\n # Things that are valid for all kinds of requirements?\n @property\n def name(self) -> Optional[str]:\n if self.req is None:\n return None\n return self.req.name\n\n @functools.cached_property\n def supports_pyproject_editable(self) -> bool:\n if not self.use_pep517:\n return False\n assert self.pep517_backend\n with self.build_env:\n runner = runner_with_spinner_message(\n \"Checking if build backend supports build_editable\"\n )\n with self.pep517_backend.subprocess_runner(runner):\n return \"build_editable\" in self.pep517_backend._supported_features()\n\n @property\n def specifier(self) -> SpecifierSet:\n assert self.req is not None\n return self.req.specifier\n\n @property\n def is_direct(self) -> bool:\n \"\"\"Whether this requirement was specified as a direct URL.\"\"\"\n return self.original_link is not None\n\n @property\n def is_pinned(self) -> bool:\n \"\"\"Return whether I am pinned to an exact version.\n\n For example, some-package==1.2 is pinned; some-package>1.2 is not.\n \"\"\"\n assert self.req is not None\n specifiers = self.req.specifier\n return len(specifiers) == 1 and next(iter(specifiers)).operator in {\"==\", \"===\"}\n\n def match_markers(self, extras_requested: Optional[Iterable[str]] = None) -> bool:\n if not extras_requested:\n # Provide an extra to safely evaluate the markers\n # without matching any extra\n extras_requested = (\"\",)\n if self.markers is not None:\n return any(\n self.markers.evaluate({\"extra\": extra}) for extra in extras_requested\n )\n else:\n return True\n\n @property\n def has_hash_options(self) -> bool:\n \"\"\"Return whether any known-good hashes are specified as options.\n\n These activate --require-hashes mode; hashes specified as part of a\n URL do not.\n\n \"\"\"\n return bool(self.hash_options)\n\n def hashes(self, trust_internet: bool = True) -> Hashes:\n \"\"\"Return a hash-comparer that considers my option- and URL-based\n hashes to be known-good.\n\n Hashes in URLs--ones embedded in the requirements file, not ones\n downloaded from an index server--are almost peers with ones from\n flags. They satisfy --require-hashes (whether it was implicitly or\n explicitly activated) but do not activate it. md5 and sha224 are not\n allowed in flags, which should nudge people toward good algos. We\n always OR all hashes together, even ones from URLs.\n\n :param trust_internet: Whether to trust URL-based (#md5=...) hashes\n downloaded from the internet, as by populate_link()\n\n \"\"\"\n good_hashes = self.hash_options.copy()\n if trust_internet:\n link = self.link\n elif self.is_direct and self.user_supplied:\n link = self.original_link\n else:\n link = None\n if link and link.hash:\n assert link.hash_name is not None\n good_hashes.setdefault(link.hash_name, []).append(link.hash)\n return Hashes(good_hashes)\n\n def from_path(self) -> Optional[str]:\n \"\"\"Format a nice indicator to show where this \"comes from\" \"\"\"\n if self.req is None:\n return None\n s = str(self.req)\n if self.comes_from:\n comes_from: Optional[str]\n if isinstance(self.comes_from, str):\n comes_from = self.comes_from\n else:\n comes_from = self.comes_from.from_path()\n if comes_from:\n s += \"->\" + comes_from\n return s\n\n def ensure_build_location(\n self, build_dir: str, autodelete: bool, parallel_builds: bool\n ) -> str:\n assert build_dir is not None\n if self._temp_build_dir is not None:\n assert self._temp_build_dir.path\n return self._temp_build_dir.path\n if self.req is None:\n # Some systems have /tmp as a symlink which confuses custom\n # builds (such as numpy). Thus, we ensure that the real path\n # is returned.\n self._temp_build_dir = TempDirectory(\n kind=tempdir_kinds.REQ_BUILD, globally_managed=True\n )\n\n return self._temp_build_dir.path\n\n # This is the only remaining place where we manually determine the path\n # for the temporary directory. It is only needed for editables where\n # it is the value of the --src option.\n\n # When parallel builds are enabled, add a UUID to the build directory\n # name so multiple builds do not interfere with each other.\n dir_name: str = canonicalize_name(self.req.name)\n if parallel_builds:\n dir_name = f\"{dir_name}_{uuid.uuid4().hex}\"\n\n # FIXME: Is there a better place to create the build_dir? (hg and bzr\n # need this)\n if not os.path.exists(build_dir):\n logger.debug(\"Creating directory %s\", build_dir)\n os.makedirs(build_dir)\n actual_build_dir = os.path.join(build_dir, dir_name)\n # `None` indicates that we respect the globally-configured deletion\n # settings, which is what we actually want when auto-deleting.\n delete_arg = None if autodelete else False\n return TempDirectory(\n path=actual_build_dir,\n delete=delete_arg,\n kind=tempdir_kinds.REQ_BUILD,\n globally_managed=True,\n ).path\n\n def _set_requirement(self) -> None:\n \"\"\"Set requirement after generating metadata.\"\"\"\n assert self.req is None\n assert self.metadata is not None\n assert self.source_dir is not None\n\n # Construct a Requirement object from the generated metadata\n if isinstance(parse_version(self.metadata[\"Version\"]), Version):\n op = \"==\"\n else:\n op = \"===\"\n\n self.req = get_requirement(\n \"\".join(\n [\n self.metadata[\"Name\"],\n op,\n self.metadata[\"Version\"],\n ]\n )\n )\n\n def warn_on_mismatching_name(self) -> None:\n assert self.req is not None\n metadata_name = canonicalize_name(self.metadata[\"Name\"])\n if canonicalize_name(self.req.name) == metadata_name:\n # Everything is fine.\n return\n\n # If we're here, there's a mismatch. Log a warning about it.\n logger.warning(\n \"Generating metadata for package %s \"\n \"produced metadata for project name %s. Fix your \"\n \"#egg=%s fragments.\",\n self.name,\n metadata_name,\n self.name,\n )\n self.req = get_requirement(metadata_name)\n\n def check_if_exists(self, use_user_site: bool) -> None:\n \"\"\"Find an installed distribution that satisfies or conflicts\n with this requirement, and set self.satisfied_by or\n self.should_reinstall appropriately.\n \"\"\"\n if self.req is None:\n return\n existing_dist = get_default_environment().get_distribution(self.req.name)\n if not existing_dist:\n return\n\n version_compatible = self.req.specifier.contains(\n existing_dist.version,\n prereleases=True,\n )\n if not version_compatible:\n self.satisfied_by = None\n if use_user_site:\n if existing_dist.in_usersite:\n self.should_reinstall = True\n elif running_under_virtualenv() and existing_dist.in_site_packages:\n raise InstallationError(\n f\"Will not install to the user site because it will \"\n f\"lack sys.path precedence to {existing_dist.raw_name} \"\n f\"in {existing_dist.location}\"\n )\n else:\n self.should_reinstall = True\n else:\n if self.editable:\n self.should_reinstall = True\n # when installing editables, nothing pre-existing should ever\n # satisfy\n self.satisfied_by = None\n else:\n self.satisfied_by = existing_dist\n\n # Things valid for wheels\n @property\n def is_wheel(self) -> bool:\n if not self.link:\n return False\n return self.link.is_wheel\n\n @property\n def is_wheel_from_cache(self) -> bool:\n # When True, it means that this InstallRequirement is a local wheel file in the\n # cache of locally built wheels.\n return self.cached_wheel_source_link is not None\n\n # Things valid for sdists\n @property\n def unpacked_source_directory(self) -> str:\n assert self.source_dir, f\"No source dir for {self}\"\n return os.path.join(\n self.source_dir, self.link and self.link.subdirectory_fragment or \"\"\n )\n\n @property\n def setup_py_path(self) -> str:\n assert self.source_dir, f\"No source dir for {self}\"\n setup_py = os.path.join(self.unpacked_source_directory, \"setup.py\")\n\n return setup_py\n\n @property\n def setup_cfg_path(self) -> str:\n assert self.source_dir, f\"No source dir for {self}\"\n setup_cfg = os.path.join(self.unpacked_source_directory, \"setup.cfg\")\n\n return setup_cfg\n\n @property\n def pyproject_toml_path(self) -> str:\n assert self.source_dir, f\"No source dir for {self}\"\n return make_pyproject_path(self.unpacked_source_directory)\n\n def load_pyproject_toml(self) -> None:\n \"\"\"Load the pyproject.toml file.\n\n After calling this routine, all of the attributes related to PEP 517\n processing for this requirement have been set. In particular, the\n use_pep517 attribute can be used to determine whether we should\n follow the PEP 517 or legacy (setup.py) code path.\n \"\"\"\n pyproject_toml_data = load_pyproject_toml(\n self.use_pep517, self.pyproject_toml_path, self.setup_py_path, str(self)\n )\n\n if pyproject_toml_data is None:\n assert not self.config_settings\n self.use_pep517 = False\n return\n\n self.use_pep517 = True\n requires, backend, check, backend_path = pyproject_toml_data\n self.requirements_to_check = check\n self.pyproject_requires = requires\n self.pep517_backend = ConfiguredBuildBackendHookCaller(\n self,\n self.unpacked_source_directory,\n backend,\n backend_path=backend_path,\n )\n\n def isolated_editable_sanity_check(self) -> None:\n \"\"\"Check that an editable requirement if valid for use with PEP 517/518.\n\n This verifies that an editable that has a pyproject.toml either supports PEP 660\n or as a setup.py or a setup.cfg\n \"\"\"\n if (\n self.editable\n and self.use_pep517\n and not self.supports_pyproject_editable\n and not os.path.isfile(self.setup_py_path)\n and not os.path.isfile(self.setup_cfg_path)\n ):\n raise InstallationError(\n f\"Project {self} has a 'pyproject.toml' and its build \"\n f\"backend is missing the 'build_editable' hook. Since it does not \"\n f\"have a 'setup.py' nor a 'setup.cfg', \"\n f\"it cannot be installed in editable mode. \"\n f\"Consider using a build backend that supports PEP 660.\"\n )\n\n def prepare_metadata(self) -> None:\n \"\"\"Ensure that project metadata is available.\n\n Under PEP 517 and PEP 660, call the backend hook to prepare the metadata.\n Under legacy processing, call setup.py egg-info.\n \"\"\"\n assert self.source_dir, f\"No source dir for {self}\"\n details = self.name or f\"from {self.link}\"\n\n if self.use_pep517:\n assert self.pep517_backend is not None\n if (\n self.editable\n and self.permit_editable_wheels\n and self.supports_pyproject_editable\n ):\n self.metadata_directory = generate_editable_metadata(\n build_env=self.build_env,\n backend=self.pep517_backend,\n details=details,\n )\n else:\n self.metadata_directory = generate_metadata(\n build_env=self.build_env,\n backend=self.pep517_backend,\n details=details,\n )\n else:\n self.metadata_directory = generate_metadata_legacy(\n build_env=self.build_env,\n setup_py_path=self.setup_py_path,\n source_dir=self.unpacked_source_directory,\n isolated=self.isolated,\n details=details,\n )\n\n # Act on the newly generated metadata, based on the name and version.\n if not self.name:\n self._set_requirement()\n else:\n self.warn_on_mismatching_name()\n\n self.assert_source_matches_version()\n\n @property\n def metadata(self) -> Any:\n if not hasattr(self, \"_metadata\"):\n self._metadata = self.get_dist().metadata\n\n return self._metadata\n\n def get_dist(self) -> BaseDistribution:\n if self.metadata_directory:\n return get_directory_distribution(self.metadata_directory)\n elif self.local_file_path and self.is_wheel:\n assert self.req is not None\n return get_wheel_distribution(\n FilesystemWheel(self.local_file_path),\n canonicalize_name(self.req.name),\n )\n raise AssertionError(\n f\"InstallRequirement {self} has no metadata directory and no wheel: \"\n f\"can't make a distribution.\"\n )\n\n def assert_source_matches_version(self) -> None:\n assert self.source_dir, f\"No source dir for {self}\"\n version = self.metadata[\"version\"]\n if self.req and self.req.specifier and version not in self.req.specifier:\n logger.warning(\n \"Requested %s, but installing version %s\",\n self,\n version,\n )\n else:\n logger.debug(\n \"Source in %s has version %s, which satisfies requirement %s\",\n display_path(self.source_dir),\n version,\n self,\n )\n\n # For both source distributions and editables\n def ensure_has_source_dir(\n self,\n parent_dir: str,\n autodelete: bool = False,\n parallel_builds: bool = False,\n ) -> None:\n \"\"\"Ensure that a source_dir is set.\n\n This will create a temporary build dir if the name of the requirement\n isn't known yet.\n\n :param parent_dir: The ideal pip parent_dir for the source_dir.\n Generally src_dir for editables and build_dir for sdists.\n :return: self.source_dir\n \"\"\"\n if self.source_dir is None:\n self.source_dir = self.ensure_build_location(\n parent_dir,\n autodelete=autodelete,\n parallel_builds=parallel_builds,\n )\n\n def needs_unpacked_archive(self, archive_source: Path) -> None:\n assert self._archive_source is None\n self._archive_source = archive_source\n\n def ensure_pristine_source_checkout(self) -> None:\n \"\"\"Ensure the source directory has not yet been built in.\"\"\"\n assert self.source_dir is not None\n if self._archive_source is not None:\n unpack_file(str(self._archive_source), self.source_dir)\n elif is_installable_dir(self.source_dir):\n # If a checkout exists, it's unwise to keep going.\n # version inconsistencies are logged later, but do not fail\n # the installation.\n raise PreviousBuildDirError(\n f\"pip can't proceed with requirements '{self}' due to a \"\n f\"pre-existing build directory ({self.source_dir}). This is likely \"\n \"due to a previous installation that failed . pip is \"\n \"being responsible and not assuming it can delete this. \"\n \"Please delete it and try again.\"\n )\n\n # For editable installations\n def update_editable(self) -> None:\n if not self.link:\n logger.debug(\n \"Cannot update repository at %s; repository location is unknown\",\n self.source_dir,\n )\n return\n assert self.editable\n assert self.source_dir\n if self.link.scheme == \"file\":\n # Static paths don't get updated\n return\n vcs_backend = vcs.get_backend_for_scheme(self.link.scheme)\n # Editable requirements are validated in Requirement constructors.\n # So here, if it's neither a path nor a valid VCS URL, it's a bug.\n assert vcs_backend, f\"Unsupported VCS URL {self.link.url}\"\n hidden_url = hide_url(self.link.url)\n vcs_backend.obtain(self.source_dir, url=hidden_url, verbosity=0)\n\n # Top-level Actions\n def uninstall(\n self, auto_confirm: bool = False, verbose: bool = False\n ) -> Optional[UninstallPathSet]:\n \"\"\"\n Uninstall the distribution currently satisfying this requirement.\n\n Prompts before removing or modifying files unless\n ``auto_confirm`` is True.\n\n Refuses to delete or modify files outside of ``sys.prefix`` -\n thus uninstallation within a virtual environment can only\n modify that virtual environment, even if the virtualenv is\n linked to global site-packages.\n\n \"\"\"\n assert self.req\n dist = get_default_environment().get_distribution(self.req.name)\n if not dist:\n logger.warning(\"Skipping %s as it is not installed.\", self.name)\n return None\n logger.info(\"Found existing installation: %s\", dist)\n\n uninstalled_pathset = UninstallPathSet.from_dist(dist)\n uninstalled_pathset.remove(auto_confirm, verbose)\n return uninstalled_pathset\n\n def _get_archive_name(self, path: str, parentdir: str, rootdir: str) -> str:\n def _clean_zip_name(name: str, prefix: str) -> str:\n assert name.startswith(\n prefix + os.path.sep\n ), f\"name {name!r} doesn't start with prefix {prefix!r}\"\n name = name[len(prefix) + 1 :]\n name = name.replace(os.path.sep, \"/\")\n return name\n\n assert self.req is not None\n path = os.path.join(parentdir, path)\n name = _clean_zip_name(path, rootdir)\n return self.req.name + \"/\" + name\n\n def archive(self, build_dir: Optional[str]) -> None:\n \"\"\"Saves archive to provided build_dir.\n\n Used for saving downloaded VCS requirements as part of `pip download`.\n \"\"\"\n assert self.source_dir\n if build_dir is None:\n return\n\n create_archive = True\n archive_name = \"{}-{}.zip\".format(self.name, self.metadata[\"version\"])\n archive_path = os.path.join(build_dir, archive_name)\n\n if os.path.exists(archive_path):\n response = ask_path_exists(\n f\"The file {display_path(archive_path)} exists. (i)gnore, (w)ipe, \"\n \"(b)ackup, (a)bort \",\n (\"i\", \"w\", \"b\", \"a\"),\n )\n if response == \"i\":\n create_archive = False\n elif response == \"w\":\n logger.warning(\"Deleting %s\", display_path(archive_path))\n os.remove(archive_path)\n elif response == \"b\":\n dest_file = backup_dir(archive_path)\n logger.warning(\n \"Backing up %s to %s\",\n display_path(archive_path),\n display_path(dest_file),\n )\n shutil.move(archive_path, dest_file)\n elif response == \"a\":\n sys.exit(-1)\n\n if not create_archive:\n return\n\n zip_output = zipfile.ZipFile(\n archive_path,\n \"w\",\n zipfile.ZIP_DEFLATED,\n allowZip64=True,\n )\n with zip_output:\n dir = os.path.normcase(os.path.abspath(self.unpacked_source_directory))\n for dirpath, dirnames, filenames in os.walk(dir):\n for dirname in dirnames:\n dir_arcname = self._get_archive_name(\n dirname,\n parentdir=dirpath,\n rootdir=dir,\n )\n zipdir = zipfile.ZipInfo(dir_arcname + \"/\")\n zipdir.external_attr = 0x1ED << 16 # 0o755\n zip_output.writestr(zipdir, \"\")\n for filename in filenames:\n file_arcname = self._get_archive_name(\n filename,\n parentdir=dirpath,\n rootdir=dir,\n )\n filename = os.path.join(dirpath, filename)\n zip_output.write(filename, file_arcname)\n\n logger.info(\"Saved %s\", display_path(archive_path))\n\n def install(\n self,\n global_options: Optional[Sequence[str]] = None,\n root: Optional[str] = None,\n home: Optional[str] = None,\n prefix: Optional[str] = None,\n warn_script_location: bool = True,\n use_user_site: bool = False,\n pycompile: bool = True,\n ) -> None:\n assert self.req is not None\n scheme = get_scheme(\n self.req.name,\n user=use_user_site,\n home=home,\n root=root,\n isolated=self.isolated,\n prefix=prefix,\n )\n\n if self.editable and not self.is_wheel:\n deprecated(\n reason=(\n f\"Legacy editable install of {self} (setup.py develop) \"\n \"is deprecated.\"\n ),\n replacement=(\n \"to add a pyproject.toml or enable --use-pep517, \"\n \"and use setuptools >= 64. \"\n \"If the resulting installation is not behaving as expected, \"\n \"try using --config-settings editable_mode=compat. \"\n \"Please consult the setuptools documentation for more information\"\n ),\n gone_in=\"25.3\",\n issue=11457,\n )\n if self.config_settings:\n logger.warning(\n \"--config-settings ignored for legacy editable install of %s. \"\n \"Consider upgrading to a version of setuptools \"\n \"that supports PEP 660 (>= 64).\",\n self,\n )\n install_editable_legacy(\n global_options=global_options if global_options is not None else [],\n prefix=prefix,\n home=home,\n use_user_site=use_user_site,\n name=self.req.name,\n setup_py_path=self.setup_py_path,\n isolated=self.isolated,\n build_env=self.build_env,\n unpacked_source_directory=self.unpacked_source_directory,\n )\n self.install_succeeded = True\n return\n\n assert self.is_wheel\n assert self.local_file_path\n\n install_wheel(\n self.req.name,\n self.local_file_path,\n scheme=scheme,\n req_description=str(self.req),\n pycompile=pycompile,\n warn_script_location=warn_script_location,\n direct_url=self.download_info if self.is_direct else None,\n requested=self.user_supplied,\n )\n self.install_succeeded = True\n\n\ndef check_invalid_constraint_type(req: InstallRequirement) -> str:\n # Check for unsupported forms\n problem = \"\"\n if not req.name:\n problem = \"Unnamed requirements are not allowed as constraints\"\n elif req.editable:\n problem = \"Editable requirements are not allowed as constraints\"\n elif req.extras:\n problem = \"Constraints cannot have extras\"\n\n if problem:\n deprecated(\n reason=(\n \"Constraints are only allowed to take the form of a package \"\n \"name and a version specifier. Other forms were originally \"\n \"permitted as an accident of the implementation, but were \"\n \"undocumented. The new implementation of the resolver no \"\n \"longer supports these forms.\"\n ),\n replacement=\"replacing the constraint with a requirement\",\n # No plan yet for when the new resolver becomes default\n gone_in=None,\n issue=8210,\n )\n\n return problem\n\n\ndef _has_option(options: Values, reqs: List[InstallRequirement], option: str) -> bool:\n if getattr(options, option, None):\n return True\n for req in reqs:\n if getattr(req, option, None):\n return True\n return False\n\n\ndef check_legacy_setup_py_options(\n options: Values,\n reqs: List[InstallRequirement],\n) -> None:\n has_build_options = _has_option(options, reqs, \"build_options\")\n has_global_options = _has_option(options, reqs, \"global_options\")\n if has_build_options or has_global_options:\n deprecated(\n reason=\"--build-option and --global-option are deprecated.\",\n issue=11859,\n replacement=\"to use --config-settings\",\n gone_in=\"25.3\",\n )\n logger.warning(\n \"Implying --no-binary=:all: due to the presence of \"\n \"--build-option / --global-option. \"\n )\n options.format_control.disallow_binaries()\n",[],[100,509,516,523,475,544,1409,1451],{"_104":1459,"_96":1460,"_158":1461,"_160":1410,"_161":139,"_162":1462,"_164":165,"_106":1463,"_101":29,"_167":215,"_169":1464,"_170":25,"_171":-5,"_172":1465,"_99":1466},"061343fc-67fc-11f0-aedf-0224a6c84d84","req_set.py","061344c4-67fc-11f0-aedf-0224a6c84d84",208,["D",1753299257972],"import logging\nfrom collections import OrderedDict\nfrom typing import Dict, List\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.req.req_install import InstallRequirement\n\nlogger = logging.getLogger(__name__)\n\n\nclass RequirementSet:\n def __init__(self, check_supported_wheels: bool = True) -> None:\n \"\"\"Create a RequirementSet.\"\"\"\n\n self.requirements: Dict[str, InstallRequirement] = OrderedDict()\n self.check_supported_wheels = check_supported_wheels\n\n self.unnamed_requirements: List[InstallRequirement] = []\n\n def __str__(self) -> str:\n requirements = sorted(\n (req for req in self.requirements.values() if not req.comes_from),\n key=lambda req: canonicalize_name(req.name or \"\"),\n )\n return \" \".join(str(req.req) for req in requirements)\n\n def __repr__(self) -> str:\n requirements = sorted(\n self.requirements.values(),\n key=lambda req: canonicalize_name(req.name or \"\"),\n )\n\n format_string = \"<{classname} object; {count} requirement(s): {reqs}>\"\n return format_string.format(\n classname=self.__class__.__name__,\n count=len(requirements),\n reqs=\", \".join(str(req.req) for req in requirements),\n )\n\n def add_unnamed_requirement(self, install_req: InstallRequirement) -> None:\n assert not install_req.name\n self.unnamed_requirements.append(install_req)\n\n def add_named_requirement(self, install_req: InstallRequirement) -> None:\n assert install_req.name\n\n project_name = canonicalize_name(install_req.name)\n self.requirements[project_name] = install_req\n\n def has_requirement(self, name: str) -> bool:\n project_name = canonicalize_name(name)\n\n return (\n project_name in self.requirements\n and not self.requirements[project_name].constraint\n )\n\n def get_requirement(self, name: str) -> InstallRequirement:\n project_name = canonicalize_name(name)\n\n if project_name in self.requirements:\n return self.requirements[project_name]\n\n raise KeyError(f\"No project with the name {name!r}\")\n\n @property\n def all_requirements(self) -> List[InstallRequirement]:\n return self.unnamed_requirements + list(self.requirements.values())\n\n @property\n def requirements_to_install(self) -> List[InstallRequirement]:\n \"\"\"Return the list of requirements that need to be installed.\n\n TODO remove this property together with the legacy resolver, since the new\n resolver only returns requirements that need to be installed.\n \"\"\"\n return [\n install_req\n for install_req in self.all_requirements\n if not install_req.constraint and not install_req.satisfied_by\n ]\n",[],[100,509,516,523,475,544,1409,1460],{"_104":1468,"_96":1469,"_158":1470,"_160":1410,"_161":139,"_162":1471,"_164":165,"_106":1472,"_101":29,"_167":215,"_169":1473,"_170":25,"_171":-5,"_172":1474,"_99":1475},"061aacd2-67fc-11f0-928e-0224a6c84d84","req_uninstall.py","061aad7c-67fc-11f0-928e-0224a6c84d84",209,["D",1753299258010],"import functools\nimport os\nimport sys\nimport sysconfig\nfrom importlib.util import cache_from_source\nfrom typing import Any, Callable, Dict, Generator, Iterable, List, Optional, Set, Tuple\n\nfrom pip._internal.exceptions import LegacyDistutilsInstall, UninstallMissingRecord\nfrom pip._internal.locations import get_bin_prefix, get_bin_user\nfrom pip._internal.metadata import BaseDistribution\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.egg_link import egg_link_path_from_location\nfrom pip._internal.utils.logging import getLogger, indent_log\nfrom pip._internal.utils.misc import ask, normalize_path, renames, rmtree\nfrom pip._internal.utils.temp_dir import AdjacentTempDirectory, TempDirectory\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\nlogger = getLogger(__name__)\n\n\ndef _script_names(\n bin_dir: str, script_name: str, is_gui: bool\n) -> Generator[str, None, None]:\n \"\"\"Create the fully qualified name of the files created by\n {console,gui}_scripts for the given ``dist``.\n Returns the list of file names\n \"\"\"\n exe_name = os.path.join(bin_dir, script_name)\n yield exe_name\n if not WINDOWS:\n return\n yield f\"{exe_name}.exe\"\n yield f\"{exe_name}.exe.manifest\"\n if is_gui:\n yield f\"{exe_name}-script.pyw\"\n else:\n yield f\"{exe_name}-script.py\"\n\n\ndef _unique(\n fn: Callable[..., Generator[Any, None, None]],\n) -> Callable[..., Generator[Any, None, None]]:\n @functools.wraps(fn)\n def unique(*args: Any, **kw: Any) -> Generator[Any, None, None]:\n seen: Set[Any] = set()\n for item in fn(*args, **kw):\n if item not in seen:\n seen.add(item)\n yield item\n\n return unique\n\n\n@_unique\ndef uninstallation_paths(dist: BaseDistribution) -> Generator[str, None, None]:\n \"\"\"\n Yield all the uninstallation paths for dist based on RECORD-without-.py[co]\n\n Yield paths to all the files in RECORD. For each .py file in RECORD, add\n the .pyc and .pyo in the same directory.\n\n UninstallPathSet.add() takes care of the __pycache__ .py[co].\n\n If RECORD is not found, raises an error,\n with possible information from the INSTALLER file.\n\n https://packaging.python.org/specifications/recording-installed-packages/\n \"\"\"\n location = dist.location\n assert location is not None, \"not installed\"\n\n entries = dist.iter_declared_entries()\n if entries is None:\n raise UninstallMissingRecord(distribution=dist)\n\n for entry in entries:\n path = os.path.join(location, entry)\n yield path\n if path.endswith(\".py\"):\n dn, fn = os.path.split(path)\n base = fn[:-3]\n path = os.path.join(dn, base + \".pyc\")\n yield path\n path = os.path.join(dn, base + \".pyo\")\n yield path\n\n\ndef compact(paths: Iterable[str]) -> Set[str]:\n \"\"\"Compact a path set to contain the minimal number of paths\n necessary to contain all paths in the set. If /a/path/ and\n /a/path/to/a/file.txt are both in the set, leave only the\n shorter path.\"\"\"\n\n sep = os.path.sep\n short_paths: Set[str] = set()\n for path in sorted(paths, key=len):\n should_skip = any(\n path.startswith(shortpath.rstrip(\"*\"))\n and path[len(shortpath.rstrip(\"*\").rstrip(sep))] == sep\n for shortpath in short_paths\n )\n if not should_skip:\n short_paths.add(path)\n return short_paths\n\n\ndef compress_for_rename(paths: Iterable[str]) -> Set[str]:\n \"\"\"Returns a set containing the paths that need to be renamed.\n\n This set may include directories when the original sequence of paths\n included every file on disk.\n \"\"\"\n case_map = {os.path.normcase(p): p for p in paths}\n remaining = set(case_map)\n unchecked = sorted({os.path.split(p)[0] for p in case_map.values()}, key=len)\n wildcards: Set[str] = set()\n\n def norm_join(*a: str) -> str:\n return os.path.normcase(os.path.join(*a))\n\n for root in unchecked:\n if any(os.path.normcase(root).startswith(w) for w in wildcards):\n # This directory has already been handled.\n continue\n\n all_files: Set[str] = set()\n all_subdirs: Set[str] = set()\n for dirname, subdirs, files in os.walk(root):\n all_subdirs.update(norm_join(root, dirname, d) for d in subdirs)\n all_files.update(norm_join(root, dirname, f) for f in files)\n # If all the files we found are in our remaining set of files to\n # remove, then remove them from the latter set and add a wildcard\n # for the directory.\n if not (all_files - remaining):\n remaining.difference_update(all_files)\n wildcards.add(root + os.sep)\n\n return set(map(case_map.__getitem__, remaining)) | wildcards\n\n\ndef compress_for_output_listing(paths: Iterable[str]) -> Tuple[Set[str], Set[str]]:\n \"\"\"Returns a tuple of 2 sets of which paths to display to user\n\n The first set contains paths that would be deleted. Files of a package\n are not added and the top-level directory of the package has a '*' added\n at the end - to signify that all it's contents are removed.\n\n The second set contains files that would have been skipped in the above\n folders.\n \"\"\"\n\n will_remove = set(paths)\n will_skip = set()\n\n # Determine folders and files\n folders = set()\n files = set()\n for path in will_remove:\n if path.endswith(\".pyc\"):\n continue\n if path.endswith(\"__init__.py\") or \".dist-info\" in path:\n folders.add(os.path.dirname(path))\n files.add(path)\n\n _normcased_files = set(map(os.path.normcase, files))\n\n folders = compact(folders)\n\n # This walks the tree using os.walk to not miss extra folders\n # that might get added.\n for folder in folders:\n for dirpath, _, dirfiles in os.walk(folder):\n for fname in dirfiles:\n if fname.endswith(\".pyc\"):\n continue\n\n file_ = os.path.join(dirpath, fname)\n if (\n os.path.isfile(file_)\n and os.path.normcase(file_) not in _normcased_files\n ):\n # We are skipping this file. Add it to the set.\n will_skip.add(file_)\n\n will_remove = files | {os.path.join(folder, \"*\") for folder in folders}\n\n return will_remove, will_skip\n\n\nclass StashedUninstallPathSet:\n \"\"\"A set of file rename operations to stash files while\n tentatively uninstalling them.\"\"\"\n\n def __init__(self) -> None:\n # Mapping from source file root to [Adjacent]TempDirectory\n # for files under that directory.\n self._save_dirs: Dict[str, TempDirectory] = {}\n # (old path, new path) tuples for each move that may need\n # to be undone.\n self._moves: List[Tuple[str, str]] = []\n\n def _get_directory_stash(self, path: str) -> str:\n \"\"\"Stashes a directory.\n\n Directories are stashed adjacent to their original location if\n possible, or else moved/copied into the user's temp dir.\"\"\"\n\n try:\n save_dir: TempDirectory = AdjacentTempDirectory(path)\n except OSError:\n save_dir = TempDirectory(kind=\"uninstall\")\n self._save_dirs[os.path.normcase(path)] = save_dir\n\n return save_dir.path\n\n def _get_file_stash(self, path: str) -> str:\n \"\"\"Stashes a file.\n\n If no root has been provided, one will be created for the directory\n in the user's temp directory.\"\"\"\n path = os.path.normcase(path)\n head, old_head = os.path.dirname(path), None\n save_dir = None\n\n while head != old_head:\n try:\n save_dir = self._save_dirs[head]\n break\n except KeyError:\n pass\n head, old_head = os.path.dirname(head), head\n else:\n # Did not find any suitable root\n head = os.path.dirname(path)\n save_dir = TempDirectory(kind=\"uninstall\")\n self._save_dirs[head] = save_dir\n\n relpath = os.path.relpath(path, head)\n if relpath and relpath != os.path.curdir:\n return os.path.join(save_dir.path, relpath)\n return save_dir.path\n\n def stash(self, path: str) -> str:\n \"\"\"Stashes the directory or file and returns its new location.\n Handle symlinks as files to avoid modifying the symlink targets.\n \"\"\"\n path_is_dir = os.path.isdir(path) and not os.path.islink(path)\n if path_is_dir:\n new_path = self._get_directory_stash(path)\n else:\n new_path = self._get_file_stash(path)\n\n self._moves.append((path, new_path))\n if path_is_dir and os.path.isdir(new_path):\n # If we're moving a directory, we need to\n # remove the destination first or else it will be\n # moved to inside the existing directory.\n # We just created new_path ourselves, so it will\n # be removable.\n os.rmdir(new_path)\n renames(path, new_path)\n return new_path\n\n def commit(self) -> None:\n \"\"\"Commits the uninstall by removing stashed files.\"\"\"\n for save_dir in self._save_dirs.values():\n save_dir.cleanup()\n self._moves = []\n self._save_dirs = {}\n\n def rollback(self) -> None:\n \"\"\"Undoes the uninstall by moving stashed files back.\"\"\"\n for p in self._moves:\n logger.info(\"Moving to %s\\n from %s\", *p)\n\n for new_path, path in self._moves:\n try:\n logger.debug(\"Replacing %s from %s\", new_path, path)\n if os.path.isfile(new_path) or os.path.islink(new_path):\n os.unlink(new_path)\n elif os.path.isdir(new_path):\n rmtree(new_path)\n renames(path, new_path)\n except OSError as ex:\n logger.error(\"Failed to restore %s\", new_path)\n logger.debug(\"Exception: %s\", ex)\n\n self.commit()\n\n @property\n def can_rollback(self) -> bool:\n return bool(self._moves)\n\n\nclass UninstallPathSet:\n \"\"\"A set of file paths to be removed in the uninstallation of a\n requirement.\"\"\"\n\n def __init__(self, dist: BaseDistribution) -> None:\n self._paths: Set[str] = set()\n self._refuse: Set[str] = set()\n self._pth: Dict[str, UninstallPthEntries] = {}\n self._dist = dist\n self._moved_paths = StashedUninstallPathSet()\n # Create local cache of normalize_path results. Creating an UninstallPathSet\n # can result in hundreds/thousands of redundant calls to normalize_path with\n # the same args, which hurts performance.\n self._normalize_path_cached = functools.lru_cache(normalize_path)\n\n def _permitted(self, path: str) -> bool:\n \"\"\"\n Return True if the given path is one we are permitted to\n remove/modify, False otherwise.\n\n \"\"\"\n # aka is_local, but caching normalized sys.prefix\n if not running_under_virtualenv():\n return True\n return path.startswith(self._normalize_path_cached(sys.prefix))\n\n def add(self, path: str) -> None:\n head, tail = os.path.split(path)\n\n # we normalize the head to resolve parent directory symlinks, but not\n # the tail, since we only want to uninstall symlinks, not their targets\n path = os.path.join(self._normalize_path_cached(head), os.path.normcase(tail))\n\n if not os.path.exists(path):\n return\n if self._permitted(path):\n self._paths.add(path)\n else:\n self._refuse.add(path)\n\n # __pycache__ files can show up after 'installed-files.txt' is created,\n # due to imports\n if os.path.splitext(path)[1] == \".py\":\n self.add(cache_from_source(path))\n\n def add_pth(self, pth_file: str, entry: str) -> None:\n pth_file = self._normalize_path_cached(pth_file)\n if self._permitted(pth_file):\n if pth_file not in self._pth:\n self._pth[pth_file] = UninstallPthEntries(pth_file)\n self._pth[pth_file].add(entry)\n else:\n self._refuse.add(pth_file)\n\n def remove(self, auto_confirm: bool = False, verbose: bool = False) -> None:\n \"\"\"Remove paths in ``self._paths`` with confirmation (unless\n ``auto_confirm`` is True).\"\"\"\n\n if not self._paths:\n logger.info(\n \"Can't uninstall '%s'. No files were found to uninstall.\",\n self._dist.raw_name,\n )\n return\n\n dist_name_version = f\"{self._dist.raw_name}-{self._dist.raw_version}\"\n logger.info(\"Uninstalling %s:\", dist_name_version)\n\n with indent_log():\n if auto_confirm or self._allowed_to_proceed(verbose):\n moved = self._moved_paths\n\n for_rename = compress_for_rename(self._paths)\n\n for path in sorted(compact(for_rename)):\n moved.stash(path)\n logger.verbose(\"Removing file or directory %s\", path)\n\n for pth in self._pth.values():\n pth.remove()\n\n logger.info(\"Successfully uninstalled %s\", dist_name_version)\n\n def _allowed_to_proceed(self, verbose: bool) -> bool:\n \"\"\"Display which files would be deleted and prompt for confirmation\"\"\"\n\n def _display(msg: str, paths: Iterable[str]) -> None:\n if not paths:\n return\n\n logger.info(msg)\n with indent_log():\n for path in sorted(compact(paths)):\n logger.info(path)\n\n if not verbose:\n will_remove, will_skip = compress_for_output_listing(self._paths)\n else:\n # In verbose mode, display all the files that are going to be\n # deleted.\n will_remove = set(self._paths)\n will_skip = set()\n\n _display(\"Would remove:\", will_remove)\n _display(\"Would not remove (might be manually added):\", will_skip)\n _display(\"Would not remove (outside of prefix):\", self._refuse)\n if verbose:\n _display(\"Will actually move:\", compress_for_rename(self._paths))\n\n return ask(\"Proceed (Y/n)? \", (\"y\", \"n\", \"\")) != \"n\"\n\n def rollback(self) -> None:\n \"\"\"Rollback the changes previously made by remove().\"\"\"\n if not self._moved_paths.can_rollback:\n logger.error(\n \"Can't roll back %s; was not uninstalled\",\n self._dist.raw_name,\n )\n return\n logger.info(\"Rolling back uninstall of %s\", self._dist.raw_name)\n self._moved_paths.rollback()\n for pth in self._pth.values():\n pth.rollback()\n\n def commit(self) -> None:\n \"\"\"Remove temporary save dir: rollback will no longer be possible.\"\"\"\n self._moved_paths.commit()\n\n @classmethod\n def from_dist(cls, dist: BaseDistribution) -> \"UninstallPathSet\":\n dist_location = dist.location\n info_location = dist.info_location\n if dist_location is None:\n logger.info(\n \"Not uninstalling %s since it is not installed\",\n dist.canonical_name,\n )\n return cls(dist)\n\n normalized_dist_location = normalize_path(dist_location)\n if not dist.local:\n logger.info(\n \"Not uninstalling %s at %s, outside environment %s\",\n dist.canonical_name,\n normalized_dist_location,\n sys.prefix,\n )\n return cls(dist)\n\n if normalized_dist_location in {\n p\n for p in {sysconfig.get_path(\"stdlib\"), sysconfig.get_path(\"platstdlib\")}\n if p\n }:\n logger.info(\n \"Not uninstalling %s at %s, as it is in the standard library.\",\n dist.canonical_name,\n normalized_dist_location,\n )\n return cls(dist)\n\n paths_to_remove = cls(dist)\n develop_egg_link = egg_link_path_from_location(dist.raw_name)\n\n # Distribution is installed with metadata in a \"flat\" .egg-info\n # directory. This means it is not a modern .dist-info installation, an\n # egg, or legacy editable.\n setuptools_flat_installation = (\n dist.installed_with_setuptools_egg_info\n and info_location is not None\n and os.path.exists(info_location)\n # If dist is editable and the location points to a ``.egg-info``,\n # we are in fact in the legacy editable case.\n and not info_location.endswith(f\"{dist.setuptools_filename}.egg-info\")\n )\n\n # Uninstall cases order do matter as in the case of 2 installs of the\n # same package, pip needs to uninstall the currently detected version\n if setuptools_flat_installation:\n if info_location is not None:\n paths_to_remove.add(info_location)\n installed_files = dist.iter_declared_entries()\n if installed_files is not None:\n for installed_file in installed_files:\n paths_to_remove.add(os.path.join(dist_location, installed_file))\n # FIXME: need a test for this elif block\n # occurs with --single-version-externally-managed/--record outside\n # of pip\n elif dist.is_file(\"top_level.txt\"):\n try:\n namespace_packages = dist.read_text(\"namespace_packages.txt\")\n except FileNotFoundError:\n namespaces = []\n else:\n namespaces = namespace_packages.splitlines(keepends=False)\n for top_level_pkg in [\n p\n for p in dist.read_text(\"top_level.txt\").splitlines()\n if p and p not in namespaces\n ]:\n path = os.path.join(dist_location, top_level_pkg)\n paths_to_remove.add(path)\n paths_to_remove.add(f\"{path}.py\")\n paths_to_remove.add(f\"{path}.pyc\")\n paths_to_remove.add(f\"{path}.pyo\")\n\n elif dist.installed_by_distutils:\n raise LegacyDistutilsInstall(distribution=dist)\n\n elif dist.installed_as_egg:\n # package installed by easy_install\n # We cannot match on dist.egg_name because it can slightly vary\n # i.e. setuptools-0.6c11-py2.6.egg vs setuptools-0.6rc11-py2.6.egg\n # XXX We use normalized_dist_location because dist_location my contain\n # a trailing / if the distribution is a zipped egg\n # (which is not a directory).\n paths_to_remove.add(normalized_dist_location)\n easy_install_egg = os.path.split(normalized_dist_location)[1]\n easy_install_pth = os.path.join(\n os.path.dirname(normalized_dist_location),\n \"easy-install.pth\",\n )\n paths_to_remove.add_pth(easy_install_pth, \"./\" + easy_install_egg)\n\n elif dist.installed_with_dist_info:\n for path in uninstallation_paths(dist):\n paths_to_remove.add(path)\n\n elif develop_egg_link:\n # PEP 660 modern editable is handled in the ``.dist-info`` case\n # above, so this only covers the setuptools-style editable.\n with open(develop_egg_link) as fh:\n link_pointer = os.path.normcase(fh.readline().strip())\n normalized_link_pointer = paths_to_remove._normalize_path_cached(\n link_pointer\n )\n assert os.path.samefile(\n normalized_link_pointer, normalized_dist_location\n ), (\n f\"Egg-link {develop_egg_link} (to {link_pointer}) does not match \"\n f\"installed location of {dist.raw_name} (at {dist_location})\"\n )\n paths_to_remove.add(develop_egg_link)\n easy_install_pth = os.path.join(\n os.path.dirname(develop_egg_link), \"easy-install.pth\"\n )\n paths_to_remove.add_pth(easy_install_pth, dist_location)\n\n else:\n logger.debug(\n \"Not sure how to uninstall: %s - Check: %s\",\n dist,\n dist_location,\n )\n\n if dist.in_usersite:\n bin_dir = get_bin_user()\n else:\n bin_dir = get_bin_prefix()\n\n # find distutils scripts= scripts\n try:\n for script in dist.iter_distutils_script_names():\n paths_to_remove.add(os.path.join(bin_dir, script))\n if WINDOWS:\n paths_to_remove.add(os.path.join(bin_dir, f\"{script}.bat\"))\n except (FileNotFoundError, NotADirectoryError):\n pass\n\n # find console_scripts and gui_scripts\n def iter_scripts_to_remove(\n dist: BaseDistribution,\n bin_dir: str,\n ) -> Generator[str, None, None]:\n for entry_point in dist.iter_entry_points():\n if entry_point.group == \"console_scripts\":\n yield from _script_names(bin_dir, entry_point.name, False)\n elif entry_point.group == \"gui_scripts\":\n yield from _script_names(bin_dir, entry_point.name, True)\n\n for s in iter_scripts_to_remove(dist, bin_dir):\n paths_to_remove.add(s)\n\n return paths_to_remove\n\n\nclass UninstallPthEntries:\n def __init__(self, pth_file: str) -> None:\n self.file = pth_file\n self.entries: Set[str] = set()\n self._saved_lines: Optional[List[bytes]] = None\n\n def add(self, entry: str) -> None:\n entry = os.path.normcase(entry)\n # On Windows, os.path.normcase converts the entry to use\n # backslashes. This is correct for entries that describe absolute\n # paths outside of site-packages, but all the others use forward\n # slashes.\n # os.path.splitdrive is used instead of os.path.isabs because isabs\n # treats non-absolute paths with drive letter markings like c:foo\\bar\n # as absolute paths. It also does not recognize UNC paths if they don't\n # have more than \"\\\\sever\\share\". Valid examples: \"\\\\server\\share\\\" or\n # \"\\\\server\\share\\folder\".\n if WINDOWS and not os.path.splitdrive(entry)[0]:\n entry = entry.replace(\"\\\\\", \"/\")\n self.entries.add(entry)\n\n def remove(self) -> None:\n logger.verbose(\"Removing pth entries from %s:\", self.file)\n\n # If the file doesn't exist, log a warning and return\n if not os.path.isfile(self.file):\n logger.warning(\"Cannot remove entries from nonexistent file %s\", self.file)\n return\n with open(self.file, \"rb\") as fh:\n # windows uses '\\r\\n' with py3k, but uses '\\n' with py2.x\n lines = fh.readlines()\n self._saved_lines = lines\n if any(b\"\\r\\n\" in line for line in lines):\n endline = \"\\r\\n\"\n else:\n endline = \"\\n\"\n # handle missing trailing newline\n if lines and not lines[-1].endswith(endline.encode(\"utf-8\")):\n lines[-1] = lines[-1] + endline.encode(\"utf-8\")\n for entry in self.entries:\n try:\n logger.verbose(\"Removing entry: %s\", entry)\n lines.remove((entry + endline).encode(\"utf-8\"))\n except ValueError:\n pass\n with open(self.file, \"wb\") as fh:\n fh.writelines(lines)\n\n def rollback(self) -> bool:\n if self._saved_lines is None:\n logger.error(\"Cannot roll back changes to %s, none were made\", self.file)\n return False\n logger.debug(\"Rolling %s back to previous state\", self.file)\n with open(self.file, \"wb\") as fh:\n fh.writelines(self._saved_lines)\n return True\n",[],[100,509,516,523,475,544,1409,1469],[100,509,516,523,475,544,1409],{"_104":1478,"_96":1479,"_158":1480,"_160":545,"_161":139,"_162":1481,"_164":165,"_106":1482,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1483,"_99":1587},"fcb8efe6-67fb-11f0-a988-0224a6c84d84","resolution","fcb8f07c-67fb-11f0-a988-0224a6c84d84",63,["D",1753299242274],[1484,1501,1579],{"_104":1485,"_96":1486,"_158":1487,"_160":1480,"_161":139,"_162":1488,"_164":165,"_106":1489,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1490,"_99":1500},"ff727bc6-67fb-11f0-8cd1-0224a6c84d84","legacy","ff727c8e-67fb-11f0-8cd1-0224a6c84d84",91,["D",1753299246858],[1491],{"_104":1492,"_96":1493,"_158":1494,"_160":1487,"_161":139,"_162":1495,"_164":165,"_106":1496,"_101":29,"_167":215,"_169":1497,"_170":25,"_171":-5,"_172":1498,"_99":1499},"0633d87e-67fc-11f0-95df-0224a6c84d84","resolver.py","0633d914-67fc-11f0-95df-0224a6c84d84",214,["D",1753299258189],"\"\"\"Dependency Resolution\n\nThe dependency resolution in pip is performed as follows:\n\nfor top-level requirements:\n a. only one spec allowed per project, regardless of conflicts or not.\n otherwise a \"double requirement\" exception is raised\n b. they override sub-dependency requirements.\nfor sub-dependencies\n a. \"first found, wins\" (where the order is breadth first)\n\"\"\"\n\nimport logging\nimport sys\nfrom collections import defaultdict\nfrom itertools import chain\nfrom typing import DefaultDict, Iterable, List, Optional, Set, Tuple\n\nfrom pip._vendor.packaging import specifiers\nfrom pip._vendor.packaging.requirements import Requirement\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.exceptions import (\n BestVersionAlreadyInstalled,\n DistributionNotFound,\n HashError,\n HashErrors,\n InstallationError,\n NoneMetadataError,\n UnsupportedPythonVersion,\n)\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.metadata import BaseDistribution\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.operations.prepare import RequirementPreparer\nfrom pip._internal.req.req_install import (\n InstallRequirement,\n check_invalid_constraint_type,\n)\nfrom pip._internal.req.req_set import RequirementSet\nfrom pip._internal.resolution.base import BaseResolver, InstallRequirementProvider\nfrom pip._internal.utils import compatibility_tags\nfrom pip._internal.utils.compatibility_tags import get_supported\nfrom pip._internal.utils.direct_url_helpers import direct_url_from_link\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import normalize_version_info\nfrom pip._internal.utils.packaging import check_requires_python\n\nlogger = logging.getLogger(__name__)\n\nDiscoveredDependencies = DefaultDict[Optional[str], List[InstallRequirement]]\n\n\ndef _check_dist_requires_python(\n dist: BaseDistribution,\n version_info: Tuple[int, int, int],\n ignore_requires_python: bool = False,\n) -> None:\n \"\"\"\n Check whether the given Python version is compatible with a distribution's\n \"Requires-Python\" value.\n\n :param version_info: A 3-tuple of ints representing the Python\n major-minor-micro version to check.\n :param ignore_requires_python: Whether to ignore the \"Requires-Python\"\n value if the given Python version isn't compatible.\n\n :raises UnsupportedPythonVersion: When the given Python version isn't\n compatible.\n \"\"\"\n # This idiosyncratically converts the SpecifierSet to str and let\n # check_requires_python then parse it again into SpecifierSet. But this\n # is the legacy resolver so I'm just not going to bother refactoring.\n try:\n requires_python = str(dist.requires_python)\n except FileNotFoundError as e:\n raise NoneMetadataError(dist, str(e))\n try:\n is_compatible = check_requires_python(\n requires_python,\n version_info=version_info,\n )\n except specifiers.InvalidSpecifier as exc:\n logger.warning(\n \"Package %r has an invalid Requires-Python: %s\", dist.raw_name, exc\n )\n return\n\n if is_compatible:\n return\n\n version = \".\".join(map(str, version_info))\n if ignore_requires_python:\n logger.debug(\n \"Ignoring failed Requires-Python check for package %r: %s not in %r\",\n dist.raw_name,\n version,\n requires_python,\n )\n return\n\n raise UnsupportedPythonVersion(\n f\"Package {dist.raw_name!r} requires a different Python: \"\n f\"{version} not in {requires_python!r}\"\n )\n\n\nclass Resolver(BaseResolver):\n \"\"\"Resolves which packages need to be installed/uninstalled to perform \\\n the requested operation without breaking the requirements of any package.\n \"\"\"\n\n _allowed_strategies = {\"eager\", \"only-if-needed\", \"to-satisfy-only\"}\n\n def __init__(\n self,\n preparer: RequirementPreparer,\n finder: PackageFinder,\n wheel_cache: Optional[WheelCache],\n make_install_req: InstallRequirementProvider,\n use_user_site: bool,\n ignore_dependencies: bool,\n ignore_installed: bool,\n ignore_requires_python: bool,\n force_reinstall: bool,\n upgrade_strategy: str,\n py_version_info: Optional[Tuple[int, ...]] = None,\n ) -> None:\n super().__init__()\n assert upgrade_strategy in self._allowed_strategies\n\n if py_version_info is None:\n py_version_info = sys.version_info[:3]\n else:\n py_version_info = normalize_version_info(py_version_info)\n\n self._py_version_info = py_version_info\n\n self.preparer = preparer\n self.finder = finder\n self.wheel_cache = wheel_cache\n\n self.upgrade_strategy = upgrade_strategy\n self.force_reinstall = force_reinstall\n self.ignore_dependencies = ignore_dependencies\n self.ignore_installed = ignore_installed\n self.ignore_requires_python = ignore_requires_python\n self.use_user_site = use_user_site\n self._make_install_req = make_install_req\n\n self._discovered_dependencies: DiscoveredDependencies = defaultdict(list)\n\n def resolve(\n self, root_reqs: List[InstallRequirement], check_supported_wheels: bool\n ) -> RequirementSet:\n \"\"\"Resolve what operations need to be done\n\n As a side-effect of this method, the packages (and their dependencies)\n are downloaded, unpacked and prepared for installation. This\n preparation is done by ``pip.operations.prepare``.\n\n Once PyPI has static dependency metadata available, it would be\n possible to move the preparation to become a step separated from\n dependency resolution.\n \"\"\"\n requirement_set = RequirementSet(check_supported_wheels=check_supported_wheels)\n for req in root_reqs:\n if req.constraint:\n check_invalid_constraint_type(req)\n self._add_requirement_to_set(requirement_set, req)\n\n # Actually prepare the files, and collect any exceptions. Most hash\n # exceptions cannot be checked ahead of time, because\n # _populate_link() needs to be called before we can make decisions\n # based on link type.\n discovered_reqs: List[InstallRequirement] = []\n hash_errors = HashErrors()\n for req in chain(requirement_set.all_requirements, discovered_reqs):\n try:\n discovered_reqs.extend(self._resolve_one(requirement_set, req))\n except HashError as exc:\n exc.req = req\n hash_errors.append(exc)\n\n if hash_errors:\n raise hash_errors\n\n return requirement_set\n\n def _add_requirement_to_set(\n self,\n requirement_set: RequirementSet,\n install_req: InstallRequirement,\n parent_req_name: Optional[str] = None,\n extras_requested: Optional[Iterable[str]] = None,\n ) -> Tuple[List[InstallRequirement], Optional[InstallRequirement]]:\n \"\"\"Add install_req as a requirement to install.\n\n :param parent_req_name: The name of the requirement that needed this\n added. The name is used because when multiple unnamed requirements\n resolve to the same name, we could otherwise end up with dependency\n links that point outside the Requirements set. parent_req must\n already be added. Note that None implies that this is a user\n supplied requirement, vs an inferred one.\n :param extras_requested: an iterable of extras used to evaluate the\n environment markers.\n :return: Additional requirements to scan. That is either [] if\n the requirement is not applicable, or [install_req] if the\n requirement is applicable and has just been added.\n \"\"\"\n # If the markers do not match, ignore this requirement.\n if not install_req.match_markers(extras_requested):\n logger.info(\n \"Ignoring %s: markers '%s' don't match your environment\",\n install_req.name,\n install_req.markers,\n )\n return [], None\n\n # If the wheel is not supported, raise an error.\n # Should check this after filtering out based on environment markers to\n # allow specifying different wheels based on the environment/OS, in a\n # single requirements file.\n if install_req.link and install_req.link.is_wheel:\n wheel = Wheel(install_req.link.filename)\n tags = compatibility_tags.get_supported()\n if requirement_set.check_supported_wheels and not wheel.supported(tags):\n raise InstallationError(\n f\"{wheel.filename} is not a supported wheel on this platform.\"\n )\n\n # This next bit is really a sanity check.\n assert (\n not install_req.user_supplied or parent_req_name is None\n ), \"a user supplied req shouldn't have a parent\"\n\n # Unnamed requirements are scanned again and the requirement won't be\n # added as a dependency until after scanning.\n if not install_req.name:\n requirement_set.add_unnamed_requirement(install_req)\n return [install_req], None\n\n try:\n existing_req: Optional[InstallRequirement] = (\n requirement_set.get_requirement(install_req.name)\n )\n except KeyError:\n existing_req = None\n\n has_conflicting_requirement = (\n parent_req_name is None\n and existing_req\n and not existing_req.constraint\n and existing_req.extras == install_req.extras\n and existing_req.req\n and install_req.req\n and existing_req.req.specifier != install_req.req.specifier\n )\n if has_conflicting_requirement:\n raise InstallationError(\n f\"Double requirement given: {install_req} \"\n f\"(already in {existing_req}, name={install_req.name!r})\"\n )\n\n # When no existing requirement exists, add the requirement as a\n # dependency and it will be scanned again after.\n if not existing_req:\n requirement_set.add_named_requirement(install_req)\n # We'd want to rescan this requirement later\n return [install_req], install_req\n\n # Assume there's no need to scan, and that we've already\n # encountered this for scanning.\n if install_req.constraint or not existing_req.constraint:\n return [], existing_req\n\n does_not_satisfy_constraint = install_req.link and not (\n existing_req.link and install_req.link.path == existing_req.link.path\n )\n if does_not_satisfy_constraint:\n raise InstallationError(\n f\"Could not satisfy constraints for '{install_req.name}': \"\n \"installation from path or url cannot be \"\n \"constrained to a version\"\n )\n # If we're now installing a constraint, mark the existing\n # object for real installation.\n existing_req.constraint = False\n # If we're now installing a user supplied requirement,\n # mark the existing object as such.\n if install_req.user_supplied:\n existing_req.user_supplied = True\n existing_req.extras = tuple(\n sorted(set(existing_req.extras) | set(install_req.extras))\n )\n logger.debug(\n \"Setting %s extras to: %s\",\n existing_req,\n existing_req.extras,\n )\n # Return the existing requirement for addition to the parent and\n # scanning again.\n return [existing_req], existing_req\n\n def _is_upgrade_allowed(self, req: InstallRequirement) -> bool:\n if self.upgrade_strategy == \"to-satisfy-only\":\n return False\n elif self.upgrade_strategy == \"eager\":\n return True\n else:\n assert self.upgrade_strategy == \"only-if-needed\"\n return req.user_supplied or req.constraint\n\n def _set_req_to_reinstall(self, req: InstallRequirement) -> None:\n \"\"\"\n Set a requirement to be installed.\n \"\"\"\n # Don't uninstall the conflict if doing a user install and the\n # conflict is not a user install.\n assert req.satisfied_by is not None\n if not self.use_user_site or req.satisfied_by.in_usersite:\n req.should_reinstall = True\n req.satisfied_by = None\n\n def _check_skip_installed(\n self, req_to_install: InstallRequirement\n ) -> Optional[str]:\n \"\"\"Check if req_to_install should be skipped.\n\n This will check if the req is installed, and whether we should upgrade\n or reinstall it, taking into account all the relevant user options.\n\n After calling this req_to_install will only have satisfied_by set to\n None if the req_to_install is to be upgraded/reinstalled etc. Any\n other value will be a dist recording the current thing installed that\n satisfies the requirement.\n\n Note that for vcs urls and the like we can't assess skipping in this\n routine - we simply identify that we need to pull the thing down,\n then later on it is pulled down and introspected to assess upgrade/\n reinstalls etc.\n\n :return: A text reason for why it was skipped, or None.\n \"\"\"\n if self.ignore_installed:\n return None\n\n req_to_install.check_if_exists(self.use_user_site)\n if not req_to_install.satisfied_by:\n return None\n\n if self.force_reinstall:\n self._set_req_to_reinstall(req_to_install)\n return None\n\n if not self._is_upgrade_allowed(req_to_install):\n if self.upgrade_strategy == \"only-if-needed\":\n return \"already satisfied, skipping upgrade\"\n return \"already satisfied\"\n\n # Check for the possibility of an upgrade. For link-based\n # requirements we have to pull the tree down and inspect to assess\n # the version #, so it's handled way down.\n if not req_to_install.link:\n try:\n self.finder.find_requirement(req_to_install, upgrade=True)\n except BestVersionAlreadyInstalled:\n # Then the best version is installed.\n return \"already up-to-date\"\n except DistributionNotFound:\n # No distribution found, so we squash the error. It will\n # be raised later when we re-try later to do the install.\n # Why don't we just raise here?\n pass\n\n self._set_req_to_reinstall(req_to_install)\n return None\n\n def _find_requirement_link(self, req: InstallRequirement) -> Optional[Link]:\n upgrade = self._is_upgrade_allowed(req)\n best_candidate = self.finder.find_requirement(req, upgrade)\n if not best_candidate:\n return None\n\n # Log a warning per PEP 592 if necessary before returning.\n link = best_candidate.link\n if link.is_yanked:\n reason = link.yanked_reason or \"\"\n msg = (\n # Mark this as a unicode string to prevent\n # \"UnicodeEncodeError: 'ascii' codec can't encode character\"\n # in Python 2 when the reason contains non-ascii characters.\n \"The candidate selected for download or install is a \"\n f\"yanked version: {best_candidate}\\n\"\n f\"Reason for being yanked: {reason}\"\n )\n logger.warning(msg)\n\n return link\n\n def _populate_link(self, req: InstallRequirement) -> None:\n \"\"\"Ensure that if a link can be found for this, that it is found.\n\n Note that req.link may still be None - if the requirement is already\n installed and not needed to be upgraded based on the return value of\n _is_upgrade_allowed().\n\n If preparer.require_hashes is True, don't use the wheel cache, because\n cached wheels, always built locally, have different hashes than the\n files downloaded from the index server and thus throw false hash\n mismatches. Furthermore, cached wheels at present have undeterministic\n contents due to file modification times.\n \"\"\"\n if req.link is None:\n req.link = self._find_requirement_link(req)\n\n if self.wheel_cache is None or self.preparer.require_hashes:\n return\n\n assert req.link is not None, \"_find_requirement_link unexpectedly returned None\"\n cache_entry = self.wheel_cache.get_cache_entry(\n link=req.link,\n package_name=req.name,\n supported_tags=get_supported(),\n )\n if cache_entry is not None:\n logger.debug(\"Using cached wheel link: %s\", cache_entry.link)\n if req.link is req.original_link and cache_entry.persistent:\n req.cached_wheel_source_link = req.link\n if cache_entry.origin is not None:\n req.download_info = cache_entry.origin\n else:\n # Legacy cache entry that does not have origin.json.\n # download_info may miss the archive_info.hashes field.\n req.download_info = direct_url_from_link(\n req.link, link_is_in_wheel_cache=cache_entry.persistent\n )\n req.link = cache_entry.link\n\n def _get_dist_for(self, req: InstallRequirement) -> BaseDistribution:\n \"\"\"Takes a InstallRequirement and returns a single AbstractDist \\\n representing a prepared variant of the same.\n \"\"\"\n if req.editable:\n return self.preparer.prepare_editable_requirement(req)\n\n # satisfied_by is only evaluated by calling _check_skip_installed,\n # so it must be None here.\n assert req.satisfied_by is None\n skip_reason = self._check_skip_installed(req)\n\n if req.satisfied_by:\n return self.preparer.prepare_installed_requirement(req, skip_reason)\n\n # We eagerly populate the link, since that's our \"legacy\" behavior.\n self._populate_link(req)\n dist = self.preparer.prepare_linked_requirement(req)\n\n # NOTE\n # The following portion is for determining if a certain package is\n # going to be re-installed/upgraded or not and reporting to the user.\n # This should probably get cleaned up in a future refactor.\n\n # req.req is only avail after unpack for URL\n # pkgs repeat check_if_exists to uninstall-on-upgrade\n # (#14)\n if not self.ignore_installed:\n req.check_if_exists(self.use_user_site)\n\n if req.satisfied_by:\n should_modify = (\n self.upgrade_strategy != \"to-satisfy-only\"\n or self.force_reinstall\n or self.ignore_installed\n or req.link.scheme == \"file\"\n )\n if should_modify:\n self._set_req_to_reinstall(req)\n else:\n logger.info(\n \"Requirement already satisfied (use --upgrade to upgrade): %s\",\n req,\n )\n return dist\n\n def _resolve_one(\n self,\n requirement_set: RequirementSet,\n req_to_install: InstallRequirement,\n ) -> List[InstallRequirement]:\n \"\"\"Prepare a single requirements file.\n\n :return: A list of additional InstallRequirements to also install.\n \"\"\"\n # Tell user what we are doing for this requirement:\n # obtain (editable), skipping, processing (local url), collecting\n # (remote url or package name)\n if req_to_install.constraint or req_to_install.prepared:\n return []\n\n req_to_install.prepared = True\n\n # Parse and return dependencies\n dist = self._get_dist_for(req_to_install)\n # This will raise UnsupportedPythonVersion if the given Python\n # version isn't compatible with the distribution's Requires-Python.\n _check_dist_requires_python(\n dist,\n version_info=self._py_version_info,\n ignore_requires_python=self.ignore_requires_python,\n )\n\n more_reqs: List[InstallRequirement] = []\n\n def add_req(subreq: Requirement, extras_requested: Iterable[str]) -> None:\n # This idiosyncratically converts the Requirement to str and let\n # make_install_req then parse it again into Requirement. But this is\n # the legacy resolver so I'm just not going to bother refactoring.\n sub_install_req = self._make_install_req(str(subreq), req_to_install)\n parent_req_name = req_to_install.name\n to_scan_again, add_to_parent = self._add_requirement_to_set(\n requirement_set,\n sub_install_req,\n parent_req_name=parent_req_name,\n extras_requested=extras_requested,\n )\n if parent_req_name and add_to_parent:\n self._discovered_dependencies[parent_req_name].append(add_to_parent)\n more_reqs.extend(to_scan_again)\n\n with indent_log():\n # We add req_to_install before its dependencies, so that we\n # can refer to it when adding dependencies.\n assert req_to_install.name is not None\n if not requirement_set.has_requirement(req_to_install.name):\n # 'unnamed' requirements will get added here\n # 'unnamed' requirements can only come from being directly\n # provided by the user.\n assert req_to_install.user_supplied\n self._add_requirement_to_set(\n requirement_set, req_to_install, parent_req_name=None\n )\n\n if not self.ignore_dependencies:\n if req_to_install.extras:\n logger.debug(\n \"Installing extra requirements: %r\",\n \",\".join(req_to_install.extras),\n )\n missing_requested = sorted(\n set(req_to_install.extras) - set(dist.iter_provided_extras())\n )\n for missing in missing_requested:\n logger.warning(\n \"%s %s does not provide the extra '%s'\",\n dist.raw_name,\n dist.version,\n missing,\n )\n\n available_requested = sorted(\n set(dist.iter_provided_extras()) & set(req_to_install.extras)\n )\n for subreq in dist.iter_dependencies(available_requested):\n add_req(subreq, extras_requested=available_requested)\n\n return more_reqs\n\n def get_installation_order(\n self, req_set: RequirementSet\n ) -> List[InstallRequirement]:\n \"\"\"Create the installation order.\n\n The installation order is topological - requirements are installed\n before the requiring thing. We break cycles at an arbitrary point,\n and make no other guarantees.\n \"\"\"\n # The current implementation, which we may change at any point\n # installs the user specified things in the order given, except when\n # dependencies must come earlier to achieve topological order.\n order = []\n ordered_reqs: Set[InstallRequirement] = set()\n\n def schedule(req: InstallRequirement) -> None:\n if req.satisfied_by or req in ordered_reqs:\n return\n if req.constraint:\n return\n ordered_reqs.add(req)\n for dep in self._discovered_dependencies[req.name]:\n schedule(dep)\n order.append(req)\n\n for install_req in req_set.requirements.values():\n schedule(install_req)\n return order\n",[],[100,509,516,523,475,544,1479,1486,1493],[100,509,516,523,475,544,1479,1486],{"_104":1502,"_96":1503,"_158":1504,"_160":1480,"_161":139,"_162":1505,"_164":165,"_106":1506,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1507,"_99":1578},"ff89bade-67fb-11f0-a7d9-0224a6c84d84","resolvelib","ff89bb92-67fb-11f0-a7d9-0224a6c84d84",92,["D",1753299247008],[1508,1516,1525,1534,1543,1552,1561,1570],{"_104":1509,"_96":868,"_158":1510,"_160":1504,"_161":139,"_162":1511,"_164":165,"_106":1512,"_101":29,"_167":215,"_169":1513,"_170":25,"_171":-5,"_172":1514,"_99":1515},"06645da0-67fc-11f0-84bb-0224a6c84d84","06645e7c-67fc-11f0-84bb-0224a6c84d84",223,["D",1753299258508],"from dataclasses import dataclass\nfrom typing import FrozenSet, Iterable, Optional, Tuple\n\nfrom pip._vendor.packaging.specifiers import SpecifierSet\nfrom pip._vendor.packaging.utils import NormalizedName\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.models.link import Link, links_equivalent\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.hashes import Hashes\n\nCandidateLookup = Tuple[Optional[\"Candidate\"], Optional[InstallRequirement]]\n\n\ndef format_name(project: NormalizedName, extras: FrozenSet[NormalizedName]) -> str:\n if not extras:\n return project\n extras_expr = \",\".join(sorted(extras))\n return f\"{project}[{extras_expr}]\"\n\n\n@dataclass(frozen=True)\nclass Constraint:\n specifier: SpecifierSet\n hashes: Hashes\n links: FrozenSet[Link]\n\n @classmethod\n def empty(cls) -> \"Constraint\":\n return Constraint(SpecifierSet(), Hashes(), frozenset())\n\n @classmethod\n def from_ireq(cls, ireq: InstallRequirement) -> \"Constraint\":\n links = frozenset([ireq.link]) if ireq.link else frozenset()\n return Constraint(ireq.specifier, ireq.hashes(trust_internet=False), links)\n\n def __bool__(self) -> bool:\n return bool(self.specifier) or bool(self.hashes) or bool(self.links)\n\n def __and__(self, other: InstallRequirement) -> \"Constraint\":\n if not isinstance(other, InstallRequirement):\n return NotImplemented\n specifier = self.specifier & other.specifier\n hashes = self.hashes & other.hashes(trust_internet=False)\n links = self.links\n if other.link:\n links = links.union([other.link])\n return Constraint(specifier, hashes, links)\n\n def is_satisfied_by(self, candidate: \"Candidate\") -> bool:\n # Reject if there are any mismatched URL constraints on this package.\n if self.links and not all(_match_link(link, candidate) for link in self.links):\n return False\n # We can safely always allow prereleases here since PackageFinder\n # already implements the prerelease logic, and would have filtered out\n # prerelease candidates if the user does not expect them.\n return self.specifier.contains(candidate.version, prereleases=True)\n\n\nclass Requirement:\n @property\n def project_name(self) -> NormalizedName:\n \"\"\"The \"project name\" of a requirement.\n\n This is different from ``name`` if this requirement contains extras,\n in which case ``name`` would contain the ``[...]`` part, while this\n refers to the name of the project.\n \"\"\"\n raise NotImplementedError(\"Subclass should override\")\n\n @property\n def name(self) -> str:\n \"\"\"The name identifying this requirement in the resolver.\n\n This is different from ``project_name`` if this requirement contains\n extras, where ``project_name`` would not contain the ``[...]`` part.\n \"\"\"\n raise NotImplementedError(\"Subclass should override\")\n\n def is_satisfied_by(self, candidate: \"Candidate\") -> bool:\n return False\n\n def get_candidate_lookup(self) -> CandidateLookup:\n raise NotImplementedError(\"Subclass should override\")\n\n def format_for_error(self) -> str:\n raise NotImplementedError(\"Subclass should override\")\n\n\ndef _match_link(link: Link, candidate: \"Candidate\") -> bool:\n if candidate.source_link:\n return links_equivalent(link, candidate.source_link)\n return False\n\n\nclass Candidate:\n @property\n def project_name(self) -> NormalizedName:\n \"\"\"The \"project name\" of the candidate.\n\n This is different from ``name`` if this candidate contains extras,\n in which case ``name`` would contain the ``[...]`` part, while this\n refers to the name of the project.\n \"\"\"\n raise NotImplementedError(\"Override in subclass\")\n\n @property\n def name(self) -> str:\n \"\"\"The name identifying this candidate in the resolver.\n\n This is different from ``project_name`` if this candidate contains\n extras, where ``project_name`` would not contain the ``[...]`` part.\n \"\"\"\n raise NotImplementedError(\"Override in subclass\")\n\n @property\n def version(self) -> Version:\n raise NotImplementedError(\"Override in subclass\")\n\n @property\n def is_installed(self) -> bool:\n raise NotImplementedError(\"Override in subclass\")\n\n @property\n def is_editable(self) -> bool:\n raise NotImplementedError(\"Override in subclass\")\n\n @property\n def source_link(self) -> Optional[Link]:\n raise NotImplementedError(\"Override in subclass\")\n\n def iter_dependencies(self, with_requires: bool) -> Iterable[Optional[Requirement]]:\n raise NotImplementedError(\"Override in subclass\")\n\n def get_install_requirement(self) -> Optional[InstallRequirement]:\n raise NotImplementedError(\"Override in subclass\")\n\n def format_for_error(self) -> str:\n raise NotImplementedError(\"Subclass should override\")\n",[],[100,509,516,523,475,544,1479,1503,868],{"_104":1517,"_96":1518,"_158":1519,"_160":1504,"_161":139,"_162":1520,"_164":165,"_106":1521,"_101":29,"_167":215,"_169":1522,"_170":25,"_171":-5,"_172":1523,"_99":1524},"065e9668-67fc-11f0-8737-0224a6c84d84","candidates.py","065e9712-67fc-11f0-8737-0224a6c84d84",222,["D",1753299258468],"import logging\nimport sys\nfrom typing import TYPE_CHECKING, Any, FrozenSet, Iterable, Optional, Tuple, Union, cast\n\nfrom pip._vendor.packaging.requirements import InvalidRequirement\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import Version\n\nfrom pip._internal.exceptions import (\n HashError,\n InstallationSubprocessError,\n InvalidInstalledPackage,\n MetadataInconsistent,\n MetadataInvalid,\n)\nfrom pip._internal.metadata import BaseDistribution\nfrom pip._internal.models.link import Link, links_equivalent\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.req.constructors import (\n install_req_from_editable,\n install_req_from_line,\n)\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.direct_url_helpers import direct_url_from_link\nfrom pip._internal.utils.misc import normalize_version_info\n\nfrom .base import Candidate, Requirement, format_name\n\nif TYPE_CHECKING:\n from .factory import Factory\n\nlogger = logging.getLogger(__name__)\n\nBaseCandidate = Union[\n \"AlreadyInstalledCandidate\",\n \"EditableCandidate\",\n \"LinkCandidate\",\n]\n\n# Avoid conflicting with the PyPI package \"Python\".\nREQUIRES_PYTHON_IDENTIFIER = cast(NormalizedName, \"\")\n\n\ndef as_base_candidate(candidate: Candidate) -> Optional[BaseCandidate]:\n \"\"\"The runtime version of BaseCandidate.\"\"\"\n base_candidate_classes = (\n AlreadyInstalledCandidate,\n EditableCandidate,\n LinkCandidate,\n )\n if isinstance(candidate, base_candidate_classes):\n return candidate\n return None\n\n\ndef make_install_req_from_link(\n link: Link, template: InstallRequirement\n) -> InstallRequirement:\n assert not template.editable, \"template is editable\"\n if template.req:\n line = str(template.req)\n else:\n line = link.url\n ireq = install_req_from_line(\n line,\n user_supplied=template.user_supplied,\n comes_from=template.comes_from,\n use_pep517=template.use_pep517,\n isolated=template.isolated,\n constraint=template.constraint,\n global_options=template.global_options,\n hash_options=template.hash_options,\n config_settings=template.config_settings,\n )\n ireq.original_link = template.original_link\n ireq.link = link\n ireq.extras = template.extras\n return ireq\n\n\ndef make_install_req_from_editable(\n link: Link, template: InstallRequirement\n) -> InstallRequirement:\n assert template.editable, \"template not editable\"\n ireq = install_req_from_editable(\n link.url,\n user_supplied=template.user_supplied,\n comes_from=template.comes_from,\n use_pep517=template.use_pep517,\n isolated=template.isolated,\n constraint=template.constraint,\n permit_editable_wheels=template.permit_editable_wheels,\n global_options=template.global_options,\n hash_options=template.hash_options,\n config_settings=template.config_settings,\n )\n ireq.extras = template.extras\n return ireq\n\n\ndef _make_install_req_from_dist(\n dist: BaseDistribution, template: InstallRequirement\n) -> InstallRequirement:\n if template.req:\n line = str(template.req)\n elif template.link:\n line = f\"{dist.canonical_name} @ {template.link.url}\"\n else:\n line = f\"{dist.canonical_name}=={dist.version}\"\n ireq = install_req_from_line(\n line,\n user_supplied=template.user_supplied,\n comes_from=template.comes_from,\n use_pep517=template.use_pep517,\n isolated=template.isolated,\n constraint=template.constraint,\n global_options=template.global_options,\n hash_options=template.hash_options,\n config_settings=template.config_settings,\n )\n ireq.satisfied_by = dist\n return ireq\n\n\nclass _InstallRequirementBackedCandidate(Candidate):\n \"\"\"A candidate backed by an ``InstallRequirement``.\n\n This represents a package request with the target not being already\n in the environment, and needs to be fetched and installed. The backing\n ``InstallRequirement`` is responsible for most of the leg work; this\n class exposes appropriate information to the resolver.\n\n :param link: The link passed to the ``InstallRequirement``. The backing\n ``InstallRequirement`` will use this link to fetch the distribution.\n :param source_link: The link this candidate \"originates\" from. This is\n different from ``link`` when the link is found in the wheel cache.\n ``link`` would point to the wheel cache, while this points to the\n found remote link (e.g. from pypi.org).\n \"\"\"\n\n dist: BaseDistribution\n is_installed = False\n\n def __init__(\n self,\n link: Link,\n source_link: Link,\n ireq: InstallRequirement,\n factory: \"Factory\",\n name: Optional[NormalizedName] = None,\n version: Optional[Version] = None,\n ) -> None:\n self._link = link\n self._source_link = source_link\n self._factory = factory\n self._ireq = ireq\n self._name = name\n self._version = version\n self.dist = self._prepare()\n self._hash: Optional[int] = None\n\n def __str__(self) -> str:\n return f\"{self.name} {self.version}\"\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({str(self._link)!r})\"\n\n def __hash__(self) -> int:\n if self._hash is not None:\n return self._hash\n\n self._hash = hash((self.__class__, self._link))\n return self._hash\n\n def __eq__(self, other: Any) -> bool:\n if isinstance(other, self.__class__):\n return links_equivalent(self._link, other._link)\n return False\n\n @property\n def source_link(self) -> Optional[Link]:\n return self._source_link\n\n @property\n def project_name(self) -> NormalizedName:\n \"\"\"The normalised name of the project the candidate refers to\"\"\"\n if self._name is None:\n self._name = self.dist.canonical_name\n return self._name\n\n @property\n def name(self) -> str:\n return self.project_name\n\n @property\n def version(self) -> Version:\n if self._version is None:\n self._version = self.dist.version\n return self._version\n\n def format_for_error(self) -> str:\n return (\n f\"{self.name} {self.version} \"\n f\"(from {self._link.file_path if self._link.is_file else self._link})\"\n )\n\n def _prepare_distribution(self) -> BaseDistribution:\n raise NotImplementedError(\"Override in subclass\")\n\n def _check_metadata_consistency(self, dist: BaseDistribution) -> None:\n \"\"\"Check for consistency of project name and version of dist.\"\"\"\n if self._name is not None and self._name != dist.canonical_name:\n raise MetadataInconsistent(\n self._ireq,\n \"name\",\n self._name,\n dist.canonical_name,\n )\n if self._version is not None and self._version != dist.version:\n raise MetadataInconsistent(\n self._ireq,\n \"version\",\n str(self._version),\n str(dist.version),\n )\n # check dependencies are valid\n # TODO performance: this means we iterate the dependencies at least twice,\n # we may want to cache parsed Requires-Dist\n try:\n list(dist.iter_dependencies(list(dist.iter_provided_extras())))\n except InvalidRequirement as e:\n raise MetadataInvalid(self._ireq, str(e))\n\n def _prepare(self) -> BaseDistribution:\n try:\n dist = self._prepare_distribution()\n except HashError as e:\n # Provide HashError the underlying ireq that caused it. This\n # provides context for the resulting error message to show the\n # offending line to the user.\n e.req = self._ireq\n raise\n except InstallationSubprocessError as exc:\n # The output has been presented already, so don't duplicate it.\n exc.context = \"See above for output.\"\n raise\n\n self._check_metadata_consistency(dist)\n return dist\n\n def iter_dependencies(self, with_requires: bool) -> Iterable[Optional[Requirement]]:\n # Emit the Requires-Python requirement first to fail fast on\n # unsupported candidates and avoid pointless downloads/preparation.\n yield self._factory.make_requires_python_requirement(self.dist.requires_python)\n requires = self.dist.iter_dependencies() if with_requires else ()\n for r in requires:\n yield from self._factory.make_requirements_from_spec(str(r), self._ireq)\n\n def get_install_requirement(self) -> Optional[InstallRequirement]:\n return self._ireq\n\n\nclass LinkCandidate(_InstallRequirementBackedCandidate):\n is_editable = False\n\n def __init__(\n self,\n link: Link,\n template: InstallRequirement,\n factory: \"Factory\",\n name: Optional[NormalizedName] = None,\n version: Optional[Version] = None,\n ) -> None:\n source_link = link\n cache_entry = factory.get_wheel_cache_entry(source_link, name)\n if cache_entry is not None:\n logger.debug(\"Using cached wheel link: %s\", cache_entry.link)\n link = cache_entry.link\n ireq = make_install_req_from_link(link, template)\n assert ireq.link == link\n if ireq.link.is_wheel and not ireq.link.is_file:\n wheel = Wheel(ireq.link.filename)\n wheel_name = canonicalize_name(wheel.name)\n assert name == wheel_name, f\"{name!r} != {wheel_name!r} for wheel\"\n # Version may not be present for PEP 508 direct URLs\n if version is not None:\n wheel_version = Version(wheel.version)\n assert (\n version == wheel_version\n ), f\"{version!r} != {wheel_version!r} for wheel {name}\"\n\n if cache_entry is not None:\n assert ireq.link.is_wheel\n assert ireq.link.is_file\n if cache_entry.persistent and template.link is template.original_link:\n ireq.cached_wheel_source_link = source_link\n if cache_entry.origin is not None:\n ireq.download_info = cache_entry.origin\n else:\n # Legacy cache entry that does not have origin.json.\n # download_info may miss the archive_info.hashes field.\n ireq.download_info = direct_url_from_link(\n source_link, link_is_in_wheel_cache=cache_entry.persistent\n )\n\n super().__init__(\n link=link,\n source_link=source_link,\n ireq=ireq,\n factory=factory,\n name=name,\n version=version,\n )\n\n def _prepare_distribution(self) -> BaseDistribution:\n preparer = self._factory.preparer\n return preparer.prepare_linked_requirement(self._ireq, parallel_builds=True)\n\n\nclass EditableCandidate(_InstallRequirementBackedCandidate):\n is_editable = True\n\n def __init__(\n self,\n link: Link,\n template: InstallRequirement,\n factory: \"Factory\",\n name: Optional[NormalizedName] = None,\n version: Optional[Version] = None,\n ) -> None:\n super().__init__(\n link=link,\n source_link=link,\n ireq=make_install_req_from_editable(link, template),\n factory=factory,\n name=name,\n version=version,\n )\n\n def _prepare_distribution(self) -> BaseDistribution:\n return self._factory.preparer.prepare_editable_requirement(self._ireq)\n\n\nclass AlreadyInstalledCandidate(Candidate):\n is_installed = True\n source_link = None\n\n def __init__(\n self,\n dist: BaseDistribution,\n template: InstallRequirement,\n factory: \"Factory\",\n ) -> None:\n self.dist = dist\n self._ireq = _make_install_req_from_dist(dist, template)\n self._factory = factory\n self._version = None\n\n # This is just logging some messages, so we can do it eagerly.\n # The returned dist would be exactly the same as self.dist because we\n # set satisfied_by in _make_install_req_from_dist.\n # TODO: Supply reason based on force_reinstall and upgrade_strategy.\n skip_reason = \"already satisfied\"\n factory.preparer.prepare_installed_requirement(self._ireq, skip_reason)\n\n def __str__(self) -> str:\n return str(self.dist)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({self.dist!r})\"\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, AlreadyInstalledCandidate):\n return NotImplemented\n return self.name == other.name and self.version == other.version\n\n def __hash__(self) -> int:\n return hash((self.name, self.version))\n\n @property\n def project_name(self) -> NormalizedName:\n return self.dist.canonical_name\n\n @property\n def name(self) -> str:\n return self.project_name\n\n @property\n def version(self) -> Version:\n if self._version is None:\n self._version = self.dist.version\n return self._version\n\n @property\n def is_editable(self) -> bool:\n return self.dist.editable\n\n def format_for_error(self) -> str:\n return f\"{self.name} {self.version} (Installed)\"\n\n def iter_dependencies(self, with_requires: bool) -> Iterable[Optional[Requirement]]:\n if not with_requires:\n return\n\n try:\n for r in self.dist.iter_dependencies():\n yield from self._factory.make_requirements_from_spec(str(r), self._ireq)\n except InvalidRequirement as exc:\n raise InvalidInstalledPackage(dist=self.dist, invalid_exc=exc) from None\n\n def get_install_requirement(self) -> Optional[InstallRequirement]:\n return None\n\n\nclass ExtrasCandidate(Candidate):\n \"\"\"A candidate that has 'extras', indicating additional dependencies.\n\n Requirements can be for a project with dependencies, something like\n foo[extra]. The extras don't affect the project/version being installed\n directly, but indicate that we need additional dependencies. We model that\n by having an artificial ExtrasCandidate that wraps the \"base\" candidate.\n\n The ExtrasCandidate differs from the base in the following ways:\n\n 1. It has a unique name, of the form foo[extra]. This causes the resolver\n to treat it as a separate node in the dependency graph.\n 2. When we're getting the candidate's dependencies,\n a) We specify that we want the extra dependencies as well.\n b) We add a dependency on the base candidate.\n See below for why this is needed.\n 3. We return None for the underlying InstallRequirement, as the base\n candidate will provide it, and we don't want to end up with duplicates.\n\n The dependency on the base candidate is needed so that the resolver can't\n decide that it should recommend foo[extra1] version 1.0 and foo[extra2]\n version 2.0. Having those candidates depend on foo=1.0 and foo=2.0\n respectively forces the resolver to recognise that this is a conflict.\n \"\"\"\n\n def __init__(\n self,\n base: BaseCandidate,\n extras: FrozenSet[str],\n *,\n comes_from: Optional[InstallRequirement] = None,\n ) -> None:\n \"\"\"\n :param comes_from: the InstallRequirement that led to this candidate if it\n differs from the base's InstallRequirement. This will often be the\n case in the sense that this candidate's requirement has the extras\n while the base's does not. Unlike the InstallRequirement backed\n candidates, this requirement is used solely for reporting purposes,\n it does not do any leg work.\n \"\"\"\n self.base = base\n self.extras = frozenset(canonicalize_name(e) for e in extras)\n self._comes_from = comes_from if comes_from is not None else self.base._ireq\n\n def __str__(self) -> str:\n name, rest = str(self.base).split(\" \", 1)\n return \"{}[{}] {}\".format(name, \",\".join(self.extras), rest)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}(base={self.base!r}, extras={self.extras!r})\"\n\n def __hash__(self) -> int:\n return hash((self.base, self.extras))\n\n def __eq__(self, other: Any) -> bool:\n if isinstance(other, self.