[{"_1":2,"_3":-5,"_4":-5},"loaderData",{"_5":6,"_7":8,"_9":10},"actionData","errors","root",{"_3734":3735,"_3736":3737},"routes/_app.x.$handle.$name",{"_98":97,"_31":43,"_106":84,"_26":107,"_13":14,"_108":-5,"_11":109,"_110":111,"_112":113,"_114":115,"_116":117,"_20":-5,"_118":119,"_120":121,"_122":24,"_123":124,"_125":56,"_126":-5,"_127":-5,"_128":129},"routes/_app.x.$handle.$name.branch.$branch.version.$version.diff",{"_11":12,"_13":14,"_15":16,"_17":-5,"_18":-5},"project",{"_41":42,"_31":43,"_36":44,"_45":-5,"_46":24,"_47":48,"_49":48,"_50":-5,"_51":-5,"_18":52,"_53":54,"_55":56,"_57":56,"_58":-5,"_59":60,"_61":62,"_63":-5,"_64":-5,"_65":-5,"_66":-5,"_67":68,"_69":68,"_70":71,"_72":71,"_73":71,"_74":68,"_75":68,"_76":77,"_78":79,"_80":81,"_82":24},"version",421,"changes",[19],"aiChatInfo","userId",{"_20":21,"_22":-7,"_23":24,"_25":24,"_26":27,"_28":27},"file",{"_29":30,"_31":32,"_33":20,"_34":35,"_36":37,"_38":14,"_39":40,"_23":24},"previous","deleted",false,"deletedHere","path",".venv/lib/python3.13/site-packages/pip/_vendor/rich/control.py","latestPath","fileId","0b7a149c-67fc-11f0-bcbe-0224a6c84d84","name","control.py","fileType","content","import sys\nimport time\nfrom typing import TYPE_CHECKING, Callable, Dict, Iterable, List, Union\n\nif sys.version_info >= (3, 8):\n from typing import Final\nelse:\n from pip._vendor.typing_extensions import Final # pragma: no cover\n\nfrom .segment import ControlCode, ControlType, Segment\n\nif TYPE_CHECKING:\n from .console import Console, ConsoleOptions, RenderResult\n\nSTRIP_CONTROL_CODES: Final = [\n 7, # Bell\n 8, # Backspace\n 11, # Vertical tab\n 12, # Form feed\n 13, # Carriage return\n]\n_CONTROL_STRIP_TRANSLATE: Final = {\n _codepoint: None for _codepoint in STRIP_CONTROL_CODES\n}\n\nCONTROL_ESCAPE: Final = {\n 7: \"\\\\a\",\n 8: \"\\\\b\",\n 11: \"\\\\v\",\n 12: \"\\\\f\",\n 13: \"\\\\r\",\n}\n\nCONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = {\n ControlType.BELL: lambda: \"\\x07\",\n ControlType.CARRIAGE_RETURN: lambda: \"\\r\",\n ControlType.HOME: lambda: \"\\x1b[H\",\n ControlType.CLEAR: lambda: \"\\x1b[2J\",\n ControlType.ENABLE_ALT_SCREEN: lambda: \"\\x1b[?1049h\",\n ControlType.DISABLE_ALT_SCREEN: lambda: \"\\x1b[?1049l\",\n ControlType.SHOW_CURSOR: lambda: \"\\x1b[?25h\",\n ControlType.HIDE_CURSOR: lambda: \"\\x1b[?25l\",\n ControlType.CURSOR_UP: lambda param: f\"\\x1b[{param}A\",\n ControlType.CURSOR_DOWN: lambda param: f\"\\x1b[{param}B\",\n ControlType.CURSOR_FORWARD: lambda param: f\"\\x1b[{param}C\",\n ControlType.CURSOR_BACKWARD: lambda param: f\"\\x1b[{param}D\",\n ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f\"\\x1b[{param+1}G\",\n ControlType.ERASE_IN_LINE: lambda param: f\"\\x1b[{param}K\",\n ControlType.CURSOR_MOVE_TO: lambda x, y: f\"\\x1b[{y+1};{x+1}H\",\n ControlType.SET_WINDOW_TITLE: lambda title: f\"\\x1b]0;{title}\\x07\",\n}\n\n\nclass Control:\n \"\"\"A renderable that inserts a control code (non printable but may move cursor).\n\n Args:\n *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a\n tuple of ControlType and an integer parameter\n \"\"\"\n\n __slots__ = [\"segment\"]\n\n def __init__(self, *codes: Union[ControlType, ControlCode]) -> None:\n control_codes: List[ControlCode] = [\n (code,) if isinstance(code, ControlType) else code for code in codes\n ]\n _format_map = CONTROL_CODES_FORMAT\n rendered_codes = \"\".join(\n _format_map[code](*parameters) for code, *parameters in control_codes\n )\n self.segment = Segment(rendered_codes, None, control_codes)\n\n @classmethod\n def bell(cls) -> \"Control\":\n \"\"\"Ring the 'bell'.