__class__):\n return self.base == other.base and self.extras == other.extras\n return False\n\n @property\n def project_name(self) -> NormalizedName:\n return self.base.project_name\n\n @property\n def name(self) -> str:\n \"\"\"The normalised name of the project the candidate refers to\"\"\"\n return format_name(self.base.project_name, self.extras)\n\n @property\n def version(self) -> Version:\n return self.base.version\n\n def format_for_error(self) -> str:\n return \"{} [{}]\".format(\n self.base.format_for_error(), \", \".join(sorted(self.extras))\n )\n\n @property\n def is_installed(self) -> bool:\n return self.base.is_installed\n\n @property\n def is_editable(self) -> bool:\n return self.base.is_editable\n\n @property\n def source_link(self) -> Optional[Link]:\n return self.base.source_link\n\n def iter_dependencies(self, with_requires: bool) -> Iterable[Optional[Requirement]]:\n factory = self.base._factory\n\n # Add a dependency on the exact base\n # (See note 2b in the class docstring)\n yield factory.make_requirement_from_candidate(self.base)\n if not with_requires:\n return\n\n # The user may have specified extras that the candidate doesn't\n # support. We ignore any unsupported extras here.\n valid_extras = self.extras.intersection(self.base.dist.iter_provided_extras())\n invalid_extras = self.extras.difference(self.base.dist.iter_provided_extras())\n for extra in sorted(invalid_extras):\n logger.warning(\n \"%s %s does not provide the extra '%s'\",\n self.base.name,\n self.version,\n extra,\n )\n\n for r in self.base.dist.iter_dependencies(valid_extras):\n yield from factory.make_requirements_from_spec(\n str(r),\n self._comes_from,\n valid_extras,\n )\n\n def get_install_requirement(self) -> Optional[InstallRequirement]:\n # We don't return anything here, because we always\n # depend on the base candidate, and we'll get the\n # install requirement from that.\n return None\n\n\nclass RequiresPythonCandidate(Candidate):\n is_installed = False\n source_link = None\n\n def __init__(self, py_version_info: Optional[Tuple[int, ...]]) -> None:\n if py_version_info is not None:\n version_info = normalize_version_info(py_version_info)\n else:\n version_info = sys.version_info[:3]\n self._version = Version(\".\".join(str(c) for c in version_info))\n\n # We don't need to implement __eq__() and __ne__() since there is always\n # only one RequiresPythonCandidate in a resolution, i.e. the host Python.\n # The built-in object.__eq__() and object.__ne__() do exactly what we want.\n\n def __str__(self) -> str:\n return f\"Python {self._version}\"\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({self._version!r})\"\n\n @property\n def project_name(self) -> NormalizedName:\n return REQUIRES_PYTHON_IDENTIFIER\n\n @property\n def name(self) -> str:\n return REQUIRES_PYTHON_IDENTIFIER\n\n @property\n def version(self) -> Version:\n return self._version\n\n def format_for_error(self) -> str:\n return f\"Python {self.version}\"\n\n def iter_dependencies(self, with_requires: bool) -> Iterable[Optional[Requirement]]:\n return ()\n\n def get_install_requirement(self) -> Optional[InstallRequirement]:\n return None\n",[],[100,509,516,523,475,544,1479,1503,1518],{"_104":1526,"_96":1527,"_158":1528,"_160":1504,"_161":139,"_162":1529,"_164":165,"_106":1530,"_101":29,"_167":215,"_169":1531,"_170":25,"_171":-5,"_172":1532,"_99":1533},"064f6cb0-67fc-11f0-8863-0224a6c84d84","factory.py","064f6d46-67fc-11f0-8863-0224a6c84d84",219,["D",1753299258357],"import contextlib\nimport functools\nimport logging\nfrom typing import (\n TYPE_CHECKING,\n Callable,\n Dict,\n FrozenSet,\n Iterable,\n Iterator,\n List,\n Mapping,\n NamedTuple,\n Optional,\n Protocol,\n Sequence,\n Set,\n Tuple,\n TypeVar,\n cast,\n)\n\nfrom pip._vendor.packaging.requirements import InvalidRequirement\nfrom pip._vendor.packaging.specifiers import SpecifierSet\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\nfrom pip._vendor.packaging.version import InvalidVersion, Version\nfrom pip._vendor.resolvelib import ResolutionImpossible\n\nfrom pip._internal.cache import CacheEntry, WheelCache\nfrom pip._internal.exceptions import (\n DistributionNotFound,\n InstallationError,\n InvalidInstalledPackage,\n MetadataInconsistent,\n MetadataInvalid,\n UnsupportedPythonVersion,\n UnsupportedWheel,\n)\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.metadata import BaseDistribution, get_default_environment\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.operations.prepare import RequirementPreparer\nfrom pip._internal.req.constructors import (\n install_req_drop_extras,\n install_req_from_link_and_ireq,\n)\nfrom pip._internal.req.req_install import (\n InstallRequirement,\n check_invalid_constraint_type,\n)\nfrom pip._internal.resolution.base import InstallRequirementProvider\nfrom pip._internal.utils.compatibility_tags import get_supported\nfrom pip._internal.utils.hashes import Hashes\nfrom pip._internal.utils.packaging import get_requirement\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\nfrom .base import Candidate, Constraint, Requirement\nfrom .candidates import (\n AlreadyInstalledCandidate,\n BaseCandidate,\n EditableCandidate,\n ExtrasCandidate,\n LinkCandidate,\n RequiresPythonCandidate,\n as_base_candidate,\n)\nfrom .found_candidates import FoundCandidates, IndexCandidateInfo\nfrom .requirements import (\n ExplicitRequirement,\n RequiresPythonRequirement,\n SpecifierRequirement,\n SpecifierWithoutExtrasRequirement,\n UnsatisfiableRequirement,\n)\n\nif TYPE_CHECKING:\n\n class ConflictCause(Protocol):\n requirement: RequiresPythonRequirement\n parent: Candidate\n\n\nlogger = logging.getLogger(__name__)\n\nC = TypeVar(\"C\")\nCache = Dict[Link, C]\n\n\nclass CollectedRootRequirements(NamedTuple):\n requirements: List[Requirement]\n constraints: Dict[str, Constraint]\n user_requested: Dict[str, int]\n\n\nclass Factory:\n def __init__(\n self,\n finder: PackageFinder,\n preparer: RequirementPreparer,\n make_install_req: InstallRequirementProvider,\n wheel_cache: Optional[WheelCache],\n use_user_site: bool,\n force_reinstall: bool,\n ignore_installed: bool,\n ignore_requires_python: bool,\n py_version_info: Optional[Tuple[int, ...]] = None,\n ) -> None:\n self._finder = finder\n self.preparer = preparer\n self._wheel_cache = wheel_cache\n self._python_candidate = RequiresPythonCandidate(py_version_info)\n self._make_install_req_from_spec = make_install_req\n self._use_user_site = use_user_site\n self._force_reinstall = force_reinstall\n self._ignore_requires_python = ignore_requires_python\n\n self._build_failures: Cache[InstallationError] = {}\n self._link_candidate_cache: Cache[LinkCandidate] = {}\n self._editable_candidate_cache: Cache[EditableCandidate] = {}\n self._installed_candidate_cache: Dict[str, AlreadyInstalledCandidate] = {}\n self._extras_candidate_cache: Dict[\n Tuple[int, FrozenSet[NormalizedName]], ExtrasCandidate\n ] = {}\n self._supported_tags_cache = get_supported()\n\n if not ignore_installed:\n env = get_default_environment()\n self._installed_dists = {\n dist.canonical_name: dist\n for dist in env.iter_installed_distributions(local_only=False)\n }\n else:\n self._installed_dists = {}\n\n @property\n def force_reinstall(self) -> bool:\n return self._force_reinstall\n\n def _fail_if_link_is_unsupported_wheel(self, link: Link) -> None:\n if not link.is_wheel:\n return\n wheel = Wheel(link.filename)\n if wheel.supported(self._finder.target_python.get_unsorted_tags()):\n return\n msg = f\"{link.filename} is not a supported wheel on this platform.\"\n raise UnsupportedWheel(msg)\n\n def _make_extras_candidate(\n self,\n base: BaseCandidate,\n extras: FrozenSet[str],\n *,\n comes_from: Optional[InstallRequirement] = None,\n ) -> ExtrasCandidate:\n cache_key = (id(base), frozenset(canonicalize_name(e) for e in extras))\n try:\n candidate = self._extras_candidate_cache[cache_key]\n except KeyError:\n candidate = ExtrasCandidate(base, extras, comes_from=comes_from)\n self._extras_candidate_cache[cache_key] = candidate\n return candidate\n\n def _make_candidate_from_dist(\n self,\n dist: BaseDistribution,\n extras: FrozenSet[str],\n template: InstallRequirement,\n ) -> Candidate:\n try:\n base = self._installed_candidate_cache[dist.canonical_name]\n except KeyError:\n base = AlreadyInstalledCandidate(dist, template, factory=self)\n self._installed_candidate_cache[dist.canonical_name] = base\n if not extras:\n return base\n return self._make_extras_candidate(base, extras, comes_from=template)\n\n def _make_candidate_from_link(\n self,\n link: Link,\n extras: FrozenSet[str],\n template: InstallRequirement,\n name: Optional[NormalizedName],\n version: Optional[Version],\n ) -> Optional[Candidate]:\n base: Optional[BaseCandidate] = self._make_base_candidate_from_link(\n link, template, name, version\n )\n if not extras or base is None:\n return base\n return self._make_extras_candidate(base, extras, comes_from=template)\n\n def _make_base_candidate_from_link(\n self,\n link: Link,\n template: InstallRequirement,\n name: Optional[NormalizedName],\n version: Optional[Version],\n ) -> Optional[BaseCandidate]:\n # TODO: Check already installed candidate, and use it if the link and\n # editable flag match.\n\n if link in self._build_failures:\n # We already tried this candidate before, and it does not build.\n # Don't bother trying again.\n return None\n\n if template.editable:\n if link not in self._editable_candidate_cache:\n try:\n self._editable_candidate_cache[link] = EditableCandidate(\n link,\n template,\n factory=self,\n name=name,\n version=version,\n )\n except (MetadataInconsistent, MetadataInvalid) as e:\n logger.info(\n \"Discarding [blue underline]%s[/]: [yellow]%s[reset]\",\n link,\n e,\n extra={\"markup\": True},\n )\n self._build_failures[link] = e\n return None\n\n return self._editable_candidate_cache[link]\n else:\n if link not in self._link_candidate_cache:\n try:\n self._link_candidate_cache[link] = LinkCandidate(\n link,\n template,\n factory=self,\n name=name,\n version=version,\n )\n except MetadataInconsistent as e:\n logger.info(\n \"Discarding [blue underline]%s[/]: [yellow]%s[reset]\",\n link,\n e,\n extra={\"markup\": True},\n )\n self._build_failures[link] = e\n return None\n return self._link_candidate_cache[link]\n\n def _iter_found_candidates(\n self,\n ireqs: Sequence[InstallRequirement],\n specifier: SpecifierSet,\n hashes: Hashes,\n prefers_installed: bool,\n incompatible_ids: Set[int],\n ) -> Iterable[Candidate]:\n if not ireqs:\n return ()\n\n # The InstallRequirement implementation requires us to give it a\n # \"template\". Here we just choose the first requirement to represent\n # all of them.\n # Hopefully the Project model can correct this mismatch in the future.\n template = ireqs[0]\n assert template.req, \"Candidates found on index must be PEP 508\"\n name = canonicalize_name(template.req.name)\n\n extras: FrozenSet[str] = frozenset()\n for ireq in ireqs:\n assert ireq.req, \"Candidates found on index must be PEP 508\"\n specifier &= ireq.req.specifier\n hashes &= ireq.hashes(trust_internet=False)\n extras |= frozenset(ireq.extras)\n\n def _get_installed_candidate() -> Optional[Candidate]:\n \"\"\"Get the candidate for the currently-installed version.\"\"\"\n # If --force-reinstall is set, we want the version from the index\n # instead, so we \"pretend\" there is nothing installed.\n if self._force_reinstall:\n return None\n try:\n installed_dist = self._installed_dists[name]\n except KeyError:\n return None\n\n try:\n # Don't use the installed distribution if its version\n # does not fit the current dependency graph.\n if not specifier.contains(installed_dist.version, prereleases=True):\n return None\n except InvalidVersion as e:\n raise InvalidInstalledPackage(dist=installed_dist, invalid_exc=e)\n\n candidate = self._make_candidate_from_dist(\n dist=installed_dist,\n extras=extras,\n template=template,\n )\n # The candidate is a known incompatibility. Don't use it.\n if id(candidate) in incompatible_ids:\n return None\n return candidate\n\n def iter_index_candidate_infos() -> Iterator[IndexCandidateInfo]:\n result = self._finder.find_best_candidate(\n project_name=name,\n specifier=specifier,\n hashes=hashes,\n )\n icans = result.applicable_candidates\n\n # PEP 592: Yanked releases are ignored unless the specifier\n # explicitly pins a version (via '==' or '===') that can be\n # solely satisfied by a yanked release.\n all_yanked = all(ican.link.is_yanked for ican in icans)\n\n def is_pinned(specifier: SpecifierSet) -> bool:\n for sp in specifier:\n if sp.operator == \"===\":\n return True\n if sp.operator != \"==\":\n continue\n if sp.version.endswith(\".*\"):\n continue\n return True\n return False\n\n pinned = is_pinned(specifier)\n\n # PackageFinder returns earlier versions first, so we reverse.\n for ican in reversed(icans):\n if not (all_yanked and pinned) and ican.link.is_yanked:\n continue\n func = functools.partial(\n self._make_candidate_from_link,\n link=ican.link,\n extras=extras,\n template=template,\n name=name,\n version=ican.version,\n )\n yield ican.version, func\n\n return FoundCandidates(\n iter_index_candidate_infos,\n _get_installed_candidate(),\n prefers_installed,\n incompatible_ids,\n )\n\n def _iter_explicit_candidates_from_base(\n self,\n base_requirements: Iterable[Requirement],\n extras: FrozenSet[str],\n ) -> Iterator[Candidate]:\n \"\"\"Produce explicit candidates from the base given an extra-ed package.\n\n :param base_requirements: Requirements known to the resolver. The\n requirements are guaranteed to not have extras.\n :param extras: The extras to inject into the explicit requirements'\n candidates.\n \"\"\"\n for req in base_requirements:\n lookup_cand, _ = req.get_candidate_lookup()\n if lookup_cand is None: # Not explicit.\n continue\n # We've stripped extras from the identifier, and should always\n # get a BaseCandidate here, unless there's a bug elsewhere.\n base_cand = as_base_candidate(lookup_cand)\n assert base_cand is not None, \"no extras here\"\n yield self._make_extras_candidate(base_cand, extras)\n\n def _iter_candidates_from_constraints(\n self,\n identifier: str,\n constraint: Constraint,\n template: InstallRequirement,\n ) -> Iterator[Candidate]:\n \"\"\"Produce explicit candidates from constraints.\n\n This creates \"fake\" InstallRequirement objects that are basically clones\n of what \"should\" be the template, but with original_link set to link.\n \"\"\"\n for link in constraint.links:\n self._fail_if_link_is_unsupported_wheel(link)\n candidate = self._make_base_candidate_from_link(\n link,\n template=install_req_from_link_and_ireq(link, template),\n name=canonicalize_name(identifier),\n version=None,\n )\n if candidate:\n yield candidate\n\n def find_candidates(\n self,\n identifier: str,\n requirements: Mapping[str, Iterable[Requirement]],\n incompatibilities: Mapping[str, Iterator[Candidate]],\n constraint: Constraint,\n prefers_installed: bool,\n is_satisfied_by: Callable[[Requirement, Candidate], bool],\n ) -> Iterable[Candidate]:\n # Collect basic lookup information from the requirements.\n explicit_candidates: Set[Candidate] = set()\n ireqs: List[InstallRequirement] = []\n for req in requirements[identifier]:\n cand, ireq = req.get_candidate_lookup()\n if cand is not None:\n explicit_candidates.add(cand)\n if ireq is not None:\n ireqs.append(ireq)\n\n # If the current identifier contains extras, add requires and explicit\n # candidates from entries from extra-less identifier.\n with contextlib.suppress(InvalidRequirement):\n parsed_requirement = get_requirement(identifier)\n if parsed_requirement.name != identifier:\n explicit_candidates.update(\n self._iter_explicit_candidates_from_base(\n requirements.get(parsed_requirement.name, ()),\n frozenset(parsed_requirement.extras),\n ),\n )\n for req in requirements.get(parsed_requirement.name, []):\n _, ireq = req.get_candidate_lookup()\n if ireq is not None:\n ireqs.append(ireq)\n\n # Add explicit candidates from constraints. We only do this if there are\n # known ireqs, which represent requirements not already explicit. If\n # there are no ireqs, we're constraining already-explicit requirements,\n # which is handled later when we return the explicit candidates.\n if ireqs:\n try:\n explicit_candidates.update(\n self._iter_candidates_from_constraints(\n identifier,\n constraint,\n template=ireqs[0],\n ),\n )\n except UnsupportedWheel:\n # If we're constrained to install a wheel incompatible with the\n # target architecture, no candidates will ever be valid.\n return ()\n\n # Since we cache all the candidates, incompatibility identification\n # can be made quicker by comparing only the id() values.\n incompat_ids = {id(c) for c in incompatibilities.get(identifier, ())}\n\n # If none of the requirements want an explicit candidate, we can ask\n # the finder for candidates.\n if not explicit_candidates:\n return self._iter_found_candidates(\n ireqs,\n constraint.specifier,\n constraint.hashes,\n prefers_installed,\n incompat_ids,\n )\n\n return (\n c\n for c in explicit_candidates\n if id(c) not in incompat_ids\n and constraint.is_satisfied_by(c)\n and all(is_satisfied_by(req, c) for req in requirements[identifier])\n )\n\n def _make_requirements_from_install_req(\n self, ireq: InstallRequirement, requested_extras: Iterable[str]\n ) -> Iterator[Requirement]:\n \"\"\"\n Returns requirement objects associated with the given InstallRequirement. In\n most cases this will be a single object but the following special cases exist:\n - the InstallRequirement has markers that do not apply -> result is empty\n - the InstallRequirement has both a constraint (or link) and extras\n -> result is split in two requirement objects: one with the constraint\n (or link) and one with the extra. This allows centralized constraint\n handling for the base, resulting in fewer candidate rejections.\n \"\"\"\n if not ireq.match_markers(requested_extras):\n logger.info(\n \"Ignoring %s: markers '%s' don't match your environment\",\n ireq.name,\n ireq.markers,\n )\n elif not ireq.link:\n if ireq.extras and ireq.req is not None and ireq.req.specifier:\n yield SpecifierWithoutExtrasRequirement(ireq)\n yield SpecifierRequirement(ireq)\n else:\n self._fail_if_link_is_unsupported_wheel(ireq.link)\n # Always make the link candidate for the base requirement to make it\n # available to `find_candidates` for explicit candidate lookup for any\n # set of extras.\n # The extras are required separately via a second requirement.\n cand = self._make_base_candidate_from_link(\n ireq.link,\n template=install_req_drop_extras(ireq) if ireq.extras else ireq,\n name=canonicalize_name(ireq.name) if ireq.name else None,\n version=None,\n )\n if cand is None:\n # There's no way we can satisfy a URL requirement if the underlying\n # candidate fails to build. An unnamed URL must be user-supplied, so\n # we fail eagerly. If the URL is named, an unsatisfiable requirement\n # can make the resolver do the right thing, either backtrack (and\n # maybe find some other requirement that's buildable) or raise a\n # ResolutionImpossible eventually.\n if not ireq.name:\n raise self._build_failures[ireq.link]\n yield UnsatisfiableRequirement(canonicalize_name(ireq.name))\n else:\n # require the base from the link\n yield self.make_requirement_from_candidate(cand)\n if ireq.extras:\n # require the extras on top of the base candidate\n yield self.make_requirement_from_candidate(\n self._make_extras_candidate(cand, frozenset(ireq.extras))\n )\n\n def collect_root_requirements(\n self, root_ireqs: List[InstallRequirement]\n ) -> CollectedRootRequirements:\n collected = CollectedRootRequirements([], {}, {})\n for i, ireq in enumerate(root_ireqs):\n if ireq.constraint:\n # Ensure we only accept valid constraints\n problem = check_invalid_constraint_type(ireq)\n if problem:\n raise InstallationError(problem)\n if not ireq.match_markers():\n continue\n assert ireq.name, \"Constraint must be named\"\n name = canonicalize_name(ireq.name)\n if name in collected.constraints:\n collected.constraints[name] &= ireq\n else:\n collected.constraints[name] = Constraint.from_ireq(ireq)\n else:\n reqs = list(\n self._make_requirements_from_install_req(\n ireq,\n requested_extras=(),\n )\n )\n if not reqs:\n continue\n template = reqs[0]\n if ireq.user_supplied and template.name not in collected.user_requested:\n collected.user_requested[template.name] = i\n collected.requirements.extend(reqs)\n # Put requirements with extras at the end of the root requires. This does not\n # affect resolvelib's picking preference but it does affect its initial criteria\n # population: by putting extras at the end we enable the candidate finder to\n # present resolvelib with a smaller set of candidates to resolvelib, already\n # taking into account any non-transient constraints on the associated base. This\n # means resolvelib will have fewer candidates to visit and reject.\n # Python's list sort is stable, meaning relative order is kept for objects with\n # the same key.\n collected.requirements.sort(key=lambda r: r.name != r.project_name)\n return collected\n\n def make_requirement_from_candidate(\n self, candidate: Candidate\n ) -> ExplicitRequirement:\n return ExplicitRequirement(candidate)\n\n def make_requirements_from_spec(\n self,\n specifier: str,\n comes_from: Optional[InstallRequirement],\n requested_extras: Iterable[str] = (),\n ) -> Iterator[Requirement]:\n \"\"\"\n Returns requirement objects associated with the given specifier. In most cases\n this will be a single object but the following special cases exist:\n - the specifier has markers that do not apply -> result is empty\n - the specifier has both a constraint and extras -> result is split\n in two requirement objects: one with the constraint and one with the\n extra. This allows centralized constraint handling for the base,\n resulting in fewer candidate rejections.\n \"\"\"\n ireq = self._make_install_req_from_spec(specifier, comes_from)\n return self._make_requirements_from_install_req(ireq, requested_extras)\n\n def make_requires_python_requirement(\n self,\n specifier: SpecifierSet,\n ) -> Optional[Requirement]:\n if self._ignore_requires_python:\n return None\n # Don't bother creating a dependency for an empty Requires-Python.\n if not str(specifier):\n return None\n return RequiresPythonRequirement(specifier, self._python_candidate)\n\n def get_wheel_cache_entry(\n self, link: Link, name: Optional[str]\n ) -> Optional[CacheEntry]:\n \"\"\"Look up the link in the wheel cache.\n\n If ``preparer.require_hashes`` is True, don't use the wheel cache,\n because cached wheels, always built locally, have different hashes\n than the files downloaded from the index server and thus throw false\n hash mismatches. Furthermore, cached wheels at present have\n nondeterministic contents due to file modification times.\n \"\"\"\n if self._wheel_cache is None:\n return None\n return self._wheel_cache.get_cache_entry(\n link=link,\n package_name=name,\n supported_tags=self._supported_tags_cache,\n )\n\n def get_dist_to_uninstall(self, candidate: Candidate) -> Optional[BaseDistribution]:\n # TODO: Are there more cases this needs to return True? Editable?\n dist = self._installed_dists.get(candidate.project_name)\n if dist is None: # Not installed, no uninstallation required.\n return None\n\n # We're installing into global site. The current installation must\n # be uninstalled, no matter it's in global or user site, because the\n # user site installation has precedence over global.\n if not self._use_user_site:\n return dist\n\n # We're installing into user site. Remove the user site installation.\n if dist.in_usersite:\n return dist\n\n # We're installing into user site, but the installed incompatible\n # package is in global site. We can't uninstall that, and would let\n # the new user installation to \"shadow\" it. But shadowing won't work\n # in virtual environments, so we error out.\n if running_under_virtualenv() and dist.in_site_packages:\n message = (\n f\"Will not install to the user site because it will lack \"\n f\"sys.path precedence to {dist.raw_name} in {dist.location}\"\n )\n raise InstallationError(message)\n return None\n\n def _report_requires_python_error(\n self, causes: Sequence[\"ConflictCause\"]\n ) -> UnsupportedPythonVersion:\n assert causes, \"Requires-Python error reported with no cause\"\n\n version = self._python_candidate.version\n\n if len(causes) == 1:\n specifier = str(causes[0].requirement.specifier)\n message = (\n f\"Package {causes[0].parent.name!r} requires a different \"\n f\"Python: {version} not in {specifier!r}\"\n )\n return UnsupportedPythonVersion(message)\n\n message = f\"Packages require a different Python. {version} not in:\"\n for cause in causes:\n package = cause.parent.format_for_error()\n specifier = str(cause.requirement.specifier)\n message += f\"\\n{specifier!r} (required by {package})\"\n return UnsupportedPythonVersion(message)\n\n def _report_single_requirement_conflict(\n self, req: Requirement, parent: Optional[Candidate]\n ) -> DistributionNotFound:\n if parent is None:\n req_disp = str(req)\n else:\n req_disp = f\"{req} (from {parent.name})\"\n\n cands = self._finder.find_all_candidates(req.project_name)\n skipped_by_requires_python = self._finder.requires_python_skipped_reasons()\n\n versions_set: Set[Version] = set()\n yanked_versions_set: Set[Version] = set()\n for c in cands:\n is_yanked = c.link.is_yanked if c.link else False\n if is_yanked:\n yanked_versions_set.add(c.version)\n else:\n versions_set.add(c.version)\n\n versions = [str(v) for v in sorted(versions_set)]\n yanked_versions = [str(v) for v in sorted(yanked_versions_set)]\n\n if yanked_versions:\n # Saying \"version X is yanked\" isn't entirely accurate.\n # https://github.com/pypa/pip/issues/11745#issuecomment-1402805842\n logger.critical(\n \"Ignored the following yanked versions: %s\",\n \", \".join(yanked_versions) or \"none\",\n )\n if skipped_by_requires_python:\n logger.critical(\n \"Ignored the following versions that require a different python \"\n \"version: %s\",\n \"; \".join(skipped_by_requires_python) or \"none\",\n )\n logger.critical(\n \"Could not find a version that satisfies the requirement %s \"\n \"(from versions: %s)\",\n req_disp,\n \", \".join(versions) or \"none\",\n )\n if str(req) == \"requirements.txt\":\n logger.info(\n \"HINT: You are attempting to install a package literally \"\n 'named \"requirements.txt\" (which cannot exist). Consider '\n \"using the '-r' flag to install the packages listed in \"\n \"requirements.txt\"\n )\n\n return DistributionNotFound(f\"No matching distribution found for {req}\")\n\n def get_installation_error(\n self,\n e: \"ResolutionImpossible[Requirement, Candidate]\",\n constraints: Dict[str, Constraint],\n ) -> InstallationError:\n assert e.causes, \"Installation error reported with no cause\"\n\n # If one of the things we can't solve is \"we need Python X.Y\",\n # that is what we report.\n requires_python_causes = [\n cause\n for cause in e.causes\n if isinstance(cause.requirement, RequiresPythonRequirement)\n and not cause.requirement.is_satisfied_by(self._python_candidate)\n ]\n if requires_python_causes:\n # The comprehension above makes sure all Requirement instances are\n # RequiresPythonRequirement, so let's cast for convenience.\n return self._report_requires_python_error(\n cast(\"Sequence[ConflictCause]\", requires_python_causes),\n )\n\n # Otherwise, we have a set of causes which can't all be satisfied\n # at once.\n\n # The simplest case is when we have *one* cause that can't be\n # satisfied. We just report that case.\n if len(e.causes) == 1:\n req, parent = next(iter(e.causes))\n if req.name not in constraints:\n return self._report_single_requirement_conflict(req, parent)\n\n # OK, we now have a list of requirements that can't all be\n # satisfied at once.\n\n # A couple of formatting helpers\n def text_join(parts: List[str]) -> str:\n if len(parts) == 1:\n return parts[0]\n\n return \", \".join(parts[:-1]) + \" and \" + parts[-1]\n\n def describe_trigger(parent: Candidate) -> str:\n ireq = parent.get_install_requirement()\n if not ireq or not ireq.comes_from:\n return f\"{parent.name}=={parent.version}\"\n if isinstance(ireq.comes_from, InstallRequirement):\n return str(ireq.comes_from.name)\n return str(ireq.comes_from)\n\n triggers = set()\n for req, parent in e.causes:\n if parent is None:\n # This is a root requirement, so we can report it directly\n trigger = req.format_for_error()\n else:\n trigger = describe_trigger(parent)\n triggers.add(trigger)\n\n if triggers:\n info = text_join(sorted(triggers))\n else:\n info = \"the requested packages\"\n\n msg = (\n f\"Cannot install {info} because these package versions \"\n \"have conflicting dependencies.\"\n )\n logger.critical(msg)\n msg = \"\\nThe conflict is caused by:\"\n\n relevant_constraints = set()\n for req, parent in e.causes:\n if req.name in constraints:\n relevant_constraints.add(req.name)\n msg = msg + \"\\n \"\n if parent:\n msg = msg + f\"{parent.name} {parent.version} depends on \"\n else:\n msg = msg + \"The user requested \"\n msg = msg + req.format_for_error()\n for key in relevant_constraints:\n spec = constraints[key].specifier\n msg += f\"\\n The user requested (constraint) {key}{spec}\"\n\n msg = (\n msg\n + \"\\n\\n\"\n + \"To fix this you could try to:\\n\"\n + \"1. loosen the range of package versions you've specified\\n\"\n + \"2. remove package versions to allow pip to attempt to solve \"\n + \"the dependency conflict\\n\"\n )\n\n logger.info(msg)\n\n return DistributionNotFound(\n \"ResolutionImpossible: for help visit \"\n \"https://pip.pypa.io/en/latest/topics/dependency-resolution/\"\n \"#dealing-with-dependency-conflicts\"\n )\n",[],[100,509,516,523,475,544,1479,1503,1527],{"_104":1535,"_96":1536,"_158":1537,"_160":1504,"_161":139,"_162":1538,"_164":165,"_106":1539,"_101":29,"_167":215,"_169":1540,"_170":25,"_171":-5,"_172":1541,"_99":1542},"06448d18-67fc-11f0-a516-0224a6c84d84","found_candidates.py","06448db8-67fc-11f0-a516-0224a6c84d84",217,["D",1753299258284],"\"\"\"Utilities to lazily create and visit candidates found.\n\nCreating and visiting a candidate is a *very* costly operation. It involves\nfetching, extracting, potentially building modules from source, and verifying\ndistribution metadata. It is therefore crucial for performance to keep\neverything here lazy all the way down, so we only touch candidates that we\nabsolutely need, and not \"download the world\" when we only need one version of\nsomething.\n\"\"\"\n\nimport logging\nfrom collections.abc import Sequence\nfrom typing import Any, Callable, Iterator, Optional, Set, Tuple\n\nfrom pip._vendor.packaging.version import _BaseVersion\n\nfrom pip._internal.exceptions import MetadataInvalid\n\nfrom .base import Candidate\n\nlogger = logging.getLogger(__name__)\n\nIndexCandidateInfo = Tuple[_BaseVersion, Callable[[], Optional[Candidate]]]\n\n\ndef _iter_built(infos: Iterator[IndexCandidateInfo]) -> Iterator[Candidate]:\n \"\"\"Iterator for ``FoundCandidates``.\n\n This iterator is used when the package is not already installed. Candidates\n from index come later in their normal ordering.\n \"\"\"\n versions_found: Set[_BaseVersion] = set()\n for version, func in infos:\n if version in versions_found:\n continue\n try:\n candidate = func()\n except MetadataInvalid as e:\n logger.warning(\n \"Ignoring version %s of %s since it has invalid metadata:\\n\"\n \"%s\\n\"\n \"Please use pip<24.1 if you need to use this version.\",\n version,\n e.ireq.name,\n e,\n )\n # Mark version as found to avoid trying other candidates with the same\n # version, since they most likely have invalid metadata as well.\n versions_found.add(version)\n else:\n if candidate is None:\n continue\n yield candidate\n versions_found.add(version)\n\n\ndef _iter_built_with_prepended(\n installed: Candidate, infos: Iterator[IndexCandidateInfo]\n) -> Iterator[Candidate]:\n \"\"\"Iterator for ``FoundCandidates``.\n\n This iterator is used when the resolver prefers the already-installed\n candidate and NOT to upgrade. The installed candidate is therefore\n always yielded first, and candidates from index come later in their\n normal ordering, except skipped when the version is already installed.\n \"\"\"\n yield installed\n versions_found: Set[_BaseVersion] = {installed.version}\n for version, func in infos:\n if version in versions_found:\n continue\n candidate = func()\n if candidate is None:\n continue\n yield candidate\n versions_found.add(version)\n\n\ndef _iter_built_with_inserted(\n installed: Candidate, infos: Iterator[IndexCandidateInfo]\n) -> Iterator[Candidate]:\n \"\"\"Iterator for ``FoundCandidates``.\n\n This iterator is used when the resolver prefers to upgrade an\n already-installed package. Candidates from index are returned in their\n normal ordering, except replaced when the version is already installed.\n\n The implementation iterates through and yields other candidates, inserting\n the installed candidate exactly once before we start yielding older or\n equivalent candidates, or after all other candidates if they are all newer.\n \"\"\"\n versions_found: Set[_BaseVersion] = set()\n for version, func in infos:\n if version in versions_found:\n continue\n # If the installed candidate is better, yield it first.\n if installed.version >= version:\n yield installed\n versions_found.add(installed.version)\n candidate = func()\n if candidate is None:\n continue\n yield candidate\n versions_found.add(version)\n\n # If the installed candidate is older than all other candidates.\n if installed.version not in versions_found:\n yield installed\n\n\nclass FoundCandidates(Sequence[Candidate]):\n \"\"\"A lazy sequence to provide candidates to the resolver.\n\n The intended usage is to return this from `find_matches()` so the resolver\n can iterate through the sequence multiple times, but only access the index\n page when remote packages are actually needed. This improve performances\n when suitable candidates are already installed on disk.\n \"\"\"\n\n def __init__(\n self,\n get_infos: Callable[[], Iterator[IndexCandidateInfo]],\n installed: Optional[Candidate],\n prefers_installed: bool,\n incompatible_ids: Set[int],\n ):\n self._get_infos = get_infos\n self._installed = installed\n self._prefers_installed = prefers_installed\n self._incompatible_ids = incompatible_ids\n self._bool: Optional[bool] = None\n\n def __getitem__(self, index: Any) -> Any:\n # Implemented to satisfy the ABC check. This is not needed by the\n # resolver, and should not be used by the provider either (for\n # performance reasons).\n raise NotImplementedError(\"don't do this\")\n\n def __iter__(self) -> Iterator[Candidate]:\n infos = self._get_infos()\n if not self._installed:\n iterator = _iter_built(infos)\n elif self._prefers_installed:\n iterator = _iter_built_with_prepended(self._installed, infos)\n else:\n iterator = _iter_built_with_inserted(self._installed, infos)\n return (c for c in iterator if id(c) not in self._incompatible_ids)\n\n def __len__(self) -> int:\n # Implemented to satisfy the ABC check. This is not needed by the\n # resolver, and should not be used by the provider either (for\n # performance reasons).\n raise NotImplementedError(\"don't do this\")\n\n def __bool__(self) -> bool:\n if self._bool is not None:\n return self._bool\n\n if self._prefers_installed and self._installed:\n self._bool = True\n return True\n\n self._bool = any(self)\n return self._bool\n",[],[100,509,516,523,475,544,1479,1503,1536],{"_104":1544,"_96":1545,"_158":1546,"_160":1504,"_161":139,"_162":1547,"_164":165,"_106":1548,"_101":29,"_167":215,"_169":1549,"_170":25,"_171":-5,"_172":1550,"_99":1551},"063d02d2-67fc-11f0-b5ac-0224a6c84d84","provider.py","063d037c-67fc-11f0-b5ac-0224a6c84d84",215,["D",1753299258253],"import math\nfrom functools import lru_cache\nfrom typing import (\n TYPE_CHECKING,\n Dict,\n Iterable,\n Iterator,\n Mapping,\n Optional,\n Sequence,\n Tuple,\n TypeVar,\n Union,\n)\n\nfrom pip._vendor.resolvelib.providers import AbstractProvider\n\nfrom pip._internal.req.req_install import InstallRequirement\n\nfrom .base import Candidate, Constraint, Requirement\nfrom .candidates import REQUIRES_PYTHON_IDENTIFIER\nfrom .factory import Factory\nfrom .requirements import ExplicitRequirement\n\nif TYPE_CHECKING:\n from pip._vendor.resolvelib.providers import Preference\n from pip._vendor.resolvelib.resolvers import RequirementInformation\n\n PreferenceInformation = RequirementInformation[Requirement, Candidate]\n\n _ProviderBase = AbstractProvider[Requirement, Candidate, str]\nelse:\n _ProviderBase = AbstractProvider\n\n# Notes on the relationship between the provider, the factory, and the\n# candidate and requirement classes.\n#\n# The provider is a direct implementation of the resolvelib class. Its role\n# is to deliver the API that resolvelib expects.\n#\n# Rather than work with completely abstract \"requirement\" and \"candidate\"\n# concepts as resolvelib does, pip has concrete classes implementing these two\n# ideas. The API of Requirement and Candidate objects are defined in the base\n# classes, but essentially map fairly directly to the equivalent provider\n# methods. In particular, `find_matches` and `is_satisfied_by` are\n# requirement methods, and `get_dependencies` is a candidate method.\n#\n# The factory is the interface to pip's internal mechanisms. It is stateless,\n# and is created by the resolver and held as a property of the provider. It is\n# responsible for creating Requirement and Candidate objects, and provides\n# services to those objects (access to pip's finder and preparer).\n\n\nD = TypeVar(\"D\")\nV = TypeVar(\"V\")\n\n\ndef _get_with_identifier(\n mapping: Mapping[str, V],\n identifier: str,\n default: D,\n) -> Union[D, V]:\n \"\"\"Get item from a package name lookup mapping with a resolver identifier.\n\n This extra logic is needed when the target mapping is keyed by package\n name, which cannot be directly looked up with an identifier (which may\n contain requested extras). Additional logic is added to also look up a value\n by \"cleaning up\" the extras from the identifier.\n \"\"\"\n if identifier in mapping:\n return mapping[identifier]\n # HACK: Theoretically we should check whether this identifier is a valid\n # \"NAME[EXTRAS]\" format, and parse out the name part with packaging or\n # some regular expression. But since pip's resolver only spits out three\n # kinds of identifiers: normalized PEP 503 names, normalized names plus\n # extras, and Requires-Python, we can cheat a bit here.\n name, open_bracket, _ = identifier.partition(\"[\")\n if open_bracket and name in mapping:\n return mapping[name]\n return default\n\n\nclass PipProvider(_ProviderBase):\n \"\"\"Pip's provider implementation for resolvelib.\n\n :params constraints: A mapping of constraints specified by the user. Keys\n are canonicalized project names.\n :params ignore_dependencies: Whether the user specified ``--no-deps``.\n :params upgrade_strategy: The user-specified upgrade strategy.\n :params user_requested: A set of canonicalized package names that the user\n supplied for pip to install/upgrade.\n \"\"\"\n\n def __init__(\n self,\n factory: Factory,\n constraints: Dict[str, Constraint],\n ignore_dependencies: bool,\n upgrade_strategy: str,\n user_requested: Dict[str, int],\n ) -> None:\n self._factory = factory\n self._constraints = constraints\n self._ignore_dependencies = ignore_dependencies\n self._upgrade_strategy = upgrade_strategy\n self._user_requested = user_requested\n\n def identify(self, requirement_or_candidate: Union[Requirement, Candidate]) -> str:\n return requirement_or_candidate.name\n\n def narrow_requirement_selection(\n self,\n identifiers: Iterable[str],\n resolutions: Mapping[str, Candidate],\n candidates: Mapping[str, Iterator[Candidate]],\n information: Mapping[str, Iterator[\"PreferenceInformation\"]],\n backtrack_causes: Sequence[\"PreferenceInformation\"],\n ) -> Iterable[str]:\n \"\"\"Produce a subset of identifiers that should be considered before others.\n\n Currently pip narrows the following selection:\n * Requires-Python, if present is always returned by itself\n * Backtrack causes are considered next because they can be identified\n in linear time here, whereas because get_preference() is called\n for each identifier, it would be quadratic to check for them there.\n Further, the current backtrack causes likely need to be resolved\n before other requirements as a resolution can't be found while\n there is a conflict.\n \"\"\"\n backtrack_identifiers = set()\n for info in backtrack_causes:\n backtrack_identifiers.add(info.requirement.name)\n if info.parent is not None:\n backtrack_identifiers.add(info.parent.name)\n\n current_backtrack_causes = []\n for identifier in identifiers:\n # Requires-Python has only one candidate and the check is basically\n # free, so we always do it first to avoid needless work if it fails.\n # This skips calling get_preference() for all other identifiers.\n if identifier == REQUIRES_PYTHON_IDENTIFIER:\n return [identifier]\n\n # Check if this identifier is a backtrack cause\n if identifier in backtrack_identifiers:\n current_backtrack_causes.append(identifier)\n continue\n\n if current_backtrack_causes:\n return current_backtrack_causes\n\n return identifiers\n\n def get_preference(\n self,\n identifier: str,\n resolutions: Mapping[str, Candidate],\n candidates: Mapping[str, Iterator[Candidate]],\n information: Mapping[str, Iterable[\"PreferenceInformation\"]],\n backtrack_causes: Sequence[\"PreferenceInformation\"],\n ) -> \"Preference\":\n \"\"\"Produce a sort key for given requirement based on preference.\n\n The lower the return value is, the more preferred this group of\n arguments is.\n\n Currently pip considers the following in order:\n\n * Any requirement that is \"direct\", e.g., points to an explicit URL.\n * Any requirement that is \"pinned\", i.e., contains the operator ``===``\n or ``==`` without a wildcard.\n * Any requirement that imposes an upper version limit, i.e., contains the\n operator ``<``, ``<=``, ``~=``, or ``==`` with a wildcard. Because\n pip prioritizes the latest version, preferring explicit upper bounds\n can rule out infeasible candidates sooner. This does not imply that\n upper bounds are good practice; they can make dependency management\n and resolution harder.\n * Order user-specified requirements as they are specified, placing\n other requirements afterward.\n * Any \"non-free\" requirement, i.e., one that contains at least one\n operator, such as ``>=`` or ``!=``.\n * Alphabetical order for consistency (aids debuggability).\n \"\"\"\n try:\n next(iter(information[identifier]))\n except StopIteration:\n # There is no information for this identifier, so there's no known\n # candidates.\n has_information = False\n else:\n has_information = True\n\n if not has_information:\n direct = False\n ireqs: Tuple[Optional[InstallRequirement], ...] = ()\n else:\n # Go through the information and for each requirement,\n # check if it's explicit (e.g., a direct link) and get the\n # InstallRequirement (the second element) from get_candidate_lookup()\n directs, ireqs = zip(\n *(\n (isinstance(r, ExplicitRequirement), r.get_candidate_lookup()[1])\n for r, _ in information[identifier]\n )\n )\n direct = any(directs)\n\n operators: list[tuple[str, str]] = [\n (specifier.operator, specifier.version)\n for specifier_set in (ireq.specifier for ireq in ireqs if ireq)\n for specifier in specifier_set\n ]\n\n pinned = any(((op[:2] == \"==\") and (\"*\" not in ver)) for op, ver in operators)\n upper_bounded = any(\n ((op in (\"<\", \"<=\", \"~=\")) or (op == \"==\" and \"*\" in ver))\n for op, ver in operators\n )\n unfree = bool(operators)\n requested_order = self._user_requested.get(identifier, math.inf)\n\n return (\n not direct,\n not pinned,\n not upper_bounded,\n requested_order,\n not unfree,\n identifier,\n )\n\n def find_matches(\n self,\n identifier: str,\n requirements: Mapping[str, Iterator[Requirement]],\n incompatibilities: Mapping[str, Iterator[Candidate]],\n ) -> Iterable[Candidate]:\n def _eligible_for_upgrade(identifier: str) -> bool:\n \"\"\"Are upgrades allowed for this project?\n\n This checks the upgrade strategy, and whether the project was one\n that the user specified in the command line, in order to decide\n whether we should upgrade if there's a newer version available.\n\n (Note that we don't need access to the `--upgrade` flag, because\n an upgrade strategy of \"to-satisfy-only\" means that `--upgrade`\n was not specified).\n \"\"\"\n if self._upgrade_strategy == \"eager\":\n return True\n elif self._upgrade_strategy == \"only-if-needed\":\n user_order = _get_with_identifier(\n self._user_requested,\n identifier,\n default=None,\n )\n return user_order is not None\n return False\n\n constraint = _get_with_identifier(\n self._constraints,\n identifier,\n default=Constraint.empty(),\n )\n return self._factory.find_candidates(\n identifier=identifier,\n requirements=requirements,\n constraint=constraint,\n prefers_installed=(not _eligible_for_upgrade(identifier)),\n incompatibilities=incompatibilities,\n is_satisfied_by=self.is_satisfied_by,\n )\n\n @staticmethod\n @lru_cache(maxsize=None)\n def is_satisfied_by(requirement: Requirement, candidate: Candidate) -> bool:\n return requirement.is_satisfied_by(candidate)\n\n def get_dependencies(self, candidate: Candidate) -> Iterable[Requirement]:\n with_requires = not self._ignore_dependencies\n # iter_dependencies() can perform nontrivial work so delay until needed.\n return (r for r in candidate.iter_dependencies(with_requires) if r is not None)\n",[],[100,509,516,523,475,544,1479,1503,1545],{"_104":1553,"_96":1554,"_158":1555,"_160":1504,"_161":139,"_162":1556,"_164":165,"_106":1557,"_101":29,"_167":215,"_169":1558,"_170":25,"_171":-5,"_172":1559,"_99":1560},"064adea2-67fc-11f0-bf1a-0224a6c84d84","reporter.py","064adf4c-67fc-11f0-bf1a-0224a6c84d84",218,["D",1753299258339],"from collections import defaultdict\nfrom logging import getLogger\nfrom typing import Any, DefaultDict, Optional\n\nfrom pip._vendor.resolvelib.reporters import BaseReporter\n\nfrom .base import Candidate, Requirement\n\nlogger = getLogger(__name__)\n\n\nclass PipReporter(BaseReporter[Requirement, Candidate, str]):\n def __init__(self) -> None:\n self.reject_count_by_package: DefaultDict[str, int] = defaultdict(int)\n\n self._messages_at_reject_count = {\n 1: (\n \"pip is looking at multiple versions of {package_name} to \"\n \"determine which version is compatible with other \"\n \"requirements. This could take a while.\"\n ),\n 8: (\n \"pip is still looking at multiple versions of {package_name} to \"\n \"determine which version is compatible with other \"\n \"requirements. This could take a while.\"\n ),\n 13: (\n \"This is taking longer than usual. You might need to provide \"\n \"the dependency resolver with stricter constraints to reduce \"\n \"runtime. See https://pip.pypa.io/warnings/backtracking for \"\n \"guidance. If you want to abort this run, press Ctrl + C.\"\n ),\n }\n\n def rejecting_candidate(self, criterion: Any, candidate: Candidate) -> None:\n self.reject_count_by_package[candidate.name] += 1\n\n count = self.reject_count_by_package[candidate.name]\n if count not in self._messages_at_reject_count:\n return\n\n message = self._messages_at_reject_count[count]\n logger.info(\"INFO: %s\", message.format(package_name=candidate.name))\n\n msg = \"Will try a different candidate, due to conflict:\"\n for req_info in criterion.information:\n req, parent = req_info.requirement, req_info.parent\n # Inspired by Factory.get_installation_error\n msg += \"\\n \"\n if parent:\n msg += f\"{parent.name} {parent.version} depends on \"\n else:\n msg += \"The user requested \"\n msg += req.format_for_error()\n logger.debug(msg)\n\n\nclass PipDebuggingReporter(BaseReporter[Requirement, Candidate, str]):\n \"\"\"A reporter that does an info log for every event it sees.\"\"\"\n\n def starting(self) -> None:\n logger.info(\"Reporter.starting()\")\n\n def starting_round(self, index: int) -> None:\n logger.info(\"Reporter.starting_round(%r)\", index)\n\n def ending_round(self, index: int, state: Any) -> None:\n logger.info(\"Reporter.ending_round(%r, state)\", index)\n logger.debug(\"Reporter.ending_round(%r, %r)\", index, state)\n\n def ending(self, state: Any) -> None:\n logger.info(\"Reporter.ending(%r)\", state)\n\n def adding_requirement(\n self, requirement: Requirement, parent: Optional[Candidate]\n ) -> None:\n logger.info(\"Reporter.adding_requirement(%r, %r)\", requirement, parent)\n\n def rejecting_candidate(self, criterion: Any, candidate: Candidate) -> None:\n logger.info(\"Reporter.rejecting_candidate(%r, %r)\", criterion, candidate)\n\n def pinning(self, candidate: Candidate) -> None:\n logger.info(\"Reporter.pinning(%r)\", candidate)\n",[],[100,509,516,523,475,544,1479,1503,1554],{"_104":1562,"_96":1563,"_158":1564,"_160":1504,"_161":139,"_162":1565,"_164":165,"_106":1566,"_101":29,"_167":215,"_169":1567,"_170":25,"_171":-5,"_172":1568,"_99":1569},"06549226-67fc-11f0-8d4e-0224a6c84d84","requirements.py","065492d0-67fc-11f0-8d4e-0224a6c84d84",220,["D",1753299258403],"from typing import Any, Optional\n\nfrom pip._vendor.packaging.specifiers import SpecifierSet\nfrom pip._vendor.packaging.utils import NormalizedName, canonicalize_name\n\nfrom pip._internal.req.constructors import install_req_drop_extras\nfrom pip._internal.req.req_install import InstallRequirement\n\nfrom .base import Candidate, CandidateLookup, Requirement, format_name\n\n\nclass ExplicitRequirement(Requirement):\n def __init__(self, candidate: Candidate) -> None:\n self.candidate = candidate\n\n def __str__(self) -> str:\n return str(self.candidate)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({self.candidate!r})\"\n\n def __hash__(self) -> int:\n return hash(self.candidate)\n\n def __eq__(self, other: Any) -> bool:\n if not isinstance(other, ExplicitRequirement):\n return False\n return self.candidate == other.candidate\n\n @property\n def project_name(self) -> NormalizedName:\n # No need to canonicalize - the candidate did this\n return self.candidate.project_name\n\n @property\n def name(self) -> str:\n # No need to canonicalize - the candidate did this\n return self.candidate.name\n\n def format_for_error(self) -> str:\n return self.candidate.format_for_error()\n\n def get_candidate_lookup(self) -> CandidateLookup:\n return self.candidate, None\n\n def is_satisfied_by(self, candidate: Candidate) -> bool:\n return candidate == self.candidate\n\n\nclass SpecifierRequirement(Requirement):\n def __init__(self, ireq: InstallRequirement) -> None:\n assert ireq.link is None, \"This is a link, not a specifier\"\n self._ireq = ireq\n self._equal_cache: Optional[str] = None\n self._hash: Optional[int] = None\n self._extras = frozenset(canonicalize_name(e) for e in self._ireq.extras)\n\n @property\n def _equal(self) -> str:\n if self._equal_cache is not None:\n return self._equal_cache\n\n self._equal_cache = str(self._ireq)\n return self._equal_cache\n\n def __str__(self) -> str:\n return str(self._ireq.req)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({str(self._ireq.req)!r})\"\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, SpecifierRequirement):\n return NotImplemented\n return self._equal == other._equal\n\n def __hash__(self) -> int:\n if self._hash is not None:\n return self._hash\n\n self._hash = hash(self._equal)\n return self._hash\n\n @property\n def project_name(self) -> NormalizedName:\n assert self._ireq.req, \"Specifier-backed ireq is always PEP 508\"\n return canonicalize_name(self._ireq.req.name)\n\n @property\n def name(self) -> str:\n return format_name(self.project_name, self._extras)\n\n def format_for_error(self) -> str:\n # Convert comma-separated specifiers into \"A, B, ..., F and G\"\n # This makes the specifier a bit more \"human readable\", without\n # risking a change in meaning. (Hopefully! Not all edge cases have\n # been checked)\n parts = [s.strip() for s in str(self).split(\",\")]\n if len(parts) == 0:\n return \"\"\n elif len(parts) == 1:\n return parts[0]\n\n return \", \".join(parts[:-1]) + \" and \" + parts[-1]\n\n def get_candidate_lookup(self) -> CandidateLookup:\n return None, self._ireq\n\n def is_satisfied_by(self, candidate: Candidate) -> bool:\n assert candidate.name == self.name, (\n f\"Internal issue: Candidate is not for this requirement \"\n f\"{candidate.name} vs {self.name}\"\n )\n # We can safely always allow prereleases here since PackageFinder\n # already implements the prerelease logic, and would have filtered out\n # prerelease candidates if the user does not expect them.\n assert self._ireq.req, \"Specifier-backed ireq is always PEP 508\"\n spec = self._ireq.req.specifier\n return spec.contains(candidate.version, prereleases=True)\n\n\nclass SpecifierWithoutExtrasRequirement(SpecifierRequirement):\n \"\"\"\n Requirement backed by an install requirement on a base package.\n Trims extras from its install requirement if there are any.\n \"\"\"\n\n def __init__(self, ireq: InstallRequirement) -> None:\n assert ireq.link is None, \"This is a link, not a specifier\"\n self._ireq = install_req_drop_extras(ireq)\n self._equal_cache: Optional[str] = None\n self._hash: Optional[int] = None\n self._extras = frozenset(canonicalize_name(e) for e in self._ireq.extras)\n\n @property\n def _equal(self) -> str:\n if self._equal_cache is not None:\n return self._equal_cache\n\n self._equal_cache = str(self._ireq)\n return self._equal_cache\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, SpecifierWithoutExtrasRequirement):\n return NotImplemented\n return self._equal == other._equal\n\n def __hash__(self) -> int:\n if self._hash is not None:\n return self._hash\n\n self._hash = hash(self._equal)\n return self._hash\n\n\nclass RequiresPythonRequirement(Requirement):\n \"\"\"A requirement representing Requires-Python metadata.\"\"\"\n\n def __init__(self, specifier: SpecifierSet, match: Candidate) -> None:\n self.specifier = specifier\n self._specifier_string = str(specifier) # for faster __eq__\n self._hash: Optional[int] = None\n self._candidate = match\n\n def __str__(self) -> str:\n return f\"Python {self.specifier}\"\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({str(self.specifier)!r})\"\n\n def __hash__(self) -> int:\n if self._hash is not None:\n return self._hash\n\n self._hash = hash((self._specifier_string, self._candidate))\n return self._hash\n\n def __eq__(self, other: Any) -> bool:\n if not isinstance(other, RequiresPythonRequirement):\n return False\n return (\n self._specifier_string == other._specifier_string\n and self._candidate == other._candidate\n )\n\n @property\n def project_name(self) -> NormalizedName:\n return self._candidate.project_name\n\n @property\n def name(self) -> str:\n return self._candidate.name\n\n def format_for_error(self) -> str:\n return str(self)\n\n def get_candidate_lookup(self) -> CandidateLookup:\n if self.specifier.contains(self._candidate.version, prereleases=True):\n return self._candidate, None\n return None, None\n\n def is_satisfied_by(self, candidate: Candidate) -> bool:\n assert candidate.name == self._candidate.name, \"Not Python candidate\"\n # We can safely always allow prereleases here since PackageFinder\n # already implements the prerelease logic, and would have filtered out\n # prerelease candidates if the user does not expect them.\n return self.specifier.contains(candidate.version, prereleases=True)\n\n\nclass UnsatisfiableRequirement(Requirement):\n \"\"\"A requirement that cannot be satisfied.\"\"\"\n\n def __init__(self, name: NormalizedName) -> None:\n self._name = name\n\n def __str__(self) -> str:\n return f\"{self._name} (unavailable)\"\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({str(self._name)!r})\"\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, UnsatisfiableRequirement):\n return NotImplemented\n return self._name == other._name\n\n def __hash__(self) -> int:\n return hash(self._name)\n\n @property\n def project_name(self) -> NormalizedName:\n return self._name\n\n @property\n def name(self) -> str:\n return self._name\n\n def format_for_error(self) -> str:\n return str(self)\n\n def get_candidate_lookup(self) -> CandidateLookup:\n return None, None\n\n def is_satisfied_by(self, candidate: Candidate) -> bool:\n return False\n",[],[100,509,516,523,475,544,1479,1503,1563],{"_104":1571,"_96":1493,"_158":1572,"_160":1504,"_161":139,"_162":1573,"_164":165,"_106":1574,"_101":29,"_167":215,"_169":1575,"_170":25,"_171":-5,"_172":1576,"_99":1577},"0659a02c-67fc-11f0-bf1a-0224a6c84d84","0659a0f4-67fc-11f0-bf1a-0224a6c84d84",221,["D",1753299258437],"import contextlib\nimport functools\nimport logging\nimport os\nfrom typing import TYPE_CHECKING, Dict, List, Optional, Set, Tuple, cast\n\nfrom pip._vendor.packaging.utils import canonicalize_name\nfrom pip._vendor.resolvelib import BaseReporter, ResolutionImpossible, ResolutionTooDeep\nfrom pip._vendor.resolvelib import Resolver as RLResolver\nfrom pip._vendor.resolvelib.structs import DirectedGraph\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.exceptions import ResolutionTooDeepError\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.operations.prepare import RequirementPreparer\nfrom pip._internal.req.constructors import install_req_extend_extras\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.req.req_set import RequirementSet\nfrom pip._internal.resolution.base import BaseResolver, InstallRequirementProvider\nfrom pip._internal.resolution.resolvelib.provider import PipProvider\nfrom pip._internal.resolution.resolvelib.reporter import (\n PipDebuggingReporter,\n PipReporter,\n)\nfrom pip._internal.utils.packaging import get_requirement\n\nfrom .base import Candidate, Requirement\nfrom .factory import Factory\n\nif TYPE_CHECKING:\n from pip._vendor.resolvelib.resolvers import Result as RLResult\n\n Result = RLResult[Requirement, Candidate, str]\n\n\nlogger = logging.getLogger(__name__)\n\n\nclass Resolver(BaseResolver):\n _allowed_strategies = {\"eager\", \"only-if-needed\", \"to-satisfy-only\"}\n\n def __init__(\n self,\n preparer: RequirementPreparer,\n finder: PackageFinder,\n wheel_cache: Optional[WheelCache],\n make_install_req: InstallRequirementProvider,\n use_user_site: bool,\n ignore_dependencies: bool,\n ignore_installed: bool,\n ignore_requires_python: bool,\n force_reinstall: bool,\n upgrade_strategy: str,\n py_version_info: Optional[Tuple[int, ...]] = None,\n ):\n super().__init__()\n assert upgrade_strategy in self._allowed_strategies\n\n self.factory = Factory(\n finder=finder,\n preparer=preparer,\n make_install_req=make_install_req,\n wheel_cache=wheel_cache,\n use_user_site=use_user_site,\n force_reinstall=force_reinstall,\n ignore_installed=ignore_installed,\n ignore_requires_python=ignore_requires_python,\n py_version_info=py_version_info,\n )\n self.ignore_dependencies = ignore_dependencies\n self.upgrade_strategy = upgrade_strategy\n self._result: Optional[Result] = None\n\n def resolve(\n self, root_reqs: List[InstallRequirement], check_supported_wheels: bool\n ) -> RequirementSet:\n collected = self.factory.collect_root_requirements(root_reqs)\n provider = PipProvider(\n factory=self.factory,\n constraints=collected.constraints,\n ignore_dependencies=self.ignore_dependencies,\n upgrade_strategy=self.upgrade_strategy,\n user_requested=collected.user_requested,\n )\n if \"PIP_RESOLVER_DEBUG\" in os.environ:\n reporter: BaseReporter[Requirement, Candidate, str] = PipDebuggingReporter()\n else:\n reporter = PipReporter()\n resolver: RLResolver[Requirement, Candidate, str] = RLResolver(\n provider,\n reporter,\n )\n\n try:\n limit_how_complex_resolution_can_be = 200000\n result = self._result = resolver.resolve(\n collected.requirements, max_rounds=limit_how_complex_resolution_can_be\n )\n\n except ResolutionImpossible as e:\n error = self.factory.get_installation_error(\n cast(\"ResolutionImpossible[Requirement, Candidate]\", e),\n collected.constraints,\n )\n raise error from e\n except ResolutionTooDeep:\n raise ResolutionTooDeepError from None\n\n req_set = RequirementSet(check_supported_wheels=check_supported_wheels)\n # process candidates with extras last to ensure their base equivalent is\n # already in the req_set if appropriate.\n # Python's sort is stable so using a binary key function keeps relative order\n # within both subsets.\n for candidate in sorted(\n result.mapping.values(), key=lambda c: c.name != c.project_name\n ):\n ireq = candidate.get_install_requirement()\n if ireq is None:\n if candidate.name != candidate.project_name:\n # extend existing req's extras\n with contextlib.suppress(KeyError):\n req = req_set.get_requirement(candidate.project_name)\n req_set.add_named_requirement(\n install_req_extend_extras(\n req, get_requirement(candidate.name).extras\n )\n )\n continue\n\n # Check if there is already an installation under the same name,\n # and set a flag for later stages to uninstall it, if needed.\n installed_dist = self.factory.get_dist_to_uninstall(candidate)\n if installed_dist is None:\n # There is no existing installation -- nothing to uninstall.\n ireq.should_reinstall = False\n elif self.factory.force_reinstall:\n # The --force-reinstall flag is set -- reinstall.\n ireq.should_reinstall = True\n elif installed_dist.version != candidate.version:\n # The installation is different in version -- reinstall.\n ireq.should_reinstall = True\n elif candidate.is_editable or installed_dist.editable:\n # The incoming distribution is editable, or different in\n # editable-ness to installation -- reinstall.\n ireq.should_reinstall = True\n elif candidate.source_link and candidate.source_link.is_file:\n # The incoming distribution is under file://\n if candidate.source_link.is_wheel:\n # is a local wheel -- do nothing.\n logger.info(\n \"%s is already installed with the same version as the \"\n \"provided wheel. Use --force-reinstall to force an \"\n \"installation of the wheel.\",\n ireq.name,\n )\n continue\n\n # is a local sdist or path -- reinstall\n ireq.should_reinstall = True\n else:\n continue\n\n link = candidate.source_link\n if link and link.is_yanked:\n # The reason can contain non-ASCII characters, Unicode\n # is required for Python 2.\n msg = (\n \"The candidate selected for download or install is a \"\n \"yanked version: {name!r} candidate (version {version} \"\n \"at {link})\\nReason for being yanked: {reason}\"\n ).format(\n name=candidate.name,\n version=candidate.version,\n link=link,\n reason=link.yanked_reason or \"\",\n )\n logger.warning(msg)\n\n req_set.add_named_requirement(ireq)\n\n reqs = req_set.all_requirements\n self.factory.preparer.prepare_linked_requirements_more(reqs)\n for req in reqs:\n req.prepared = True\n req.needs_more_preparation = False\n return req_set\n\n def get_installation_order(\n self, req_set: RequirementSet\n ) -> List[InstallRequirement]:\n \"\"\"Get order for installation of requirements in RequirementSet.\n\n The returned list contains a requirement before another that depends on\n it. This helps ensure that the environment is kept consistent as they\n get installed one-by-one.\n\n The current implementation creates a topological ordering of the\n dependency graph, giving more weight to packages with less\n or no dependencies, while breaking any cycles in the graph at\n arbitrary points. We make no guarantees about where the cycle\n would be broken, other than it *would* be broken.\n \"\"\"\n assert self._result is not None, \"must call resolve() first\"\n\n if not req_set.requirements:\n # Nothing is left to install, so we do not need an order.\n return []\n\n graph = self._result.graph\n weights = get_topological_weights(graph, set(req_set.requirements.keys()))\n\n sorted_items = sorted(\n req_set.requirements.items(),\n key=functools.partial(_req_set_item_sorter, weights=weights),\n reverse=True,\n )\n return [ireq for _, ireq in sorted_items]\n\n\ndef get_topological_weights(\n graph: \"DirectedGraph[Optional[str]]\", requirement_keys: Set[str]\n) -> Dict[Optional[str], int]:\n \"\"\"Assign weights to each node based on how \"deep\" they are.\n\n This implementation may change at any point in the future without prior\n notice.\n\n We first simplify the dependency graph by pruning any leaves and giving them\n the highest weight: a package without any dependencies should be installed\n first. This is done again and again in the same way, giving ever less weight\n to the newly found leaves. The loop stops when no leaves are left: all\n remaining packages have at least one dependency left in the graph.\n\n Then we continue with the remaining graph, by taking the length for the\n longest path to any node from root, ignoring any paths that contain a single\n node twice (i.e. cycles). This is done through a depth-first search through\n the graph, while keeping track of the path to the node.\n\n Cycles in the graph result would result in node being revisited while also\n being on its own path. In this case, take no action. This helps ensure we\n don't get stuck in a cycle.\n\n When assigning weight, the longer path (i.e. larger length) is preferred.\n\n We are only interested in the weights of packages that are in the\n requirement_keys.\n \"\"\"\n path: Set[Optional[str]] = set()\n weights: Dict[Optional[str], int] = {}\n\n def visit(node: Optional[str]) -> None:\n if node in path:\n # We hit a cycle, so we'll break it here.\n return\n\n # Time to visit the children!\n path.add(node)\n for child in graph.iter_children(node):\n visit(child)\n path.remove(node)\n\n if node not in requirement_keys:\n return\n\n last_known_parent_count = weights.get(node, 0)\n weights[node] = max(last_known_parent_count, len(path))\n\n # Simplify the graph, pruning leaves that have no dependencies.\n # This is needed for large graphs (say over 200 packages) because the\n # `visit` function is exponentially slower then, taking minutes.\n # See https://github.com/pypa/pip/issues/10557\n # We will loop until we explicitly break the loop.\n while True:\n leaves = set()\n for key in graph:\n if key is None:\n continue\n for _child in graph.iter_children(key):\n # This means we have at least one child\n break\n else:\n # No child.\n leaves.add(key)\n if not leaves:\n # We are done simplifying.\n break\n # Calculate the weight for the leaves.\n weight = len(graph) - 1\n for leaf in leaves:\n if leaf not in requirement_keys:\n continue\n weights[leaf] = weight\n # Remove the leaves from the graph, making it simpler.\n for leaf in leaves:\n graph.remove(leaf)\n\n # Visit the remaining graph.\n # `None` is guaranteed to be the root node by resolvelib.\n visit(None)\n\n # Sanity check: all requirement keys should be in the weights,\n # and no other keys should be in the weights.\n difference = set(weights.keys()).difference(requirement_keys)\n assert not difference, difference\n\n return weights\n\n\ndef _req_set_item_sorter(\n item: Tuple[str, InstallRequirement],\n weights: Dict[Optional[str], int],\n) -> Tuple[int, str]:\n \"\"\"Key function used to sort install requirements for installation.\n\n Based on the \"weight\" mapping calculated in ``get_installation_order()``.\n The canonical package name is returned as the second member as a tie-\n breaker to ensure the result is predictable, which is useful in tests.\n \"\"\"\n name = canonicalize_name(item[0])\n return weights[name], name\n",[],[100,509,516,523,475,544,1479,1503,1493],[100,509,516,523,475,544,1479,1503],{"_104":1580,"_96":868,"_158":1581,"_160":1480,"_161":139,"_162":1582,"_164":165,"_106":1583,"_101":29,"_167":215,"_169":1584,"_170":25,"_171":-5,"_172":1585,"_99":1586},"0640a216-67fc-11f0-84bb-0224a6c84d84","0640a2ac-67fc-11f0-84bb-0224a6c84d84",216,["D",1753299258274],"from typing import Callable, List, Optional\n\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.req.req_set import RequirementSet\n\nInstallRequirementProvider = Callable[\n [str, Optional[InstallRequirement]], InstallRequirement\n]\n\n\nclass BaseResolver:\n def resolve(\n self, root_reqs: List[InstallRequirement], check_supported_wheels: bool\n ) -> RequirementSet:\n raise NotImplementedError()\n\n def get_installation_order(\n self, req_set: RequirementSet\n ) -> List[InstallRequirement]:\n raise NotImplementedError()\n",[],[100,509,516,523,475,544,1479,868],[100,509,516,523,475,544,1479],{"_104":1589,"_96":1590,"_158":1591,"_160":545,"_161":139,"_162":1592,"_164":165,"_106":1593,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1594,"_99":1819},"fbf914dc-67fb-11f0-8cc3-0224a6c84d84","utils","fbf915b8-67fb-11f0-8cc3-0224a6c84d84",58,["D",1753299241027],[1595,1604,1613,1622,1631,1640,1649,1658,1667,1676,1685,1694,1703,1712,1721,1730,1739,1748,1757,1766,1775,1784,1793,1802,1811],{"_104":1596,"_96":1597,"_158":1598,"_160":1591,"_161":139,"_162":1599,"_164":165,"_106":1600,"_101":29,"_167":215,"_169":1601,"_170":25,"_171":-5,"_172":1602,"_99":1603},"04bfe38e-67fc-11f0-9ad5-0224a6c84d84","_jaraco_text.py","04bfe460-67fc-11f0-9ad5-0224a6c84d84",151,["D",1753299255751],"\"\"\"Functions brought over from jaraco.text.\n\nThese functions are not supposed to be used within `pip._internal`. These are\nhelper functions brought over from `jaraco.text` to enable vendoring newer\ncopies of `pkg_resources` without having to vendor `jaraco.text` and its entire\ndependency cone; something that our vendoring setup is not currently capable of\nhandling.\n\nLicense reproduced from original source below:\n\nCopyright Jason R. Coombs\n\nPermission is hereby granted, free of charge, to any person obtaining a copy\nof this software and associated documentation files (the \"Software\"), to\ndeal in the Software without restriction, including without limitation the\nrights to use, copy, modify, merge, publish, distribute, sublicense, and/or\nsell copies of the Software, and to permit persons to whom the Software is\nfurnished to do so, subject to the following conditions:\n\nThe above copyright notice and this permission notice shall be included in\nall copies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\nIMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\nFITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\nAUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\nLIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING\nFROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS\nIN THE SOFTWARE.\n\"\"\"\n\nimport functools\nimport itertools\n\n\ndef _nonblank(str):\n return str and not str.startswith(\"#\")\n\n\n@functools.singledispatch\ndef yield_lines(iterable):\n r\"\"\"\n Yield valid lines of a string or iterable.\n\n >>> list(yield_lines(''))\n []\n >>> list(yield_lines(['foo', 'bar']))\n ['foo', 'bar']\n >>> list(yield_lines('foo\\nbar'))\n ['foo', 'bar']\n >>> list(yield_lines('\\nfoo\\n#bar\\nbaz #comment'))\n ['foo', 'baz #comment']\n >>> list(yield_lines(['foo\\nbar', 'baz', 'bing\\n\\n\\n']))\n ['foo', 'bar', 'baz', 'bing']\n \"\"\"\n return itertools.chain.from_iterable(map(yield_lines, iterable))\n\n\n@yield_lines.register(str)\ndef _(text):\n return filter(_nonblank, map(str.strip, text.splitlines()))\n\n\ndef drop_comment(line):\n \"\"\"\n Drop comments.\n\n >>> drop_comment('foo # bar')\n 'foo'\n\n A hash without a space may be in a URL.\n\n >>> drop_comment('http://example.com/foo#bar')\n 'http://example.com/foo#bar'\n \"\"\"\n return line.partition(\" #\")[0]\n\n\ndef join_continuation(lines):\n r\"\"\"\n Join lines continued by a trailing backslash.\n\n >>> list(join_continuation(['foo \\\\', 'bar', 'baz']))\n ['foobar', 'baz']\n >>> list(join_continuation(['foo \\\\', 'bar', 'baz']))\n ['foobar', 'baz']\n >>> list(join_continuation(['foo \\\\', 'bar \\\\', 'baz']))\n ['foobarbaz']\n\n Not sure why, but...\n The character preceding the backslash is also elided.\n\n >>> list(join_continuation(['goo\\\\', 'dly']))\n ['godly']\n\n A terrible idea, but...\n If no line is available to continue, suppress the lines.\n\n >>> list(join_continuation(['foo', 'bar\\\\', 'baz\\\\']))\n ['foo']\n \"\"\"\n lines = iter(lines)\n for item in lines:\n while item.endswith(\"\\\\\"):\n try:\n item = item[:-2].strip() + next(lines)\n except StopIteration:\n return\n yield item\n",[],[100,509,516,523,475,544,1590,1597],{"_104":1605,"_96":1606,"_158":1607,"_160":1591,"_161":139,"_162":1608,"_164":165,"_106":1609,"_101":29,"_167":215,"_169":1610,"_170":25,"_171":-5,"_172":1611,"_99":1612},"05157254-67fc-11f0-b87e-0224a6c84d84","_log.py","0515731c-67fc-11f0-b87e-0224a6c84d84",165,["D",1753299256281],"\"\"\"Customize logging\n\nDefines custom logger class for the `logger.verbose(...)` method.\n\ninit_logging() must be called before any other modules that call logging.getLogger.\n\"\"\"\n\nimport logging\nfrom typing import Any, cast\n\n# custom log level for `--verbose` output\n# between DEBUG and INFO\nVERBOSE = 15\n\n\nclass VerboseLogger(logging.Logger):\n \"\"\"Custom Logger, defining a verbose log-level\n\n VERBOSE is between INFO and DEBUG.\n \"\"\"\n\n def verbose(self, msg: str, *args: Any, **kwargs: Any) -> None:\n return self.log(VERBOSE, msg, *args, **kwargs)\n\n\ndef getLogger(name: str) -> VerboseLogger:\n \"\"\"logging.getLogger, but ensures our VerboseLogger class is returned\"\"\"\n return cast(VerboseLogger, logging.getLogger(name))\n\n\ndef init_logging() -> None:\n \"\"\"Register our VerboseLogger and VERBOSE log level.\n\n Should be called before any calls to getLogger(),\n i.e. in pip._internal.__init__\n \"\"\"\n logging.setLoggerClass(VerboseLogger)\n logging.addLevelName(VERBOSE, \"VERBOSE\")\n",[],[100,509,516,523,475,544,1590,1606],{"_104":1614,"_96":1615,"_158":1616,"_160":1591,"_161":139,"_162":1617,"_164":165,"_106":1618,"_101":29,"_167":215,"_169":1619,"_170":25,"_171":-5,"_172":1620,"_99":1621},"04cc70f4-67fc-11f0-aedf-0224a6c84d84","appdirs.py","04cc719e-67fc-11f0-aedf-0224a6c84d84",154,["D",1753299255822],"\"\"\"\nThis code wraps the vendored appdirs module to so the return values are\ncompatible for the current pip code base.\n\nThe intention is to rewrite current usages gradually, keeping the tests pass,\nand eventually drop this after all usages are changed.\n\"\"\"\n\nimport os\nimport sys\nfrom typing import List\n\nfrom pip._vendor import platformdirs as _appdirs\n\n\ndef user_cache_dir(appname: str) -> str:\n return _appdirs.user_cache_dir(appname, appauthor=False)\n\n\ndef _macos_user_config_dir(appname: str, roaming: bool = True) -> str:\n # Use ~/Application Support/pip, if the directory exists.\n path = _appdirs.user_data_dir(appname, appauthor=False, roaming=roaming)\n if os.path.isdir(path):\n return path\n\n # Use a Linux-like ~/.config/pip, by default.\n linux_like_path = \"~/.config/\"\n if appname:\n linux_like_path = os.path.join(linux_like_path, appname)\n\n return os.path.expanduser(linux_like_path)\n\n\ndef user_config_dir(appname: str, roaming: bool = True) -> str:\n if sys.platform == \"darwin\":\n return _macos_user_config_dir(appname, roaming)\n\n return _appdirs.user_config_dir(appname, appauthor=False, roaming=roaming)\n\n\n# for the discussion regarding site_config_dir locations\n# see \ndef site_config_dirs(appname: str) -> List[str]:\n if sys.platform == \"darwin\":\n dirval = _appdirs.site_data_dir(appname, appauthor=False, multipath=True)\n return dirval.split(os.pathsep)\n\n dirval = _appdirs.site_config_dir(appname, appauthor=False, multipath=True)\n if sys.platform == \"win32\":\n return [dirval]\n\n # Unix-y system. Look in /etc as well.\n return dirval.split(os.pathsep) + [\"/etc\"]\n",[],[100,509,516,523,475,544,1590,1615],{"_104":1623,"_96":1624,"_158":1625,"_160":1591,"_161":139,"_162":1626,"_164":165,"_106":1627,"_101":29,"_167":215,"_169":1628,"_170":25,"_171":-5,"_172":1629,"_99":1630},"04a686e6-67fc-11f0-9d2d-0224a6c84d84","compat.py","04a68790-67fc-11f0-9d2d-0224a6c84d84",146,["D",1753299255582],"\"\"\"Stuff that differs in different Python versions and platform\ndistributions.\"\"\"\n\nimport importlib.resources\nimport logging\nimport os\nimport sys\nfrom typing import IO\n\n__all__ = [\"get_path_uid\", \"stdlib_pkgs\", \"WINDOWS\"]\n\n\nlogger = logging.getLogger(__name__)\n\n\ndef has_tls() -> bool:\n try:\n import _ssl # noqa: F401 # ignore unused\n\n return True\n except ImportError:\n pass\n\n from pip._vendor.urllib3.util import IS_PYOPENSSL\n\n return IS_PYOPENSSL\n\n\ndef get_path_uid(path: str) -> int:\n \"\"\"\n Return path's uid.\n\n Does not follow symlinks:\n https://github.com/pypa/pip/pull/935#discussion_r5307003\n\n Placed this function in compat due to differences on AIX and\n Jython, that should eventually go away.\n\n :raises OSError: When path is a symlink or can't be read.\n \"\"\"\n if hasattr(os, \"O_NOFOLLOW\"):\n fd = os.open(path, os.O_RDONLY | os.O_NOFOLLOW)\n file_uid = os.fstat(fd).st_uid\n os.close(fd)\n else: # AIX and Jython\n # WARNING: time of check vulnerability, but best we can do w/o NOFOLLOW\n if not os.path.islink(path):\n # older versions of Jython don't have `os.fstat`\n file_uid = os.stat(path).st_uid\n else:\n # raise OSError for parity with os.O_NOFOLLOW above\n raise OSError(f\"{path} is a symlink; Will not return uid for symlinks\")\n return file_uid\n\n\n# The importlib.resources.open_text function was deprecated in 3.11 with suggested\n# replacement we use below.\nif sys.version_info < (3, 11):\n open_text_resource = importlib.resources.open_text\nelse:\n\n def open_text_resource(\n package: str, resource: str, encoding: str = \"utf-8\", errors: str = \"strict\"\n ) -> IO[str]:\n return (importlib.resources.files(package) / resource).open(\n \"r\", encoding=encoding, errors=errors\n )\n\n\n# packages in the stdlib that may have installation metadata, but should not be\n# considered 'installed'. this theoretically could be determined based on\n# dist.location (py27:`sysconfig.get_paths()['stdlib']`,\n# py26:sysconfig.get_config_vars('LIBDEST')), but fear platform variation may\n# make this ineffective, so hard-coding\nstdlib_pkgs = {\"python\", \"wsgiref\", \"argparse\"}\n\n\n# windows detection, covers cpython and ironpython\nWINDOWS = sys.platform.startswith(\"win\") or (sys.platform == \"cli\" and os.name == \"nt\")\n",[],[100,509,516,523,475,544,1590,1624],{"_104":1632,"_96":1633,"_158":1634,"_160":1591,"_161":139,"_162":1635,"_164":165,"_106":1636,"_101":29,"_167":215,"_169":1637,"_170":25,"_171":-5,"_172":1638,"_99":1639},"04e9873e-67fc-11f0-8cc3-0224a6c84d84","compatibility_tags.py","04e987e8-67fc-11f0-8cc3-0224a6c84d84",159,["D",1753299256014],"\"\"\"Generate and work with PEP 425 Compatibility Tags.\"\"\"\n\nimport re\nfrom typing import List, Optional, Tuple\n\nfrom pip._vendor.packaging.tags import (\n PythonVersion,\n Tag,\n android_platforms,\n compatible_tags,\n cpython_tags,\n generic_tags,\n interpreter_name,\n interpreter_version,\n ios_platforms,\n mac_platforms,\n)\n\n_apple_arch_pat = re.compile(r\"(.+)_(\\d+)_(\\d+)_(.+)\")\n\n\ndef version_info_to_nodot(version_info: Tuple[int, ...]) -> str:\n # Only use up to the first two numbers.\n return \"\".join(map(str, version_info[:2]))\n\n\ndef _mac_platforms(arch: str) -> List[str]:\n match = _apple_arch_pat.match(arch)\n if match:\n name, major, minor, actual_arch = match.groups()\n mac_version = (int(major), int(minor))\n arches = [\n # Since we have always only checked that the platform starts\n # with \"macosx\", for backwards-compatibility we extract the\n # actual prefix provided by the user in case they provided\n # something like \"macosxcustom_\". It may be good to remove\n # this as undocumented or deprecate it in the future.\n \"{}_{}\".format(name, arch[len(\"macosx_\") :])\n for arch in mac_platforms(mac_version, actual_arch)\n ]\n else:\n # arch pattern didn't match (?!)\n arches = [arch]\n return arches\n\n\ndef _ios_platforms(arch: str) -> List[str]:\n match = _apple_arch_pat.match(arch)\n if match:\n name, major, minor, actual_multiarch = match.groups()\n ios_version = (int(major), int(minor))\n arches = [\n # Since we have always only checked that the platform starts\n # with \"ios\", for backwards-compatibility we extract the\n # actual prefix provided by the user in case they provided\n # something like \"ioscustom_\". It may be good to remove\n # this as undocumented or deprecate it in the future.\n \"{}_{}\".format(name, arch[len(\"ios_\") :])\n for arch in ios_platforms(ios_version, actual_multiarch)\n ]\n else:\n # arch pattern didn't match (?!)\n arches = [arch]\n return arches\n\n\ndef _android_platforms(arch: str) -> List[str]:\n match = re.fullmatch(r\"android_(\\d+)_(.+)\", arch)\n if match:\n api_level, abi = match.groups()\n return list(android_platforms(int(api_level), abi))\n else:\n # arch pattern didn't match (?!)\n return [arch]\n\n\ndef _custom_manylinux_platforms(arch: str) -> List[str]:\n arches = [arch]\n arch_prefix, arch_sep, arch_suffix = arch.partition(\"_\")\n if arch_prefix == \"manylinux2014\":\n # manylinux1/manylinux2010 wheels run on most manylinux2014 systems\n # with the exception of wheels depending on ncurses. PEP 599 states\n # manylinux1/manylinux2010 wheels should be considered\n # manylinux2014 wheels:\n # https://www.python.org/dev/peps/pep-0599/#backwards-compatibility-with-manylinux2010-wheels\n if arch_suffix in {\"i686\", \"x86_64\"}:\n arches.append(\"manylinux2010\" + arch_sep + arch_suffix)\n arches.append(\"manylinux1\" + arch_sep + arch_suffix)\n elif arch_prefix == \"manylinux2010\":\n # manylinux1 wheels run on most manylinux2010 systems with the\n # exception of wheels depending on ncurses. PEP 571 states\n # manylinux1 wheels should be considered manylinux2010 wheels:\n # https://www.python.org/dev/peps/pep-0571/#backwards-compatibility-with-manylinux1-wheels\n arches.append(\"manylinux1\" + arch_sep + arch_suffix)\n return arches\n\n\ndef _get_custom_platforms(arch: str) -> List[str]:\n arch_prefix, arch_sep, arch_suffix = arch.partition(\"_\")\n if arch.startswith(\"macosx\"):\n arches = _mac_platforms(arch)\n elif arch.startswith(\"ios\"):\n arches = _ios_platforms(arch)\n elif arch_prefix == \"android\":\n arches = _android_platforms(arch)\n elif arch_prefix in [\"manylinux2014\", \"manylinux2010\"]:\n arches = _custom_manylinux_platforms(arch)\n else:\n arches = [arch]\n return arches\n\n\ndef _expand_allowed_platforms(platforms: Optional[List[str]]) -> Optional[List[str]]:\n if not platforms:\n return None\n\n seen = set()\n result = []\n\n for p in platforms:\n if p in seen:\n continue\n additions = [c for c in _get_custom_platforms(p) if c not in seen]\n seen.update(additions)\n result.extend(additions)\n\n return result\n\n\ndef _get_python_version(version: str) -> PythonVersion:\n if len(version) > 1:\n return int(version[0]), int(version[1:])\n else:\n return (int(version[0]),)\n\n\ndef _get_custom_interpreter(\n implementation: Optional[str] = None, version: Optional[str] = None\n) -> str:\n if implementation is None:\n implementation = interpreter_name()\n if version is None:\n version = interpreter_version()\n return f\"{implementation}{version}\"\n\n\ndef get_supported(\n version: Optional[str] = None,\n platforms: Optional[List[str]] = None,\n impl: Optional[str] = None,\n abis: Optional[List[str]] = None,\n) -> List[Tag]:\n \"\"\"Return a list of supported tags for each version specified in\n `versions`.\n\n :param version: a string version, of the form \"33\" or \"32\",\n or None. The version will be assumed to support our ABI.\n :param platform: specify a list of platforms you want valid\n tags for, or None. If None, use the local system platform.\n :param impl: specify the exact implementation you want valid\n tags for, or None. If None, use the local interpreter impl.\n :param abis: specify a list of abis you want valid\n tags for, or None. If None, use the local interpreter abi.\n \"\"\"\n supported: List[Tag] = []\n\n python_version: Optional[PythonVersion] = None\n if version is not None:\n python_version = _get_python_version(version)\n\n interpreter = _get_custom_interpreter(impl, version)\n\n platforms = _expand_allowed_platforms(platforms)\n\n is_cpython = (impl or interpreter_name()) == \"cp\"\n if is_cpython:\n supported.extend(\n cpython_tags(\n python_version=python_version,\n abis=abis,\n platforms=platforms,\n )\n )\n else:\n supported.extend(\n generic_tags(\n interpreter=interpreter,\n abis=abis,\n platforms=platforms,\n )\n )\n supported.extend(\n compatible_tags(\n python_version=python_version,\n interpreter=interpreter,\n platforms=platforms,\n )\n )\n\n return supported\n",[],[100,509,516,523,475,544,1590,1633],{"_104":1641,"_96":1642,"_158":1643,"_160":1591,"_161":139,"_162":1644,"_164":165,"_106":1645,"_101":29,"_167":215,"_169":1646,"_170":25,"_171":-5,"_172":1647,"_99":1648},"04fcd0be-67fc-11f0-9ad5-0224a6c84d84","datetime.py","04fcd172-67fc-11f0-9ad5-0224a6c84d84",161,["D",1753299256116],"\"\"\"For when pip wants to check the date or time.\"\"\"\n\nimport datetime\n\n\ndef today_is_later_than(year: int, month: int, day: int) -> bool:\n today = datetime.date.today()\n given = datetime.date(year, month, day)\n\n return today > given\n",[],[100,509,516,523,475,544,1590,1642],{"_104":1650,"_96":1651,"_158":1652,"_160":1591,"_161":139,"_162":1653,"_164":165,"_106":1654,"_101":29,"_167":215,"_169":1655,"_170":25,"_171":-5,"_172":1656,"_99":1657},"04aad976-67fc-11f0-8cc3-0224a6c84d84","deprecation.py","04aada0c-67fc-11f0-8cc3-0224a6c84d84",147,["D",1753299255601],"\"\"\"\nA module that implements tooling to enable easy warnings about deprecations.\n\"\"\"\n\nimport logging\nimport warnings\nfrom typing import Any, Optional, TextIO, Type, Union\n\nfrom pip._vendor.packaging.version import parse\n\nfrom pip import __version__ as current_version # NOTE: tests patch this name.\n\nDEPRECATION_MSG_PREFIX = \"DEPRECATION: \"\n\n\nclass PipDeprecationWarning(Warning):\n pass\n\n\n_original_showwarning: Any = None\n\n\n# Warnings <-> Logging Integration\ndef _showwarning(\n message: Union[Warning, str],\n category: Type[Warning],\n filename: str,\n lineno: int,\n file: Optional[TextIO] = None,\n line: Optional[str] = None,\n) -> None:\n if file is not None:\n if _original_showwarning is not None:\n _original_showwarning(message, category, filename, lineno, file, line)\n elif issubclass(category, PipDeprecationWarning):\n # We use a specially named logger which will handle all of the\n # deprecation messages for pip.\n logger = logging.getLogger(\"pip._internal.deprecations\")\n logger.warning(message)\n else:\n _original_showwarning(message, category, filename, lineno, file, line)\n\n\ndef install_warning_logger() -> None:\n # Enable our Deprecation Warnings\n warnings.simplefilter(\"default\", PipDeprecationWarning, append=True)\n\n global _original_showwarning\n\n if _original_showwarning is None:\n _original_showwarning = warnings.showwarning\n warnings.showwarning = _showwarning\n\n\ndef deprecated(\n *,\n reason: str,\n replacement: Optional[str],\n gone_in: Optional[str],\n feature_flag: Optional[str] = None,\n issue: Optional[int] = None,\n) -> None:\n \"\"\"Helper to deprecate existing functionality.\n\n reason:\n Textual reason shown to the user about why this functionality has\n been deprecated. Should be a complete sentence.\n replacement:\n Textual suggestion shown to the user about what alternative\n functionality they can use.\n gone_in:\n The version of pip does this functionality should get removed in.\n Raises an error if pip's current version is greater than or equal to\n this.\n feature_flag:\n Command-line flag of the form --use-feature={feature_flag} for testing\n upcoming functionality.\n issue:\n Issue number on the tracker that would serve as a useful place for\n users to find related discussion and provide feedback.\n \"\"\"\n\n # Determine whether or not the feature is already gone in this version.\n is_gone = gone_in is not None and parse(current_version) >= parse(gone_in)\n\n message_parts = [\n (reason, f\"{DEPRECATION_MSG_PREFIX}{{}}\"),\n (\n gone_in,\n (\n \"pip {} will enforce this behaviour change.\"\n if not is_gone\n else \"Since pip {}, this is no longer supported.\"\n ),\n ),\n (\n replacement,\n \"A possible replacement is {}.\",\n ),\n (\n feature_flag,\n (\n \"You can use the flag --use-feature={} to test the upcoming behaviour.\"\n if not is_gone\n else None\n ),\n ),\n (\n issue,\n \"Discussion can be found at https://github.com/pypa/pip/issues/{}\",\n ),\n ]\n\n message = \" \".join(\n format_str.format(value)\n for value, format_str in message_parts\n if format_str is not None and value is not None\n )\n\n # Raise as an error if this behaviour is deprecated.\n if is_gone:\n raise PipDeprecationWarning(message)\n\n warnings.warn(message, category=PipDeprecationWarning, stacklevel=2)\n",[],[100,509,516,523,475,544,1590,1651],{"_104":1659,"_96":1660,"_158":1661,"_160":1591,"_161":139,"_162":1662,"_164":165,"_106":1663,"_101":29,"_167":215,"_169":1664,"_170":25,"_171":-5,"_172":1665,"_99":1666},"04b68b36-67fc-11f0-a319-0224a6c84d84","direct_url_helpers.py","04b68bea-67fc-11f0-a319-0224a6c84d84",150,["D",1753299255688],"from typing import Optional\n\nfrom pip._internal.models.direct_url import ArchiveInfo, DirectUrl, DirInfo, VcsInfo\nfrom pip._internal.models.link import Link\nfrom pip._internal.utils.urls import path_to_url\nfrom pip._internal.vcs import vcs\n\n\ndef direct_url_as_pep440_direct_reference(direct_url: DirectUrl, name: str) -> str:\n \"\"\"Convert a DirectUrl to a pip requirement string.\"\"\"\n direct_url.validate() # if invalid, this is a pip bug\n requirement = name + \" @ \"\n fragments = []\n if isinstance(direct_url.info, VcsInfo):\n requirement += (\n f\"{direct_url.info.vcs}+{direct_url.url}@{direct_url.info.commit_id}\"\n )\n elif isinstance(direct_url.info, ArchiveInfo):\n requirement += direct_url.url\n if direct_url.info.hash:\n fragments.append(direct_url.info.hash)\n else:\n assert isinstance(direct_url.info, DirInfo)\n requirement += direct_url.url\n if direct_url.subdirectory:\n fragments.append(\"subdirectory=\" + direct_url.subdirectory)\n if fragments:\n requirement += \"#\" + \"&\".join(fragments)\n return requirement\n\n\ndef direct_url_for_editable(source_dir: str) -> DirectUrl:\n return DirectUrl(\n url=path_to_url(source_dir),\n info=DirInfo(editable=True),\n )\n\n\ndef direct_url_from_link(\n link: Link, source_dir: Optional[str] = None, link_is_in_wheel_cache: bool = False\n) -> DirectUrl:\n if link.is_vcs:\n vcs_backend = vcs.get_backend_for_scheme(link.scheme)\n assert vcs_backend\n url, requested_revision, _ = vcs_backend.get_url_rev_and_auth(\n link.url_without_fragment\n )\n # For VCS links, we need to find out and add commit_id.\n if link_is_in_wheel_cache:\n # If the requested VCS link corresponds to a cached\n # wheel, it means the requested revision was an\n # immutable commit hash, otherwise it would not have\n # been cached. In that case we don't have a source_dir\n # with the VCS checkout.\n assert requested_revision\n commit_id = requested_revision\n else:\n # If the wheel was not in cache, it means we have\n # had to checkout from VCS to build and we have a source_dir\n # which we can inspect to find out the commit id.\n assert source_dir\n commit_id = vcs_backend.get_revision(source_dir)\n return DirectUrl(\n url=url,\n info=VcsInfo(\n vcs=vcs_backend.name,\n commit_id=commit_id,\n requested_revision=requested_revision,\n ),\n subdirectory=link.subdirectory_fragment,\n )\n elif link.is_existing_dir():\n return DirectUrl(\n url=link.url_without_fragment,\n info=DirInfo(),\n subdirectory=link.subdirectory_fragment,\n )\n else:\n hash = None\n hash_name = link.hash_name\n if hash_name:\n hash = f\"{hash_name}={link.hash}\"\n return DirectUrl(\n url=link.url_without_fragment,\n info=ArchiveInfo(hash=hash),\n subdirectory=link.subdirectory_fragment,\n )\n",[],[100,509,516,523,475,544,1590,1660],{"_104":1668,"_96":1669,"_158":1670,"_160":1591,"_161":139,"_162":1671,"_164":165,"_106":1672,"_101":29,"_167":215,"_169":1673,"_170":25,"_171":-5,"_172":1674,"_99":1675},"049cf3f6-67fc-11f0-a988-0224a6c84d84","egg_link.py","049cf4fa-67fc-11f0-a988-0224a6c84d84",145,["D",1753299255488],"import os\nimport re\nimport sys\nfrom typing import List, Optional\n\nfrom pip._internal.locations import site_packages, user_site\nfrom pip._internal.utils.virtualenv import (\n running_under_virtualenv,\n virtualenv_no_global,\n)\n\n__all__ = [\n \"egg_link_path_from_sys_path\",\n \"egg_link_path_from_location\",\n]\n\n\ndef _egg_link_names(raw_name: str) -> List[str]:\n \"\"\"\n Convert a Name metadata value to a .egg-link name, by applying\n the same substitution as pkg_resources's safe_name function.\n Note: we cannot use canonicalize_name because it has a different logic.\n\n We also look for the raw name (without normalization) as setuptools 69 changed\n the way it names .egg-link files (https://github.com/pypa/setuptools/issues/4167).\n \"\"\"\n return [\n re.sub(\"[^A-Za-z0-9.]+\", \"-\", raw_name) + \".egg-link\",\n f\"{raw_name}.egg-link\",\n ]\n\n\ndef egg_link_path_from_sys_path(raw_name: str) -> Optional[str]:\n \"\"\"\n Look for a .egg-link file for project name, by walking sys.path.\n \"\"\"\n egg_link_names = _egg_link_names(raw_name)\n for path_item in sys.path:\n for egg_link_name in egg_link_names:\n egg_link = os.path.join(path_item, egg_link_name)\n if os.path.isfile(egg_link):\n return egg_link\n return None\n\n\ndef egg_link_path_from_location(raw_name: str) -> Optional[str]:\n \"\"\"\n Return the path for the .egg-link file if it exists, otherwise, None.\n\n There's 3 scenarios:\n 1) not in a virtualenv\n try to find in site.USER_SITE, then site_packages\n 2) in a no-global virtualenv\n try to find in site_packages\n 3) in a yes-global virtualenv\n try to find in site_packages, then site.USER_SITE\n (don't look in global location)\n\n For #1 and #3, there could be odd cases, where there's an egg-link in 2\n locations.\n\n This method will just return the first one found.\n \"\"\"\n sites: List[str] = []\n if running_under_virtualenv():\n sites.append(site_packages)\n if not virtualenv_no_global() and user_site:\n sites.append(user_site)\n else:\n if user_site:\n sites.append(user_site)\n sites.append(site_packages)\n\n egg_link_names = _egg_link_names(raw_name)\n for site in sites:\n for egg_link_name in egg_link_names:\n egglink = os.path.join(site, egg_link_name)\n if os.path.isfile(egglink):\n return egglink\n return None\n",[],[100,509,516,523,475,544,1590,1669],{"_104":1677,"_96":1678,"_158":1679,"_160":1591,"_161":139,"_162":1680,"_164":165,"_106":1681,"_101":29,"_167":215,"_169":1682,"_170":25,"_171":-5,"_172":1683,"_99":1684},"04e448be-67fc-11f0-8b06-0224a6c84d84","entrypoints.py","04e44972-67fc-11f0-8b06-0224a6c84d84",157,["D",1753299255959],"import itertools\nimport os\nimport shutil\nimport sys\nfrom typing import List, Optional\n\nfrom pip._internal.cli.main import main\nfrom pip._internal.utils.compat import WINDOWS\n\n_EXECUTABLE_NAMES = [\n \"pip\",\n f\"pip{sys.version_info.major}\",\n f\"pip{sys.version_info.major}.{sys.version_info.minor}\",\n]\nif WINDOWS:\n _allowed_extensions = {\"\", \".exe\"}\n _EXECUTABLE_NAMES = [\n \"\".join(parts)\n for parts in itertools.product(_EXECUTABLE_NAMES, _allowed_extensions)\n ]\n\n\ndef _wrapper(args: Optional[List[str]] = None) -> int:\n \"\"\"Central wrapper for all old entrypoints.\n\n Historically pip has had several entrypoints defined. Because of issues\n arising from PATH, sys.path, multiple Pythons, their interactions, and most\n of them having a pip installed, users suffer every time an entrypoint gets\n moved.\n\n To alleviate this pain, and provide a mechanism for warning users and\n directing them to an appropriate place for help, we now define all of\n our old entrypoints as wrappers for the current one.\n \"\"\"\n sys.stderr.write(\n \"WARNING: pip is being invoked by an old script wrapper. This will \"\n \"fail in a future version of pip.\\n\"\n \"Please see https://github.com/pypa/pip/issues/5599 for advice on \"\n \"fixing the underlying issue.\\n\"\n \"To avoid this problem you can invoke Python with '-m pip' instead of \"\n \"running pip directly.\\n\"\n )\n return main(args)\n\n\ndef get_best_invocation_for_this_pip() -> str:\n \"\"\"Try to figure out the best way to invoke pip in the current environment.\"\"\"\n binary_directory = \"Scripts\" if WINDOWS else \"bin\"\n binary_prefix = os.path.join(sys.prefix, binary_directory)\n\n # Try to use pip[X[.Y]] names, if those executables for this environment are\n # the first on PATH with that name.\n path_parts = os.path.normcase(os.environ.get(\"PATH\", \"\")).split(os.pathsep)\n exe_are_in_PATH = os.path.normcase(binary_prefix) in path_parts\n if exe_are_in_PATH:\n for exe_name in _EXECUTABLE_NAMES:\n found_executable = shutil.which(exe_name)\n binary_executable = os.path.join(binary_prefix, exe_name)\n if (\n found_executable\n and os.path.exists(binary_executable)\n and os.path.samefile(\n found_executable,\n binary_executable,\n )\n ):\n return exe_name\n\n # Use the `-m` invocation, if there's no \"nice\" invocation.\n return f\"{get_best_invocation_for_this_python()} -m pip\"\n\n\ndef get_best_invocation_for_this_python() -> str:\n \"\"\"Try to figure out the best way to invoke the current Python.\"\"\"\n exe = sys.executable\n exe_name = os.path.basename(exe)\n\n # Try to use the basename, if it's the first executable.\n found_executable = shutil.which(exe_name)\n # Virtual environments often symlink to their parent Python binaries, but we don't\n # want to treat the Python binaries as equivalent when the environment's Python is\n # not on PATH (not activated). Thus, we don't follow symlinks.\n if found_executable and os.path.samestat(os.lstat(found_executable), os.lstat(exe)):\n return exe_name\n\n # Use the full executable name, because we couldn't find something simpler.\n return exe\n",[],[100,509,516,523,475,544,1590,1678],{"_104":1686,"_96":1687,"_158":1688,"_160":1591,"_161":139,"_162":1689,"_164":165,"_106":1690,"_101":29,"_167":215,"_169":1691,"_170":25,"_171":-5,"_172":1692,"_99":1693},"04b1adb4-67fc-11f0-9d2d-0224a6c84d84","filesystem.py","04b1ae5e-67fc-11f0-9d2d-0224a6c84d84",149,["D",1753299255658],"import fnmatch\nimport os\nimport os.path\nimport random\nimport sys\nfrom contextlib import contextmanager\nfrom tempfile import NamedTemporaryFile\nfrom typing import Any, BinaryIO, Generator, List, Union, cast\n\nfrom pip._internal.utils.compat import get_path_uid\nfrom pip._internal.utils.misc import format_size\nfrom pip._internal.utils.retry import retry\n\n\ndef check_path_owner(path: str) -> bool:\n # If we don't have a way to check the effective uid of this process, then\n # we'll just assume that we own the directory.\n if sys.platform == \"win32\" or not hasattr(os, \"geteuid\"):\n return True\n\n assert os.path.isabs(path)\n\n previous = None\n while path != previous:\n if os.path.lexists(path):\n # Check if path is writable by current user.\n if os.geteuid() == 0:\n # Special handling for root user in order to handle properly\n # cases where users use sudo without -H flag.\n try:\n path_uid = get_path_uid(path)\n except OSError:\n return False\n return path_uid == 0\n else:\n return os.access(path, os.W_OK)\n else:\n previous, path = path, os.path.dirname(path)\n return False # assume we don't own the path\n\n\n@contextmanager\ndef adjacent_tmp_file(path: str, **kwargs: Any) -> Generator[BinaryIO, None, None]:\n \"\"\"Return a file-like object pointing to a tmp file next to path.\n\n The file is created securely and is ensured to be written to disk\n after the context reaches its end.\n\n kwargs will be passed to tempfile.NamedTemporaryFile to control\n the way the temporary file will be opened.\n \"\"\"\n with NamedTemporaryFile(\n delete=False,\n dir=os.path.dirname(path),\n prefix=os.path.basename(path),\n suffix=\".tmp\",\n **kwargs,\n ) as f:\n result = cast(BinaryIO, f)\n try:\n yield result\n finally:\n result.flush()\n os.fsync(result.fileno())\n\n\nreplace = retry(stop_after_delay=1, wait=0.25)(os.replace)\n\n\n# test_writable_dir and _test_writable_dir_win are copied from Flit,\n# with the author's agreement to also place them under pip's license.\ndef test_writable_dir(path: str) -> bool:\n \"\"\"Check if a directory is writable.\n\n Uses os.access() on POSIX, tries creating files on Windows.\n \"\"\"\n # If the directory doesn't exist, find the closest parent that does.\n while not os.path.isdir(path):\n parent = os.path.dirname(path)\n if parent == path:\n break # Should never get here, but infinite loops are bad\n path = parent\n\n if os.name == \"posix\":\n return os.access(path, os.W_OK)\n\n return _test_writable_dir_win(path)\n\n\ndef _test_writable_dir_win(path: str) -> bool:\n # os.access doesn't work on Windows: http://bugs.python.org/issue2528\n # and we can't use tempfile: http://bugs.python.org/issue22107\n basename = \"accesstest_deleteme_fishfingers_custard_\"\n alphabet = \"abcdefghijklmnopqrstuvwxyz0123456789\"\n for _ in range(10):\n name = basename + \"\".join(random.choice(alphabet) for _ in range(6))\n file = os.path.join(path, name)\n try:\n fd = os.open(file, os.O_RDWR | os.O_CREAT | os.O_EXCL)\n except FileExistsError:\n pass\n except PermissionError:\n # This could be because there's a directory with the same name.\n # But it's highly unlikely there's a directory called that,\n # so we'll assume it's because the parent dir is not writable.\n # This could as well be because the parent dir is not readable,\n # due to non-privileged user access.\n return False\n else:\n os.close(fd)\n os.unlink(file)\n return True\n\n # This should never be reached\n raise OSError(\"Unexpected condition testing for writable directory\")\n\n\ndef find_files(path: str, pattern: str) -> List[str]:\n \"\"\"Returns a list of absolute paths of files beneath path, recursively,\n with filenames which match the UNIX-style shell glob pattern.\"\"\"\n result: List[str] = []\n for root, _, files in os.walk(path):\n matches = fnmatch.filter(files, pattern)\n result.extend(os.path.join(root, f) for f in matches)\n return result\n\n\ndef file_size(path: str) -> Union[int, float]:\n # If it's a symlink, return 0.\n if os.path.islink(path):\n return 0\n return os.path.getsize(path)\n\n\ndef format_file_size(path: str) -> str:\n return format_size(file_size(path))\n\n\ndef directory_size(path: str) -> Union[int, float]:\n size = 0.0\n for root, _dirs, files in os.walk(path):\n for filename in files:\n file_path = os.path.join(root, filename)\n size += file_size(file_path)\n return size\n\n\ndef format_directory_size(path: str) -> str:\n return format_size(directory_size(path))\n",[],[100,509,516,523,475,544,1590,1687],{"_104":1695,"_96":1696,"_158":1697,"_160":1591,"_161":139,"_162":1698,"_164":165,"_106":1699,"_101":29,"_167":215,"_169":1700,"_170":25,"_171":-5,"_172":1701,"_99":1702},"04e706b2-67fc-11f0-bf1a-0224a6c84d84","filetypes.py","04e707ca-67fc-11f0-bf1a-0224a6c84d84",158,["D",1753299255994],"\"\"\"Filetype information.\"\"\"\n\nfrom typing import Tuple\n\nfrom pip._internal.utils.misc import splitext\n\nWHEEL_EXTENSION = \".whl\"\nBZ2_EXTENSIONS: Tuple[str, ...] = (\".tar.bz2\", \".tbz\")\nXZ_EXTENSIONS: Tuple[str, ...] = (\n \".tar.xz\",\n \".txz\",\n \".tlz\",\n \".tar.lz\",\n \".tar.lzma\",\n)\nZIP_EXTENSIONS: Tuple[str, ...] = (\".zip\", WHEEL_EXTENSION)\nTAR_EXTENSIONS: Tuple[str, ...] = (\".tar.gz\", \".tgz\", \".tar\")\nARCHIVE_EXTENSIONS = ZIP_EXTENSIONS + BZ2_EXTENSIONS + TAR_EXTENSIONS + XZ_EXTENSIONS\n\n\ndef is_archive_file(name: str) -> bool:\n \"\"\"Return True if `name` is a considered as an archive file.\"\"\"\n ext = splitext(name)[1].lower()\n if ext in ARCHIVE_EXTENSIONS:\n return True\n return False\n",[],[100,509,516,523,475,544,1590,1696],{"_104":1704,"_96":1705,"_158":1706,"_160":1591,"_161":139,"_162":1707,"_164":165,"_106":1708,"_101":29,"_167":215,"_169":1709,"_170":25,"_171":-5,"_172":1710,"_99":1711},"051057c4-67fc-11f0-9ad5-0224a6c84d84","glibc.py","05105882-67fc-11f0-9ad5-0224a6c84d84",164,["D",1753299256278],"import os\nimport sys\nfrom typing import Optional, Tuple\n\n\ndef glibc_version_string() -> Optional[str]:\n \"Returns glibc version string, or None if not using glibc.\"\n return glibc_version_string_confstr() or glibc_version_string_ctypes()\n\n\ndef glibc_version_string_confstr() -> Optional[str]:\n \"Primary implementation of glibc_version_string using os.confstr.\"\n # os.confstr is quite a bit faster than ctypes.DLL. It's also less likely\n # to be broken or missing. This strategy is used in the standard library\n # platform module:\n # https://github.com/python/cpython/blob/fcf1d003bf4f0100c9d0921ff3d70e1127ca1b71/Lib/platform.py#L175-L183\n if sys.platform == \"win32\":\n return None\n try:\n gnu_libc_version = os.confstr(\"CS_GNU_LIBC_VERSION\")\n if gnu_libc_version is None:\n return None\n # os.confstr(\"CS_GNU_LIBC_VERSION\") returns a string like \"glibc 2.17\":\n _, version = gnu_libc_version.split()\n except (AttributeError, OSError, ValueError):\n # os.confstr() or CS_GNU_LIBC_VERSION not available (or a bad value)...\n return None\n return version\n\n\ndef glibc_version_string_ctypes() -> Optional[str]:\n \"Fallback implementation of glibc_version_string using ctypes.\"\n\n try:\n import ctypes\n except ImportError:\n return None\n\n # ctypes.CDLL(None) internally calls dlopen(NULL), and as the dlopen\n # manpage says, \"If filename is NULL, then the returned handle is for the\n # main program\". This way we can let the linker do the work to figure out\n # which libc our process is actually using.\n #\n # We must also handle the special case where the executable is not a\n # dynamically linked executable. This can occur when using musl libc,\n # for example. In this situation, dlopen() will error, leading to an\n # OSError. Interestingly, at least in the case of musl, there is no\n # errno set on the OSError. The single string argument used to construct\n # OSError comes from libc itself and is therefore not portable to\n # hard code here. In any case, failure to call dlopen() means we\n # can't proceed, so we bail on our attempt.\n try:\n process_namespace = ctypes.CDLL(None)\n except OSError:\n return None\n\n try:\n gnu_get_libc_version = process_namespace.gnu_get_libc_version\n except AttributeError:\n # Symbol doesn't exist -> therefore, we are not linked to\n # glibc.\n return None\n\n # Call gnu_get_libc_version, which returns a string like \"2.5\"\n gnu_get_libc_version.restype = ctypes.c_char_p\n version_str: str = gnu_get_libc_version()\n # py2 / py3 compatibility:\n if not isinstance(version_str, str):\n version_str = version_str.decode(\"ascii\")\n\n return version_str\n\n\n# platform.libc_ver regularly returns completely nonsensical glibc\n# versions. E.g. on my computer, platform says:\n#\n# ~$ python2.7 -c 'import platform; print(platform.libc_ver())'\n# ('glibc', '2.7')\n# ~$ python3.5 -c 'import platform; print(platform.libc_ver())'\n# ('glibc', '2.9')\n#\n# But the truth is:\n#\n# ~$ ldd --version\n# ldd (Debian GLIBC 2.22-11) 2.22\n#\n# This is unfortunate, because it means that the linehaul data on libc\n# versions that was generated by pip 8.1.2 and earlier is useless and\n# misleading. Solution: instead of using platform, use our code that actually\n# works.\ndef libc_ver() -> Tuple[str, str]:\n \"\"\"Try to determine the glibc version\n\n Returns a tuple of strings (lib, version) which default to empty strings\n in case the lookup fails.\n \"\"\"\n glibc_version = glibc_version_string()\n if glibc_version is None:\n return (\"\", \"\")\n else:\n return (\"glibc\", glibc_version)\n",[],[100,509,516,523,475,544,1590,1705],{"_104":1713,"_96":1714,"_158":1715,"_160":1591,"_161":139,"_162":1716,"_164":165,"_106":1717,"_101":29,"_167":215,"_169":1718,"_170":25,"_171":-5,"_172":1719,"_99":1720},"050994de-67fc-11f0-8737-0224a6c84d84","hashes.py","0509965a-67fc-11f0-8737-0224a6c84d84",163,["D",1753299256158],"import hashlib\nfrom typing import TYPE_CHECKING, BinaryIO, Dict, Iterable, List, NoReturn, Optional\n\nfrom pip._internal.exceptions import HashMismatch, HashMissing, InstallationError\nfrom pip._internal.utils.misc import read_chunks\n\nif TYPE_CHECKING:\n from hashlib import _Hash\n\n\n# The recommended hash algo of the moment. Change this whenever the state of\n# the art changes; it won't hurt backward compatibility.\nFAVORITE_HASH = \"sha256\"\n\n\n# Names of hashlib algorithms allowed by the --hash option and ``pip hash``\n# Currently, those are the ones at least as collision-resistant as sha256.\nSTRONG_HASHES = [\"sha256\", \"sha384\", \"sha512\"]\n\n\nclass Hashes:\n \"\"\"A wrapper that builds multiple hashes at once and checks them against\n known-good values\n\n \"\"\"\n\n def __init__(self, hashes: Optional[Dict[str, List[str]]] = None) -> None:\n \"\"\"\n :param hashes: A dict of algorithm names pointing to lists of allowed\n hex digests\n \"\"\"\n allowed = {}\n if hashes is not None:\n for alg, keys in hashes.items():\n # Make sure values are always sorted (to ease equality checks)\n allowed[alg] = [k.lower() for k in sorted(keys)]\n self._allowed = allowed\n\n def __and__(self, other: \"Hashes\") -> \"Hashes\":\n if not isinstance(other, Hashes):\n return NotImplemented\n\n # If either of the Hashes object is entirely empty (i.e. no hash\n # specified at all), all hashes from the other object are allowed.\n if not other:\n return self\n if not self:\n return other\n\n # Otherwise only hashes that present in both objects are allowed.\n new = {}\n for alg, values in other._allowed.items():\n if alg not in self._allowed:\n continue\n new[alg] = [v for v in values if v in self._allowed[alg]]\n return Hashes(new)\n\n @property\n def digest_count(self) -> int:\n return sum(len(digests) for digests in self._allowed.values())\n\n def is_hash_allowed(self, hash_name: str, hex_digest: str) -> bool:\n \"\"\"Return whether the given hex digest is allowed.\"\"\"\n return hex_digest in self._allowed.get(hash_name, [])\n\n def check_against_chunks(self, chunks: Iterable[bytes]) -> None:\n \"\"\"Check good hashes against ones built from iterable of chunks of\n data.\n\n Raise HashMismatch if none match.\n\n \"\"\"\n gots = {}\n for hash_name in self._allowed.keys():\n try:\n gots[hash_name] = hashlib.new(hash_name)\n except (ValueError, TypeError):\n raise InstallationError(f\"Unknown hash name: {hash_name}\")\n\n for chunk in chunks:\n for hash in gots.values():\n hash.update(chunk)\n\n for hash_name, got in gots.items():\n if got.hexdigest() in self._allowed[hash_name]:\n return\n self._raise(gots)\n\n def _raise(self, gots: Dict[str, \"_Hash\"]) -> \"NoReturn\":\n raise HashMismatch(self._allowed, gots)\n\n def check_against_file(self, file: BinaryIO) -> None:\n \"\"\"Check good hashes against a file-like object\n\n Raise HashMismatch if none match.\n\n \"\"\"\n return self.check_against_chunks(read_chunks(file))\n\n def check_against_path(self, path: str) -> None:\n with open(path, \"rb\") as file:\n return self.check_against_file(file)\n\n def has_one_of(self, hashes: Dict[str, str]) -> bool:\n \"\"\"Return whether any of the given hashes are allowed.\"\"\"\n for hash_name, hex_digest in hashes.items():\n if self.is_hash_allowed(hash_name, hex_digest):\n return True\n return False\n\n def __bool__(self) -> bool:\n \"\"\"Return whether I know any known-good hashes.\"\"\"\n return bool(self._allowed)\n\n def __eq__(self, other: object) -> bool:\n if not isinstance(other, Hashes):\n return NotImplemented\n return self._allowed == other._allowed\n\n def __hash__(self) -> int:\n return hash(\n \",\".join(\n sorted(\n \":\".join((alg, digest))\n for alg, digest_list in self._allowed.items()\n for digest in digest_list\n )\n )\n )\n\n\nclass MissingHashes(Hashes):\n \"\"\"A workalike for Hashes used when we're missing a hash for a requirement\n\n It computes the actual hash of the requirement and raises a HashMissing\n exception showing it to the user.\n\n \"\"\"\n\n def __init__(self) -> None:\n \"\"\"Don't offer the ``hashes`` kwarg.\"\"\"\n # Pass our favorite hash in to generate a \"gotten hash\". With the\n # empty list, it will never match, so an error will always raise.\n super().__init__(hashes={FAVORITE_HASH: []})\n\n def _raise(self, gots: Dict[str, \"_Hash\"]) -> \"NoReturn\":\n raise HashMissing(gots[FAVORITE_HASH].hexdigest())\n",[],[100,509,516,523,475,544,1590,1714],{"_104":1722,"_96":1723,"_158":1724,"_160":1591,"_161":139,"_162":1725,"_164":165,"_106":1726,"_101":29,"_167":215,"_169":1727,"_170":25,"_171":-5,"_172":1728,"_99":1729},"0490a65a-67fc-11f0-8737-0224a6c84d84","logging.py","0490a75e-67fc-11f0-8737-0224a6c84d84",142,["D",1753299255430],"import contextlib\nimport errno\nimport logging\nimport logging.handlers\nimport os\nimport sys\nimport threading\nfrom dataclasses import dataclass\nfrom io import TextIOWrapper\nfrom logging import Filter\nfrom typing import Any, ClassVar, Generator, List, Optional, Type\n\nfrom pip._vendor.rich.console import (\n Console,\n ConsoleOptions,\n ConsoleRenderable,\n RenderableType,\n RenderResult,\n RichCast,\n)\nfrom pip._vendor.rich.highlighter import NullHighlighter\nfrom pip._vendor.rich.logging import RichHandler\nfrom pip._vendor.rich.segment import Segment\nfrom pip._vendor.rich.style import Style\n\nfrom pip._internal.utils._log import VERBOSE, getLogger\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.deprecation import DEPRECATION_MSG_PREFIX\nfrom pip._internal.utils.misc import ensure_dir\n\n_log_state = threading.local()\n_stdout_console = None\n_stderr_console = None\nsubprocess_logger = getLogger(\"pip.subprocessor\")\n\n\nclass BrokenStdoutLoggingError(Exception):\n \"\"\"\n Raised if BrokenPipeError occurs for the stdout stream while logging.\n \"\"\"\n\n\ndef _is_broken_pipe_error(exc_class: Type[BaseException], exc: BaseException) -> bool:\n if exc_class is BrokenPipeError:\n return True\n\n # On Windows, a broken pipe can show up as EINVAL rather than EPIPE:\n # https://bugs.python.org/issue19612\n # https://bugs.python.org/issue30418\n if not WINDOWS:\n return False\n\n return isinstance(exc, OSError) and exc.errno in (errno.EINVAL, errno.EPIPE)\n\n\n@contextlib.contextmanager\ndef indent_log(num: int = 2) -> Generator[None, None, None]:\n \"\"\"\n A context manager which will cause the log output to be indented for any\n log messages emitted inside it.\n \"\"\"\n # For thread-safety\n _log_state.indentation = get_indentation()\n _log_state.indentation += num\n try:\n yield\n finally:\n _log_state.indentation -= num\n\n\ndef get_indentation() -> int:\n return getattr(_log_state, \"indentation\", 0)\n\n\nclass IndentingFormatter(logging.Formatter):\n default_time_format = \"%Y-%m-%dT%H:%M:%S\"\n\n def __init__(\n self,\n *args: Any,\n add_timestamp: bool = False,\n **kwargs: Any,\n ) -> None:\n \"\"\"\n A logging.Formatter that obeys the indent_log() context manager.\n\n :param add_timestamp: A bool indicating output lines should be prefixed\n with their record's timestamp.\n \"\"\"\n self.add_timestamp = add_timestamp\n super().__init__(*args, **kwargs)\n\n def get_message_start(self, formatted: str, levelno: int) -> str:\n \"\"\"\n Return the start of the formatted log message (not counting the\n prefix to add to each line).\n \"\"\"\n if levelno < logging.WARNING:\n return \"\"\n if formatted.startswith(DEPRECATION_MSG_PREFIX):\n # Then the message already has a prefix. We don't want it to\n # look like \"WARNING: DEPRECATION: ....\"\n return \"\"\n if levelno < logging.ERROR:\n return \"WARNING: \"\n\n return \"ERROR: \"\n\n def format(self, record: logging.LogRecord) -> str:\n \"\"\"\n Calls the standard formatter, but will indent all of the log message\n lines by our current indentation level.\n \"\"\"\n formatted = super().format(record)\n message_start = self.get_message_start(formatted, record.levelno)\n formatted = message_start + formatted\n\n prefix = \"\"\n if self.add_timestamp:\n prefix = f\"{self.formatTime(record)} \"\n prefix += \" \" * get_indentation()\n formatted = \"\".join([prefix + line for line in formatted.splitlines(True)])\n return formatted\n\n\n@dataclass\nclass IndentedRenderable:\n renderable: RenderableType\n indent: int\n\n def __rich_console__(\n self, console: Console, options: ConsoleOptions\n ) -> RenderResult:\n segments = console.render(self.renderable, options)\n lines = Segment.split_lines(segments)\n for line in lines:\n yield Segment(\" \" * self.indent)\n yield from line\n yield Segment(\"\\n\")\n\n\nclass PipConsole(Console):\n def on_broken_pipe(self) -> None:\n # Reraise the original exception, rich 13.8.0+ exits by default\n # instead, preventing our handler from firing.\n raise BrokenPipeError() from None\n\n\ndef get_console(*, stderr: bool = False) -> Console:\n if stderr:\n assert _stderr_console is not None, \"stderr rich console is missing!\"\n return _stderr_console\n else:\n assert _stdout_console is not None, \"stdout rich console is missing!\"\n return _stdout_console\n\n\nclass RichPipStreamHandler(RichHandler):\n KEYWORDS: ClassVar[Optional[List[str]]] = []\n\n def __init__(self, console: Console) -> None:\n super().__init__(\n console=console,\n show_time=False,\n show_level=False,\n show_path=False,\n highlighter=NullHighlighter(),\n )\n\n # Our custom override on Rich's logger, to make things work as we need them to.\n def emit(self, record: logging.LogRecord) -> None:\n style: Optional[Style] = None\n\n # If we are given a diagnostic error to present, present it with indentation.\n if getattr(record, \"rich\", False):\n assert isinstance(record.args, tuple)\n (rich_renderable,) = record.args\n assert isinstance(\n rich_renderable, (ConsoleRenderable, RichCast, str)\n ), f\"{rich_renderable} is not rich-console-renderable\"\n\n renderable: RenderableType = IndentedRenderable(\n rich_renderable, indent=get_indentation()\n )\n else:\n message = self.format(record)\n renderable = self.render_message(record, message)\n if record.levelno is not None:\n if record.levelno >= logging.ERROR:\n style = Style(color=\"red\")\n elif record.levelno >= logging.WARNING:\n style = Style(color=\"yellow\")\n\n try:\n self.console.print(renderable, overflow=\"ignore\", crop=False, style=style)\n except Exception:\n self.handleError(record)\n\n def handleError(self, record: logging.LogRecord) -> None:\n \"\"\"Called when logging is unable to log some output.\"\"\"\n\n exc_class, exc = sys.exc_info()[:2]\n # If a broken pipe occurred while calling write() or flush() on the\n # stdout stream in logging's Handler.emit(), then raise our special\n # exception so we can handle it in main() instead of logging the\n # broken pipe error and continuing.\n if (\n exc_class\n and exc\n and self.console.file is sys.stdout\n and _is_broken_pipe_error(exc_class, exc)\n ):\n raise BrokenStdoutLoggingError()\n\n return super().handleError(record)\n\n\nclass BetterRotatingFileHandler(logging.handlers.RotatingFileHandler):\n def _open(self) -> TextIOWrapper:\n ensure_dir(os.path.dirname(self.baseFilename))\n return super()._open()\n\n\nclass MaxLevelFilter(Filter):\n def __init__(self, level: int) -> None:\n self.level = level\n\n def filter(self, record: logging.LogRecord) -> bool:\n return record.levelno < self.level\n\n\nclass ExcludeLoggerFilter(Filter):\n \"\"\"\n A logging Filter that excludes records from a logger (or its children).\n \"\"\"\n\n def filter(self, record: logging.LogRecord) -> bool:\n # The base Filter class allows only records from a logger (or its\n # children).\n return not super().filter(record)\n\n\ndef setup_logging(verbosity: int, no_color: bool, user_log_file: Optional[str]) -> int:\n \"\"\"Configures and sets up all of the logging\n\n Returns the requested logging level, as its integer value.\n \"\"\"\n\n # Determine the level to be logging at.\n if verbosity >= 2:\n level_number = logging.DEBUG\n elif verbosity == 1:\n level_number = VERBOSE\n elif verbosity == -1:\n level_number = logging.WARNING\n elif verbosity == -2:\n level_number = logging.ERROR\n elif verbosity <= -3:\n level_number = logging.CRITICAL\n else:\n level_number = logging.INFO\n\n level = logging.getLevelName(level_number)\n\n # The \"root\" logger should match the \"console\" level *unless* we also need\n # to log to a user log file.\n include_user_log = user_log_file is not None\n if include_user_log:\n additional_log_file = user_log_file\n root_level = \"DEBUG\"\n else:\n additional_log_file = \"/dev/null\"\n root_level = level\n\n # Disable any logging besides WARNING unless we have DEBUG level logging\n # enabled for vendored libraries.\n vendored_log_level = \"WARNING\" if level in [\"INFO\", \"ERROR\"] else \"DEBUG\"\n\n # Shorthands for clarity\n handler_classes = {\n \"stream\": \"pip._internal.utils.logging.RichPipStreamHandler\",\n \"file\": \"pip._internal.utils.logging.BetterRotatingFileHandler\",\n }\n handlers = [\"console\", \"console_errors\", \"console_subprocess\"] + (\n [\"user_log\"] if include_user_log else []\n )\n global _stdout_console, stderr_console\n _stdout_console = PipConsole(file=sys.stdout, no_color=no_color, soft_wrap=True)\n _stderr_console = PipConsole(file=sys.stderr, no_color=no_color, soft_wrap=True)\n\n logging.config.dictConfig(\n {\n \"version\": 1,\n \"disable_existing_loggers\": False,\n \"filters\": {\n \"exclude_warnings\": {\n \"()\": \"pip._internal.utils.logging.MaxLevelFilter\",\n \"level\": logging.WARNING,\n },\n \"restrict_to_subprocess\": {\n \"()\": \"logging.Filter\",\n \"name\": subprocess_logger.name,\n },\n \"exclude_subprocess\": {\n \"()\": \"pip._internal.utils.logging.ExcludeLoggerFilter\",\n \"name\": subprocess_logger.name,\n },\n },\n \"formatters\": {\n \"indent\": {\n \"()\": IndentingFormatter,\n \"format\": \"%(message)s\",\n },\n \"indent_with_timestamp\": {\n \"()\": IndentingFormatter,\n \"format\": \"%(message)s\",\n \"add_timestamp\": True,\n },\n },\n \"handlers\": {\n \"console\": {\n \"level\": level,\n \"class\": handler_classes[\"stream\"],\n \"console\": _stdout_console,\n \"filters\": [\"exclude_subprocess\", \"exclude_warnings\"],\n \"formatter\": \"indent\",\n },\n \"console_errors\": {\n \"level\": \"WARNING\",\n \"class\": handler_classes[\"stream\"],\n \"console\": _stderr_console,\n \"filters\": [\"exclude_subprocess\"],\n \"formatter\": \"indent\",\n },\n # A handler responsible for logging to the console messages\n # from the \"subprocessor\" logger.\n \"console_subprocess\": {\n \"level\": level,\n \"class\": handler_classes[\"stream\"],\n \"console\": _stderr_console,\n \"filters\": [\"restrict_to_subprocess\"],\n \"formatter\": \"indent\",\n },\n \"user_log\": {\n \"level\": \"DEBUG\",\n \"class\": handler_classes[\"file\"],\n \"filename\": additional_log_file,\n \"encoding\": \"utf-8\",\n \"delay\": True,\n \"formatter\": \"indent_with_timestamp\",\n },\n },\n \"root\": {\n \"level\": root_level,\n \"handlers\": handlers,\n },\n \"loggers\": {\"pip._vendor\": {\"level\": vendored_log_level}},\n }\n )\n\n return level_number\n",[],[100,509,516,523,475,544,1590,1723],{"_104":1731,"_96":1732,"_158":1733,"_160":1591,"_161":139,"_162":1734,"_164":165,"_106":1735,"_101":29,"_167":215,"_169":1736,"_170":25,"_171":-5,"_172":1737,"_99":1738},"0494d324-67fc-11f0-b654-0224a6c84d84","misc.py","0494d3c4-67fc-11f0-b654-0224a6c84d84",143,["D",1753299255455],"import errno\nimport getpass\nimport hashlib\nimport logging\nimport os\nimport posixpath\nimport shutil\nimport stat\nimport sys\nimport sysconfig\nimport urllib.parse\nfrom dataclasses import dataclass\nfrom functools import partial\nfrom io import StringIO\nfrom itertools import filterfalse, tee, zip_longest\nfrom pathlib import Path\nfrom types import FunctionType, TracebackType\nfrom typing import (\n Any,\n BinaryIO,\n Callable,\n Generator,\n Iterable,\n Iterator,\n List,\n Mapping,\n Optional,\n Sequence,\n TextIO,\n Tuple,\n Type,\n TypeVar,\n Union,\n cast,\n)\n\nfrom pip._vendor.packaging.requirements import Requirement\nfrom pip._vendor.pyproject_hooks import BuildBackendHookCaller\n\nfrom pip import __version__\nfrom pip._internal.exceptions import CommandError, ExternallyManagedEnvironment\nfrom pip._internal.locations import get_major_minor_version\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.retry import retry\nfrom pip._internal.utils.virtualenv import running_under_virtualenv\n\n__all__ = [\n \"rmtree\",\n \"display_path\",\n \"backup_dir\",\n \"ask\",\n \"splitext\",\n \"format_size\",\n \"is_installable_dir\",\n \"normalize_path\",\n \"renames\",\n \"get_prog\",\n \"ensure_dir\",\n \"remove_auth_from_url\",\n \"check_externally_managed\",\n \"ConfiguredBuildBackendHookCaller\",\n]\n\nlogger = logging.getLogger(__name__)\n\nT = TypeVar(\"T\")\nExcInfo = Tuple[Type[BaseException], BaseException, TracebackType]\nVersionInfo = Tuple[int, int, int]\nNetlocTuple = Tuple[str, Tuple[Optional[str], Optional[str]]]\nOnExc = Callable[[FunctionType, Path, BaseException], Any]\nOnErr = Callable[[FunctionType, Path, ExcInfo], Any]\n\nFILE_CHUNK_SIZE = 1024 * 1024\n\n\ndef get_pip_version() -> str:\n pip_pkg_dir = os.path.join(os.path.dirname(__file__), \"..\", \"..\")\n pip_pkg_dir = os.path.abspath(pip_pkg_dir)\n\n return f\"pip {__version__} from {pip_pkg_dir} (python {get_major_minor_version()})\"\n\n\ndef normalize_version_info(py_version_info: Tuple[int, ...]) -> Tuple[int, int, int]:\n \"\"\"\n Convert a tuple of ints representing a Python version to one of length\n three.\n\n :param py_version_info: a tuple of ints representing a Python version,\n or None to specify no version. The tuple can have any length.\n\n :return: a tuple of length three if `py_version_info` is non-None.\n Otherwise, return `py_version_info` unchanged (i.e. None).\n \"\"\"\n if len(py_version_info) < 3:\n py_version_info += (3 - len(py_version_info)) * (0,)\n elif len(py_version_info) > 3:\n py_version_info = py_version_info[:3]\n\n return cast(\"VersionInfo\", py_version_info)\n\n\ndef ensure_dir(path: str) -> None:\n \"\"\"os.path.makedirs without EEXIST.\"\"\"\n try:\n os.makedirs(path)\n except OSError as e:\n # Windows can raise spurious ENOTEMPTY errors. See #6426.\n if e.errno != errno.EEXIST and e.errno != errno.ENOTEMPTY:\n raise\n\n\ndef get_prog() -> str:\n try:\n prog = os.path.basename(sys.argv[0])\n if prog in (\"__main__.py\", \"-c\"):\n return f\"{sys.executable} -m pip\"\n else:\n return prog\n except (AttributeError, TypeError, IndexError):\n pass\n return \"pip\"\n\n\n# Retry every half second for up to 3 seconds\n@retry(stop_after_delay=3, wait=0.5)\ndef rmtree(\n dir: str, ignore_errors: bool = False, onexc: Optional[OnExc] = None\n) -> None:\n if ignore_errors:\n onexc = _onerror_ignore\n if onexc is None:\n onexc = _onerror_reraise\n handler: OnErr = partial(rmtree_errorhandler, onexc=onexc)\n if sys.version_info >= (3, 12):\n # See https://docs.python.org/3.12/whatsnew/3.12.html#shutil.\n shutil.rmtree(dir, onexc=handler) # type: ignore\n else:\n shutil.rmtree(dir, onerror=handler) # type: ignore\n\n\ndef _onerror_ignore(*_args: Any) -> None:\n pass\n\n\ndef _onerror_reraise(*_args: Any) -> None:\n raise # noqa: PLE0704 - Bare exception used to reraise existing exception\n\n\ndef rmtree_errorhandler(\n func: FunctionType,\n path: Path,\n exc_info: Union[ExcInfo, BaseException],\n *,\n onexc: OnExc = _onerror_reraise,\n) -> None:\n \"\"\"\n `rmtree` error handler to 'force' a file remove (i.e. like `rm -f`).\n\n * If a file is readonly then it's write flag is set and operation is\n retried.\n\n * `onerror` is the original callback from `rmtree(... onerror=onerror)`\n that is chained at the end if the \"rm -f\" still fails.\n \"\"\"\n try:\n st_mode = os.stat(path).st_mode\n except OSError:\n # it's equivalent to os.path.exists\n return\n\n if not st_mode & stat.S_IWRITE:\n # convert to read/write\n try:\n os.chmod(path, st_mode | stat.S_IWRITE)\n except OSError:\n pass\n else:\n # use the original function to repeat the operation\n try:\n func(path)\n return\n except OSError:\n pass\n\n if not isinstance(exc_info, BaseException):\n _, exc_info, _ = exc_info\n onexc(func, path, exc_info)\n\n\ndef display_path(path: str) -> str:\n \"\"\"Gives the display value for a given path, making it relative to cwd\n if possible.\"\"\"\n path = os.path.normcase(os.path.abspath(path))\n if path.startswith(os.getcwd() + os.path.sep):\n path = \".\" + path[len(os.getcwd()) :]\n return path\n\n\ndef backup_dir(dir: str, ext: str = \".bak\") -> str:\n \"\"\"Figure out the name of a directory to back up the given dir to\n (adding .bak, .bak2, etc)\"\"\"\n n = 1\n extension = ext\n while os.path.exists(dir + extension):\n n += 1\n extension = ext + str(n)\n return dir + extension\n\n\ndef ask_path_exists(message: str, options: Iterable[str]) -> str:\n for action in os.environ.get(\"PIP_EXISTS_ACTION\", \"\").split():\n if action in options:\n return action\n return ask(message, options)\n\n\ndef _check_no_input(message: str) -> None:\n \"\"\"Raise an error if no input is allowed.\"\"\"\n if os.environ.get(\"PIP_NO_INPUT\"):\n raise Exception(\n f\"No input was expected ($PIP_NO_INPUT set); question: {message}\"\n )\n\n\ndef ask(message: str, options: Iterable[str]) -> str:\n \"\"\"Ask the message interactively, with the given possible responses\"\"\"\n while 1:\n _check_no_input(message)\n response = input(message)\n response = response.strip().lower()\n if response not in options:\n print(\n \"Your response ({!r}) was not one of the expected responses: \"\n \"{}\".format(response, \", \".join(options))\n )\n else:\n return response\n\n\ndef ask_input(message: str) -> str:\n \"\"\"Ask for input interactively.\"\"\"\n _check_no_input(message)\n return input(message)\n\n\ndef ask_password(message: str) -> str:\n \"\"\"Ask for a password interactively.\"\"\"\n _check_no_input(message)\n return getpass.getpass(message)\n\n\ndef strtobool(val: str) -> int:\n \"\"\"Convert a string representation of truth to true (1) or false (0).\n\n True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values\n are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if\n 'val' is anything else.\n \"\"\"\n val = val.lower()\n if val in (\"y\", \"yes\", \"t\", \"true\", \"on\", \"1\"):\n return 1\n elif val in (\"n\", \"no\", \"f\", \"false\", \"off\", \"0\"):\n return 0\n else:\n raise ValueError(f\"invalid truth value {val!r}\")\n\n\ndef format_size(bytes: float) -> str:\n if bytes > 1000 * 1000:\n return f\"{bytes / 1000.0 / 1000:.1f} MB\"\n elif bytes > 10 * 1000:\n return f\"{int(bytes / 1000)} kB\"\n elif bytes > 1000:\n return f\"{bytes / 1000.0:.1f} kB\"\n else:\n return f\"{int(bytes)} bytes\"\n\n\ndef tabulate(rows: Iterable[Iterable[Any]]) -> Tuple[List[str], List[int]]:\n \"\"\"Return a list of formatted rows and a list of column sizes.\n\n For example::\n\n >>> tabulate([['foobar', 2000], [0xdeadbeef]])\n (['foobar 2000', '3735928559'], [10, 4])\n \"\"\"\n rows = [tuple(map(str, row)) for row in rows]\n sizes = [max(map(len, col)) for col in zip_longest(*rows, fillvalue=\"\")]\n table = [\" \".join(map(str.ljust, row, sizes)).rstrip() for row in rows]\n return table, sizes\n\n\ndef is_installable_dir(path: str) -> bool:\n \"\"\"Is path is a directory containing pyproject.toml or setup.py?\n\n If pyproject.toml exists, this is a PEP 517 project. Otherwise we look for\n a legacy setuptools layout by identifying setup.py. We don't check for the\n setup.cfg because using it without setup.py is only available for PEP 517\n projects, which are already covered by the pyproject.toml check.\n \"\"\"\n if not os.path.isdir(path):\n return False\n if os.path.isfile(os.path.join(path, \"pyproject.toml\")):\n return True\n if os.path.isfile(os.path.join(path, \"setup.py\")):\n return True\n return False\n\n\ndef read_chunks(\n file: BinaryIO, size: int = FILE_CHUNK_SIZE\n) -> Generator[bytes, None, None]:\n \"\"\"Yield pieces of data from a file-like object until EOF.\"\"\"\n while True:\n chunk = file.read(size)\n if not chunk:\n break\n yield chunk\n\n\ndef normalize_path(path: str, resolve_symlinks: bool = True) -> str:\n \"\"\"\n Convert a path to its canonical, case-normalized, absolute version.\n\n \"\"\"\n path = os.path.expanduser(path)\n if resolve_symlinks:\n path = os.path.realpath(path)\n else:\n path = os.path.abspath(path)\n return os.path.normcase(path)\n\n\ndef splitext(path: str) -> Tuple[str, str]:\n \"\"\"Like os.path.splitext, but take off .tar too\"\"\"\n base, ext = posixpath.splitext(path)\n if base.lower().endswith(\".tar\"):\n ext = base[-4:] + ext\n base = base[:-4]\n return base, ext\n\n\ndef renames(old: str, new: str) -> None:\n \"\"\"Like os.renames(), but handles renaming across devices.\"\"\"\n # Implementation borrowed from os.renames().\n head, tail = os.path.split(new)\n if head and tail and not os.path.exists(head):\n os.makedirs(head)\n\n shutil.move(old, new)\n\n head, tail = os.path.split(old)\n if head and tail:\n try:\n os.removedirs(head)\n except OSError:\n pass\n\n\ndef is_local(path: str) -> bool:\n \"\"\"\n Return True if path is within sys.prefix, if we're running in a virtualenv.\n\n If we're not in a virtualenv, all paths are considered \"local.\"\n\n Caution: this function assumes the head of path has been normalized\n with normalize_path.\n \"\"\"\n if not running_under_virtualenv():\n return True\n return path.startswith(normalize_path(sys.prefix))\n\n\ndef write_output(msg: Any, *args: Any) -> None:\n logger.info(msg, *args)\n\n\nclass StreamWrapper(StringIO):\n orig_stream: TextIO\n\n @classmethod\n def from_stream(cls, orig_stream: TextIO) -> \"StreamWrapper\":\n ret = cls()\n ret.orig_stream = orig_stream\n return ret\n\n # compileall.compile_dir() needs stdout.encoding to print to stdout\n # type ignore is because TextIOBase.encoding is writeable\n @property\n def encoding(self) -> str: # type: ignore\n return self.orig_stream.encoding\n\n\n# Simulates an enum\ndef enum(*sequential: Any, **named: Any) -> Type[Any]:\n enums = dict(zip(sequential, range(len(sequential))), **named)\n reverse = {value: key for key, value in enums.items()}\n enums[\"reverse_mapping\"] = reverse\n return type(\"Enum\", (), enums)\n\n\ndef build_netloc(host: str, port: Optional[int]) -> str:\n \"\"\"\n Build a netloc from a host-port pair\n \"\"\"\n if port is None:\n return host\n if \":\" in host:\n # Only wrap host with square brackets when it is IPv6\n host = f\"[{host}]\"\n return f\"{host}:{port}\"\n\n\ndef build_url_from_netloc(netloc: str, scheme: str = \"https\") -> str:\n \"\"\"\n Build a full URL from a netloc.\n \"\"\"\n if netloc.count(\":\") >= 2 and \"@\" not in netloc and \"[\" not in netloc:\n # It must be a bare IPv6 address, so wrap it with brackets.\n netloc = f\"[{netloc}]\"\n return f\"{scheme}://{netloc}\"\n\n\ndef parse_netloc(netloc: str) -> Tuple[Optional[str], Optional[int]]:\n \"\"\"\n Return the host-port pair from a netloc.\n \"\"\"\n url = build_url_from_netloc(netloc)\n parsed = urllib.parse.urlparse(url)\n return parsed.hostname, parsed.port\n\n\ndef split_auth_from_netloc(netloc: str) -> NetlocTuple:\n \"\"\"\n Parse out and remove the auth information from a netloc.\n\n Returns: (netloc, (username, password)).\n \"\"\"\n if \"@\" not in netloc:\n return netloc, (None, None)\n\n # Split from the right because that's how urllib.parse.urlsplit()\n # behaves if more than one @ is present (which can be checked using\n # the password attribute of urlsplit()'s return value).\n auth, netloc = netloc.rsplit(\"@\", 1)\n pw: Optional[str] = None\n if \":\" in auth:\n # Split from the left because that's how urllib.parse.urlsplit()\n # behaves if more than one : is present (which again can be checked\n # using the password attribute of the return value)\n user, pw = auth.split(\":\", 1)\n else:\n user, pw = auth, None\n\n user = urllib.parse.unquote(user)\n if pw is not None:\n pw = urllib.parse.unquote(pw)\n\n return netloc, (user, pw)\n\n\ndef redact_netloc(netloc: str) -> str:\n \"\"\"\n Replace the sensitive data in a netloc with \"****\", if it exists.\n\n For example:\n - \"user:pass@example.com\" returns \"user:****@example.com\"\n - \"accesstoken@example.com\" returns \"****@example.com\"\n \"\"\"\n netloc, (user, password) = split_auth_from_netloc(netloc)\n if user is None:\n return netloc\n if password is None:\n user = \"****\"\n password = \"\"\n else:\n user = urllib.parse.quote(user)\n password = \":****\"\n return f\"{user}{password}@{netloc}\"\n\n\ndef _transform_url(\n url: str, transform_netloc: Callable[[str], Tuple[Any, ...]]\n) -> Tuple[str, NetlocTuple]:\n \"\"\"Transform and replace netloc in a url.\n\n transform_netloc is a function taking the netloc and returning a\n tuple. The first element of this tuple is the new netloc. The\n entire tuple is returned.\n\n Returns a tuple containing the transformed url as item 0 and the\n original tuple returned by transform_netloc as item 1.\n \"\"\"\n purl = urllib.parse.urlsplit(url)\n netloc_tuple = transform_netloc(purl.netloc)\n # stripped url\n url_pieces = (purl.scheme, netloc_tuple[0], purl.path, purl.query, purl.fragment)\n surl = urllib.parse.urlunsplit(url_pieces)\n return surl, cast(\"NetlocTuple\", netloc_tuple)\n\n\ndef _get_netloc(netloc: str) -> NetlocTuple:\n return split_auth_from_netloc(netloc)\n\n\ndef _redact_netloc(netloc: str) -> Tuple[str]:\n return (redact_netloc(netloc),)\n\n\ndef split_auth_netloc_from_url(\n url: str,\n) -> Tuple[str, str, Tuple[Optional[str], Optional[str]]]:\n \"\"\"\n Parse a url into separate netloc, auth, and url with no auth.\n\n Returns: (url_without_auth, netloc, (username, password))\n \"\"\"\n url_without_auth, (netloc, auth) = _transform_url(url, _get_netloc)\n return url_without_auth, netloc, auth\n\n\ndef remove_auth_from_url(url: str) -> str:\n \"\"\"Return a copy of url with 'username:password@' removed.\"\"\"\n # username/pass params are passed to subversion through flags\n # and are not recognized in the url.\n return _transform_url(url, _get_netloc)[0]\n\n\ndef redact_auth_from_url(url: str) -> str:\n \"\"\"Replace the password in a given url with ****.\"\"\"\n return _transform_url(url, _redact_netloc)[0]\n\n\ndef redact_auth_from_requirement(req: Requirement) -> str:\n \"\"\"Replace the password in a given requirement url with ****.\"\"\"\n if not req.url:\n return str(req)\n return str(req).replace(req.url, redact_auth_from_url(req.url))\n\n\n@dataclass(frozen=True)\nclass HiddenText:\n secret: str\n redacted: str\n\n def __repr__(self) -> str:\n return f\"\"\n\n def __str__(self) -> str:\n return self.redacted\n\n # This is useful for testing.\n def __eq__(self, other: Any) -> bool:\n if type(self) is not type(other):\n return False\n\n # The string being used for redaction doesn't also have to match,\n # just the raw, original string.\n return self.secret == other.secret\n\n\ndef hide_value(value: str) -> HiddenText:\n return HiddenText(value, redacted=\"****\")\n\n\ndef hide_url(url: str) -> HiddenText:\n redacted = redact_auth_from_url(url)\n return HiddenText(url, redacted=redacted)\n\n\ndef protect_pip_from_modification_on_windows(modifying_pip: bool) -> None:\n \"\"\"Protection of pip.exe from modification on Windows\n\n On Windows, any operation modifying pip should be run as:\n python -m pip ...\n \"\"\"\n pip_names = [\n \"pip\",\n f\"pip{sys.version_info.major}\",\n f\"pip{sys.version_info.major}.{sys.version_info.minor}\",\n ]\n\n # See https://github.com/pypa/pip/issues/1299 for more discussion\n should_show_use_python_msg = (\n modifying_pip and WINDOWS and os.path.basename(sys.argv[0]) in pip_names\n )\n\n if should_show_use_python_msg:\n new_command = [sys.executable, \"-m\", \"pip\"] + sys.argv[1:]\n raise CommandError(\n \"To modify pip, please run the following command:\\n{}\".format(\n \" \".join(new_command)\n )\n )\n\n\ndef check_externally_managed() -> None:\n \"\"\"Check whether the current environment is externally managed.\n\n If the ``EXTERNALLY-MANAGED`` config file is found, the current environment\n is considered externally managed, and an ExternallyManagedEnvironment is\n raised.\n \"\"\"\n if running_under_virtualenv():\n return\n marker = os.path.join(sysconfig.get_path(\"stdlib\"), \"EXTERNALLY-MANAGED\")\n if not os.path.isfile(marker):\n return\n raise ExternallyManagedEnvironment.from_config(marker)\n\n\ndef is_console_interactive() -> bool:\n \"\"\"Is this console interactive?\"\"\"\n return sys.stdin is not None and sys.stdin.isatty()\n\n\ndef hash_file(path: str, blocksize: int = 1 << 20) -> Tuple[Any, int]:\n \"\"\"Return (hash, length) for path using hashlib.sha256()\"\"\"\n\n h = hashlib.sha256()\n length = 0\n with open(path, \"rb\") as f:\n for block in read_chunks(f, size=blocksize):\n length += len(block)\n h.update(block)\n return h, length\n\n\ndef pairwise(iterable: Iterable[Any]) -> Iterator[Tuple[Any, Any]]:\n \"\"\"\n Return paired elements.\n\n For example:\n s -> (s0, s1), (s2, s3), (s4, s5), ...\n \"\"\"\n iterable = iter(iterable)\n return zip_longest(iterable, iterable)\n\n\ndef partition(\n pred: Callable[[T], bool], iterable: Iterable[T]\n) -> Tuple[Iterable[T], Iterable[T]]:\n \"\"\"\n Use a predicate to partition entries into false entries and true entries,\n like\n\n partition(is_odd, range(10)) --> 0 2 4 6 8 and 1 3 5 7 9\n \"\"\"\n t1, t2 = tee(iterable)\n return filterfalse(pred, t1), filter(pred, t2)\n\n\nclass ConfiguredBuildBackendHookCaller(BuildBackendHookCaller):\n def __init__(\n self,\n config_holder: Any,\n source_dir: str,\n build_backend: str,\n backend_path: Optional[str] = None,\n runner: Optional[Callable[..., None]] = None,\n python_executable: Optional[str] = None,\n ):\n super().__init__(\n source_dir, build_backend, backend_path, runner, python_executable\n )\n self.config_holder = config_holder\n\n def build_wheel(\n self,\n wheel_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n metadata_directory: Optional[str] = None,\n ) -> str:\n cs = self.config_holder.config_settings\n return super().build_wheel(\n wheel_directory, config_settings=cs, metadata_directory=metadata_directory\n )\n\n def build_sdist(\n self,\n sdist_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n ) -> str:\n cs = self.config_holder.config_settings\n return super().build_sdist(sdist_directory, config_settings=cs)\n\n def build_editable(\n self,\n wheel_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n metadata_directory: Optional[str] = None,\n ) -> str:\n cs = self.config_holder.config_settings\n return super().build_editable(\n wheel_directory, config_settings=cs, metadata_directory=metadata_directory\n )\n\n def get_requires_for_build_wheel(\n self, config_settings: Optional[Mapping[str, Any]] = None\n ) -> Sequence[str]:\n cs = self.config_holder.config_settings\n return super().get_requires_for_build_wheel(config_settings=cs)\n\n def get_requires_for_build_sdist(\n self, config_settings: Optional[Mapping[str, Any]] = None\n ) -> Sequence[str]:\n cs = self.config_holder.config_settings\n return super().get_requires_for_build_sdist(config_settings=cs)\n\n def get_requires_for_build_editable(\n self, config_settings: Optional[Mapping[str, Any]] = None\n ) -> Sequence[str]:\n cs = self.config_holder.config_settings\n return super().get_requires_for_build_editable(config_settings=cs)\n\n def prepare_metadata_for_build_wheel(\n self,\n metadata_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n _allow_fallback: bool = True,\n ) -> str:\n cs = self.config_holder.config_settings\n return super().prepare_metadata_for_build_wheel(\n metadata_directory=metadata_directory,\n config_settings=cs,\n _allow_fallback=_allow_fallback,\n )\n\n def prepare_metadata_for_build_editable(\n self,\n metadata_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n _allow_fallback: bool = True,\n ) -> Optional[str]:\n cs = self.config_holder.config_settings\n return super().prepare_metadata_for_build_editable(\n metadata_directory=metadata_directory,\n config_settings=cs,\n _allow_fallback=_allow_fallback,\n )\n\n\ndef warn_if_run_as_root() -> None:\n \"\"\"Output a warning for sudo users on Unix.\n\n In a virtual environment, sudo pip still writes to virtualenv.\n On Windows, users may run pip as Administrator without issues.\n This warning only applies to Unix root users outside of virtualenv.\n \"\"\"\n if running_under_virtualenv():\n return\n if not hasattr(os, \"getuid\"):\n return\n # On Windows, there are no \"system managed\" Python packages. Installing as\n # Administrator via pip is the correct way of updating system environments.\n #\n # We choose sys.platform over utils.compat.WINDOWS here to enable Mypy platform\n # checks: https://mypy.readthedocs.io/en/stable/common_issues.html\n if sys.platform == \"win32\" or sys.platform == \"cygwin\":\n return\n\n if os.getuid() != 0:\n return\n\n logger.warning(\n \"Running pip as the 'root' user can result in broken permissions and \"\n \"conflicting behaviour with the system package manager, possibly \"\n \"rendering your system unusable. \"\n \"It is recommended to use a virtual environment instead: \"\n \"https://pip.pypa.io/warnings/venv. \"\n \"Use the --root-user-action option if you know what you are doing and \"\n \"want to suppress this warning.\"\n )\n",[],[100,509,516,523,475,544,1590,1732],{"_104":1740,"_96":1741,"_158":1742,"_160":1591,"_161":139,"_162":1743,"_164":165,"_106":1744,"_101":29,"_167":215,"_169":1745,"_170":25,"_171":-5,"_172":1746,"_99":1747},"04df49ea-67fc-11f0-9ad5-0224a6c84d84","packaging.py","04df4ae4-67fc-11f0-9ad5-0224a6c84d84",156,["D",1753299255921],"import functools\nimport logging\nfrom typing import Optional, Tuple\n\nfrom pip._vendor.packaging import specifiers, version\nfrom pip._vendor.packaging.requirements import Requirement\n\nlogger = logging.getLogger(__name__)\n\n\n@functools.lru_cache(maxsize=32)\ndef check_requires_python(\n requires_python: Optional[str], version_info: Tuple[int, ...]\n) -> bool:\n \"\"\"\n Check if the given Python version matches a \"Requires-Python\" specifier.\n\n :param version_info: A 3-tuple of ints representing a Python\n major-minor-micro version to check (e.g. `sys.version_info[:3]`).\n\n :return: `True` if the given Python version satisfies the requirement.\n Otherwise, return `False`.\n\n :raises InvalidSpecifier: If `requires_python` has an invalid format.\n \"\"\"\n if requires_python is None:\n # The package provides no information\n return True\n requires_python_specifier = specifiers.SpecifierSet(requires_python)\n\n python_version = version.parse(\".\".join(map(str, version_info)))\n return python_version in requires_python_specifier\n\n\n@functools.lru_cache(maxsize=10000)\ndef get_requirement(req_string: str) -> Requirement:\n \"\"\"Construct a packaging.Requirement object with caching\"\"\"\n # Parsing requirement strings is expensive, and is also expected to happen\n # with a low diversity of different arguments (at least relative the number\n # constructed). This method adds a cache to requirement object creation to\n # minimize repeated parsing of the same string to construct equivalent\n # Requirement objects.\n return Requirement(req_string)\n",[],[100,509,516,523,475,544,1590,1741],{"_104":1749,"_96":1750,"_158":1751,"_160":1591,"_161":139,"_162":1752,"_164":165,"_106":1753,"_101":29,"_167":215,"_169":1754,"_170":25,"_171":-5,"_172":1755,"_99":1756},"04c8cfa8-67fc-11f0-8737-0224a6c84d84","retry.py","04c8d08e-67fc-11f0-8737-0224a6c84d84",153,["D",1753299255799],"import functools\nfrom time import perf_counter, sleep\nfrom typing import Callable, TypeVar\n\nfrom pip._vendor.typing_extensions import ParamSpec\n\nT = TypeVar(\"T\")\nP = ParamSpec(\"P\")\n\n\ndef retry(\n wait: float, stop_after_delay: float\n) -> Callable[[Callable[P, T]], Callable[P, T]]:\n \"\"\"Decorator to automatically retry a function on error.\n\n If the function raises, the function is recalled with the same arguments\n until it returns or the time limit is reached. When the time limit is\n surpassed, the last exception raised is reraised.\n\n :param wait: The time to wait after an error before retrying, in seconds.\n :param stop_after_delay: The time limit after which retries will cease,\n in seconds.\n \"\"\"\n\n def wrapper(func: Callable[P, T]) -> Callable[P, T]:\n\n @functools.wraps(func)\n def retry_wrapped(*args: P.args, **kwargs: P.kwargs) -> T:\n # The performance counter is monotonic on all platforms we care\n # about and has much better resolution than time.monotonic().\n start_time = perf_counter()\n while True:\n try:\n return func(*args, **kwargs)\n except Exception:\n if perf_counter() - start_time > stop_after_delay:\n raise\n sleep(wait)\n\n return retry_wrapped\n\n return wrapper\n",[],[100,509,516,523,475,544,1590,1750],{"_104":1758,"_96":1759,"_158":1760,"_160":1591,"_161":139,"_162":1761,"_164":165,"_106":1762,"_101":29,"_167":215,"_169":1763,"_170":25,"_171":-5,"_172":1764,"_99":1765},"04db2f22-67fc-11f0-95df-0224a6c84d84","setuptools_build.py","04db2fd6-67fc-11f0-95df-0224a6c84d84",155,["D",1753299255905],"import sys\nimport textwrap\nfrom typing import List, Optional, Sequence\n\n# Shim to wrap setup.py invocation with setuptools\n# Note that __file__ is handled via two {!r} *and* %r, to ensure that paths on\n# Windows are correctly handled (it should be \"C:\\\\Users\" not \"C:\\Users\").\n_SETUPTOOLS_SHIM = textwrap.dedent(\n \"\"\"\n exec(compile('''\n # This is -- a caller that pip uses to run setup.py\n #\n # - It imports setuptools before invoking setup.py, to enable projects that directly\n # import from `distutils.core` to work with newer packaging standards.\n # - It provides a clear error message when setuptools is not installed.\n # - It sets `sys.argv[0]` to the underlying `setup.py`, when invoking `setup.py` so\n # setuptools doesn't think the script is `-c`. This avoids the following warning:\n # manifest_maker: standard file '-c' not found\".\n # - It generates a shim setup.py, for handling setup.cfg-only projects.\n import os, sys, tokenize, traceback\n\n try:\n import setuptools\n except ImportError:\n print(\n \"ERROR: Can not execute `setup.py` since setuptools failed to import in \"\n \"the build environment with exception:\",\n file=sys.stderr,\n )\n traceback.print_exc()\n sys.exit(1)\n\n __file__ = %r\n sys.argv[0] = __file__\n\n if os.path.exists(__file__):\n filename = __file__\n with tokenize.open(__file__) as f:\n setup_py_code = f.read()\n else:\n filename = \"\"\n setup_py_code = \"from setuptools import setup; setup()\"\n\n exec(compile(setup_py_code, filename, \"exec\"))\n ''' % ({!r},), \"\", \"exec\"))\n \"\"\"\n).rstrip()\n\n\ndef make_setuptools_shim_args(\n setup_py_path: str,\n global_options: Optional[Sequence[str]] = None,\n no_user_config: bool = False,\n unbuffered_output: bool = False,\n) -> List[str]:\n \"\"\"\n Get setuptools command arguments with shim wrapped setup file invocation.\n\n :param setup_py_path: The path to setup.py to be wrapped.\n :param global_options: Additional global options.\n :param no_user_config: If True, disables personal user configuration.\n :param unbuffered_output: If True, adds the unbuffered switch to the\n argument list.\n \"\"\"\n args = [sys.executable]\n if unbuffered_output:\n args += [\"-u\"]\n args += [\"-c\", _SETUPTOOLS_SHIM.format(setup_py_path)]\n if global_options:\n args += global_options\n if no_user_config:\n args += [\"--no-user-cfg\"]\n return args\n\n\ndef make_setuptools_bdist_wheel_args(\n setup_py_path: str,\n global_options: Sequence[str],\n build_options: Sequence[str],\n destination_dir: str,\n) -> List[str]:\n # NOTE: Eventually, we'd want to also -S to the flags here, when we're\n # isolating. Currently, it breaks Python in virtualenvs, because it\n # relies on site.py to find parts of the standard library outside the\n # virtualenv.\n args = make_setuptools_shim_args(\n setup_py_path, global_options=global_options, unbuffered_output=True\n )\n args += [\"bdist_wheel\", \"-d\", destination_dir]\n args += build_options\n return args\n\n\ndef make_setuptools_clean_args(\n setup_py_path: str,\n global_options: Sequence[str],\n) -> List[str]:\n args = make_setuptools_shim_args(\n setup_py_path, global_options=global_options, unbuffered_output=True\n )\n args += [\"clean\", \"--all\"]\n return args\n\n\ndef make_setuptools_develop_args(\n setup_py_path: str,\n *,\n global_options: Sequence[str],\n no_user_config: bool,\n prefix: Optional[str],\n home: Optional[str],\n use_user_site: bool,\n) -> List[str]:\n assert not (use_user_site and prefix)\n\n args = make_setuptools_shim_args(\n setup_py_path,\n global_options=global_options,\n no_user_config=no_user_config,\n )\n\n args += [\"develop\", \"--no-deps\"]\n\n if prefix:\n args += [\"--prefix\", prefix]\n if home is not None:\n args += [\"--install-dir\", home]\n\n if use_user_site:\n args += [\"--user\", \"--prefix=\"]\n\n return args\n\n\ndef make_setuptools_egg_info_args(\n setup_py_path: str,\n egg_info_dir: Optional[str],\n no_user_config: bool,\n) -> List[str]:\n args = make_setuptools_shim_args(setup_py_path, no_user_config=no_user_config)\n\n args += [\"egg_info\"]\n\n if egg_info_dir:\n args += [\"--egg-base\", egg_info_dir]\n\n return args\n",[],[100,509,516,523,475,544,1590,1759],{"_104":1767,"_96":1768,"_158":1769,"_160":1591,"_161":139,"_162":1770,"_164":165,"_106":1771,"_101":29,"_167":215,"_169":1772,"_170":25,"_171":-5,"_172":1773,"_99":1774},"04ae4408-67fc-11f0-bf1a-0224a6c84d84","subprocess.py","04ae449e-67fc-11f0-bf1a-0224a6c84d84",148,["D",1753299255625],"import logging\nimport os\nimport shlex\nimport subprocess\nfrom typing import Any, Callable, Iterable, List, Literal, Mapping, Optional, Union\n\nfrom pip._vendor.rich.markup import escape\n\nfrom pip._internal.cli.spinners import SpinnerInterface, open_spinner\nfrom pip._internal.exceptions import InstallationSubprocessError\nfrom pip._internal.utils.logging import VERBOSE, subprocess_logger\nfrom pip._internal.utils.misc import HiddenText\n\nCommandArgs = List[Union[str, HiddenText]]\n\n\ndef make_command(*args: Union[str, HiddenText, CommandArgs]) -> CommandArgs:\n \"\"\"\n Create a CommandArgs object.\n \"\"\"\n command_args: CommandArgs = []\n for arg in args:\n # Check for list instead of CommandArgs since CommandArgs is\n # only known during type-checking.\n if isinstance(arg, list):\n command_args.extend(arg)\n else:\n # Otherwise, arg is str or HiddenText.\n command_args.append(arg)\n\n return command_args\n\n\ndef format_command_args(args: Union[List[str], CommandArgs]) -> str:\n \"\"\"\n Format command arguments for display.\n \"\"\"\n # For HiddenText arguments, display the redacted form by calling str().\n # Also, we don't apply str() to arguments that aren't HiddenText since\n # this can trigger a UnicodeDecodeError in Python 2 if the argument\n # has type unicode and includes a non-ascii character. (The type\n # checker doesn't ensure the annotations are correct in all cases.)\n return \" \".join(\n shlex.quote(str(arg)) if isinstance(arg, HiddenText) else shlex.quote(arg)\n for arg in args\n )\n\n\ndef reveal_command_args(args: Union[List[str], CommandArgs]) -> List[str]:\n \"\"\"\n Return the arguments in their raw, unredacted form.\n \"\"\"\n return [arg.secret if isinstance(arg, HiddenText) else arg for arg in args]\n\n\ndef call_subprocess(\n cmd: Union[List[str], CommandArgs],\n show_stdout: bool = False,\n cwd: Optional[str] = None,\n on_returncode: 'Literal[\"raise\", \"warn\", \"ignore\"]' = \"raise\",\n extra_ok_returncodes: Optional[Iterable[int]] = None,\n extra_environ: Optional[Mapping[str, Any]] = None,\n unset_environ: Optional[Iterable[str]] = None,\n spinner: Optional[SpinnerInterface] = None,\n log_failed_cmd: Optional[bool] = True,\n stdout_only: Optional[bool] = False,\n *,\n command_desc: str,\n) -> str:\n \"\"\"\n Args:\n show_stdout: if true, use INFO to log the subprocess's stderr and\n stdout streams. Otherwise, use DEBUG. Defaults to False.\n extra_ok_returncodes: an iterable of integer return codes that are\n acceptable, in addition to 0. Defaults to None, which means [].\n unset_environ: an iterable of environment variable names to unset\n prior to calling subprocess.Popen().\n log_failed_cmd: if false, failed commands are not logged, only raised.\n stdout_only: if true, return only stdout, else return both. When true,\n logging of both stdout and stderr occurs when the subprocess has\n terminated, else logging occurs as subprocess output is produced.\n \"\"\"\n if extra_ok_returncodes is None:\n extra_ok_returncodes = []\n if unset_environ is None:\n unset_environ = []\n # Most places in pip use show_stdout=False. What this means is--\n #\n # - We connect the child's output (combined stderr and stdout) to a\n # single pipe, which we read.\n # - We log this output to stderr at DEBUG level as it is received.\n # - If DEBUG logging isn't enabled (e.g. if --verbose logging wasn't\n # requested), then we show a spinner so the user can still see the\n # subprocess is in progress.\n # - If the subprocess exits with an error, we log the output to stderr\n # at ERROR level if it hasn't already been displayed to the console\n # (e.g. if --verbose logging wasn't enabled). This way we don't log\n # the output to the console twice.\n #\n # If show_stdout=True, then the above is still done, but with DEBUG\n # replaced by INFO.\n if show_stdout:\n # Then log the subprocess output at INFO level.\n log_subprocess: Callable[..., None] = subprocess_logger.info\n used_level = logging.INFO\n else:\n # Then log the subprocess output using VERBOSE. This also ensures\n # it will be logged to the log file (aka user_log), if enabled.\n log_subprocess = subprocess_logger.verbose\n used_level = VERBOSE\n\n # Whether the subprocess will be visible in the console.\n showing_subprocess = subprocess_logger.getEffectiveLevel() <= used_level\n\n # Only use the spinner if we're not showing the subprocess output\n # and we have a spinner.\n use_spinner = not showing_subprocess and spinner is not None\n\n log_subprocess(\"Running command %s\", command_desc)\n env = os.environ.copy()\n if extra_environ:\n env.update(extra_environ)\n for name in unset_environ:\n env.pop(name, None)\n try:\n proc = subprocess.Popen(\n # Convert HiddenText objects to the underlying str.\n reveal_command_args(cmd),\n stdin=subprocess.PIPE,\n stdout=subprocess.PIPE,\n stderr=subprocess.STDOUT if not stdout_only else subprocess.PIPE,\n cwd=cwd,\n env=env,\n errors=\"backslashreplace\",\n )\n except Exception as exc:\n if log_failed_cmd:\n subprocess_logger.critical(\n \"Error %s while executing command %s\",\n exc,\n command_desc,\n )\n raise\n all_output = []\n if not stdout_only:\n assert proc.stdout\n assert proc.stdin\n proc.stdin.close()\n # In this mode, stdout and stderr are in the same pipe.\n while True:\n line: str = proc.stdout.readline()\n if not line:\n break\n line = line.rstrip()\n all_output.append(line + \"\\n\")\n\n # Show the line immediately.\n log_subprocess(line)\n # Update the spinner.\n if use_spinner:\n assert spinner\n spinner.spin()\n try:\n proc.wait()\n finally:\n if proc.stdout:\n proc.stdout.close()\n output = \"\".join(all_output)\n else:\n # In this mode, stdout and stderr are in different pipes.\n # We must use communicate() which is the only safe way to read both.\n out, err = proc.communicate()\n # log line by line to preserve pip log indenting\n for out_line in out.splitlines():\n log_subprocess(out_line)\n all_output.append(out)\n for err_line in err.splitlines():\n log_subprocess(err_line)\n all_output.append(err)\n output = out\n\n proc_had_error = proc.returncode and proc.returncode not in extra_ok_returncodes\n if use_spinner:\n assert spinner\n if proc_had_error:\n spinner.finish(\"error\")\n else:\n spinner.finish(\"done\")\n if proc_had_error:\n if on_returncode == \"raise\":\n error = InstallationSubprocessError(\n command_description=command_desc,\n exit_code=proc.returncode,\n output_lines=all_output if not showing_subprocess else None,\n )\n if log_failed_cmd:\n subprocess_logger.error(\"%s\", error, extra={\"rich\": True})\n subprocess_logger.verbose(\n \"[bold magenta]full command[/]: [blue]%s[/]\",\n escape(format_command_args(cmd)),\n extra={\"markup\": True},\n )\n subprocess_logger.verbose(\n \"[bold magenta]cwd[/]: %s\",\n escape(cwd or \"[inherit]\"),\n extra={\"markup\": True},\n )\n\n raise error\n elif on_returncode == \"warn\":\n subprocess_logger.warning(\n 'Command \"%s\" had error code %s in %s',\n command_desc,\n proc.returncode,\n cwd,\n )\n elif on_returncode == \"ignore\":\n pass\n else:\n raise ValueError(f\"Invalid value: on_returncode={on_returncode!r}\")\n return output\n\n\ndef runner_with_spinner_message(message: str) -> Callable[..., None]:\n \"\"\"Provide a subprocess_runner that shows a spinner message.\n\n Intended for use with for BuildBackendHookCaller. Thus, the runner has\n an API that matches what's expected by BuildBackendHookCaller.subprocess_runner.\n \"\"\"\n\n def runner(\n cmd: List[str],\n cwd: Optional[str] = None,\n extra_environ: Optional[Mapping[str, Any]] = None,\n ) -> None:\n with open_spinner(message) as spinner:\n call_subprocess(\n cmd,\n command_desc=message,\n cwd=cwd,\n extra_environ=extra_environ,\n spinner=spinner,\n )\n\n return runner\n",[],[100,509,516,523,475,544,1590,1768],{"_104":1776,"_96":1777,"_158":1778,"_160":1591,"_161":139,"_162":1779,"_164":165,"_106":1780,"_101":29,"_167":215,"_169":1781,"_170":25,"_171":-5,"_172":1782,"_99":1783},"04c400a4-67fc-11f0-a319-0224a6c84d84","temp_dir.py","04c40180-67fc-11f0-a319-0224a6c84d84",152,["D",1753299255776],"import errno\nimport itertools\nimport logging\nimport os.path\nimport tempfile\nimport traceback\nfrom contextlib import ExitStack, contextmanager\nfrom pathlib import Path\nfrom typing import (\n Any,\n Callable,\n Dict,\n Generator,\n List,\n Optional,\n TypeVar,\n Union,\n)\n\nfrom pip._internal.utils.misc import enum, rmtree\n\nlogger = logging.getLogger(__name__)\n\n_T = TypeVar(\"_T\", bound=\"TempDirectory\")\n\n\n# Kinds of temporary directories. Only needed for ones that are\n# globally-managed.\ntempdir_kinds = enum(\n BUILD_ENV=\"build-env\",\n EPHEM_WHEEL_CACHE=\"ephem-wheel-cache\",\n REQ_BUILD=\"req-build\",\n)\n\n\n_tempdir_manager: Optional[ExitStack] = None\n\n\n@contextmanager\ndef global_tempdir_manager() -> Generator[None, None, None]:\n global _tempdir_manager\n with ExitStack() as stack:\n old_tempdir_manager, _tempdir_manager = _tempdir_manager, stack\n try:\n yield\n finally:\n _tempdir_manager = old_tempdir_manager\n\n\nclass TempDirectoryTypeRegistry:\n \"\"\"Manages temp directory behavior\"\"\"\n\n def __init__(self) -> None:\n self._should_delete: Dict[str, bool] = {}\n\n def set_delete(self, kind: str, value: bool) -> None:\n \"\"\"Indicate whether a TempDirectory of the given kind should be\n auto-deleted.\n \"\"\"\n self._should_delete[kind] = value\n\n def get_delete(self, kind: str) -> bool:\n \"\"\"Get configured auto-delete flag for a given TempDirectory type,\n default True.\n \"\"\"\n return self._should_delete.get(kind, True)\n\n\n_tempdir_registry: Optional[TempDirectoryTypeRegistry] = None\n\n\n@contextmanager\ndef tempdir_registry() -> Generator[TempDirectoryTypeRegistry, None, None]:\n \"\"\"Provides a scoped global tempdir registry that can be used to dictate\n whether directories should be deleted.\n \"\"\"\n global _tempdir_registry\n old_tempdir_registry = _tempdir_registry\n _tempdir_registry = TempDirectoryTypeRegistry()\n try:\n yield _tempdir_registry\n finally:\n _tempdir_registry = old_tempdir_registry\n\n\nclass _Default:\n pass\n\n\n_default = _Default()\n\n\nclass TempDirectory:\n \"\"\"Helper class that owns and cleans up a temporary directory.\n\n This class can be used as a context manager or as an OO representation of a\n temporary directory.\n\n Attributes:\n path\n Location to the created temporary directory\n delete\n Whether the directory should be deleted when exiting\n (when used as a contextmanager)\n\n Methods:\n cleanup()\n Deletes the temporary directory\n\n When used as a context manager, if the delete attribute is True, on\n exiting the context the temporary directory is deleted.\n \"\"\"\n\n def __init__(\n self,\n path: Optional[str] = None,\n delete: Union[bool, None, _Default] = _default,\n kind: str = \"temp\",\n globally_managed: bool = False,\n ignore_cleanup_errors: bool = True,\n ):\n super().__init__()\n\n if delete is _default:\n if path is not None:\n # If we were given an explicit directory, resolve delete option\n # now.\n delete = False\n else:\n # Otherwise, we wait until cleanup and see what\n # tempdir_registry says.\n delete = None\n\n # The only time we specify path is in for editables where it\n # is the value of the --src option.\n if path is None:\n path = self._create(kind)\n\n self._path = path\n self._deleted = False\n self.delete = delete\n self.kind = kind\n self.ignore_cleanup_errors = ignore_cleanup_errors\n\n if globally_managed:\n assert _tempdir_manager is not None\n _tempdir_manager.enter_context(self)\n\n @property\n def path(self) -> str:\n assert not self._deleted, f\"Attempted to access deleted path: {self._path}\"\n return self._path\n\n def __repr__(self) -> str:\n return f\"<{self.__class__.__name__} {self.path!r}>\"\n\n def __enter__(self: _T) -> _T:\n return self\n\n def __exit__(self, exc: Any, value: Any, tb: Any) -> None:\n if self.delete is not None:\n delete = self.delete\n elif _tempdir_registry:\n delete = _tempdir_registry.get_delete(self.kind)\n else:\n delete = True\n\n if delete:\n self.cleanup()\n\n def _create(self, kind: str) -> str:\n \"\"\"Create a temporary directory and store its path in self.path\"\"\"\n # We realpath here because some systems have their default tmpdir\n # symlinked to another directory. This tends to confuse build\n # scripts, so we canonicalize the path by traversing potential\n # symlinks here.\n path = os.path.realpath(tempfile.mkdtemp(prefix=f\"pip-{kind}-\"))\n logger.debug(\"Created temporary directory: %s\", path)\n return path\n\n def cleanup(self) -> None:\n \"\"\"Remove the temporary directory created and reset state\"\"\"\n self._deleted = True\n if not os.path.exists(self._path):\n return\n\n errors: List[BaseException] = []\n\n def onerror(\n func: Callable[..., Any],\n path: Path,\n exc_val: BaseException,\n ) -> None:\n \"\"\"Log a warning for a `rmtree` error and continue\"\"\"\n formatted_exc = \"\\n\".join(\n traceback.format_exception_only(type(exc_val), exc_val)\n )\n formatted_exc = formatted_exc.rstrip() # remove trailing new line\n if func in (os.unlink, os.remove, os.rmdir):\n logger.debug(\n \"Failed to remove a temporary file '%s' due to %s.\\n\",\n path,\n formatted_exc,\n )\n else:\n logger.debug(\"%s failed with %s.\", func.__qualname__, formatted_exc)\n errors.append(exc_val)\n\n if self.ignore_cleanup_errors:\n try:\n # first try with @retry; retrying to handle ephemeral errors\n rmtree(self._path, ignore_errors=False)\n except OSError:\n # last pass ignore/log all errors\n rmtree(self._path, onexc=onerror)\n if errors:\n logger.warning(\n \"Failed to remove contents in a temporary directory '%s'.\\n\"\n \"You can safely remove it manually.\",\n self._path,\n )\n else:\n rmtree(self._path)\n\n\nclass AdjacentTempDirectory(TempDirectory):\n \"\"\"Helper class that creates a temporary directory adjacent to a real one.\n\n Attributes:\n original\n The original directory to create a temp directory for.\n path\n After calling create() or entering, contains the full\n path to the temporary directory.\n delete\n Whether the directory should be deleted when exiting\n (when used as a contextmanager)\n\n \"\"\"\n\n # The characters that may be used to name the temp directory\n # We always prepend a ~ and then rotate through these until\n # a usable name is found.\n # pkg_resources raises a different error for .dist-info folder\n # with leading '-' and invalid metadata\n LEADING_CHARS = \"-~.=%0123456789\"\n\n def __init__(self, original: str, delete: Optional[bool] = None) -> None:\n self.original = original.rstrip(\"/\\\\\")\n super().__init__(delete=delete)\n\n @classmethod\n def _generate_names(cls, name: str) -> Generator[str, None, None]:\n \"\"\"Generates a series of temporary names.\n\n The algorithm replaces the leading characters in the name\n with ones that are valid filesystem characters, but are not\n valid package names (for both Python and pip definitions of\n package).\n \"\"\"\n for i in range(1, len(name)):\n for candidate in itertools.combinations_with_replacement(\n cls.LEADING_CHARS, i - 1\n ):\n new_name = \"~\" + \"\".join(candidate) + name[i:]\n if new_name != name:\n yield new_name\n\n # If we make it this far, we will have to make a longer name\n for i in range(len(cls.LEADING_CHARS)):\n for candidate in itertools.combinations_with_replacement(\n cls.LEADING_CHARS, i\n ):\n new_name = \"~\" + \"\".join(candidate) + name\n if new_name != name:\n yield new_name\n\n def _create(self, kind: str) -> str:\n root, name = os.path.split(self.original)\n for candidate in self._generate_names(name):\n path = os.path.join(root, candidate)\n try:\n os.mkdir(path)\n except OSError as ex:\n # Continue if the name exists already\n if ex.errno != errno.EEXIST:\n raise\n else:\n path = os.path.realpath(path)\n break\n else:\n # Final fallback on the default behavior.\n path = os.path.realpath(tempfile.mkdtemp(prefix=f\"pip-{kind}-\"))\n\n logger.debug(\"Created temporary directory: %s\", path)\n return path\n",[],[100,509,516,523,475,544,1590,1777],{"_104":1785,"_96":1786,"_158":1787,"_160":1591,"_161":139,"_162":1788,"_164":165,"_106":1789,"_101":29,"_167":215,"_169":1790,"_170":25,"_171":-5,"_172":1791,"_99":1792},"051af3be-67fc-11f0-b87e-0224a6c84d84","unpacking.py","051af454-67fc-11f0-b87e-0224a6c84d84",167,["D",1753299256350],"\"\"\"Utilities related archives.\"\"\"\n\nimport logging\nimport os\nimport shutil\nimport stat\nimport sys\nimport tarfile\nimport zipfile\nfrom typing import Iterable, List, Optional\nfrom zipfile import ZipInfo\n\nfrom pip._internal.exceptions import InstallationError\nfrom pip._internal.utils.filetypes import (\n BZ2_EXTENSIONS,\n TAR_EXTENSIONS,\n XZ_EXTENSIONS,\n ZIP_EXTENSIONS,\n)\nfrom pip._internal.utils.misc import ensure_dir\n\nlogger = logging.getLogger(__name__)\n\n\nSUPPORTED_EXTENSIONS = ZIP_EXTENSIONS + TAR_EXTENSIONS\n\ntry:\n import bz2 # noqa\n\n SUPPORTED_EXTENSIONS += BZ2_EXTENSIONS\nexcept ImportError:\n logger.debug(\"bz2 module is not available\")\n\ntry:\n # Only for Python 3.3+\n import lzma # noqa\n\n SUPPORTED_EXTENSIONS += XZ_EXTENSIONS\nexcept ImportError:\n logger.debug(\"lzma module is not available\")\n\n\ndef current_umask() -> int:\n \"\"\"Get the current umask which involves having to set it temporarily.\"\"\"\n mask = os.umask(0)\n os.umask(mask)\n return mask\n\n\ndef split_leading_dir(path: str) -> List[str]:\n path = path.lstrip(\"/\").lstrip(\"\\\\\")\n if \"/\" in path and (\n (\"\\\\\" in path and path.find(\"/\") < path.find(\"\\\\\")) or \"\\\\\" not in path\n ):\n return path.split(\"/\", 1)\n elif \"\\\\\" in path:\n return path.split(\"\\\\\", 1)\n else:\n return [path, \"\"]\n\n\ndef has_leading_dir(paths: Iterable[str]) -> bool:\n \"\"\"Returns true if all the paths have the same leading path name\n (i.e., everything is in one subdirectory in an archive)\"\"\"\n common_prefix = None\n for path in paths:\n prefix, rest = split_leading_dir(path)\n if not prefix:\n return False\n elif common_prefix is None:\n common_prefix = prefix\n elif prefix != common_prefix:\n return False\n return True\n\n\ndef is_within_directory(directory: str, target: str) -> bool:\n \"\"\"\n Return true if the absolute path of target is within the directory\n \"\"\"\n abs_directory = os.path.abspath(directory)\n abs_target = os.path.abspath(target)\n\n prefix = os.path.commonprefix([abs_directory, abs_target])\n return prefix == abs_directory\n\n\ndef _get_default_mode_plus_executable() -> int:\n return 0o777 & ~current_umask() | 0o111\n\n\ndef set_extracted_file_to_default_mode_plus_executable(path: str) -> None:\n \"\"\"\n Make file present at path have execute for user/group/world\n (chmod +x) is no-op on windows per python docs\n \"\"\"\n os.chmod(path, _get_default_mode_plus_executable())\n\n\ndef zip_item_is_executable(info: ZipInfo) -> bool:\n mode = info.external_attr >> 16\n # if mode and regular file and any execute permissions for\n # user/group/world?