\"\"\"\n return cls(ControlType.BELL)\n\n @classmethod\n def home(cls) -> \"Control\":\n \"\"\"Move cursor to 'home' position.\"\"\"\n return cls(ControlType.HOME)\n\n @classmethod\n def move(cls, x: int = 0, y: int = 0) -> \"Control\":\n \"\"\"Move cursor relative to current position.\n\n Args:\n x (int): X offset.\n y (int): Y offset.\n\n Returns:\n ~Control: Control object.\n\n \"\"\"\n\n def get_codes() -> Iterable[ControlCode]:\n control = ControlType\n if x:\n yield (\n control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD,\n abs(x),\n )\n if y:\n yield (\n control.CURSOR_DOWN if y > 0 else control.CURSOR_UP,\n abs(y),\n )\n\n control = cls(*get_codes())\n return control\n\n @classmethod\n def move_to_column(cls, x: int, y: int = 0) -> \"Control\":\n \"\"\"Move to the given column, optionally add offset to row.\n\n Returns:\n x (int): absolute x (column)\n y (int): optional y offset (row)\n\n Returns:\n ~Control: Control object.\n \"\"\"\n\n return (\n cls(\n (ControlType.CURSOR_MOVE_TO_COLUMN, x),\n (\n ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP,\n abs(y),\n ),\n )\n if y\n else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x))\n )\n\n @classmethod\n def move_to(cls, x: int, y: int) -> \"Control\":\n \"\"\"Move cursor to absolute position.\n\n Args:\n x (int): x offset (column)\n y (int): y offset (row)\n\n Returns:\n ~Control: Control object.\n \"\"\"\n return cls((ControlType.CURSOR_MOVE_TO, x, y))\n\n @classmethod\n def clear(cls) -> \"Control\":\n \"\"\"Clear the screen.\"\"\"\n return cls(ControlType.CLEAR)\n\n @classmethod\n def show_cursor(cls, show: bool) -> \"Control\":\n \"\"\"Show or hide the cursor.\"\"\"\n return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR)\n\n @classmethod\n def alt_screen(cls, enable: bool) -> \"Control\":\n \"\"\"Enable or disable alt screen.\"\"\"\n if enable:\n return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME)\n else:\n return cls(ControlType.DISABLE_ALT_SCREEN)\n\n @classmethod\n def title(cls, title: str) -> \"Control\":\n \"\"\"Set the terminal window title\n\n Args:\n title (str): The new terminal window title\n \"\"\"\n return cls((ControlType.SET_WINDOW_TITLE, title))\n\n def __str__(self) -> str:\n return self.segment.text\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n if self.segment.text:\n yield self.segment\n\n\ndef strip_control_codes(\n text: str, _translate_table: Dict[int, None] = _CONTROL_STRIP_TRANSLATE\n) -> str:\n \"\"\"Remove control codes from text.\n\n Args:\n text (str): A string possibly contain control codes.\n\n Returns:\n str: String with control codes removed.\n \"\"\"\n return text.translate(_translate_table)\n\n\ndef escape_control_codes(\n text: str,\n _translate_table: Dict[int, str] = CONTROL_ESCAPE,\n) -> str:\n \"\"\"Replace control codes with their \"escaped\" equivalent in the given text.\n (e.g. \"\\b\" becomes \"\\\\b\")\n\n Args:\n text (str): A string possibly containing control codes.