\n return bool(mode and stat.S_ISREG(mode) and mode & 0o111)\n\n\ndef unzip_file(filename: str, location: str, flatten: bool = True) -> None:\n \"\"\"\n Unzip the file (with path `filename`) to the destination `location`. All\n files are written based on system defaults and umask (i.e. permissions are\n not preserved), except that regular file members with any execute\n permissions (user, group, or world) have \"chmod +x\" applied after being\n written. Note that for windows, any execute changes using os.chmod are\n no-ops per the python docs.\n \"\"\"\n ensure_dir(location)\n zipfp = open(filename, \"rb\")\n try:\n zip = zipfile.ZipFile(zipfp, allowZip64=True)\n leading = has_leading_dir(zip.namelist()) and flatten\n for info in zip.infolist():\n name = info.filename\n fn = name\n if leading:\n fn = split_leading_dir(name)[1]\n fn = os.path.join(location, fn)\n dir = os.path.dirname(fn)\n if not is_within_directory(location, fn):\n message = (\n \"The zip file ({}) has a file ({}) trying to install \"\n \"outside target directory ({})\"\n )\n raise InstallationError(message.format(filename, fn, location))\n if fn.endswith(\"/\") or fn.endswith(\"\\\\\"):\n # A directory\n ensure_dir(fn)\n else:\n ensure_dir(dir)\n # Don't use read() to avoid allocating an arbitrarily large\n # chunk of memory for the file's content\n fp = zip.open(name)\n try:\n with open(fn, \"wb\") as destfp:\n shutil.copyfileobj(fp, destfp)\n finally:\n fp.close()\n if zip_item_is_executable(info):\n set_extracted_file_to_default_mode_plus_executable(fn)\n finally:\n zipfp.close()\n\n\ndef untar_file(filename: str, location: str) -> None:\n \"\"\"\n Untar the file (with path `filename`) to the destination `location`.\n All files are written based on system defaults and umask (i.e. permissions\n are not preserved), except that regular file members with any execute\n permissions (user, group, or world) have \"chmod +x\" applied on top of the\n default. Note that for windows, any execute changes using os.chmod are\n no-ops per the python docs.\n \"\"\"\n ensure_dir(location)\n if filename.lower().endswith(\".gz\") or filename.lower().endswith(\".tgz\"):\n mode = \"r:gz\"\n elif filename.lower().endswith(BZ2_EXTENSIONS):\n mode = \"r:bz2\"\n elif filename.lower().endswith(XZ_EXTENSIONS):\n mode = \"r:xz\"\n elif filename.lower().endswith(\".tar\"):\n mode = \"r\"\n else:\n logger.warning(\n \"Cannot determine compression type for file %s\",\n filename,\n )\n mode = \"r:*\"\n\n tar = tarfile.open(filename, mode, encoding=\"utf-8\") # type: ignore\n try:\n leading = has_leading_dir([member.name for member in tar.getmembers()])\n\n # PEP 706 added `tarfile.data_filter`, and made some other changes to\n # Python's tarfile module (see below). The features were backported to\n # security releases.\n try:\n data_filter = tarfile.data_filter\n except AttributeError:\n _untar_without_filter(filename, location, tar, leading)\n else:\n default_mode_plus_executable = _get_default_mode_plus_executable()\n\n if leading:\n # Strip the leading directory from all files in the archive,\n # including hardlink targets (which are relative to the\n # unpack location).\n for member in tar.getmembers():\n name_lead, name_rest = split_leading_dir(member.name)\n member.name = name_rest\n if member.islnk():\n lnk_lead, lnk_rest = split_leading_dir(member.linkname)\n if lnk_lead == name_lead:\n member.linkname = lnk_rest\n\n def pip_filter(member: tarfile.TarInfo, path: str) -> tarfile.TarInfo:\n orig_mode = member.mode\n try:\n try:\n member = data_filter(member, location)\n except tarfile.LinkOutsideDestinationError:\n if sys.version_info[:3] in {\n (3, 9, 17),\n (3, 10, 12),\n (3, 11, 4),\n }:\n # The tarfile filter in specific Python versions\n # raises LinkOutsideDestinationError on valid input\n # (https://github.com/python/cpython/issues/107845)\n # Ignore the error there, but do use the\n # more lax `tar_filter`\n member = tarfile.tar_filter(member, location)\n else:\n raise\n except tarfile.TarError as exc:\n message = \"Invalid member in the tar file {}: {}\"\n # Filter error messages mention the member name.\n # No need to add it here.\n raise InstallationError(\n message.format(\n filename,\n exc,\n )\n )\n if member.isfile() and orig_mode & 0o111:\n member.mode = default_mode_plus_executable\n else:\n # See PEP 706 note above.\n # The PEP changed this from `int` to `Optional[int]`,\n # where None means \"use the default\". Mypy doesn't\n # know this yet.\n member.mode = None # type: ignore [assignment]\n return member\n\n tar.extractall(location, filter=pip_filter)\n\n finally:\n tar.close()\n\n\ndef _untar_without_filter(\n filename: str,\n location: str,\n tar: tarfile.TarFile,\n leading: bool,\n) -> None:\n \"\"\"Fallback for Python without tarfile.data_filter\"\"\"\n for member in tar.getmembers():\n fn = member.name\n if leading:\n fn = split_leading_dir(fn)[1]\n path = os.path.join(location, fn)\n if not is_within_directory(location, path):\n message = (\n \"The tar file ({}) has a file ({}) trying to install \"\n \"outside target directory ({})\"\n )\n raise InstallationError(message.format(filename, path, location))\n if member.isdir():\n ensure_dir(path)\n elif member.issym():\n try:\n tar._extract_member(member, path)\n except Exception as exc:\n # Some corrupt tar files seem to produce this\n # (specifically bad symlinks)\n logger.warning(\n \"In the tar file %s the member %s is invalid: %s\",\n filename,\n member.name,\n exc,\n )\n continue\n else:\n try:\n fp = tar.extractfile(member)\n except (KeyError, AttributeError) as exc:\n # Some corrupt tar files seem to produce this\n # (specifically bad symlinks)\n logger.warning(\n \"In the tar file %s the member %s is invalid: %s\",\n filename,\n member.name,\n exc,\n )\n continue\n ensure_dir(os.path.dirname(path))\n assert fp is not None\n with open(path, \"wb\") as destfp:\n shutil.copyfileobj(fp, destfp)\n fp.close()\n # Update the timestamp (useful for cython compiled files)\n tar.utime(member, path)\n # member have any execute permissions for user/group/world?\n if member.mode & 0o111:\n set_extracted_file_to_default_mode_plus_executable(path)\n\n\ndef unpack_file(\n filename: str,\n location: str,\n content_type: Optional[str] = None,\n) -> None:\n filename = os.path.realpath(filename)\n if (\n content_type == \"application/zip\"\n or filename.lower().endswith(ZIP_EXTENSIONS)\n or zipfile.is_zipfile(filename)\n ):\n unzip_file(filename, location, flatten=not filename.endswith(\".whl\"))\n elif (\n content_type == \"application/x-gzip\"\n or tarfile.is_tarfile(filename)\n or filename.lower().endswith(TAR_EXTENSIONS + BZ2_EXTENSIONS + XZ_EXTENSIONS)\n ):\n untar_file(filename, location)\n else:\n # FIXME: handle?\n # FIXME: magic signatures?\n logger.critical(\n \"Cannot unpack file %s (downloaded from %s, content-type: %s); \"\n \"cannot detect archive format\",\n filename,\n location,\n content_type,\n )\n raise InstallationError(f\"Cannot determine archive format of {location}\")\n",[],[100,509,516,523,475,544,1590,1786],{"_104":1794,"_96":1795,"_158":1796,"_160":1591,"_161":139,"_162":1797,"_164":165,"_106":1798,"_101":29,"_167":215,"_169":1799,"_170":25,"_171":-5,"_172":1800,"_99":1801},"04f7c04c-67fc-11f0-a7d9-0224a6c84d84","urls.py","04f7c114-67fc-11f0-a7d9-0224a6c84d84",160,["D",1753299256117],"import os\nimport string\nimport urllib.parse\nimport urllib.request\n\nfrom .compat import WINDOWS\n\n\ndef path_to_url(path: str) -> str:\n \"\"\"\n Convert a path to a file: URL. The path will be made absolute and have\n quoted path parts.\n \"\"\"\n path = os.path.normpath(os.path.abspath(path))\n url = urllib.parse.urljoin(\"file:\", urllib.request.pathname2url(path))\n return url\n\n\ndef url_to_path(url: str) -> str:\n \"\"\"\n Convert a file: URL to a path.\n \"\"\"\n assert url.startswith(\n \"file:\"\n ), f\"You can only turn file: urls into filenames (not {url!r})\"\n\n _, netloc, path, _, _ = urllib.parse.urlsplit(url)\n\n if not netloc or netloc == \"localhost\":\n # According to RFC 8089, same as empty authority.\n netloc = \"\"\n elif WINDOWS:\n # If we have a UNC path, prepend UNC share notation.\n netloc = \"\\\\\\\\\" + netloc\n else:\n raise ValueError(\n f\"non-local file URIs are not supported on this platform: {url!r}\"\n )\n\n path = urllib.request.url2pathname(netloc + path)\n\n # On Windows, urlsplit parses the path as something like \"/C:/Users/foo\".\n # This creates issues for path-related functions like io.open(), so we try\n # to detect and strip the leading slash.\n if (\n WINDOWS\n and not netloc # Not UNC.\n and len(path) >= 3\n and path[0] == \"/\" # Leading slash to strip.\n and path[1] in string.ascii_letters # Drive letter.\n and path[2:4] in (\":\", \":/\") # Colon + end of string, or colon + absolute path.\n ):\n path = path[1:]\n\n return path\n",[],[100,509,516,523,475,544,1590,1795],{"_104":1803,"_96":1804,"_158":1805,"_160":1591,"_161":139,"_162":1806,"_164":165,"_106":1807,"_101":29,"_167":215,"_169":1808,"_170":25,"_171":-5,"_172":1809,"_99":1810},"0501b1a6-67fc-11f0-a319-0224a6c84d84","virtualenv.py","0501b278-67fc-11f0-a319-0224a6c84d84",162,["D",1753299256168],"import logging\nimport os\nimport re\nimport site\nimport sys\nfrom typing import List, Optional\n\nlogger = logging.getLogger(__name__)\n_INCLUDE_SYSTEM_SITE_PACKAGES_REGEX = re.compile(\n r\"include-system-site-packages\\s*=\\s*(?Ptrue|false)\"\n)\n\n\ndef _running_under_venv() -> bool:\n \"\"\"Checks if sys.base_prefix and sys.prefix match.\n\n This handles PEP 405 compliant virtual environments.\n \"\"\"\n return sys.prefix != getattr(sys, \"base_prefix\", sys.prefix)\n\n\ndef _running_under_legacy_virtualenv() -> bool:\n \"\"\"Checks if sys.real_prefix is set.\n\n This handles virtual environments created with pypa's virtualenv.\n \"\"\"\n # pypa/virtualenv case\n return hasattr(sys, \"real_prefix\")\n\n\ndef running_under_virtualenv() -> bool:\n \"\"\"True if we're running inside a virtual environment, False otherwise.\"\"\"\n return _running_under_venv() or _running_under_legacy_virtualenv()\n\n\ndef _get_pyvenv_cfg_lines() -> Optional[List[str]]:\n \"\"\"Reads {sys.prefix}/pyvenv.cfg and returns its contents as list of lines\n\n Returns None, if it could not read/access the file.\n \"\"\"\n pyvenv_cfg_file = os.path.join(sys.prefix, \"pyvenv.cfg\")\n try:\n # Although PEP 405 does not specify, the built-in venv module always\n # writes with UTF-8. (pypa/pip#8717)\n with open(pyvenv_cfg_file, encoding=\"utf-8\") as f:\n return f.read().splitlines() # avoids trailing newlines\n except OSError:\n return None\n\n\ndef _no_global_under_venv() -> bool:\n \"\"\"Check `{sys.prefix}/pyvenv.cfg` for system site-packages inclusion\n\n PEP 405 specifies that when system site-packages are not supposed to be\n visible from a virtual environment, `pyvenv.cfg` must contain the following\n line:\n\n include-system-site-packages = false\n\n Additionally, log a warning if accessing the file fails.\n \"\"\"\n cfg_lines = _get_pyvenv_cfg_lines()\n if cfg_lines is None:\n # We're not in a \"sane\" venv, so assume there is no system\n # site-packages access (since that's PEP 405's default state).\n logger.warning(\n \"Could not access 'pyvenv.cfg' despite a virtual environment \"\n \"being active. Assuming global site-packages is not accessible \"\n \"in this environment.\"\n )\n return True\n\n for line in cfg_lines:\n match = _INCLUDE_SYSTEM_SITE_PACKAGES_REGEX.match(line)\n if match is not None and match.group(\"value\") == \"false\":\n return True\n return False\n\n\ndef _no_global_under_legacy_virtualenv() -> bool:\n \"\"\"Check if \"no-global-site-packages.txt\" exists beside site.py\n\n This mirrors logic in pypa/virtualenv for determining whether system\n site-packages are visible in the virtual environment.\n \"\"\"\n site_mod_dir = os.path.dirname(os.path.abspath(site.__file__))\n no_global_site_packages_file = os.path.join(\n site_mod_dir,\n \"no-global-site-packages.txt\",\n )\n return os.path.exists(no_global_site_packages_file)\n\n\ndef virtualenv_no_global() -> bool:\n \"\"\"Returns a boolean, whether running in venv with no system site-packages.\"\"\"\n # PEP 405 compliance needs to be checked first since virtualenv >=20 would\n # return True for both checks, but is only able to use the PEP 405 config.\n if _running_under_venv():\n return _no_global_under_venv()\n\n if _running_under_legacy_virtualenv():\n return _no_global_under_legacy_virtualenv()\n\n return False\n",[],[100,509,516,523,475,544,1590,1804],{"_104":1812,"_96":843,"_158":1813,"_160":1591,"_161":139,"_162":1814,"_164":165,"_106":1815,"_101":29,"_167":215,"_169":1816,"_170":25,"_171":-5,"_172":1817,"_99":1818},"0517ae0c-67fc-11f0-9ab6-0224a6c84d84","0517aeac-67fc-11f0-9ab6-0224a6c84d84",166,["D",1753299256327],"\"\"\"Support functions for working with wheel files.\"\"\"\n\nimport logging\nfrom email.message import Message\nfrom email.parser import Parser\nfrom typing import Tuple\nfrom zipfile import BadZipFile, ZipFile\n\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.exceptions import UnsupportedWheel\n\nVERSION_COMPATIBLE = (1, 0)\n\n\nlogger = logging.getLogger(__name__)\n\n\ndef parse_wheel(wheel_zip: ZipFile, name: str) -> Tuple[str, Message]:\n \"\"\"Extract information from the provided wheel, ensuring it meets basic\n standards.\n\n Returns the name of the .dist-info directory and the parsed WHEEL metadata.\n \"\"\"\n try:\n info_dir = wheel_dist_info_dir(wheel_zip, name)\n metadata = wheel_metadata(wheel_zip, info_dir)\n version = wheel_version(metadata)\n except UnsupportedWheel as e:\n raise UnsupportedWheel(f\"{name} has an invalid wheel, {e}\")\n\n check_compatibility(version, name)\n\n return info_dir, metadata\n\n\ndef wheel_dist_info_dir(source: ZipFile, name: str) -> str:\n \"\"\"Returns the name of the contained .dist-info directory.\n\n Raises AssertionError or UnsupportedWheel if not found, >1 found, or\n it doesn't match the provided name.\n \"\"\"\n # Zip file path separators must be /\n subdirs = {p.split(\"/\", 1)[0] for p in source.namelist()}\n\n info_dirs = [s for s in subdirs if s.endswith(\".dist-info\")]\n\n if not info_dirs:\n raise UnsupportedWheel(\".dist-info directory not found\")\n\n if len(info_dirs) > 1:\n raise UnsupportedWheel(\n \"multiple .dist-info directories found: {}\".format(\", \".join(info_dirs))\n )\n\n info_dir = info_dirs[0]\n\n info_dir_name = canonicalize_name(info_dir)\n canonical_name = canonicalize_name(name)\n if not info_dir_name.startswith(canonical_name):\n raise UnsupportedWheel(\n f\".dist-info directory {info_dir!r} does not start with {canonical_name!r}\"\n )\n\n return info_dir\n\n\ndef read_wheel_metadata_file(source: ZipFile, path: str) -> bytes:\n try:\n return source.read(path)\n # BadZipFile for general corruption, KeyError for missing entry,\n # and RuntimeError for password-protected files\n except (BadZipFile, KeyError, RuntimeError) as e:\n raise UnsupportedWheel(f\"could not read {path!r} file: {e!r}\")\n\n\ndef wheel_metadata(source: ZipFile, dist_info_dir: str) -> Message:\n \"\"\"Return the WHEEL metadata of an extracted wheel, if possible.\n Otherwise, raise UnsupportedWheel.\n \"\"\"\n path = f\"{dist_info_dir}/WHEEL\"\n # Zip file path separators must be /\n wheel_contents = read_wheel_metadata_file(source, path)\n\n try:\n wheel_text = wheel_contents.decode()\n except UnicodeDecodeError as e:\n raise UnsupportedWheel(f\"error decoding {path!r}: {e!r}\")\n\n # FeedParser (used by Parser) does not raise any exceptions. The returned\n # message may have .defects populated, but for backwards-compatibility we\n # currently ignore them.\n return Parser().parsestr(wheel_text)\n\n\ndef wheel_version(wheel_data: Message) -> Tuple[int, ...]:\n \"\"\"Given WHEEL metadata, return the parsed Wheel-Version.\n Otherwise, raise UnsupportedWheel.\n \"\"\"\n version_text = wheel_data[\"Wheel-Version\"]\n if version_text is None:\n raise UnsupportedWheel(\"WHEEL is missing Wheel-Version\")\n\n version = version_text.strip()\n\n try:\n return tuple(map(int, version.split(\".\")))\n except ValueError:\n raise UnsupportedWheel(f\"invalid Wheel-Version: {version!r}\")\n\n\ndef check_compatibility(version: Tuple[int, ...], name: str) -> None:\n \"\"\"Raises errors or warns if called with an incompatible Wheel-Version.\n\n pip should refuse to install a Wheel-Version that's a major series\n ahead of what it's compatible with (e.g 2.0 > 1.1); and warn when\n installing a version only minor version ahead (e.g 1.2 > 1.1).\n\n version: a 2-tuple representing a Wheel-Version (Major, Minor)\n name: name of wheel or package to raise exception about\n\n :raises UnsupportedWheel: when an incompatible Wheel-Version is given\n \"\"\"\n if version[0] > VERSION_COMPATIBLE[0]:\n raise UnsupportedWheel(\n \"{}'s Wheel-Version ({}) is not compatible with this version \"\n \"of pip\".format(name, \".\".join(map(str, version)))\n )\n elif version > VERSION_COMPATIBLE:\n logger.warning(\n \"Installing from a newer Wheel-Version (%s)\",\n \".\".join(map(str, version)),\n )\n",[],[100,509,516,523,475,544,1590,843],[100,509,516,523,475,544,1590],{"_104":1821,"_96":1822,"_158":1823,"_160":545,"_161":139,"_162":1824,"_164":165,"_106":1825,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1826,"_99":1880},"fcd24496-67fb-11f0-ba2f-0224a6c84d84","vcs","fcd24554-67fb-11f0-ba2f-0224a6c84d84",64,["D",1753299242449],[1827,1835,1844,1853,1862,1871],{"_104":1828,"_96":558,"_158":1829,"_160":1823,"_161":139,"_162":1830,"_164":165,"_106":1831,"_101":29,"_167":215,"_169":1832,"_170":25,"_171":-5,"_172":1833,"_99":1834},"067162b6-67fc-11f0-a29b-0224a6c84d84","06716356-67fc-11f0-a29b-0224a6c84d84",225,["D",1753299258587],"# Expose a limited set of classes and functions so callers outside of\n# the vcs package don't need to import deeper than `pip._internal.vcs`.\n# (The test directory may still need to import from a vcs sub-package.)\n# Import all vcs modules to register each VCS in the VcsSupport object.\nimport pip._internal.vcs.bazaar\nimport pip._internal.vcs.git\nimport pip._internal.vcs.mercurial\nimport pip._internal.vcs.subversion # noqa: F401\nfrom pip._internal.vcs.versioncontrol import ( # noqa: F401\n RemoteNotFoundError,\n RemoteNotValidError,\n is_url,\n make_vcs_requirement_url,\n vcs,\n)\n",[],[100,509,516,523,475,544,1822,558],{"_104":1836,"_96":1837,"_158":1838,"_160":1823,"_161":139,"_162":1839,"_164":165,"_106":1840,"_101":29,"_167":215,"_169":1841,"_170":25,"_171":-5,"_172":1842,"_99":1843},"0690e866-67fc-11f0-9ab6-0224a6c84d84","bazaar.py","0690e906-67fc-11f0-9ab6-0224a6c84d84",230,["D",1753299258636],"import logging\nfrom typing import List, Optional, Tuple\n\nfrom pip._internal.utils.misc import HiddenText, display_path\nfrom pip._internal.utils.subprocess import make_command\nfrom pip._internal.utils.urls import path_to_url\nfrom pip._internal.vcs.versioncontrol import (\n AuthInfo,\n RemoteNotFoundError,\n RevOptions,\n VersionControl,\n vcs,\n)\n\nlogger = logging.getLogger(__name__)\n\n\nclass Bazaar(VersionControl):\n name = \"bzr\"\n dirname = \".bzr\"\n repo_name = \"branch\"\n schemes = (\n \"bzr+http\",\n \"bzr+https\",\n \"bzr+ssh\",\n \"bzr+sftp\",\n \"bzr+ftp\",\n \"bzr+lp\",\n \"bzr+file\",\n )\n\n @staticmethod\n def get_base_rev_args(rev: str) -> List[str]:\n return [\"-r\", rev]\n\n def fetch_new(\n self, dest: str, url: HiddenText, rev_options: RevOptions, verbosity: int\n ) -> None:\n rev_display = rev_options.to_display()\n logger.info(\n \"Checking out %s%s to %s\",\n url,\n rev_display,\n display_path(dest),\n )\n if verbosity <= 0:\n flags = [\"--quiet\"]\n elif verbosity == 1:\n flags = []\n else:\n flags = [f\"-{'v'*verbosity}\"]\n cmd_args = make_command(\n \"checkout\", \"--lightweight\", *flags, rev_options.to_args(), url, dest\n )\n self.run_command(cmd_args)\n\n def switch(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n self.run_command(make_command(\"switch\", url), cwd=dest)\n\n def update(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n output = self.run_command(\n make_command(\"info\"), show_stdout=False, stdout_only=True, cwd=dest\n )\n if output.startswith(\"Standalone \"):\n # Older versions of pip used to create standalone branches.\n # Convert the standalone branch to a checkout by calling \"bzr bind\".\n cmd_args = make_command(\"bind\", \"-q\", url)\n self.run_command(cmd_args, cwd=dest)\n\n cmd_args = make_command(\"update\", \"-q\", rev_options.to_args())\n self.run_command(cmd_args, cwd=dest)\n\n @classmethod\n def get_url_rev_and_auth(cls, url: str) -> Tuple[str, Optional[str], AuthInfo]:\n # hotfix the URL scheme after removing bzr+ from bzr+ssh:// re-add it\n url, rev, user_pass = super().get_url_rev_and_auth(url)\n if url.startswith(\"ssh://\"):\n url = \"bzr+\" + url\n return url, rev, user_pass\n\n @classmethod\n def get_remote_url(cls, location: str) -> str:\n urls = cls.run_command(\n [\"info\"], show_stdout=False, stdout_only=True, cwd=location\n )\n for line in urls.splitlines():\n line = line.strip()\n for x in (\"checkout of branch: \", \"parent branch: \"):\n if line.startswith(x):\n repo = line.split(x)[1]\n if cls._is_local_repository(repo):\n return path_to_url(repo)\n return repo\n raise RemoteNotFoundError\n\n @classmethod\n def get_revision(cls, location: str) -> str:\n revision = cls.run_command(\n [\"revno\"],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n )\n return revision.splitlines()[-1]\n\n @classmethod\n def is_commit_id_equal(cls, dest: str, name: Optional[str]) -> bool:\n \"\"\"Always assume the versions don't match\"\"\"\n return False\n\n\nvcs.register(Bazaar)\n",[],[100,509,516,523,475,544,1822,1837],{"_104":1845,"_96":1846,"_158":1847,"_160":1823,"_161":139,"_162":1848,"_164":165,"_106":1849,"_101":29,"_167":215,"_169":1850,"_170":25,"_171":-5,"_172":1851,"_99":1852},"0669ea72-67fc-11f0-b5ac-0224a6c84d84","git.py","0669eb30-67fc-11f0-b5ac-0224a6c84d84",224,["D",1753299258541],"import logging\nimport os.path\nimport pathlib\nimport re\nimport urllib.parse\nimport urllib.request\nfrom dataclasses import replace\nfrom typing import Any, List, Optional, Tuple\n\nfrom pip._internal.exceptions import BadCommand, InstallationError\nfrom pip._internal.utils.misc import HiddenText, display_path, hide_url\nfrom pip._internal.utils.subprocess import make_command\nfrom pip._internal.vcs.versioncontrol import (\n AuthInfo,\n RemoteNotFoundError,\n RemoteNotValidError,\n RevOptions,\n VersionControl,\n find_path_to_project_root_from_repo_root,\n vcs,\n)\n\nurlsplit = urllib.parse.urlsplit\nurlunsplit = urllib.parse.urlunsplit\n\n\nlogger = logging.getLogger(__name__)\n\n\nGIT_VERSION_REGEX = re.compile(\n r\"^git version \" # Prefix.\n r\"(\\d+)\" # Major.\n r\"\\.(\\d+)\" # Dot, minor.\n r\"(?:\\.(\\d+))?\" # Optional dot, patch.\n r\".*$\" # Suffix, including any pre- and post-release segments we don't care about.\n)\n\nHASH_REGEX = re.compile(\"^[a-fA-F0-9]{40}$\")\n\n# SCP (Secure copy protocol) shorthand. e.g. 'git@example.com:foo/bar.git'\nSCP_REGEX = re.compile(\n r\"\"\"^\n # Optional user, e.g. 'git@'\n (\\w+@)?\n # Server, e.g. 'github.com'.\n ([^/:]+):\n # The server-side path. e.g. 'user/project.git'. Must start with an\n # alphanumeric character so as not to be confusable with a Windows paths\n # like 'C:/foo/bar' or 'C:\\foo\\bar'.\n (\\w[^:]*)\n $\"\"\",\n re.VERBOSE,\n)\n\n\ndef looks_like_hash(sha: str) -> bool:\n return bool(HASH_REGEX.match(sha))\n\n\nclass Git(VersionControl):\n name = \"git\"\n dirname = \".git\"\n repo_name = \"clone\"\n schemes = (\n \"git+http\",\n \"git+https\",\n \"git+ssh\",\n \"git+git\",\n \"git+file\",\n )\n # Prevent the user's environment variables from interfering with pip:\n # https://github.com/pypa/pip/issues/1130\n unset_environ = (\"GIT_DIR\", \"GIT_WORK_TREE\")\n default_arg_rev = \"HEAD\"\n\n @staticmethod\n def get_base_rev_args(rev: str) -> List[str]:\n return [rev]\n\n @classmethod\n def run_command(cls, *args: Any, **kwargs: Any) -> str:\n if os.environ.get(\"PIP_NO_INPUT\"):\n extra_environ = kwargs.get(\"extra_environ\", {})\n extra_environ[\"GIT_TERMINAL_PROMPT\"] = \"0\"\n extra_environ[\"GIT_SSH_COMMAND\"] = \"ssh -oBatchMode=yes\"\n kwargs[\"extra_environ\"] = extra_environ\n return super().run_command(*args, **kwargs)\n\n def is_immutable_rev_checkout(self, url: str, dest: str) -> bool:\n _, rev_options = self.get_url_rev_options(hide_url(url))\n if not rev_options.rev:\n return False\n if not self.is_commit_id_equal(dest, rev_options.rev):\n # the current commit is different from rev,\n # which means rev was something else than a commit hash\n return False\n # return False in the rare case rev is both a commit hash\n # and a tag or a branch; we don't want to cache in that case\n # because that branch/tag could point to something else in the future\n is_tag_or_branch = bool(self.get_revision_sha(dest, rev_options.rev)[0])\n return not is_tag_or_branch\n\n def get_git_version(self) -> Tuple[int, ...]:\n version = self.run_command(\n [\"version\"],\n command_desc=\"git version\",\n show_stdout=False,\n stdout_only=True,\n )\n match = GIT_VERSION_REGEX.match(version)\n if not match:\n logger.warning(\"Can't parse git version: %s\", version)\n return ()\n return (int(match.group(1)), int(match.group(2)))\n\n @classmethod\n def get_current_branch(cls, location: str) -> Optional[str]:\n \"\"\"\n Return the current branch, or None if HEAD isn't at a branch\n (e.g. detached HEAD).\n \"\"\"\n # git-symbolic-ref exits with empty stdout if \"HEAD\" is a detached\n # HEAD rather than a symbolic ref. In addition, the -q causes the\n # command to exit with status code 1 instead of 128 in this case\n # and to suppress the message to stderr.\n args = [\"symbolic-ref\", \"-q\", \"HEAD\"]\n output = cls.run_command(\n args,\n extra_ok_returncodes=(1,),\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n )\n ref = output.strip()\n\n if ref.startswith(\"refs/heads/\"):\n return ref[len(\"refs/heads/\") :]\n\n return None\n\n @classmethod\n def get_revision_sha(cls, dest: str, rev: str) -> Tuple[Optional[str], bool]:\n \"\"\"\n Return (sha_or_none, is_branch), where sha_or_none is a commit hash\n if the revision names a remote branch or tag, otherwise None.\n\n Args:\n dest: the repository directory.\n rev: the revision name.\n \"\"\"\n # Pass rev to pre-filter the list.\n output = cls.run_command(\n [\"show-ref\", rev],\n cwd=dest,\n show_stdout=False,\n stdout_only=True,\n on_returncode=\"ignore\",\n )\n refs = {}\n # NOTE: We do not use splitlines here since that would split on other\n # unicode separators, which can be maliciously used to install a\n # different revision.\n for line in output.strip().split(\"\\n\"):\n line = line.rstrip(\"\\r\")\n if not line:\n continue\n try:\n ref_sha, ref_name = line.split(\" \", maxsplit=2)\n except ValueError:\n # Include the offending line to simplify troubleshooting if\n # this error ever occurs.\n raise ValueError(f\"unexpected show-ref line: {line!r}\")\n\n refs[ref_name] = ref_sha\n\n branch_ref = f\"refs/remotes/origin/{rev}\"\n tag_ref = f\"refs/tags/{rev}\"\n\n sha = refs.get(branch_ref)\n if sha is not None:\n return (sha, True)\n\n sha = refs.get(tag_ref)\n\n return (sha, False)\n\n @classmethod\n def _should_fetch(cls, dest: str, rev: str) -> bool:\n \"\"\"\n Return true if rev is a ref or is a commit that we don't have locally.\n\n Branches and tags are not considered in this method because they are\n assumed to be always available locally (which is a normal outcome of\n ``git clone`` and ``git fetch --tags``).\n \"\"\"\n if rev.startswith(\"refs/\"):\n # Always fetch remote refs.\n return True\n\n if not looks_like_hash(rev):\n # Git fetch would fail with abbreviated commits.\n return False\n\n if cls.has_commit(dest, rev):\n # Don't fetch if we have the commit locally.\n return False\n\n return True\n\n @classmethod\n def resolve_revision(\n cls, dest: str, url: HiddenText, rev_options: RevOptions\n ) -> RevOptions:\n \"\"\"\n Resolve a revision to a new RevOptions object with the SHA1 of the\n branch, tag, or ref if found.\n\n Args:\n rev_options: a RevOptions object.\n \"\"\"\n rev = rev_options.arg_rev\n # The arg_rev property's implementation for Git ensures that the\n # rev return value is always non-None.\n assert rev is not None\n\n sha, is_branch = cls.get_revision_sha(dest, rev)\n\n if sha is not None:\n rev_options = rev_options.make_new(sha)\n rev_options = replace(rev_options, branch_name=(rev if is_branch else None))\n\n return rev_options\n\n # Do not show a warning for the common case of something that has\n # the form of a Git commit hash.\n if not looks_like_hash(rev):\n logger.warning(\n \"Did not find branch or tag '%s', assuming revision or ref.\",\n rev,\n )\n\n if not cls._should_fetch(dest, rev):\n return rev_options\n\n # fetch the requested revision\n cls.run_command(\n make_command(\"fetch\", \"-q\", url, rev_options.to_args()),\n cwd=dest,\n )\n # Change the revision to the SHA of the ref we fetched\n sha = cls.get_revision(dest, rev=\"FETCH_HEAD\")\n rev_options = rev_options.make_new(sha)\n\n return rev_options\n\n @classmethod\n def is_commit_id_equal(cls, dest: str, name: Optional[str]) -> bool:\n \"\"\"\n Return whether the current commit hash equals the given name.\n\n Args:\n dest: the repository directory.\n name: a string name.\n \"\"\"\n if not name:\n # Then avoid an unnecessary subprocess call.\n return False\n\n return cls.get_revision(dest) == name\n\n def fetch_new(\n self, dest: str, url: HiddenText, rev_options: RevOptions, verbosity: int\n ) -> None:\n rev_display = rev_options.to_display()\n logger.info(\"Cloning %s%s to %s\", url, rev_display, display_path(dest))\n if verbosity <= 0:\n flags: Tuple[str, ...] = (\"--quiet\",)\n elif verbosity == 1:\n flags = ()\n else:\n flags = (\"--verbose\", \"--progress\")\n if self.get_git_version() >= (2, 17):\n # Git added support for partial clone in 2.17\n # https://git-scm.com/docs/partial-clone\n # Speeds up cloning by functioning without a complete copy of repository\n self.run_command(\n make_command(\n \"clone\",\n \"--filter=blob:none\",\n *flags,\n url,\n dest,\n )\n )\n else:\n self.run_command(make_command(\"clone\", *flags, url, dest))\n\n if rev_options.rev:\n # Then a specific revision was requested.\n rev_options = self.resolve_revision(dest, url, rev_options)\n branch_name = getattr(rev_options, \"branch_name\", None)\n logger.debug(\"Rev options %s, branch_name %s\", rev_options, branch_name)\n if branch_name is None:\n # Only do a checkout if the current commit id doesn't match\n # the requested revision.\n if not self.is_commit_id_equal(dest, rev_options.rev):\n cmd_args = make_command(\n \"checkout\",\n \"-q\",\n rev_options.to_args(),\n )\n self.run_command(cmd_args, cwd=dest)\n elif self.get_current_branch(dest) != branch_name:\n # Then a specific branch was requested, and that branch\n # is not yet checked out.\n track_branch = f\"origin/{branch_name}\"\n cmd_args = [\n \"checkout\",\n \"-b\",\n branch_name,\n \"--track\",\n track_branch,\n ]\n self.run_command(cmd_args, cwd=dest)\n else:\n sha = self.get_revision(dest)\n rev_options = rev_options.make_new(sha)\n\n logger.info(\"Resolved %s to commit %s\", url, rev_options.rev)\n\n #: repo may contain submodules\n self.update_submodules(dest)\n\n def switch(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n self.run_command(\n make_command(\"config\", \"remote.origin.url\", url),\n cwd=dest,\n )\n cmd_args = make_command(\"checkout\", \"-q\", rev_options.to_args())\n self.run_command(cmd_args, cwd=dest)\n\n self.update_submodules(dest)\n\n def update(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n # First fetch changes from the default remote\n if self.get_git_version() >= (1, 9):\n # fetch tags in addition to everything else\n self.run_command([\"fetch\", \"-q\", \"--tags\"], cwd=dest)\n else:\n self.run_command([\"fetch\", \"-q\"], cwd=dest)\n # Then reset to wanted revision (maybe even origin/master)\n rev_options = self.resolve_revision(dest, url, rev_options)\n cmd_args = make_command(\"reset\", \"--hard\", \"-q\", rev_options.to_args())\n self.run_command(cmd_args, cwd=dest)\n #: update submodules\n self.update_submodules(dest)\n\n @classmethod\n def get_remote_url(cls, location: str) -> str:\n \"\"\"\n Return URL of the first remote encountered.\n\n Raises RemoteNotFoundError if the repository does not have a remote\n url configured.\n \"\"\"\n # We need to pass 1 for extra_ok_returncodes since the command\n # exits with return code 1 if there are no matching lines.\n stdout = cls.run_command(\n [\"config\", \"--get-regexp\", r\"remote\\..*\\.url\"],\n extra_ok_returncodes=(1,),\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n )\n remotes = stdout.splitlines()\n try:\n found_remote = remotes[0]\n except IndexError:\n raise RemoteNotFoundError\n\n for remote in remotes:\n if remote.startswith(\"remote.origin.url \"):\n found_remote = remote\n break\n url = found_remote.split(\" \")[1]\n return cls._git_remote_to_pip_url(url.strip())\n\n @staticmethod\n def _git_remote_to_pip_url(url: str) -> str:\n \"\"\"\n Convert a remote url from what git uses to what pip accepts.\n\n There are 3 legal forms **url** may take:\n\n 1. A fully qualified url: ssh://git@example.com/foo/bar.git\n 2. A local project.git folder: /path/to/bare/repository.git\n 3. SCP shorthand for form 1: git@example.com:foo/bar.git\n\n Form 1 is output as-is. Form 2 must be converted to URI and form 3 must\n be converted to form 1.\n\n See the corresponding test test_git_remote_url_to_pip() for examples of\n sample inputs/outputs.\n \"\"\"\n if re.match(r\"\\w+://\", url):\n # This is already valid. Pass it though as-is.\n return url\n if os.path.exists(url):\n # A local bare remote (git clone --mirror).\n # Needs a file:// prefix.\n return pathlib.PurePath(url).as_uri()\n scp_match = SCP_REGEX.match(url)\n if scp_match:\n # Add an ssh:// prefix and replace the ':' with a '/'.\n return scp_match.expand(r\"ssh://\\1\\2/\\3\")\n # Otherwise, bail out.\n raise RemoteNotValidError(url)\n\n @classmethod\n def has_commit(cls, location: str, rev: str) -> bool:\n \"\"\"\n Check if rev is a commit that is available in the local repository.\n \"\"\"\n try:\n cls.run_command(\n [\"rev-parse\", \"-q\", \"--verify\", \"sha^\" + rev],\n cwd=location,\n log_failed_cmd=False,\n )\n except InstallationError:\n return False\n else:\n return True\n\n @classmethod\n def get_revision(cls, location: str, rev: Optional[str] = None) -> str:\n if rev is None:\n rev = \"HEAD\"\n current_rev = cls.run_command(\n [\"rev-parse\", rev],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n )\n return current_rev.strip()\n\n @classmethod\n def get_subdirectory(cls, location: str) -> Optional[str]:\n \"\"\"\n Return the path to Python project root, relative to the repo root.\n Return None if the project root is in the repo root.\n \"\"\"\n # find the repo root\n git_dir = cls.run_command(\n [\"rev-parse\", \"--git-dir\"],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n ).strip()\n if not os.path.isabs(git_dir):\n git_dir = os.path.join(location, git_dir)\n repo_root = os.path.abspath(os.path.join(git_dir, \"..\"))\n return find_path_to_project_root_from_repo_root(location, repo_root)\n\n @classmethod\n def get_url_rev_and_auth(cls, url: str) -> Tuple[str, Optional[str], AuthInfo]:\n \"\"\"\n Prefixes stub URLs like 'user@hostname:user/repo.git' with 'ssh://'.\n That's required because although they use SSH they sometimes don't\n work with a ssh:// scheme (e.g. GitHub). But we need a scheme for\n parsing. Hence we remove it again afterwards and return it as a stub.\n \"\"\"\n # Works around an apparent Git bug\n # (see https://article.gmane.org/gmane.comp.version-control.git/146500)\n scheme, netloc, path, query, fragment = urlsplit(url)\n if scheme.endswith(\"file\"):\n initial_slashes = path[: -len(path.lstrip(\"/\"))]\n newpath = initial_slashes + urllib.request.url2pathname(path).replace(\n \"\\\\\", \"/\"\n ).lstrip(\"/\")\n after_plus = scheme.find(\"+\") + 1\n url = scheme[:after_plus] + urlunsplit(\n (scheme[after_plus:], netloc, newpath, query, fragment),\n )\n\n if \"://\" not in url:\n assert \"file:\" not in url\n url = url.replace(\"git+\", \"git+ssh://\")\n url, rev, user_pass = super().get_url_rev_and_auth(url)\n url = url.replace(\"ssh://\", \"\")\n else:\n url, rev, user_pass = super().get_url_rev_and_auth(url)\n\n return url, rev, user_pass\n\n @classmethod\n def update_submodules(cls, location: str) -> None:\n if not os.path.exists(os.path.join(location, \".gitmodules\")):\n return\n cls.run_command(\n [\"submodule\", \"update\", \"--init\", \"--recursive\", \"-q\"],\n cwd=location,\n )\n\n @classmethod\n def get_repository_root(cls, location: str) -> Optional[str]:\n loc = super().get_repository_root(location)\n if loc:\n return loc\n try:\n r = cls.run_command(\n [\"rev-parse\", \"--show-toplevel\"],\n cwd=location,\n show_stdout=False,\n stdout_only=True,\n on_returncode=\"raise\",\n log_failed_cmd=False,\n )\n except BadCommand:\n logger.debug(\n \"could not determine if %s is under git control \"\n \"because git is not available\",\n location,\n )\n return None\n except InstallationError:\n return None\n return os.path.normpath(r.rstrip(\"\\r\\n\"))\n\n @staticmethod\n def should_add_vcs_url_prefix(repo_url: str) -> bool:\n \"\"\"In either https or ssh form, requirements must be prefixed with git+.\"\"\"\n return True\n\n\nvcs.register(Git)\n",[],[100,509,516,523,475,544,1822,1846],{"_104":1854,"_96":1855,"_158":1856,"_160":1823,"_161":139,"_162":1857,"_164":165,"_106":1858,"_101":29,"_167":215,"_169":1859,"_170":25,"_171":-5,"_172":1860,"_99":1861},"0679e2b0-67fc-11f0-a319-0224a6c84d84","mercurial.py","0679e35a-67fc-11f0-a319-0224a6c84d84",226,["D",1753299258609],"import configparser\nimport logging\nimport os\nfrom typing import List, Optional, Tuple\n\nfrom pip._internal.exceptions import BadCommand, InstallationError\nfrom pip._internal.utils.misc import HiddenText, display_path\nfrom pip._internal.utils.subprocess import make_command\nfrom pip._internal.utils.urls import path_to_url\nfrom pip._internal.vcs.versioncontrol import (\n RevOptions,\n VersionControl,\n find_path_to_project_root_from_repo_root,\n vcs,\n)\n\nlogger = logging.getLogger(__name__)\n\n\nclass Mercurial(VersionControl):\n name = \"hg\"\n dirname = \".hg\"\n repo_name = \"clone\"\n schemes = (\n \"hg+file\",\n \"hg+http\",\n \"hg+https\",\n \"hg+ssh\",\n \"hg+static-http\",\n )\n\n @staticmethod\n def get_base_rev_args(rev: str) -> List[str]:\n return [f\"--rev={rev}\"]\n\n def fetch_new(\n self, dest: str, url: HiddenText, rev_options: RevOptions, verbosity: int\n ) -> None:\n rev_display = rev_options.to_display()\n logger.info(\n \"Cloning hg %s%s to %s\",\n url,\n rev_display,\n display_path(dest),\n )\n if verbosity <= 0:\n flags: Tuple[str, ...] = (\"--quiet\",)\n elif verbosity == 1:\n flags = ()\n elif verbosity == 2:\n flags = (\"--verbose\",)\n else:\n flags = (\"--verbose\", \"--debug\")\n self.run_command(make_command(\"clone\", \"--noupdate\", *flags, url, dest))\n self.run_command(\n make_command(\"update\", *flags, rev_options.to_args()),\n cwd=dest,\n )\n\n def switch(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n repo_config = os.path.join(dest, self.dirname, \"hgrc\")\n config = configparser.RawConfigParser()\n try:\n config.read(repo_config)\n config.set(\"paths\", \"default\", url.secret)\n with open(repo_config, \"w\") as config_file:\n config.write(config_file)\n except (OSError, configparser.NoSectionError) as exc:\n logger.warning(\"Could not switch Mercurial repository to %s: %s\", url, exc)\n else:\n cmd_args = make_command(\"update\", \"-q\", rev_options.to_args())\n self.run_command(cmd_args, cwd=dest)\n\n def update(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n self.run_command([\"pull\", \"-q\"], cwd=dest)\n cmd_args = make_command(\"update\", \"-q\", rev_options.to_args())\n self.run_command(cmd_args, cwd=dest)\n\n @classmethod\n def get_remote_url(cls, location: str) -> str:\n url = cls.run_command(\n [\"showconfig\", \"paths.default\"],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n ).strip()\n if cls._is_local_repository(url):\n url = path_to_url(url)\n return url.strip()\n\n @classmethod\n def get_revision(cls, location: str) -> str:\n \"\"\"\n Return the repository-local changeset revision number, as an integer.\n \"\"\"\n current_revision = cls.run_command(\n [\"parents\", \"--template={rev}\"],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n ).strip()\n return current_revision\n\n @classmethod\n def get_requirement_revision(cls, location: str) -> str:\n \"\"\"\n Return the changeset identification hash, as a 40-character\n hexadecimal string\n \"\"\"\n current_rev_hash = cls.run_command(\n [\"parents\", \"--template={node}\"],\n show_stdout=False,\n stdout_only=True,\n cwd=location,\n ).strip()\n return current_rev_hash\n\n @classmethod\n def is_commit_id_equal(cls, dest: str, name: Optional[str]) -> bool:\n \"\"\"Always assume the versions don't match\"\"\"\n return False\n\n @classmethod\n def get_subdirectory(cls, location: str) -> Optional[str]:\n \"\"\"\n Return the path to Python project root, relative to the repo root.\n Return None if the project root is in the repo root.\n \"\"\"\n # find the repo root\n repo_root = cls.run_command(\n [\"root\"], show_stdout=False, stdout_only=True, cwd=location\n ).strip()\n if not os.path.isabs(repo_root):\n repo_root = os.path.abspath(os.path.join(location, repo_root))\n return find_path_to_project_root_from_repo_root(location, repo_root)\n\n @classmethod\n def get_repository_root(cls, location: str) -> Optional[str]:\n loc = super().get_repository_root(location)\n if loc:\n return loc\n try:\n r = cls.run_command(\n [\"root\"],\n cwd=location,\n show_stdout=False,\n stdout_only=True,\n on_returncode=\"raise\",\n log_failed_cmd=False,\n )\n except BadCommand:\n logger.debug(\n \"could not determine if %s is under hg control \"\n \"because hg is not available\",\n location,\n )\n return None\n except InstallationError:\n return None\n return os.path.normpath(r.rstrip(\"\\r\\n\"))\n\n\nvcs.register(Mercurial)\n",[],[100,509,516,523,475,544,1822,1855],{"_104":1863,"_96":1864,"_158":1865,"_160":1823,"_161":139,"_162":1866,"_164":165,"_106":1867,"_101":29,"_167":215,"_169":1868,"_170":25,"_171":-5,"_172":1869,"_99":1870},"06828ac8-67fc-11f0-9ad5-0224a6c84d84","subversion.py","06828b7c-67fc-11f0-9ad5-0224a6c84d84",228,["D",1753299258704],"import logging\nimport os\nimport re\nfrom typing import List, Optional, Tuple\n\nfrom pip._internal.utils.misc import (\n HiddenText,\n display_path,\n is_console_interactive,\n is_installable_dir,\n split_auth_from_netloc,\n)\nfrom pip._internal.utils.subprocess import CommandArgs, make_command\nfrom pip._internal.vcs.versioncontrol import (\n AuthInfo,\n RemoteNotFoundError,\n RevOptions,\n VersionControl,\n vcs,\n)\n\nlogger = logging.getLogger(__name__)\n\n_svn_xml_url_re = re.compile('url=\"([^\"]+)\"')\n_svn_rev_re = re.compile(r'committed-rev=\"(\\d+)\"')\n_svn_info_xml_rev_re = re.compile(r'\\s*revision=\"(\\d+)\"')\n_svn_info_xml_url_re = re.compile(r\"(.*)\")\n\n\nclass Subversion(VersionControl):\n name = \"svn\"\n dirname = \".svn\"\n repo_name = \"checkout\"\n schemes = (\"svn+ssh\", \"svn+http\", \"svn+https\", \"svn+svn\", \"svn+file\")\n\n @classmethod\n def should_add_vcs_url_prefix(cls, remote_url: str) -> bool:\n return True\n\n @staticmethod\n def get_base_rev_args(rev: str) -> List[str]:\n return [\"-r\", rev]\n\n @classmethod\n def get_revision(cls, location: str) -> str:\n \"\"\"\n Return the maximum revision for all files under a given location\n \"\"\"\n # Note: taken from setuptools.command.egg_info\n revision = 0\n\n for base, dirs, _ in os.walk(location):\n if cls.dirname not in dirs:\n dirs[:] = []\n continue # no sense walking uncontrolled subdirs\n dirs.remove(cls.dirname)\n entries_fn = os.path.join(base, cls.dirname, \"entries\")\n if not os.path.exists(entries_fn):\n # FIXME: should we warn?\n continue\n\n dirurl, localrev = cls._get_svn_url_rev(base)\n\n if base == location:\n assert dirurl is not None\n base = dirurl + \"/\" # save the root url\n elif not dirurl or not dirurl.startswith(base):\n dirs[:] = []\n continue # not part of the same svn tree, skip it\n revision = max(revision, localrev)\n return str(revision)\n\n @classmethod\n def get_netloc_and_auth(\n cls, netloc: str, scheme: str\n ) -> Tuple[str, Tuple[Optional[str], Optional[str]]]:\n \"\"\"\n This override allows the auth information to be passed to svn via the\n --username and --password options instead of via the URL.\n \"\"\"\n if scheme == \"ssh\":\n # The --username and --password options can't be used for\n # svn+ssh URLs, so keep the auth information in the URL.\n return super().get_netloc_and_auth(netloc, scheme)\n\n return split_auth_from_netloc(netloc)\n\n @classmethod\n def get_url_rev_and_auth(cls, url: str) -> Tuple[str, Optional[str], AuthInfo]:\n # hotfix the URL scheme after removing svn+ from svn+ssh:// re-add it\n url, rev, user_pass = super().get_url_rev_and_auth(url)\n if url.startswith(\"ssh://\"):\n url = \"svn+\" + url\n return url, rev, user_pass\n\n @staticmethod\n def make_rev_args(\n username: Optional[str], password: Optional[HiddenText]\n ) -> CommandArgs:\n extra_args: CommandArgs = []\n if username:\n extra_args += [\"--username\", username]\n if password:\n extra_args += [\"--password\", password]\n\n return extra_args\n\n @classmethod\n def get_remote_url(cls, location: str) -> str:\n # In cases where the source is in a subdirectory, we have to look up in\n # the location until we find a valid project root.\n orig_location = location\n while not is_installable_dir(location):\n last_location = location\n location = os.path.dirname(location)\n if location == last_location:\n # We've traversed up to the root of the filesystem without\n # finding a Python project.\n logger.warning(\n \"Could not find Python project for directory %s (tried all \"\n \"parent directories)\",\n orig_location,\n )\n raise RemoteNotFoundError\n\n url, _rev = cls._get_svn_url_rev(location)\n if url is None:\n raise RemoteNotFoundError\n\n return url\n\n @classmethod\n def _get_svn_url_rev(cls, location: str) -> Tuple[Optional[str], int]:\n from pip._internal.exceptions import InstallationError\n\n entries_path = os.path.join(location, cls.dirname, \"entries\")\n if os.path.exists(entries_path):\n with open(entries_path) as f:\n data = f.read()\n else: # subversion >= 1.7 does not have the 'entries' file\n data = \"\"\n\n url = None\n if data.startswith(\"8\") or data.startswith(\"9\") or data.startswith(\"10\"):\n entries = list(map(str.splitlines, data.split(\"\\n\\x0c\\n\")))\n del entries[0][0] # get rid of the '8'\n url = entries[0][3]\n revs = [int(d[9]) for d in entries if len(d) > 9 and d[9]] + [0]\n elif data.startswith(\"= 1.7\n # Note that using get_remote_call_options is not necessary here\n # because `svn info` is being run against a local directory.\n # We don't need to worry about making sure interactive mode\n # is being used to prompt for passwords, because passwords\n # are only potentially needed for remote server requests.\n xml = cls.run_command(\n [\"info\", \"--xml\", location],\n show_stdout=False,\n stdout_only=True,\n )\n match = _svn_info_xml_url_re.search(xml)\n assert match is not None\n url = match.group(1)\n revs = [int(m.group(1)) for m in _svn_info_xml_rev_re.finditer(xml)]\n except InstallationError:\n url, revs = None, []\n\n if revs:\n rev = max(revs)\n else:\n rev = 0\n\n return url, rev\n\n @classmethod\n def is_commit_id_equal(cls, dest: str, name: Optional[str]) -> bool:\n \"\"\"Always assume the versions don't match\"\"\"\n return False\n\n def __init__(self, use_interactive: Optional[bool] = None) -> None:\n if use_interactive is None:\n use_interactive = is_console_interactive()\n self.use_interactive = use_interactive\n\n # This member is used to cache the fetched version of the current\n # ``svn`` client.\n # Special value definitions:\n # None: Not evaluated yet.\n # Empty tuple: Could not parse version.\n self._vcs_version: Optional[Tuple[int, ...]] = None\n\n super().__init__()\n\n def call_vcs_version(self) -> Tuple[int, ...]:\n \"\"\"Query the version of the currently installed Subversion client.\n\n :return: A tuple containing the parts of the version information or\n ``()`` if the version returned from ``svn`` could not be parsed.\n :raises: BadCommand: If ``svn`` is not installed.\n \"\"\"\n # Example versions:\n # svn, version 1.10.3 (r1842928)\n # compiled Feb 25 2019, 14:20:39 on x86_64-apple-darwin17.0.0\n # svn, version 1.7.14 (r1542130)\n # compiled Mar 28 2018, 08:49:13 on x86_64-pc-linux-gnu\n # svn, version 1.12.0-SlikSvn (SlikSvn/1.12.0)\n # compiled May 28 2019, 13:44:56 on x86_64-microsoft-windows6.2\n version_prefix = \"svn, version \"\n version = self.run_command([\"--version\"], show_stdout=False, stdout_only=True)\n if not version.startswith(version_prefix):\n return ()\n\n version = version[len(version_prefix) :].split()[0]\n version_list = version.partition(\"-\")[0].split(\".\")\n try:\n parsed_version = tuple(map(int, version_list))\n except ValueError:\n return ()\n\n return parsed_version\n\n def get_vcs_version(self) -> Tuple[int, ...]:\n \"\"\"Return the version of the currently installed Subversion client.\n\n If the version of the Subversion client has already been queried,\n a cached value will be used.\n\n :return: A tuple containing the parts of the version information or\n ``()`` if the version returned from ``svn`` could not be parsed.\n :raises: BadCommand: If ``svn`` is not installed.\n \"\"\"\n if self._vcs_version is not None:\n # Use cached version, if available.\n # If parsing the version failed previously (empty tuple),\n # do not attempt to parse it again.\n return self._vcs_version\n\n vcs_version = self.call_vcs_version()\n self._vcs_version = vcs_version\n return vcs_version\n\n def get_remote_call_options(self) -> CommandArgs:\n \"\"\"Return options to be used on calls to Subversion that contact the server.\n\n These options are applicable for the following ``svn`` subcommands used\n in this class.\n\n - checkout\n - switch\n - update\n\n :return: A list of command line arguments to pass to ``svn``.\n \"\"\"\n if not self.use_interactive:\n # --non-interactive switch is available since Subversion 0.14.4.\n # Subversion < 1.8 runs in interactive mode by default.\n return [\"--non-interactive\"]\n\n svn_version = self.get_vcs_version()\n # By default, Subversion >= 1.8 runs in non-interactive mode if\n # stdin is not a TTY. Since that is how pip invokes SVN, in\n # call_subprocess(), pip must pass --force-interactive to ensure\n # the user can be prompted for a password, if required.\n # SVN added the --force-interactive option in SVN 1.8. Since\n # e.g. RHEL/CentOS 7, which is supported until 2024, ships with\n # SVN 1.7, pip should continue to support SVN 1.7. Therefore, pip\n # can't safely add the option if the SVN version is < 1.8 (or unknown).\n if svn_version >= (1, 8):\n return [\"--force-interactive\"]\n\n return []\n\n def fetch_new(\n self, dest: str, url: HiddenText, rev_options: RevOptions, verbosity: int\n ) -> None:\n rev_display = rev_options.to_display()\n logger.info(\n \"Checking out %s%s to %s\",\n url,\n rev_display,\n display_path(dest),\n )\n if verbosity <= 0:\n flags = [\"--quiet\"]\n else:\n flags = []\n cmd_args = make_command(\n \"checkout\",\n *flags,\n self.get_remote_call_options(),\n rev_options.to_args(),\n url,\n dest,\n )\n self.run_command(cmd_args)\n\n def switch(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n cmd_args = make_command(\n \"switch\",\n self.get_remote_call_options(),\n rev_options.to_args(),\n url,\n dest,\n )\n self.run_command(cmd_args)\n\n def update(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n cmd_args = make_command(\n \"update\",\n self.get_remote_call_options(),\n rev_options.to_args(),\n dest,\n )\n self.run_command(cmd_args)\n\n\nvcs.register(Subversion)\n",[],[100,509,516,523,475,544,1822,1864],{"_104":1872,"_96":1873,"_158":1874,"_160":1823,"_161":139,"_162":1875,"_164":165,"_106":1876,"_101":29,"_167":215,"_169":1877,"_170":25,"_171":-5,"_172":1878,"_99":1879},"067f0dda-67fc-11f0-aad3-0224a6c84d84","versioncontrol.py","067f0eb6-67fc-11f0-aad3-0224a6c84d84",227,["D",1753299258671],"\"\"\"Handles all VCS (version control) support\"\"\"\n\nimport logging\nimport os\nimport shutil\nimport sys\nimport urllib.parse\nfrom dataclasses import dataclass, field\nfrom typing import (\n Any,\n Dict,\n Iterable,\n Iterator,\n List,\n Literal,\n Mapping,\n Optional,\n Tuple,\n Type,\n Union,\n)\n\nfrom pip._internal.cli.spinners import SpinnerInterface\nfrom pip._internal.exceptions import BadCommand, InstallationError\nfrom pip._internal.utils.misc import (\n HiddenText,\n ask_path_exists,\n backup_dir,\n display_path,\n hide_url,\n hide_value,\n is_installable_dir,\n rmtree,\n)\nfrom pip._internal.utils.subprocess import (\n CommandArgs,\n call_subprocess,\n format_command_args,\n make_command,\n)\n\n__all__ = [\"vcs\"]\n\n\nlogger = logging.getLogger(__name__)\n\nAuthInfo = Tuple[Optional[str], Optional[str]]\n\n\ndef is_url(name: str) -> bool:\n \"\"\"\n Return true if the name looks like a URL.\n \"\"\"\n scheme = urllib.parse.urlsplit(name).scheme\n if not scheme:\n return False\n return scheme in [\"http\", \"https\", \"file\", \"ftp\"] + vcs.all_schemes\n\n\ndef make_vcs_requirement_url(\n repo_url: str, rev: str, project_name: str, subdir: Optional[str] = None\n) -> str:\n \"\"\"\n Return the URL for a VCS requirement.\n\n Args:\n repo_url: the remote VCS url, with any needed VCS prefix (e.g. \"git+\").\n project_name: the (unescaped) project name.\n \"\"\"\n egg_project_name = project_name.replace(\"-\", \"_\")\n req = f\"{repo_url}@{rev}#egg={egg_project_name}\"\n if subdir:\n req += f\"&subdirectory={subdir}\"\n\n return req\n\n\ndef find_path_to_project_root_from_repo_root(\n location: str, repo_root: str\n) -> Optional[str]:\n \"\"\"\n Find the the Python project's root by searching up the filesystem from\n `location`. Return the path to project root relative to `repo_root`.\n Return None if the project root is `repo_root`, or cannot be found.\n \"\"\"\n # find project root.\n orig_location = location\n while not is_installable_dir(location):\n last_location = location\n location = os.path.dirname(location)\n if location == last_location:\n # We've traversed up to the root of the filesystem without\n # finding a Python project.\n logger.warning(\n \"Could not find a Python project for directory %s (tried all \"\n \"parent directories)\",\n orig_location,\n )\n return None\n\n if os.path.samefile(repo_root, location):\n return None\n\n return os.path.relpath(location, repo_root)\n\n\nclass RemoteNotFoundError(Exception):\n pass\n\n\nclass RemoteNotValidError(Exception):\n def __init__(self, url: str):\n super().__init__(url)\n self.url = url\n\n\n@dataclass(frozen=True)\nclass RevOptions:\n \"\"\"\n Encapsulates a VCS-specific revision to install, along with any VCS\n install options.\n\n Args:\n vc_class: a VersionControl subclass.\n rev: the name of the revision to install.\n extra_args: a list of extra options.\n \"\"\"\n\n vc_class: Type[\"VersionControl\"]\n rev: Optional[str] = None\n extra_args: CommandArgs = field(default_factory=list)\n branch_name: Optional[str] = None\n\n def __repr__(self) -> str:\n return f\"\"\n\n @property\n def arg_rev(self) -> Optional[str]:\n if self.rev is None:\n return self.vc_class.default_arg_rev\n\n return self.rev\n\n def to_args(self) -> CommandArgs:\n \"\"\"\n Return the VCS-specific command arguments.\n \"\"\"\n args: CommandArgs = []\n rev = self.arg_rev\n if rev is not None:\n args += self.vc_class.get_base_rev_args(rev)\n args += self.extra_args\n\n return args\n\n def to_display(self) -> str:\n if not self.rev:\n return \"\"\n\n return f\" (to revision {self.rev})\"\n\n def make_new(self, rev: str) -> \"RevOptions\":\n \"\"\"\n Make a copy of the current instance, but with a new rev.\n\n Args:\n rev: the name of the revision for the new object.\n \"\"\"\n return self.vc_class.make_rev_options(rev, extra_args=self.extra_args)\n\n\nclass VcsSupport:\n _registry: Dict[str, \"VersionControl\"] = {}\n schemes = [\"ssh\", \"git\", \"hg\", \"bzr\", \"sftp\", \"svn\"]\n\n def __init__(self) -> None:\n # Register more schemes with urlparse for various version control\n # systems\n urllib.parse.uses_netloc.extend(self.schemes)\n super().__init__()\n\n def __iter__(self) -> Iterator[str]:\n return self._registry.__iter__()\n\n @property\n def backends(self) -> List[\"VersionControl\"]:\n return list(self._registry.values())\n\n @property\n def dirnames(self) -> List[str]:\n return [backend.dirname for backend in self.backends]\n\n @property\n def all_schemes(self) -> List[str]:\n schemes: List[str] = []\n for backend in self.backends:\n schemes.extend(backend.schemes)\n return schemes\n\n def register(self, cls: Type[\"VersionControl\"]) -> None:\n if not hasattr(cls, \"name\"):\n logger.warning(\"Cannot register VCS %s\", cls.__name__)\n return\n if cls.name not in self._registry:\n self._registry[cls.name] = cls()\n logger.debug(\"Registered VCS backend: %s\", cls.name)\n\n def unregister(self, name: str) -> None:\n if name in self._registry:\n del self._registry[name]\n\n def get_backend_for_dir(self, location: str) -> Optional[\"VersionControl\"]:\n \"\"\"\n Return a VersionControl object if a repository of that type is found\n at the given directory.\n \"\"\"\n vcs_backends = {}\n for vcs_backend in self._registry.values():\n repo_path = vcs_backend.get_repository_root(location)\n if not repo_path:\n continue\n logger.debug(\"Determine that %s uses VCS: %s\", location, vcs_backend.name)\n vcs_backends[repo_path] = vcs_backend\n\n if not vcs_backends:\n return None\n\n # Choose the VCS in the inner-most directory. Since all repository\n # roots found here would be either `location` or one of its\n # parents, the longest path should have the most path components,\n # i.e. the backend representing the inner-most repository.\n inner_most_repo_path = max(vcs_backends, key=len)\n return vcs_backends[inner_most_repo_path]\n\n def get_backend_for_scheme(self, scheme: str) -> Optional[\"VersionControl\"]:\n \"\"\"\n Return a VersionControl object or None.\n \"\"\"\n for vcs_backend in self._registry.values():\n if scheme in vcs_backend.schemes:\n return vcs_backend\n return None\n\n def get_backend(self, name: str) -> Optional[\"VersionControl\"]:\n \"\"\"\n Return a VersionControl object or None.\n \"\"\"\n name = name.lower()\n return self._registry.get(name)\n\n\nvcs = VcsSupport()\n\n\nclass VersionControl:\n name = \"\"\n dirname = \"\"\n repo_name = \"\"\n # List of supported schemes for this Version Control\n schemes: Tuple[str, ...] = ()\n # Iterable of environment variable names to pass to call_subprocess().\n unset_environ: Tuple[str, ...] = ()\n default_arg_rev: Optional[str] = None\n\n @classmethod\n def should_add_vcs_url_prefix(cls, remote_url: str) -> bool:\n \"\"\"\n Return whether the vcs prefix (e.g. \"git+\") should be added to a\n repository's remote url when used in a requirement.\n \"\"\"\n return not remote_url.lower().startswith(f\"{cls.name}:\")\n\n @classmethod\n def get_subdirectory(cls, location: str) -> Optional[str]:\n \"\"\"\n Return the path to Python project root, relative to the repo root.\n Return None if the project root is in the repo root.\n \"\"\"\n return None\n\n @classmethod\n def get_requirement_revision(cls, repo_dir: str) -> str:\n \"\"\"\n Return the revision string that should be used in a requirement.\n \"\"\"\n return cls.get_revision(repo_dir)\n\n @classmethod\n def get_src_requirement(cls, repo_dir: str, project_name: str) -> str:\n \"\"\"\n Return the requirement string to use to redownload the files\n currently at the given repository directory.\n\n Args:\n project_name: the (unescaped) project name.\n\n The return value has a form similar to the following:\n\n {repository_url}@{revision}#egg={project_name}\n \"\"\"\n repo_url = cls.get_remote_url(repo_dir)\n\n if cls.should_add_vcs_url_prefix(repo_url):\n repo_url = f\"{cls.name}+{repo_url}\"\n\n revision = cls.get_requirement_revision(repo_dir)\n subdir = cls.get_subdirectory(repo_dir)\n req = make_vcs_requirement_url(repo_url, revision, project_name, subdir=subdir)\n\n return req\n\n @staticmethod\n def get_base_rev_args(rev: str) -> List[str]:\n \"\"\"\n Return the base revision arguments for a vcs command.\n\n Args:\n rev: the name of a revision to install. Cannot be None.\n \"\"\"\n raise NotImplementedError\n\n def is_immutable_rev_checkout(self, url: str, dest: str) -> bool:\n \"\"\"\n Return true if the commit hash checked out at dest matches\n the revision in url.\n\n Always return False, if the VCS does not support immutable commit\n hashes.\n\n This method does not check if there are local uncommitted changes\n in dest after checkout, as pip currently has no use case for that.\n \"\"\"\n return False\n\n @classmethod\n def make_rev_options(\n cls, rev: Optional[str] = None, extra_args: Optional[CommandArgs] = None\n ) -> RevOptions:\n \"\"\"\n Return a RevOptions object.\n\n Args:\n rev: the name of a revision to install.\n extra_args: a list of extra options.\n \"\"\"\n return RevOptions(cls, rev, extra_args=extra_args or [])\n\n @classmethod\n def _is_local_repository(cls, repo: str) -> bool:\n \"\"\"\n posix absolute paths start with os.path.sep,\n win32 ones start with drive (like c:\\\\folder)\n \"\"\"\n drive, tail = os.path.splitdrive(repo)\n return repo.startswith(os.path.sep) or bool(drive)\n\n @classmethod\n def get_netloc_and_auth(\n cls, netloc: str, scheme: str\n ) -> Tuple[str, Tuple[Optional[str], Optional[str]]]:\n \"\"\"\n Parse the repository URL's netloc, and return the new netloc to use\n along with auth information.\n\n Args:\n netloc: the original repository URL netloc.\n scheme: the repository URL's scheme without the vcs prefix.\n\n This is mainly for the Subversion class to override, so that auth\n information can be provided via the --username and --password options\n instead of through the URL. For other subclasses like Git without\n such an option, auth information must stay in the URL.\n\n Returns: (netloc, (username, password)).\n \"\"\"\n return netloc, (None, None)\n\n @classmethod\n def get_url_rev_and_auth(cls, url: str) -> Tuple[str, Optional[str], AuthInfo]:\n \"\"\"\n Parse the repository URL to use, and return the URL, revision,\n and auth info to use.\n\n Returns: (url, rev, (username, password)).\n \"\"\"\n scheme, netloc, path, query, frag = urllib.parse.urlsplit(url)\n if \"+\" not in scheme:\n raise ValueError(\n f\"Sorry, {url!r} is a malformed VCS url. \"\n \"The format is +://, \"\n \"e.g. svn+http://myrepo/svn/MyApp#egg=MyApp\"\n )\n # Remove the vcs prefix.\n scheme = scheme.split(\"+\", 1)[1]\n netloc, user_pass = cls.get_netloc_and_auth(netloc, scheme)\n rev = None\n if \"@\" in path:\n path, rev = path.rsplit(\"@\", 1)\n if not rev:\n raise InstallationError(\n f\"The URL {url!r} has an empty revision (after @) \"\n \"which is not supported. Include a revision after @ \"\n \"or remove @ from the URL.\"\n )\n url = urllib.parse.urlunsplit((scheme, netloc, path, query, \"\"))\n return url, rev, user_pass\n\n @staticmethod\n def make_rev_args(\n username: Optional[str], password: Optional[HiddenText]\n ) -> CommandArgs:\n \"\"\"\n Return the RevOptions \"extra arguments\" to use in obtain().\n \"\"\"\n return []\n\n def get_url_rev_options(self, url: HiddenText) -> Tuple[HiddenText, RevOptions]:\n \"\"\"\n Return the URL and RevOptions object to use in obtain(),\n as a tuple (url, rev_options).\n \"\"\"\n secret_url, rev, user_pass = self.get_url_rev_and_auth(url.secret)\n username, secret_password = user_pass\n password: Optional[HiddenText] = None\n if secret_password is not None:\n password = hide_value(secret_password)\n extra_args = self.make_rev_args(username, password)\n rev_options = self.make_rev_options(rev, extra_args=extra_args)\n\n return hide_url(secret_url), rev_options\n\n @staticmethod\n def normalize_url(url: str) -> str:\n \"\"\"\n Normalize a URL for comparison by unquoting it and removing any\n trailing slash.\n \"\"\"\n return urllib.parse.unquote(url).rstrip(\"/\")\n\n @classmethod\n def compare_urls(cls, url1: str, url2: str) -> bool:\n \"\"\"\n Compare two repo URLs for identity, ignoring incidental differences.\n \"\"\"\n return cls.normalize_url(url1) == cls.normalize_url(url2)\n\n def fetch_new(\n self, dest: str, url: HiddenText, rev_options: RevOptions, verbosity: int\n ) -> None:\n \"\"\"\n Fetch a revision from a repository, in the case that this is the\n first fetch from the repository.\n\n Args:\n dest: the directory to fetch the repository to.\n rev_options: a RevOptions object.\n verbosity: verbosity level.\n \"\"\"\n raise NotImplementedError\n\n def switch(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n \"\"\"\n Switch the repo at ``dest`` to point to ``URL``.\n\n Args:\n rev_options: a RevOptions object.\n \"\"\"\n raise NotImplementedError\n\n def update(self, dest: str, url: HiddenText, rev_options: RevOptions) -> None:\n \"\"\"\n Update an already-existing repo to the given ``rev_options``.\n\n Args:\n rev_options: a RevOptions object.\n \"\"\"\n raise NotImplementedError\n\n @classmethod\n def is_commit_id_equal(cls, dest: str, name: Optional[str]) -> bool:\n \"\"\"\n Return whether the id of the current commit equals the given name.\n\n Args:\n dest: the repository directory.\n name: a string name.\n \"\"\"\n raise NotImplementedError\n\n def obtain(self, dest: str, url: HiddenText, verbosity: int) -> None:\n \"\"\"\n Install or update in editable mode the package represented by this\n VersionControl object.\n\n :param dest: the repository directory in which to install or update.\n :param url: the repository URL starting with a vcs prefix.\n :param verbosity: verbosity level.\n \"\"\"\n url, rev_options = self.get_url_rev_options(url)\n\n if not os.path.exists(dest):\n self.fetch_new(dest, url, rev_options, verbosity=verbosity)\n return\n\n rev_display = rev_options.to_display()\n if self.is_repository_directory(dest):\n existing_url = self.get_remote_url(dest)\n if self.compare_urls(existing_url, url.secret):\n logger.debug(\n \"%s in %s exists, and has correct URL (%s)\",\n self.repo_name.title(),\n display_path(dest),\n url,\n )\n if not self.is_commit_id_equal(dest, rev_options.rev):\n logger.info(\n \"Updating %s %s%s\",\n display_path(dest),\n self.repo_name,\n rev_display,\n )\n self.update(dest, url, rev_options)\n else:\n logger.info(\"Skipping because already up-to-date.\")\n return\n\n logger.warning(\n \"%s %s in %s exists with URL %s\",\n self.name,\n self.repo_name,\n display_path(dest),\n existing_url,\n )\n prompt = (\"(s)witch, (i)gnore, (w)ipe, (b)ackup \", (\"s\", \"i\", \"w\", \"b\"))\n else:\n logger.warning(\n \"Directory %s already exists, and is not a %s %s.\",\n dest,\n self.name,\n self.repo_name,\n )\n # https://github.com/python/mypy/issues/1174\n prompt = (\"(i)gnore, (w)ipe, (b)ackup \", (\"i\", \"w\", \"b\")) # type: ignore\n\n logger.warning(\n \"The plan is to install the %s repository %s\",\n self.name,\n url,\n )\n response = ask_path_exists(f\"What to do? {prompt[0]}\", prompt[1])\n\n if response == \"a\":\n sys.exit(-1)\n\n if response == \"w\":\n logger.warning(\"Deleting %s\", display_path(dest))\n rmtree(dest)\n self.fetch_new(dest, url, rev_options, verbosity=verbosity)\n return\n\n if response == \"b\":\n dest_dir = backup_dir(dest)\n logger.warning(\"Backing up %s to %s\", display_path(dest), dest_dir)\n shutil.move(dest, dest_dir)\n self.fetch_new(dest, url, rev_options, verbosity=verbosity)\n return\n\n # Do nothing if the response is \"i\".\n if response == \"s\":\n logger.info(\n \"Switching %s %s to %s%s\",\n self.repo_name,\n display_path(dest),\n url,\n rev_display,\n )\n self.switch(dest, url, rev_options)\n\n def unpack(self, location: str, url: HiddenText, verbosity: int) -> None:\n \"\"\"\n Clean up current location and download the url repository\n (and vcs infos) into location\n\n :param url: the repository URL starting with a vcs prefix.\n :param verbosity: verbosity level.\n \"\"\"\n if os.path.exists(location):\n rmtree(location)\n self.obtain(location, url=url, verbosity=verbosity)\n\n @classmethod\n def get_remote_url(cls, location: str) -> str:\n \"\"\"\n Return the url used at location\n\n Raises RemoteNotFoundError if the repository does not have a remote\n url configured.\n \"\"\"\n raise NotImplementedError\n\n @classmethod\n def get_revision(cls, location: str) -> str:\n \"\"\"\n Return the current commit id of the files at the given location.\n \"\"\"\n raise NotImplementedError\n\n @classmethod\n def run_command(\n cls,\n cmd: Union[List[str], CommandArgs],\n show_stdout: bool = True,\n cwd: Optional[str] = None,\n on_returncode: 'Literal[\"raise\", \"warn\", \"ignore\"]' = \"raise\",\n extra_ok_returncodes: Optional[Iterable[int]] = None,\n command_desc: Optional[str] = None,\n extra_environ: Optional[Mapping[str, Any]] = None,\n spinner: Optional[SpinnerInterface] = None,\n log_failed_cmd: bool = True,\n stdout_only: bool = False,\n ) -> str:\n \"\"\"\n Run a VCS subcommand\n This is simply a wrapper around call_subprocess that adds the VCS\n command name, and checks that the VCS is available\n \"\"\"\n cmd = make_command(cls.name, *cmd)\n if command_desc is None:\n command_desc = format_command_args(cmd)\n try:\n return call_subprocess(\n cmd,\n show_stdout,\n cwd,\n on_returncode=on_returncode,\n extra_ok_returncodes=extra_ok_returncodes,\n command_desc=command_desc,\n extra_environ=extra_environ,\n unset_environ=cls.unset_environ,\n spinner=spinner,\n log_failed_cmd=log_failed_cmd,\n stdout_only=stdout_only,\n )\n except NotADirectoryError:\n raise BadCommand(f\"Cannot find command {cls.name!r} - invalid PATH\")\n except FileNotFoundError:\n # errno.ENOENT = no such file or directory\n # In other words, the VCS executable isn't available\n raise BadCommand(\n f\"Cannot find command {cls.name!r} - do you have \"\n f\"{cls.name!r} installed and in your PATH?\"\n )\n except PermissionError:\n # errno.EACCES = Permission denied\n # This error occurs, for instance, when the command is installed\n # only for another user. So, the current user don't have\n # permission to call the other user command.\n raise BadCommand(\n f\"No permission to execute {cls.name!r} - install it \"\n f\"locally, globally (ask admin), or check your PATH. \"\n f\"See possible solutions at \"\n f\"https://pip.pypa.io/en/latest/reference/pip_freeze/\"\n f\"#fixing-permission-denied.\"\n )\n\n @classmethod\n def is_repository_directory(cls, path: str) -> bool:\n \"\"\"\n Return whether a directory path is a repository directory.\n \"\"\"\n logger.debug(\"Checking in %s for %s (%s)...\", path, cls.dirname, cls.name)\n return os.path.exists(os.path.join(path, cls.dirname))\n\n @classmethod\n def get_repository_root(cls, location: str) -> Optional[str]:\n \"\"\"\n Return the \"root\" (top-level) directory controlled by the vcs,\n or `None` if the directory is not in any.\n\n It is meant to be overridden to implement smarter detection\n mechanisms for specific vcs.\n\n This can do more than is_repository_directory() alone. For\n example, the Git override checks that Git is actually available.\n \"\"\"\n if cls.is_repository_directory(location):\n return location\n return None\n",[],[100,509,516,523,475,544,1822,1873],[100,509,516,523,475,544,1822],{"_104":1882,"_96":558,"_158":1883,"_160":545,"_161":139,"_162":1884,"_164":165,"_106":1885,"_101":29,"_167":215,"_169":1886,"_170":25,"_171":-5,"_172":1887,"_99":1888},"0498d2a8-67fc-11f0-aedf-0224a6c84d84","0498d33e-67fc-11f0-aedf-0224a6c84d84",144,["D",1753299255423],"from typing import List, Optional\n\nfrom pip._internal.utils import _log\n\n# init_logging() must be called before any call to logging.getLogger()\n# which happens at import of most modules.\n_log.init_logging()\n\n\ndef main(args: Optional[List[str]] = None) -> int:\n \"\"\"This is preserved for old console scripts that may still be referencing\n it.\n\n For additional details, see https://github.com/pypa/pip/issues/7498.\n \"\"\"\n from pip._internal.utils.entrypoints import _wrapper\n\n return _wrapper(args)\n",[],[100,509,516,523,475,544,558],{"_104":1890,"_96":1891,"_158":1892,"_160":545,"_161":139,"_162":1893,"_164":165,"_106":1894,"_101":29,"_167":215,"_169":1895,"_170":25,"_171":-5,"_172":1896,"_99":1897},"07a98c80-67fc-11f0-805e-0224a6c84d84","build_env.py","07a98d3e-67fc-11f0-805e-0224a6c84d84",274,["D",1753299260627],"\"\"\"Build Environment used for isolation during sdist building\"\"\"\n\nimport logging\nimport os\nimport pathlib\nimport site\nimport sys\nimport textwrap\nfrom collections import OrderedDict\nfrom types import TracebackType\nfrom typing import TYPE_CHECKING, Iterable, List, Optional, Set, Tuple, Type, Union\n\nfrom pip._vendor.packaging.version import Version\n\nfrom pip import __file__ as pip_location\nfrom pip._internal.cli.spinners import open_spinner\nfrom pip._internal.locations import get_platlib, get_purelib, get_scheme\nfrom pip._internal.metadata import get_default_environment, get_environment\nfrom pip._internal.utils.logging import VERBOSE\nfrom pip._internal.utils.packaging import get_requirement\nfrom pip._internal.utils.subprocess import call_subprocess\nfrom pip._internal.utils.temp_dir import TempDirectory, tempdir_kinds\n\nif TYPE_CHECKING:\n from pip._internal.index.package_finder import PackageFinder\n\nlogger = logging.getLogger(__name__)\n\n\ndef _dedup(a: str, b: str) -> Union[Tuple[str], Tuple[str, str]]:\n return (a, b) if a != b else (a,)\n\n\nclass _Prefix:\n def __init__(self, path: str) -> None:\n self.path = path\n self.setup = False\n scheme = get_scheme(\"\", prefix=path)\n self.bin_dir = scheme.scripts\n self.lib_dirs = _dedup(scheme.purelib, scheme.platlib)\n\n\ndef get_runnable_pip() -> str:\n \"\"\"Get a file to pass to a Python executable, to run the currently-running pip.\n\n This is used to run a pip subprocess, for installing requirements into the build\n environment.\n \"\"\"\n source = pathlib.Path(pip_location).resolve().parent\n\n if not source.is_dir():\n # This would happen if someone is using pip from inside a zip file. In that\n # case, we can use that directly.\n return str(source)\n\n return os.fsdecode(source / \"__pip-runner__.py\")\n\n\ndef _get_system_sitepackages() -> Set[str]:\n \"\"\"Get system site packages\n\n Usually from site.getsitepackages,\n but fallback on `get_purelib()/get_platlib()` if unavailable\n (e.g. in a virtualenv created by virtualenv<20)\n\n Returns normalized set of strings.\n \"\"\"\n if hasattr(site, \"getsitepackages\"):\n system_sites = site.getsitepackages()\n else:\n # virtualenv < 20 overwrites site.py without getsitepackages\n # fallback on get_purelib/get_platlib.\n # this is known to miss things, but shouldn't in the cases\n # where getsitepackages() has been removed (inside a virtualenv)\n system_sites = [get_purelib(), get_platlib()]\n return {os.path.normcase(path) for path in system_sites}\n\n\nclass BuildEnvironment:\n \"\"\"Creates and manages an isolated environment to install build deps\"\"\"\n\n def __init__(self) -> None:\n temp_dir = TempDirectory(kind=tempdir_kinds.BUILD_ENV, globally_managed=True)\n\n self._prefixes = OrderedDict(\n (name, _Prefix(os.path.join(temp_dir.path, name)))\n for name in (\"normal\", \"overlay\")\n )\n\n self._bin_dirs: List[str] = []\n self._lib_dirs: List[str] = []\n for prefix in reversed(list(self._prefixes.values())):\n self._bin_dirs.append(prefix.bin_dir)\n self._lib_dirs.extend(prefix.lib_dirs)\n\n # Customize site to:\n # - ensure .pth files are honored\n # - prevent access to system site packages\n system_sites = _get_system_sitepackages()\n\n self._site_dir = os.path.join(temp_dir.path, \"site\")\n if not os.path.exists(self._site_dir):\n os.mkdir(self._site_dir)\n with open(\n os.path.join(self._site_dir, \"sitecustomize.py\"), \"w\", encoding=\"utf-8\"\n ) as fp:\n fp.write(\n textwrap.dedent(\n \"\"\"\n import os, site, sys\n\n # First, drop system-sites related paths.\n original_sys_path = sys.path[:]\n known_paths = set()\n for path in {system_sites!r}:\n site.addsitedir(path, known_paths=known_paths)\n system_paths = set(\n os.path.normcase(path)\n for path in sys.path[len(original_sys_path):]\n )\n original_sys_path = [\n path for path in original_sys_path\n if os.path.normcase(path) not in system_paths\n ]\n sys.path = original_sys_path\n\n # Second, add lib directories.\n # ensuring .pth file are processed.\n for path in {lib_dirs!r}:\n assert not path in sys.path\n site.addsitedir(path)\n \"\"\"\n ).format(system_sites=system_sites, lib_dirs=self._lib_dirs)\n )\n\n def __enter__(self) -> None:\n self._save_env = {\n name: os.environ.get(name, None)\n for name in (\"PATH\", \"PYTHONNOUSERSITE\", \"PYTHONPATH\")\n }\n\n path = self._bin_dirs[:]\n old_path = self._save_env[\"PATH\"]\n if old_path:\n path.extend(old_path.split(os.pathsep))\n\n pythonpath = [self._site_dir]\n\n os.environ.update(\n {\n \"PATH\": os.pathsep.join(path),\n \"PYTHONNOUSERSITE\": \"1\",\n \"PYTHONPATH\": os.pathsep.join(pythonpath),\n }\n )\n\n def __exit__(\n self,\n exc_type: Optional[Type[BaseException]],\n exc_val: Optional[BaseException],\n exc_tb: Optional[TracebackType],\n ) -> None:\n for varname, old_value in self._save_env.items():\n if old_value is None:\n os.environ.pop(varname, None)\n else:\n os.environ[varname] = old_value\n\n def check_requirements(\n self, reqs: Iterable[str]\n ) -> Tuple[Set[Tuple[str, str]], Set[str]]:\n \"\"\"Return 2 sets:\n - conflicting requirements: set of (installed, wanted) reqs tuples\n - missing requirements: set of reqs\n \"\"\"\n missing = set()\n conflicting = set()\n if reqs:\n env = (\n get_environment(self._lib_dirs)\n if hasattr(self, \"_lib_dirs\")\n else get_default_environment()\n )\n for req_str in reqs:\n req = get_requirement(req_str)\n # We're explicitly evaluating with an empty extra value, since build\n # environments are not provided any mechanism to select specific extras.\n if req.marker is not None and not req.marker.evaluate({\"extra\": \"\"}):\n continue\n dist = env.get_distribution(req.name)\n if not dist:\n missing.add(req_str)\n continue\n if isinstance(dist.version, Version):\n installed_req_str = f\"{req.name}=={dist.version}\"\n else:\n installed_req_str = f\"{req.name}==={dist.version}\"\n if not req.specifier.contains(dist.version, prereleases=True):\n conflicting.add((installed_req_str, req_str))\n # FIXME: Consider direct URL?\n return conflicting, missing\n\n def install_requirements(\n self,\n finder: \"PackageFinder\",\n requirements: Iterable[str],\n prefix_as_string: str,\n *,\n kind: str,\n ) -> None:\n prefix = self._prefixes[prefix_as_string]\n assert not prefix.setup\n prefix.setup = True\n if not requirements:\n return\n self._install_requirements(\n get_runnable_pip(),\n finder,\n requirements,\n prefix,\n kind=kind,\n )\n\n @staticmethod\n def _install_requirements(\n pip_runnable: str,\n finder: \"PackageFinder\",\n requirements: Iterable[str],\n prefix: _Prefix,\n *,\n kind: str,\n ) -> None:\n args: List[str] = [\n sys.executable,\n pip_runnable,\n \"install\",\n \"--ignore-installed\",\n \"--no-user\",\n \"--prefix\",\n prefix.path,\n \"--no-warn-script-location\",\n \"--disable-pip-version-check\",\n # As the build environment is ephemeral, it's wasteful to\n # pre-compile everything, especially as not every Python\n # module will be used/compiled in most cases.\n \"--no-compile\",\n # The prefix specified two lines above, thus\n # target from config file or env var should be ignored\n \"--target\",\n \"\",\n ]\n if logger.getEffectiveLevel() <= logging.DEBUG:\n args.append(\"-vv\")\n elif logger.getEffectiveLevel() <= VERBOSE:\n args.append(\"-v\")\n for format_control in (\"no_binary\", \"only_binary\"):\n formats = getattr(finder.format_control, format_control)\n args.extend(\n (\n \"--\" + format_control.replace(\"_\", \"-\"),\n \",\".join(sorted(formats or {\":none:\"})),\n )\n )\n\n index_urls = finder.index_urls\n if index_urls:\n args.extend([\"-i\", index_urls[0]])\n for extra_index in index_urls[1:]:\n args.extend([\"--extra-index-url\", extra_index])\n else:\n args.append(\"--no-index\")\n for link in finder.find_links:\n args.extend([\"--find-links\", link])\n\n if finder.proxy:\n args.extend([\"--proxy\", finder.proxy])\n for host in finder.trusted_hosts:\n args.extend([\"--trusted-host\", host])\n if finder.custom_cert:\n args.extend([\"--cert\", finder.custom_cert])\n if finder.client_cert:\n args.extend([\"--client-cert\", finder.client_cert])\n if finder.allow_all_prereleases:\n args.append(\"--pre\")\n if finder.prefer_binary:\n args.append(\"--prefer-binary\")\n args.append(\"--\")\n args.extend(requirements)\n with open_spinner(f\"Installing {kind}\") as spinner:\n call_subprocess(\n args,\n command_desc=f\"pip subprocess to install {kind}\",\n spinner=spinner,\n )\n\n\nclass NoOpBuildEnvironment(BuildEnvironment):\n \"\"\"A no-op drop-in replacement for BuildEnvironment\"\"\"\n\n def __init__(self) -> None:\n pass\n\n def __enter__(self) -> None:\n pass\n\n def __exit__(\n self,\n exc_type: Optional[Type[BaseException]],\n exc_val: Optional[BaseException],\n exc_tb: Optional[TracebackType],\n ) -> None:\n pass\n\n def cleanup(self) -> None:\n pass\n\n def install_requirements(\n self,\n finder: \"PackageFinder\",\n requirements: Iterable[str],\n prefix_as_string: str,\n *,\n kind: str,\n ) -> None:\n raise NotImplementedError()\n",[],[100,509,516,523,475,544,1891],{"_104":1899,"_96":690,"_158":1900,"_160":545,"_161":139,"_162":1901,"_164":165,"_106":1902,"_101":29,"_167":215,"_169":1903,"_170":25,"_171":-5,"_172":1904,"_99":1905},"047e57e8-67fc-11f0-928e-0224a6c84d84","047e58ba-67fc-11f0-928e-0224a6c84d84",140,["D",1753299255320],"\"\"\"Cache Management\"\"\"\n\nimport hashlib\nimport json\nimport logging\nimport os\nfrom pathlib import Path\nfrom typing import Any, Dict, List, Optional\n\nfrom pip._vendor.packaging.tags import Tag, interpreter_name, interpreter_version\nfrom pip._vendor.packaging.utils import canonicalize_name\n\nfrom pip._internal.exceptions import InvalidWheelFilename\nfrom pip._internal.models.direct_url import DirectUrl\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.utils.temp_dir import TempDirectory, tempdir_kinds\nfrom pip._internal.utils.urls import path_to_url\n\nlogger = logging.getLogger(__name__)\n\nORIGIN_JSON_NAME = \"origin.json\"\n\n\ndef _hash_dict(d: Dict[str, str]) -> str:\n \"\"\"Return a stable sha224 of a dictionary.\"\"\"\n s = json.dumps(d, sort_keys=True, separators=(\",\", \":\"), ensure_ascii=True)\n return hashlib.sha224(s.encode(\"ascii\")).hexdigest()\n\n\nclass Cache:\n \"\"\"An abstract class - provides cache directories for data from links\n\n :param cache_dir: The root of the cache.\n \"\"\"\n\n def __init__(self, cache_dir: str) -> None:\n super().__init__()\n assert not cache_dir or os.path.isabs(cache_dir)\n self.cache_dir = cache_dir or None\n\n def _get_cache_path_parts(self, link: Link) -> List[str]:\n \"\"\"Get parts of part that must be os.path.joined with cache_dir\"\"\"\n\n # We want to generate an url to use as our cache key, we don't want to\n # just reuse the URL because it might have other items in the fragment\n # and we don't care about those.\n key_parts = {\"url\": link.url_without_fragment}\n if link.hash_name is not None and link.hash is not None:\n key_parts[link.hash_name] = link.hash\n if link.subdirectory_fragment:\n key_parts[\"subdirectory\"] = link.subdirectory_fragment\n\n # Include interpreter name, major and minor version in cache key\n # to cope with ill-behaved sdists that build a different wheel\n # depending on the python version their setup.py is being run on,\n # and don't encode the difference in compatibility tags.\n # https://github.com/pypa/pip/issues/7296\n key_parts[\"interpreter_name\"] = interpreter_name()\n key_parts[\"interpreter_version\"] = interpreter_version()\n\n # Encode our key url with sha224, we'll use this because it has similar\n # security properties to sha256, but with a shorter total output (and\n # thus less secure). However the differences don't make a lot of\n # difference for our use case here.\n hashed = _hash_dict(key_parts)\n\n # We want to nest the directories some to prevent having a ton of top\n # level directories where we might run out of sub directories on some\n # FS.\n parts = [hashed[:2], hashed[2:4], hashed[4:6], hashed[6:]]\n\n return parts\n\n def _get_candidates(self, link: Link, canonical_package_name: str) -> List[Any]:\n can_not_cache = not self.cache_dir or not canonical_package_name or not link\n if can_not_cache:\n return []\n\n path = self.get_path_for_link(link)\n if os.path.isdir(path):\n return [(candidate, path) for candidate in os.listdir(path)]\n return []\n\n def get_path_for_link(self, link: Link) -> str:\n \"\"\"Return a directory to store cached items in for link.\"\"\"\n raise NotImplementedError()\n\n def get(\n self,\n link: Link,\n package_name: Optional[str],\n supported_tags: List[Tag],\n ) -> Link:\n \"\"\"Returns a link to a cached item if it exists, otherwise returns the\n passed link.\n \"\"\"\n raise NotImplementedError()\n\n\nclass SimpleWheelCache(Cache):\n \"\"\"A cache of wheels for future installs.\"\"\"\n\n def __init__(self, cache_dir: str) -> None:\n super().__init__(cache_dir)\n\n def get_path_for_link(self, link: Link) -> str:\n \"\"\"Return a directory to store cached wheels for link\n\n Because there are M wheels for any one sdist, we provide a directory\n to cache them in, and then consult that directory when looking up\n cache hits.\n\n We only insert things into the cache if they have plausible version\n numbers, so that we don't contaminate the cache with things that were\n not unique. E.g. ./package might have dozens of installs done for it\n and build a version of 0.0...and if we built and cached a wheel, we'd\n end up using the same wheel even if the source has been edited.\n\n :param link: The link of the sdist for which this will cache wheels.\n \"\"\"\n parts = self._get_cache_path_parts(link)\n assert self.cache_dir\n # Store wheels within the root cache_dir\n return os.path.join(self.cache_dir, \"wheels\", *parts)\n\n def get(\n self,\n link: Link,\n package_name: Optional[str],\n supported_tags: List[Tag],\n ) -> Link:\n candidates = []\n\n if not package_name:\n return link\n\n canonical_package_name = canonicalize_name(package_name)\n for wheel_name, wheel_dir in self._get_candidates(link, canonical_package_name):\n try:\n wheel = Wheel(wheel_name)\n except InvalidWheelFilename:\n continue\n if canonicalize_name(wheel.name) != canonical_package_name:\n logger.debug(\n \"Ignoring cached wheel %s for %s as it \"\n \"does not match the expected distribution name %s.\",\n wheel_name,\n link,\n package_name,\n )\n continue\n if not wheel.supported(supported_tags):\n # Built for a different python/arch/etc\n continue\n candidates.append(\n (\n wheel.support_index_min(supported_tags),\n wheel_name,\n wheel_dir,\n )\n )\n\n if not candidates:\n return link\n\n _, wheel_name, wheel_dir = min(candidates)\n return Link(path_to_url(os.path.join(wheel_dir, wheel_name)))\n\n\nclass EphemWheelCache(SimpleWheelCache):\n \"\"\"A SimpleWheelCache that creates it's own temporary cache directory\"\"\"\n\n def __init__(self) -> None:\n self._temp_dir = TempDirectory(\n kind=tempdir_kinds.EPHEM_WHEEL_CACHE,\n globally_managed=True,\n )\n\n super().__init__(self._temp_dir.path)\n\n\nclass CacheEntry:\n def __init__(\n self,\n link: Link,\n persistent: bool,\n ):\n self.link = link\n self.persistent = persistent\n self.origin: Optional[DirectUrl] = None\n origin_direct_url_path = Path(self.link.file_path).parent / ORIGIN_JSON_NAME\n if origin_direct_url_path.exists():\n try:\n self.origin = DirectUrl.from_json(\n origin_direct_url_path.read_text(encoding=\"utf-8\")\n )\n except Exception as e:\n logger.warning(\n \"Ignoring invalid cache entry origin file %s for %s (%s)\",\n origin_direct_url_path,\n link.filename,\n e,\n )\n\n\nclass WheelCache(Cache):\n \"\"\"Wraps EphemWheelCache and SimpleWheelCache into a single Cache\n\n This Cache allows for gracefully degradation, using the ephem wheel cache\n when a certain link is not found in the simple wheel cache first.\n \"\"\"\n\n def __init__(self, cache_dir: str) -> None:\n super().__init__(cache_dir)\n self._wheel_cache = SimpleWheelCache(cache_dir)\n self._ephem_cache = EphemWheelCache()\n\n def get_path_for_link(self, link: Link) -> str:\n return self._wheel_cache.get_path_for_link(link)\n\n def get_ephem_path_for_link(self, link: Link) -> str:\n return self._ephem_cache.get_path_for_link(link)\n\n def get(\n self,\n link: Link,\n package_name: Optional[str],\n supported_tags: List[Tag],\n ) -> Link:\n cache_entry = self.get_cache_entry(link, package_name, supported_tags)\n if cache_entry is None:\n return link\n return cache_entry.link\n\n def get_cache_entry(\n self,\n link: Link,\n package_name: Optional[str],\n supported_tags: List[Tag],\n ) -> Optional[CacheEntry]:\n \"\"\"Returns a CacheEntry with a link to a cached item if it exists or\n None. The cache entry indicates if the item was found in the persistent\n or ephemeral cache.\n \"\"\"\n retval = self._wheel_cache.get(\n link=link,\n package_name=package_name,\n supported_tags=supported_tags,\n )\n if retval is not link:\n return CacheEntry(retval, persistent=True)\n\n retval = self._ephem_cache.get(\n link=link,\n package_name=package_name,\n supported_tags=supported_tags,\n )\n if retval is not link:\n return CacheEntry(retval, persistent=False)\n\n return None\n\n @staticmethod\n def record_download_origin(cache_dir: str, download_info: DirectUrl) -> None:\n origin_path = Path(cache_dir) / ORIGIN_JSON_NAME\n if origin_path.exists():\n try:\n origin = DirectUrl.from_json(origin_path.read_text(encoding=\"utf-8\"))\n except Exception as e:\n logger.warning(\n \"Could not read origin file %s in cache entry (%s). \"\n \"Will attempt to overwrite it.\",\n origin_path,\n e,\n )\n else:\n # TODO: use DirectUrl.equivalent when\n # https://github.com/pypa/pip/pull/10564 is merged.\n if origin.url != download_info.url:\n logger.warning(\n \"Origin URL %s in cache entry %s does not match download URL \"\n \"%s. This is likely a pip bug or a cache corruption issue. \"\n \"Will overwrite it with the new value.\",\n origin.url,\n cache_dir,\n download_info.url,\n )\n origin_path.write_text(download_info.to_json(), encoding=\"utf-8\")\n",[],[100,509,516,523,475,544,690],{"_104":1907,"_96":717,"_158":1908,"_160":545,"_161":139,"_162":1909,"_164":165,"_106":1910,"_101":29,"_167":215,"_169":1911,"_170":25,"_171":-5,"_172":1912,"_99":1913},"044cb04e-67fc-11f0-928e-0224a6c84d84","044cb10c-67fc-11f0-928e-0224a6c84d84",131,["D",1753299254995],"\"\"\"Configuration management setup\n\nSome terminology:\n- name\n As written in config files.\n- value\n Value associated with a name\n- key\n Name combined with it's section (section.name)\n- variant\n A single word describing where the configuration key-value pair came from\n\"\"\"\n\nimport configparser\nimport locale\nimport os\nimport sys\nfrom typing import Any, Dict, Iterable, List, NewType, Optional, Tuple\n\nfrom pip._internal.exceptions import (\n ConfigurationError,\n ConfigurationFileCouldNotBeLoaded,\n)\nfrom pip._internal.utils import appdirs\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.logging import getLogger\nfrom pip._internal.utils.misc import ensure_dir, enum\n\nRawConfigParser = configparser.RawConfigParser # Shorthand\nKind = NewType(\"Kind\", str)\n\nCONFIG_BASENAME = \"pip.ini\" if WINDOWS else \"pip.conf\"\nENV_NAMES_IGNORED = \"version\", \"help\"\n\n# The kinds of configurations there are.\nkinds = enum(\n USER=\"user\", # User Specific\n GLOBAL=\"global\", # System Wide\n SITE=\"site\", # [Virtual] Environment Specific\n ENV=\"env\", # from PIP_CONFIG_FILE\n ENV_VAR=\"env-var\", # from Environment Variables\n)\nOVERRIDE_ORDER = kinds.GLOBAL, kinds.USER, kinds.SITE, kinds.ENV, kinds.ENV_VAR\nVALID_LOAD_ONLY = kinds.USER, kinds.GLOBAL, kinds.SITE\n\nlogger = getLogger(__name__)\n\n\n# NOTE: Maybe use the optionx attribute to normalize keynames.\ndef _normalize_name(name: str) -> str:\n \"\"\"Make a name consistent regardless of source (environment or file)\"\"\"\n name = name.lower().replace(\"_\", \"-\")\n if name.startswith(\"--\"):\n name = name[2:] # only prefer long opts\n return name\n\n\ndef _disassemble_key(name: str) -> List[str]:\n if \".\" not in name:\n error_message = (\n \"Key does not contain dot separated section and key. \"\n f\"Perhaps you wanted to use 'global.{name}' instead?\"\n )\n raise ConfigurationError(error_message)\n return name.split(\".\", 1)\n\n\ndef get_configuration_files() -> Dict[Kind, List[str]]:\n global_config_files = [\n os.path.join(path, CONFIG_BASENAME) for path in appdirs.site_config_dirs(\"pip\")\n ]\n\n site_config_file = os.path.join(sys.prefix, CONFIG_BASENAME)\n legacy_config_file = os.path.join(\n os.path.expanduser(\"~\"),\n \"pip\" if WINDOWS else \".pip\",\n CONFIG_BASENAME,\n )\n new_config_file = os.path.join(appdirs.user_config_dir(\"pip\"), CONFIG_BASENAME)\n return {\n kinds.GLOBAL: global_config_files,\n kinds.SITE: [site_config_file],\n kinds.USER: [legacy_config_file, new_config_file],\n }\n\n\nclass Configuration:\n \"\"\"Handles management of configuration.\n\n Provides an interface to accessing and managing configuration files.\n\n This class converts provides an API that takes \"section.key-name\" style\n keys and stores the value associated with it as \"key-name\" under the\n section \"section\".\n\n This allows for a clean interface wherein the both the section and the\n key-name are preserved in an easy to manage form in the configuration files\n and the data stored is also nice.\n \"\"\"\n\n def __init__(self, isolated: bool, load_only: Optional[Kind] = None) -> None:\n super().__init__()\n\n if load_only is not None and load_only not in VALID_LOAD_ONLY:\n raise ConfigurationError(\n \"Got invalid value for load_only - should be one of {}\".format(\n \", \".join(map(repr, VALID_LOAD_ONLY))\n )\n )\n self.isolated = isolated\n self.load_only = load_only\n\n # Because we keep track of where we got the data from\n self._parsers: Dict[Kind, List[Tuple[str, RawConfigParser]]] = {\n variant: [] for variant in OVERRIDE_ORDER\n }\n self._config: Dict[Kind, Dict[str, Any]] = {\n variant: {} for variant in OVERRIDE_ORDER\n }\n self._modified_parsers: List[Tuple[str, RawConfigParser]] = []\n\n def load(self) -> None:\n \"\"\"Loads configuration from configuration files and environment\"\"\"\n self._load_config_files()\n if not self.isolated:\n self._load_environment_vars()\n\n def get_file_to_edit(self) -> Optional[str]:\n \"\"\"Returns the file with highest priority in configuration\"\"\"\n assert self.load_only is not None, \"Need to be specified a file to be editing\"\n\n try:\n return self._get_parser_to_modify()[0]\n except IndexError:\n return None\n\n def items(self) -> Iterable[Tuple[str, Any]]:\n \"\"\"Returns key-value pairs like dict.items() representing the loaded\n configuration\n \"\"\"\n return self._dictionary.items()\n\n def get_value(self, key: str) -> Any:\n \"\"\"Get a value from the configuration.\"\"\"\n orig_key = key\n key = _normalize_name(key)\n try:\n return self._dictionary[key]\n except KeyError:\n # disassembling triggers a more useful error message than simply\n # \"No such key\" in the case that the key isn't in the form command.option\n _disassemble_key(key)\n raise ConfigurationError(f\"No such key - {orig_key}\")\n\n def set_value(self, key: str, value: Any) -> None:\n \"\"\"Modify a value in the configuration.\"\"\"\n key = _normalize_name(key)\n self._ensure_have_load_only()\n\n assert self.load_only\n fname, parser = self._get_parser_to_modify()\n\n if parser is not None:\n section, name = _disassemble_key(key)\n\n # Modify the parser and the configuration\n if not parser.has_section(section):\n parser.add_section(section)\n parser.set(section, name, value)\n\n self._config[self.load_only][key] = value\n self._mark_as_modified(fname, parser)\n\n def unset_value(self, key: str) -> None:\n \"\"\"Unset a value in the configuration.\"\"\"\n orig_key = key\n key = _normalize_name(key)\n self._ensure_have_load_only()\n\n assert self.load_only\n if key not in self._config[self.load_only]:\n raise ConfigurationError(f\"No such key - {orig_key}\")\n\n fname, parser = self._get_parser_to_modify()\n\n if parser is not None:\n section, name = _disassemble_key(key)\n if not (\n parser.has_section(section) and parser.remove_option(section, name)\n ):\n # The option was not removed.\n raise ConfigurationError(\n \"Fatal Internal error [id=1]. Please report as a bug.\"\n )\n\n # The section may be empty after the option was removed.\n if not parser.items(section):\n parser.remove_section(section)\n self._mark_as_modified(fname, parser)\n\n del self._config[self.load_only][key]\n\n def save(self) -> None:\n \"\"\"Save the current in-memory state.\"\"\"\n self._ensure_have_load_only()\n\n for fname, parser in self._modified_parsers:\n logger.info(\"Writing to %s\", fname)\n\n # Ensure directory exists.\n ensure_dir(os.path.dirname(fname))\n\n # Ensure directory's permission(need to be writeable)\n try:\n with open(fname, \"w\") as f:\n parser.write(f)\n except OSError as error:\n raise ConfigurationError(\n f\"An error occurred while writing to the configuration file \"\n f\"{fname}: {error}\"\n )\n\n #\n # Private routines\n #\n\n def _ensure_have_load_only(self) -> None:\n if self.load_only is None:\n raise ConfigurationError(\"Needed a specific file to be modifying.\")\n logger.debug(\"Will be working with %s variant only\", self.load_only)\n\n @property\n def _dictionary(self) -> Dict[str, Any]:\n \"\"\"A dictionary representing the loaded configuration.\"\"\"\n # NOTE: Dictionaries are not populated if not loaded. So, conditionals\n # are not needed here.\n retval = {}\n\n for variant in OVERRIDE_ORDER:\n retval.update(self._config[variant])\n\n return retval\n\n def _load_config_files(self) -> None:\n \"\"\"Loads configuration from configuration files\"\"\"\n config_files = dict(self.iter_config_files())\n if config_files[kinds.ENV][0:1] == [os.devnull]:\n logger.debug(\n \"Skipping loading configuration files due to \"\n \"environment's PIP_CONFIG_FILE being os.devnull\"\n )\n return\n\n for variant, files in config_files.items():\n for fname in files:\n # If there's specific variant set in `load_only`, load only\n # that variant, not the others.\n if self.load_only is not None and variant != self.load_only:\n logger.debug(\"Skipping file '%s' (variant: %s)\", fname, variant)\n continue\n\n parser = self._load_file(variant, fname)\n\n # Keeping track of the parsers used\n self._parsers[variant].append((fname, parser))\n\n def _load_file(self, variant: Kind, fname: str) -> RawConfigParser:\n logger.verbose(\"For variant '%s', will try loading '%s'\", variant, fname)\n parser = self._construct_parser(fname)\n\n for section in parser.sections():\n items = parser.items(section)\n self._config[variant].update(self._normalized_keys(section, items))\n\n return parser\n\n def _construct_parser(self, fname: str) -> RawConfigParser:\n parser = configparser.RawConfigParser()\n # If there is no such file, don't bother reading it but create the\n # parser anyway, to hold the data.\n # Doing this is useful when modifying and saving files, where we don't\n # need to construct a parser.\n if os.path.exists(fname):\n locale_encoding = locale.getpreferredencoding(False)\n try:\n parser.read(fname, encoding=locale_encoding)\n except UnicodeDecodeError:\n # See https://github.com/pypa/pip/issues/4963\n raise ConfigurationFileCouldNotBeLoaded(\n reason=f\"contains invalid {locale_encoding} characters\",\n fname=fname,\n )\n except configparser.Error as error:\n # See https://github.com/pypa/pip/issues/4893\n raise ConfigurationFileCouldNotBeLoaded(error=error)\n return parser\n\n def _load_environment_vars(self) -> None:\n \"\"\"Loads configuration from environment variables\"\"\"\n self._config[kinds.ENV_VAR].update(\n self._normalized_keys(\":env:\", self.get_environ_vars())\n )\n\n def _normalized_keys(\n self, section: str, items: Iterable[Tuple[str, Any]]\n ) -> Dict[str, Any]:\n \"\"\"Normalizes items to construct a dictionary with normalized keys.\n\n This routine is where the names become keys and are made the same\n regardless of source - configuration files or environment.\n \"\"\"\n normalized = {}\n for name, val in items:\n key = section + \".\" + _normalize_name(name)\n normalized[key] = val\n return normalized\n\n def get_environ_vars(self) -> Iterable[Tuple[str, str]]:\n \"\"\"Returns a generator with all environmental vars with prefix PIP_\"\"\"\n for key, val in os.environ.items():\n if key.startswith(\"PIP_\"):\n name = key[4:].lower()\n if name not in ENV_NAMES_IGNORED:\n yield name, val\n\n # XXX: This is patched in the tests.\n def iter_config_files(self) -> Iterable[Tuple[Kind, List[str]]]:\n \"\"\"Yields variant and configuration files associated with it.\n\n This should be treated like items of a dictionary. The order\n here doesn't affect what gets overridden. That is controlled\n by OVERRIDE_ORDER. However this does control the order they are\n displayed to the user. It's probably most ergonomic to display\n things in the same order as OVERRIDE_ORDER\n \"\"\"\n # SMELL: Move the conditions out of this function\n\n env_config_file = os.environ.get(\"PIP_CONFIG_FILE\", None)\n config_files = get_configuration_files()\n\n yield kinds.GLOBAL, config_files[kinds.GLOBAL]\n\n # per-user config is not loaded when env_config_file exists\n should_load_user_config = not self.isolated and not (\n env_config_file and os.path.exists(env_config_file)\n )\n if should_load_user_config:\n # The legacy config file is overridden by the new config file\n yield kinds.USER, config_files[kinds.USER]\n\n # virtualenv config\n yield kinds.SITE, config_files[kinds.SITE]\n\n if env_config_file is not None:\n yield kinds.ENV, [env_config_file]\n else:\n yield kinds.ENV, []\n\n def get_values_in_config(self, variant: Kind) -> Dict[str, Any]:\n \"\"\"Get values present in a config file\"\"\"\n return self._config[variant]\n\n def _get_parser_to_modify(self) -> Tuple[str, RawConfigParser]:\n # Determine which parser to modify\n assert self.load_only\n parsers = self._parsers[self.load_only]\n if not parsers:\n # This should not happen if everything works correctly.\n raise ConfigurationError(\n \"Fatal Internal error [id=2]. Please report as a bug.\"\n )\n\n # Use the highest priority parser.\n return parsers[-1]\n\n # XXX: This is patched in the tests.\n def _mark_as_modified(self, fname: str, parser: RawConfigParser) -> None:\n file_parser_tuple = (fname, parser)\n if file_parser_tuple not in self._modified_parsers:\n self._modified_parsers.append(file_parser_tuple)\n\n def __repr__(self) -> str:\n return f\"{self.__class__.__name__}({self._dictionary!r})\"\n",[],[100,509,516,523,475,544,717],{"_104":1915,"_96":1916,"_158":1917,"_160":545,"_161":139,"_162":1918,"_164":165,"_106":1919,"_101":29,"_167":215,"_169":1920,"_170":25,"_171":-5,"_172":1921,"_99":1922},"06b52442-67fc-11f0-9ab6-0224a6c84d84","exceptions.py","06b524d8-67fc-11f0-9ab6-0224a6c84d84",237,["D",1753299259038],"\"\"\"Exceptions used throughout package.\n\nThis module MUST NOT try to import from anything within `pip._internal` to\noperate. This is expected to be importable from any/all files within the\nsubpackage and, thus, should not depend on them.\n\"\"\"\n\nimport configparser\nimport contextlib\nimport locale\nimport logging\nimport pathlib\nimport re\nimport sys\nfrom itertools import chain, groupby, repeat\nfrom typing import TYPE_CHECKING, Dict, Iterator, List, Literal, Optional, Union\n\nfrom pip._vendor.packaging.requirements import InvalidRequirement\nfrom pip._vendor.packaging.version import InvalidVersion\nfrom pip._vendor.rich.console import Console, ConsoleOptions, RenderResult\nfrom pip._vendor.rich.markup import escape\nfrom pip._vendor.rich.text import Text\n\nif TYPE_CHECKING:\n from hashlib import _Hash\n\n from pip._vendor.requests.models import Request, Response\n\n from pip._internal.metadata import BaseDistribution\n from pip._internal.models.link import Link\n from pip._internal.req.req_install import InstallRequirement\n\nlogger = logging.getLogger(__name__)\n\n\n#\n# Scaffolding\n#\ndef _is_kebab_case(s: str) -> bool:\n return re.match(r\"^[a-z]+(-[a-z]+)*$\", s) is not None\n\n\ndef _prefix_with_indent(\n s: Union[Text, str],\n console: Console,\n *,\n prefix: str,\n indent: str,\n) -> Text:\n if isinstance(s, Text):\n text = s\n else:\n text = console.render_str(s)\n\n return console.render_str(prefix, overflow=\"ignore\") + console.render_str(\n f\"\\n{indent}\", overflow=\"ignore\"\n ).join(text.split(allow_blank=True))\n\n\nclass PipError(Exception):\n \"\"\"The base pip error.\"\"\"\n\n\nclass DiagnosticPipError(PipError):\n \"\"\"An error, that presents diagnostic information to the user.\n\n This contains a bunch of logic, to enable pretty presentation of our error\n messages. Each error gets a unique reference. Each error can also include\n additional context, a hint and/or a note -- which are presented with the\n main error message in a consistent style.\n\n This is adapted from the error output styling in `sphinx-theme-builder`.\n \"\"\"\n\n reference: str\n\n def __init__(\n self,\n *,\n kind: 'Literal[\"error\", \"warning\"]' = \"error\",\n reference: Optional[str] = None,\n message: Union[str, Text],\n context: Optional[Union[str, Text]],\n hint_stmt: Optional[Union[str, Text]],\n note_stmt: Optional[Union[str, Text]] = None,\n link: Optional[str] = None,\n ) -> None:\n # Ensure a proper reference is provided.\n if reference is None:\n assert hasattr(self, \"reference\"), \"error reference not provided!\"\n reference = self.reference\n assert _is_kebab_case(reference), \"error reference must be kebab-case!\"\n\n self.kind = kind\n self.reference = reference\n\n self.message = message\n self.context = context\n\n self.note_stmt = note_stmt\n self.hint_stmt = hint_stmt\n\n self.link = link\n\n super().__init__(f\"<{self.__class__.__name__}: {self.reference}>\")\n\n def __repr__(self) -> str:\n return (\n f\"<{self.__class__.__name__}(\"\n f\"reference={self.reference!r}, \"\n f\"message={self.message!r}, \"\n f\"context={self.context!r}, \"\n f\"note_stmt={self.note_stmt!r}, \"\n f\"hint_stmt={self.hint_stmt!r}\"\n \")>\"\n )\n\n def __rich_console__(\n self,\n console: Console,\n options: ConsoleOptions,\n ) -> RenderResult:\n colour = \"red\" if self.kind == \"error\" else \"yellow\"\n\n yield f\"[{colour} bold]{self.kind}[/]: [bold]{self.reference}[/]\"\n yield \"\"\n\n if not options.ascii_only:\n # Present the main message, with relevant context indented.\n if self.context is not None:\n yield _prefix_with_indent(\n self.message,\n console,\n prefix=f\"[{colour}]×[/] \",\n indent=f\"[{colour}]│[/] \",\n )\n yield _prefix_with_indent(\n self.context,\n console,\n prefix=f\"[{colour}]╰─>[/] \",\n indent=f\"[{colour}] [/] \",\n )\n else:\n yield _prefix_with_indent(\n self.message,\n console,\n prefix=\"[red]×[/] \",\n indent=\" \",\n )\n else:\n yield self.message\n if self.context is not None:\n yield \"\"\n yield self.context\n\n if self.note_stmt is not None or self.hint_stmt is not None:\n yield \"\"\n\n if self.note_stmt is not None:\n yield _prefix_with_indent(\n self.note_stmt,\n console,\n prefix=\"[magenta bold]note[/]: \",\n indent=\" \",\n )\n if self.hint_stmt is not None:\n yield _prefix_with_indent(\n self.hint_stmt,\n console,\n prefix=\"[cyan bold]hint[/]: \",\n indent=\" \",\n )\n\n if self.link is not None:\n yield \"\"\n yield f\"Link: {self.link}\"\n\n\n#\n# Actual Errors\n#\nclass ConfigurationError(PipError):\n \"\"\"General exception in configuration\"\"\"\n\n\nclass InstallationError(PipError):\n \"\"\"General exception during installation\"\"\"\n\n\nclass MissingPyProjectBuildRequires(DiagnosticPipError):\n \"\"\"Raised when pyproject.toml has `build-system`, but no `build-system.requires`.\"\"\"\n\n reference = \"missing-pyproject-build-system-requires\"\n\n def __init__(self, *, package: str) -> None:\n super().__init__(\n message=f\"Can not process {escape(package)}\",\n context=Text(\n \"This package has an invalid pyproject.toml file.\\n\"\n \"The [build-system] table is missing the mandatory `requires` key.\"\n ),\n note_stmt=\"This is an issue with the package mentioned above, not pip.\",\n hint_stmt=Text(\"See PEP 518 for the detailed specification.\"),\n )\n\n\nclass InvalidPyProjectBuildRequires(DiagnosticPipError):\n \"\"\"Raised when pyproject.toml an invalid `build-system.requires`.\"\"\"\n\n reference = \"invalid-pyproject-build-system-requires\"\n\n def __init__(self, *, package: str, reason: str) -> None:\n super().__init__(\n message=f\"Can not process {escape(package)}\",\n context=Text(\n \"This package has an invalid `build-system.requires` key in \"\n f\"pyproject.toml.\\n{reason}\"\n ),\n note_stmt=\"This is an issue with the package mentioned above, not pip.\",\n hint_stmt=Text(\"See PEP 518 for the detailed specification.\"),\n )\n\n\nclass NoneMetadataError(PipError):\n \"\"\"Raised when accessing a Distribution's \"METADATA\" or \"PKG-INFO\".\n\n This signifies an inconsistency, when the Distribution claims to have\n the metadata file (if not, raise ``FileNotFoundError`` instead), but is\n not actually able to produce its content. This may be due to permission\n errors.\n \"\"\"\n\n def __init__(\n self,\n dist: \"BaseDistribution\",\n metadata_name: str,\n ) -> None:\n \"\"\"\n :param dist: A Distribution object.\n :param metadata_name: The name of the metadata being accessed\n (can be \"METADATA\" or \"PKG-INFO\").\n \"\"\"\n self.dist = dist\n self.metadata_name = metadata_name\n\n def __str__(self) -> str:\n # Use `dist` in the error message because its stringification\n # includes more information, like the version and location.\n return f\"None {self.metadata_name} metadata found for distribution: {self.dist}\"\n\n\nclass UserInstallationInvalid(InstallationError):\n \"\"\"A --user install is requested on an environment without user site.\"\"\"\n\n def __str__(self) -> str:\n return \"User base directory is not specified\"\n\n\nclass InvalidSchemeCombination(InstallationError):\n def __str__(self) -> str:\n before = \", \".join(str(a) for a in self.args[:-1])\n return f\"Cannot set {before} and {self.args[-1]} together\"\n\n\nclass DistributionNotFound(InstallationError):\n \"\"\"Raised when a distribution cannot be found to satisfy a requirement\"\"\"\n\n\nclass RequirementsFileParseError(InstallationError):\n \"\"\"Raised when a general error occurs parsing a requirements file line.\"\"\"\n\n\nclass BestVersionAlreadyInstalled(PipError):\n \"\"\"Raised when the most up-to-date version of a package is already\n installed.\"\"\"\n\n\nclass BadCommand(PipError):\n \"\"\"Raised when virtualenv or a command is not found\"\"\"\n\n\nclass CommandError(PipError):\n \"\"\"Raised when there is an error in command-line arguments\"\"\"\n\n\nclass PreviousBuildDirError(PipError):\n \"\"\"Raised when there's a previous conflicting build directory\"\"\"\n\n\nclass NetworkConnectionError(PipError):\n \"\"\"HTTP connection error\"\"\"\n\n def __init__(\n self,\n error_msg: str,\n response: Optional[\"Response\"] = None,\n request: Optional[\"Request\"] = None,\n ) -> None:\n \"\"\"\n Initialize NetworkConnectionError with `request` and `response`\n objects.\n \"\"\"\n self.response = response\n self.request = request\n self.error_msg = error_msg\n if (\n self.response is not None\n and not self.request\n and hasattr(response, \"request\")\n ):\n self.request = self.response.request\n super().__init__(error_msg, response, request)\n\n def __str__(self) -> str:\n return str(self.error_msg)\n\n\nclass InvalidWheelFilename(InstallationError):\n \"\"\"Invalid wheel filename.\"\"\"\n\n\nclass UnsupportedWheel(InstallationError):\n \"\"\"Unsupported wheel.\"\"\"\n\n\nclass InvalidWheel(InstallationError):\n \"\"\"Invalid (e.g. corrupt) wheel.\"\"\"\n\n def __init__(self, location: str, name: str):\n self.location = location\n self.name = name\n\n def __str__(self) -> str:\n return f\"Wheel '{self.name}' located at {self.location} is invalid.\"\n\n\nclass MetadataInconsistent(InstallationError):\n \"\"\"Built metadata contains inconsistent information.\n\n This is raised when the metadata contains values (e.g. name and version)\n that do not match the information previously obtained from sdist filename,\n user-supplied ``#egg=`` value, or an install requirement name.\n \"\"\"\n\n def __init__(\n self, ireq: \"InstallRequirement\", field: str, f_val: str, m_val: str\n ) -> None:\n self.ireq = ireq\n self.field = field\n self.f_val = f_val\n self.m_val = m_val\n\n def __str__(self) -> str:\n return (\n f\"Requested {self.ireq} has inconsistent {self.field}: \"\n f\"expected {self.f_val!r}, but metadata has {self.m_val!r}\"\n )\n\n\nclass MetadataInvalid(InstallationError):\n \"\"\"Metadata is invalid.\"\"\"\n\n def __init__(self, ireq: \"InstallRequirement\", error: str) -> None:\n self.ireq = ireq\n self.error = error\n\n def __str__(self) -> str:\n return f\"Requested {self.ireq} has invalid metadata: {self.error}\"\n\n\nclass InstallationSubprocessError(DiagnosticPipError, InstallationError):\n \"\"\"A subprocess call failed.\"\"\"\n\n reference = \"subprocess-exited-with-error\"\n\n def __init__(\n self,\n *,\n command_description: str,\n exit_code: int,\n output_lines: Optional[List[str]],\n ) -> None:\n if output_lines is None:\n output_prompt = Text(\"See above for output.\")\n else:\n output_prompt = (\n Text.from_markup(f\"[red][{len(output_lines)} lines of output][/]\\n\")\n + Text(\"\".join(output_lines))\n + Text.from_markup(R\"[red]\\[end of output][/]\")\n )\n\n super().__init__(\n message=(\n f\"[green]{escape(command_description)}[/] did not run successfully.\\n\"\n f\"exit code: {exit_code}\"\n ),\n context=output_prompt,\n hint_stmt=None,\n note_stmt=(\n \"This error originates from a subprocess, and is likely not a \"\n \"problem with pip.\"\n ),\n )\n\n self.command_description = command_description\n self.exit_code = exit_code\n\n def __str__(self) -> str:\n return f\"{self.command_description} exited with {self.exit_code}\"\n\n\nclass MetadataGenerationFailed(InstallationSubprocessError, InstallationError):\n reference = \"metadata-generation-failed\"\n\n def __init__(\n self,\n *,\n package_details: str,\n ) -> None:\n super(InstallationSubprocessError, self).__init__(\n message=\"Encountered error while generating package metadata.\",\n context=escape(package_details),\n hint_stmt=\"See above for details.\",\n note_stmt=\"This is an issue with the package mentioned above, not pip.\",\n )\n\n def __str__(self) -> str:\n return \"metadata generation failed\"\n\n\nclass HashErrors(InstallationError):\n \"\"\"Multiple HashError instances rolled into one for reporting\"\"\"\n\n def __init__(self) -> None:\n self.errors: List[HashError] = []\n\n def append(self, error: \"HashError\") -> None:\n self.errors.append(error)\n\n def __str__(self) -> str:\n lines = []\n self.errors.sort(key=lambda e: e.order)\n for cls, errors_of_cls in groupby(self.errors, lambda e: e.__class__):\n lines.append(cls.head)\n lines.extend(e.body() for e in errors_of_cls)\n if lines:\n return \"\\n\".join(lines)\n return \"\"\n\n def __bool__(self) -> bool:\n return bool(self.errors)\n\n\nclass HashError(InstallationError):\n \"\"\"\n A failure to verify a package against known-good hashes\n\n :cvar order: An int sorting hash exception classes by difficulty of\n recovery (lower being harder), so the user doesn't bother fretting\n about unpinned packages when he has deeper issues, like VCS\n dependencies, to deal with. Also keeps error reports in a\n deterministic order.\n :cvar head: A section heading for display above potentially many\n exceptions of this kind\n :ivar req: The InstallRequirement that triggered this error. This is\n pasted on after the exception is instantiated, because it's not\n typically available earlier.\n\n \"\"\"\n\n req: Optional[\"InstallRequirement\"] = None\n head = \"\"\n order: int = -1\n\n def body(self) -> str:\n \"\"\"Return a summary of me for display under the heading.\n\n This default implementation simply prints a description of the\n triggering requirement.\n\n :param req: The InstallRequirement that provoked this error, with\n its link already populated by the resolver's _populate_link().\n\n \"\"\"\n return f\" {self._requirement_name()}\"\n\n def __str__(self) -> str:\n return f\"{self.head}\\n{self.body()}\"\n\n def _requirement_name(self) -> str:\n \"\"\"Return a description of the requirement that triggered me.\n\n This default implementation returns long description of the req, with\n line numbers\n\n \"\"\"\n return str(self.req) if self.req else \"unknown package\"\n\n\nclass VcsHashUnsupported(HashError):\n \"\"\"A hash was provided for a version-control-system-based requirement, but\n we don't have a method for hashing those.\"\"\"\n\n order = 0\n head = (\n \"Can't verify hashes for these requirements because we don't \"\n \"have a way to hash version control repositories:\"\n )\n\n\nclass DirectoryUrlHashUnsupported(HashError):\n \"\"\"A hash was provided for a version-control-system-based requirement, but\n we don't have a method for hashing those.\"\"\"\n\n order = 1\n head = (\n \"Can't verify hashes for these file:// requirements because they \"\n \"point to directories:\"\n )\n\n\nclass HashMissing(HashError):\n \"\"\"A hash was needed for a requirement but is absent.\"\"\"\n\n order = 2\n head = (\n \"Hashes are required in --require-hashes mode, but they are \"\n \"missing from some requirements. Here is a list of those \"\n \"requirements along with the hashes their downloaded archives \"\n \"actually had. Add lines like these to your requirements files to \"\n \"prevent tampering. (If you did not enable --require-hashes \"\n \"manually, note that it turns on automatically when any package \"\n \"has a hash.)\"\n )\n\n def __init__(self, gotten_hash: str) -> None:\n \"\"\"\n :param gotten_hash: The hash of the (possibly malicious) archive we\n just downloaded\n \"\"\"\n self.gotten_hash = gotten_hash\n\n def body(self) -> str:\n # Dodge circular import.\n from pip._internal.utils.hashes import FAVORITE_HASH\n\n package = None\n if self.req:\n # In the case of URL-based requirements, display the original URL\n # seen in the requirements file rather than the package name,\n # so the output can be directly copied into the requirements file.\n package = (\n self.req.original_link\n if self.req.is_direct\n # In case someone feeds something downright stupid\n # to InstallRequirement's constructor.\n else getattr(self.req, \"req\", None)\n )\n return \" {} --hash={}:{}\".format(\n package or \"unknown package\", FAVORITE_HASH, self.gotten_hash\n )\n\n\nclass HashUnpinned(HashError):\n \"\"\"A requirement had a hash specified but was not pinned to a specific\n version.\"\"\"\n\n order = 3\n head = (\n \"In --require-hashes mode, all requirements must have their \"\n \"versions pinned with ==. These do not:\"\n )\n\n\nclass HashMismatch(HashError):\n \"\"\"\n Distribution file hash values don't match.\n\n :ivar package_name: The name of the package that triggered the hash\n mismatch. Feel free to write to this after the exception is raise to\n improve its error message.\n\n \"\"\"\n\n order = 4\n head = (\n \"THESE PACKAGES DO NOT MATCH THE HASHES FROM THE REQUIREMENTS \"\n \"FILE. If you have updated the package versions, please update \"\n \"the hashes. Otherwise, examine the package contents carefully; \"\n \"someone may have tampered with them.\"\n )\n\n def __init__(self, allowed: Dict[str, List[str]], gots: Dict[str, \"_Hash\"]) -> None:\n \"\"\"\n :param allowed: A dict of algorithm names pointing to lists of allowed\n hex digests\n :param gots: A dict of algorithm names pointing to hashes we\n actually got from the files under suspicion\n \"\"\"\n self.allowed = allowed\n self.gots = gots\n\n def body(self) -> str:\n return f\" {self._requirement_name()}:\\n{self._hash_comparison()}\"\n\n def _hash_comparison(self) -> str:\n \"\"\"\n Return a comparison of actual and expected hash values.\n\n Example::\n\n Expected sha256 abcdeabcdeabcdeabcdeabcdeabcdeabcdeabcdeabcde\n or 123451234512345123451234512345123451234512345\n Got bcdefbcdefbcdefbcdefbcdefbcdefbcdefbcdefbcdef\n\n \"\"\"\n\n def hash_then_or(hash_name: str) -> \"chain[str]\":\n # For now, all the decent hashes have 6-char names, so we can get\n # away with hard-coding space literals.\n return chain([hash_name], repeat(\" or\"))\n\n lines: List[str] = []\n for hash_name, expecteds in self.allowed.items():\n prefix = hash_then_or(hash_name)\n lines.extend((f\" Expected {next(prefix)} {e}\") for e in expecteds)\n lines.append(\n f\" Got {self.gots[hash_name].hexdigest()}\\n\"\n )\n return \"\\n\".join(lines)\n\n\nclass UnsupportedPythonVersion(InstallationError):\n \"\"\"Unsupported python version according to Requires-Python package\n metadata.\"\"\"\n\n\nclass ConfigurationFileCouldNotBeLoaded(ConfigurationError):\n \"\"\"When there are errors while loading a configuration file\"\"\"\n\n def __init__(\n self,\n reason: str = \"could not be loaded\",\n fname: Optional[str] = None,\n error: Optional[configparser.Error] = None,\n ) -> None:\n super().__init__(error)\n self.reason = reason\n self.fname = fname\n self.error = error\n\n def __str__(self) -> str:\n if self.fname is not None:\n message_part = f\" in {self.fname}.\"\n else:\n assert self.error is not None\n message_part = f\".\\n{self.error}\\n\"\n return f\"Configuration file {self.reason}{message_part}\"\n\n\n_DEFAULT_EXTERNALLY_MANAGED_ERROR = f\"\"\"\\\nThe Python environment under {sys.prefix} is managed externally, and may not be\nmanipulated by the user. Please use specific tooling from the distributor of\nthe Python installation to interact with this environment instead.\n\"\"\"\n\n\nclass ExternallyManagedEnvironment(DiagnosticPipError):\n \"\"\"The current environment is externally managed.\n\n This is raised when the current environment is externally managed, as\n defined by `PEP 668`_. The ``EXTERNALLY-MANAGED`` configuration is checked\n and displayed when the error is bubbled up to the user.\n\n :param error: The error message read from ``EXTERNALLY-MANAGED``.\n \"\"\"\n\n reference = \"externally-managed-environment\"\n\n def __init__(self, error: Optional[str]) -> None:\n if error is None:\n context = Text(_DEFAULT_EXTERNALLY_MANAGED_ERROR)\n else:\n context = Text(error)\n super().__init__(\n message=\"This environment is externally managed\",\n context=context,\n note_stmt=(\n \"If you believe this is a mistake, please contact your \"\n \"Python installation or OS distribution provider. \"\n \"You can override this, at the risk of breaking your Python \"\n \"installation or OS, by passing --break-system-packages.\"\n ),\n hint_stmt=Text(\"See PEP 668 for the detailed specification.\"),\n )\n\n @staticmethod\n def _iter_externally_managed_error_keys() -> Iterator[str]:\n # LC_MESSAGES is in POSIX, but not the C standard. The most common\n # platform that does not implement this category is Windows, where\n # using other categories for console message localization is equally\n # unreliable, so we fall back to the locale-less vendor message. This\n # can always be re-evaluated when a vendor proposes a new alternative.\n try:\n category = locale.LC_MESSAGES\n except AttributeError:\n lang: Optional[str] = None\n else:\n lang, _ = locale.getlocale(category)\n if lang is not None:\n yield f\"Error-{lang}\"\n for sep in (\"-\", \"_\"):\n before, found, _ = lang.partition(sep)\n if not found:\n continue\n yield f\"Error-{before}\"\n yield \"Error\"\n\n @classmethod\n def from_config(\n cls,\n config: Union[pathlib.Path, str],\n ) -> \"ExternallyManagedEnvironment\":\n parser = configparser.ConfigParser(interpolation=None)\n try:\n parser.read(config, encoding=\"utf-8\")\n section = parser[\"externally-managed\"]\n for key in cls._iter_externally_managed_error_keys():\n with contextlib.suppress(KeyError):\n return cls(section[key])\n except KeyError:\n pass\n except (OSError, UnicodeDecodeError, configparser.ParsingError):\n from pip._internal.utils._log import VERBOSE\n\n exc_info = logger.isEnabledFor(VERBOSE)\n logger.warning(\"Failed to read %s\", config, exc_info=exc_info)\n return cls(None)\n\n\nclass UninstallMissingRecord(DiagnosticPipError):\n reference = \"uninstall-no-record-file\"\n\n def __init__(self, *, distribution: \"BaseDistribution\") -> None:\n installer = distribution.installer\n if not installer or installer == \"pip\":\n dep = f\"{distribution.raw_name}=={distribution.version}\"\n hint = Text.assemble(\n \"You might be able to recover from this via: \",\n (f\"pip install --force-reinstall --no-deps {dep}\", \"green\"),\n )\n else:\n hint = Text(\n f\"The package was installed by {installer}. \"\n \"You should check if it can uninstall the package.\"\n )\n\n super().__init__(\n message=Text(f\"Cannot uninstall {distribution}\"),\n context=(\n \"The package's contents are unknown: \"\n f\"no RECORD file was found for {distribution.raw_name}.\"\n ),\n hint_stmt=hint,\n )\n\n\nclass LegacyDistutilsInstall(DiagnosticPipError):\n reference = \"uninstall-distutils-installed-package\"\n\n def __init__(self, *, distribution: \"BaseDistribution\") -> None:\n super().__init__(\n message=Text(f\"Cannot uninstall {distribution}\"),\n context=(\n \"It is a distutils installed project and thus we cannot accurately \"\n \"determine which files belong to it which would lead to only a partial \"\n \"uninstall.\"\n ),\n hint_stmt=None,\n )\n\n\nclass InvalidInstalledPackage(DiagnosticPipError):\n reference = \"invalid-installed-package\"\n\n def __init__(\n self,\n *,\n dist: \"BaseDistribution\",\n invalid_exc: Union[InvalidRequirement, InvalidVersion],\n ) -> None:\n installed_location = dist.installed_location\n\n if isinstance(invalid_exc, InvalidRequirement):\n invalid_type = \"requirement\"\n else:\n invalid_type = \"version\"\n\n super().__init__(\n message=Text(\n f\"Cannot process installed package {dist} \"\n + (f\"in {installed_location!r} \" if installed_location else \"\")\n + f\"because it has an invalid {invalid_type}:\\n{invalid_exc.args[0]}\"\n ),\n context=(\n \"Starting with pip 24.1, packages with invalid \"\n f\"{invalid_type}s can not be processed.\"\n ),\n hint_stmt=\"To proceed this package must be uninstalled.\",\n )\n\n\nclass IncompleteDownloadError(DiagnosticPipError):\n \"\"\"Raised when the downloader receives fewer bytes than advertised\n in the Content-Length header.\"\"\"\n\n reference = \"incomplete-download\"\n\n def __init__(\n self, link: \"Link\", received: int, expected: int, *, retries: int\n ) -> None:\n # Dodge circular import.\n from pip._internal.utils.misc import format_size\n\n download_status = f\"{format_size(received)}/{format_size(expected)}\"\n if retries:\n retry_status = f\"after {retries} attempts \"\n hint = \"Use --resume-retries to configure resume attempt limit.\"\n else:\n retry_status = \"\"\n hint = \"Consider using --resume-retries to enable download resumption.\"\n message = Text(\n f\"Download failed {retry_status}because not enough bytes \"\n f\"were received ({download_status})\"\n )\n\n super().__init__(\n message=message,\n context=f\"URL: {link.redacted_url}\",\n hint_stmt=hint,\n note_stmt=\"This is an issue with network connectivity, not pip.\",\n )\n\n\nclass ResolutionTooDeepError(DiagnosticPipError):\n \"\"\"Raised when the dependency resolver exceeds the maximum recursion depth.\"\"\"\n\n reference = \"resolution-too-deep\"\n\n def __init__(self) -> None:\n super().__init__(\n message=\"Dependency resolution exceeded maximum depth\",\n context=(\n \"Pip cannot resolve the current dependencies as the dependency graph \"\n \"is too complex for pip to solve efficiently.\"\n ),\n hint_stmt=(\n \"Try adding lower bounds to constrain your dependencies, \"\n \"for example: 'package>=2.0.0' instead of just 'package'. \"\n ),\n link=\"https://pip.pypa.io/en/stable/topics/dependency-resolution/#handling-resolution-too-deep-errors\",\n )\n",[],[100,509,516,523,475,544,1916],{"_104":1924,"_96":612,"_158":1925,"_160":545,"_161":139,"_162":1926,"_164":165,"_106":1927,"_101":29,"_167":215,"_169":1928,"_170":25,"_171":-5,"_172":1929,"_99":1930},"074d3d18-67fc-11f0-aad3-0224a6c84d84","074d3de0-67fc-11f0-aad3-0224a6c84d84",260,["D",1753299259953],"from typing import List, Optional\n\n\ndef main(args: Optional[List[str]] = None) -> int:\n \"\"\"This is preserved for old console scripts that may still be referencing\n it.\n\n For additional details, see https://github.com/pypa/pip/issues/7498.\n \"\"\"\n from pip._internal.utils.entrypoints import _wrapper\n\n return _wrapper(args)\n",[],[100,509,516,523,475,544,612],{"_104":1932,"_96":1933,"_158":1934,"_160":545,"_161":139,"_162":1935,"_164":165,"_106":1936,"_101":29,"_167":215,"_169":1937,"_170":25,"_171":-5,"_172":1938,"_99":1939},"045526f2-67fc-11f0-9d2d-0224a6c84d84","pyproject.py","045527a6-67fc-11f0-9d2d-0224a6c84d84",132,["D",1753299255052],"import importlib.util\nimport os\nimport sys\nfrom collections import namedtuple\nfrom typing import Any, List, Optional\n\nif sys.version_info >= (3, 11):\n import tomllib\nelse:\n from pip._vendor import tomli as tomllib\n\nfrom pip._vendor.packaging.requirements import InvalidRequirement\n\nfrom pip._internal.exceptions import (\n InstallationError,\n InvalidPyProjectBuildRequires,\n MissingPyProjectBuildRequires,\n)\nfrom pip._internal.utils.packaging import get_requirement\n\n\ndef _is_list_of_str(obj: Any) -> bool:\n return isinstance(obj, list) and all(isinstance(item, str) for item in obj)\n\n\ndef make_pyproject_path(unpacked_source_directory: str) -> str:\n return os.path.join(unpacked_source_directory, \"pyproject.toml\")\n\n\nBuildSystemDetails = namedtuple(\n \"BuildSystemDetails\", [\"requires\", \"backend\", \"check\", \"backend_path\"]\n)\n\n\ndef load_pyproject_toml(\n use_pep517: Optional[bool], pyproject_toml: str, setup_py: str, req_name: str\n) -> Optional[BuildSystemDetails]:\n \"\"\"Load the pyproject.toml file.\n\n Parameters:\n use_pep517 - Has the user requested PEP 517 processing? None\n means the user hasn't explicitly specified.\n pyproject_toml - Location of the project's pyproject.toml file\n setup_py - Location of the project's setup.py file\n req_name - The name of the requirement we're processing (for\n error reporting)\n\n Returns:\n None if we should use the legacy code path, otherwise a tuple\n (\n requirements from pyproject.toml,\n name of PEP 517 backend,\n requirements we should check are installed after setting\n up the build environment\n directory paths to import the backend from (backend-path),\n relative to the project root.\n )\n \"\"\"\n has_pyproject = os.path.isfile(pyproject_toml)\n has_setup = os.path.isfile(setup_py)\n\n if not has_pyproject and not has_setup:\n raise InstallationError(\n f\"{req_name} does not appear to be a Python project: \"\n f\"neither 'setup.py' nor 'pyproject.toml' found.\"\n )\n\n if has_pyproject:\n with open(pyproject_toml, encoding=\"utf-8\") as f:\n pp_toml = tomllib.loads(f.read())\n build_system = pp_toml.get(\"build-system\")\n else:\n build_system = None\n\n # The following cases must use PEP 517\n # We check for use_pep517 being non-None and falsy because that means\n # the user explicitly requested --no-use-pep517. The value 0 as\n # opposed to False can occur when the value is provided via an\n # environment variable or config file option (due to the quirk of\n # strtobool() returning an integer in pip's configuration code).\n if has_pyproject and not has_setup:\n if use_pep517 is not None and not use_pep517:\n raise InstallationError(\n \"Disabling PEP 517 processing is invalid: \"\n \"project does not have a setup.py\"\n )\n use_pep517 = True\n elif build_system and \"build-backend\" in build_system:\n if use_pep517 is not None and not use_pep517:\n raise InstallationError(\n \"Disabling PEP 517 processing is invalid: \"\n \"project specifies a build backend of {} \"\n \"in pyproject.toml\".format(build_system[\"build-backend\"])\n )\n use_pep517 = True\n\n # If we haven't worked out whether to use PEP 517 yet,\n # and the user hasn't explicitly stated a preference,\n # we do so if the project has a pyproject.toml file\n # or if we cannot import setuptools or wheels.\n\n # We fallback to PEP 517 when without setuptools or without the wheel package,\n # so setuptools can be installed as a default build backend.\n # For more info see:\n # https://discuss.python.org/t/pip-without-setuptools-could-the-experience-be-improved/11810/9\n # https://github.com/pypa/pip/issues/8559\n elif use_pep517 is None:\n use_pep517 = (\n has_pyproject\n or not importlib.util.find_spec(\"setuptools\")\n or not importlib.util.find_spec(\"wheel\")\n )\n\n # At this point, we know whether we're going to use PEP 517.\n assert use_pep517 is not None\n\n # If we're using the legacy code path, there is nothing further\n # for us to do here.\n if not use_pep517:\n return None\n\n if build_system is None:\n # Either the user has a pyproject.toml with no build-system\n # section, or the user has no pyproject.toml, but has opted in\n # explicitly via --use-pep517.\n # In the absence of any explicit backend specification, we\n # assume the setuptools backend that most closely emulates the\n # traditional direct setup.py execution, and require wheel and\n # a version of setuptools that supports that backend.\n\n build_system = {\n \"requires\": [\"setuptools>=40.8.0\"],\n \"build-backend\": \"setuptools.build_meta:__legacy__\",\n }\n\n # If we're using PEP 517, we have build system information (either\n # from pyproject.toml, or defaulted by the code above).\n # Note that at this point, we do not know if the user has actually\n # specified a backend, though.\n assert build_system is not None\n\n # Ensure that the build-system section in pyproject.toml conforms\n # to PEP 518.\n\n # Specifying the build-system table but not the requires key is invalid\n if \"requires\" not in build_system:\n raise MissingPyProjectBuildRequires(package=req_name)\n\n # Error out if requires is not a list of strings\n requires = build_system[\"requires\"]\n if not _is_list_of_str(requires):\n raise InvalidPyProjectBuildRequires(\n package=req_name,\n reason=\"It is not a list of strings.\",\n )\n\n # Each requirement must be valid as per PEP 508\n for requirement in requires:\n try:\n get_requirement(requirement)\n except InvalidRequirement as error:\n raise InvalidPyProjectBuildRequires(\n package=req_name,\n reason=f\"It contains an invalid requirement: {requirement!r}\",\n ) from error\n\n backend = build_system.get(\"build-backend\")\n backend_path = build_system.get(\"backend-path\", [])\n check: List[str] = []\n if backend is None:\n # If the user didn't specify a backend, we assume they want to use\n # the setuptools backend. But we can't be sure they have included\n # a version of setuptools which supplies the backend. So we\n # make a note to check that this requirement is present once\n # we have set up the environment.\n # This is quite a lot of work to check for a very specific case. But\n # the problem is, that case is potentially quite common - projects that\n # adopted PEP 518 early for the ability to specify requirements to\n # execute setup.py, but never considered needing to mention the build\n # tools themselves. The original PEP 518 code had a similar check (but\n # implemented in a different way).\n backend = \"setuptools.build_meta:__legacy__\"\n check = [\"setuptools>=40.8.0\"]\n\n return BuildSystemDetails(requires, backend, check, backend_path)\n",[],[100,509,516,523,475,544,1933],{"_104":1941,"_96":1942,"_158":1943,"_160":545,"_161":139,"_162":1944,"_164":165,"_106":1945,"_101":29,"_167":215,"_169":1946,"_170":25,"_171":-5,"_172":1947,"_99":1948},"07a5e76a-67fc-11f0-9cad-0224a6c84d84","self_outdated_check.py","07a5e828-67fc-11f0-9cad-0224a6c84d84",273,["D",1753299260601],"import datetime\nimport functools\nimport hashlib\nimport json\nimport logging\nimport optparse\nimport os.path\nimport sys\nfrom dataclasses import dataclass\nfrom typing import Any, Callable, Dict, Optional\n\nfrom pip._vendor.packaging.version import Version\nfrom pip._vendor.packaging.version import parse as parse_version\nfrom pip._vendor.rich.console import Group\nfrom pip._vendor.rich.markup import escape\nfrom pip._vendor.rich.text import Text\n\nfrom pip._internal.index.collector import LinkCollector\nfrom pip._internal.index.package_finder import PackageFinder\nfrom pip._internal.metadata import get_default_environment\nfrom pip._internal.models.selection_prefs import SelectionPreferences\nfrom pip._internal.network.session import PipSession\nfrom pip._internal.utils.compat import WINDOWS\nfrom pip._internal.utils.entrypoints import (\n get_best_invocation_for_this_pip,\n get_best_invocation_for_this_python,\n)\nfrom pip._internal.utils.filesystem import adjacent_tmp_file, check_path_owner, replace\nfrom pip._internal.utils.misc import (\n ExternallyManagedEnvironment,\n check_externally_managed,\n ensure_dir,\n)\n\n_WEEK = datetime.timedelta(days=7)\n\nlogger = logging.getLogger(__name__)\n\n\ndef _get_statefile_name(key: str) -> str:\n key_bytes = key.encode()\n name = hashlib.sha224(key_bytes).hexdigest()\n return name\n\n\ndef _convert_date(isodate: str) -> datetime.datetime:\n \"\"\"Convert an ISO format string to a date.\n\n Handles the format 2020-01-22T14:24:01Z (trailing Z)\n which is not supported by older versions of fromisoformat.\n \"\"\"\n return datetime.datetime.fromisoformat(isodate.replace(\"Z\", \"+00:00\"))\n\n\nclass SelfCheckState:\n def __init__(self, cache_dir: str) -> None:\n self._state: Dict[str, Any] = {}\n self._statefile_path = None\n\n # Try to load the existing state\n if cache_dir:\n self._statefile_path = os.path.join(\n cache_dir, \"selfcheck\", _get_statefile_name(self.key)\n )\n try:\n with open(self._statefile_path, encoding=\"utf-8\") as statefile:\n self._state = json.load(statefile)\n except (OSError, ValueError, KeyError):\n # Explicitly suppressing exceptions, since we don't want to\n # error out if the cache file is invalid.\n pass\n\n @property\n def key(self) -> str:\n return sys.prefix\n\n def get(self, current_time: datetime.datetime) -> Optional[str]:\n \"\"\"Check if we have a not-outdated version loaded already.\"\"\"\n if not self._state:\n return None\n\n if \"last_check\" not in self._state:\n return None\n\n if \"pypi_version\" not in self._state:\n return None\n\n # Determine if we need to refresh the state\n last_check = _convert_date(self._state[\"last_check\"])\n time_since_last_check = current_time - last_check\n if time_since_last_check > _WEEK:\n return None\n\n return self._state[\"pypi_version\"]\n\n def set(self, pypi_version: str, current_time: datetime.datetime) -> None:\n # If we do not have a path to cache in, don't bother saving.\n if not self._statefile_path:\n return\n\n # Check to make sure that we own the directory\n if not check_path_owner(os.path.dirname(self._statefile_path)):\n return\n\n # Now that we've ensured the directory is owned by this user, we'll go\n # ahead and make sure that all our directories are created.\n ensure_dir(os.path.dirname(self._statefile_path))\n\n state = {\n # Include the key so it's easy to tell which pip wrote the\n # file.\n \"key\": self.key,\n \"last_check\": current_time.isoformat(),\n \"pypi_version\": pypi_version,\n }\n\n text = json.dumps(state, sort_keys=True, separators=(\",\", \":\"))\n\n with adjacent_tmp_file(self._statefile_path) as f:\n f.write(text.encode())\n\n try:\n # Since we have a prefix-specific state file, we can just\n # overwrite whatever is there, no need to check.\n replace(f.name, self._statefile_path)\n except OSError:\n # Best effort.\n pass\n\n\n@dataclass\nclass UpgradePrompt:\n old: str\n new: str\n\n def __rich__(self) -> Group:\n if WINDOWS:\n pip_cmd = f\"{get_best_invocation_for_this_python()} -m pip\"\n else:\n pip_cmd = get_best_invocation_for_this_pip()\n\n notice = \"[bold][[reset][blue]notice[reset][bold]][reset]\"\n return Group(\n Text(),\n Text.from_markup(\n f\"{notice} A new release of pip is available: \"\n f\"[red]{self.old}[reset] -> [green]{self.new}[reset]\"\n ),\n Text.from_markup(\n f\"{notice} To update, run: \"\n f\"[green]{escape(pip_cmd)} install --upgrade pip\"\n ),\n )\n\n\ndef was_installed_by_pip(pkg: str) -> bool:\n \"\"\"Checks whether pkg was installed by pip\n\n This is used not to display the upgrade message when pip is in fact\n installed by system package manager, such as dnf on Fedora.\n \"\"\"\n dist = get_default_environment().get_distribution(pkg)\n return dist is not None and \"pip\" == dist.installer\n\n\ndef _get_current_remote_pip_version(\n session: PipSession, options: optparse.Values\n) -> Optional[str]:\n # Lets use PackageFinder to see what the latest pip version is\n link_collector = LinkCollector.create(\n session,\n options=options,\n suppress_no_index=True,\n )\n\n # Pass allow_yanked=False so we don't suggest upgrading to a\n # yanked version.\n selection_prefs = SelectionPreferences(\n allow_yanked=False,\n allow_all_prereleases=False, # Explicitly set to False\n )\n\n finder = PackageFinder.create(\n link_collector=link_collector,\n selection_prefs=selection_prefs,\n )\n best_candidate = finder.find_best_candidate(\"pip\").best_candidate\n if best_candidate is None:\n return None\n\n return str(best_candidate.version)\n\n\ndef _self_version_check_logic(\n *,\n state: SelfCheckState,\n current_time: datetime.datetime,\n local_version: Version,\n get_remote_version: Callable[[], Optional[str]],\n) -> Optional[UpgradePrompt]:\n remote_version_str = state.get(current_time)\n if remote_version_str is None:\n remote_version_str = get_remote_version()\n if remote_version_str is None:\n logger.debug(\"No remote pip version found\")\n return None\n state.set(remote_version_str, current_time)\n\n remote_version = parse_version(remote_version_str)\n logger.debug(\"Remote version of pip: %s\", remote_version)\n logger.debug(\"Local version of pip: %s\", local_version)\n\n pip_installed_by_pip = was_installed_by_pip(\"pip\")\n logger.debug(\"Was pip installed by pip? %s\", pip_installed_by_pip)\n if not pip_installed_by_pip:\n return None # Only suggest upgrade if pip is installed by pip.\n\n local_version_is_older = (\n local_version < remote_version\n and local_version.base_version != remote_version.base_version\n )\n if local_version_is_older:\n return UpgradePrompt(old=str(local_version), new=remote_version_str)\n\n return None\n\n\ndef pip_self_version_check(session: PipSession, options: optparse.Values) -> None:\n \"\"\"Check for an update for pip.\n\n Limit the frequency of checks to once per week. State is stored either in\n the active virtualenv or in the user's USER_CACHE_DIR keyed off the prefix\n of the pip script path.\n \"\"\"\n installed_dist = get_default_environment().get_distribution(\"pip\")\n if not installed_dist:\n return\n try:\n check_externally_managed()\n except ExternallyManagedEnvironment:\n return\n\n upgrade_prompt = _self_version_check_logic(\n state=SelfCheckState(cache_dir=options.cache_dir),\n current_time=datetime.datetime.now(datetime.timezone.utc),\n local_version=installed_dist.version,\n get_remote_version=functools.partial(\n _get_current_remote_pip_version, session, options\n ),\n )\n if upgrade_prompt is not None:\n logger.warning(\"%s\", upgrade_prompt, extra={\"rich\": True})\n",[],[100,509,516,523,475,544,1942],{"_104":1950,"_96":1951,"_158":1952,"_160":545,"_161":139,"_162":1953,"_164":165,"_106":1954,"_101":29,"_167":215,"_169":1955,"_170":25,"_171":-5,"_172":1956,"_99":1957},"0744007c-67fc-11f0-9cad-0224a6c84d84","wheel_builder.py","0744011c-67fc-11f0-9cad-0224a6c84d84",259,["D",1753299259958],"\"\"\"Orchestrator for building wheels from InstallRequirements.\"\"\"\n\nimport logging\nimport os.path\nimport re\nimport shutil\nfrom typing import Iterable, List, Optional, Tuple\n\nfrom pip._vendor.packaging.utils import canonicalize_name, canonicalize_version\nfrom pip._vendor.packaging.version import InvalidVersion, Version\n\nfrom pip._internal.cache import WheelCache\nfrom pip._internal.exceptions import InvalidWheelFilename, UnsupportedWheel\nfrom pip._internal.metadata import FilesystemWheel, get_wheel_distribution\nfrom pip._internal.models.link import Link\nfrom pip._internal.models.wheel import Wheel\nfrom pip._internal.operations.build.wheel import build_wheel_pep517\nfrom pip._internal.operations.build.wheel_editable import build_wheel_editable\nfrom pip._internal.operations.build.wheel_legacy import build_wheel_legacy\nfrom pip._internal.req.req_install import InstallRequirement\nfrom pip._internal.utils.logging import indent_log\nfrom pip._internal.utils.misc import ensure_dir, hash_file\nfrom pip._internal.utils.setuptools_build import make_setuptools_clean_args\nfrom pip._internal.utils.subprocess import call_subprocess\nfrom pip._internal.utils.temp_dir import TempDirectory\nfrom pip._internal.utils.urls import path_to_url\nfrom pip._internal.vcs import vcs\n\nlogger = logging.getLogger(__name__)\n\n_egg_info_re = re.compile(r\"([a-z0-9_.]+)-([a-z0-9_.!+-]+)\", re.IGNORECASE)\n\nBuildResult = Tuple[List[InstallRequirement], List[InstallRequirement]]\n\n\ndef _contains_egg_info(s: str) -> bool:\n \"\"\"Determine whether the string looks like an egg_info.\n\n :param s: The string to parse. E.g. foo-2.1\n \"\"\"\n return bool(_egg_info_re.search(s))\n\n\ndef _should_build(\n req: InstallRequirement,\n) -> bool:\n \"\"\"Return whether an InstallRequirement should be built into a wheel.\"\"\"\n assert not req.constraint\n\n if req.is_wheel:\n return False\n\n assert req.source_dir\n\n if req.editable:\n # we only build PEP 660 editable requirements\n return req.supports_pyproject_editable\n\n return True\n\n\ndef should_build_for_install_command(\n req: InstallRequirement,\n) -> bool:\n return _should_build(req)\n\n\ndef _should_cache(\n req: InstallRequirement,\n) -> Optional[bool]:\n \"\"\"\n Return whether a built InstallRequirement can be stored in the persistent\n wheel cache, assuming the wheel cache is available, and _should_build()\n has determined a wheel needs to be built.\n \"\"\"\n if req.editable or not req.source_dir:\n # never cache editable requirements\n return False\n\n if req.link and req.link.is_vcs:\n # VCS checkout. Do not cache\n # unless it points to an immutable commit hash.\n assert not req.editable\n assert req.source_dir\n vcs_backend = vcs.get_backend_for_scheme(req.link.scheme)\n assert vcs_backend\n if vcs_backend.is_immutable_rev_checkout(req.link.url, req.source_dir):\n return True\n return False\n\n assert req.link\n base, ext = req.link.splitext()\n if _contains_egg_info(base):\n return True\n\n # Otherwise, do not cache.\n return False\n\n\ndef _get_cache_dir(\n req: InstallRequirement,\n wheel_cache: WheelCache,\n) -> str:\n \"\"\"Return the persistent or temporary cache directory where the built\n wheel need to be stored.\n \"\"\"\n cache_available = bool(wheel_cache.cache_dir)\n assert req.link\n if cache_available and _should_cache(req):\n cache_dir = wheel_cache.get_path_for_link(req.link)\n else:\n cache_dir = wheel_cache.get_ephem_path_for_link(req.link)\n return cache_dir\n\n\ndef _verify_one(req: InstallRequirement, wheel_path: str) -> None:\n canonical_name = canonicalize_name(req.name or \"\")\n w = Wheel(os.path.basename(wheel_path))\n if canonicalize_name(w.name) != canonical_name:\n raise InvalidWheelFilename(\n f\"Wheel has unexpected file name: expected {canonical_name!r}, \"\n f\"got {w.name!r}\",\n )\n dist = get_wheel_distribution(FilesystemWheel(wheel_path), canonical_name)\n dist_verstr = str(dist.version)\n if canonicalize_version(dist_verstr) != canonicalize_version(w.version):\n raise InvalidWheelFilename(\n f\"Wheel has unexpected file name: expected {dist_verstr!r}, \"\n f\"got {w.version!r}\",\n )\n metadata_version_value = dist.metadata_version\n if metadata_version_value is None:\n raise UnsupportedWheel(\"Missing Metadata-Version\")\n try:\n metadata_version = Version(metadata_version_value)\n except InvalidVersion:\n msg = f\"Invalid Metadata-Version: {metadata_version_value}\"\n raise UnsupportedWheel(msg)\n if metadata_version >= Version(\"1.2\") and not isinstance(dist.version, Version):\n raise UnsupportedWheel(\n f\"Metadata 1.2 mandates PEP 440 version, but {dist_verstr!r} is not\"\n )\n\n\ndef _build_one(\n req: InstallRequirement,\n output_dir: str,\n verify: bool,\n build_options: List[str],\n global_options: List[str],\n editable: bool,\n) -> Optional[str]:\n \"\"\"Build one wheel.\n\n :return: The filename of the built wheel, or None if the build failed.\n \"\"\"\n artifact = \"editable\" if editable else \"wheel\"\n try:\n ensure_dir(output_dir)\n except OSError as e:\n logger.warning(\n \"Building %s for %s failed: %s\",\n artifact,\n req.name,\n e,\n )\n return None\n\n # Install build deps into temporary directory (PEP 518)\n with req.build_env:\n wheel_path = _build_one_inside_env(\n req, output_dir, build_options, global_options, editable\n )\n if wheel_path and verify:\n try:\n _verify_one(req, wheel_path)\n except (InvalidWheelFilename, UnsupportedWheel) as e:\n logger.warning(\"Built %s for %s is invalid: %s\", artifact, req.name, e)\n return None\n return wheel_path\n\n\ndef _build_one_inside_env(\n req: InstallRequirement,\n output_dir: str,\n build_options: List[str],\n global_options: List[str],\n editable: bool,\n) -> Optional[str]:\n with TempDirectory(kind=\"wheel\") as temp_dir:\n assert req.name\n if req.use_pep517:\n assert req.metadata_directory\n assert req.pep517_backend\n if global_options:\n logger.warning(\n \"Ignoring --global-option when building %s using PEP 517\", req.name\n )\n if build_options:\n logger.warning(\n \"Ignoring --build-option when building %s using PEP 517\", req.name\n )\n if editable:\n wheel_path = build_wheel_editable(\n name=req.name,\n backend=req.pep517_backend,\n metadata_directory=req.metadata_directory,\n tempd=temp_dir.path,\n )\n else:\n wheel_path = build_wheel_pep517(\n name=req.name,\n backend=req.pep517_backend,\n metadata_directory=req.metadata_directory,\n tempd=temp_dir.path,\n )\n else:\n wheel_path = build_wheel_legacy(\n name=req.name,\n setup_py_path=req.setup_py_path,\n source_dir=req.unpacked_source_directory,\n global_options=global_options,\n build_options=build_options,\n tempd=temp_dir.path,\n )\n\n if wheel_path is not None:\n wheel_name = os.path.basename(wheel_path)\n dest_path = os.path.join(output_dir, wheel_name)\n try:\n wheel_hash, length = hash_file(wheel_path)\n shutil.move(wheel_path, dest_path)\n logger.info(\n \"Created wheel for %s: filename=%s size=%d sha256=%s\",\n req.name,\n wheel_name,\n length,\n wheel_hash.hexdigest(),\n )\n logger.info(\"Stored in directory: %s\", output_dir)\n return dest_path\n except Exception as e:\n logger.warning(\n \"Building wheel for %s failed: %s\",\n req.name,\n e,\n )\n # Ignore return, we can't do anything else useful.\n if not req.use_pep517:\n _clean_one_legacy(req, global_options)\n return None\n\n\ndef _clean_one_legacy(req: InstallRequirement, global_options: List[str]) -> bool:\n clean_args = make_setuptools_clean_args(\n req.setup_py_path,\n global_options=global_options,\n )\n\n logger.info(\"Running setup.py clean for %s\", req.name)\n try:\n call_subprocess(\n clean_args, command_desc=\"python setup.py clean\", cwd=req.source_dir\n )\n return True\n except Exception:\n logger.error(\"Failed cleaning build dir for %s\", req.name)\n return False\n\n\ndef build(\n requirements: Iterable[InstallRequirement],\n wheel_cache: WheelCache,\n verify: bool,\n build_options: List[str],\n global_options: List[str],\n) -> BuildResult:\n \"\"\"Build wheels.\n\n :return: The list of InstallRequirement that succeeded to build and\n the list of InstallRequirement that failed to build.\n \"\"\"\n if not requirements:\n return [], []\n\n # Build the wheels.\n logger.info(\n \"Building wheels for collected packages: %s\",\n \", \".join(req.name for req in requirements), # type: ignore\n )\n\n with indent_log():\n build_successes, build_failures = [], []\n for req in requirements:\n assert req.name\n cache_dir = _get_cache_dir(req, wheel_cache)\n wheel_file = _build_one(\n req,\n cache_dir,\n verify,\n build_options,\n global_options,\n req.editable and req.permit_editable_wheels,\n )\n if wheel_file:\n # Record the download origin in the cache\n if req.download_info is not None:\n # download_info is guaranteed to be set because when we build an\n # InstallRequirement it has been through the preparer before, but\n # let's be cautious.\n wheel_cache.record_download_origin(cache_dir, req.download_info)\n # Update the link for this.\n req.link = Link(path_to_url(wheel_file))\n req.local_file_path = req.link.file_path\n assert req.link.is_wheel\n build_successes.append(req)\n else:\n build_failures.append(req)\n\n # notify success/failure\n if build_successes:\n logger.info(\n \"Successfully built %s\",\n \" \".join([req.name for req in build_successes]), # type: ignore\n )\n if build_failures:\n logger.info(\n \"Failed to build %s\",\n \" \".join([req.name for req in build_failures]), # type: ignore\n )\n # Return a list of requirements that failed to build\n return build_successes, build_failures\n",[],[100,509,516,523,475,544,1951],[100,509,516,523,475,544],{"_104":1960,"_96":1961,"_158":1962,"_160":538,"_161":139,"_162":1963,"_164":165,"_106":1964,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1965,"_99":4420},"fb750b1a-67fb-11f0-b654-0224a6c84d84","_vendor","fb750bb0-67fb-11f0-b654-0224a6c84d84",53,["D",1753299240147],[1966,2087,2121,2181,2301,2334,2402,2444,2597,2605,2682,2920,2970,3132,3225,3904,3955,3987,4047,4403,4411],{"_104":1967,"_96":1968,"_158":1969,"_160":1962,"_161":139,"_162":1970,"_164":165,"_106":1971,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1972,"_99":2086},"fe1c1458-67fb-11f0-a7d9-0224a6c84d84","cachecontrol","fe1c150c-67fb-11f0-a7d9-0224a6c84d84",77,["D",1753299244612],[1973,2007,2015,2024,2033,2041,2050,2059,2068,2077],{"_104":1974,"_96":1975,"_158":1976,"_160":1969,"_161":139,"_162":1977,"_164":165,"_106":1978,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":1979,"_99":2006},"02ed850c-67fc-11f0-805e-0224a6c84d84","caches","02ed8606-67fc-11f0-805e-0224a6c84d84",99,["D",1753299252696],[1980,1988,1997],{"_104":1981,"_96":558,"_158":1982,"_160":1976,"_161":139,"_162":1983,"_164":165,"_106":1984,"_101":29,"_167":215,"_169":1985,"_170":25,"_171":-5,"_172":1986,"_99":1987},"09dd4e24-67fc-11f0-9b65-0224a6c84d84","09dd4f00-67fc-11f0-9b65-0224a6c84d84",357,["D",1753299264334],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\n\nfrom pip._vendor.cachecontrol.caches.file_cache import FileCache, SeparateBodyFileCache\nfrom pip._vendor.cachecontrol.caches.redis_cache import RedisCache\n\n__all__ = [\"FileCache\", \"SeparateBodyFileCache\", \"RedisCache\"]\n",[],[100,509,516,523,475,1961,1968,1975,558],{"_104":1989,"_96":1990,"_158":1991,"_160":1976,"_161":139,"_162":1992,"_164":165,"_106":1993,"_101":29,"_167":215,"_169":1994,"_170":25,"_171":-5,"_172":1995,"_99":1996},"09d3cd36-67fc-11f0-8d4e-0224a6c84d84","file_cache.py","09d3cdea-67fc-11f0-8d4e-0224a6c84d84",356,["D",1753299264270],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport hashlib\nimport os\nimport tempfile\nfrom textwrap import dedent\nfrom typing import IO, TYPE_CHECKING\nfrom pathlib import Path\n\nfrom pip._vendor.cachecontrol.cache import BaseCache, SeparateBodyBaseCache\nfrom pip._vendor.cachecontrol.controller import CacheController\n\nif TYPE_CHECKING:\n from datetime import datetime\n\n from filelock import BaseFileLock\n\n\nclass _FileCacheMixin:\n \"\"\"Shared implementation for both FileCache variants.\"\"\"\n\n def __init__(\n self,\n directory: str | Path,\n forever: bool = False,\n filemode: int = 0o0600,\n dirmode: int = 0o0700,\n lock_class: type[BaseFileLock] | None = None,\n ) -> None:\n try:\n if lock_class is None:\n from filelock import FileLock\n\n lock_class = FileLock\n except ImportError:\n notice = dedent(\n \"\"\"\n NOTE: In order to use the FileCache you must have\n filelock installed. You can install it via pip:\n pip install cachecontrol[filecache]\n \"\"\"\n )\n raise ImportError(notice)\n\n self.directory = directory\n self.forever = forever\n self.filemode = filemode\n self.dirmode = dirmode\n self.lock_class = lock_class\n\n @staticmethod\n def encode(x: str) -> str:\n return hashlib.sha224(x.encode()).hexdigest()\n\n def _fn(self, name: str) -> str:\n # NOTE: This method should not change as some may depend on it.\n # See: https://github.com/ionrock/cachecontrol/issues/63\n hashed = self.encode(name)\n parts = list(hashed[:5]) + [hashed]\n return os.path.join(self.directory, *parts)\n\n def get(self, key: str) -> bytes | None:\n name = self._fn(key)\n try:\n with open(name, \"rb\") as fh:\n return fh.read()\n\n except FileNotFoundError:\n return None\n\n def set(\n self, key: str, value: bytes, expires: int | datetime | None = None\n ) -> None:\n name = self._fn(key)\n self._write(name, value)\n\n def _write(self, path: str, data: bytes) -> None:\n \"\"\"\n Safely write the data to the given path.\n \"\"\"\n # Make sure the directory exists\n dirname = os.path.dirname(path)\n os.makedirs(dirname, self.dirmode, exist_ok=True)\n\n with self.lock_class(path + \".lock\"):\n # Write our actual file\n (fd, name) = tempfile.mkstemp(dir=dirname)\n try:\n os.write(fd, data)\n finally:\n os.close(fd)\n os.chmod(name, self.filemode)\n os.replace(name, path)\n\n def _delete(self, key: str, suffix: str) -> None:\n name = self._fn(key) + suffix\n if not self.forever:\n try:\n os.remove(name)\n except FileNotFoundError:\n pass\n\n\nclass FileCache(_FileCacheMixin, BaseCache):\n \"\"\"\n Traditional FileCache: body is stored in memory, so not suitable for large\n downloads.\n \"\"\"\n\n def delete(self, key: str) -> None:\n self._delete(key, \"\")\n\n\nclass SeparateBodyFileCache(_FileCacheMixin, SeparateBodyBaseCache):\n \"\"\"\n Memory-efficient FileCache: body is stored in a separate file, reducing\n peak memory usage.\n \"\"\"\n\n def get_body(self, key: str) -> IO[bytes] | None:\n name = self._fn(key) + \".body\"\n try:\n return open(name, \"rb\")\n except FileNotFoundError:\n return None\n\n def set_body(self, key: str, body: bytes) -> None:\n name = self._fn(key) + \".body\"\n self._write(name, body)\n\n def delete(self, key: str) -> None:\n self._delete(key, \"\")\n self._delete(key, \".body\")\n\n\ndef url_to_file_path(url: str, filecache: FileCache) -> str:\n \"\"\"Return the file cache path based on the URL.\n\n This does not ensure the file exists!\n \"\"\"\n key = CacheController.cache_url(url)\n return filecache._fn(key)\n",[],[100,509,516,523,475,1961,1968,1975,1990],{"_104":1998,"_96":1999,"_158":2000,"_160":1976,"_161":139,"_162":2001,"_164":165,"_106":2002,"_101":29,"_167":215,"_169":2003,"_170":25,"_171":-5,"_172":2004,"_99":2005},"09e32452-67fc-11f0-85ab-0224a6c84d84","redis_cache.py","09e32524-67fc-11f0-85ab-0224a6c84d84",358,["D",1753299264336],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\n\nfrom datetime import datetime, timezone\nfrom typing import TYPE_CHECKING\n\nfrom pip._vendor.cachecontrol.cache import BaseCache\n\nif TYPE_CHECKING:\n from redis import Redis\n\n\nclass RedisCache(BaseCache):\n def __init__(self, conn: Redis[bytes]) -> None:\n self.conn = conn\n\n def get(self, key: str) -> bytes | None:\n return self.conn.get(key)\n\n def set(\n self, key: str, value: bytes, expires: int | datetime | None = None\n ) -> None:\n if not expires:\n self.conn.set(key, value)\n elif isinstance(expires, datetime):\n now_utc = datetime.now(timezone.utc)\n if expires.tzinfo is None:\n now_utc = now_utc.replace(tzinfo=None)\n delta = expires - now_utc\n self.conn.setex(key, int(delta.total_seconds()), value)\n else:\n self.conn.setex(key, expires, value)\n\n def delete(self, key: str) -> None:\n self.conn.delete(key)\n\n def clear(self) -> None:\n \"\"\"Helper for clearing all the keys in a database. Use with\n caution!\"\"\"\n for key in self.conn.keys():\n self.conn.delete(key)\n\n def close(self) -> None:\n \"\"\"Redis uses connection pooling, no need to close the connection.\"\"\"\n pass\n",[],[100,509,516,523,475,1961,1968,1975,1999],[100,509,516,523,475,1961,1968,1975],{"_104":2008,"_96":558,"_158":2009,"_160":1969,"_161":139,"_162":2010,"_164":165,"_106":2011,"_101":29,"_167":215,"_169":2012,"_170":25,"_171":-5,"_172":2013,"_99":2014},"09cdd854-67fc-11f0-9ad5-0224a6c84d84","09cdd908-67fc-11f0-9ad5-0224a6c84d84",355,["D",1753299264220],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\n\n\"\"\"CacheControl import Interface.\n\nMake it easy to import from cachecontrol without long namespaces.\n\"\"\"\n\n__author__ = \"Eric Larson\"\n__email__ = \"eric@ionrock.org\"\n__version__ = \"0.14.2\"\n\nfrom pip._vendor.cachecontrol.adapter import CacheControlAdapter\nfrom pip._vendor.cachecontrol.controller import CacheController\nfrom pip._vendor.cachecontrol.wrapper import CacheControl\n\n__all__ = [\n \"__author__\",\n \"__email__\",\n \"__version__\",\n \"CacheControlAdapter\",\n \"CacheController\",\n \"CacheControl\",\n]\n\nimport logging\n\nlogging.getLogger(__name__).addHandler(logging.NullHandler())\n",[],[100,509,516,523,475,1961,1968,558],{"_104":2016,"_96":2017,"_158":2018,"_160":1969,"_161":139,"_162":2019,"_164":165,"_106":2020,"_101":29,"_167":215,"_169":2021,"_170":25,"_171":-5,"_172":2022,"_99":2023},"09cb1128-67fc-11f0-9b65-0224a6c84d84","_cmd.py","09cb11fa-67fc-11f0-9b65-0224a6c84d84",354,["D",1753299264214],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport logging\nfrom argparse import ArgumentParser\nfrom typing import TYPE_CHECKING\n\nfrom pip._vendor import requests\n\nfrom pip._vendor.cachecontrol.adapter import CacheControlAdapter\nfrom pip._vendor.cachecontrol.cache import DictCache\nfrom pip._vendor.cachecontrol.controller import logger\n\nif TYPE_CHECKING:\n from argparse import Namespace\n\n from pip._vendor.cachecontrol.controller import CacheController\n\n\ndef setup_logging() -> None:\n logger.setLevel(logging.DEBUG)\n handler = logging.StreamHandler()\n logger.addHandler(handler)\n\n\ndef get_session() -> requests.Session:\n adapter = CacheControlAdapter(\n DictCache(), cache_etags=True, serializer=None, heuristic=None\n )\n sess = requests.Session()\n sess.mount(\"http://\", adapter)\n sess.mount(\"https://\", adapter)\n\n sess.cache_controller = adapter.controller # type: ignore[attr-defined]\n return sess\n\n\ndef get_args() -> Namespace:\n parser = ArgumentParser()\n parser.add_argument(\"url\", help=\"The URL to try and cache\")\n return parser.parse_args()\n\n\ndef main() -> None:\n args = get_args()\n sess = get_session()\n\n # Make a request to get a response\n resp = sess.get(args.url)\n\n # Turn on logging\n setup_logging()\n\n # try setting the cache\n cache_controller: CacheController = (\n sess.cache_controller # type: ignore[attr-defined]\n )\n cache_controller.cache_response(resp.request, resp.raw)\n\n # Now try to get it\n if cache_controller.cached_request(resp.request):\n print(\"Cached!\")\n else:\n print(\"Not cached :(\")\n\n\nif __name__ == \"__main__\":\n main()\n",[],[100,509,516,523,475,1961,1968,2017],{"_104":2025,"_96":2026,"_158":2027,"_160":1969,"_161":139,"_162":2028,"_164":165,"_106":2029,"_101":29,"_167":215,"_169":2030,"_170":25,"_171":-5,"_172":2031,"_99":2032},"09bc5cc8-67fc-11f0-a319-0224a6c84d84","adapter.py","09bc5d7c-67fc-11f0-a319-0224a6c84d84",352,["D",1753299264116],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport functools\nimport types\nimport weakref\nimport zlib\nfrom typing import TYPE_CHECKING, Any, Collection, Mapping\n\nfrom pip._vendor.requests.adapters import HTTPAdapter\n\nfrom pip._vendor.cachecontrol.cache import DictCache\nfrom pip._vendor.cachecontrol.controller import PERMANENT_REDIRECT_STATUSES, CacheController\nfrom pip._vendor.cachecontrol.filewrapper import CallbackFileWrapper\n\nif TYPE_CHECKING:\n from pip._vendor.requests import PreparedRequest, Response\n from pip._vendor.urllib3 import HTTPResponse\n\n from pip._vendor.cachecontrol.cache import BaseCache\n from pip._vendor.cachecontrol.heuristics import BaseHeuristic\n from pip._vendor.cachecontrol.serialize import Serializer\n\n\nclass CacheControlAdapter(HTTPAdapter):\n invalidating_methods = {\"PUT\", \"PATCH\", \"DELETE\"}\n\n def __init__(\n self,\n cache: BaseCache | None = None,\n cache_etags: bool = True,\n controller_class: type[CacheController] | None = None,\n serializer: Serializer | None = None,\n heuristic: BaseHeuristic | None = None,\n cacheable_methods: Collection[str] | None = None,\n *args: Any,\n **kw: Any,\n ) -> None:\n super().__init__(*args, **kw)\n self.cache = DictCache() if cache is None else cache\n self.heuristic = heuristic\n self.cacheable_methods = cacheable_methods or (\"GET\",)\n\n controller_factory = controller_class or CacheController\n self.controller = controller_factory(\n self.cache, cache_etags=cache_etags, serializer=serializer\n )\n\n def send(\n self,\n request: PreparedRequest,\n stream: bool = False,\n timeout: None | float | tuple[float, float] | tuple[float, None] = None,\n verify: bool | str = True,\n cert: (None | bytes | str | tuple[bytes | str, bytes | str]) = None,\n proxies: Mapping[str, str] | None = None,\n cacheable_methods: Collection[str] | None = None,\n ) -> Response:\n \"\"\"\n Send a request. Use the request information to see if it\n exists in the cache and cache the response if we need to and can.\n \"\"\"\n cacheable = cacheable_methods or self.cacheable_methods\n if request.method in cacheable:\n try:\n cached_response = self.controller.cached_request(request)\n except zlib.error:\n cached_response = None\n if cached_response:\n return self.build_response(request, cached_response, from_cache=True)\n\n # check for etags and add headers if appropriate\n request.headers.update(self.controller.conditional_headers(request))\n\n resp = super().send(request, stream, timeout, verify, cert, proxies)\n\n return resp\n\n def build_response( # type: ignore[override]\n self,\n request: PreparedRequest,\n response: HTTPResponse,\n from_cache: bool = False,\n cacheable_methods: Collection[str] | None = None,\n ) -> Response:\n \"\"\"\n Build a response by making a request or using the cache.\n\n This will end up calling send and returning a potentially\n cached response\n \"\"\"\n cacheable = cacheable_methods or self.cacheable_methods\n if not from_cache and request.method in cacheable:\n # Check for any heuristics that might update headers\n # before trying to cache.\n if self.heuristic:\n response = self.heuristic.apply(response)\n\n # apply any expiration heuristics\n if response.status == 304:\n # We must have sent an ETag request. This could mean\n # that we've been expired already or that we simply\n # have an etag. In either case, we want to try and\n # update the cache if that is the case.\n cached_response = self.controller.update_cached_response(\n request, response\n )\n\n if cached_response is not response:\n from_cache = True\n\n # We are done with the server response, read a\n # possible response body (compliant servers will\n # not return one, but we cannot be 100% sure) and\n # release the connection back to the pool.\n response.read(decode_content=False)\n response.release_conn()\n\n response = cached_response\n\n # We always cache the 301 responses\n elif int(response.status) in PERMANENT_REDIRECT_STATUSES:\n self.controller.cache_response(request, response)\n else:\n # Wrap the response file with a wrapper that will cache the\n # response when the stream has been consumed.\n response._fp = CallbackFileWrapper( # type: ignore[assignment]\n response._fp, # type: ignore[arg-type]\n functools.partial(\n self.controller.cache_response, request, weakref.ref(response)\n ),\n )\n if response.chunked:\n super_update_chunk_length = response.__class__._update_chunk_length\n\n def _update_chunk_length(\n weak_self: weakref.ReferenceType[HTTPResponse],\n ) -> None:\n self = weak_self()\n if self is None:\n return\n\n super_update_chunk_length(self)\n if self.chunk_left == 0:\n self._fp._close() # type: ignore[union-attr]\n\n response._update_chunk_length = functools.partial( # type: ignore[method-assign]\n _update_chunk_length, weakref.ref(response)\n )\n\n resp: Response = super().build_response(request, response)\n\n # See if we should invalidate the cache.\n if request.method in self.invalidating_methods and resp.ok:\n assert request.url is not None\n cache_url = self.controller.cache_url(request.url)\n self.cache.delete(cache_url)\n\n # Give the request a from_cache attr to let people use it\n resp.from_cache = from_cache # type: ignore[attr-defined]\n\n return resp\n\n def close(self) -> None:\n self.cache.close()\n super().close() # type: ignore[no-untyped-call]\n",[],[100,509,516,523,475,1961,1968,2026],{"_104":2034,"_96":690,"_158":2035,"_160":1969,"_161":139,"_162":2036,"_164":165,"_106":2037,"_101":29,"_167":215,"_169":2038,"_170":25,"_171":-5,"_172":2039,"_99":2040},"09c29a3e-67fc-11f0-928e-0224a6c84d84","09c29c5a-67fc-11f0-928e-0224a6c84d84",353,["D",1753299264143],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\n\n\"\"\"\nThe cache object API for implementing caches. The default is a thread\nsafe in-memory dictionary.\n\"\"\"\n\nfrom __future__ import annotations\n\nfrom threading import Lock\nfrom typing import IO, TYPE_CHECKING, MutableMapping\n\nif TYPE_CHECKING:\n from datetime import datetime\n\n\nclass BaseCache:\n def get(self, key: str) -> bytes | None:\n raise NotImplementedError()\n\n def set(\n self, key: str, value: bytes, expires: int | datetime | None = None\n ) -> None:\n raise NotImplementedError()\n\n def delete(self, key: str) -> None:\n raise NotImplementedError()\n\n def close(self) -> None:\n pass\n\n\nclass DictCache(BaseCache):\n def __init__(self, init_dict: MutableMapping[str, bytes] | None = None) -> None:\n self.lock = Lock()\n self.data = init_dict or {}\n\n def get(self, key: str) -> bytes | None:\n return self.data.get(key, None)\n\n def set(\n self, key: str, value: bytes, expires: int | datetime | None = None\n ) -> None:\n with self.lock:\n self.data.update({key: value})\n\n def delete(self, key: str) -> None:\n with self.lock:\n if key in self.data:\n self.data.pop(key)\n\n\nclass SeparateBodyBaseCache(BaseCache):\n \"\"\"\n In this variant, the body is not stored mixed in with the metadata, but is\n passed in (as a bytes-like object) in a separate call to ``set_body()``.\n\n That is, the expected interaction pattern is::\n\n cache.set(key, serialized_metadata)\n cache.set_body(key)\n\n Similarly, the body should be loaded separately via ``get_body()``.\n \"\"\"\n\n def set_body(self, key: str, body: bytes) -> None:\n raise NotImplementedError()\n\n def get_body(self, key: str) -> IO[bytes] | None:\n \"\"\"\n Return the body as file-like object.