\n\n Returns:\n str: String with control codes replaced with their escaped version.\n \"\"\"\n return text.translate(_translate_table)\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from pip._vendor.rich.console import Console\n\n console = Console()\n console.print(\"Look at the title of your terminal window ^\")\n # console.print(Control((ControlType.SET_WINDOW_TITLE, \"Hello, world!\")))\n for i in range(10):\n console.set_window_title(\"🚀 Loading\" + \".\" * i)\n time.sleep(0.5)\n","createdAt",["D",1753299267039],"branchVersion","branchId","9152d4b2-67ef-11f0-97a8-0224a6c84d84","id","91500c1e-67ef-11f0-97a8-0224a6c84d84","aita",["D",1753293908093],"deletedAt","legacyEnvVars","privacy","public","httpPrivacy","description","imageUrl","01983870-a3b2-73c9-9a1d-1aa63e70e1b2","pinnedFileId","01983875-e8ca-7735-b93b-be439ff044a2","pinPreview",true,"pinMigrated","screenshotVersion","likeCount",1,"orgId","01983870-a3b2-73c9-9a1d-1f44dda566fd","tursoName","tursoHostname","tursoMeasuredAt","pinned","userPerm","r","valPerm","blobPerm","rw","emailPerm","sqlitePerm","projectPerm","telemetryPerm","user",{"_98":97,"_105":101},"org",{"_98":97,"_99":-5,"_100":101,"_18":52,"_102":103,"_104":24},"branch",{"_13":83,"_31":84,"_41":40,"_85":42,"_86":87,"_88":89,"_90":48,"_91":92,"_93":94,"_95":43,"_96":97},"isOwned",559,"main","projectId","forkedBranchId","961078ea-f528-11ef-aa68-569c3dd06744","forkedBranchVersion",67,"forkedProjectPrivacy","forkedProjectId","96102714-f528-11ef-aa68-569c3dd06744","forkedProjectOrgId","019aa807-52c2-709c-928b-2029bae9a558","projectName","userHandle","joost","handle","displayName","avatar","https://img.clerk.com/eyJ0eXBlIjoicHJveHkiLCJzcmMiOiJodHRwczovL2ltYWdlcy5jbGVyay5kZXYvb2F1dGhfZ2l0aHViL2ltZ18zMEhucWlWR2JJOWNvaGtVRnUzaGZGM21xYWoifQ","tier","free","canRestrictVals","profileImageUrl","branchName","","adoptOrgId",{"_41":42,"_31":43,"_36":3730,"_45":-5,"_46":24,"_47":48,"_49":48,"_50":-5,"_51":-5,"_18":52,"_53":54,"_55":56,"_57":56,"_58":-5,"_59":60,"_61":62,"_63":-5,"_64":-5,"_65":-5,"_66":-5,"_67":68,"_69":68,"_70":71,"_72":71,"_73":71,"_74":68,"_75":68,"_76":3731,"_78":3732,"_80":3733,"_82":24},"tree",[236,255,628,632,633,634,642,646,647,648,649],"files",[236,237,238,239,240,241,242,243,244,245,246,247,248,249,250,251,252,253,254,255,256,257,258,259,260,261,262,263,264,265,266,267,268,269,270,271,272,273,274,275,276,277,278,279,280,281,282,283,284,285,286,287,288,289,290,291,292,293,294,295,296,297,298,299,300,301,302,303,304,305,306,307,308,309,310,311,312,313,314,315,316,317,318,319,320,321,322,323,324,325,326,327,328,329,330,331,332,333,334,335,336,337,338,339,340,341,342,343,344,345,346,347,348,349,350,351,352,353,354,355,356,357,358,359,360,361,362,363,364,365,366,367,368,369,370,371,372,373,374,375,376,377,378,379,380,381,382,383,384,385,386,387,388,389,390,391,392,393,394,395,396,397,398,399,400,401,402,403,404,405,406,407,408,409,410,411,412,413,414,415,416,417,418,419,420,421,422,423,424,425,426,427,428,429,430,431,432,433,434,435,436,437,438,439,440,441,442,443,444,445,446,447,448,449,450,451,452,453,454,455,456,457,458,459,460,461,462,463,464,465,466,467,468,469,470,471,472,473,474,475,476,477,478,479,480,481,482,483,484,485,486,487,488,489,490,491,492,493,494,495,496,497,498,499,500,501,502,503,504,505,506,507,508,509,510,