\n \"\"\"\n raise NotImplementedError()\n",[],[100,509,516,523,475,1961,1968,690],{"_104":2042,"_96":2043,"_158":2044,"_160":1969,"_161":139,"_162":2045,"_164":165,"_106":2046,"_101":29,"_167":215,"_169":2047,"_170":25,"_171":-5,"_172":2048,"_99":2049},"09ad9da0-67fc-11f0-8791-0224a6c84d84","controller.py","09ad9e54-67fc-11f0-8791-0224a6c84d84",349,["D",1753299264020],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\n\n\"\"\"\nThe httplib2 algorithms ported for use with requests.\n\"\"\"\n\nfrom __future__ import annotations\n\nimport calendar\nimport logging\nimport re\nimport time\nimport weakref\nfrom email.utils import parsedate_tz\nfrom typing import TYPE_CHECKING, Collection, Mapping\n\nfrom pip._vendor.requests.structures import CaseInsensitiveDict\n\nfrom pip._vendor.cachecontrol.cache import DictCache, SeparateBodyBaseCache\nfrom pip._vendor.cachecontrol.serialize import Serializer\n\nif TYPE_CHECKING:\n from typing import Literal\n\n from pip._vendor.requests import PreparedRequest\n from pip._vendor.urllib3 import HTTPResponse\n\n from pip._vendor.cachecontrol.cache import BaseCache\n\nlogger = logging.getLogger(__name__)\n\nURI = re.compile(r\"^(([^:/?#]+):)?(//([^/?#]*))?([^?#]*)(\\?([^#]*))?(#(.*))?\")\n\nPERMANENT_REDIRECT_STATUSES = (301, 308)\n\n\ndef parse_uri(uri: str) -> tuple[str, str, str, str, str]:\n \"\"\"Parses a URI using the regex given in Appendix B of RFC 3986.\n\n (scheme, authority, path, query, fragment) = parse_uri(uri)\n \"\"\"\n match = URI.match(uri)\n assert match is not None\n groups = match.groups()\n return (groups[1], groups[3], groups[4], groups[6], groups[8])\n\n\nclass CacheController:\n \"\"\"An interface to see if request should cached or not.\"\"\"\n\n def __init__(\n self,\n cache: BaseCache | None = None,\n cache_etags: bool = True,\n serializer: Serializer | None = None,\n status_codes: Collection[int] | None = None,\n ):\n self.cache = DictCache() if cache is None else cache\n self.cache_etags = cache_etags\n self.serializer = serializer or Serializer()\n self.cacheable_status_codes = status_codes or (200, 203, 300, 301, 308)\n\n @classmethod\n def _urlnorm(cls, uri: str) -> str:\n \"\"\"Normalize the URL to create a safe key for the cache\"\"\"\n (scheme, authority, path, query, fragment) = parse_uri(uri)\n if not scheme or not authority:\n raise Exception(\"Only absolute URIs are allowed. uri = %s\" % uri)\n\n scheme = scheme.lower()\n authority = authority.lower()\n\n if not path:\n path = \"/\"\n\n # Could do syntax based normalization of the URI before\n # computing the digest. See Section 6.2.2 of Std 66.\n request_uri = query and \"?\".join([path, query]) or path\n defrag_uri = scheme + \"://\" + authority + request_uri\n\n return defrag_uri\n\n @classmethod\n def cache_url(cls, uri: str) -> str:\n return cls._urlnorm(uri)\n\n def parse_cache_control(self, headers: Mapping[str, str]) -> dict[str, int | None]:\n known_directives = {\n # https://tools.ietf.org/html/rfc7234#section-5.2\n \"max-age\": (int, True),\n \"max-stale\": (int, False),\n \"min-fresh\": (int, True),\n \"no-cache\": (None, False),\n \"no-store\": (None, False),\n \"no-transform\": (None, False),\n \"only-if-cached\": (None, False),\n \"must-revalidate\": (None, False),\n \"public\": (None, False),\n \"private\": (None, False),\n \"proxy-revalidate\": (None, False),\n \"s-maxage\": (int, True),\n }\n\n cc_headers = headers.get(\"cache-control\", headers.get(\"Cache-Control\", \"\"))\n\n retval: dict[str, int | None] = {}\n\n for cc_directive in cc_headers.split(\",\"):\n if not cc_directive.strip():\n continue\n\n parts = cc_directive.split(\"=\", 1)\n directive = parts[0].strip()\n\n try:\n typ, required = known_directives[directive]\n except KeyError:\n logger.debug(\"Ignoring unknown cache-control directive: %s\", directive)\n continue\n\n if not typ or not required:\n retval[directive] = None\n if typ:\n try:\n retval[directive] = typ(parts[1].strip())\n except IndexError:\n if required:\n logger.debug(\n \"Missing value for cache-control \" \"directive: %s\",\n directive,\n )\n except ValueError:\n logger.debug(\n \"Invalid value for cache-control directive \" \"%s, must be %s\",\n directive,\n typ.__name__,\n )\n\n return retval\n\n def _load_from_cache(self, request: PreparedRequest) -> HTTPResponse | None:\n \"\"\"\n Load a cached response, or return None if it's not available.\n \"\"\"\n # We do not support caching of partial content: so if the request contains a\n # Range header then we don't want to load anything from the cache.\n if \"Range\" in request.headers:\n return None\n\n cache_url = request.url\n assert cache_url is not None\n cache_data = self.cache.get(cache_url)\n if cache_data is None:\n logger.debug(\"No cache entry available\")\n return None\n\n if isinstance(self.cache, SeparateBodyBaseCache):\n body_file = self.cache.get_body(cache_url)\n else:\n body_file = None\n\n result = self.serializer.loads(request, cache_data, body_file)\n if result is None:\n logger.warning(\"Cache entry deserialization failed, entry ignored\")\n return result\n\n def cached_request(self, request: PreparedRequest) -> HTTPResponse | Literal[False]:\n \"\"\"\n Return a cached response if it exists in the cache, otherwise\n return False.\n \"\"\"\n assert request.url is not None\n cache_url = self.cache_url(request.url)\n logger.debug('Looking up \"%s\" in the cache', cache_url)\n cc = self.parse_cache_control(request.headers)\n\n # Bail out if the request insists on fresh data\n if \"no-cache\" in cc:\n logger.debug('Request header has \"no-cache\", cache bypassed')\n return False\n\n if \"max-age\" in cc and cc[\"max-age\"] == 0:\n logger.debug('Request header has \"max_age\" as 0, cache bypassed')\n return False\n\n # Check whether we can load the response from the cache:\n resp = self._load_from_cache(request)\n if not resp:\n return False\n\n # If we have a cached permanent redirect, return it immediately. We\n # don't need to test our response for other headers b/c it is\n # intrinsically \"cacheable\" as it is Permanent.\n #\n # See:\n # https://tools.ietf.org/html/rfc7231#section-6.4.2\n #\n # Client can try to refresh the value by repeating the request\n # with cache busting headers as usual (ie no-cache).\n if int(resp.status) in PERMANENT_REDIRECT_STATUSES:\n msg = (\n \"Returning cached permanent redirect response \"\n \"(ignoring date and etag information)\"\n )\n logger.debug(msg)\n return resp\n\n headers: CaseInsensitiveDict[str] = CaseInsensitiveDict(resp.headers)\n if not headers or \"date\" not in headers:\n if \"etag\" not in headers:\n # Without date or etag, the cached response can never be used\n # and should be deleted.\n logger.debug(\"Purging cached response: no date or etag\")\n self.cache.delete(cache_url)\n logger.debug(\"Ignoring cached response: no date\")\n return False\n\n now = time.time()\n time_tuple = parsedate_tz(headers[\"date\"])\n assert time_tuple is not None\n date = calendar.timegm(time_tuple[:6])\n current_age = max(0, now - date)\n logger.debug(\"Current age based on date: %i\", current_age)\n\n # TODO: There is an assumption that the result will be a\n # urllib3 response object. This may not be best since we\n # could probably avoid instantiating or constructing the\n # response until we know we need it.\n resp_cc = self.parse_cache_control(headers)\n\n # determine freshness\n freshness_lifetime = 0\n\n # Check the max-age pragma in the cache control header\n max_age = resp_cc.get(\"max-age\")\n if max_age is not None:\n freshness_lifetime = max_age\n logger.debug(\"Freshness lifetime from max-age: %i\", freshness_lifetime)\n\n # If there isn't a max-age, check for an expires header\n elif \"expires\" in headers:\n expires = parsedate_tz(headers[\"expires\"])\n if expires is not None:\n expire_time = calendar.timegm(expires[:6]) - date\n freshness_lifetime = max(0, expire_time)\n logger.debug(\"Freshness lifetime from expires: %i\", freshness_lifetime)\n\n # Determine if we are setting freshness limit in the\n # request. Note, this overrides what was in the response.\n max_age = cc.get(\"max-age\")\n if max_age is not None:\n freshness_lifetime = max_age\n logger.debug(\n \"Freshness lifetime from request max-age: %i\", freshness_lifetime\n )\n\n min_fresh = cc.get(\"min-fresh\")\n if min_fresh is not None:\n # adjust our current age by our min fresh\n current_age += min_fresh\n logger.debug(\"Adjusted current age from min-fresh: %i\", current_age)\n\n # Return entry if it is fresh enough\n if freshness_lifetime > current_age:\n logger.debug('The response is \"fresh\", returning cached response')\n logger.debug(\"%i > %i\", freshness_lifetime, current_age)\n return resp\n\n # we're not fresh. If we don't have an Etag, clear it out\n if \"etag\" not in headers:\n logger.debug('The cached response is \"stale\" with no etag, purging')\n self.cache.delete(cache_url)\n\n # return the original handler\n return False\n\n def conditional_headers(self, request: PreparedRequest) -> dict[str, str]:\n resp = self._load_from_cache(request)\n new_headers = {}\n\n if resp:\n headers: CaseInsensitiveDict[str] = CaseInsensitiveDict(resp.headers)\n\n if \"etag\" in headers:\n new_headers[\"If-None-Match\"] = headers[\"ETag\"]\n\n if \"last-modified\" in headers:\n new_headers[\"If-Modified-Since\"] = headers[\"Last-Modified\"]\n\n return new_headers\n\n def _cache_set(\n self,\n cache_url: str,\n request: PreparedRequest,\n response: HTTPResponse,\n body: bytes | None = None,\n expires_time: int | None = None,\n ) -> None:\n \"\"\"\n Store the data in the cache.\n \"\"\"\n if isinstance(self.cache, SeparateBodyBaseCache):\n # We pass in the body separately; just put a placeholder empty\n # string in the metadata.\n self.cache.set(\n cache_url,\n self.serializer.dumps(request, response, b\"\"),\n expires=expires_time,\n )\n # body is None can happen when, for example, we're only updating\n # headers, as is the case in update_cached_response().\n if body is not None:\n self.cache.set_body(cache_url, body)\n else:\n self.cache.set(\n cache_url,\n self.serializer.dumps(request, response, body),\n expires=expires_time,\n )\n\n def cache_response(\n self,\n request: PreparedRequest,\n response_or_ref: HTTPResponse | weakref.ReferenceType[HTTPResponse],\n body: bytes | None = None,\n status_codes: Collection[int] | None = None,\n ) -> None:\n \"\"\"\n Algorithm for caching requests.\n\n This assumes a requests Response object.\n \"\"\"\n if isinstance(response_or_ref, weakref.ReferenceType):\n response = response_or_ref()\n if response is None:\n # The weakref can be None only in case the user used streamed request\n # and did not consume or close it, and holds no reference to requests.Response.\n # In such case, we don't want to cache the response.\n return\n else:\n response = response_or_ref\n\n # From httplib2: Don't cache 206's since we aren't going to\n # handle byte range requests\n cacheable_status_codes = status_codes or self.cacheable_status_codes\n if response.status not in cacheable_status_codes:\n logger.debug(\n \"Status code %s not in %s\", response.status, cacheable_status_codes\n )\n return\n\n response_headers: CaseInsensitiveDict[str] = CaseInsensitiveDict(\n response.headers\n )\n\n if \"date\" in response_headers:\n time_tuple = parsedate_tz(response_headers[\"date\"])\n assert time_tuple is not None\n date = calendar.timegm(time_tuple[:6])\n else:\n date = 0\n\n # If we've been given a body, our response has a Content-Length, that\n # Content-Length is valid then we can check to see if the body we've\n # been given matches the expected size, and if it doesn't we'll just\n # skip trying to cache it.\n if (\n body is not None\n and \"content-length\" in response_headers\n and response_headers[\"content-length\"].isdigit()\n and int(response_headers[\"content-length\"]) != len(body)\n ):\n return\n\n cc_req = self.parse_cache_control(request.headers)\n cc = self.parse_cache_control(response_headers)\n\n assert request.url is not None\n cache_url = self.cache_url(request.url)\n logger.debug('Updating cache with response from \"%s\"', cache_url)\n\n # Delete it from the cache if we happen to have it stored there\n no_store = False\n if \"no-store\" in cc:\n no_store = True\n logger.debug('Response header has \"no-store\"')\n if \"no-store\" in cc_req:\n no_store = True\n logger.debug('Request header has \"no-store\"')\n if no_store and self.cache.get(cache_url):\n logger.debug('Purging existing cache entry to honor \"no-store\"')\n self.cache.delete(cache_url)\n if no_store:\n return\n\n # https://tools.ietf.org/html/rfc7234#section-4.1:\n # A Vary header field-value of \"*\" always fails to match.\n # Storing such a response leads to a deserialization warning\n # during cache lookup and is not allowed to ever be served,\n # so storing it can be avoided.\n if \"*\" in response_headers.get(\"vary\", \"\"):\n logger.debug('Response header has \"Vary: *\"')\n return\n\n # If we've been given an etag, then keep the response\n if self.cache_etags and \"etag\" in response_headers:\n expires_time = 0\n if response_headers.get(\"expires\"):\n expires = parsedate_tz(response_headers[\"expires\"])\n if expires is not None:\n expires_time = calendar.timegm(expires[:6]) - date\n\n expires_time = max(expires_time, 14 * 86400)\n\n logger.debug(f\"etag object cached for {expires_time} seconds\")\n logger.debug(\"Caching due to etag\")\n self._cache_set(cache_url, request, response, body, expires_time)\n\n # Add to the cache any permanent redirects. We do this before looking\n # that the Date headers.\n elif int(response.status) in PERMANENT_REDIRECT_STATUSES:\n logger.debug(\"Caching permanent redirect\")\n self._cache_set(cache_url, request, response, b\"\")\n\n # Add to the cache if the response headers demand it. If there\n # is no date header then we can't do anything about expiring\n # the cache.\n elif \"date\" in response_headers:\n time_tuple = parsedate_tz(response_headers[\"date\"])\n assert time_tuple is not None\n date = calendar.timegm(time_tuple[:6])\n # cache when there is a max-age > 0\n max_age = cc.get(\"max-age\")\n if max_age is not None and max_age > 0:\n logger.debug(\"Caching b/c date exists and max-age > 0\")\n expires_time = max_age\n self._cache_set(\n cache_url,\n request,\n response,\n body,\n expires_time,\n )\n\n # If the request can expire, it means we should cache it\n # in the meantime.\n elif \"expires\" in response_headers:\n if response_headers[\"expires\"]:\n expires = parsedate_tz(response_headers[\"expires\"])\n if expires is not None:\n expires_time = calendar.timegm(expires[:6]) - date\n else:\n expires_time = None\n\n logger.debug(\n \"Caching b/c of expires header. expires in {} seconds\".format(\n expires_time\n )\n )\n self._cache_set(\n cache_url,\n request,\n response,\n body,\n expires_time,\n )\n\n def update_cached_response(\n self, request: PreparedRequest, response: HTTPResponse\n ) -> HTTPResponse:\n \"\"\"On a 304 we will get a new set of headers that we want to\n update our cached value with, assuming we have one.\n\n This should only ever be called when we've sent an ETag and\n gotten a 304 as the response.\n \"\"\"\n assert request.url is not None\n cache_url = self.cache_url(request.url)\n cached_response = self._load_from_cache(request)\n\n if not cached_response:\n # we didn't have a cached response\n return response\n\n # Lets update our headers with the headers from the new request:\n # http://tools.ietf.org/html/draft-ietf-httpbis-p4-conditional-26#section-4.1\n #\n # The server isn't supposed to send headers that would make\n # the cached body invalid. But... just in case, we'll be sure\n # to strip out ones we know that might be problmatic due to\n # typical assumptions.\n excluded_headers = [\"content-length\"]\n\n cached_response.headers.update(\n {\n k: v\n for k, v in response.headers.items()\n if k.lower() not in excluded_headers\n }\n )\n\n # we want a 200 b/c we have content via the cache\n cached_response.status = 200\n\n # update our cache\n self._cache_set(cache_url, request, cached_response)\n\n return cached_response\n",[],[100,509,516,523,475,1961,1968,2043],{"_104":2051,"_96":2052,"_158":2053,"_160":1969,"_161":139,"_162":2054,"_164":165,"_106":2055,"_101":29,"_167":215,"_169":2056,"_170":25,"_171":-5,"_172":2057,"_99":2058},"09b1da96-67fc-11f0-96d6-0224a6c84d84","filewrapper.py","09b1db36-67fc-11f0-96d6-0224a6c84d84",350,["D",1753299264049],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport mmap\nfrom tempfile import NamedTemporaryFile\nfrom typing import TYPE_CHECKING, Any, Callable\n\nif TYPE_CHECKING:\n from http.client import HTTPResponse\n\n\nclass CallbackFileWrapper:\n \"\"\"\n Small wrapper around a fp object which will tee everything read into a\n buffer, and when that file is closed it will execute a callback with the\n contents of that buffer.\n\n All attributes are proxied to the underlying file object.\n\n This class uses members with a double underscore (__) leading prefix so as\n not to accidentally shadow an attribute.\n\n The data is stored in a temporary file until it is all available. As long\n as the temporary files directory is disk-based (sometimes it's a\n memory-backed-``tmpfs`` on Linux), data will be unloaded to disk if memory\n pressure is high. For small files the disk usually won't be used at all,\n it'll all be in the filesystem memory cache, so there should be no\n performance impact.\n \"\"\"\n\n def __init__(\n self, fp: HTTPResponse, callback: Callable[[bytes], None] | None\n ) -> None:\n self.__buf = NamedTemporaryFile(\"rb+\", delete=True)\n self.__fp = fp\n self.__callback = callback\n\n def __getattr__(self, name: str) -> Any:\n # The vagaries of garbage collection means that self.__fp is\n # not always set. By using __getattribute__ and the private\n # name[0] allows looking up the attribute value and raising an\n # AttributeError when it doesn't exist. This stop things from\n # infinitely recursing calls to getattr in the case where\n # self.__fp hasn't been set.\n #\n # [0] https://docs.python.org/2/reference/expressions.html#atom-identifiers\n fp = self.__getattribute__(\"_CallbackFileWrapper__fp\")\n return getattr(fp, name)\n\n def __is_fp_closed(self) -> bool:\n try:\n return self.__fp.fp is None\n\n except AttributeError:\n pass\n\n try:\n closed: bool = self.__fp.closed\n return closed\n\n except AttributeError:\n pass\n\n # We just don't cache it then.\n # TODO: Add some logging here...\n return False\n\n def _close(self) -> None:\n if self.__callback:\n if self.__buf.tell() == 0:\n # Empty file:\n result = b\"\"\n else:\n # Return the data without actually loading it into memory,\n # relying on Python's buffer API and mmap(). mmap() just gives\n # a view directly into the filesystem's memory cache, so it\n # doesn't result in duplicate memory use.\n self.__buf.seek(0, 0)\n result = memoryview(\n mmap.mmap(self.__buf.fileno(), 0, access=mmap.ACCESS_READ)\n )\n self.__callback(result)\n\n # We assign this to None here, because otherwise we can get into\n # really tricky problems where the CPython interpreter dead locks\n # because the callback is holding a reference to something which\n # has a __del__ method. Setting this to None breaks the cycle\n # and allows the garbage collector to do it's thing normally.\n self.__callback = None\n\n # Closing the temporary file releases memory and frees disk space.\n # Important when caching big files.\n self.__buf.close()\n\n def read(self, amt: int | None = None) -> bytes:\n data: bytes = self.__fp.read(amt)\n if data:\n # We may be dealing with b'', a sign that things are over:\n # it's passed e.g. after we've already closed self.__buf.\n self.__buf.write(data)\n if self.__is_fp_closed():\n self._close()\n\n return data\n\n def _safe_read(self, amt: int) -> bytes:\n data: bytes = self.__fp._safe_read(amt) # type: ignore[attr-defined]\n if amt == 2 and data == b\"\\r\\n\":\n # urllib executes this read to toss the CRLF at the end\n # of the chunk.\n return data\n\n self.__buf.write(data)\n if self.__is_fp_closed():\n self._close()\n\n return data\n",[],[100,509,516,523,475,1961,1968,2052],{"_104":2060,"_96":2061,"_158":2062,"_160":1969,"_161":139,"_162":2063,"_164":165,"_106":2064,"_101":29,"_167":215,"_169":2065,"_170":25,"_171":-5,"_172":2066,"_99":2067},"09b6ed38-67fc-11f0-85ab-0224a6c84d84","heuristics.py","09b6ee28-67fc-11f0-85ab-0224a6c84d84",351,["D",1753299264082],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport calendar\nimport time\nfrom datetime import datetime, timedelta, timezone\nfrom email.utils import formatdate, parsedate, parsedate_tz\nfrom typing import TYPE_CHECKING, Any, Mapping\n\nif TYPE_CHECKING:\n from pip._vendor.urllib3 import HTTPResponse\n\nTIME_FMT = \"%a, %d %b %Y %H:%M:%S GMT\"\n\n\ndef expire_after(delta: timedelta, date: datetime | None = None) -> datetime:\n date = date or datetime.now(timezone.utc)\n return date + delta\n\n\ndef datetime_to_header(dt: datetime) -> str:\n return formatdate(calendar.timegm(dt.timetuple()))\n\n\nclass BaseHeuristic:\n def warning(self, response: HTTPResponse) -> str | None:\n \"\"\"\n Return a valid 1xx warning header value describing the cache\n adjustments.\n\n The response is provided too allow warnings like 113\n http://tools.ietf.org/html/rfc7234#section-5.5.4 where we need\n to explicitly say response is over 24 hours old.\n \"\"\"\n return '110 - \"Response is Stale\"'\n\n def update_headers(self, response: HTTPResponse) -> dict[str, str]:\n \"\"\"Update the response headers with any new headers.\n\n NOTE: This SHOULD always include some Warning header to\n signify that the response was cached by the client, not\n by way of the provided headers.\n \"\"\"\n return {}\n\n def apply(self, response: HTTPResponse) -> HTTPResponse:\n updated_headers = self.update_headers(response)\n\n if updated_headers:\n response.headers.update(updated_headers)\n warning_header_value = self.warning(response)\n if warning_header_value is not None:\n response.headers.update({\"Warning\": warning_header_value})\n\n return response\n\n\nclass OneDayCache(BaseHeuristic):\n \"\"\"\n Cache the response by providing an expires 1 day in the\n future.\n \"\"\"\n\n def update_headers(self, response: HTTPResponse) -> dict[str, str]:\n headers = {}\n\n if \"expires\" not in response.headers:\n date = parsedate(response.headers[\"date\"])\n expires = expire_after(\n timedelta(days=1),\n date=datetime(*date[:6], tzinfo=timezone.utc), # type: ignore[index,misc]\n )\n headers[\"expires\"] = datetime_to_header(expires)\n headers[\"cache-control\"] = \"public\"\n return headers\n\n\nclass ExpiresAfter(BaseHeuristic):\n \"\"\"\n Cache **all** requests for a defined time period.\n \"\"\"\n\n def __init__(self, **kw: Any) -> None:\n self.delta = timedelta(**kw)\n\n def update_headers(self, response: HTTPResponse) -> dict[str, str]:\n expires = expire_after(self.delta)\n return {\"expires\": datetime_to_header(expires), \"cache-control\": \"public\"}\n\n def warning(self, response: HTTPResponse) -> str | None:\n tmpl = \"110 - Automatically cached for %s. Response might be stale\"\n return tmpl % self.delta\n\n\nclass LastModified(BaseHeuristic):\n \"\"\"\n If there is no Expires header already, fall back on Last-Modified\n using the heuristic from\n http://tools.ietf.org/html/rfc7234#section-4.2.2\n to calculate a reasonable value.\n\n Firefox also does something like this per\n https://developer.mozilla.org/en-US/docs/Web/HTTP/Caching_FAQ\n http://lxr.mozilla.org/mozilla-release/source/netwerk/protocol/http/nsHttpResponseHead.cpp#397\n Unlike mozilla we limit this to 24-hr.\n \"\"\"\n\n cacheable_by_default_statuses = {\n 200,\n 203,\n 204,\n 206,\n 300,\n 301,\n 404,\n 405,\n 410,\n 414,\n 501,\n }\n\n def update_headers(self, resp: HTTPResponse) -> dict[str, str]:\n headers: Mapping[str, str] = resp.headers\n\n if \"expires\" in headers:\n return {}\n\n if \"cache-control\" in headers and headers[\"cache-control\"] != \"public\":\n return {}\n\n if resp.status not in self.cacheable_by_default_statuses:\n return {}\n\n if \"date\" not in headers or \"last-modified\" not in headers:\n return {}\n\n time_tuple = parsedate_tz(headers[\"date\"])\n assert time_tuple is not None\n date = calendar.timegm(time_tuple[:6])\n last_modified = parsedate(headers[\"last-modified\"])\n if last_modified is None:\n return {}\n\n now = time.time()\n current_age = max(0, now - date)\n delta = date - calendar.timegm(last_modified)\n freshness_lifetime = max(0, min(delta / 10, 24 * 3600))\n if freshness_lifetime <= current_age:\n return {}\n\n expires = date + freshness_lifetime\n return {\"expires\": time.strftime(TIME_FMT, time.gmtime(expires))}\n\n def warning(self, resp: HTTPResponse) -> str | None:\n return None\n",[],[100,509,516,523,475,1961,1968,2061],{"_104":2069,"_96":2070,"_158":2071,"_160":1969,"_161":139,"_162":2072,"_164":165,"_106":2073,"_101":29,"_167":215,"_169":2074,"_170":25,"_171":-5,"_172":2075,"_99":2076},"09a00dde-67fc-11f0-a99a-0224a6c84d84","serialize.py","09a00e74-67fc-11f0-a99a-0224a6c84d84",347,["D",1753299263920],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nimport io\nfrom typing import IO, TYPE_CHECKING, Any, Mapping, cast\n\nfrom pip._vendor import msgpack\nfrom pip._vendor.requests.structures import CaseInsensitiveDict\nfrom pip._vendor.urllib3 import HTTPResponse\n\nif TYPE_CHECKING:\n from pip._vendor.requests import PreparedRequest\n\n\nclass Serializer:\n serde_version = \"4\"\n\n def dumps(\n self,\n request: PreparedRequest,\n response: HTTPResponse,\n body: bytes | None = None,\n ) -> bytes:\n response_headers: CaseInsensitiveDict[str] = CaseInsensitiveDict(\n response.headers\n )\n\n if body is None:\n # When a body isn't passed in, we'll read the response. We\n # also update the response with a new file handler to be\n # sure it acts as though it was never read.\n body = response.read(decode_content=False)\n response._fp = io.BytesIO(body) # type: ignore[assignment]\n response.length_remaining = len(body)\n\n data = {\n \"response\": {\n \"body\": body, # Empty bytestring if body is stored separately\n \"headers\": {str(k): str(v) for k, v in response.headers.items()},\n \"status\": response.status,\n \"version\": response.version,\n \"reason\": str(response.reason),\n \"decode_content\": response.decode_content,\n }\n }\n\n # Construct our vary headers\n data[\"vary\"] = {}\n if \"vary\" in response_headers:\n varied_headers = response_headers[\"vary\"].split(\",\")\n for header in varied_headers:\n header = str(header).strip()\n header_value = request.headers.get(header, None)\n if header_value is not None:\n header_value = str(header_value)\n data[\"vary\"][header] = header_value\n\n return b\",\".join([f\"cc={self.serde_version}\".encode(), self.serialize(data)])\n\n def serialize(self, data: dict[str, Any]) -> bytes:\n return cast(bytes, msgpack.dumps(data, use_bin_type=True))\n\n def loads(\n self,\n request: PreparedRequest,\n data: bytes,\n body_file: IO[bytes] | None = None,\n ) -> HTTPResponse | None:\n # Short circuit if we've been given an empty set of data\n if not data:\n return None\n\n # Previous versions of this library supported other serialization\n # formats, but these have all been removed.\n if not data.startswith(f\"cc={self.serde_version},\".encode()):\n return None\n\n data = data[5:]\n return self._loads_v4(request, data, body_file)\n\n def prepare_response(\n self,\n request: PreparedRequest,\n cached: Mapping[str, Any],\n body_file: IO[bytes] | None = None,\n ) -> HTTPResponse | None:\n \"\"\"Verify our vary headers match and construct a real urllib3\n HTTPResponse object.\n \"\"\"\n # Special case the '*' Vary value as it means we cannot actually\n # determine if the cached response is suitable for this request.\n # This case is also handled in the controller code when creating\n # a cache entry, but is left here for backwards compatibility.\n if \"*\" in cached.get(\"vary\", {}):\n return None\n\n # Ensure that the Vary headers for the cached response match our\n # request\n for header, value in cached.get(\"vary\", {}).items():\n if request.headers.get(header, None) != value:\n return None\n\n body_raw = cached[\"response\"].pop(\"body\")\n\n headers: CaseInsensitiveDict[str] = CaseInsensitiveDict(\n data=cached[\"response\"][\"headers\"]\n )\n if headers.get(\"transfer-encoding\", \"\") == \"chunked\":\n headers.pop(\"transfer-encoding\")\n\n cached[\"response\"][\"headers\"] = headers\n\n try:\n body: IO[bytes]\n if body_file is None:\n body = io.BytesIO(body_raw)\n else:\n body = body_file\n except TypeError:\n # This can happen if cachecontrol serialized to v1 format (pickle)\n # using Python 2. A Python 2 str(byte string) will be unpickled as\n # a Python 3 str (unicode string), which will cause the above to\n # fail with:\n #\n # TypeError: 'str' does not support the buffer interface\n body = io.BytesIO(body_raw.encode(\"utf8\"))\n\n # Discard any `strict` parameter serialized by older version of cachecontrol.\n cached[\"response\"].pop(\"strict\", None)\n\n return HTTPResponse(body=body, preload_content=False, **cached[\"response\"])\n\n def _loads_v4(\n self,\n request: PreparedRequest,\n data: bytes,\n body_file: IO[bytes] | None = None,\n ) -> HTTPResponse | None:\n try:\n cached = msgpack.loads(data, raw=False)\n except ValueError:\n return None\n\n return self.prepare_response(request, cached, body_file)\n",[],[100,509,516,523,475,1961,1968,2070],{"_104":2078,"_96":2079,"_158":2080,"_160":1969,"_161":139,"_162":2081,"_164":165,"_106":2082,"_101":29,"_167":215,"_169":2083,"_170":25,"_171":-5,"_172":2084,"_99":2085},"09a446f6-67fc-11f0-832f-0224a6c84d84","wrapper.py","09a447be-67fc-11f0-832f-0224a6c84d84",348,["D",1753299263961],"# SPDX-FileCopyrightText: 2015 Eric Larson\n#\n# SPDX-License-Identifier: Apache-2.0\nfrom __future__ import annotations\n\nfrom typing import TYPE_CHECKING, Collection\n\nfrom pip._vendor.cachecontrol.adapter import CacheControlAdapter\nfrom pip._vendor.cachecontrol.cache import DictCache\n\nif TYPE_CHECKING:\n from pip._vendor import requests\n\n from pip._vendor.cachecontrol.cache import BaseCache\n from pip._vendor.cachecontrol.controller import CacheController\n from pip._vendor.cachecontrol.heuristics import BaseHeuristic\n from pip._vendor.cachecontrol.serialize import Serializer\n\n\ndef CacheControl(\n sess: requests.Session,\n cache: BaseCache | None = None,\n cache_etags: bool = True,\n serializer: Serializer | None = None,\n heuristic: BaseHeuristic | None = None,\n controller_class: type[CacheController] | None = None,\n adapter_class: type[CacheControlAdapter] | None = None,\n cacheable_methods: Collection[str] | None = None,\n) -> requests.Session:\n cache = DictCache() if cache is None else cache\n adapter_class = adapter_class or CacheControlAdapter\n adapter = adapter_class(\n cache,\n cache_etags=cache_etags,\n serializer=serializer,\n heuristic=heuristic,\n controller_class=controller_class,\n cacheable_methods=cacheable_methods,\n )\n sess.mount(\"http://\", adapter)\n sess.mount(\"https://\", adapter)\n\n return sess\n",[],[100,509,516,523,475,1961,1968,2079],[100,509,516,523,475,1961,1968],{"_104":2088,"_96":2089,"_158":2090,"_160":1962,"_161":139,"_162":2091,"_164":165,"_106":2092,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":2093,"_99":2120},"fe7aeafa-67fb-11f0-a516-0224a6c84d84","certifi","fe7aebea-67fb-11f0-a516-0224a6c84d84",81,["D",1753299245231],[2094,2102,2111],{"_104":2095,"_96":558,"_158":2096,"_160":2090,"_161":139,"_162":2097,"_164":165,"_106":2098,"_101":29,"_167":215,"_169":2099,"_170":25,"_171":-5,"_172":2100,"_99":2101},"0aa6e694-67fc-11f0-a99a-0224a6c84d84","0aa6e8e2-67fc-11f0-a99a-0224a6c84d84",388,["D",1753299265640],"from .core import contents, where\n\n__all__ = [\"contents\", \"where\"]\n__version__ = \"2025.01.31\"\n",[],[100,509,516,523,475,1961,2089,558],{"_104":2103,"_96":2104,"_158":2105,"_160":2090,"_161":139,"_162":2106,"_164":165,"_106":2107,"_101":29,"_167":215,"_169":2108,"_170":25,"_171":-5,"_172":2109,"_99":2110},"0ac2f96a-67fc-11f0-b666-0224a6c84d84","__main__.py","0ac2fa0a-67fc-11f0-b666-0224a6c84d84",392,["D",1753299265839],"import argparse\n\nfrom pip._vendor.certifi import contents, where\n\nparser = argparse.ArgumentParser()\nparser.add_argument(\"-c\", \"--contents\", action=\"store_true\")\nargs = parser.parse_args()\n\nif args.contents:\n print(contents())\nelse:\n print(where())\n",[],[100,509,516,523,475,1961,2089,2104],{"_104":2112,"_96":2113,"_158":2114,"_160":2090,"_161":139,"_162":2115,"_164":165,"_106":2116,"_101":29,"_167":215,"_169":2117,"_170":25,"_171":-5,"_172":2118,"_99":2119},"0abc2b44-67fc-11f0-9bd1-0224a6c84d84","core.py","0abc2bf8-67fc-11f0-9bd1-0224a6c84d84",391,["D",1753299265795],"\"\"\"\ncertifi.py\n~~~~~~~~~~\n\nThis module returns the installation location of cacert.pem or its contents.\n\"\"\"\nimport sys\nimport atexit\n\ndef exit_cacert_ctx() -> None:\n _CACERT_CTX.__exit__(None, None, None) # type: ignore[union-attr]\n\n\nif sys.version_info >= (3, 11):\n\n from importlib.resources import as_file, files\n\n _CACERT_CTX = None\n _CACERT_PATH = None\n\n def where() -> str:\n # This is slightly terrible, but we want to delay extracting the file\n # in cases where we're inside of a zipimport situation until someone\n # actually calls where(), but we don't want to re-extract the file\n # on every call of where(), so we'll do it once then store it in a\n # global variable.\n global _CACERT_CTX\n global _CACERT_PATH\n if _CACERT_PATH is None:\n # This is slightly janky, the importlib.resources API wants you to\n # manage the cleanup of this file, so it doesn't actually return a\n # path, it returns a context manager that will give you the path\n # when you enter it and will do any cleanup when you leave it. In\n # the common case of not needing a temporary file, it will just\n # return the file system location and the __exit__() is a no-op.\n #\n # We also have to hold onto the actual context manager, because\n # it will do the cleanup whenever it gets garbage collected, so\n # we will also store that at the global level as well.\n _CACERT_CTX = as_file(files(\"pip._vendor.certifi\").joinpath(\"cacert.pem\"))\n _CACERT_PATH = str(_CACERT_CTX.__enter__())\n atexit.register(exit_cacert_ctx)\n\n return _CACERT_PATH\n\n def contents() -> str:\n return files(\"pip._vendor.certifi\").joinpath(\"cacert.pem\").read_text(encoding=\"ascii\")\n\nelif sys.version_info >= (3, 7):\n\n from importlib.resources import path as get_path, read_text\n\n _CACERT_CTX = None\n _CACERT_PATH = None\n\n def where() -> str:\n # This is slightly terrible, but we want to delay extracting the\n # file in cases where we're inside of a zipimport situation until\n # someone actually calls where(), but we don't want to re-extract\n # the file on every call of where(), so we'll do it once then store\n # it in a global variable.\n global _CACERT_CTX\n global _CACERT_PATH\n if _CACERT_PATH is None:\n # This is slightly janky, the importlib.resources API wants you\n # to manage the cleanup of this file, so it doesn't actually\n # return a path, it returns a context manager that will give\n # you the path when you enter it and will do any cleanup when\n # you leave it. In the common case of not needing a temporary\n # file, it will just return the file system location and the\n # __exit__() is a no-op.\n #\n # We also have to hold onto the actual context manager, because\n # it will do the cleanup whenever it gets garbage collected, so\n # we will also store that at the global level as well.\n _CACERT_CTX = get_path(\"pip._vendor.certifi\", \"cacert.pem\")\n _CACERT_PATH = str(_CACERT_CTX.__enter__())\n atexit.register(exit_cacert_ctx)\n\n return _CACERT_PATH\n\n def contents() -> str:\n return read_text(\"pip._vendor.certifi\", \"cacert.pem\", encoding=\"ascii\")\n\nelse:\n import os\n import types\n from typing import Union\n\n Package = Union[types.ModuleType, str]\n Resource = Union[str, \"os.PathLike\"]\n\n # This fallback will work for Python versions prior to 3.7 that lack the\n # importlib.resources module but relies on the existing `where` function\n # so won't address issues with environments like PyOxidizer that don't set\n # __file__ on modules.\n def read_text(\n package: Package,\n resource: Resource,\n encoding: str = 'utf-8',\n errors: str = 'strict'\n ) -> str:\n with open(where(), encoding=encoding) as data:\n return data.read()\n\n # If we don't have importlib.resources, then we will just do the old logic\n # of assuming we're on the filesystem and munge the path directly.\n def where() -> str:\n f = os.path.dirname(__file__)\n\n return os.path.join(f, \"cacert.pem\")\n\n def contents() -> str:\n return read_text(\"pip._vendor.certifi\", \"cacert.pem\", encoding=\"ascii\")\n",[],[100,509,516,523,475,1961,2089,2113],[100,509,516,523,475,1961,2089],{"_104":2122,"_96":2123,"_158":2124,"_160":1962,"_161":139,"_162":2125,"_164":165,"_106":2126,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":2127,"_99":2180},"fdb1ecf4-67fb-11f0-ba2f-0224a6c84d84","dependency_groups","fdb1eda8-67fb-11f0-ba2f-0224a6c84d84",73,["D",1753299243916],[2128,2136,2144,2153,2162,2171],{"_104":2129,"_96":558,"_158":2130,"_160":2124,"_161":139,"_162":2131,"_164":165,"_106":2132,"_101":29,"_167":215,"_169":2133,"_170":25,"_171":-5,"_172":2134,"_99":2135},"084f9850-67fc-11f0-8d4e-0224a6c84d84","084f98fa-67fc-11f0-8d4e-0224a6c84d84",303,["D",1753299261727],"from ._implementation import (\n CyclicDependencyError,\n DependencyGroupInclude,\n DependencyGroupResolver,\n resolve,\n)\n\n__all__ = (\n \"CyclicDependencyError\",\n \"DependencyGroupInclude\",\n \"DependencyGroupResolver\",\n \"resolve\",\n)\n",[],[100,509,516,523,475,1961,2123,558],{"_104":2137,"_96":2104,"_158":2138,"_160":2124,"_161":139,"_162":2139,"_164":165,"_106":2140,"_101":29,"_167":215,"_169":2141,"_170":25,"_171":-5,"_172":2142,"_99":2143},"088216fe-67fc-11f0-96d6-0224a6c84d84","088217da-67fc-11f0-96d6-0224a6c84d84",308,["D",1753299261984],"import argparse\nimport sys\n\nfrom ._implementation import resolve\nfrom ._toml_compat import tomllib\n\n\ndef main() -> None:\n if tomllib is None:\n print(\n \"Usage error: dependency-groups CLI requires tomli or Python 3.11+\",\n file=sys.stderr,\n )\n raise SystemExit(2)\n\n parser = argparse.ArgumentParser(\n description=(\n \"A dependency-groups CLI. Prints out a resolved group, newline-delimited.\"\n )\n )\n parser.add_argument(\n \"GROUP_NAME\", nargs=\"*\", help=\"The dependency group(s) to resolve.\"\n )\n parser.add_argument(\n \"-f\",\n \"--pyproject-file\",\n default=\"pyproject.toml\",\n help=\"The pyproject.toml file. Defaults to trying in the current directory.\",\n )\n parser.add_argument(\n \"-o\",\n \"--output\",\n help=\"An output file. Defaults to stdout.\",\n )\n parser.add_argument(\n \"-l\",\n \"--list\",\n action=\"store_true\",\n help=\"List the available dependency groups\",\n )\n args = parser.parse_args()\n\n with open(args.pyproject_file, \"rb\") as fp:\n pyproject = tomllib.load(fp)\n\n dependency_groups_raw = pyproject.get(\"dependency-groups\", {})\n\n if args.list:\n print(*dependency_groups_raw.keys())\n return\n if not args.GROUP_NAME:\n print(\"A GROUP_NAME is required\", file=sys.stderr)\n raise SystemExit(3)\n\n content = \"\\n\".join(resolve(dependency_groups_raw, *args.GROUP_NAME))\n\n if args.output is None or args.output == \"-\":\n print(content)\n else:\n with open(args.output, \"w\", encoding=\"utf-8\") as fp:\n print(content, file=fp)\n\n\nif __name__ == \"__main__\":\n main()\n",[],[100,509,516,523,475,1961,2123,2104],{"_104":2145,"_96":2146,"_158":2147,"_160":2124,"_161":139,"_162":2148,"_164":165,"_106":2149,"_101":29,"_167":215,"_169":2150,"_170":25,"_171":-5,"_172":2151,"_99":2152},"0857b4c2-67fc-11f0-85ab-0224a6c84d84","_implementation.py","0857b5bc-67fc-11f0-85ab-0224a6c84d84",305,["D",1753299261780],"from __future__ import annotations\n\nimport dataclasses\nimport re\nfrom collections.abc import Mapping\n\nfrom pip._vendor.packaging.requirements import Requirement\n\n\ndef _normalize_name(name: str) -> str:\n return re.sub(r\"[-_.]+\", \"-\", name).lower()\n\n\ndef _normalize_group_names(\n dependency_groups: Mapping[str, str | Mapping[str, str]],\n) -> Mapping[str, str | Mapping[str, str]]:\n original_names: dict[str, list[str]] = {}\n normalized_groups = {}\n\n for group_name, value in dependency_groups.items():\n normed_group_name = _normalize_name(group_name)\n original_names.setdefault(normed_group_name, []).append(group_name)\n normalized_groups[normed_group_name] = value\n\n errors = []\n for normed_name, names in original_names.items():\n if len(names) > 1:\n errors.append(f\"{normed_name} ({', '.join(names)})\")\n if errors:\n raise ValueError(f\"Duplicate dependency group names: {', '.join(errors)}\")\n\n return normalized_groups\n\n\n@dataclasses.dataclass\nclass DependencyGroupInclude:\n include_group: str\n\n\nclass CyclicDependencyError(ValueError):\n \"\"\"\n An error representing the detection of a cycle.\n \"\"\"\n\n def __init__(self, requested_group: str, group: str, include_group: str) -> None:\n self.requested_group = requested_group\n self.group = group\n self.include_group = include_group\n\n if include_group == group:\n reason = f\"{group} includes itself\"\n else:\n reason = f\"{include_group} -> {group}, {group} -> {include_group}\"\n super().__init__(\n \"Cyclic dependency group include while resolving \"\n f\"{requested_group}: {reason}\"\n )\n\n\nclass DependencyGroupResolver:\n \"\"\"\n A resolver for Dependency Group data.\n\n This class handles caching, name normalization, cycle detection, and other\n parsing requirements. There are only two public methods for exploring the data:\n ``lookup()`` and ``resolve()``.\n\n :param dependency_groups: A mapping, as provided via pyproject\n ``[dependency-groups]``.\n \"\"\"\n\n def __init__(\n self,\n dependency_groups: Mapping[str, str | Mapping[str, str]],\n ) -> None:\n if not isinstance(dependency_groups, Mapping):\n raise TypeError(\"Dependency Groups table is not a mapping\")\n self.dependency_groups = _normalize_group_names(dependency_groups)\n # a map of group names to parsed data\n self._parsed_groups: dict[\n str, tuple[Requirement | DependencyGroupInclude, ...]\n ] = {}\n # a map of group names to their ancestors, used for cycle detection\n self._include_graph_ancestors: dict[str, tuple[str, ...]] = {}\n # a cache of completed resolutions to Requirement lists\n self._resolve_cache: dict[str, tuple[Requirement, ...]] = {}\n\n def lookup(self, group: str) -> tuple[Requirement | DependencyGroupInclude, ...]:\n \"\"\"\n Lookup a group name, returning the parsed dependency data for that group.\n This will not resolve includes.\n\n :param group: the name of the group to lookup\n\n :raises ValueError: if the data does not appear to be valid dependency group\n data\n :raises TypeError: if the data is not a string\n :raises LookupError: if group name is absent\n :raises packaging.requirements.InvalidRequirement: if a specifier is not valid\n \"\"\"\n if not isinstance(group, str):\n raise TypeError(\"Dependency group name is not a str\")\n group = _normalize_name(group)\n return self._parse_group(group)\n\n def resolve(self, group: str) -> tuple[Requirement, ...]:\n \"\"\"\n Resolve a dependency group to a list of requirements.\n\n :param group: the name of the group to resolve\n\n :raises TypeError: if the inputs appear to be the wrong types\n :raises ValueError: if the data does not appear to be valid dependency group\n data\n :raises LookupError: if group name is absent\n :raises packaging.requirements.InvalidRequirement: if a specifier is not valid\n \"\"\"\n if not isinstance(group, str):\n raise TypeError(\"Dependency group name is not a str\")\n group = _normalize_name(group)\n return self._resolve(group, group)\n\n def _parse_group(\n self, group: str\n ) -> tuple[Requirement | DependencyGroupInclude, ...]:\n # short circuit -- never do the work twice\n if group in self._parsed_groups:\n return self._parsed_groups[group]\n\n if group not in self.dependency_groups:\n raise LookupError(f\"Dependency group '{group}' not found\")\n\n raw_group = self.dependency_groups[group]\n if not isinstance(raw_group, list):\n raise TypeError(f\"Dependency group '{group}' is not a list\")\n\n elements: list[Requirement | DependencyGroupInclude] = []\n for item in raw_group:\n if isinstance(item, str):\n # packaging.requirements.Requirement parsing ensures that this is a\n # valid PEP 508 Dependency Specifier\n # raises InvalidRequirement on failure\n elements.append(Requirement(item))\n elif isinstance(item, dict):\n if tuple(item.keys()) != (\"include-group\",):\n raise ValueError(f\"Invalid dependency group item: {item}\")\n\n include_group = next(iter(item.values()))\n elements.append(DependencyGroupInclude(include_group=include_group))\n else:\n raise ValueError(f\"Invalid dependency group item: {item}\")\n\n self._parsed_groups[group] = tuple(elements)\n return self._parsed_groups[group]\n\n def _resolve(self, group: str, requested_group: str) -> tuple[Requirement, ...]:\n \"\"\"\n This is a helper for cached resolution to strings.\n\n :param group: The name of the group to resolve.\n :param requested_group: The group which was used in the original, user-facing\n request.\n \"\"\"\n if group in self._resolve_cache:\n return self._resolve_cache[group]\n\n parsed = self._parse_group(group)\n\n resolved_group = []\n for item in parsed:\n if isinstance(item, Requirement):\n resolved_group.append(item)\n elif isinstance(item, DependencyGroupInclude):\n include_group = _normalize_name(item.include_group)\n if include_group in self._include_graph_ancestors.get(group, ()):\n raise CyclicDependencyError(\n requested_group, group, item.include_group\n )\n self._include_graph_ancestors[include_group] = (\n *self._include_graph_ancestors.get(group, ()),\n group,\n )\n resolved_group.extend(self._resolve(include_group, requested_group))\n else: # unreachable\n raise NotImplementedError(\n f\"Invalid dependency group item after parse: {item}\"\n )\n\n self._resolve_cache[group] = tuple(resolved_group)\n return self._resolve_cache[group]\n\n\ndef resolve(\n dependency_groups: Mapping[str, str | Mapping[str, str]], /, *groups: str\n) -> tuple[str, ...]:\n \"\"\"\n Resolve a dependency group to a tuple of requirements, as strings.\n\n :param dependency_groups: the parsed contents of the ``[dependency-groups]`` table\n from ``pyproject.toml``\n :param groups: the name of the group(s) to resolve\n\n :raises TypeError: if the inputs appear to be the wrong types\n :raises ValueError: if the data does not appear to be valid dependency group data\n :raises LookupError: if group name is absent\n :raises packaging.requirements.InvalidRequirement: if a specifier is not valid\n \"\"\"\n resolver = DependencyGroupResolver(dependency_groups)\n return tuple(str(r) for group in groups for r in resolver.resolve(group))\n",[],[100,509,516,523,475,1961,2123,2146],{"_104":2154,"_96":2155,"_158":2156,"_160":2124,"_161":139,"_162":2157,"_164":165,"_106":2158,"_101":29,"_167":215,"_169":2159,"_170":25,"_171":-5,"_172":2160,"_99":2161},"084835ec-67fc-11f0-8d4e-0224a6c84d84","_lint_dependency_groups.py","084837b8-67fc-11f0-8d4e-0224a6c84d84",302,["D",1753299261678],"from __future__ import annotations\n\nimport argparse\nimport sys\n\nfrom ._implementation import DependencyGroupResolver\nfrom ._toml_compat import tomllib\n\n\ndef main(*, argv: list[str] | None = None) -> None:\n if tomllib is None:\n print(\n \"Usage error: dependency-groups CLI requires tomli or Python 3.11+\",\n file=sys.stderr,\n )\n raise SystemExit(2)\n\n parser = argparse.ArgumentParser(\n description=(\n \"Lint Dependency Groups for validity. \"\n \"This will eagerly load and check all of your Dependency Groups.\"\n )\n )\n parser.add_argument(\n \"-f\",\n \"--pyproject-file\",\n default=\"pyproject.toml\",\n help=\"The pyproject.toml file. Defaults to trying in the current directory.\",\n )\n args = parser.parse_args(argv if argv is not None else sys.argv[1:])\n\n with open(args.pyproject_file, \"rb\") as fp:\n pyproject = tomllib.load(fp)\n dependency_groups_raw = pyproject.get(\"dependency-groups\", {})\n\n errors: list[str] = []\n try:\n resolver = DependencyGroupResolver(dependency_groups_raw)\n except (ValueError, TypeError) as e:\n errors.append(f\"{type(e).__name__}: {e}\")\n else:\n for groupname in resolver.dependency_groups:\n try:\n resolver.resolve(groupname)\n except (LookupError, ValueError, TypeError) as e:\n errors.append(f\"{type(e).__name__}: {e}\")\n\n if errors:\n print(\"errors encountered while examining dependency groups:\")\n for msg in errors:\n print(f\" {msg}\")\n sys.exit(1)\n else:\n print(\"ok\")\n sys.exit(0)\n\n\nif __name__ == \"__main__\":\n main()\n",[],[100,509,516,523,475,1961,2123,2155],{"_104":2163,"_96":2164,"_158":2165,"_160":2124,"_161":139,"_162":2166,"_164":165,"_106":2167,"_101":29,"_167":215,"_169":2168,"_170":25,"_171":-5,"_172":2169,"_99":2170},"08530e54-67fc-11f0-9b65-0224a6c84d84","_pip_wrapper.py","08530f58-67fc-11f0-9b65-0224a6c84d84",304,["D",1753299261750],"from __future__ import annotations\n\nimport argparse\nimport subprocess\nimport sys\n\nfrom ._implementation import DependencyGroupResolver\nfrom ._toml_compat import tomllib\n\n\ndef _invoke_pip(deps: list[str]) -> None:\n subprocess.check_call([sys.executable, \"-m\", \"pip\", \"install\", *deps])\n\n\ndef main(*, argv: list[str] | None = None) -> None:\n if tomllib is None:\n print(\n \"Usage error: dependency-groups CLI requires tomli or Python 3.11+\",\n file=sys.stderr,\n )\n raise SystemExit(2)\n\n parser = argparse.ArgumentParser(description=\"Install Dependency Groups.\")\n parser.add_argument(\n \"DEPENDENCY_GROUP\", nargs=\"+\", help=\"The dependency groups to install.\"\n )\n parser.add_argument(\n \"-f\",\n \"--pyproject-file\",\n default=\"pyproject.toml\",\n help=\"The pyproject.toml file. Defaults to trying in the current directory.\",\n )\n args = parser.parse_args(argv if argv is not None else sys.argv[1:])\n\n with open(args.pyproject_file, \"rb\") as fp:\n pyproject = tomllib.load(fp)\n dependency_groups_raw = pyproject.get(\"dependency-groups\", {})\n\n errors: list[str] = []\n resolved: list[str] = []\n try:\n resolver = DependencyGroupResolver(dependency_groups_raw)\n except (ValueError, TypeError) as e:\n errors.append(f\"{type(e).__name__}: {e}\")\n else:\n for groupname in args.DEPENDENCY_GROUP:\n try:\n resolved.extend(str(r) for r in resolver.resolve(groupname))\n except (LookupError, ValueError, TypeError) as e:\n errors.append(f\"{type(e).__name__}: {e}\")\n\n if errors:\n print(\"errors encountered while examining dependency groups:\")\n for msg in errors:\n print(f\" {msg}\")\n sys.exit(1)\n\n _invoke_pip(resolved)\n\n\nif __name__ == \"__main__\":\n main()\n",[],[100,509,516,523,475,1961,2123,2164],{"_104":2172,"_96":2173,"_158":2174,"_160":2124,"_161":139,"_162":2175,"_164":165,"_106":2176,"_101":29,"_167":215,"_169":2177,"_170":25,"_171":-5,"_172":2178,"_99":2179},"08774152-67fc-11f0-8791-0224a6c84d84","_toml_compat.py","08774210-67fc-11f0-8791-0224a6c84d84",306,["D",1753299261981],"try:\n import tomllib\nexcept ImportError:\n try:\n from pip._vendor import tomli as tomllib # type: ignore[no-redef, unused-ignore]\n except ModuleNotFoundError: # pragma: no cover\n tomllib = None # type: ignore[assignment, unused-ignore]\n\n__all__ = (\"tomllib\",)\n",[],[100,509,516,523,475,1961,2123,2173],[100,509,516,523,475,1961,2123],{"_104":2182,"_96":2183,"_158":2184,"_160":1962,"_161":139,"_162":2185,"_164":165,"_106":2186,"_101":29,"_167":168,"_169":-5,"_170":25,"_171":-5,"_172":2187,"_99":2300},"fde615d8-67fb-11f0-88b0-0224a6c84d84","distlib","fde616aa-67fb-11f0-88b0-0224a6c84d84",75,["D",1753299244261],[2188,2196,2204,2213,2221,2230,2239,2248,2256,2265,2274,2283,2292],{"_104":2189,"_96":558,"_158":2190,"_160":2184,"_161":139,"_162":2191,"_164":165,"_106":2192,"_101":29,"_167":215,"_169":2193,"_170":25,"_171":-5,"_172":2194,"_99":2195},"0967b61e-67fc-11f0-b489-0224a6c84d84","0967b6d2-67fc-11f0-b489-0224a6c84d84",337,["D",1753299263566],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nimport logging\n\n__version__ = '0.3.9'\n\n\nclass DistlibException(Exception):\n pass\n\n\ntry:\n from logging import NullHandler\nexcept ImportError: # pragma: no cover\n\n class NullHandler(logging.Handler):\n\n def handle(self, record):\n pass\n\n def emit(self, record):\n pass\n\n def createLock(self):\n self.lock = None\n\n\nlogger = logging.getLogger(__name__)\nlogger.addHandler(NullHandler())\n",[],[100,509,516,523,475,1961,2183,558],{"_104":2197,"_96":1624,"_158":2198,"_160":2184,"_161":139,"_162":2199,"_164":165,"_106":2200,"_101":29,"_167":215,"_169":2201,"_170":25,"_171":-5,"_172":2202,"_99":2203},"0947a388-67fc-11f0-9ad5-0224a6c84d84","0947a482-67fc-11f0-9ad5-0224a6c84d84",333,["D",1753299263351],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2017 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom __future__ import absolute_import\n\nimport os\nimport re\nimport shutil\nimport sys\n\ntry:\n import ssl\nexcept ImportError: # pragma: no cover\n ssl = None\n\nif sys.version_info[0] < 3: # pragma: no cover\n from StringIO import StringIO\n string_types = basestring,\n text_type = unicode\n from types import FileType as file_type\n import __builtin__ as builtins\n import ConfigParser as configparser\n from urlparse import urlparse, urlunparse, urljoin, urlsplit, urlunsplit\n from urllib import (urlretrieve, quote as _quote, unquote, url2pathname,\n pathname2url, ContentTooShortError, splittype)\n\n def quote(s):\n if isinstance(s, unicode):\n s = s.encode('utf-8')\n return _quote(s)\n\n import urllib2\n from urllib2 import (Request, urlopen, URLError, HTTPError,\n HTTPBasicAuthHandler, HTTPPasswordMgr, HTTPHandler,\n HTTPRedirectHandler, build_opener)\n if ssl:\n from urllib2 import HTTPSHandler\n import httplib\n import xmlrpclib\n import Queue as queue\n from HTMLParser import HTMLParser\n import htmlentitydefs\n raw_input = raw_input\n from itertools import ifilter as filter\n from itertools import ifilterfalse as filterfalse\n\n # Leaving this around for now, in case it needs resurrecting in some way\n # _userprog = None\n # def splituser(host):\n # \"\"\"splituser('user[:passwd]@host[:port]') --> 'user[:passwd]', 'host[:port]'.\"\"\"\n # global _userprog\n # if _userprog is None:\n # import re\n # _userprog = re.compile('^(.*)@(.*)$')\n\n # match = _userprog.match(host)\n # if match: return match.group(1, 2)\n # return None, host\n\nelse: # pragma: no cover\n from io import StringIO\n string_types = str,\n text_type = str\n from io import TextIOWrapper as file_type\n import builtins\n import configparser\n from urllib.parse import (urlparse, urlunparse, urljoin, quote, unquote,\n urlsplit, urlunsplit, splittype)\n from urllib.request import (urlopen, urlretrieve, Request, url2pathname,\n pathname2url, HTTPBasicAuthHandler,\n HTTPPasswordMgr, HTTPHandler,\n HTTPRedirectHandler, build_opener)\n if ssl:\n from urllib.request import HTTPSHandler\n from urllib.error import HTTPError, URLError, ContentTooShortError\n import http.client as httplib\n import urllib.request as urllib2\n import xmlrpc.client as xmlrpclib\n import queue\n from html.parser import HTMLParser\n import html.entities as htmlentitydefs\n raw_input = input\n from itertools import filterfalse\n filter = filter\n\ntry:\n from ssl import match_hostname, CertificateError\nexcept ImportError: # pragma: no cover\n\n class CertificateError(ValueError):\n pass\n\n def _dnsname_match(dn, hostname, max_wildcards=1):\n \"\"\"Matching according to RFC 6125, section 6.4.3\n\n http://tools.ietf.org/html/rfc6125#section-6.4.3\n \"\"\"\n pats = []\n if not dn:\n return False\n\n parts = dn.split('.')\n leftmost, remainder = parts[0], parts[1:]\n\n wildcards = leftmost.count('*')\n if wildcards > max_wildcards:\n # Issue #17980: avoid denials of service by refusing more\n # than one wildcard per fragment. A survey of established\n # policy among SSL implementations showed it to be a\n # reasonable choice.\n raise CertificateError(\n \"too many wildcards in certificate DNS name: \" + repr(dn))\n\n # speed up common case w/o wildcards\n if not wildcards:\n return dn.lower() == hostname.lower()\n\n # RFC 6125, section 6.4.3, subitem 1.\n # The client SHOULD NOT attempt to match a presented identifier in which\n # the wildcard character comprises a label other than the left-most label.\n if leftmost == '*':\n # When '*' is a fragment by itself, it matches a non-empty dotless\n # fragment.\n pats.append('[^.]+')\n elif leftmost.startswith('xn--') or hostname.startswith('xn--'):\n # RFC 6125, section 6.4.3, subitem 3.\n # The client SHOULD NOT attempt to match a presented identifier\n # where the wildcard character is embedded within an A-label or\n # U-label of an internationalized domain name.\n pats.append(re.escape(leftmost))\n else:\n # Otherwise, '*' matches any dotless string, e.g. www*\n pats.append(re.escape(leftmost).replace(r'\\*', '[^.]*'))\n\n # add the remaining fragments, ignore any wildcards\n for frag in remainder:\n pats.append(re.escape(frag))\n\n pat = re.compile(r'\\A' + r'\\.'.join(pats) + r'\\Z', re.IGNORECASE)\n return pat.match(hostname)\n\n def match_hostname(cert, hostname):\n \"\"\"Verify that *cert* (in decoded format as returned by\n SSLSocket.getpeercert()) matches the *hostname*. RFC 2818 and RFC 6125\n rules are followed, but IP addresses are not accepted for *hostname*.\n\n CertificateError is raised on failure. On success, the function\n returns nothing.\n \"\"\"\n if not cert:\n raise ValueError(\"empty or no certificate, match_hostname needs a \"\n \"SSL socket or SSL context with either \"\n \"CERT_OPTIONAL or CERT_REQUIRED\")\n dnsnames = []\n san = cert.get('subjectAltName', ())\n for key, value in san:\n if key == 'DNS':\n if _dnsname_match(value, hostname):\n return\n dnsnames.append(value)\n if not dnsnames:\n # The subject is only checked when there is no dNSName entry\n # in subjectAltName\n for sub in cert.get('subject', ()):\n for key, value in sub:\n # XXX according to RFC 2818, the most specific Common Name\n # must be used.\n if key == 'commonName':\n if _dnsname_match(value, hostname):\n return\n dnsnames.append(value)\n if len(dnsnames) > 1:\n raise CertificateError(\"hostname %r \"\n \"doesn't match either of %s\" %\n (hostname, ', '.join(map(repr, dnsnames))))\n elif len(dnsnames) == 1:\n raise CertificateError(\"hostname %r \"\n \"doesn't match %r\" %\n (hostname, dnsnames[0]))\n else:\n raise CertificateError(\"no appropriate commonName or \"\n \"subjectAltName fields were found\")\n\n\ntry:\n from types import SimpleNamespace as Container\nexcept ImportError: # pragma: no cover\n\n class Container(object):\n \"\"\"\n A generic container for when multiple values need to be returned\n \"\"\"\n\n def __init__(self, **kwargs):\n self.__dict__.update(kwargs)\n\n\ntry:\n from shutil import which\nexcept ImportError: # pragma: no cover\n # Implementation from Python 3.3\n def which(cmd, mode=os.F_OK | os.X_OK, path=None):\n \"\"\"Given a command, mode, and a PATH string, return the path which\n conforms to the given mode on the PATH, or None if there is no such\n file.\n\n `mode` defaults to os.F_OK | os.X_OK. `path` defaults to the result\n of os.environ.get(\"PATH\"), or can be overridden with a custom search\n path.\n\n \"\"\"\n\n # Check that a given file can be accessed with the correct mode.\n # Additionally check that `file` is not a directory, as on Windows\n # directories pass the os.access check.\n def _access_check(fn, mode):\n return (os.path.exists(fn) and os.access(fn, mode) and not os.path.isdir(fn))\n\n # If we're given a path with a directory part, look it up directly rather\n # than referring to PATH directories. This includes checking relative to the\n # current directory, e.g. ./script\n if os.path.dirname(cmd):\n if _access_check(cmd, mode):\n return cmd\n return None\n\n if path is None:\n path = os.environ.get(\"PATH\", os.defpath)\n if not path:\n return None\n path = path.split(os.pathsep)\n\n if sys.platform == \"win32\":\n # The current directory takes precedence on Windows.\n if os.curdir not in path:\n path.insert(0, os.curdir)\n\n # PATHEXT is necessary to check on Windows.\n pathext = os.environ.get(\"PATHEXT\", \"\").split(os.pathsep)\n # See if the given file matches any of the expected path extensions.\n # This will allow us to short circuit when given \"python.exe\".\n # If it does match, only test that one, otherwise we have to try\n # others.\n if any(cmd.lower().endswith(ext.lower()) for ext in pathext):\n files = [cmd]\n else:\n files = [cmd + ext for ext in pathext]\n else:\n # On other platforms you don't have things like PATHEXT to tell you\n # what file suffixes are executable, so just pass on cmd as-is.\n files = [cmd]\n\n seen = set()\n for dir in path:\n normdir = os.path.normcase(dir)\n if normdir not in seen:\n seen.add(normdir)\n for thefile in files:\n name = os.path.join(dir, thefile)\n if _access_check(name, mode):\n return name\n return None\n\n\n# ZipFile is a context manager in 2.7, but not in 2.6\n\nfrom zipfile import ZipFile as BaseZipFile\n\nif hasattr(BaseZipFile, '__enter__'): # pragma: no cover\n ZipFile = BaseZipFile\nelse: # pragma: no cover\n from zipfile import ZipExtFile as BaseZipExtFile\n\n class ZipExtFile(BaseZipExtFile):\n\n def __init__(self, base):\n self.__dict__.update(base.__dict__)\n\n def __enter__(self):\n return self\n\n def __exit__(self, *exc_info):\n self.close()\n # return None, so if an exception occurred, it will propagate\n\n class ZipFile(BaseZipFile):\n\n def __enter__(self):\n return self\n\n def __exit__(self, *exc_info):\n self.close()\n # return None, so if an exception occurred, it will propagate\n\n def open(self, *args, **kwargs):\n base = BaseZipFile.open(self, *args, **kwargs)\n return ZipExtFile(base)\n\n\ntry:\n from platform import python_implementation\nexcept ImportError: # pragma: no cover\n\n def python_implementation():\n \"\"\"Return a string identifying the Python implementation.\"\"\"\n if 'PyPy' in sys.version:\n return 'PyPy'\n if os.name == 'java':\n return 'Jython'\n if sys.version.startswith('IronPython'):\n return 'IronPython'\n return 'CPython'\n\n\nimport sysconfig\n\ntry:\n callable = callable\nexcept NameError: # pragma: no cover\n from collections.abc import Callable\n\n def callable(obj):\n return isinstance(obj, Callable)\n\n\ntry:\n fsencode = os.fsencode\n fsdecode = os.fsdecode\nexcept AttributeError: # pragma: no cover\n # Issue #99: on some systems (e.g. containerised),\n # sys.getfilesystemencoding() returns None, and we need a real value,\n # so fall back to utf-8. From the CPython 2.7 docs relating to Unix and\n # sys.getfilesystemencoding(): the return value is \"the user’s preference\n # according to the result of nl_langinfo(CODESET), or None if the\n # nl_langinfo(CODESET) failed.\"\n _fsencoding = sys.getfilesystemencoding() or 'utf-8'\n if _fsencoding == 'mbcs':\n _fserrors = 'strict'\n else:\n _fserrors = 'surrogateescape'\n\n def fsencode(filename):\n if isinstance(filename, bytes):\n return filename\n elif isinstance(filename, text_type):\n return filename.encode(_fsencoding, _fserrors)\n else:\n raise TypeError(\"expect bytes or str, not %s\" %\n type(filename).__name__)\n\n def fsdecode(filename):\n if isinstance(filename, text_type):\n return filename\n elif isinstance(filename, bytes):\n return filename.decode(_fsencoding, _fserrors)\n else:\n raise TypeError(\"expect bytes or str, not %s\" %\n type(filename).__name__)\n\n\ntry:\n from tokenize import detect_encoding\nexcept ImportError: # pragma: no cover\n from codecs import BOM_UTF8, lookup\n\n cookie_re = re.compile(r\"coding[:=]\\s*([-\\w.]+)\")\n\n def _get_normal_name(orig_enc):\n \"\"\"Imitates get_normal_name in tokenizer.c.\"\"\"\n # Only care about the first 12 characters.\n enc = orig_enc[:12].lower().replace(\"_\", \"-\")\n if enc == \"utf-8\" or enc.startswith(\"utf-8-\"):\n return \"utf-8\"\n if enc in (\"latin-1\", \"iso-8859-1\", \"iso-latin-1\") or \\\n enc.startswith((\"latin-1-\", \"iso-8859-1-\", \"iso-latin-1-\")):\n return \"iso-8859-1\"\n return orig_enc\n\n def detect_encoding(readline):\n \"\"\"\n The detect_encoding() function is used to detect the encoding that should\n be used to decode a Python source file. It requires one argument, readline,\n in the same way as the tokenize() generator.\n\n It will call readline a maximum of twice, and return the encoding used\n (as a string) and a list of any lines (left as bytes) it has read in.\n\n It detects the encoding from the presence of a utf-8 bom or an encoding\n cookie as specified in pep-0263. If both a bom and a cookie are present,\n but disagree, a SyntaxError will be raised. If the encoding cookie is an\n invalid charset, raise a SyntaxError. Note that if a utf-8 bom is found,\n 'utf-8-sig' is returned.\n\n If no encoding is specified, then the default of 'utf-8' will be returned.\n \"\"\"\n try:\n filename = readline.__self__.name\n except AttributeError:\n filename = None\n bom_found = False\n encoding = None\n default = 'utf-8'\n\n def read_or_stop():\n try:\n return readline()\n except StopIteration:\n return b''\n\n def find_cookie(line):\n try:\n # Decode as UTF-8. Either the line is an encoding declaration,\n # in which case it should be pure ASCII, or it must be UTF-8\n # per default encoding.\n line_string = line.decode('utf-8')\n except UnicodeDecodeError:\n msg = \"invalid or missing encoding declaration\"\n if filename is not None:\n msg = '{} for {!r}'.format(msg, filename)\n raise SyntaxError(msg)\n\n matches = cookie_re.findall(line_string)\n if not matches:\n return None\n encoding = _get_normal_name(matches[0])\n try:\n codec = lookup(encoding)\n except LookupError:\n # This behaviour mimics the Python interpreter\n if filename is None:\n msg = \"unknown encoding: \" + encoding\n else:\n msg = \"unknown encoding for {!r}: {}\".format(\n filename, encoding)\n raise SyntaxError(msg)\n\n if bom_found:\n if codec.name != 'utf-8':\n # This behaviour mimics the Python interpreter\n if filename is None:\n msg = 'encoding problem: utf-8'\n else:\n msg = 'encoding problem for {!r}: utf-8'.format(\n filename)\n raise SyntaxError(msg)\n encoding += '-sig'\n return encoding\n\n first = read_or_stop()\n if first.startswith(BOM_UTF8):\n bom_found = True\n first = first[3:]\n default = 'utf-8-sig'\n if not first:\n return default, []\n\n encoding = find_cookie(first)\n if encoding:\n return encoding, [first]\n\n second = read_or_stop()\n if not second:\n return default, [first]\n\n encoding = find_cookie(second)\n if encoding:\n return encoding, [first, second]\n\n return default, [first, second]\n\n\n# For converting & <-> & etc.\ntry:\n from html import escape\nexcept ImportError:\n from cgi import escape\nif sys.version_info[:2] < (3, 4):\n unescape = HTMLParser().unescape\nelse:\n from html import unescape\n\ntry:\n from collections import ChainMap\nexcept ImportError: # pragma: no cover\n from collections import MutableMapping\n\n try:\n from reprlib import recursive_repr as _recursive_repr\n except ImportError:\n\n def _recursive_repr(fillvalue='...'):\n '''\n Decorator to make a repr function return fillvalue for a recursive\n call\n '''\n\n def decorating_function(user_function):\n repr_running = set()\n\n def wrapper(self):\n key = id(self), get_ident()\n if key in repr_running:\n return fillvalue\n repr_running.add(key)\n try:\n result = user_function(self)\n finally:\n repr_running.discard(key)\n return result\n\n # Can't use functools.wraps() here because of bootstrap issues\n wrapper.__module__ = getattr(user_function, '__module__')\n wrapper.__doc__ = getattr(user_function, '__doc__')\n wrapper.__name__ = getattr(user_function, '__name__')\n wrapper.__annotations__ = getattr(user_function,\n '__annotations__', {})\n return wrapper\n\n return decorating_function\n\n class ChainMap(MutableMapping):\n '''\n A ChainMap groups multiple dicts (or other mappings) together\n to create a single, updateable view.\n\n The underlying mappings are stored in a list. That list is public and can\n accessed or updated using the *maps* attribute. There is no other state.\n\n Lookups search the underlying mappings successively until a key is found.\n In contrast, writes, updates, and deletions only operate on the first\n mapping.\n '''\n\n def __init__(self, *maps):\n '''Initialize a ChainMap by setting *maps* to the given mappings.\n If no mappings are provided, a single empty dictionary is used.\n\n '''\n self.maps = list(maps) or [{}] # always at least one map\n\n def __missing__(self, key):\n raise KeyError(key)\n\n def __getitem__(self, key):\n for mapping in self.maps:\n try:\n return mapping[\n key] # can't use 'key in mapping' with defaultdict\n except KeyError:\n pass\n return self.__missing__(\n key) # support subclasses that define __missing__\n\n def get(self, key, default=None):\n return self[key] if key in self else default\n\n def __len__(self):\n return len(set().union(\n *self.maps)) # reuses stored hash values if possible\n\n def __iter__(self):\n return iter(set().union(*self.maps))\n\n def __contains__(self, key):\n return any(key in m for m in self.maps)\n\n def __bool__(self):\n return any(self.maps)\n\n @_recursive_repr()\n def __repr__(self):\n return '{0.__class__.__name__}({1})'.format(\n self, ', '.join(map(repr, self.maps)))\n\n @classmethod\n def fromkeys(cls, iterable, *args):\n 'Create a ChainMap with a single dict created from the iterable.'\n return cls(dict.fromkeys(iterable, *args))\n\n def copy(self):\n 'New ChainMap or subclass with a new copy of maps[0] and refs to maps[1:]'\n return self.__class__(self.maps[0].copy(), *self.maps[1:])\n\n __copy__ = copy\n\n def new_child(self): # like Django's Context.push()\n 'New ChainMap with a new dict followed by all previous maps.'\n return self.__class__({}, *self.maps)\n\n @property\n def parents(self): # like Django's Context.pop()\n 'New ChainMap from maps[1:].'\n return self.__class__(*self.maps[1:])\n\n def __setitem__(self, key, value):\n self.maps[0][key] = value\n\n def __delitem__(self, key):\n try:\n del self.maps[0][key]\n except KeyError:\n raise KeyError(\n 'Key not found in the first mapping: {!r}'.format(key))\n\n def popitem(self):\n 'Remove and return an item pair from maps[0]. Raise KeyError is maps[0] is empty.'\n try:\n return self.maps[0].popitem()\n except KeyError:\n raise KeyError('No keys found in the first mapping.')\n\n def pop(self, key, *args):\n 'Remove *key* from maps[0] and return its value. Raise KeyError if *key* not in maps[0].'\n try:\n return self.maps[0].pop(key, *args)\n except KeyError:\n raise KeyError(\n 'Key not found in the first mapping: {!r}'.format(key))\n\n def clear(self):\n 'Clear maps[0], leaving maps[1:] intact.'\n self.maps[0].clear()\n\n\ntry:\n from importlib.util import cache_from_source # Python >= 3.4\nexcept ImportError: # pragma: no cover\n\n def cache_from_source(path, debug_override=None):\n assert path.endswith('.py')\n if debug_override is None:\n debug_override = __debug__\n if debug_override:\n suffix = 'c'\n else:\n suffix = 'o'\n return path + suffix\n\n\ntry:\n from collections import OrderedDict\nexcept ImportError: # pragma: no cover\n # {{{ http://code.activestate.com/recipes/576693/ (r9)\n # Backport of OrderedDict() class that runs on Python 2.4, 2.5, 2.6, 2.7 and pypy.\n # Passes Python2.7's test suite and incorporates all the latest updates.\n try:\n from thread import get_ident as _get_ident\n except ImportError:\n from dummy_thread import get_ident as _get_ident\n\n try:\n from _abcoll import KeysView, ValuesView, ItemsView\n except ImportError:\n pass\n\n class OrderedDict(dict):\n 'Dictionary that remembers insertion order'\n\n # An inherited dict maps keys to values.\n # The inherited dict provides __getitem__, __len__, __contains__, and get.\n # The remaining methods are order-aware.\n # Big-O running times for all methods are the same as for regular dictionaries.\n\n # The internal self.__map dictionary maps keys to links in a doubly linked list.\n # The circular doubly linked list starts and ends with a sentinel element.\n # The sentinel element never gets deleted (this simplifies the algorithm).\n # Each link is stored as a list of length three: [PREV, NEXT, KEY].\n\n def __init__(self, *args, **kwds):\n '''Initialize an ordered dictionary. Signature is the same as for\n regular dictionaries, but keyword arguments are not recommended\n because their insertion order is arbitrary.\n\n '''\n if len(args) > 1:\n raise TypeError('expected at most 1 arguments, got %d' %\n len(args))\n try:\n self.__root\n except AttributeError:\n self.__root = root = [] # sentinel node\n root[:] = [root, root, None]\n self.__map = {}\n self.__update(*args, **kwds)\n\n def __setitem__(self, key, value, dict_setitem=dict.__setitem__):\n 'od.__setitem__(i, y) <==> od[i]=y'\n # Setting a new item creates a new link which goes at the end of the linked\n # list, and the inherited dictionary is updated with the new key/value pair.\n if key not in self:\n root = self.__root\n last = root[0]\n last[1] = root[0] = self.__map[key] = [last, root, key]\n dict_setitem(self, key, value)\n\n def __delitem__(self, key, dict_delitem=dict.__delitem__):\n 'od.__delitem__(y) <==> del od[y]'\n # Deleting an existing item uses self.__map to find the link which is\n # then removed by updating the links in the predecessor and successor nodes.\n dict_delitem(self, key)\n link_prev, link_next, key = self.__map.pop(key)\n link_prev[1] = link_next\n link_next[0] = link_prev\n\n def __iter__(self):\n 'od.__iter__() <==> iter(od)'\n root = self.__root\n curr = root[1]\n while curr is not root:\n yield curr[2]\n curr = curr[1]\n\n def __reversed__(self):\n 'od.__reversed__() <==> reversed(od)'\n root = self.__root\n curr = root[0]\n while curr is not root:\n yield curr[2]\n curr = curr[0]\n\n def clear(self):\n 'od.clear() -> None. Remove all items from od.'\n try:\n for node in self.__map.itervalues():\n del node[:]\n root = self.__root\n root[:] = [root, root, None]\n self.__map.clear()\n except AttributeError:\n pass\n dict.clear(self)\n\n def popitem(self, last=True):\n '''od.popitem() -> (k, v), return and remove a (key, value) pair.\n Pairs are returned in LIFO order if last is true or FIFO order if false.\n\n '''\n if not self:\n raise KeyError('dictionary is empty')\n root = self.__root\n if last:\n link = root[0]\n link_prev = link[0]\n link_prev[1] = root\n root[0] = link_prev\n else:\n link = root[1]\n link_next = link[1]\n root[1] = link_next\n link_next[0] = root\n key = link[2]\n del self.__map[key]\n value = dict.pop(self, key)\n return key, value\n\n # -- the following methods do not depend on the internal structure --\n\n def keys(self):\n 'od.keys() -> list of keys in od'\n return list(self)\n\n def values(self):\n 'od.values() -> list of values in od'\n return [self[key] for key in self]\n\n def items(self):\n 'od.items() -> list of (key, value) pairs in od'\n return [(key, self[key]) for key in self]\n\n def iterkeys(self):\n 'od.iterkeys() -> an iterator over the keys in od'\n return iter(self)\n\n def itervalues(self):\n 'od.itervalues -> an iterator over the values in od'\n for k in self:\n yield self[k]\n\n def iteritems(self):\n 'od.iteritems -> an iterator over the (key, value) items in od'\n for k in self:\n yield (k, self[k])\n\n def update(*args, **kwds):\n '''od.update(E, **F) -> None. Update od from dict/iterable E and F.\n\n If E is a dict instance, does: for k in E: od[k] = E[k]\n If E has a .keys() method, does: for k in E.keys(): od[k] = E[k]\n Or if E is an iterable of items, does: for k, v in E: od[k] = v\n In either case, this is followed by: for k, v in F.items(): od[k] = v\n\n '''\n if len(args) > 2:\n raise TypeError('update() takes at most 2 positional '\n 'arguments (%d given)' % (len(args), ))\n elif not args:\n raise TypeError('update() takes at least 1 argument (0 given)')\n self = args[0]\n # Make progressively weaker assumptions about \"other\"\n other = ()\n if len(args) == 2:\n other = args[1]\n if isinstance(other, dict):\n for key in other:\n self[key] = other[key]\n elif hasattr(other, 'keys'):\n for key in other.keys():\n self[key] = other[key]\n else:\n for key, value in other:\n self[key] = value\n for key, value in kwds.items():\n self[key] = value\n\n __update = update # let subclasses override update without breaking __init__\n\n __marker = object()\n\n def pop(self, key, default=__marker):\n '''od.pop(k[,d]) -> v, remove specified key and return the corresponding value.\n If key is not found, d is returned if given, otherwise KeyError is raised.\n\n '''\n if key in self:\n result = self[key]\n del self[key]\n return result\n if default is self.__marker:\n raise KeyError(key)\n return default\n\n def setdefault(self, key, default=None):\n 'od.setdefault(k[,d]) -> od.get(k,d), also set od[k]=d if k not in od'\n if key in self:\n return self[key]\n self[key] = default\n return default\n\n def __repr__(self, _repr_running=None):\n 'od.__repr__() <==> repr(od)'\n if not _repr_running:\n _repr_running = {}\n call_key = id(self), _get_ident()\n if call_key in _repr_running:\n return '...'\n _repr_running[call_key] = 1\n try:\n if not self:\n return '%s()' % (self.__class__.__name__, )\n return '%s(%r)' % (self.__class__.__name__, self.items())\n finally:\n del _repr_running[call_key]\n\n def __reduce__(self):\n 'Return state information for pickling'\n items = [[k, self[k]] for k in self]\n inst_dict = vars(self).copy()\n for k in vars(OrderedDict()):\n inst_dict.pop(k, None)\n if inst_dict:\n return (self.__class__, (items, ), inst_dict)\n return self.__class__, (items, )\n\n def copy(self):\n 'od.copy() -> a shallow copy of od'\n return self.__class__(self)\n\n @classmethod\n def fromkeys(cls, iterable, value=None):\n '''OD.fromkeys(S[, v]) -> New ordered dictionary with keys from S\n and values equal to v (which defaults to None).\n\n '''\n d = cls()\n for key in iterable:\n d[key] = value\n return d\n\n def __eq__(self, other):\n '''od.__eq__(y) <==> od==y. Comparison to another OD is order-sensitive\n while comparison to a regular mapping is order-insensitive.\n\n '''\n if isinstance(other, OrderedDict):\n return len(self) == len(\n other) and self.items() == other.items()\n return dict.__eq__(self, other)\n\n def __ne__(self, other):\n return not self == other\n\n # -- the following methods are only used in Python 2.7 --\n\n def viewkeys(self):\n \"od.viewkeys() -> a set-like object providing a view on od's keys\"\n return KeysView(self)\n\n def viewvalues(self):\n \"od.viewvalues() -> an object providing a view on od's values\"\n return ValuesView(self)\n\n def viewitems(self):\n \"od.viewitems() -> a set-like object providing a view on od's items\"\n return ItemsView(self)\n\n\ntry:\n from logging.config import BaseConfigurator, valid_ident\nexcept ImportError: # pragma: no cover\n IDENTIFIER = re.compile('^[a-z_][a-z0-9_]*$', re.I)\n\n def valid_ident(s):\n m = IDENTIFIER.match(s)\n if not m:\n raise ValueError('Not a valid Python identifier: %r' % s)\n return True\n\n # The ConvertingXXX classes are wrappers around standard Python containers,\n # and they serve to convert any suitable values in the container. The\n # conversion converts base dicts, lists and tuples to their wrapped\n # equivalents, whereas strings which match a conversion format are converted\n # appropriately.\n #\n # Each wrapper should have a configurator attribute holding the actual\n # configurator to use for conversion.\n\n class ConvertingDict(dict):\n \"\"\"A converting dictionary wrapper.\"\"\"\n\n def __getitem__(self, key):\n value = dict.__getitem__(self, key)\n result = self.configurator.convert(value)\n # If the converted value is different, save for next time\n if value is not result:\n self[key] = result\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n result.key = key\n return result\n\n def get(self, key, default=None):\n value = dict.get(self, key, default)\n result = self.configurator.convert(value)\n # If the converted value is different, save for next time\n if value is not result:\n self[key] = result\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n result.key = key\n return result\n\n def pop(self, key, default=None):\n value = dict.pop(self, key, default)\n result = self.configurator.convert(value)\n if value is not result:\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n result.key = key\n return result\n\n class ConvertingList(list):\n \"\"\"A converting list wrapper.\"\"\"\n\n def __getitem__(self, key):\n value = list.__getitem__(self, key)\n result = self.configurator.convert(value)\n # If the converted value is different, save for next time\n if value is not result:\n self[key] = result\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n result.key = key\n return result\n\n def pop(self, idx=-1):\n value = list.pop(self, idx)\n result = self.configurator.convert(value)\n if value is not result:\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n return result\n\n class ConvertingTuple(tuple):\n \"\"\"A converting tuple wrapper.\"\"\"\n\n def __getitem__(self, key):\n value = tuple.__getitem__(self, key)\n result = self.configurator.convert(value)\n if value is not result:\n if type(result) in (ConvertingDict, ConvertingList,\n ConvertingTuple):\n result.parent = self\n result.key = key\n return result\n\n class BaseConfigurator(object):\n \"\"\"\n The configurator base class which defines some useful defaults.\n \"\"\"\n\n CONVERT_PATTERN = re.compile(r'^(?P[a-z]+)://(?P.*)$')\n\n WORD_PATTERN = re.compile(r'^\\s*(\\w+)\\s*')\n DOT_PATTERN = re.compile(r'^\\.\\s*(\\w+)\\s*')\n INDEX_PATTERN = re.compile(r'^\\[\\s*(\\w+)\\s*\\]\\s*')\n DIGIT_PATTERN = re.compile(r'^\\d+$')\n\n value_converters = {\n 'ext': 'ext_convert',\n 'cfg': 'cfg_convert',\n }\n\n # We might want to use a different one, e.g. importlib\n importer = staticmethod(__import__)\n\n def __init__(self, config):\n self.config = ConvertingDict(config)\n self.config.configurator = self\n\n def resolve(self, s):\n \"\"\"\n Resolve strings to objects using standard import and attribute\n syntax.\n \"\"\"\n name = s.split('.')\n used = name.pop(0)\n try:\n found = self.importer(used)\n for frag in name:\n used += '.' + frag\n try:\n found = getattr(found, frag)\n except AttributeError:\n self.importer(used)\n found = getattr(found, frag)\n return found\n except ImportError:\n e, tb = sys.exc_info()[1:]\n v = ValueError('Cannot resolve %r: %s' % (s, e))\n v.__cause__, v.__traceback__ = e, tb\n raise v\n\n def ext_convert(self, value):\n \"\"\"Default converter for the ext:// protocol.\"\"\"\n return self.resolve(value)\n\n def cfg_convert(self, value):\n \"\"\"Default converter for the cfg:// protocol.\"\"\"\n rest = value\n m = self.WORD_PATTERN.match(rest)\n if m is None:\n raise ValueError(\"Unable to convert %r\" % value)\n else:\n rest = rest[m.end():]\n d = self.config[m.groups()[0]]\n while rest:\n m = self.DOT_PATTERN.match(rest)\n if m:\n d = d[m.groups()[0]]\n else:\n m = self.INDEX_PATTERN.match(rest)\n if m:\n idx = m.groups()[0]\n if not self.DIGIT_PATTERN.match(idx):\n d = d[idx]\n else:\n try:\n n = int(\n idx\n ) # try as number first (most likely)\n d = d[n]\n except TypeError:\n d = d[idx]\n if m:\n rest = rest[m.end():]\n else:\n raise ValueError('Unable to convert '\n '%r at %r' % (value, rest))\n # rest should be empty\n return d\n\n def convert(self, value):\n \"\"\"\n Convert values to an appropriate type. dicts, lists and tuples are\n replaced by their converting alternatives. Strings are checked to\n see if they have a conversion format and are converted if they do.\n \"\"\"\n if not isinstance(value, ConvertingDict) and isinstance(\n value, dict):\n value = ConvertingDict(value)\n value.configurator = self\n elif not isinstance(value, ConvertingList) and isinstance(\n value, list):\n value = ConvertingList(value)\n value.configurator = self\n elif not isinstance(value, ConvertingTuple) and isinstance(value, tuple):\n value = ConvertingTuple(value)\n value.configurator = self\n elif isinstance(value, string_types):\n m = self.CONVERT_PATTERN.match(value)\n if m:\n d = m.groupdict()\n prefix = d['prefix']\n converter = self.value_converters.get(prefix, None)\n if converter:\n suffix = d['suffix']\n converter = getattr(self, converter)\n value = converter(suffix)\n return value\n\n def configure_custom(self, config):\n \"\"\"Configure an object with a user-supplied factory.\"\"\"\n c = config.pop('()')\n if not callable(c):\n c = self.resolve(c)\n props = config.pop('.', None)\n # Check for valid identifiers\n kwargs = dict([(k, config[k]) for k in config if valid_ident(k)])\n result = c(**kwargs)\n if props:\n for name, value in props.items():\n setattr(result, name, value)\n return result\n\n def as_tuple(self, value):\n \"\"\"Utility function which converts lists to tuples.\"\"\"\n if isinstance(value, list):\n value = tuple(value)\n return value\n",[],[100,509,516,523,475,1961,2183,1624],{"_104":2205,"_96":2206,"_158":2207,"_160":2184,"_161":139,"_162":2208,"_164":165,"_106":2209,"_101":29,"_167":215,"_169":2210,"_170":25,"_171":-5,"_172":2211,"_99":2212},"097befb2-67fc-11f0-a99a-0224a6c84d84","database.py","097bf052-67fc-11f0-a99a-0224a6c84d84",340,["D",1753299263533],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"PEP 376 implementation.\"\"\"\n\nfrom __future__ import unicode_literals\n\nimport base64\nimport codecs\nimport contextlib\nimport hashlib\nimport logging\nimport os\nimport posixpath\nimport sys\nimport zipimport\n\nfrom . import DistlibException, resources\nfrom .compat import StringIO\nfrom .version import get_scheme, UnsupportedVersionError\nfrom .metadata import (Metadata, METADATA_FILENAME, WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME)\nfrom .util import (parse_requirement, cached_property, parse_name_and_version, read_exports, write_exports, CSVReader,\n CSVWriter)\n\n__all__ = [\n 'Distribution', 'BaseInstalledDistribution', 'InstalledDistribution', 'EggInfoDistribution', 'DistributionPath'\n]\n\nlogger = logging.getLogger(__name__)\n\nEXPORTS_FILENAME = 'pydist-exports.json'\nCOMMANDS_FILENAME = 'pydist-commands.json'\n\nDIST_FILES = ('INSTALLER', METADATA_FILENAME, 'RECORD', 'REQUESTED', 'RESOURCES', EXPORTS_FILENAME, 'SHARED')\n\nDISTINFO_EXT = '.dist-info'\n\n\nclass _Cache(object):\n \"\"\"\n A simple cache mapping names and .dist-info paths to distributions\n \"\"\"\n\n def __init__(self):\n \"\"\"\n Initialise an instance. There is normally one for each DistributionPath.\n \"\"\"\n self.name = {}\n self.path = {}\n self.generated = False\n\n def clear(self):\n \"\"\"\n Clear the cache, setting it to its initial state.\n \"\"\"\n self.name.clear()\n self.path.clear()\n self.generated = False\n\n def add(self, dist):\n \"\"\"\n Add a distribution to the cache.\n :param dist: The distribution to add.\n \"\"\"\n if dist.path not in self.path:\n self.path[dist.path] = dist\n self.name.setdefault(dist.key, []).append(dist)\n\n\nclass DistributionPath(object):\n \"\"\"\n Represents a set of distributions installed on a path (typically sys.path).\n \"\"\"\n\n def __init__(self, path=None, include_egg=False):\n \"\"\"\n Create an instance from a path, optionally including legacy (distutils/\n setuptools/distribute) distributions.\n :param path: The path to use, as a list of directories. If not specified,\n sys.path is used.\n :param include_egg: If True, this instance will look for and return legacy\n distributions as well as those based on PEP 376.\n \"\"\"\n if path is None:\n path = sys.path\n self.path = path\n self._include_dist = True\n self._include_egg = include_egg\n\n self._cache = _Cache()\n self._cache_egg = _Cache()\n self._cache_enabled = True\n self._scheme = get_scheme('default')\n\n def _get_cache_enabled(self):\n return self._cache_enabled\n\n def _set_cache_enabled(self, value):\n self._cache_enabled = value\n\n cache_enabled = property(_get_cache_enabled, _set_cache_enabled)\n\n def clear_cache(self):\n \"\"\"\n Clears the internal cache.\n \"\"\"\n self._cache.clear()\n self._cache_egg.clear()\n\n def _yield_distributions(self):\n \"\"\"\n Yield .dist-info and/or .egg(-info) distributions.\n \"\"\"\n # We need to check if we've seen some resources already, because on\n # some Linux systems (e.g. some Debian/Ubuntu variants) there are\n # symlinks which alias other files in the environment.\n seen = set()\n for path in self.path:\n finder = resources.finder_for_path(path)\n if finder is None:\n continue\n r = finder.find('')\n if not r or not r.is_container:\n continue\n rset = sorted(r.resources)\n for entry in rset:\n r = finder.find(entry)\n if not r or r.path in seen:\n continue\n try:\n if self._include_dist and entry.endswith(DISTINFO_EXT):\n possible_filenames = [METADATA_FILENAME, WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME]\n for metadata_filename in possible_filenames:\n metadata_path = posixpath.join(entry, metadata_filename)\n pydist = finder.find(metadata_path)\n if pydist:\n break\n else:\n continue\n\n with contextlib.closing(pydist.as_stream()) as stream:\n metadata = Metadata(fileobj=stream, scheme='legacy')\n logger.debug('Found %s', r.path)\n seen.add(r.path)\n yield new_dist_class(r.path, metadata=metadata, env=self)\n elif self._include_egg and entry.endswith(('.egg-info', '.egg')):\n logger.debug('Found %s', r.path)\n seen.add(r.path)\n yield old_dist_class(r.path, self)\n except Exception as e:\n msg = 'Unable to read distribution at %s, perhaps due to bad metadata: %s'\n logger.warning(msg, r.path, e)\n import warnings\n warnings.warn(msg % (r.path, e), stacklevel=2)\n\n def _generate_cache(self):\n \"\"\"\n Scan the path for distributions and populate the cache with\n those that are found.\n \"\"\"\n gen_dist = not self._cache.generated\n gen_egg = self._include_egg and not self._cache_egg.generated\n if gen_dist or gen_egg:\n for dist in self._yield_distributions():\n if isinstance(dist, InstalledDistribution):\n self._cache.add(dist)\n else:\n self._cache_egg.add(dist)\n\n if gen_dist:\n self._cache.generated = True\n if gen_egg:\n self._cache_egg.generated = True\n\n @classmethod\n def distinfo_dirname(cls, name, version):\n \"\"\"\n The *name* and *version* parameters are converted into their\n filename-escaped form, i.e. any ``'-'`` characters are replaced\n with ``'_'`` other than the one in ``'dist-info'`` and the one\n separating the name from the version number.\n\n :parameter name: is converted to a standard distribution name by replacing\n any runs of non- alphanumeric characters with a single\n ``'-'``.\n :type name: string\n :parameter version: is converted to a standard version string. Spaces\n become dots, and all other non-alphanumeric characters\n (except dots) become dashes, with runs of multiple\n dashes condensed to a single dash.\n :type version: string\n :returns: directory name\n :rtype: string\"\"\"\n name = name.replace('-', '_')\n return '-'.join([name, version]) + DISTINFO_EXT\n\n def get_distributions(self):\n \"\"\"\n Provides an iterator that looks for distributions and returns\n :class:`InstalledDistribution` or\n :class:`EggInfoDistribution` instances for each one of them.\n\n :rtype: iterator of :class:`InstalledDistribution` and\n :class:`EggInfoDistribution` instances\n \"\"\"\n if not self._cache_enabled:\n for dist in self._yield_distributions():\n yield dist\n else:\n self._generate_cache()\n\n for dist in self._cache.path.values():\n yield dist\n\n if self._include_egg:\n for dist in self._cache_egg.path.values():\n yield dist\n\n def get_distribution(self, name):\n \"\"\"\n Looks for a named distribution on the path.\n\n This function only returns the first result found, as no more than one\n value is expected. If nothing is found, ``None`` is returned.\n\n :rtype: :class:`InstalledDistribution`, :class:`EggInfoDistribution`\n or ``None``\n \"\"\"\n result = None\n name = name.lower()\n if not self._cache_enabled:\n for dist in self._yield_distributions():\n if dist.key == name:\n result = dist\n break\n else:\n self._generate_cache()\n\n if name in self._cache.name:\n result = self._cache.name[name][0]\n elif self._include_egg and name in self._cache_egg.name:\n result = self._cache_egg.name[name][0]\n return result\n\n def provides_distribution(self, name, version=None):\n \"\"\"\n Iterates over all distributions to find which distributions provide *name*.\n If a *version* is provided, it will be used to filter the results.\n\n This function only returns the first result found, since no more than\n one values are expected. If the directory is not found, returns ``None``.\n\n :parameter version: a version specifier that indicates the version\n required, conforming to the format in ``PEP-345``\n\n :type name: string\n :type version: string\n \"\"\"\n matcher = None\n if version is not None:\n try:\n matcher = self._scheme.matcher('%s (%s)' % (name, version))\n except ValueError:\n raise DistlibException('invalid name or version: %r, %r' % (name, version))\n\n for dist in self.get_distributions():\n # We hit a problem on Travis where enum34 was installed and doesn't\n # have a provides attribute ...\n if not hasattr(dist, 'provides'):\n logger.debug('No \"provides\": %s', dist)\n else:\n provided = dist.provides\n\n for p in provided:\n p_name, p_ver = parse_name_and_version(p)\n if matcher is None:\n if p_name == name:\n yield dist\n break\n else:\n if p_name == name and matcher.match(p_ver):\n yield dist\n break\n\n def get_file_path(self, name, relative_path):\n \"\"\"\n Return the path to a resource file.\n \"\"\"\n dist = self.get_distribution(name)\n if dist is None:\n raise LookupError('no distribution named %r found' % name)\n return dist.get_resource_path(relative_path)\n\n def get_exported_entries(self, category, name=None):\n \"\"\"\n Return all of the exported entries in a particular category.\n\n :param category: The category to search for entries.\n :param name: If specified, only entries with that name are returned.\n \"\"\"\n for dist in self.get_distributions():\n r = dist.exports\n if category in r:\n d = r[category]\n if name is not None:\n if name in d:\n yield d[name]\n else:\n for v in d.values():\n yield v\n\n\nclass Distribution(object):\n \"\"\"\n A base class for distributions, whether installed or from indexes.\n Either way, it must have some metadata, so that's all that's needed\n for construction.\n \"\"\"\n\n build_time_dependency = False\n \"\"\"\n Set to True if it's known to be only a build-time dependency (i.e.\n not needed after installation).\n \"\"\"\n\n requested = False\n \"\"\"A boolean that indicates whether the ``REQUESTED`` metadata file is\n present (in other words, whether the package was installed by user\n request or it was installed as a dependency).\"\"\"\n\n def __init__(self, metadata):\n \"\"\"\n Initialise an instance.\n :param metadata: The instance of :class:`Metadata` describing this\n distribution.\n \"\"\"\n self.metadata = metadata\n self.name = metadata.name\n self.key = self.name.lower() # for case-insensitive comparisons\n self.version = metadata.version\n self.locator = None\n self.digest = None\n self.extras = None # additional features requested\n self.context = None # environment marker overrides\n self.download_urls = set()\n self.digests = {}\n\n @property\n def source_url(self):\n \"\"\"\n The source archive download URL for this distribution.\n \"\"\"\n return self.metadata.source_url\n\n download_url = source_url # Backward compatibility\n\n @property\n def name_and_version(self):\n \"\"\"\n A utility property which displays the name and version in parentheses.\n \"\"\"\n return '%s (%s)' % (self.name, self.version)\n\n @property\n def provides(self):\n \"\"\"\n A set of distribution names and versions provided by this distribution.\n :return: A set of \"name (version)\" strings.\n \"\"\"\n plist = self.metadata.provides\n s = '%s (%s)' % (self.name, self.version)\n if s not in plist:\n plist.append(s)\n return plist\n\n def _get_requirements(self, req_attr):\n md = self.metadata\n reqts = getattr(md, req_attr)\n logger.debug('%s: got requirements %r from metadata: %r', self.name, req_attr, reqts)\n return set(md.get_requirements(reqts, extras=self.extras, env=self.context))\n\n @property\n def run_requires(self):\n return self._get_requirements('run_requires')\n\n @property\n def meta_requires(self):\n return self._get_requirements('meta_requires')\n\n @property\n def build_requires(self):\n return self._get_requirements('build_requires')\n\n @property\n def test_requires(self):\n return self._get_requirements('test_requires')\n\n @property\n def dev_requires(self):\n return self._get_requirements('dev_requires')\n\n def matches_requirement(self, req):\n \"\"\"\n Say if this instance matches (fulfills) a requirement.\n :param req: The requirement to match.\n :rtype req: str\n :return: True if it matches, else False.\n \"\"\"\n # Requirement may contain extras - parse to lose those\n # from what's passed to the matcher\n r = parse_requirement(req)\n scheme = get_scheme(self.metadata.scheme)\n try:\n matcher = scheme.matcher(r.requirement)\n except UnsupportedVersionError:\n # XXX compat-mode if cannot read the version\n logger.warning('could not read version %r - using name only', req)\n name = req.split()[0]\n matcher = scheme.matcher(name)\n\n name = matcher.key # case-insensitive\n\n result = False\n for p in self.provides:\n p_name, p_ver = parse_name_and_version(p)\n if p_name != name:\n continue\n try:\n result = matcher.match(p_ver)\n break\n except UnsupportedVersionError:\n pass\n return result\n\n def __repr__(self):\n \"\"\"\n Return a textual representation of this instance,\n \"\"\"\n if self.source_url:\n suffix = ' [%s]' % self.source_url\n else:\n suffix = ''\n return '' % (self.name, self.version, suffix)\n\n def __eq__(self, other):\n \"\"\"\n See if this distribution is the same as another.\n :param other: The distribution to compare with. To be equal to one\n another. distributions must have the same type, name,\n version and source_url.\n :return: True if it is the same, else False.\n \"\"\"\n if type(other) is not type(self):\n result = False\n else:\n result = (self.name == other.name and self.version == other.version and self.source_url == other.source_url)\n return result\n\n def __hash__(self):\n \"\"\"\n Compute hash in a way which matches the equality test.\n \"\"\"\n return hash(self.name) + hash(self.version) + hash(self.source_url)\n\n\nclass BaseInstalledDistribution(Distribution):\n \"\"\"\n This is the base class for installed distributions (whether PEP 376 or\n legacy).\n \"\"\"\n\n hasher = None\n\n def __init__(self, metadata, path, env=None):\n \"\"\"\n Initialise an instance.\n :param metadata: An instance of :class:`Metadata` which describes the\n distribution. This will normally have been initialised\n from a metadata file in the ``path``.\n :param path: The path of the ``.dist-info`` or ``.egg-info``\n directory for the distribution.\n :param env: This is normally the :class:`DistributionPath`\n instance where this distribution was found.\n \"\"\"\n super(BaseInstalledDistribution, self).__init__(metadata)\n self.path = path\n self.dist_path = env\n\n def get_hash(self, data, hasher=None):\n \"\"\"\n Get the hash of some data, using a particular hash algorithm, if\n specified.\n\n :param data: The data to be hashed.\n :type data: bytes\n :param hasher: The name of a hash implementation, supported by hashlib,\n or ``None``. Examples of valid values are ``'sha1'``,\n ``'sha224'``, ``'sha384'``, '``sha256'``, ``'md5'`` and\n ``'sha512'``. If no hasher is specified, the ``hasher``\n attribute of the :class:`InstalledDistribution` instance\n is used. If the hasher is determined to be ``None``, MD5\n is used as the hashing algorithm.\n :returns: The hash of the data. If a hasher was explicitly specified,\n the returned hash will be prefixed with the specified hasher\n followed by '='.\n :rtype: str\n \"\"\"\n if hasher is None:\n hasher = self.hasher\n if hasher is None:\n hasher = hashlib.md5\n prefix = ''\n else:\n hasher = getattr(hashlib, hasher)\n prefix = '%s=' % self.hasher\n digest = hasher(data).digest()\n digest = base64.urlsafe_b64encode(digest).rstrip(b'=').decode('ascii')\n return '%s%s' % (prefix, digest)\n\n\nclass InstalledDistribution(BaseInstalledDistribution):\n \"\"\"\n Created with the *path* of the ``.dist-info`` directory provided to the\n constructor. It reads the metadata contained in ``pydist.json`` when it is\n instantiated., or uses a passed in Metadata instance (useful for when\n dry-run mode is being used).\n \"\"\"\n\n hasher = 'sha256'\n\n def __init__(self, path, metadata=None, env=None):\n self.modules = []\n self.finder = finder = resources.finder_for_path(path)\n if finder is None:\n raise ValueError('finder unavailable for %s' % path)\n if env and env._cache_enabled and path in env._cache.path:\n metadata = env._cache.path[path].metadata\n elif metadata is None:\n r = finder.find(METADATA_FILENAME)\n # Temporary - for Wheel 0.23 support\n if r is None:\n r = finder.find(WHEEL_METADATA_FILENAME)\n # Temporary - for legacy support\n if r is None:\n r = finder.find(LEGACY_METADATA_FILENAME)\n if r is None:\n raise ValueError('no %s found in %s' % (METADATA_FILENAME, path))\n with contextlib.closing(r.as_stream()) as stream:\n metadata = Metadata(fileobj=stream, scheme='legacy')\n\n super(InstalledDistribution, self).__init__(metadata, path, env)\n\n if env and env._cache_enabled:\n env._cache.add(self)\n\n r = finder.find('REQUESTED')\n self.requested = r is not None\n p = os.path.join(path, 'top_level.txt')\n if os.path.exists(p):\n with open(p, 'rb') as f:\n data = f.read().decode('utf-8')\n self.modules = data.splitlines()\n\n def __repr__(self):\n return '' % (self.name, self.version, self.path)\n\n def __str__(self):\n return \"%s %s\" % (self.name, self.version)\n\n def _get_records(self):\n \"\"\"\n Get the list of installed files for the distribution\n :return: A list of tuples of path, hash and size. Note that hash and\n size might be ``None`` for some entries. The path is exactly\n as stored in the file (which is as in PEP 376).\n \"\"\"\n results = []\n r = self.get_distinfo_resource('RECORD')\n with contextlib.closing(r.as_stream()) as stream:\n with CSVReader(stream=stream) as record_reader:\n # Base location is parent dir of .dist-info dir\n # base_location = os.path.dirname(self.path)\n # base_location = os.path.abspath(base_location)\n for row in record_reader:\n missing = [None for i in range(len(row), 3)]\n path, checksum, size = row + missing\n # if not os.path.isabs(path):\n # path = path.replace('/', os.sep)\n # path = os.path.join(base_location, path)\n results.append((path, checksum, size))\n return results\n\n @cached_property\n def exports(self):\n \"\"\"\n Return the information exported by this distribution.\n :return: A dictionary of exports, mapping an export category to a dict\n of :class:`ExportEntry` instances describing the individual\n export entries, and keyed by name.\n \"\"\"\n result = {}\n r = self.get_distinfo_resource(EXPORTS_FILENAME)\n if r:\n result = self.read_exports()\n return result\n\n def read_exports(self):\n \"\"\"\n Read exports data from a file in .ini format.\n\n :return: A dictionary of exports, mapping an export category to a list\n of :class:`ExportEntry` instances describing the individual\n export entries.\n \"\"\"\n result = {}\n r = self.get_distinfo_resource(EXPORTS_FILENAME)\n if r:\n with contextlib.closing(r.as_stream()) as stream:\n result = read_exports(stream)\n return result\n\n def write_exports(self, exports):\n \"\"\"\n Write a dictionary of exports to a file in .ini format.\n :param exports: A dictionary of exports, mapping an export category to\n a list of :class:`ExportEntry` instances describing the\n individual export entries.\n \"\"\"\n rf = self.get_distinfo_file(EXPORTS_FILENAME)\n with open(rf, 'w') as f:\n write_exports(exports, f)\n\n def get_resource_path(self, relative_path):\n \"\"\"\n NOTE: This API may change in the future.\n\n Return the absolute path to a resource file with the given relative\n path.\n\n :param relative_path: The path, relative to .dist-info, of the resource\n of interest.\n :return: The absolute path where the resource is to be found.\n \"\"\"\n r = self.get_distinfo_resource('RESOURCES')\n with contextlib.closing(r.as_stream()) as stream:\n with CSVReader(stream=stream) as resources_reader:\n for relative, destination in resources_reader:\n if relative == relative_path:\n return destination\n raise KeyError('no resource file with relative path %r '\n 'is installed' % relative_path)\n\n def list_installed_files(self):\n \"\"\"\n Iterates over the ``RECORD`` entries and returns a tuple\n ``(path, hash, size)`` for each line.\n\n :returns: iterator of (path, hash, size)\n \"\"\"\n for result in self._get_records():\n yield result\n\n def write_installed_files(self, paths, prefix, dry_run=False):\n \"\"\"\n Writes the ``RECORD`` file, using the ``paths`` iterable passed in. Any\n existing ``RECORD`` file is silently overwritten.\n\n prefix is used to determine when to write absolute paths.\n \"\"\"\n prefix = os.path.join(prefix, '')\n base = os.path.dirname(self.path)\n base_under_prefix = base.startswith(prefix)\n base = os.path.join(base, '')\n record_path = self.get_distinfo_file('RECORD')\n logger.info('creating %s', record_path)\n if dry_run:\n return None\n with CSVWriter(record_path) as writer:\n for path in paths:\n if os.path.isdir(path) or path.endswith(('.pyc', '.pyo')):\n # do not put size and hash, as in PEP-376\n hash_value = size = ''\n else:\n size = '%d' % os.path.getsize(path)\n with open(path, 'rb') as fp:\n hash_value = self.get_hash(fp.read())\n if path.startswith(base) or (base_under_prefix and path.startswith(prefix)):\n path = os.path.relpath(path, base)\n writer.writerow((path, hash_value, size))\n\n # add the RECORD file itself\n if record_path.startswith(base):\n record_path = os.path.relpath(record_path, base)\n writer.writerow((record_path, '', ''))\n return record_path\n\n def check_installed_files(self):\n \"\"\"\n Checks that the hashes and sizes of the files in ``RECORD`` are\n matched by the files themselves. Returns a (possibly empty) list of\n mismatches. Each entry in the mismatch list will be a tuple consisting\n of the path, 'exists', 'size' or 'hash' according to what didn't match\n (existence is checked first, then size, then hash), the expected\n value and the actual value.\n \"\"\"\n mismatches = []\n base = os.path.dirname(self.path)\n record_path = self.get_distinfo_file('RECORD')\n for path, hash_value, size in self.list_installed_files():\n if not os.path.isabs(path):\n path = os.path.join(base, path)\n if path == record_path:\n continue\n if not os.path.exists(path):\n mismatches.append((path, 'exists', True, False))\n elif os.path.isfile(path):\n actual_size = str(os.path.getsize(path))\n if size and actual_size != size:\n mismatches.append((path, 'size', size, actual_size))\n elif hash_value:\n if '=' in hash_value:\n hasher = hash_value.split('=', 1)[0]\n else:\n hasher = None\n\n with open(path, 'rb') as f:\n actual_hash = self.get_hash(f.read(), hasher)\n if actual_hash != hash_value:\n mismatches.append((path, 'hash', hash_value, actual_hash))\n return mismatches\n\n @cached_property\n def shared_locations(self):\n \"\"\"\n A dictionary of shared locations whose keys are in the set 'prefix',\n 'purelib', 'platlib', 'scripts', 'headers', 'data' and 'namespace'.\n The corresponding value is the absolute path of that category for\n this distribution, and takes into account any paths selected by the\n user at installation time (e.g. via command-line arguments). In the\n case of the 'namespace' key, this would be a list of absolute paths\n for the roots of namespace packages in this distribution.\n\n The first time this property is accessed, the relevant information is\n read from the SHARED file in the .dist-info directory.\n \"\"\"\n result = {}\n shared_path = os.path.join(self.path, 'SHARED')\n if os.path.isfile(shared_path):\n with codecs.open(shared_path, 'r', encoding='utf-8') as f:\n lines = f.read().splitlines()\n for line in lines:\n key, value = line.split('=', 1)\n if key == 'namespace':\n result.setdefault(key, []).append(value)\n else:\n result[key] = value\n return result\n\n def write_shared_locations(self, paths, dry_run=False):\n \"\"\"\n Write shared location information to the SHARED file in .dist-info.\n :param paths: A dictionary as described in the documentation for\n :meth:`shared_locations`.\n :param dry_run: If True, the action is logged but no file is actually\n written.\n :return: The path of the file written to.\n \"\"\"\n shared_path = os.path.join(self.path, 'SHARED')\n logger.info('creating %s', shared_path)\n if dry_run:\n return None\n lines = []\n for key in ('prefix', 'lib', 'headers', 'scripts', 'data'):\n path = paths[key]\n if os.path.isdir(paths[key]):\n lines.append('%s=%s' % (key, path))\n for ns in paths.get('namespace', ()):\n lines.append('namespace=%s' % ns)\n\n with codecs.open(shared_path, 'w', encoding='utf-8') as f:\n f.write('\\n'.join(lines))\n return shared_path\n\n def get_distinfo_resource(self, path):\n if path not in DIST_FILES:\n raise DistlibException('invalid path for a dist-info file: '\n '%r at %r' % (path, self.path))\n finder = resources.finder_for_path(self.path)\n if finder is None:\n raise DistlibException('Unable to get a finder for %s' % self.path)\n return finder.find(path)\n\n def get_distinfo_file(self, path):\n \"\"\"\n Returns a path located under the ``.dist-info`` directory. Returns a\n string representing the path.\n\n :parameter path: a ``'/'``-separated path relative to the\n ``.dist-info`` directory or an absolute path;\n If *path* is an absolute path and doesn't start\n with the ``.dist-info`` directory path,\n a :class:`DistlibException` is raised\n :type path: str\n :rtype: str\n \"\"\"\n # Check if it is an absolute path # XXX use relpath, add tests\n if path.find(os.sep) >= 0:\n # it's an absolute path?\n distinfo_dirname, path = path.split(os.sep)[-2:]\n if distinfo_dirname != self.path.split(os.sep)[-1]:\n raise DistlibException('dist-info file %r does not belong to the %r %s '\n 'distribution' % (path, self.name, self.version))\n\n # The file must be relative\n if path not in DIST_FILES:\n raise DistlibException('invalid path for a dist-info file: '\n '%r at %r' % (path, self.path))\n\n return os.path.join(self.path, path)\n\n def list_distinfo_files(self):\n \"\"\"\n Iterates over the ``RECORD`` entries and returns paths for each line if\n the path is pointing to a file located in the ``.dist-info`` directory\n or one of its subdirectories.\n\n :returns: iterator of paths\n \"\"\"\n base = os.path.dirname(self.path)\n for path, checksum, size in self._get_records():\n # XXX add separator or use real relpath algo\n if not os.path.isabs(path):\n path = os.path.join(base, path)\n if path.startswith(self.path):\n yield path\n\n def __eq__(self, other):\n return (isinstance(other, InstalledDistribution) and self.path == other.path)\n\n # See http://docs.python.org/reference/datamodel#object.__hash__\n __hash__ = object.__hash__\n\n\nclass EggInfoDistribution(BaseInstalledDistribution):\n \"\"\"Created with the *path* of the ``.egg-info`` directory or file provided\n to the constructor. It reads the metadata contained in the file itself, or\n if the given path happens to be a directory, the metadata is read from the\n file ``PKG-INFO`` under that directory.\"\"\"\n\n requested = True # as we have no way of knowing, assume it was\n shared_locations = {}\n\n def __init__(self, path, env=None):\n\n def set_name_and_version(s, n, v):\n s.name = n\n s.key = n.lower() # for case-insensitive comparisons\n s.version = v\n\n self.path = path\n self.dist_path = env\n if env and env._cache_enabled and path in env._cache_egg.path:\n metadata = env._cache_egg.path[path].metadata\n set_name_and_version(self, metadata.name, metadata.version)\n else:\n metadata = self._get_metadata(path)\n\n # Need to be set before caching\n set_name_and_version(self, metadata.name, metadata.version)\n\n if env and env._cache_enabled:\n env._cache_egg.add(self)\n super(EggInfoDistribution, self).__init__(metadata, path, env)\n\n def _get_metadata(self, path):\n requires = None\n\n def parse_requires_data(data):\n \"\"\"Create a list of dependencies from a requires.txt file.\n\n *data*: the contents of a setuptools-produced requires.txt file.\n \"\"\"\n reqs = []\n lines = data.splitlines()\n for line in lines:\n line = line.strip()\n # sectioned files have bare newlines (separating sections)\n if not line: # pragma: no cover\n continue\n if line.startswith('['): # pragma: no cover\n logger.warning('Unexpected line: quitting requirement scan: %r', line)\n break\n r = parse_requirement(line)\n if not r: # pragma: no cover\n logger.warning('Not recognised as a requirement: %r', line)\n continue\n if r.extras: # pragma: no cover\n logger.warning('extra requirements in requires.txt are '\n 'not supported')\n if not r.constraints:\n reqs.append(r.name)\n else:\n cons = ', '.join('%s%s' % c for c in r.constraints)\n reqs.append('%s (%s)' % (r.name, cons))\n return reqs\n\n def parse_requires_path(req_path):\n \"\"\"Create a list of dependencies from a requires.txt file.\n\n *req_path*: the path to a setuptools-produced requires.txt file.\n \"\"\"\n\n reqs = []\n try:\n with codecs.open(req_path, 'r', 'utf-8') as fp:\n reqs = parse_requires_data(fp.read())\n except IOError:\n pass\n return reqs\n\n tl_path = tl_data = None\n if path.endswith('.egg'):\n if os.path.isdir(path):\n p = os.path.join(path, 'EGG-INFO')\n meta_path = os.path.join(p, 'PKG-INFO')\n metadata = Metadata(path=meta_path, scheme='legacy')\n req_path = os.path.join(p, 'requires.txt')\n tl_path = os.path.join(p, 'top_level.txt')\n requires = parse_requires_path(req_path)\n else:\n # FIXME handle the case where zipfile is not available\n zipf = zipimport.zipimporter(path)\n fileobj = StringIO(zipf.get_data('EGG-INFO/PKG-INFO').decode('utf8'))\n metadata = Metadata(fileobj=fileobj, scheme='legacy')\n try:\n data = zipf.get_data('EGG-INFO/requires.txt')\n tl_data = zipf.get_data('EGG-INFO/top_level.txt').decode('utf-8')\n requires = parse_requires_data(data.decode('utf-8'))\n except IOError:\n requires = None\n elif path.endswith('.egg-info'):\n if os.path.isdir(path):\n req_path = os.path.join(path, 'requires.txt')\n requires = parse_requires_path(req_path)\n path = os.path.join(path, 'PKG-INFO')\n tl_path = os.path.join(path, 'top_level.txt')\n metadata = Metadata(path=path, scheme='legacy')\n else:\n raise DistlibException('path must end with .egg-info or .egg, '\n 'got %r' % path)\n\n if requires:\n metadata.add_requirements(requires)\n # look for top-level modules in top_level.txt, if present\n if tl_data is None:\n if tl_path is not None and os.path.exists(tl_path):\n with open(tl_path, 'rb') as f:\n tl_data = f.read().decode('utf-8')\n if not tl_data:\n tl_data = []\n else:\n tl_data = tl_data.splitlines()\n self.modules = tl_data\n return metadata\n\n def __repr__(self):\n return '' % (self.name, self.version, self.path)\n\n def __str__(self):\n return \"%s %s\" % (self.name, self.version)\n\n def check_installed_files(self):\n \"\"\"\n Checks that the hashes and sizes of the files in ``RECORD`` are\n matched by the files themselves. Returns a (possibly empty) list of\n mismatches. Each entry in the mismatch list will be a tuple consisting\n of the path, 'exists', 'size' or 'hash' according to what didn't match\n (existence is checked first, then size, then hash), the expected\n value and the actual value.\n \"\"\"\n mismatches = []\n record_path = os.path.join(self.path, 'installed-files.txt')\n if os.path.exists(record_path):\n for path, _, _ in self.list_installed_files():\n if path == record_path:\n continue\n if not os.path.exists(path):\n mismatches.append((path, 'exists', True, False))\n return mismatches\n\n def list_installed_files(self):\n \"\"\"\n Iterates over the ``installed-files.txt`` entries and returns a tuple\n ``(path, hash, size)`` for each line.\n\n :returns: a list of (path, hash, size)\n \"\"\"\n\n def _md5(path):\n f = open(path, 'rb')\n try:\n content = f.read()\n finally:\n f.close()\n return hashlib.md5(content).hexdigest()\n\n def _size(path):\n return os.stat(path).st_size\n\n record_path = os.path.join(self.path, 'installed-files.txt')\n result = []\n if os.path.exists(record_path):\n with codecs.open(record_path, 'r', encoding='utf-8') as f:\n for line in f:\n line = line.strip()\n p = os.path.normpath(os.path.join(self.path, line))\n # \"./\" is present as a marker between installed files\n # and installation metadata files\n if not os.path.exists(p):\n logger.warning('Non-existent file: %s', p)\n if p.endswith(('.pyc', '.pyo')):\n continue\n # otherwise fall through and fail\n if not os.path.isdir(p):\n result.append((p, _md5(p), _size(p)))\n result.append((record_path, None, None))\n return result\n\n def list_distinfo_files(self, absolute=False):\n \"\"\"\n Iterates over the ``installed-files.txt`` entries and returns paths for\n each line if the path is pointing to a file located in the\n ``.egg-info`` directory or one of its subdirectories.\n\n :parameter absolute: If *absolute* is ``True``, each returned path is\n transformed into a local absolute path. Otherwise the\n raw value from ``installed-files.txt`` is returned.\n :type absolute: boolean\n :returns: iterator of paths\n \"\"\"\n record_path = os.path.join(self.path, 'installed-files.txt')\n if os.path.exists(record_path):\n skip = True\n with codecs.open(record_path, 'r', encoding='utf-8') as f:\n for line in f:\n line = line.strip()\n if line == './':\n skip = False\n continue\n if not skip:\n p = os.path.normpath(os.path.join(self.path, line))\n if p.startswith(self.path):\n if absolute:\n yield p\n else:\n yield line\n\n def __eq__(self, other):\n return (isinstance(other, EggInfoDistribution) and self.path == other.path)\n\n # See http://docs.python.org/reference/datamodel#object.__hash__\n __hash__ = object.__hash__\n\n\nnew_dist_class = InstalledDistribution\nold_dist_class = EggInfoDistribution\n\n\nclass DependencyGraph(object):\n \"\"\"\n Represents a dependency graph between distributions.\n\n The dependency relationships are stored in an ``adjacency_list`` that maps\n distributions to a list of ``(other, label)`` tuples where ``other``\n is a distribution and the edge is labeled with ``label`` (i.e. the version\n specifier, if such was provided). Also, for more efficient traversal, for\n every distribution ``x``, a list of predecessors is kept in\n ``reverse_list[x]``. An edge from distribution ``a`` to\n distribution ``b`` means that ``a`` depends on ``b``. If any missing\n dependencies are found, they are stored in ``missing``, which is a\n dictionary that maps distributions to a list of requirements that were not\n provided by any other distributions.\n \"\"\"\n\n def __init__(self):\n self.adjacency_list = {}\n self.reverse_list = {}\n self.missing = {}\n\n def add_distribution(self, distribution):\n \"\"\"Add the *distribution* to the graph.\n\n :type distribution: :class:`distutils2.database.InstalledDistribution`\n or :class:`distutils2.database.EggInfoDistribution`\n \"\"\"\n self.adjacency_list[distribution] = []\n self.reverse_list[distribution] = []\n # self.missing[distribution] = []\n\n def add_edge(self, x, y, label=None):\n \"\"\"Add an edge from distribution *x* to distribution *y* with the given\n *label*.\n\n :type x: :class:`distutils2.database.InstalledDistribution` or\n :class:`distutils2.database.EggInfoDistribution`\n :type y: :class:`distutils2.database.InstalledDistribution` or\n :class:`distutils2.database.EggInfoDistribution`\n :type label: ``str`` or ``None``\n \"\"\"\n self.adjacency_list[x].append((y, label))\n # multiple edges are allowed, so be careful\n if x not in self.reverse_list[y]:\n self.reverse_list[y].append(x)\n\n def add_missing(self, distribution, requirement):\n \"\"\"\n Add a missing *requirement* for the given *distribution*.\n\n :type distribution: :class:`distutils2.database.InstalledDistribution`\n or :class:`distutils2.database.EggInfoDistribution`\n :type requirement: ``str``\n \"\"\"\n logger.debug('%s missing %r', distribution, requirement)\n self.missing.setdefault(distribution, []).append(requirement)\n\n def _repr_dist(self, dist):\n return '%s %s' % (dist.name, dist.version)\n\n def repr_node(self, dist, level=1):\n \"\"\"Prints only a subgraph\"\"\"\n output = [self._repr_dist(dist)]\n for other, label in self.adjacency_list[dist]:\n dist = self._repr_dist(other)\n if label is not None:\n dist = '%s [%s]' % (dist, label)\n output.append(' ' * level + str(dist))\n suboutput = self.repr_node(other, level + 1)\n subs = suboutput.split('\\n')\n output.extend(subs[1:])\n return '\\n'.join(output)\n\n def to_dot(self, f, skip_disconnected=True):\n \"\"\"Writes a DOT output for the graph to the provided file *f*.\n\n If *skip_disconnected* is set to ``True``, then all distributions\n that are not dependent on any other distribution are skipped.\n\n :type f: has to support ``file``-like operations\n :type skip_disconnected: ``bool``\n \"\"\"\n disconnected = []\n\n f.write(\"digraph dependencies {\\n\")\n for dist, adjs in self.adjacency_list.items():\n if len(adjs) == 0 and not skip_disconnected:\n disconnected.append(dist)\n for other, label in adjs:\n if label is not None:\n f.write('\"%s\" -> \"%s\" [label=\"%s\"]\\n' % (dist.name, other.name, label))\n else:\n f.write('\"%s\" -> \"%s\"\\n' % (dist.name, other.name))\n if not skip_disconnected and len(disconnected) > 0:\n f.write('subgraph disconnected {\\n')\n f.write('label = \"Disconnected\"\\n')\n f.write('bgcolor = red\\n')\n\n for dist in disconnected:\n f.write('\"%s\"' % dist.name)\n f.write('\\n')\n f.write('}\\n')\n f.write('}\\n')\n\n def topological_sort(self):\n \"\"\"\n Perform a topological sort of the graph.\n :return: A tuple, the first element of which is a topologically sorted\n list of distributions, and the second element of which is a\n list of distributions that cannot be sorted because they have\n circular dependencies and so form a cycle.\n \"\"\"\n result = []\n # Make a shallow copy of the adjacency list\n alist = {}\n for k, v in self.adjacency_list.items():\n alist[k] = v[:]\n while True:\n # See what we can remove in this run\n to_remove = []\n for k, v in list(alist.items())[:]:\n if not v:\n to_remove.append(k)\n del alist[k]\n if not to_remove:\n # What's left in alist (if anything) is a cycle.\n break\n # Remove from the adjacency list of others\n for k, v in alist.items():\n alist[k] = [(d, r) for d, r in v if d not in to_remove]\n logger.debug('Moving to result: %s', ['%s (%s)' % (d.name, d.version) for d in to_remove])\n result.extend(to_remove)\n return result, list(alist.keys())\n\n def __repr__(self):\n \"\"\"Representation of the graph\"\"\"\n output = []\n for dist, adjs in self.adjacency_list.items():\n output.append(self.repr_node(dist))\n return '\\n'.join(output)\n\n\ndef make_graph(dists, scheme='default'):\n \"\"\"Makes a dependency graph from the given distributions.\n\n :parameter dists: a list of distributions\n :type dists: list of :class:`distutils2.database.InstalledDistribution` and\n :class:`distutils2.database.EggInfoDistribution` instances\n :rtype: a :class:`DependencyGraph` instance\n \"\"\"\n scheme = get_scheme(scheme)\n graph = DependencyGraph()\n provided = {} # maps names to lists of (version, dist) tuples\n\n # first, build the graph and find out what's provided\n for dist in dists:\n graph.add_distribution(dist)\n\n for p in dist.provides:\n name, version = parse_name_and_version(p)\n logger.debug('Add to provided: %s, %s, %s', name, version, dist)\n provided.setdefault(name, []).append((version, dist))\n\n # now make the edges\n for dist in dists:\n requires = (dist.run_requires | dist.meta_requires | dist.build_requires | dist.dev_requires)\n for req in requires:\n try:\n matcher = scheme.matcher(req)\n except UnsupportedVersionError:\n # XXX compat-mode if cannot read the version\n logger.warning('could not read version %r - using name only', req)\n name = req.split()[0]\n matcher = scheme.matcher(name)\n\n name = matcher.key # case-insensitive\n\n matched = False\n if name in provided:\n for version, provider in provided[name]:\n try:\n match = matcher.match(version)\n except UnsupportedVersionError:\n match = False\n\n if match:\n graph.add_edge(dist, provider, req)\n matched = True\n break\n if not matched:\n graph.add_missing(dist, req)\n return graph\n\n\ndef get_dependent_dists(dists, dist):\n \"\"\"Recursively generate a list of distributions from *dists* that are\n dependent on *dist*.\n\n :param dists: a list of distributions\n :param dist: a distribution, member of *dists* for which we are interested\n \"\"\"\n if dist not in dists:\n raise DistlibException('given distribution %r is not a member '\n 'of the list' % dist.name)\n graph = make_graph(dists)\n\n dep = [dist] # dependent distributions\n todo = graph.reverse_list[dist] # list of nodes we should inspect\n\n while todo:\n d = todo.pop()\n dep.append(d)\n for succ in graph.reverse_list[d]:\n if succ not in dep:\n todo.append(succ)\n\n dep.pop(0) # remove dist from dep, was there to prevent infinite loops\n return dep\n\n\ndef get_required_dists(dists, dist):\n \"\"\"Recursively generate a list of distributions from *dists* that are\n required by *dist*.\n\n :param dists: a list of distributions\n :param dist: a distribution, member of *dists* for which we are interested\n in finding the dependencies.\n \"\"\"\n if dist not in dists:\n raise DistlibException('given distribution %r is not a member '\n 'of the list' % dist.name)\n graph = make_graph(dists)\n\n req = set() # required distributions\n todo = graph.adjacency_list[dist] # list of nodes we should inspect\n seen = set(t[0] for t in todo) # already added to todo\n\n while todo:\n d = todo.pop()[0]\n req.add(d)\n pred_list = graph.adjacency_list[d]\n for pred in pred_list:\n d = pred[0]\n if d not in req and d not in seen:\n seen.add(d)\n todo.append(pred)\n return req\n\n\ndef make_dist(name, version, **kwargs):\n \"\"\"\n A convenience method for making a dist given just a name and version.\n \"\"\"\n summary = kwargs.pop('summary', 'Placeholder for summary')\n md = Metadata(**kwargs)\n md.name = name\n md.version = version\n md.summary = summary or 'Placeholder for summary'\n return Distribution(md)\n",[],[100,509,516,523,475,1961,2183,2206],{"_104":2214,"_96":771,"_158":2215,"_160":2184,"_161":139,"_162":2216,"_164":165,"_106":2217,"_101":29,"_167":215,"_169":2218,"_170":25,"_171":-5,"_172":2219,"_99":2220},"094c8f88-67fc-11f0-8791-0224a6c84d84","094c9028-67fc-11f0-8791-0224a6c84d84",334,["D",1753299263384],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nimport hashlib\nimport logging\nimport os\nimport shutil\nimport subprocess\nimport tempfile\ntry:\n from threading import Thread\nexcept ImportError: # pragma: no cover\n from dummy_threading import Thread\n\nfrom . import DistlibException\nfrom .compat import (HTTPBasicAuthHandler, Request, HTTPPasswordMgr,\n urlparse, build_opener, string_types)\nfrom .util import zip_dir, ServerProxy\n\nlogger = logging.getLogger(__name__)\n\nDEFAULT_INDEX = 'https://pypi.org/pypi'\nDEFAULT_REALM = 'pypi'\n\n\nclass PackageIndex(object):\n \"\"\"\n This class represents a package index compatible with PyPI, the Python\n Package Index.\n \"\"\"\n\n boundary = b'----------ThIs_Is_tHe_distlib_index_bouNdaRY_$'\n\n def __init__(self, url=None):\n \"\"\"\n Initialise an instance.\n\n :param url: The URL of the index. If not specified, the URL for PyPI is\n used.\n \"\"\"\n self.url = url or DEFAULT_INDEX\n self.read_configuration()\n scheme, netloc, path, params, query, frag = urlparse(self.url)\n if params or query or frag or scheme not in ('http', 'https'):\n raise DistlibException('invalid repository: %s' % self.url)\n self.password_handler = None\n self.ssl_verifier = None\n self.gpg = None\n self.gpg_home = None\n with open(os.devnull, 'w') as sink:\n # Use gpg by default rather than gpg2, as gpg2 insists on\n # prompting for passwords\n for s in ('gpg', 'gpg2'):\n try:\n rc = subprocess.check_call([s, '--version'], stdout=sink,\n stderr=sink)\n if rc == 0:\n self.gpg = s\n break\n except OSError:\n pass\n\n def _get_pypirc_command(self):\n \"\"\"\n Get the distutils command for interacting with PyPI configurations.\n :return: the command.\n \"\"\"\n from .util import _get_pypirc_command as cmd\n return cmd()\n\n def read_configuration(self):\n \"\"\"\n Read the PyPI access configuration as supported by distutils. This populates\n ``username``, ``password``, ``realm`` and ``url`` attributes from the\n configuration.\n \"\"\"\n from .util import _load_pypirc\n cfg = _load_pypirc(self)\n self.username = cfg.get('username')\n self.password = cfg.get('password')\n self.realm = cfg.get('realm', 'pypi')\n self.url = cfg.get('repository', self.url)\n\n def save_configuration(self):\n \"\"\"\n Save the PyPI access configuration. You must have set ``username`` and\n ``password`` attributes before calling this method.\n \"\"\"\n self.check_credentials()\n from .util import _store_pypirc\n _store_pypirc(self)\n\n def check_credentials(self):\n \"\"\"\n Check that ``username`` and ``password`` have been set, and raise an\n exception if not.\n \"\"\"\n if self.username is None or self.password is None:\n raise DistlibException('username and password must be set')\n pm = HTTPPasswordMgr()\n _, netloc, _, _, _, _ = urlparse(self.url)\n pm.add_password(self.realm, netloc, self.username, self.password)\n self.password_handler = HTTPBasicAuthHandler(pm)\n\n def register(self, metadata): # pragma: no cover\n \"\"\"\n Register a distribution on PyPI, using the provided metadata.\n\n :param metadata: A :class:`Metadata` instance defining at least a name\n and version number for the distribution to be\n registered.\n :return: The HTTP response received from PyPI upon submission of the\n request.\n \"\"\"\n self.check_credentials()\n metadata.validate()\n d = metadata.todict()\n d[':action'] = 'verify'\n request = self.encode_request(d.items(), [])\n self.send_request(request)\n d[':action'] = 'submit'\n request = self.encode_request(d.items(), [])\n return self.send_request(request)\n\n def _reader(self, name, stream, outbuf):\n \"\"\"\n Thread runner for reading lines of from a subprocess into a buffer.\n\n :param name: The logical name of the stream (used for logging only).\n :param stream: The stream to read from. This will typically a pipe\n connected to the output stream of a subprocess.\n :param outbuf: The list to append the read lines to.\n \"\"\"\n while True:\n s = stream.readline()\n if not s:\n break\n s = s.decode('utf-8').rstrip()\n outbuf.append(s)\n logger.debug('%s: %s' % (name, s))\n stream.close()\n\n def get_sign_command(self, filename, signer, sign_password, keystore=None): # pragma: no cover\n \"\"\"\n Return a suitable command for signing a file.\n\n :param filename: The pathname to the file to be signed.\n :param signer: The identifier of the signer of the file.\n :param sign_password: The passphrase for the signer's\n private key used for signing.\n :param keystore: The path to a directory which contains the keys\n used in verification. If not specified, the\n instance's ``gpg_home`` attribute is used instead.\n :return: The signing command as a list suitable to be\n passed to :class:`subprocess.Popen`.\n \"\"\"\n cmd = [self.gpg, '--status-fd', '2', '--no-tty']\n if keystore is None:\n keystore = self.gpg_home\n if keystore:\n cmd.extend(['--homedir', keystore])\n if sign_password is not None:\n cmd.extend(['--batch', '--passphrase-fd', '0'])\n td = tempfile.mkdtemp()\n sf = os.path.join(td, os.path.basename(filename) + '.asc')\n cmd.extend(['--detach-sign', '--armor', '--local-user',\n signer, '--output', sf, filename])\n logger.debug('invoking: %s', ' '.join(cmd))\n return cmd, sf\n\n def run_command(self, cmd, input_data=None):\n \"\"\"\n Run a command in a child process , passing it any input data specified.\n\n :param cmd: The command to run.\n :param input_data: If specified, this must be a byte string containing\n data to be sent to the child process.\n :return: A tuple consisting of the subprocess' exit code, a list of\n lines read from the subprocess' ``stdout``, and a list of\n lines read from the subprocess' ``stderr``.\n \"\"\"\n kwargs = {\n 'stdout': subprocess.PIPE,\n 'stderr': subprocess.PIPE,\n }\n if input_data is not None:\n kwargs['stdin'] = subprocess.PIPE\n stdout = []\n stderr = []\n p = subprocess.Popen(cmd, **kwargs)\n # We don't use communicate() here because we may need to\n # get clever with interacting with the command\n t1 = Thread(target=self._reader, args=('stdout', p.stdout, stdout))\n t1.start()\n t2 = Thread(target=self._reader, args=('stderr', p.stderr, stderr))\n t2.start()\n if input_data is not None:\n p.stdin.write(input_data)\n p.stdin.close()\n\n p.wait()\n t1.join()\n t2.join()\n return p.returncode, stdout, stderr\n\n def sign_file(self, filename, signer, sign_password, keystore=None): # pragma: no cover\n \"\"\"\n Sign a file.\n\n :param filename: The pathname to the file to be signed.\n :param signer: The identifier of the signer of the file.\n :param sign_password: The passphrase for the signer's\n private key used for signing.\n :param keystore: The path to a directory which contains the keys\n used in signing. If not specified, the instance's\n ``gpg_home`` attribute is used instead.\n :return: The absolute pathname of the file where the signature is\n stored.\n \"\"\"\n cmd, sig_file = self.get_sign_command(filename, signer, sign_password,\n keystore)\n rc, stdout, stderr = self.run_command(cmd,\n sign_password.encode('utf-8'))\n if rc != 0:\n raise DistlibException('sign command failed with error '\n 'code %s' % rc)\n return sig_file\n\n def upload_file(self, metadata, filename, signer=None, sign_password=None,\n filetype='sdist', pyversion='source', keystore=None):\n \"\"\"\n Upload a release file to the index.\n\n :param metadata: A :class:`Metadata` instance defining at least a name\n and version number for the file to be uploaded.\n :param filename: The pathname of the file to be uploaded.\n :param signer: The identifier of the signer of the file.\n :param sign_password: The passphrase for the signer's\n private key used for signing.\n :param filetype: The type of the file being uploaded. This is the\n distutils command which produced that file, e.g.\n ``sdist`` or ``bdist_wheel``.\n :param pyversion: The version of Python which the release relates\n to. For code compatible with any Python, this would\n be ``source``, otherwise it would be e.g. ``3.2``.\n :param keystore: The path to a directory which contains the keys\n used in signing. If not specified, the instance's\n ``gpg_home`` attribute is used instead.\n :return: The HTTP response received from PyPI upon submission of the\n request.\n \"\"\"\n self.check_credentials()\n if not os.path.exists(filename):\n raise DistlibException('not found: %s' % filename)\n metadata.validate()\n d = metadata.todict()\n sig_file = None\n if signer:\n if not self.gpg:\n logger.warning('no signing program available - not signed')\n else:\n sig_file = self.sign_file(filename, signer, sign_password,\n keystore)\n with open(filename, 'rb') as f:\n file_data = f.read()\n md5_digest = hashlib.md5(file_data).hexdigest()\n sha256_digest = hashlib.sha256(file_data).hexdigest()\n d.update({\n ':action': 'file_upload',\n 'protocol_version': '1',\n 'filetype': filetype,\n 'pyversion': pyversion,\n 'md5_digest': md5_digest,\n 'sha256_digest': sha256_digest,\n })\n files = [('content', os.path.basename(filename), file_data)]\n if sig_file:\n with open(sig_file, 'rb') as f:\n sig_data = f.read()\n files.append(('gpg_signature', os.path.basename(sig_file),\n sig_data))\n shutil.rmtree(os.path.dirname(sig_file))\n request = self.encode_request(d.items(), files)\n return self.send_request(request)\n\n def upload_documentation(self, metadata, doc_dir): # pragma: no cover\n \"\"\"\n Upload documentation to the index.\n\n :param metadata: A :class:`Metadata` instance defining at least a name\n and version number for the documentation to be\n uploaded.\n :param doc_dir: The pathname of the directory which contains the\n documentation. This should be the directory that\n contains the ``index.html`` for the documentation.\n :return: The HTTP response received from PyPI upon submission of the\n request.\n \"\"\"\n self.check_credentials()\n if not os.path.isdir(doc_dir):\n raise DistlibException('not a directory: %r' % doc_dir)\n fn = os.path.join(doc_dir, 'index.html')\n if not os.path.exists(fn):\n raise DistlibException('not found: %r' % fn)\n metadata.validate()\n name, version = metadata.name, metadata.version\n zip_data = zip_dir(doc_dir).getvalue()\n fields = [(':action', 'doc_upload'),\n ('name', name), ('version', version)]\n files = [('content', name, zip_data)]\n request = self.encode_request(fields, files)\n return self.send_request(request)\n\n def get_verify_command(self, signature_filename, data_filename,\n keystore=None):\n \"\"\"\n Return a suitable command for verifying a file.\n\n :param signature_filename: The pathname to the file containing the\n signature.\n :param data_filename: The pathname to the file containing the\n signed data.\n :param keystore: The path to a directory which contains the keys\n used in verification. If not specified, the\n instance's ``gpg_home`` attribute is used instead.\n :return: The verifying command as a list suitable to be\n passed to :class:`subprocess.Popen`.\n \"\"\"\n cmd = [self.gpg, '--status-fd', '2', '--no-tty']\n if keystore is None:\n keystore = self.gpg_home\n if keystore:\n cmd.extend(['--homedir', keystore])\n cmd.extend(['--verify', signature_filename, data_filename])\n logger.debug('invoking: %s', ' '.join(cmd))\n return cmd\n\n def verify_signature(self, signature_filename, data_filename,\n keystore=None):\n \"\"\"\n Verify a signature for a file.\n\n :param signature_filename: The pathname to the file containing the\n signature.\n :param data_filename: The pathname to the file containing the\n signed data.\n :param keystore: The path to a directory which contains the keys\n used in verification. If not specified, the\n instance's ``gpg_home`` attribute is used instead.\n :return: True if the signature was verified, else False.\n \"\"\"\n if not self.gpg:\n raise DistlibException('verification unavailable because gpg '\n 'unavailable')\n cmd = self.get_verify_command(signature_filename, data_filename,\n keystore)\n rc, stdout, stderr = self.run_command(cmd)\n if rc not in (0, 1):\n raise DistlibException('verify command failed with error code %s' % rc)\n return rc == 0\n\n def download_file(self, url, destfile, digest=None, reporthook=None):\n \"\"\"\n This is a convenience method for downloading a file from an URL.\n Normally, this will be a file from the index, though currently\n no check is made for this (i.e. a file can be downloaded from\n anywhere).\n\n The method is just like the :func:`urlretrieve` function in the\n standard library, except that it allows digest computation to be\n done during download and checking that the downloaded data\n matched any expected value.\n\n :param url: The URL of the file to be downloaded (assumed to be\n available via an HTTP GET request).\n :param destfile: The pathname where the downloaded file is to be\n saved.\n :param digest: If specified, this must be a (hasher, value)\n tuple, where hasher is the algorithm used (e.g.\n ``'md5'``) and ``value`` is the expected value.\n :param reporthook: The same as for :func:`urlretrieve` in the\n standard library.\n \"\"\"\n if digest is None:\n digester = None\n logger.debug('No digest specified')\n else:\n if isinstance(digest, (list, tuple)):\n hasher, digest = digest\n else:\n hasher = 'md5'\n digester = getattr(hashlib, hasher)()\n logger.debug('Digest specified: %s' % digest)\n # The following code is equivalent to urlretrieve.\n # We need to do it this way so that we can compute the\n # digest of the file as we go.\n with open(destfile, 'wb') as dfp:\n # addinfourl is not a context manager on 2.x\n # so we have to use try/finally\n sfp = self.send_request(Request(url))\n try:\n headers = sfp.info()\n blocksize = 8192\n size = -1\n read = 0\n blocknum = 0\n if \"content-length\" in headers:\n size = int(headers[\"Content-Length\"])\n if reporthook:\n reporthook(blocknum, blocksize, size)\n while True:\n block = sfp.read(blocksize)\n if not block:\n break\n read += len(block)\n dfp.write(block)\n if digester:\n digester.update(block)\n blocknum += 1\n if reporthook:\n reporthook(blocknum, blocksize, size)\n finally:\n sfp.close()\n\n # check that we got the whole file, if we can\n if size >= 0 and read < size:\n raise DistlibException(\n 'retrieval incomplete: got only %d out of %d bytes'\n % (read, size))\n # if we have a digest, it must match.\n if digester:\n actual = digester.hexdigest()\n if digest != actual:\n raise DistlibException('%s digest mismatch for %s: expected '\n '%s, got %s' % (hasher, destfile,\n digest, actual))\n logger.debug('Digest verified: %s', digest)\n\n def send_request(self, req):\n \"\"\"\n Send a standard library :class:`Request` to PyPI and return its\n response.\n\n :param req: The request to send.\n :return: The HTTP response from PyPI (a standard library HTTPResponse).\n \"\"\"\n handlers = []\n if self.password_handler:\n handlers.append(self.password_handler)\n if self.ssl_verifier:\n handlers.append(self.ssl_verifier)\n opener = build_opener(*handlers)\n return opener.open(req)\n\n def encode_request(self, fields, files):\n \"\"\"\n Encode fields and files for posting to an HTTP server.\n\n :param fields: The fields to send as a list of (fieldname, value)\n tuples.\n :param files: The files to send as a list of (fieldname, filename,\n file_bytes) tuple.\n \"\"\"\n # Adapted from packaging, which in turn was adapted from\n # http://code.activestate.com/recipes/146306\n\n parts = []\n boundary = self.boundary\n for k, values in fields:\n if not isinstance(values, (list, tuple)):\n values = [values]\n\n for v in values:\n parts.extend((\n b'--' + boundary,\n ('Content-Disposition: form-data; name=\"%s\"' %\n k).encode('utf-8'),\n b'',\n v.encode('utf-8')))\n for key, filename, value in files:\n parts.extend((\n b'--' + boundary,\n ('Content-Disposition: form-data; name=\"%s\"; filename=\"%s\"' %\n (key, filename)).encode('utf-8'),\n b'',\n value))\n\n parts.extend((b'--' + boundary + b'--', b''))\n\n body = b'\\r\\n'.join(parts)\n ct = b'multipart/form-data; boundary=' + boundary\n headers = {\n 'Content-type': ct,\n 'Content-length': str(len(body))\n }\n return Request(self.url, body, headers)\n\n def search(self, terms, operator=None): # pragma: no cover\n if isinstance(terms, string_types):\n terms = {'name': terms}\n rpc_proxy = ServerProxy(self.url, timeout=3.0)\n try:\n return rpc_proxy.search(terms, operator or 'and')\n finally:\n rpc_proxy('close')()\n",[],[100,509,516,523,475,1961,2183,771],{"_104":2222,"_96":2223,"_158":2224,"_160":2184,"_161":139,"_162":2225,"_164":165,"_106":2226,"_101":29,"_167":215,"_169":2227,"_170":25,"_171":-5,"_172":2228,"_99":2229},"09308bbc-67fc-11f0-805e-0224a6c84d84","locators.py","09308c5c-67fc-11f0-805e-0224a6c84d84",330,["D",1753299263186],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\nimport gzip\nfrom io import BytesIO\nimport json\nimport logging\nimport os\nimport posixpath\nimport re\ntry:\n import threading\nexcept ImportError: # pragma: no cover\n import dummy_threading as threading\nimport zlib\n\nfrom . import DistlibException\nfrom .compat import (urljoin, urlparse, urlunparse, url2pathname, pathname2url, queue, quote, unescape, build_opener,\n HTTPRedirectHandler as BaseRedirectHandler, text_type, Request, HTTPError, URLError)\nfrom .database import Distribution, DistributionPath, make_dist\nfrom .metadata import Metadata, MetadataInvalidError\nfrom .util import (cached_property, ensure_slash, split_filename, get_project_data, parse_requirement,\n parse_name_and_version, ServerProxy, normalize_name)\nfrom .version import get_scheme, UnsupportedVersionError\nfrom .wheel import Wheel, is_compatible\n\nlogger = logging.getLogger(__name__)\n\nHASHER_HASH = re.compile(r'^(\\w+)=([a-f0-9]+)')\nCHARSET = re.compile(r';\\s*charset\\s*=\\s*(.*)\\s*$', re.I)\nHTML_CONTENT_TYPE = re.compile('text/html|application/x(ht)?ml')\nDEFAULT_INDEX = 'https://pypi.org/pypi'\n\n\ndef get_all_distribution_names(url=None):\n \"\"\"\n Return all distribution names known by an index.\n :param url: The URL of the index.\n :return: A list of all known distribution names.\n \"\"\"\n if url is None:\n url = DEFAULT_INDEX\n client = ServerProxy(url, timeout=3.0)\n try:\n return client.list_packages()\n finally:\n client('close')()\n\n\nclass RedirectHandler(BaseRedirectHandler):\n \"\"\"\n A class to work around a bug in some Python 3.2.x releases.\n \"\"\"\n\n # There's a bug in the base version for some 3.2.x\n # (e.g. 3.2.2 on Ubuntu Oneiric). If a Location header\n # returns e.g. /abc, it bails because it says the scheme ''\n # is bogus, when actually it should use the request's\n # URL for the scheme. See Python issue #13696.\n def http_error_302(self, req, fp, code, msg, headers):\n # Some servers (incorrectly) return multiple Location headers\n # (so probably same goes for URI). Use first header.\n newurl = None\n for key in ('location', 'uri'):\n if key in headers:\n newurl = headers[key]\n break\n if newurl is None: # pragma: no cover\n return\n urlparts = urlparse(newurl)\n if urlparts.scheme == '':\n newurl = urljoin(req.get_full_url(), newurl)\n if hasattr(headers, 'replace_header'):\n headers.replace_header(key, newurl)\n else:\n headers[key] = newurl\n return BaseRedirectHandler.http_error_302(self, req, fp, code, msg, headers)\n\n http_error_301 = http_error_303 = http_error_307 = http_error_302\n\n\nclass Locator(object):\n \"\"\"\n A base class for locators - things that locate distributions.\n \"\"\"\n source_extensions = ('.tar.gz', '.tar.bz2', '.tar', '.zip', '.tgz', '.tbz')\n binary_extensions = ('.egg', '.exe', '.whl')\n excluded_extensions = ('.pdf', )\n\n # A list of tags indicating which wheels you want to match. The default\n # value of None matches against the tags compatible with the running\n # Python. If you want to match other values, set wheel_tags on a locator\n # instance to a list of tuples (pyver, abi, arch) which you want to match.\n wheel_tags = None\n\n downloadable_extensions = source_extensions + ('.whl', )\n\n def __init__(self, scheme='default'):\n \"\"\"\n Initialise an instance.\n :param scheme: Because locators look for most recent versions, they\n need to know the version scheme to use. This specifies\n the current PEP-recommended scheme - use ``'legacy'``\n if you need to support existing distributions on PyPI.\n \"\"\"\n self._cache = {}\n self.scheme = scheme\n # Because of bugs in some of the handlers on some of the platforms,\n # we use our own opener rather than just using urlopen.\n self.opener = build_opener(RedirectHandler())\n # If get_project() is called from locate(), the matcher instance\n # is set from the requirement passed to locate(). See issue #18 for\n # why this can be useful to know.\n self.matcher = None\n self.errors = queue.Queue()\n\n def get_errors(self):\n \"\"\"\n Return any errors which have occurred.\n \"\"\"\n result = []\n while not self.errors.empty(): # pragma: no cover\n try:\n e = self.errors.get(False)\n result.append(e)\n except self.errors.Empty:\n continue\n self.errors.task_done()\n return result\n\n def clear_errors(self):\n \"\"\"\n Clear any errors which may have been logged.\n \"\"\"\n # Just get the errors and throw them away\n self.get_errors()\n\n def clear_cache(self):\n self._cache.clear()\n\n def _get_scheme(self):\n return self._scheme\n\n def _set_scheme(self, value):\n self._scheme = value\n\n scheme = property(_get_scheme, _set_scheme)\n\n def _get_project(self, name):\n \"\"\"\n For a given project, get a dictionary mapping available versions to Distribution\n instances.\n\n This should be implemented in subclasses.\n\n If called from a locate() request, self.matcher will be set to a\n matcher for the requirement to satisfy, otherwise it will be None.\n \"\"\"\n raise NotImplementedError('Please implement in the subclass')\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n raise NotImplementedError('Please implement in the subclass')\n\n def get_project(self, name):\n \"\"\"\n For a given project, get a dictionary mapping available versions to Distribution\n instances.\n\n This calls _get_project to do all the work, and just implements a caching layer on top.\n \"\"\"\n if self._cache is None: # pragma: no cover\n result = self._get_project(name)\n elif name in self._cache:\n result = self._cache[name]\n else:\n self.clear_errors()\n result = self._get_project(name)\n self._cache[name] = result\n return result\n\n def score_url(self, url):\n \"\"\"\n Give an url a score which can be used to choose preferred URLs\n for a given project release.\n \"\"\"\n t = urlparse(url)\n basename = posixpath.basename(t.path)\n compatible = True\n is_wheel = basename.endswith('.whl')\n is_downloadable = basename.endswith(self.downloadable_extensions)\n if is_wheel:\n compatible = is_compatible(Wheel(basename), self.wheel_tags)\n return (t.scheme == 'https', 'pypi.org' in t.netloc, is_downloadable, is_wheel, compatible, basename)\n\n def prefer_url(self, url1, url2):\n \"\"\"\n Choose one of two URLs where both are candidates for distribution\n archives for the same version of a distribution (for example,\n .tar.gz vs. zip).\n\n The current implementation favours https:// URLs over http://, archives\n from PyPI over those from other locations, wheel compatibility (if a\n wheel) and then the archive name.\n \"\"\"\n result = url2\n if url1:\n s1 = self.score_url(url1)\n s2 = self.score_url(url2)\n if s1 > s2:\n result = url1\n if result != url2:\n logger.debug('Not replacing %r with %r', url1, url2)\n else:\n logger.debug('Replacing %r with %r', url1, url2)\n return result\n\n def split_filename(self, filename, project_name):\n \"\"\"\n Attempt to split a filename in project name, version and Python version.\n \"\"\"\n return split_filename(filename, project_name)\n\n def convert_url_to_download_info(self, url, project_name):\n \"\"\"\n See if a URL is a candidate for a download URL for a project (the URL\n has typically been scraped from an HTML page).\n\n If it is, a dictionary is returned with keys \"name\", \"version\",\n \"filename\" and \"url\"; otherwise, None is returned.\n \"\"\"\n\n def same_project(name1, name2):\n return normalize_name(name1) == normalize_name(name2)\n\n result = None\n scheme, netloc, path, params, query, frag = urlparse(url)\n if frag.lower().startswith('egg='): # pragma: no cover\n logger.debug('%s: version hint in fragment: %r', project_name, frag)\n m = HASHER_HASH.match(frag)\n if m:\n algo, digest = m.groups()\n else:\n algo, digest = None, None\n origpath = path\n if path and path[-1] == '/': # pragma: no cover\n path = path[:-1]\n if path.endswith('.whl'):\n try:\n wheel = Wheel(path)\n if not is_compatible(wheel, self.wheel_tags):\n logger.debug('Wheel not compatible: %s', path)\n else:\n if project_name is None:\n include = True\n else:\n include = same_project(wheel.name, project_name)\n if include:\n result = {\n 'name': wheel.name,\n 'version': wheel.version,\n 'filename': wheel.filename,\n 'url': urlunparse((scheme, netloc, origpath, params, query, '')),\n 'python-version': ', '.join(['.'.join(list(v[2:])) for v in wheel.pyver]),\n }\n except Exception: # pragma: no cover\n logger.warning('invalid path for wheel: %s', path)\n elif not path.endswith(self.downloadable_extensions): # pragma: no cover\n logger.debug('Not downloadable: %s', path)\n else: # downloadable extension\n path = filename = posixpath.basename(path)\n for ext in self.downloadable_extensions:\n if path.endswith(ext):\n path = path[:-len(ext)]\n t = self.split_filename(path, project_name)\n if not t: # pragma: no cover\n logger.debug('No match for project/version: %s', path)\n else:\n name, version, pyver = t\n if not project_name or same_project(project_name, name):\n result = {\n 'name': name,\n 'version': version,\n 'filename': filename,\n 'url': urlunparse((scheme, netloc, origpath, params, query, '')),\n }\n if pyver: # pragma: no cover\n result['python-version'] = pyver\n break\n if result and algo:\n result['%s_digest' % algo] = digest\n return result\n\n def _get_digest(self, info):\n \"\"\"\n Get a digest from a dictionary by looking at a \"digests\" dictionary\n or keys of the form 'algo_digest'.\n\n Returns a 2-tuple (algo, digest) if found, else None. Currently\n looks only for SHA256, then MD5.\n \"\"\"\n result = None\n if 'digests' in info:\n digests = info['digests']\n for algo in ('sha256', 'md5'):\n if algo in digests:\n result = (algo, digests[algo])\n break\n if not result:\n for algo in ('sha256', 'md5'):\n key = '%s_digest' % algo\n if key in info:\n result = (algo, info[key])\n break\n return result\n\n def _update_version_data(self, result, info):\n \"\"\"\n Update a result dictionary (the final result from _get_project) with a\n dictionary for a specific version, which typically holds information\n gleaned from a filename or URL for an archive for the distribution.\n \"\"\"\n name = info.pop('name')\n version = info.pop('version')\n if version in result:\n dist = result[version]\n md = dist.metadata\n else:\n dist = make_dist(name, version, scheme=self.scheme)\n md = dist.metadata\n dist.digest = digest = self._get_digest(info)\n url = info['url']\n result['digests'][url] = digest\n if md.source_url != info['url']:\n md.source_url = self.prefer_url(md.source_url, url)\n result['urls'].setdefault(version, set()).add(url)\n dist.locator = self\n result[version] = dist\n\n def locate(self, requirement, prereleases=False):\n \"\"\"\n Find the most recent distribution which matches the given\n requirement.\n\n :param requirement: A requirement of the form 'foo (1.0)' or perhaps\n 'foo (>= 1.0, < 2.0, != 1.3)'\n :param prereleases: If ``True``, allow pre-release versions\n to be located. Otherwise, pre-release versions\n are not returned.\n :return: A :class:`Distribution` instance, or ``None`` if no such\n distribution could be located.\n \"\"\"\n result = None\n r = parse_requirement(requirement)\n if r is None: # pragma: no cover\n raise DistlibException('Not a valid requirement: %r' % requirement)\n scheme = get_scheme(self.scheme)\n self.matcher = matcher = scheme.matcher(r.requirement)\n logger.debug('matcher: %s (%s)', matcher, type(matcher).__name__)\n versions = self.get_project(r.name)\n if len(versions) > 2: # urls and digests keys are present\n # sometimes, versions are invalid\n slist = []\n vcls = matcher.version_class\n for k in versions:\n if k in ('urls', 'digests'):\n continue\n try:\n if not matcher.match(k):\n pass # logger.debug('%s did not match %r', matcher, k)\n else:\n if prereleases or not vcls(k).is_prerelease:\n slist.append(k)\n except Exception: # pragma: no cover\n logger.warning('error matching %s with %r', matcher, k)\n pass # slist.append(k)\n if len(slist) > 1:\n slist = sorted(slist, key=scheme.key)\n if slist:\n logger.debug('sorted list: %s', slist)\n version = slist[-1]\n result = versions[version]\n if result:\n if r.extras:\n result.extras = r.extras\n result.download_urls = versions.get('urls', {}).get(version, set())\n d = {}\n sd = versions.get('digests', {})\n for url in result.download_urls:\n if url in sd: # pragma: no cover\n d[url] = sd[url]\n result.digests = d\n self.matcher = None\n return result\n\n\nclass PyPIRPCLocator(Locator):\n \"\"\"\n This locator uses XML-RPC to locate distributions. It therefore\n cannot be used with simple mirrors (that only mirror file content).\n \"\"\"\n\n def __init__(self, url, **kwargs):\n \"\"\"\n Initialise an instance.\n\n :param url: The URL to use for XML-RPC.\n :param kwargs: Passed to the superclass constructor.\n \"\"\"\n super(PyPIRPCLocator, self).__init__(**kwargs)\n self.base_url = url\n self.client = ServerProxy(url, timeout=3.0)\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n return set(self.client.list_packages())\n\n def _get_project(self, name):\n result = {'urls': {}, 'digests': {}}\n versions = self.client.package_releases(name, True)\n for v in versions:\n urls = self.client.release_urls(name, v)\n data = self.client.release_data(name, v)\n metadata = Metadata(scheme=self.scheme)\n metadata.name = data['name']\n metadata.version = data['version']\n metadata.license = data.get('license')\n metadata.keywords = data.get('keywords', [])\n metadata.summary = data.get('summary')\n dist = Distribution(metadata)\n if urls:\n info = urls[0]\n metadata.source_url = info['url']\n dist.digest = self._get_digest(info)\n dist.locator = self\n result[v] = dist\n for info in urls:\n url = info['url']\n digest = self._get_digest(info)\n result['urls'].setdefault(v, set()).add(url)\n result['digests'][url] = digest\n return result\n\n\nclass PyPIJSONLocator(Locator):\n \"\"\"\n This locator uses PyPI's JSON interface. It's very limited in functionality\n and probably not worth using.\n \"\"\"\n\n def __init__(self, url, **kwargs):\n super(PyPIJSONLocator, self).__init__(**kwargs)\n self.base_url = ensure_slash(url)\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n raise NotImplementedError('Not available from this locator')\n\n def _get_project(self, name):\n result = {'urls': {}, 'digests': {}}\n url = urljoin(self.base_url, '%s/json' % quote(name))\n try:\n resp = self.opener.open(url)\n data = resp.read().decode() # for now\n d = json.loads(data)\n md = Metadata(scheme=self.scheme)\n data = d['info']\n md.name = data['name']\n md.version = data['version']\n md.license = data.get('license')\n md.keywords = data.get('keywords', [])\n md.summary = data.get('summary')\n dist = Distribution(md)\n dist.locator = self\n # urls = d['urls']\n result[md.version] = dist\n for info in d['urls']:\n url = info['url']\n dist.download_urls.add(url)\n dist.digests[url] = self._get_digest(info)\n result['urls'].setdefault(md.version, set()).add(url)\n result['digests'][url] = self._get_digest(info)\n # Now get other releases\n for version, infos in d['releases'].items():\n if version == md.version:\n continue # already done\n omd = Metadata(scheme=self.scheme)\n omd.name = md.name\n omd.version = version\n odist = Distribution(omd)\n odist.locator = self\n result[version] = odist\n for info in infos:\n url = info['url']\n odist.download_urls.add(url)\n odist.digests[url] = self._get_digest(info)\n result['urls'].setdefault(version, set()).add(url)\n result['digests'][url] = self._get_digest(info)\n\n\n# for info in urls:\n# md.source_url = info['url']\n# dist.digest = self._get_digest(info)\n# dist.locator = self\n# for info in urls:\n# url = info['url']\n# result['urls'].setdefault(md.version, set()).add(url)\n# result['digests'][url] = self._get_digest(info)\n except Exception as e:\n self.errors.put(text_type(e))\n logger.exception('JSON fetch failed: %s', e)\n return result\n\n\nclass Page(object):\n \"\"\"\n This class represents a scraped HTML page.\n \"\"\"\n # The following slightly hairy-looking regex just looks for the contents of\n # an anchor link, which has an attribute \"href\" either immediately preceded\n # or immediately followed by a \"rel\" attribute. The attribute values can be\n # declared with double quotes, single quotes or no quotes - which leads to\n # the length of the expression.\n _href = re.compile(\n \"\"\"\n(rel\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*))\\\\s+)?\nhref\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*))\n(\\\\s+rel\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*)))?\n\"\"\", re.I | re.S | re.X)\n _base = re.compile(r\"\"\"]+)\"\"\", re.I | re.S)\n\n def __init__(self, data, url):\n \"\"\"\n Initialise an instance with the Unicode page contents and the URL they\n came from.\n \"\"\"\n self.data = data\n self.base_url = self.url = url\n m = self._base.search(self.data)\n if m:\n self.base_url = m.group(1)\n\n _clean_re = re.compile(r'[^a-z0-9$&+,/:;=?@.#%_\\\\|-]', re.I)\n\n @cached_property\n def links(self):\n \"\"\"\n Return the URLs of all the links on a page together with information\n about their \"rel\" attribute, for determining which ones to treat as\n downloads and which ones to queue for further scraping.\n \"\"\"\n\n def clean(url):\n \"Tidy up an URL.\"\n scheme, netloc, path, params, query, frag = urlparse(url)\n return urlunparse((scheme, netloc, quote(path), params, query, frag))\n\n result = set()\n for match in self._href.finditer(self.data):\n d = match.groupdict('')\n rel = (d['rel1'] or d['rel2'] or d['rel3'] or d['rel4'] or d['rel5'] or d['rel6'])\n url = d['url1'] or d['url2'] or d['url3']\n url = urljoin(self.base_url, url)\n url = unescape(url)\n url = self._clean_re.sub(lambda m: '%%%2x' % ord(m.group(0)), url)\n result.add((url, rel))\n # We sort the result, hoping to bring the most recent versions\n # to the front\n result = sorted(result, key=lambda t: t[0], reverse=True)\n return result\n\n\nclass SimpleScrapingLocator(Locator):\n \"\"\"\n A locator which scrapes HTML pages to locate downloads for a distribution.\n This runs multiple threads to do the I/O; performance is at least as good\n as pip's PackageFinder, which works in an analogous fashion.\n \"\"\"\n\n # These are used to deal with various Content-Encoding schemes.\n decoders = {\n 'deflate': zlib.decompress,\n 'gzip': lambda b: gzip.GzipFile(fileobj=BytesIO(b)).read(),\n 'none': lambda b: b,\n }\n\n def __init__(self, url, timeout=None, num_workers=10, **kwargs):\n \"\"\"\n Initialise an instance.\n :param url: The root URL to use for scraping.\n :param timeout: The timeout, in seconds, to be applied to requests.\n This defaults to ``None`` (no timeout specified).\n :param num_workers: The number of worker threads you want to do I/O,\n This defaults to 10.\n :param kwargs: Passed to the superclass.\n \"\"\"\n super(SimpleScrapingLocator, self).__init__(**kwargs)\n self.base_url = ensure_slash(url)\n self.timeout = timeout\n self._page_cache = {}\n self._seen = set()\n self._to_fetch = queue.Queue()\n self._bad_hosts = set()\n self.skip_externals = False\n self.num_workers = num_workers\n self._lock = threading.RLock()\n # See issue #45: we need to be resilient when the locator is used\n # in a thread, e.g. with concurrent.futures. We can't use self._lock\n # as it is for coordinating our internal threads - the ones created\n # in _prepare_threads.\n self._gplock = threading.RLock()\n self.platform_check = False # See issue #112\n\n def _prepare_threads(self):\n \"\"\"\n Threads are created only when get_project is called, and terminate\n before it returns. They are there primarily to parallelise I/O (i.e.\n fetching web pages).\n \"\"\"\n self._threads = []\n for i in range(self.num_workers):\n t = threading.Thread(target=self._fetch)\n t.daemon = True\n t.start()\n self._threads.append(t)\n\n def _wait_threads(self):\n \"\"\"\n Tell all the threads to terminate (by sending a sentinel value) and\n wait for them to do so.\n \"\"\"\n # Note that you need two loops, since you can't say which\n # thread will get each sentinel\n for t in self._threads:\n self._to_fetch.put(None) # sentinel\n for t in self._threads:\n t.join()\n self._threads = []\n\n def _get_project(self, name):\n result = {'urls': {}, 'digests': {}}\n with self._gplock:\n self.result = result\n self.project_name = name\n url = urljoin(self.base_url, '%s/' % quote(name))\n self._seen.clear()\n self._page_cache.clear()\n self._prepare_threads()\n try:\n logger.debug('Queueing %s', url)\n self._to_fetch.put(url)\n self._to_fetch.join()\n finally:\n self._wait_threads()\n del self.result\n return result\n\n platform_dependent = re.compile(r'\\b(linux_(i\\d86|x86_64|arm\\w+)|'\n r'win(32|_amd64)|macosx_?\\d+)\\b', re.I)\n\n def _is_platform_dependent(self, url):\n \"\"\"\n Does an URL refer to a platform-specific download?\n \"\"\"\n return self.platform_dependent.search(url)\n\n def _process_download(self, url):\n \"\"\"\n See if an URL is a suitable download for a project.\n\n If it is, register information in the result dictionary (for\n _get_project) about the specific version it's for.\n\n Note that the return value isn't actually used other than as a boolean\n value.\n \"\"\"\n if self.platform_check and self._is_platform_dependent(url):\n info = None\n else:\n info = self.convert_url_to_download_info(url, self.project_name)\n logger.debug('process_download: %s -> %s', url, info)\n if info:\n with self._lock: # needed because self.result is shared\n self._update_version_data(self.result, info)\n return info\n\n def _should_queue(self, link, referrer, rel):\n \"\"\"\n Determine whether a link URL from a referring page and with a\n particular \"rel\" attribute should be queued for scraping.\n \"\"\"\n scheme, netloc, path, _, _, _ = urlparse(link)\n if path.endswith(self.source_extensions + self.binary_extensions + self.excluded_extensions):\n result = False\n elif self.skip_externals and not link.startswith(self.base_url):\n result = False\n elif not referrer.startswith(self.base_url):\n result = False\n elif rel not in ('homepage', 'download'):\n result = False\n elif scheme not in ('http', 'https', 'ftp'):\n result = False\n elif self._is_platform_dependent(link):\n result = False\n else:\n host = netloc.split(':', 1)[0]\n if host.lower() == 'localhost':\n result = False\n else:\n result = True\n logger.debug('should_queue: %s (%s) from %s -> %s', link, rel, referrer, result)\n return result\n\n def _fetch(self):\n \"\"\"\n Get a URL to fetch from the work queue, get the HTML page, examine its\n links for download candidates and candidates for further scraping.\n\n This is a handy method to run in a thread.\n \"\"\"\n while True:\n url = self._to_fetch.get()\n try:\n if url:\n page = self.get_page(url)\n if page is None: # e.g. after an error\n continue\n for link, rel in page.links:\n if link not in self._seen:\n try:\n self._seen.add(link)\n if (not self._process_download(link) and self._should_queue(link, url, rel)):\n logger.debug('Queueing %s from %s', link, url)\n self._to_fetch.put(link)\n except MetadataInvalidError: # e.g. invalid versions\n pass\n except Exception as e: # pragma: no cover\n self.errors.put(text_type(e))\n finally:\n # always do this, to avoid hangs :-)\n self._to_fetch.task_done()\n if not url:\n # logger.debug('Sentinel seen, quitting.')\n break\n\n def get_page(self, url):\n \"\"\"\n Get the HTML for an URL, possibly from an in-memory cache.\n\n XXX TODO Note: this cache is never actually cleared. It's assumed that\n the data won't get stale over the lifetime of a locator instance (not\n necessarily true for the default_locator).\n \"\"\"\n # http://peak.telecommunity.com/DevCenter/EasyInstall#package-index-api\n scheme, netloc, path, _, _, _ = urlparse(url)\n if scheme == 'file' and os.path.isdir(url2pathname(path)):\n url = urljoin(ensure_slash(url), 'index.html')\n\n if url in self._page_cache:\n result = self._page_cache[url]\n logger.debug('Returning %s from cache: %s', url, result)\n else:\n host = netloc.split(':', 1)[0]\n result = None\n if host in self._bad_hosts:\n logger.debug('Skipping %s due to bad host %s', url, host)\n else:\n req = Request(url, headers={'Accept-encoding': 'identity'})\n try:\n logger.debug('Fetching %s', url)\n resp = self.opener.open(req, timeout=self.timeout)\n logger.debug('Fetched %s', url)\n headers = resp.info()\n content_type = headers.get('Content-Type', '')\n if HTML_CONTENT_TYPE.match(content_type):\n final_url = resp.geturl()\n data = resp.read()\n encoding = headers.get('Content-Encoding')\n if encoding:\n decoder = self.decoders[encoding] # fail if not found\n data = decoder(data)\n encoding = 'utf-8'\n m = CHARSET.search(content_type)\n if m:\n encoding = m.group(1)\n try:\n data = data.decode(encoding)\n except UnicodeError: # pragma: no cover\n data = data.decode('latin-1') # fallback\n result = Page(data, final_url)\n self._page_cache[final_url] = result\n except HTTPError as e:\n if e.code != 404:\n logger.exception('Fetch failed: %s: %s', url, e)\n except URLError as e: # pragma: no cover\n logger.exception('Fetch failed: %s: %s', url, e)\n with self._lock:\n self._bad_hosts.add(host)\n except Exception as e: # pragma: no cover\n logger.exception('Fetch failed: %s: %s', url, e)\n finally:\n self._page_cache[url] = result # even if None (failure)\n return result\n\n _distname_re = re.compile(']*>([^<]+)<')\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n result = set()\n page = self.get_page(self.base_url)\n if not page:\n raise DistlibException('Unable to get %s' % self.base_url)\n for match in self._distname_re.finditer(page.data):\n result.add(match.group(1))\n return result\n\n\nclass DirectoryLocator(Locator):\n \"\"\"\n This class locates distributions in a directory tree.\n \"\"\"\n\n def __init__(self, path, **kwargs):\n \"\"\"\n Initialise an instance.\n :param path: The root of the directory tree to search.\n :param kwargs: Passed to the superclass constructor,\n except for:\n * recursive - if True (the default), subdirectories are\n recursed into. If False, only the top-level directory\n is searched,\n \"\"\"\n self.recursive = kwargs.pop('recursive', True)\n super(DirectoryLocator, self).__init__(**kwargs)\n path = os.path.abspath(path)\n if not os.path.isdir(path): # pragma: no cover\n raise DistlibException('Not a directory: %r' % path)\n self.base_dir = path\n\n def should_include(self, filename, parent):\n \"\"\"\n Should a filename be considered as a candidate for a distribution\n archive? As well as the filename, the directory which contains it\n is provided, though not used by the current implementation.\n \"\"\"\n return filename.endswith(self.downloadable_extensions)\n\n def _get_project(self, name):\n result = {'urls': {}, 'digests': {}}\n for root, dirs, files in os.walk(self.base_dir):\n for fn in files:\n if self.should_include(fn, root):\n fn = os.path.join(root, fn)\n url = urlunparse(('file', '', pathname2url(os.path.abspath(fn)), '', '', ''))\n info = self.convert_url_to_download_info(url, name)\n if info:\n self._update_version_data(result, info)\n if not self.recursive:\n break\n return result\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n result = set()\n for root, dirs, files in os.walk(self.base_dir):\n for fn in files:\n if self.should_include(fn, root):\n fn = os.path.join(root, fn)\n url = urlunparse(('file', '', pathname2url(os.path.abspath(fn)), '', '', ''))\n info = self.convert_url_to_download_info(url, None)\n if info:\n result.add(info['name'])\n if not self.recursive:\n break\n return result\n\n\nclass JSONLocator(Locator):\n \"\"\"\n This locator uses special extended metadata (not available on PyPI) and is\n the basis of performant dependency resolution in distlib. Other locators\n require archive downloads before dependencies can be determined! As you\n might imagine, that can be slow.\n \"\"\"\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n raise NotImplementedError('Not available from this locator')\n\n def _get_project(self, name):\n result = {'urls': {}, 'digests': {}}\n data = get_project_data(name)\n if data:\n for info in data.get('files', []):\n if info['ptype'] != 'sdist' or info['pyversion'] != 'source':\n continue\n # We don't store summary in project metadata as it makes\n # the data bigger for no benefit during dependency\n # resolution\n dist = make_dist(data['name'],\n info['version'],\n summary=data.get('summary', 'Placeholder for summary'),\n scheme=self.scheme)\n md = dist.metadata\n md.source_url = info['url']\n # TODO SHA256 digest\n if 'digest' in info and info['digest']:\n dist.digest = ('md5', info['digest'])\n md.dependencies = info.get('requirements', {})\n dist.exports = info.get('exports', {})\n result[dist.version] = dist\n result['urls'].setdefault(dist.version, set()).add(info['url'])\n return result\n\n\nclass DistPathLocator(Locator):\n \"\"\"\n This locator finds installed distributions in a path. It can be useful for\n adding to an :class:`AggregatingLocator`.\n \"\"\"\n\n def __init__(self, distpath, **kwargs):\n \"\"\"\n Initialise an instance.\n\n :param distpath: A :class:`DistributionPath` instance to search.\n \"\"\"\n super(DistPathLocator, self).__init__(**kwargs)\n assert isinstance(distpath, DistributionPath)\n self.distpath = distpath\n\n def _get_project(self, name):\n dist = self.distpath.get_distribution(name)\n if dist is None:\n result = {'urls': {}, 'digests': {}}\n else:\n result = {\n dist.version: dist,\n 'urls': {\n dist.version: set([dist.source_url])\n },\n 'digests': {\n dist.version: set([None])\n }\n }\n return result\n\n\nclass AggregatingLocator(Locator):\n \"\"\"\n This class allows you to chain and/or merge a list of locators.\n \"\"\"\n\n def __init__(self, *locators, **kwargs):\n \"\"\"\n Initialise an instance.\n\n :param locators: The list of locators to search.\n :param kwargs: Passed to the superclass constructor,\n except for:\n * merge - if False (the default), the first successful\n search from any of the locators is returned. If True,\n the results from all locators are merged (this can be\n slow).\n \"\"\"\n self.merge = kwargs.pop('merge', False)\n self.locators = locators\n super(AggregatingLocator, self).__init__(**kwargs)\n\n def clear_cache(self):\n super(AggregatingLocator, self).clear_cache()\n for locator in self.locators:\n locator.clear_cache()\n\n def _set_scheme(self, value):\n self._scheme = value\n for locator in self.locators:\n locator.scheme = value\n\n scheme = property(Locator.scheme.fget, _set_scheme)\n\n def _get_project(self, name):\n result = {}\n for locator in self.locators:\n d = locator.get_project(name)\n if d:\n if self.merge:\n files = result.get('urls', {})\n digests = result.get('digests', {})\n # next line could overwrite result['urls'], result['digests']\n result.update(d)\n df = result.get('urls')\n if files and df:\n for k, v in files.items():\n if k in df:\n df[k] |= v\n else:\n df[k] = v\n dd = result.get('digests')\n if digests and dd:\n dd.update(digests)\n else:\n # See issue #18. If any dists are found and we're looking\n # for specific constraints, we only return something if\n # a match is found. For example, if a DirectoryLocator\n # returns just foo (1.0) while we're looking for\n # foo (>= 2.0), we'll pretend there was nothing there so\n # that subsequent locators can be queried. Otherwise we\n # would just return foo (1.0) which would then lead to a\n # failure to find foo (>= 2.0), because other locators\n # weren't searched. Note that this only matters when\n # merge=False.\n if self.matcher is None:\n found = True\n else:\n found = False\n for k in d:\n if self.matcher.match(k):\n found = True\n break\n if found:\n result = d\n break\n return result\n\n def get_distribution_names(self):\n \"\"\"\n Return all the distribution names known to this locator.\n \"\"\"\n result = set()\n for locator in self.locators:\n try:\n result |= locator.get_distribution_names()\n except NotImplementedError:\n pass\n return result\n\n\n# We use a legacy scheme simply because most of the dists on PyPI use legacy\n# versions which don't conform to PEP 440.\ndefault_locator = AggregatingLocator(\n # JSONLocator(), # don't use as PEP 426 is withdrawn\n SimpleScrapingLocator('https://pypi.org/simple/', timeout=3.0),\n scheme='legacy')\n\nlocate = default_locator.locate\n\n\nclass DependencyFinder(object):\n \"\"\"\n Locate dependencies for distributions.\n \"\"\"\n\n def __init__(self, locator=None):\n \"\"\"\n Initialise an instance, using the specified locator\n to locate distributions.\n \"\"\"\n self.locator = locator or default_locator\n self.scheme = get_scheme(self.locator.scheme)\n\n def add_distribution(self, dist):\n \"\"\"\n Add a distribution to the finder. This will update internal information\n about who provides what.\n :param dist: The distribution to add.\n \"\"\"\n logger.debug('adding distribution %s', dist)\n name = dist.key\n self.dists_by_name[name] = dist\n self.dists[(name, dist.version)] = dist\n for p in dist.provides:\n name, version = parse_name_and_version(p)\n logger.debug('Add to provided: %s, %s, %s', name, version, dist)\n self.provided.setdefault(name, set()).add((version, dist))\n\n def remove_distribution(self, dist):\n \"\"\"\n Remove a distribution from the finder. This will update internal\n information about who provides what.\n :param dist: The distribution to remove.\n \"\"\"\n logger.debug('removing distribution %s', dist)\n name = dist.key\n del self.dists_by_name[name]\n del self.dists[(name, dist.version)]\n for p in dist.provides:\n name, version = parse_name_and_version(p)\n logger.debug('Remove from provided: %s, %s, %s', name, version, dist)\n s = self.provided[name]\n s.remove((version, dist))\n if not s:\n del self.provided[name]\n\n def get_matcher(self, reqt):\n \"\"\"\n Get a version matcher for a requirement.\n :param reqt: The requirement\n :type reqt: str\n :return: A version matcher (an instance of\n :class:`distlib.version.Matcher`).\n \"\"\"\n try:\n matcher = self.scheme.matcher(reqt)\n except UnsupportedVersionError: # pragma: no cover\n # XXX compat-mode if cannot read the version\n name = reqt.split()[0]\n matcher = self.scheme.matcher(name)\n return matcher\n\n def find_providers(self, reqt):\n \"\"\"\n Find the distributions which can fulfill a requirement.\n\n :param reqt: The requirement.\n :type reqt: str\n :return: A set of distribution which can fulfill the requirement.\n \"\"\"\n matcher = self.get_matcher(reqt)\n name = matcher.key # case-insensitive\n result = set()\n provided = self.provided\n if name in provided:\n for version, provider in provided[name]:\n try:\n match = matcher.match(version)\n except UnsupportedVersionError:\n match = False\n\n if match:\n result.add(provider)\n break\n return result\n\n def try_to_replace(self, provider, other, problems):\n \"\"\"\n Attempt to replace one provider with another. This is typically used\n when resolving dependencies from multiple sources, e.g. A requires\n (B >= 1.0) while C requires (B >= 1.1).\n\n For successful replacement, ``provider`` must meet all the requirements\n which ``other`` fulfills.\n\n :param provider: The provider we are trying to replace with.\n :param other: The provider we're trying to replace.\n :param problems: If False is returned, this will contain what\n problems prevented replacement. This is currently\n a tuple of the literal string 'cantreplace',\n ``provider``, ``other`` and the set of requirements\n that ``provider`` couldn't fulfill.\n :return: True if we can replace ``other`` with ``provider``, else\n False.\n \"\"\"\n rlist = self.reqts[other]\n unmatched = set()\n for s in rlist:\n matcher = self.get_matcher(s)\n if not matcher.match(provider.version):\n unmatched.add(s)\n if unmatched:\n # can't replace other with provider\n problems.add(('cantreplace', provider, other, frozenset(unmatched)))\n result = False\n else:\n # can replace other with provider\n self.remove_distribution(other)\n del self.reqts[other]\n for s in rlist:\n self.reqts.setdefault(provider, set()).add(s)\n self.add_distribution(provider)\n result = True\n return result\n\n def find(self, requirement, meta_extras=None, prereleases=False):\n \"\"\"\n Find a distribution and all distributions it depends on.\n\n :param requirement: The requirement specifying the distribution to\n find, or a Distribution instance.\n :param meta_extras: A list of meta extras such as :test:, :build: and\n so on.\n :param prereleases: If ``True``, allow pre-release versions to be\n returned - otherwise, don't return prereleases\n unless they're all that's available.\n\n Return a set of :class:`Distribution` instances and a set of\n problems.\n\n The distributions returned should be such that they have the\n :attr:`required` attribute set to ``True`` if they were\n from the ``requirement`` passed to ``find()``, and they have the\n :attr:`build_time_dependency` attribute set to ``True`` unless they\n are post-installation dependencies of the ``requirement``.\n\n The problems should be a tuple consisting of the string\n ``'unsatisfied'`` and the requirement which couldn't be satisfied\n by any distribution known to the locator.\n \"\"\"\n\n self.provided = {}\n self.dists = {}\n self.dists_by_name = {}\n self.reqts = {}\n\n meta_extras = set(meta_extras or [])\n if ':*:' in meta_extras:\n meta_extras.remove(':*:')\n # :meta: and :run: are implicitly included\n meta_extras |= set([':test:', ':build:', ':dev:'])\n\n if isinstance(requirement, Distribution):\n dist = odist = requirement\n logger.debug('passed %s as requirement', odist)\n else:\n dist = odist = self.locator.locate(requirement, prereleases=prereleases)\n if dist is None:\n raise DistlibException('Unable to locate %r' % requirement)\n logger.debug('located %s', odist)\n dist.requested = True\n problems = set()\n todo = set([dist])\n install_dists = set([odist])\n while todo:\n dist = todo.pop()\n name = dist.key # case-insensitive\n if name not in self.dists_by_name:\n self.add_distribution(dist)\n else:\n # import pdb; pdb.set_trace()\n other = self.dists_by_name[name]\n if other != dist:\n self.try_to_replace(dist, other, problems)\n\n ireqts = dist.run_requires | dist.meta_requires\n sreqts = dist.build_requires\n ereqts = set()\n if meta_extras and dist in install_dists:\n for key in ('test', 'build', 'dev'):\n e = ':%s:' % key\n if e in meta_extras:\n ereqts |= getattr(dist, '%s_requires' % key)\n all_reqts = ireqts | sreqts | ereqts\n for r in all_reqts:\n providers = self.find_providers(r)\n if not providers:\n logger.debug('No providers found for %r', r)\n provider = self.locator.locate(r, prereleases=prereleases)\n # If no provider is found and we didn't consider\n # prereleases, consider them now.\n if provider is None and not prereleases:\n provider = self.locator.locate(r, prereleases=True)\n if provider is None:\n logger.debug('Cannot satisfy %r', r)\n problems.add(('unsatisfied', r))\n else:\n n, v = provider.key, provider.version\n if (n, v) not in self.dists:\n todo.add(provider)\n providers.add(provider)\n if r in ireqts and dist in install_dists:\n install_dists.add(provider)\n logger.debug('Adding %s to install_dists', provider.name_and_version)\n for p in providers:\n name = p.key\n if name not in self.dists_by_name:\n self.reqts.setdefault(p, set()).add(r)\n else:\n other = self.dists_by_name[name]\n if other != p:\n # see if other can be replaced by p\n self.try_to_replace(p, other, problems)\n\n dists = set(self.dists.values())\n for dist in dists:\n dist.build_time_dependency = dist not in install_dists\n if dist.build_time_dependency:\n logger.debug('%s is a build-time dependency only.', dist.name_and_version)\n logger.debug('find done for %s', odist)\n return dists, problems\n",[],[100,509,516,523,475,1961,2183,2223],{"_104":2231,"_96":2232,"_158":2233,"_160":2184,"_161":139,"_162":2234,"_164":165,"_106":2235,"_101":29,"_167":215,"_169":2236,"_170":25,"_171":-5,"_172":2237,"_99":2238},"094fd6e8-67fc-11f0-aad3-0224a6c84d84","manifest.py","094fd77e-67fc-11f0-aad3-0224a6c84d84",335,["D",1753299263395],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"\nClass representing the list of files in a distribution.\n\nEquivalent to distutils.filelist, but fixes some problems.\n\"\"\"\nimport fnmatch\nimport logging\nimport os\nimport re\nimport sys\n\nfrom . import DistlibException\nfrom .compat import fsdecode\nfrom .util import convert_path\n\n\n__all__ = ['Manifest']\n\nlogger = logging.getLogger(__name__)\n\n# a \\ followed by some spaces + EOL\n_COLLAPSE_PATTERN = re.compile('\\\\\\\\w*\\n', re.M)\n_COMMENTED_LINE = re.compile('#.*?(?=\\n)|\\n(?=$)', re.M | re.S)\n\n#\n# Due to the different results returned by fnmatch.translate, we need\n# to do slightly different processing for Python 2.7 and 3.2 ... this needed\n# to be brought in for Python 3.6 onwards.\n#\n_PYTHON_VERSION = sys.version_info[:2]\n\n\nclass Manifest(object):\n \"\"\"\n A list of files built by exploring the filesystem and filtered by applying various\n patterns to what we find there.\n \"\"\"\n\n def __init__(self, base=None):\n \"\"\"\n Initialise an instance.\n\n :param base: The base directory to explore under.\n \"\"\"\n self.base = os.path.abspath(os.path.normpath(base or os.getcwd()))\n self.prefix = self.base + os.sep\n self.allfiles = None\n self.files = set()\n\n #\n # Public API\n #\n\n def findall(self):\n \"\"\"Find all files under the base and set ``allfiles`` to the absolute\n pathnames of files found.\n \"\"\"\n from stat import S_ISREG, S_ISDIR, S_ISLNK\n\n self.allfiles = allfiles = []\n root = self.base\n stack = [root]\n pop = stack.pop\n push = stack.append\n\n while stack:\n root = pop()\n names = os.listdir(root)\n\n for name in names:\n fullname = os.path.join(root, name)\n\n # Avoid excess stat calls -- just one will do, thank you!\n stat = os.stat(fullname)\n mode = stat.st_mode\n if S_ISREG(mode):\n allfiles.append(fsdecode(fullname))\n elif S_ISDIR(mode) and not S_ISLNK(mode):\n push(fullname)\n\n def add(self, item):\n \"\"\"\n Add a file to the manifest.\n\n :param item: The pathname to add. This can be relative to the base.\n \"\"\"\n if not item.startswith(self.prefix):\n item = os.path.join(self.base, item)\n self.files.add(os.path.normpath(item))\n\n def add_many(self, items):\n \"\"\"\n Add a list of files to the manifest.\n\n :param items: The pathnames to add. These can be relative to the base.\n \"\"\"\n for item in items:\n self.add(item)\n\n def sorted(self, wantdirs=False):\n \"\"\"\n Return sorted files in directory order\n \"\"\"\n\n def add_dir(dirs, d):\n dirs.add(d)\n logger.debug('add_dir added %s', d)\n if d != self.base:\n parent, _ = os.path.split(d)\n assert parent not in ('', '/')\n add_dir(dirs, parent)\n\n result = set(self.files) # make a copy!\n if wantdirs:\n dirs = set()\n for f in result:\n add_dir(dirs, os.path.dirname(f))\n result |= dirs\n return [os.path.join(*path_tuple) for path_tuple in\n sorted(os.path.split(path) for path in result)]\n\n def clear(self):\n \"\"\"Clear all collected files.\"\"\"\n self.files = set()\n self.allfiles = []\n\n def process_directive(self, directive):\n \"\"\"\n Process a directive which either adds some files from ``allfiles`` to\n ``files``, or removes some files from ``files``.\n\n :param directive: The directive to process. This should be in a format\n compatible with distutils ``MANIFEST.in`` files:\n\n http://docs.python.org/distutils/sourcedist.html#commands\n \"\"\"\n # Parse the line: split it up, make sure the right number of words\n # is there, and return the relevant words. 'action' is always\n # defined: it's the first word of the line. Which of the other\n # three are defined depends on the action; it'll be either\n # patterns, (dir and patterns), or (dirpattern).\n action, patterns, thedir, dirpattern = self._parse_directive(directive)\n\n # OK, now we know that the action is valid and we have the\n # right number of words on the line for that action -- so we\n # can proceed with minimal error-checking.\n if action == 'include':\n for pattern in patterns:\n if not self._include_pattern(pattern, anchor=True):\n logger.warning('no files found matching %r', pattern)\n\n elif action == 'exclude':\n for pattern in patterns:\n self._exclude_pattern(pattern, anchor=True)\n\n elif action == 'global-include':\n for pattern in patterns:\n if not self._include_pattern(pattern, anchor=False):\n logger.warning('no files found matching %r '\n 'anywhere in distribution', pattern)\n\n elif action == 'global-exclude':\n for pattern in patterns:\n self._exclude_pattern(pattern, anchor=False)\n\n elif action == 'recursive-include':\n for pattern in patterns:\n if not self._include_pattern(pattern, prefix=thedir):\n logger.warning('no files found matching %r '\n 'under directory %r', pattern, thedir)\n\n elif action == 'recursive-exclude':\n for pattern in patterns:\n self._exclude_pattern(pattern, prefix=thedir)\n\n elif action == 'graft':\n if not self._include_pattern(None, prefix=dirpattern):\n logger.warning('no directories found matching %r',\n dirpattern)\n\n elif action == 'prune':\n if not self._exclude_pattern(None, prefix=dirpattern):\n logger.warning('no previously-included directories found '\n 'matching %r', dirpattern)\n else: # pragma: no cover\n # This should never happen, as it should be caught in\n # _parse_template_line\n raise DistlibException(\n 'invalid action %r' % action)\n\n #\n # Private API\n #\n\n def _parse_directive(self, directive):\n \"\"\"\n Validate a directive.\n :param directive: The directive to validate.\n :return: A tuple of action, patterns, thedir, dir_patterns\n \"\"\"\n words = directive.split()\n if len(words) == 1 and words[0] not in ('include', 'exclude',\n 'global-include',\n 'global-exclude',\n 'recursive-include',\n 'recursive-exclude',\n 'graft', 'prune'):\n # no action given, let's use the default 'include'\n words.insert(0, 'include')\n\n action = words[0]\n patterns = thedir = dir_pattern = None\n\n if action in ('include', 'exclude',\n 'global-include', 'global-exclude'):\n if len(words) < 2:\n raise DistlibException(\n '%r expects ...' % action)\n\n patterns = [convert_path(word) for word in words[1:]]\n\n elif action in ('recursive-include', 'recursive-exclude'):\n if len(words) < 3:\n raise DistlibException(\n '%r expects ...' % action)\n\n thedir = convert_path(words[1])\n patterns = [convert_path(word) for word in words[2:]]\n\n elif action in ('graft', 'prune'):\n if len(words) != 2:\n raise DistlibException(\n '%r expects a single ' % action)\n\n dir_pattern = convert_path(words[1])\n\n else:\n raise DistlibException('unknown action %r' % action)\n\n return action, patterns, thedir, dir_pattern\n\n def _include_pattern(self, pattern, anchor=True, prefix=None,\n is_regex=False):\n \"\"\"Select strings (presumably filenames) from 'self.files' that\n match 'pattern', a Unix-style wildcard (glob) pattern.\n\n Patterns are not quite the same as implemented by the 'fnmatch'\n module: '*' and '?' match non-special characters, where \"special\"\n is platform-dependent: slash on Unix; colon, slash, and backslash on\n DOS/Windows; and colon on Mac OS.\n\n If 'anchor' is true (the default), then the pattern match is more\n stringent: \"*.py\" will match \"foo.py\" but not \"foo/bar.py\". If\n 'anchor' is false, both of these will match.\n\n If 'prefix' is supplied, then only filenames starting with 'prefix'\n (itself a pattern) and ending with 'pattern', with anything in between\n them, will match. 'anchor' is ignored in this case.\n\n If 'is_regex' is true, 'anchor' and 'prefix' are ignored, and\n 'pattern' is assumed to be either a string containing a regex or a\n regex object -- no translation is done, the regex is just compiled\n and used as-is.\n\n Selected strings will be added to self.files.\n\n Return True if files are found.\n \"\"\"\n # XXX docstring lying about what the special chars are?\n found = False\n pattern_re = self._translate_pattern(pattern, anchor, prefix, is_regex)\n\n # delayed loading of allfiles list\n if self.allfiles is None:\n self.findall()\n\n for name in self.allfiles:\n if pattern_re.search(name):\n self.files.add(name)\n found = True\n return found\n\n def _exclude_pattern(self, pattern, anchor=True, prefix=None,\n is_regex=False):\n \"\"\"Remove strings (presumably filenames) from 'files' that match\n 'pattern'.\n\n Other parameters are the same as for 'include_pattern()', above.\n The list 'self.files' is modified in place. Return True if files are\n found.\n\n This API is public to allow e.g. exclusion of SCM subdirs, e.g. when\n packaging source distributions\n \"\"\"\n found = False\n pattern_re = self._translate_pattern(pattern, anchor, prefix, is_regex)\n for f in list(self.files):\n if pattern_re.search(f):\n self.files.remove(f)\n found = True\n return found\n\n def _translate_pattern(self, pattern, anchor=True, prefix=None,\n is_regex=False):\n \"\"\"Translate a shell-like wildcard pattern to a compiled regular\n expression.\n\n Return the compiled regex. If 'is_regex' true,\n then 'pattern' is directly compiled to a regex (if it's a string)\n or just returned as-is (assumes it's a regex object).\n \"\"\"\n if is_regex:\n if isinstance(pattern, str):\n return re.compile(pattern)\n else:\n return pattern\n\n if _PYTHON_VERSION > (3, 2):\n # ditch start and end characters\n start, _, end = self._glob_to_re('_').partition('_')\n\n if pattern:\n pattern_re = self._glob_to_re(pattern)\n if _PYTHON_VERSION > (3, 2):\n assert pattern_re.startswith(start) and pattern_re.endswith(end)\n else:\n pattern_re = ''\n\n base = re.escape(os.path.join(self.base, ''))\n if prefix is not None:\n # ditch end of pattern character\n if _PYTHON_VERSION <= (3, 2):\n empty_pattern = self._glob_to_re('')\n prefix_re = self._glob_to_re(prefix)[:-len(empty_pattern)]\n else:\n prefix_re = self._glob_to_re(prefix)\n assert prefix_re.startswith(start) and prefix_re.endswith(end)\n prefix_re = prefix_re[len(start): len(prefix_re) - len(end)]\n sep = os.sep\n if os.sep == '\\\\':\n sep = r'\\\\'\n if _PYTHON_VERSION <= (3, 2):\n pattern_re = '^' + base + sep.join((prefix_re,\n '.*' + pattern_re))\n else:\n pattern_re = pattern_re[len(start): len(pattern_re) - len(end)]\n pattern_re = r'%s%s%s%s.*%s%s' % (start, base, prefix_re, sep,\n pattern_re, end)\n else: # no prefix -- respect anchor flag\n if anchor:\n if _PYTHON_VERSION <= (3, 2):\n pattern_re = '^' + base + pattern_re\n else:\n pattern_re = r'%s%s%s' % (start, base, pattern_re[len(start):])\n\n return re.compile(pattern_re)\n\n def _glob_to_re(self, pattern):\n \"\"\"Translate a shell-like glob pattern to a regular expression.\n\n Return a string containing the regex. Differs from\n 'fnmatch.translate()' in that '*' does not match \"special characters\"\n (which are platform-specific).\n \"\"\"\n pattern_re = fnmatch.translate(pattern)\n\n # '?' and '*' in the glob pattern become '.' and '.*' in the RE, which\n # IMHO is wrong -- '?' and '*' aren't supposed to match slash in Unix,\n # and by extension they shouldn't match such \"special characters\" under\n # any OS. So change all non-escaped dots in the RE to match any\n # character except the special characters (currently: just os.sep).\n sep = os.sep\n if os.sep == '\\\\':\n # we're using a regex to manipulate a regex, so we need\n # to escape the backslash twice\n sep = r'\\\\\\\\'\n escaped = r'\\1[^%s]' % sep\n pattern_re = re.sub(r'((? y,\n '!=': lambda x, y: x != y,\n '<': lambda x, y: x < y,\n '<=': lambda x, y: x == y or x < y,\n '>': lambda x, y: x > y,\n '>=': lambda x, y: x == y or x > y,\n 'and': lambda x, y: x and y,\n 'or': lambda x, y: x or y,\n 'in': lambda x, y: x in y,\n 'not in': lambda x, y: x not in y,\n }\n\n def evaluate(self, expr, context):\n \"\"\"\n Evaluate a marker expression returned by the :func:`parse_requirement`\n function in the specified context.\n \"\"\"\n if isinstance(expr, string_types):\n if expr[0] in '\\'\"':\n result = expr[1:-1]\n else:\n if expr not in context:\n raise SyntaxError('unknown variable: %s' % expr)\n result = context[expr]\n else:\n assert isinstance(expr, dict)\n op = expr['op']\n if op not in self.operations:\n raise NotImplementedError('op not implemented: %s' % op)\n elhs = expr['lhs']\n erhs = expr['rhs']\n if _is_literal(expr['lhs']) and _is_literal(expr['rhs']):\n raise SyntaxError('invalid comparison: %s %s %s' % (elhs, op, erhs))\n\n lhs = self.evaluate(elhs, context)\n rhs = self.evaluate(erhs, context)\n if ((_is_version_marker(elhs) or _is_version_marker(erhs)) and\n op in ('<', '<=', '>', '>=', '===', '==', '!=', '~=')):\n lhs = LV(lhs)\n rhs = LV(rhs)\n elif _is_version_marker(elhs) and op in ('in', 'not in'):\n lhs = LV(lhs)\n rhs = _get_versions(rhs)\n result = self.operations[op](lhs, rhs)\n return result\n\n\n_DIGITS = re.compile(r'\\d+\\.\\d+')\n\n\ndef default_context():\n\n def format_full_version(info):\n version = '%s.%s.%s' % (info.major, info.minor, info.micro)\n kind = info.releaselevel\n if kind != 'final':\n version += kind[0] + str(info.serial)\n return version\n\n if hasattr(sys, 'implementation'):\n implementation_version = format_full_version(sys.implementation.version)\n implementation_name = sys.implementation.name\n else:\n implementation_version = '0'\n implementation_name = ''\n\n ppv = platform.python_version()\n m = _DIGITS.match(ppv)\n pv = m.group(0)\n result = {\n 'implementation_name': implementation_name,\n 'implementation_version': implementation_version,\n 'os_name': os.name,\n 'platform_machine': platform.machine(),\n 'platform_python_implementation': platform.python_implementation(),\n 'platform_release': platform.release(),\n 'platform_system': platform.system(),\n 'platform_version': platform.version(),\n 'platform_in_venv': str(in_venv()),\n 'python_full_version': ppv,\n 'python_version': pv,\n 'sys_platform': sys.platform,\n }\n return result\n\n\nDEFAULT_CONTEXT = default_context()\ndel default_context\n\nevaluator = Evaluator()\n\n\ndef interpret(marker, execution_context=None):\n \"\"\"\n Interpret a marker and return a result depending on environment.\n\n :param marker: The marker to interpret.\n :type marker: str\n :param execution_context: The context used for name lookup.\n :type execution_context: mapping\n \"\"\"\n try:\n expr, rest = parse_marker(marker)\n except Exception as e:\n raise SyntaxError('Unable to interpret marker syntax: %s: %s' % (marker, e))\n if rest and rest[0] != '#':\n raise SyntaxError('unexpected trailing data in marker: %s: %s' % (marker, rest))\n context = dict(DEFAULT_CONTEXT)\n if execution_context:\n context.update(execution_context)\n return evaluator.evaluate(expr, context)\n",[],[100,509,516,523,475,1961,2183,2241],{"_104":2249,"_96":1296,"_158":2250,"_160":2184,"_161":139,"_162":2251,"_164":165,"_106":2252,"_101":29,"_167":215,"_169":2253,"_170":25,"_171":-5,"_172":2254,"_99":2255},"0962c398-67fc-11f0-bcbe-0224a6c84d84","0962c442-67fc-11f0-bcbe-0224a6c84d84",336,["D",1753299263209],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"Implementation of the Metadata for Python packages PEPs.\n\nSupports all metadata formats (1.0, 1.1, 1.2, 1.3/2.1 and 2.2).\n\"\"\"\nfrom __future__ import unicode_literals\n\nimport codecs\nfrom email import message_from_file\nimport json\nimport logging\nimport re\n\nfrom . import DistlibException, __version__\nfrom .compat import StringIO, string_types, text_type\nfrom .markers import interpret\nfrom .util import extract_by_key, get_extras\nfrom .version import get_scheme, PEP440_VERSION_RE\n\nlogger = logging.getLogger(__name__)\n\n\nclass MetadataMissingError(DistlibException):\n \"\"\"A required metadata is missing\"\"\"\n\n\nclass MetadataConflictError(DistlibException):\n \"\"\"Attempt to read or write metadata fields that are conflictual.\"\"\"\n\n\nclass MetadataUnrecognizedVersionError(DistlibException):\n \"\"\"Unknown metadata version number.\"\"\"\n\n\nclass MetadataInvalidError(DistlibException):\n \"\"\"A metadata value is invalid\"\"\"\n\n\n# public API of this module\n__all__ = ['Metadata', 'PKG_INFO_ENCODING', 'PKG_INFO_PREFERRED_VERSION']\n\n# Encoding used for the PKG-INFO files\nPKG_INFO_ENCODING = 'utf-8'\n\n# preferred version. Hopefully will be changed\n# to 1.2 once PEP 345 is supported everywhere\nPKG_INFO_PREFERRED_VERSION = '1.1'\n\n_LINE_PREFIX_1_2 = re.compile('\\n \\\\|')\n_LINE_PREFIX_PRE_1_2 = re.compile('\\n ')\n_241_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Summary', 'Description', 'Keywords', 'Home-page',\n 'Author', 'Author-email', 'License')\n\n_314_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n 'Keywords', 'Home-page', 'Author', 'Author-email', 'License', 'Classifier', 'Download-URL', 'Obsoletes',\n 'Provides', 'Requires')\n\n_314_MARKERS = ('Obsoletes', 'Provides', 'Requires', 'Classifier', 'Download-URL')\n\n_345_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n 'Keywords', 'Home-page', 'Author', 'Author-email', 'Maintainer', 'Maintainer-email', 'License',\n 'Classifier', 'Download-URL', 'Obsoletes-Dist', 'Project-URL', 'Provides-Dist', 'Requires-Dist',\n 'Requires-Python', 'Requires-External')\n\n_345_MARKERS = ('Provides-Dist', 'Requires-Dist', 'Requires-Python', 'Obsoletes-Dist', 'Requires-External',\n 'Maintainer', 'Maintainer-email', 'Project-URL')\n\n_426_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n 'Keywords', 'Home-page', 'Author', 'Author-email', 'Maintainer', 'Maintainer-email', 'License',\n 'Classifier', 'Download-URL', 'Obsoletes-Dist', 'Project-URL', 'Provides-Dist', 'Requires-Dist',\n 'Requires-Python', 'Requires-External', 'Private-Version', 'Obsoleted-By', 'Setup-Requires-Dist',\n 'Extension', 'Provides-Extra')\n\n_426_MARKERS = ('Private-Version', 'Provides-Extra', 'Obsoleted-By', 'Setup-Requires-Dist', 'Extension')\n\n# See issue #106: Sometimes 'Requires' and 'Provides' occur wrongly in\n# the metadata. Include them in the tuple literal below to allow them\n# (for now).\n# Ditto for Obsoletes - see issue #140.\n_566_FIELDS = _426_FIELDS + ('Description-Content-Type', 'Requires', 'Provides', 'Obsoletes')\n\n_566_MARKERS = ('Description-Content-Type', )\n\n_643_MARKERS = ('Dynamic', 'License-File')\n\n_643_FIELDS = _566_FIELDS + _643_MARKERS\n\n_ALL_FIELDS = set()\n_ALL_FIELDS.update(_241_FIELDS)\n_ALL_FIELDS.update(_314_FIELDS)\n_ALL_FIELDS.update(_345_FIELDS)\n_ALL_FIELDS.update(_426_FIELDS)\n_ALL_FIELDS.update(_566_FIELDS)\n_ALL_FIELDS.update(_643_FIELDS)\n\nEXTRA_RE = re.compile(r'''extra\\s*==\\s*(\"([^\"]+)\"|'([^']+)')''')\n\n\ndef _version2fieldlist(version):\n if version == '1.0':\n return _241_FIELDS\n elif version == '1.1':\n return _314_FIELDS\n elif version == '1.2':\n return _345_FIELDS\n elif version in ('1.3', '2.1'):\n # avoid adding field names if already there\n return _345_FIELDS + tuple(f for f in _566_FIELDS if f not in _345_FIELDS)\n elif version == '2.0':\n raise ValueError('Metadata 2.0 is withdrawn and not supported')\n # return _426_FIELDS\n elif version == '2.2':\n return _643_FIELDS\n raise MetadataUnrecognizedVersionError(version)\n\n\ndef _best_version(fields):\n \"\"\"Detect the best version depending on the fields used.\"\"\"\n\n def _has_marker(keys, markers):\n return any(marker in keys for marker in markers)\n\n keys = [key for key, value in fields.items() if value not in ([], 'UNKNOWN', None)]\n possible_versions = ['1.0', '1.1', '1.2', '1.3', '2.1', '2.2'] # 2.0 removed\n\n # first let's try to see if a field is not part of one of the version\n for key in keys:\n if key not in _241_FIELDS and '1.0' in possible_versions:\n possible_versions.remove('1.0')\n logger.debug('Removed 1.0 due to %s', key)\n if key not in _314_FIELDS and '1.1' in possible_versions:\n possible_versions.remove('1.1')\n logger.debug('Removed 1.1 due to %s', key)\n if key not in _345_FIELDS and '1.2' in possible_versions:\n possible_versions.remove('1.2')\n logger.debug('Removed 1.2 due to %s', key)\n if key not in _566_FIELDS and '1.3' in possible_versions:\n possible_versions.remove('1.3')\n logger.debug('Removed 1.3 due to %s', key)\n if key not in _566_FIELDS and '2.1' in possible_versions:\n if key != 'Description': # In 2.1, description allowed after headers\n possible_versions.remove('2.1')\n logger.debug('Removed 2.1 due to %s', key)\n if key not in _643_FIELDS and '2.2' in possible_versions:\n possible_versions.remove('2.2')\n logger.debug('Removed 2.2 due to %s', key)\n # if key not in _426_FIELDS and '2.0' in possible_versions:\n # possible_versions.remove('2.0')\n # logger.debug('Removed 2.0 due to %s', key)\n\n # possible_version contains qualified versions\n if len(possible_versions) == 1:\n return possible_versions[0] # found !\n elif len(possible_versions) == 0:\n logger.debug('Out of options - unknown metadata set: %s', fields)\n raise MetadataConflictError('Unknown metadata set')\n\n # let's see if one unique marker is found\n is_1_1 = '1.1' in possible_versions and _has_marker(keys, _314_MARKERS)\n is_1_2 = '1.2' in possible_versions and _has_marker(keys, _345_MARKERS)\n is_2_1 = '2.1' in possible_versions and _has_marker(keys, _566_MARKERS)\n # is_2_0 = '2.0' in possible_versions and _has_marker(keys, _426_MARKERS)\n is_2_2 = '2.2' in possible_versions and _has_marker(keys, _643_MARKERS)\n if int(is_1_1) + int(is_1_2) + int(is_2_1) + int(is_2_2) > 1:\n raise MetadataConflictError('You used incompatible 1.1/1.2/2.1/2.2 fields')\n\n # we have the choice, 1.0, or 1.2, 2.1 or 2.2\n # - 1.0 has a broken Summary field but works with all tools\n # - 1.1 is to avoid\n # - 1.2 fixes Summary but has little adoption\n # - 2.1 adds more features\n # - 2.2 is the latest\n if not is_1_1 and not is_1_2 and not is_2_1 and not is_2_2:\n # we couldn't find any specific marker\n if PKG_INFO_PREFERRED_VERSION in possible_versions:\n return PKG_INFO_PREFERRED_VERSION\n if is_1_1:\n return '1.1'\n if is_1_2:\n return '1.2'\n if is_2_1:\n return '2.1'\n # if is_2_2:\n # return '2.2'\n\n return '2.2'\n\n\n# This follows the rules about transforming keys as described in\n# https://www.python.org/dev/peps/pep-0566/#id17\n_ATTR2FIELD = {name.lower().replace(\"-\", \"_\"): name for name in _ALL_FIELDS}\n_FIELD2ATTR = {field: attr for attr, field in _ATTR2FIELD.items()}\n\n_PREDICATE_FIELDS = ('Requires-Dist', 'Obsoletes-Dist', 'Provides-Dist')\n_VERSIONS_FIELDS = ('Requires-Python', )\n_VERSION_FIELDS = ('Version', )\n_LISTFIELDS = ('Platform', 'Classifier', 'Obsoletes', 'Requires', 'Provides', 'Obsoletes-Dist', 'Provides-Dist',\n 'Requires-Dist', 'Requires-External', 'Project-URL', 'Supported-Platform', 'Setup-Requires-Dist',\n 'Provides-Extra', 'Extension', 'License-File')\n_LISTTUPLEFIELDS = ('Project-URL', )\n\n_ELEMENTSFIELD = ('Keywords', )\n\n_UNICODEFIELDS = ('Author', 'Maintainer', 'Summary', 'Description')\n\n_MISSING = object()\n\n_FILESAFE = re.compile('[^A-Za-z0-9.]+')\n\n\ndef _get_name_and_version(name, version, for_filename=False):\n \"\"\"Return the distribution name with version.\n\n If for_filename is true, return a filename-escaped form.\"\"\"\n if for_filename:\n # For both name and version any runs of non-alphanumeric or '.'\n # characters are replaced with a single '-'. Additionally any\n # spaces in the version string become '.'\n name = _FILESAFE.sub('-', name)\n version = _FILESAFE.sub('-', version.replace(' ', '.'))\n return '%s-%s' % (name, version)\n\n\nclass LegacyMetadata(object):\n \"\"\"The legacy metadata of a release.\n\n Supports versions 1.0, 1.1, 1.2, 2.0 and 1.3/2.1 (auto-detected). You can\n instantiate the class with one of these arguments (or none):\n - *path*, the path to a metadata file\n - *fileobj* give a file-like object with metadata as content\n - *mapping* is a dict-like object\n - *scheme* is a version scheme name\n \"\"\"\n\n # TODO document the mapping API and UNKNOWN default key\n\n def __init__(self, path=None, fileobj=None, mapping=None, scheme='default'):\n if [path, fileobj, mapping].count(None) < 2:\n raise TypeError('path, fileobj and mapping are exclusive')\n self._fields = {}\n self.requires_files = []\n self._dependencies = None\n self.scheme = scheme\n if path is not None:\n self.read(path)\n elif fileobj is not None:\n self.read_file(fileobj)\n elif mapping is not None:\n self.update(mapping)\n self.set_metadata_version()\n\n def set_metadata_version(self):\n self._fields['Metadata-Version'] = _best_version(self._fields)\n\n def _write_field(self, fileobj, name, value):\n fileobj.write('%s: %s\\n' % (name, value))\n\n def __getitem__(self, name):\n return self.get(name)\n\n def __setitem__(self, name, value):\n return self.set(name, value)\n\n def __delitem__(self, name):\n field_name = self._convert_name(name)\n try:\n del self._fields[field_name]\n except KeyError:\n raise KeyError(name)\n\n def __contains__(self, name):\n return (name in self._fields or self._convert_name(name) in self._fields)\n\n def _convert_name(self, name):\n if name in _ALL_FIELDS:\n return name\n name = name.replace('-', '_').lower()\n return _ATTR2FIELD.get(name, name)\n\n def _default_value(self, name):\n if name in _LISTFIELDS or name in _ELEMENTSFIELD:\n return []\n return 'UNKNOWN'\n\n def _remove_line_prefix(self, value):\n if self.metadata_version in ('1.0', '1.1'):\n return _LINE_PREFIX_PRE_1_2.sub('\\n', value)\n else:\n return _LINE_PREFIX_1_2.sub('\\n', value)\n\n def __getattr__(self, name):\n if name in _ATTR2FIELD:\n return self[name]\n raise AttributeError(name)\n\n #\n # Public API\n #\n\n def get_fullname(self, filesafe=False):\n \"\"\"\n Return the distribution name with version.\n\n If filesafe is true, return a filename-escaped form.\n \"\"\"\n return _get_name_and_version(self['Name'], self['Version'], filesafe)\n\n def is_field(self, name):\n \"\"\"return True if name is a valid metadata key\"\"\"\n name = self._convert_name(name)\n return name in _ALL_FIELDS\n\n def is_multi_field(self, name):\n name = self._convert_name(name)\n return name in _LISTFIELDS\n\n def read(self, filepath):\n \"\"\"Read the metadata values from a file path.\"\"\"\n fp = codecs.open(filepath, 'r', encoding='utf-8')\n try:\n self.read_file(fp)\n finally:\n fp.close()\n\n def read_file(self, fileob):\n \"\"\"Read the metadata values from a file object.\"\"\"\n msg = message_from_file(fileob)\n self._fields['Metadata-Version'] = msg['metadata-version']\n\n # When reading, get all the fields we can\n for field in _ALL_FIELDS:\n if field not in msg:\n continue\n if field in _LISTFIELDS:\n # we can have multiple lines\n values = msg.get_all(field)\n if field in _LISTTUPLEFIELDS and values is not None:\n values = [tuple(value.split(',')) for value in values]\n self.set(field, values)\n else:\n # single line\n value = msg[field]\n if value is not None and value != 'UNKNOWN':\n self.set(field, value)\n\n # PEP 566 specifies that the body be used for the description, if\n # available\n body = msg.get_payload()\n self[\"Description\"] = body if body else self[\"Description\"]\n # logger.debug('Attempting to set metadata for %s', self)\n # self.set_metadata_version()\n\n def write(self, filepath, skip_unknown=False):\n \"\"\"Write the metadata fields to filepath.\"\"\"\n fp = codecs.open(filepath, 'w', encoding='utf-8')\n try:\n self.write_file(fp, skip_unknown)\n finally:\n fp.close()\n\n def write_file(self, fileobject, skip_unknown=False):\n \"\"\"Write the PKG-INFO format data to a file object.\"\"\"\n self.set_metadata_version()\n\n for field in _version2fieldlist(self['Metadata-Version']):\n values = self.get(field)\n if skip_unknown and values in ('UNKNOWN', [], ['UNKNOWN']):\n continue\n if field in _ELEMENTSFIELD:\n self._write_field(fileobject, field, ','.join(values))\n continue\n if field not in _LISTFIELDS:\n if field == 'Description':\n if self.metadata_version in ('1.0', '1.1'):\n values = values.replace('\\n', '\\n ')\n else:\n values = values.replace('\\n', '\\n |')\n values = [values]\n\n if field in _LISTTUPLEFIELDS:\n values = [','.join(value) for value in values]\n\n for value in values:\n self._write_field(fileobject, field, value)\n\n def update(self, other=None, **kwargs):\n \"\"\"Set metadata values from the given iterable `other` and kwargs.\n\n Behavior is like `dict.update`: If `other` has a ``keys`` method,\n they are looped over and ``self[key]`` is assigned ``other[key]``.\n Else, ``other`` is an iterable of ``(key, value)`` iterables.\n\n Keys that don't match a metadata field or that have an empty value are\n dropped.\n \"\"\"\n\n def _set(key, value):\n if key in _ATTR2FIELD and value:\n self.set(self._convert_name(key), value)\n\n if not other:\n # other is None or empty container\n pass\n elif hasattr(other, 'keys'):\n for k in other.keys():\n _set(k, other[k])\n else:\n for k, v in other:\n _set(k, v)\n\n if kwargs:\n for k, v in kwargs.items():\n _set(k, v)\n\n def set(self, name, value):\n \"\"\"Control then set a metadata field.\"\"\"\n name = self._convert_name(name)\n\n if ((name in _ELEMENTSFIELD or name == 'Platform') and not isinstance(value, (list, tuple))):\n if isinstance(value, string_types):\n value = [v.strip() for v in value.split(',')]\n else:\n value = []\n elif (name in _LISTFIELDS and not isinstance(value, (list, tuple))):\n if isinstance(value, string_types):\n value = [value]\n else:\n value = []\n\n if logger.isEnabledFor(logging.WARNING):\n project_name = self['Name']\n\n scheme = get_scheme(self.scheme)\n if name in _PREDICATE_FIELDS and value is not None:\n for v in value:\n # check that the values are valid\n if not scheme.is_valid_matcher(v.split(';')[0]):\n logger.warning(\"'%s': '%s' is not valid (field '%s')\", project_name, v, name)\n # FIXME this rejects UNKNOWN, is that right?\n elif name in _VERSIONS_FIELDS and value is not None:\n if not scheme.is_valid_constraint_list(value):\n logger.warning(\"'%s': '%s' is not a valid version (field '%s')\", project_name, value, name)\n elif name in _VERSION_FIELDS and value is not None:\n if not scheme.is_valid_version(value):\n logger.warning(\"'%s': '%s' is not a valid version (field '%s')\", project_name, value, name)\n\n if name in _UNICODEFIELDS:\n if name == 'Description':\n value = self._remove_line_prefix(value)\n\n self._fields[name] = value\n\n def get(self, name, default=_MISSING):\n \"\"\"Get a metadata field.\"\"\"\n name = self._convert_name(name)\n if name not in self._fields:\n if default is _MISSING:\n default = self._default_value(name)\n return default\n if name in _UNICODEFIELDS:\n value = self._fields[name]\n return value\n elif name in _LISTFIELDS:\n value = self._fields[name]\n if value is None:\n return []\n res = []\n for val in value:\n if name not in _LISTTUPLEFIELDS:\n res.append(val)\n else:\n # That's for Project-URL\n res.append((val[0], val[1]))\n return res\n\n elif name in _ELEMENTSFIELD:\n value = self._fields[name]\n if isinstance(value, string_types):\n return value.split(',')\n return self._fields[name]\n\n def check(self, strict=False):\n \"\"\"Check if the metadata is compliant. If strict is True then raise if\n no Name or Version are provided\"\"\"\n self.set_metadata_version()\n\n # XXX should check the versions (if the file was loaded)\n missing, warnings = [], []\n\n for attr in ('Name', 'Version'): # required by PEP 345\n if attr not in self:\n missing.append(attr)\n\n if strict and missing != []:\n msg = 'missing required metadata: %s' % ', '.join(missing)\n raise MetadataMissingError(msg)\n\n for attr in ('Home-page', 'Author'):\n if attr not in self:\n missing.append(attr)\n\n # checking metadata 1.2 (XXX needs to check 1.1, 1.0)\n if self['Metadata-Version'] != '1.2':\n return missing, warnings\n\n scheme = get_scheme(self.scheme)\n\n def are_valid_constraints(value):\n for v in value:\n if not scheme.is_valid_matcher(v.split(';')[0]):\n return False\n return True\n\n for fields, controller in ((_PREDICATE_FIELDS, are_valid_constraints),\n (_VERSIONS_FIELDS, scheme.is_valid_constraint_list), (_VERSION_FIELDS,\n scheme.is_valid_version)):\n for field in fields:\n value = self.get(field, None)\n if value is not None and not controller(value):\n warnings.append(\"Wrong value for '%s': %s\" % (field, value))\n\n return missing, warnings\n\n def todict(self, skip_missing=False):\n \"\"\"Return fields as a dict.\n\n Field names will be converted to use the underscore-lowercase style\n instead of hyphen-mixed case (i.e. home_page instead of Home-page).\n This is as per https://www.python.org/dev/peps/pep-0566/#id17.\n \"\"\"\n self.set_metadata_version()\n\n fields = _version2fieldlist(self['Metadata-Version'])\n\n data = {}\n\n for field_name in fields:\n if not skip_missing or field_name in self._fields:\n key = _FIELD2ATTR[field_name]\n if key != 'project_url':\n data[key] = self[field_name]\n else:\n data[key] = [','.join(u) for u in self[field_name]]\n\n return data\n\n def add_requirements(self, requirements):\n if self['Metadata-Version'] == '1.1':\n # we can't have 1.1 metadata *and* Setuptools requires\n for field in ('Obsoletes', 'Requires', 'Provides'):\n if field in self:\n del self[field]\n self['Requires-Dist'] += requirements\n\n # Mapping API\n # TODO could add iter* variants\n\n def keys(self):\n return list(_version2fieldlist(self['Metadata-Version']))\n\n def __iter__(self):\n for key in self.keys():\n yield key\n\n def values(self):\n return [self[key] for key in self.keys()]\n\n def items(self):\n return [(key, self[key]) for key in self.keys()]\n\n def __repr__(self):\n return '<%s %s %s>' % (self.__class__.__name__, self.name, self.version)\n\n\nMETADATA_FILENAME = 'pydist.json'\nWHEEL_METADATA_FILENAME = 'metadata.json'\nLEGACY_METADATA_FILENAME = 'METADATA'\n\n\nclass Metadata(object):\n \"\"\"\n The metadata of a release. This implementation uses 2.1\n metadata where possible. If not possible, it wraps a LegacyMetadata\n instance which handles the key-value metadata format.\n \"\"\"\n\n METADATA_VERSION_MATCHER = re.compile(r'^\\d+(\\.\\d+)*$')\n\n NAME_MATCHER = re.compile('^[0-9A-Z]([0-9A-Z_.-]*[0-9A-Z])?$', re.I)\n\n FIELDNAME_MATCHER = re.compile('^[A-Z]([0-9A-Z-]*[0-9A-Z])?$', re.I)\n\n VERSION_MATCHER = PEP440_VERSION_RE\n\n SUMMARY_MATCHER = re.compile('.{1,2047}')\n\n METADATA_VERSION = '2.0'\n\n GENERATOR = 'distlib (%s)' % __version__\n\n MANDATORY_KEYS = {\n 'name': (),\n 'version': (),\n 'summary': ('legacy', ),\n }\n\n INDEX_KEYS = ('name version license summary description author '\n 'author_email keywords platform home_page classifiers '\n 'download_url')\n\n DEPENDENCY_KEYS = ('extras run_requires test_requires build_requires '\n 'dev_requires provides meta_requires obsoleted_by '\n 'supports_environments')\n\n SYNTAX_VALIDATORS = {\n 'metadata_version': (METADATA_VERSION_MATCHER, ()),\n 'name': (NAME_MATCHER, ('legacy', )),\n 'version': (VERSION_MATCHER, ('legacy', )),\n 'summary': (SUMMARY_MATCHER, ('legacy', )),\n 'dynamic': (FIELDNAME_MATCHER, ('legacy', )),\n }\n\n __slots__ = ('_legacy', '_data', 'scheme')\n\n def __init__(self, path=None, fileobj=None, mapping=None, scheme='default'):\n if [path, fileobj, mapping].count(None) < 2:\n raise TypeError('path, fileobj and mapping are exclusive')\n self._legacy = None\n self._data = None\n self.scheme = scheme\n # import pdb; pdb.set_trace()\n if mapping is not None:\n try:\n self._validate_mapping(mapping, scheme)\n self._data = mapping\n except MetadataUnrecognizedVersionError:\n self._legacy = LegacyMetadata(mapping=mapping, scheme=scheme)\n self.validate()\n else:\n data = None\n if path:\n with open(path, 'rb') as f:\n data = f.read()\n elif fileobj:\n data = fileobj.read()\n if data is None:\n # Initialised with no args - to be added\n self._data = {\n 'metadata_version': self.METADATA_VERSION,\n 'generator': self.GENERATOR,\n }\n else:\n if not isinstance(data, text_type):\n data = data.decode('utf-8')\n try:\n self._data = json.loads(data)\n self._validate_mapping(self._data, scheme)\n except ValueError:\n # Note: MetadataUnrecognizedVersionError does not\n # inherit from ValueError (it's a DistlibException,\n # which should not inherit from ValueError).\n # The ValueError comes from the json.load - if that\n # succeeds and we get a validation error, we want\n # that to propagate\n self._legacy = LegacyMetadata(fileobj=StringIO(data), scheme=scheme)\n self.validate()\n\n common_keys = set(('name', 'version', 'license', 'keywords', 'summary'))\n\n none_list = (None, list)\n none_dict = (None, dict)\n\n mapped_keys = {\n 'run_requires': ('Requires-Dist', list),\n 'build_requires': ('Setup-Requires-Dist', list),\n 'dev_requires': none_list,\n 'test_requires': none_list,\n 'meta_requires': none_list,\n 'extras': ('Provides-Extra', list),\n 'modules': none_list,\n 'namespaces': none_list,\n 'exports': none_dict,\n 'commands': none_dict,\n 'classifiers': ('Classifier', list),\n 'source_url': ('Download-URL', None),\n 'metadata_version': ('Metadata-Version', None),\n }\n\n del none_list, none_dict\n\n def __getattribute__(self, key):\n common = object.__getattribute__(self, 'common_keys')\n mapped = object.__getattribute__(self, 'mapped_keys')\n if key in mapped:\n lk, maker = mapped[key]\n if self._legacy:\n if lk is None:\n result = None if maker is None else maker()\n else:\n result = self._legacy.get(lk)\n else:\n value = None if maker is None else maker()\n if key not in ('commands', 'exports', 'modules', 'namespaces', 'classifiers'):\n result = self._data.get(key, value)\n else:\n # special cases for PEP 459\n sentinel = object()\n result = sentinel\n d = self._data.get('extensions')\n if d:\n if key == 'commands':\n result = d.get('python.commands', value)\n elif key == 'classifiers':\n d = d.get('python.details')\n if d:\n result = d.get(key, value)\n else:\n d = d.get('python.exports')\n if not d:\n d = self._data.get('python.exports')\n if d:\n result = d.get(key, value)\n if result is sentinel:\n result = value\n elif key not in common:\n result = object.__getattribute__(self, key)\n elif self._legacy:\n result = self._legacy.get(key)\n else:\n result = self._data.get(key)\n return result\n\n def _validate_value(self, key, value, scheme=None):\n if key in self.SYNTAX_VALIDATORS:\n pattern, exclusions = self.SYNTAX_VALIDATORS[key]\n if (scheme or self.scheme) not in exclusions:\n m = pattern.match(value)\n if not m:\n raise MetadataInvalidError(\"'%s' is an invalid value for \"\n \"the '%s' property\" % (value, key))\n\n def __setattr__(self, key, value):\n self._validate_value(key, value)\n common = object.__getattribute__(self, 'common_keys')\n mapped = object.__getattribute__(self, 'mapped_keys')\n if key in mapped:\n lk, _ = mapped[key]\n if self._legacy:\n if lk is None:\n raise NotImplementedError\n self._legacy[lk] = value\n elif key not in ('commands', 'exports', 'modules', 'namespaces', 'classifiers'):\n self._data[key] = value\n else:\n # special cases for PEP 459\n d = self._data.setdefault('extensions', {})\n if key == 'commands':\n d['python.commands'] = value\n elif key == 'classifiers':\n d = d.setdefault('python.details', {})\n d[key] = value\n else:\n d = d.setdefault('python.exports', {})\n d[key] = value\n elif key not in common:\n object.__setattr__(self, key, value)\n else:\n if key == 'keywords':\n if isinstance(value, string_types):\n value = value.strip()\n if value:\n value = value.split()\n else:\n value = []\n if self._legacy:\n self._legacy[key] = value\n else:\n self._data[key] = value\n\n @property\n def name_and_version(self):\n return _get_name_and_version(self.name, self.version, True)\n\n @property\n def provides(self):\n if self._legacy:\n result = self._legacy['Provides-Dist']\n else:\n result = self._data.setdefault('provides', [])\n s = '%s (%s)' % (self.name, self.version)\n if s not in result:\n result.append(s)\n return result\n\n @provides.setter\n def provides(self, value):\n if self._legacy:\n self._legacy['Provides-Dist'] = value\n else:\n self._data['provides'] = value\n\n def get_requirements(self, reqts, extras=None, env=None):\n \"\"\"\n Base method to get dependencies, given a set of extras\n to satisfy and an optional environment context.\n :param reqts: A list of sometimes-wanted dependencies,\n perhaps dependent on extras and environment.\n :param extras: A list of optional components being requested.\n :param env: An optional environment for marker evaluation.\n \"\"\"\n if self._legacy:\n result = reqts\n else:\n result = []\n extras = get_extras(extras or [], self.extras)\n for d in reqts:\n if 'extra' not in d and 'environment' not in d:\n # unconditional\n include = True\n else:\n if 'extra' not in d:\n # Not extra-dependent - only environment-dependent\n include = True\n else:\n include = d.get('extra') in extras\n if include:\n # Not excluded because of extras, check environment\n marker = d.get('environment')\n if marker:\n include = interpret(marker, env)\n if include:\n result.extend(d['requires'])\n for key in ('build', 'dev', 'test'):\n e = ':%s:' % key\n if e in extras:\n extras.remove(e)\n # A recursive call, but it should terminate since 'test'\n # has been removed from the extras\n reqts = self._data.get('%s_requires' % key, [])\n result.extend(self.get_requirements(reqts, extras=extras, env=env))\n return result\n\n @property\n def dictionary(self):\n if self._legacy:\n return self._from_legacy()\n return self._data\n\n @property\n def dependencies(self):\n if self._legacy:\n raise NotImplementedError\n else:\n return extract_by_key(self._data, self.DEPENDENCY_KEYS)\n\n @dependencies.setter\n def dependencies(self, value):\n if self._legacy:\n raise NotImplementedError\n else:\n self._data.update(value)\n\n def _validate_mapping(self, mapping, scheme):\n if mapping.get('metadata_version') != self.METADATA_VERSION:\n raise MetadataUnrecognizedVersionError()\n missing = []\n for key, exclusions in self.MANDATORY_KEYS.items():\n if key not in mapping:\n if scheme not in exclusions:\n missing.append(key)\n if missing:\n msg = 'Missing metadata items: %s' % ', '.join(missing)\n raise MetadataMissingError(msg)\n for k, v in mapping.items():\n self._validate_value(k, v, scheme)\n\n def validate(self):\n if self._legacy:\n missing, warnings = self._legacy.check(True)\n if missing or warnings:\n logger.warning('Metadata: missing: %s, warnings: %s', missing, warnings)\n else:\n self._validate_mapping(self._data, self.scheme)\n\n def todict(self):\n if self._legacy:\n return self._legacy.todict(True)\n else:\n result = extract_by_key(self._data, self.INDEX_KEYS)\n return result\n\n def _from_legacy(self):\n assert self._legacy and not self._data\n result = {\n 'metadata_version': self.METADATA_VERSION,\n 'generator': self.GENERATOR,\n }\n lmd = self._legacy.todict(True) # skip missing ones\n for k in ('name', 'version', 'license', 'summary', 'description', 'classifier'):\n if k in lmd:\n if k == 'classifier':\n nk = 'classifiers'\n else:\n nk = k\n result[nk] = lmd[k]\n kw = lmd.get('Keywords', [])\n if kw == ['']:\n kw = []\n result['keywords'] = kw\n keys = (('requires_dist', 'run_requires'), ('setup_requires_dist', 'build_requires'))\n for ok, nk in keys:\n if ok in lmd and lmd[ok]:\n result[nk] = [{'requires': lmd[ok]}]\n result['provides'] = self.provides\n # author = {}\n # maintainer = {}\n return result\n\n LEGACY_MAPPING = {\n 'name': 'Name',\n 'version': 'Version',\n ('extensions', 'python.details', 'license'): 'License',\n 'summary': 'Summary',\n 'description': 'Description',\n ('extensions', 'python.project', 'project_urls', 'Home'): 'Home-page',\n ('extensions', 'python.project', 'contacts', 0, 'name'): 'Author',\n ('extensions', 'python.project', 'contacts', 0, 'email'): 'Author-email',\n 'source_url': 'Download-URL',\n ('extensions', 'python.details', 'classifiers'): 'Classifier',\n }\n\n def _to_legacy(self):\n\n def process_entries(entries):\n reqts = set()\n for e in entries:\n extra = e.get('extra')\n env = e.get('environment')\n rlist = e['requires']\n for r in rlist:\n if not env and not extra:\n reqts.add(r)\n else:\n marker = ''\n if extra:\n marker = 'extra == \"%s\"' % extra\n if env:\n if marker:\n marker = '(%s) and %s' % (env, marker)\n else:\n marker = env\n reqts.add(';'.join((r, marker)))\n return reqts\n\n assert self._data and not self._legacy\n result = LegacyMetadata()\n nmd = self._data\n # import pdb; pdb.set_trace()\n for nk, ok in self.LEGACY_MAPPING.items():\n if not isinstance(nk, tuple):\n if nk in nmd:\n result[ok] = nmd[nk]\n else:\n d = nmd\n found = True\n for k in nk:\n try:\n d = d[k]\n except (KeyError, IndexError):\n found = False\n break\n if found:\n result[ok] = d\n r1 = process_entries(self.run_requires + self.meta_requires)\n r2 = process_entries(self.build_requires + self.dev_requires)\n if self.extras:\n result['Provides-Extra'] = sorted(self.extras)\n result['Requires-Dist'] = sorted(r1)\n result['Setup-Requires-Dist'] = sorted(r2)\n # TODO: any other fields wanted\n return result\n\n def write(self, path=None, fileobj=None, legacy=False, skip_unknown=True):\n if [path, fileobj].count(None) != 1:\n raise ValueError('Exactly one of path and fileobj is needed')\n self.validate()\n if legacy:\n if self._legacy:\n legacy_md = self._legacy\n else:\n legacy_md = self._to_legacy()\n if path:\n legacy_md.write(path, skip_unknown=skip_unknown)\n else:\n legacy_md.write_file(fileobj, skip_unknown=skip_unknown)\n else:\n if self._legacy:\n d = self._from_legacy()\n else:\n d = self._data\n if fileobj:\n json.dump(d, fileobj, ensure_ascii=True, indent=2, sort_keys=True)\n else:\n with codecs.open(path, 'w', 'utf-8') as f:\n json.dump(d, f, ensure_ascii=True, indent=2, sort_keys=True)\n\n def add_requirements(self, requirements):\n if self._legacy:\n self._legacy.add_requirements(requirements)\n else:\n run_requires = self._data.setdefault('run_requires', [])\n always = None\n for entry in run_requires:\n if 'environment' not in entry and 'extra' not in entry:\n always = entry\n break\n if always is None:\n always = {'requires': requirements}\n run_requires.insert(0, always)\n else:\n rset = set(always['requires']) | set(requirements)\n always['requires'] = sorted(rset)\n\n def __repr__(self):\n name = self.name or '(no name)'\n version = self.version or 'no version'\n return '<%s %s %s (%s)>' % (self.__class__.__name__, self.metadata_version, name, version)\n",[],[100,509,516,523,475,1961,2183,1296],{"_104":2257,"_96":2258,"_158":2259,"_160":2184,"_161":139,"_162":2260,"_164":165,"_106":2261,"_101":29,"_167":215,"_169":2262,"_170":25,"_171":-5,"_172":2263,"_99":2264},"0980670e-67fc-11f0-bcbe-0224a6c84d84","resources.py","098067c2-67fc-11f0-bcbe-0224a6c84d84",341,["D",1753299263711],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2017 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom __future__ import unicode_literals\n\nimport bisect\nimport io\nimport logging\nimport os\nimport pkgutil\nimport sys\nimport types\nimport zipimport\n\nfrom . import DistlibException\nfrom .util import cached_property, get_cache_base, Cache\n\nlogger = logging.getLogger(__name__)\n\n\ncache = None # created when needed\n\n\nclass ResourceCache(Cache):\n def __init__(self, base=None):\n if base is None:\n # Use native string to avoid issues on 2.x: see Python #20140.\n base = os.path.join(get_cache_base(), str('resource-cache'))\n super(ResourceCache, self).__init__(base)\n\n def is_stale(self, resource, path):\n \"\"\"\n Is the cache stale for the given resource?\n\n :param resource: The :class:`Resource` being cached.\n :param path: The path of the resource in the cache.\n :return: True if the cache is stale.\n \"\"\"\n # Cache invalidation is a hard problem :-)\n return True\n\n def get(self, resource):\n \"\"\"\n Get a resource into the cache,\n\n :param resource: A :class:`Resource` instance.\n :return: The pathname of the resource in the cache.\n \"\"\"\n prefix, path = resource.finder.get_cache_info(resource)\n if prefix is None:\n result = path\n else:\n result = os.path.join(self.base, self.prefix_to_dir(prefix), path)\n dirname = os.path.dirname(result)\n if not os.path.isdir(dirname):\n os.makedirs(dirname)\n if not os.path.exists(result):\n stale = True\n else:\n stale = self.is_stale(resource, path)\n if stale:\n # write the bytes of the resource to the cache location\n with open(result, 'wb') as f:\n f.write(resource.bytes)\n return result\n\n\nclass ResourceBase(object):\n def __init__(self, finder, name):\n self.finder = finder\n self.name = name\n\n\nclass Resource(ResourceBase):\n \"\"\"\n A class representing an in-package resource, such as a data file. This is\n not normally instantiated by user code, but rather by a\n :class:`ResourceFinder` which manages the resource.\n \"\"\"\n is_container = False # Backwards compatibility\n\n def as_stream(self):\n \"\"\"\n Get the resource as a stream.\n\n This is not a property to make it obvious that it returns a new stream\n each time.\n \"\"\"\n return self.finder.get_stream(self)\n\n @cached_property\n def file_path(self):\n global cache\n if cache is None:\n cache = ResourceCache()\n return cache.get(self)\n\n @cached_property\n def bytes(self):\n return self.finder.get_bytes(self)\n\n @cached_property\n def size(self):\n return self.finder.get_size(self)\n\n\nclass ResourceContainer(ResourceBase):\n is_container = True # Backwards compatibility\n\n @cached_property\n def resources(self):\n return self.finder.get_resources(self)\n\n\nclass ResourceFinder(object):\n \"\"\"\n Resource finder for file system resources.\n \"\"\"\n\n if sys.platform.startswith('java'):\n skipped_extensions = ('.pyc', '.pyo', '.class')\n else:\n skipped_extensions = ('.pyc', '.pyo')\n\n def __init__(self, module):\n self.module = module\n self.loader = getattr(module, '__loader__', None)\n self.base = os.path.dirname(getattr(module, '__file__', ''))\n\n def _adjust_path(self, path):\n return os.path.realpath(path)\n\n def _make_path(self, resource_name):\n # Issue #50: need to preserve type of path on Python 2.x\n # like os.path._get_sep\n if isinstance(resource_name, bytes): # should only happen on 2.x\n sep = b'/'\n else:\n sep = '/'\n parts = resource_name.split(sep)\n parts.insert(0, self.base)\n result = os.path.join(*parts)\n return self._adjust_path(result)\n\n def _find(self, path):\n return os.path.exists(path)\n\n def get_cache_info(self, resource):\n return None, resource.path\n\n def find(self, resource_name):\n path = self._make_path(resource_name)\n if not self._find(path):\n result = None\n else:\n if self._is_directory(path):\n result = ResourceContainer(self, resource_name)\n else:\n result = Resource(self, resource_name)\n result.path = path\n return result\n\n def get_stream(self, resource):\n return open(resource.path, 'rb')\n\n def get_bytes(self, resource):\n with open(resource.path, 'rb') as f:\n return f.read()\n\n def get_size(self, resource):\n return os.path.getsize(resource.path)\n\n def get_resources(self, resource):\n def allowed(f):\n return (f != '__pycache__' and not\n f.endswith(self.skipped_extensions))\n return set([f for f in os.listdir(resource.path) if allowed(f)])\n\n def is_container(self, resource):\n return self._is_directory(resource.path)\n\n _is_directory = staticmethod(os.path.isdir)\n\n def iterator(self, resource_name):\n resource = self.find(resource_name)\n if resource is not None:\n todo = [resource]\n while todo:\n resource = todo.pop(0)\n yield resource\n if resource.is_container:\n rname = resource.name\n for name in resource.resources:\n if not rname:\n new_name = name\n else:\n new_name = '/'.join([rname, name])\n child = self.find(new_name)\n if child.is_container:\n todo.append(child)\n else:\n yield child\n\n\nclass ZipResourceFinder(ResourceFinder):\n \"\"\"\n Resource finder for resources in .zip files.\n \"\"\"\n def __init__(self, module):\n super(ZipResourceFinder, self).__init__(module)\n archive = self.loader.archive\n self.prefix_len = 1 + len(archive)\n # PyPy doesn't have a _files attr on zipimporter, and you can't set one\n if hasattr(self.loader, '_files'):\n self._files = self.loader._files\n else:\n self._files = zipimport._zip_directory_cache[archive]\n self.index = sorted(self._files)\n\n def _adjust_path(self, path):\n return path\n\n def _find(self, path):\n path = path[self.prefix_len:]\n if path in self._files:\n result = True\n else:\n if path and path[-1] != os.sep:\n path = path + os.sep\n i = bisect.bisect(self.index, path)\n try:\n result = self.index[i].startswith(path)\n except IndexError:\n result = False\n if not result:\n logger.debug('_find failed: %r %r', path, self.loader.prefix)\n else:\n logger.debug('_find worked: %r %r', path, self.loader.prefix)\n return result\n\n def get_cache_info(self, resource):\n prefix = self.loader.archive\n path = resource.path[1 + len(prefix):]\n return prefix, path\n\n def get_bytes(self, resource):\n return self.loader.get_data(resource.path)\n\n def get_stream(self, resource):\n return io.BytesIO(self.get_bytes(resource))\n\n def get_size(self, resource):\n path = resource.path[self.prefix_len:]\n return self._files[path][3]\n\n def get_resources(self, resource):\n path = resource.path[self.prefix_len:]\n if path and path[-1] != os.sep:\n path += os.sep\n plen = len(path)\n result = set()\n i = bisect.bisect(self.index, path)\n while i < len(self.index):\n if not self.index[i].startswith(path):\n break\n s = self.index[i][plen:]\n result.add(s.split(os.sep, 1)[0]) # only immediate children\n i += 1\n return result\n\n def _is_directory(self, path):\n path = path[self.prefix_len:]\n if path and path[-1] != os.sep:\n path += os.sep\n i = bisect.bisect(self.index, path)\n try:\n result = self.index[i].startswith(path)\n except IndexError:\n result = False\n return result\n\n\n_finder_registry = {\n type(None): ResourceFinder,\n zipimport.zipimporter: ZipResourceFinder\n}\n\ntry:\n # In Python 3.6, _frozen_importlib -> _frozen_importlib_external\n try:\n import _frozen_importlib_external as _fi\n except ImportError:\n import _frozen_importlib as _fi\n _finder_registry[_fi.SourceFileLoader] = ResourceFinder\n _finder_registry[_fi.FileFinder] = ResourceFinder\n # See issue #146\n _finder_registry[_fi.SourcelessFileLoader] = ResourceFinder\n del _fi\nexcept (ImportError, AttributeError):\n pass\n\n\ndef register_finder(loader, finder_maker):\n _finder_registry[type(loader)] = finder_maker\n\n\n_finder_cache = {}\n\n\ndef finder(package):\n \"\"\"\n Return a resource finder for a package.\n :param package: The name of the package.\n :return: A :class:`ResourceFinder` instance for the package.\n \"\"\"\n if package in _finder_cache:\n result = _finder_cache[package]\n else:\n if package not in sys.modules:\n __import__(package)\n module = sys.modules[package]\n path = getattr(module, '__path__', None)\n if path is None:\n raise DistlibException('You cannot get a finder for a module, '\n 'only for a package')\n loader = getattr(module, '__loader__', None)\n finder_maker = _finder_registry.get(type(loader))\n if finder_maker is None:\n raise DistlibException('Unable to locate finder for %r' % package)\n result = finder_maker(module)\n _finder_cache[package] = result\n return result\n\n\n_dummy_module = types.ModuleType(str('__dummy__'))\n\n\ndef finder_for_path(path):\n \"\"\"\n Return a resource finder for a path, which should represent a container.\n\n :param path: The path.\n :return: A :class:`ResourceFinder` instance for the path.\n \"\"\"\n result = None\n # calls any path hooks, gets importer into cache\n pkgutil.get_importer(path)\n loader = sys.path_importer_cache.get(path)\n finder = _finder_registry.get(type(loader))\n if finder:\n module = _dummy_module\n module.__file__ = os.path.join(path, '')\n module.__loader__ = loader\n result = finder(module)\n return result\n",[],[100,509,516,523,475,1961,2183,2258],{"_104":2266,"_96":2267,"_158":2268,"_160":2184,"_161":139,"_162":2269,"_164":165,"_106":2270,"_101":29,"_167":215,"_169":2271,"_170":25,"_171":-5,"_172":2272,"_99":2273},"0984a3d2-67fc-11f0-aedf-0224a6c84d84","scripts.py","0984a49a-67fc-11f0-aedf-0224a6c84d84",342,["D",1753299263753],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom io import BytesIO\nimport logging\nimport os\nimport re\nimport struct\nimport sys\nimport time\nfrom zipfile import ZipInfo\n\nfrom .compat import sysconfig, detect_encoding, ZipFile\nfrom .resources import finder\nfrom .util import (FileOperator, get_export_entry, convert_path, get_executable, get_platform, in_venv)\n\nlogger = logging.getLogger(__name__)\n\n_DEFAULT_MANIFEST = '''\n\n\n \n\n \n \n \n \n \n \n \n \n'''.strip()\n\n# check if Python is called on the first line with this expression\nFIRST_LINE_RE = re.compile(b'^#!.*pythonw?[0-9.]*([ \\t].*)?$')\nSCRIPT_TEMPLATE = r'''# -*- coding: utf-8 -*-\nimport re\nimport sys\nfrom %(module)s import %(import_name)s\nif __name__ == '__main__':\n sys.argv[0] = re.sub(r'(-script\\.pyw|\\.exe)?$', '', sys.argv[0])\n sys.exit(%(func)s())\n'''\n\n# Pre-fetch the contents of all executable wrapper stubs.\n# This is to address https://github.com/pypa/pip/issues/12666.\n# When updating pip, we rename the old pip in place before installing the\n# new version. If we try to fetch a wrapper *after* that rename, the finder\n# machinery will be confused as the package is no longer available at the\n# location where it was imported from. So we load everything into memory in\n# advance.\n\nif os.name == 'nt' or (os.name == 'java' and os._name == 'nt'):\n # Issue 31: don't hardcode an absolute package name, but\n # determine it relative to the current package\n DISTLIB_PACKAGE = __name__.rsplit('.', 1)[0]\n\n WRAPPERS = {\n r.name: r.bytes\n for r in finder(DISTLIB_PACKAGE).iterator(\"\")\n if r.name.endswith(\".exe\")\n }\n\n\ndef enquote_executable(executable):\n if ' ' in executable:\n # make sure we quote only the executable in case of env\n # for example /usr/bin/env \"/dir with spaces/bin/jython\"\n # instead of \"/usr/bin/env /dir with spaces/bin/jython\"\n # otherwise whole\n if executable.startswith('/usr/bin/env '):\n env, _executable = executable.split(' ', 1)\n if ' ' in _executable and not _executable.startswith('\"'):\n executable = '%s \"%s\"' % (env, _executable)\n else:\n if not executable.startswith('\"'):\n executable = '\"%s\"' % executable\n return executable\n\n\n# Keep the old name around (for now), as there is at least one project using it!\n_enquote_executable = enquote_executable\n\n\nclass ScriptMaker(object):\n \"\"\"\n A class to copy or create scripts from source scripts or callable\n specifications.\n \"\"\"\n script_template = SCRIPT_TEMPLATE\n\n executable = None # for shebangs\n\n def __init__(self, source_dir, target_dir, add_launchers=True, dry_run=False, fileop=None):\n self.source_dir = source_dir\n self.target_dir = target_dir\n self.add_launchers = add_launchers\n self.force = False\n self.clobber = False\n # It only makes sense to set mode bits on POSIX.\n self.set_mode = (os.name == 'posix') or (os.name == 'java' and os._name == 'posix')\n self.variants = set(('', 'X.Y'))\n self._fileop = fileop or FileOperator(dry_run)\n\n self._is_nt = os.name == 'nt' or (os.name == 'java' and os._name == 'nt')\n self.version_info = sys.version_info\n\n def _get_alternate_executable(self, executable, options):\n if options.get('gui', False) and self._is_nt: # pragma: no cover\n dn, fn = os.path.split(executable)\n fn = fn.replace('python', 'pythonw')\n executable = os.path.join(dn, fn)\n return executable\n\n if sys.platform.startswith('java'): # pragma: no cover\n\n def _is_shell(self, executable):\n \"\"\"\n Determine if the specified executable is a script\n (contains a #! line)\n \"\"\"\n try:\n with open(executable) as fp:\n return fp.read(2) == '#!'\n except (OSError, IOError):\n logger.warning('Failed to open %s', executable)\n return False\n\n def _fix_jython_executable(self, executable):\n if self._is_shell(executable):\n # Workaround for Jython is not needed on Linux systems.\n import java\n\n if java.lang.System.getProperty('os.name') == 'Linux':\n return executable\n elif executable.lower().endswith('jython.exe'):\n # Use wrapper exe for Jython on Windows\n return executable\n return '/usr/bin/env %s' % executable\n\n def _build_shebang(self, executable, post_interp):\n \"\"\"\n Build a shebang line. In the simple case (on Windows, or a shebang line\n which is not too long or contains spaces) use a simple formulation for\n the shebang. Otherwise, use /bin/sh as the executable, with a contrived\n shebang which allows the script to run either under Python or sh, using\n suitable quoting. Thanks to Harald Nordgren for his input.\n\n See also: http://www.in-ulm.de/~mascheck/various/shebang/#length\n https://hg.mozilla.org/mozilla-central/file/tip/mach\n \"\"\"\n if os.name != 'posix':\n simple_shebang = True\n elif getattr(sys, \"cross_compiling\", False):\n # In a cross-compiling environment, the shebang will likely be a\n # script; this *must* be invoked with the \"safe\" version of the\n # shebang, or else using os.exec() to run the entry script will\n # fail, raising \"OSError 8 [Errno 8] Exec format error\".\n simple_shebang = False\n else:\n # Add 3 for '#!' prefix and newline suffix.\n shebang_length = len(executable) + len(post_interp) + 3\n if sys.platform == 'darwin':\n max_shebang_length = 512\n else:\n max_shebang_length = 127\n simple_shebang = ((b' ' not in executable) and (shebang_length <= max_shebang_length))\n\n if simple_shebang:\n result = b'#!' + executable + post_interp + b'\\n'\n else:\n result = b'#!/bin/sh\\n'\n result += b\"'''exec' \" + executable + post_interp + b' \"$0\" \"$@\"\\n'\n result += b\"' '''\\n\"\n return result\n\n def _get_shebang(self, encoding, post_interp=b'', options=None):\n enquote = True\n if self.executable:\n executable = self.executable\n enquote = False # assume this will be taken care of\n elif not sysconfig.is_python_build():\n executable = get_executable()\n elif in_venv(): # pragma: no cover\n executable = os.path.join(sysconfig.get_path('scripts'), 'python%s' % sysconfig.get_config_var('EXE'))\n else: # pragma: no cover\n if os.name == 'nt':\n # for Python builds from source on Windows, no Python executables with\n # a version suffix are created, so we use python.exe\n executable = os.path.join(sysconfig.get_config_var('BINDIR'),\n 'python%s' % (sysconfig.get_config_var('EXE')))\n else:\n executable = os.path.join(\n sysconfig.get_config_var('BINDIR'),\n 'python%s%s' % (sysconfig.get_config_var('VERSION'), sysconfig.get_config_var('EXE')))\n if options:\n executable = self._get_alternate_executable(executable, options)\n\n if sys.platform.startswith('java'): # pragma: no cover\n executable = self._fix_jython_executable(executable)\n\n # Normalise case for Windows - COMMENTED OUT\n # executable = os.path.normcase(executable)\n # N.B. The normalising operation above has been commented out: See\n # issue #124. Although paths in Windows are generally case-insensitive,\n # they aren't always. For example, a path containing a ẞ (which is a\n # LATIN CAPITAL LETTER SHARP S - U+1E9E) is normcased to ß (which is a\n # LATIN SMALL LETTER SHARP S' - U+00DF). The two are not considered by\n # Windows as equivalent in path names.\n\n # If the user didn't specify an executable, it may be necessary to\n # cater for executable paths with spaces (not uncommon on Windows)\n if enquote:\n executable = enquote_executable(executable)\n # Issue #51: don't use fsencode, since we later try to\n # check that the shebang is decodable using utf-8.\n executable = executable.encode('utf-8')\n # in case of IronPython, play safe and enable frames support\n if (sys.platform == 'cli' and '-X:Frames' not in post_interp and\n '-X:FullFrames' not in post_interp): # pragma: no cover\n post_interp += b' -X:Frames'\n shebang = self._build_shebang(executable, post_interp)\n # Python parser starts to read a script using UTF-8 until\n # it gets a #coding:xxx cookie. The shebang has to be the\n # first line of a file, the #coding:xxx cookie cannot be\n # written before. So the shebang has to be decodable from\n # UTF-8.\n try:\n shebang.decode('utf-8')\n except UnicodeDecodeError: # pragma: no cover\n raise ValueError('The shebang (%r) is not decodable from utf-8' % shebang)\n # If the script is encoded to a custom encoding (use a\n # #coding:xxx cookie), the shebang has to be decodable from\n # the script encoding too.\n if encoding != 'utf-8':\n try:\n shebang.decode(encoding)\n except UnicodeDecodeError: # pragma: no cover\n raise ValueError('The shebang (%r) is not decodable '\n 'from the script encoding (%r)' % (shebang, encoding))\n return shebang\n\n def _get_script_text(self, entry):\n return self.script_template % dict(\n module=entry.prefix, import_name=entry.suffix.split('.')[0], func=entry.suffix)\n\n manifest = _DEFAULT_MANIFEST\n\n def get_manifest(self, exename):\n base = os.path.basename(exename)\n return self.manifest % base\n\n def _write_script(self, names, shebang, script_bytes, filenames, ext):\n use_launcher = self.add_launchers and self._is_nt\n if not use_launcher:\n script_bytes = shebang + script_bytes\n else: # pragma: no cover\n if ext == 'py':\n launcher = self._get_launcher('t')\n else:\n launcher = self._get_launcher('w')\n stream = BytesIO()\n with ZipFile(stream, 'w') as zf:\n source_date_epoch = os.environ.get('SOURCE_DATE_EPOCH')\n if source_date_epoch:\n date_time = time.gmtime(int(source_date_epoch))[:6]\n zinfo = ZipInfo(filename='__main__.py', date_time=date_time)\n zf.writestr(zinfo, script_bytes)\n else:\n zf.writestr('__main__.py', script_bytes)\n zip_data = stream.getvalue()\n script_bytes = launcher + shebang + zip_data\n for name in names:\n outname = os.path.join(self.target_dir, name)\n if use_launcher: # pragma: no cover\n n, e = os.path.splitext(outname)\n if e.startswith('.py'):\n outname = n\n outname = '%s.exe' % outname\n try:\n self._fileop.write_binary_file(outname, script_bytes)\n except Exception:\n # Failed writing an executable - it might be in use.\n logger.warning('Failed to write executable - trying to '\n 'use .deleteme logic')\n dfname = '%s.deleteme' % outname\n if os.path.exists(dfname):\n os.remove(dfname) # Not allowed to fail here\n os.rename(outname, dfname) # nor here\n self._fileop.write_binary_file(outname, script_bytes)\n logger.debug('Able to replace executable using '\n '.deleteme logic')\n try:\n os.remove(dfname)\n except Exception:\n pass # still in use - ignore error\n else:\n if self._is_nt and not outname.endswith('.' + ext): # pragma: no cover\n outname = '%s.%s' % (outname, ext)\n if os.path.exists(outname) and not self.clobber:\n logger.warning('Skipping existing file %s', outname)\n continue\n self._fileop.write_binary_file(outname, script_bytes)\n if self.set_mode:\n self._fileop.set_executable_mode([outname])\n filenames.append(outname)\n\n variant_separator = '-'\n\n def get_script_filenames(self, name):\n result = set()\n if '' in self.variants:\n result.add(name)\n if 'X' in self.variants:\n result.add('%s%s' % (name, self.version_info[0]))\n if 'X.Y' in self.variants:\n result.add('%s%s%s.%s' % (name, self.variant_separator, self.version_info[0], self.version_info[1]))\n return result\n\n def _make_script(self, entry, filenames, options=None):\n post_interp = b''\n if options:\n args = options.get('interpreter_args', [])\n if args:\n args = ' %s' % ' '.join(args)\n post_interp = args.encode('utf-8')\n shebang = self._get_shebang('utf-8', post_interp, options=options)\n script = self._get_script_text(entry).encode('utf-8')\n scriptnames = self.get_script_filenames(entry.name)\n if options and options.get('gui', False):\n ext = 'pyw'\n else:\n ext = 'py'\n self._write_script(scriptnames, shebang, script, filenames, ext)\n\n def _copy_script(self, script, filenames):\n adjust = False\n script = os.path.join(self.source_dir, convert_path(script))\n outname = os.path.join(self.target_dir, os.path.basename(script))\n if not self.force and not self._fileop.newer(script, outname):\n logger.debug('not copying %s (up-to-date)', script)\n return\n\n # Always open the file, but ignore failures in dry-run mode --\n # that way, we'll get accurate feedback if we can read the\n # script.\n try:\n f = open(script, 'rb')\n except IOError: # pragma: no cover\n if not self.dry_run:\n raise\n f = None\n else:\n first_line = f.readline()\n if not first_line: # pragma: no cover\n logger.warning('%s is an empty file (skipping)', script)\n return\n\n match = FIRST_LINE_RE.match(first_line.replace(b'\\r\\n', b'\\n'))\n if match:\n adjust = True\n post_interp = match.group(1) or b''\n\n if not adjust:\n if f:\n f.close()\n self._fileop.copy_file(script, outname)\n if self.set_mode:\n self._fileop.set_executable_mode([outname])\n filenames.append(outname)\n else:\n logger.info('copying and adjusting %s -> %s', script, self.target_dir)\n if not self._fileop.dry_run:\n encoding, lines = detect_encoding(f.readline)\n f.seek(0)\n shebang = self._get_shebang(encoding, post_interp)\n if b'pythonw' in first_line: # pragma: no cover\n ext = 'pyw'\n else:\n ext = 'py'\n n = os.path.basename(outname)\n self._write_script([n], shebang, f.read(), filenames, ext)\n if f:\n f.close()\n\n @property\n def dry_run(self):\n return self._fileop.dry_run\n\n @dry_run.setter\n def dry_run(self, value):\n self._fileop.dry_run = value\n\n if os.name == 'nt' or (os.name == 'java' and os._name == 'nt'): # pragma: no cover\n # Executable launcher support.\n # Launchers are from https://bitbucket.org/vinay.sajip/simple_launcher/\n\n def _get_launcher(self, kind):\n if struct.calcsize('P') == 8: # 64-bit\n bits = '64'\n else:\n bits = '32'\n platform_suffix = '-arm' if get_platform() == 'win-arm64' else ''\n name = '%s%s%s.exe' % (kind, bits, platform_suffix)\n if name not in WRAPPERS:\n msg = ('Unable to find resource %s in package %s' %\n (name, DISTLIB_PACKAGE))\n raise ValueError(msg)\n return WRAPPERS[name]\n\n # Public API follows\n\n def make(self, specification, options=None):\n \"\"\"\n Make a script.\n\n :param specification: The specification, which is either a valid export\n entry specification (to make a script from a\n callable) or a filename (to make a script by\n copying from a source location).\n :param options: A dictionary of options controlling script generation.\n :return: A list of all absolute pathnames written to.\n \"\"\"\n filenames = []\n entry = get_export_entry(specification)\n if entry is None:\n self._copy_script(specification, filenames)\n else:\n self._make_script(entry, filenames, options=options)\n return filenames\n\n def make_multiple(self, specifications, options=None):\n \"\"\"\n Take a list of specifications and make scripts from them,\n :param specifications: A list of specifications.\n :return: A list of all absolute pathnames written to,\n \"\"\"\n filenames = []\n for specification in specifications:\n filenames.extend(self.make(specification, options))\n return filenames\n",[],[100,509,516,523,475,1961,2183,2267],{"_104":2275,"_96":2276,"_158":2277,"_160":2184,"_161":139,"_162":2278,"_164":165,"_106":2279,"_101":29,"_167":215,"_169":2280,"_170":25,"_171":-5,"_172":2281,"_99":2282},"096d6b7c-67fc-11f0-a7d9-0224a6c84d84","util.py","096d6c44-67fc-11f0-a7d9-0224a6c84d84",338,["D",1753299263574],"#\n# Copyright (C) 2012-2023 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nimport codecs\nfrom collections import deque\nimport contextlib\nimport csv\nfrom glob import iglob as std_iglob\nimport io\nimport json\nimport logging\nimport os\nimport py_compile\nimport re\nimport socket\ntry:\n import ssl\nexcept ImportError: # pragma: no cover\n ssl = None\nimport subprocess\nimport sys\nimport tarfile\nimport tempfile\nimport textwrap\n\ntry:\n import threading\nexcept ImportError: # pragma: no cover\n import dummy_threading as threading\nimport time\n\nfrom . import DistlibException\nfrom .compat import (string_types, text_type, shutil, raw_input, StringIO, cache_from_source, urlopen, urljoin, httplib,\n xmlrpclib, HTTPHandler, BaseConfigurator, valid_ident, Container, configparser, URLError, ZipFile,\n fsdecode, unquote, urlparse)\n\nlogger = logging.getLogger(__name__)\n\n#\n# Requirement parsing code as per PEP 508\n#\n\nIDENTIFIER = re.compile(r'^([\\w\\.-]+)\\s*')\nVERSION_IDENTIFIER = re.compile(r'^([\\w\\.*+-]+)\\s*')\nCOMPARE_OP = re.compile(r'^(<=?|>=?|={2,3}|[~!]=)\\s*')\nMARKER_OP = re.compile(r'^((<=?)|(>=?)|={2,3}|[~!]=|in|not\\s+in)\\s*')\nOR = re.compile(r'^or\\b\\s*')\nAND = re.compile(r'^and\\b\\s*')\nNON_SPACE = re.compile(r'(\\S+)\\s*')\nSTRING_CHUNK = re.compile(r'([\\s\\w\\.{}()*+#:;,/?!~`@$%^&=|<>\\[\\]-]+)')\n\n\ndef parse_marker(marker_string):\n \"\"\"\n Parse a marker string and return a dictionary containing a marker expression.\n\n The dictionary will contain keys \"op\", \"lhs\" and \"rhs\" for non-terminals in\n the expression grammar, or strings. A string contained in quotes is to be\n interpreted as a literal string, and a string not contained in quotes is a\n variable (such as os_name).\n \"\"\"\n\n def marker_var(remaining):\n # either identifier, or literal string\n m = IDENTIFIER.match(remaining)\n if m:\n result = m.groups()[0]\n remaining = remaining[m.end():]\n elif not remaining:\n raise SyntaxError('unexpected end of input')\n else:\n q = remaining[0]\n if q not in '\\'\"':\n raise SyntaxError('invalid expression: %s' % remaining)\n oq = '\\'\"'.replace(q, '')\n remaining = remaining[1:]\n parts = [q]\n while remaining:\n # either a string chunk, or oq, or q to terminate\n if remaining[0] == q:\n break\n elif remaining[0] == oq:\n parts.append(oq)\n remaining = remaining[1:]\n else:\n m = STRING_CHUNK.match(remaining)\n if not m:\n raise SyntaxError('error in string literal: %s' % remaining)\n parts.append(m.groups()[0])\n remaining = remaining[m.end():]\n else:\n s = ''.join(parts)\n raise SyntaxError('unterminated string: %s' % s)\n parts.append(q)\n result = ''.join(parts)\n remaining = remaining[1:].lstrip() # skip past closing quote\n return result, remaining\n\n def marker_expr(remaining):\n if remaining and remaining[0] == '(':\n result, remaining = marker(remaining[1:].lstrip())\n if remaining[0] != ')':\n raise SyntaxError('unterminated parenthesis: %s' % remaining)\n remaining = remaining[1:].lstrip()\n else:\n lhs, remaining = marker_var(remaining)\n while remaining:\n m = MARKER_OP.match(remaining)\n if not m:\n break\n op = m.groups()[0]\n remaining = remaining[m.end():]\n rhs, remaining = marker_var(remaining)\n lhs = {'op': op, 'lhs': lhs, 'rhs': rhs}\n result = lhs\n return result, remaining\n\n def marker_and(remaining):\n lhs, remaining = marker_expr(remaining)\n while remaining:\n m = AND.match(remaining)\n if not m:\n break\n remaining = remaining[m.end():]\n rhs, remaining = marker_expr(remaining)\n