511,512,513,514,515,516,517,518,519,520,521,522,523,524,525,526,527,528,529,530,531,532,533,534,535,536,537,538,539,540,541,542,543,544,545,546,547,548,549,550,551,552,553,554,555,556,557,558,559,560,561,562,563,564,565,566,567,568,569,570,571,572,573,574,575,576,577,578,579,580,581,582,583,584,585,586,587,588,589,590,591,592,593,594,595,596,597,598,599,600,601,602,603,604,605,606,607,608,609,610,611,612,613,614,615,616,617,618,619,620,621,622,623,624,625,626,627,628,629,630,631,632,633,634,635,636,637,638,639,640,641,642,643,644,645,646,647,648,649],"counts",{"_226":160,"_227":60,"_228":160,"_229":230,"_231":232},"contents",[142,143,144,145,146,147,148,149,150,151,152],"upstreamProject",{"_41":92,"_31":137,"_50":138,"_51":139,"_47":48,"_76":140},"upstreamBranch",{"_41":87,"_36":130,"_131":132,"_31":84,"_85":92,"_13":133,"_86":-5,"_88":-5,"_134":135,"_45":-5,"_82":24,"_47":48,"_96":136,"_61":94,"_95":137},"emptyEnvVars","flags",[],"hasHttpFiles","grants","orgs","customDomains",{},["D",1740674013689],"updatedAt",["D",1785420707976],91,"lockfileKey","1785420708123-esm.town_v_templates_react-hono-starter@91-main","templates","react-hono-starter","Starter template with client-side React & Hono server","https://imagedelivery.net/iHX6Ovru0O7AjmyT5yZRoA/64dc00cc-94d9-47dd-81b1-dde02610d900/square512?exp=1789733035&sig=c5828570fe1032e72fd25a08821d6d734ce70dd62f42acecd054fc0c91bec955",{"_98":136,"_105":141},"https://imagedelivery.net/iHX6Ovru0O7AjmyT5yZRoA/129cab32-3bd7-4c3e-f39b-f12900c76100/square512?exp=1789733035&sig=513051de8508f3df7ca30b44c747086933fee593bc3bf7e7d31779fcf4483e0c",{"_41":221,"_31":222,"_29":223,"_156":-5,"_39":40,"_38":176,"_158":56,"_36":224,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":225},{"_41":215,"_31":216,"_29":217,"_156":-5,"_39":40,"_38":218,"_158":56,"_36":219,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":220},{"_41":210,"_31":211,"_29":212,"_156":-5,"_39":40,"_38":60,"_158":56,"_36":213,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":214},{"_41":204,"_31":205,"_29":206,"_156":-5,"_39":40,"_38":207,"_158":24,"_36":208,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":209},{"_41":198,"_31":199,"_29":200,"_156":-5,"_39":40,"_38":201,"_158":56,"_36":202,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":203},{"_41":193,"_31":194,"_29":195,"_156":-5,"_39":40,"_38":60,"_158":56,"_36":196,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":197},{"_41":186,"_31":187,"_29":188,"_156":-5,"_39":40,"_38":189,"_158":56,"_36":190,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_26":192},{"_41":179,"_31":180,"_29":181,"_156":-5,"_39":40,"_38":182,"_158":24,"_36":183,"_13":176,"_33":20,"_34":184,"_23":24,"_162":-5,"_26":185},{"_41":171,"_31":172,"_29":173,"_156":-5,"_39":40,"_38":174,"_158":24,"_36":175,"_13":176,"_33":20,"_34":177,"_23":24,"_162":-5,"_26":178},{"_41":164,"_31":165,"_29":166,"_156":-5,"_39":40,"_38":167,"_158":56,"_36":168,"_13":60,"_33":20,"_34":169,"_23":24,"_162":-5,"_26":170},{"_41":153,"_31":154,"_29":155,"_156":-5,"_39":40,"_38":157,"_158":56,"_36":159,"_13":160,"_33":20,"_34":161,"_23":24,"_162":-5,"_26":163},"c6b532c8-67f2-11f0-97a0-0224a6c84d84","deno.json","c6b53372-67f2-11f0-97a0-0224a6c84d84","parentId",5,"latest",["D",1753295286180],0,"{\n \"$schema\": \"https://raw.githubusercontent.com/denoland/deno/348900b8b79f4a434cab4c74b3bc8d4d2fa8ee74/cli/schemas/config-file.v1.json\",\n \"lock\": false,\n \"compilerOptions\": {\n \"noImplicitAny\": false,\n \"strict\": false,\n \"types\": [\n \"https://www.val.town/types/valtown.d.ts\"\n ],\n \"lib\": [\n \"dom\",\n \"dom.iterable\",\n \"dom.asynciterable\",\n \"deno.ns\",\n \"deno.unstable\"\n ]\n },\n \"lint\": {\n \"files\": {\n \"include\": [\n \"deno:/https/esm.town/**/*\"\n ]\n },\n \"rules\": {\n \"exclude\": [\n \"no-explicit-any\"\n ]\n }\n },\n \"node_modules_dir\": false,\n \"experimental\": {\n \"unstable-node-globals\": true,\n \"unstable-temporal\": true,\n \"unstable-worker-options\": true,\n \"unstable-sloppy-imports\": true\n }\n}","label",[154],"c709d896-67f2-11f0-8ec1-0224a6c84d84","README.md","01983875-e8ca-7735-b93b-e26da749ec93",16,["D",1753295286718],"# Am I The Asshole? Guessing Game\n\nA web-based guessing game built with React and Hono where users try to guess what percentage of Reddit users thought the poster was the asshole in posts from the r/AmITheAsshole subreddit.\n\n## Game Description\n\nIn this game, players are presented with a post from the \"Am I The Asshole?\" subreddit, where people share situations and ask if they were in the wrong. Players use a slider to guess what percentage of Reddit users voted that the original poster was the asshole. After submitting their guess, they see how close they were to the actual percentage.\n\n## Features\n\n- Beautiful, Reddit-inspired UI\n- Interactive slider for making guesses\n- Feedback on how close your guess was to the actual percentage\n- Responsive design that works on mobile and desktop\n\n## Technical Structure\n\n- **Frontend**: React with TypeScript, modern CSS\n- **Backend**: Hono (lightweight web framework)\n- **Data**: Currently uses static data, with plans to connect to SQL later\n\n## Project Structure\n\n- `/backend/index.ts` - The main server entry point\n- `/backend/data/posts.ts` - Static AITA post data\n- `/frontend/components/AITAGame.tsx` - The main game component\n- `/frontend/components/App.tsx` - The root React component\n- `/frontend/style.css` - Styles for the application\n\n## Future Enhancements\n\n- Connect to a SQL database for storing and retrieving posts\n- Add multiple posts with the ability to cycle through them\n- Add user accounts to track scores\n- Add social sharing features",[165],"9b5cdfd0-67f3-11f0-8195-0224a6c84d84",".vtignore","c6c4281e-67f2-11f0-84e8-0224a6c84d84",27,["D",1753295642961],2,".git\n.vscode\n.cursorrules\n.DS_Store\nnode_modules\nvendor\n./data/",[172],"9d860d18-67f3-11f0-9b67-0224a6c84d84",".gitignore","78f0477a-67f3-11f0-9b33-0224a6c84d84",29,["D",1753295646586],"vcs.xml\nstate.json\n./data/",[180],"f942ed08-67fb-11f0-8ad5-0224a6c84d84","local","f942edbc-67fb-11f0-8ad5-0224a6c84d84",31,["D",1753299236474],"directory",[187],"9158d5b0-67ef-11f0-97a8-0224a6c84d84","frontend","01983875-e8ca-7735-b93b-df00685bcab2",["D",1753293908093],[194],"f9737b08-67fb-11f0-ad3e-0224a6c84d84","db","f9737be4-67fb-11f0-ad3e-0224a6c84d84",33,["D",1753299236795],[199],"91e92f30-67f3-11f0-946a-0224a6c84d84","data","91e9305c-67f3-11f0-946a-0224a6c84d84",24,["D",1753295627106],[205],"9158c5ac-67ef-11f0-97a8-0224a6c84d84","backend","01983875-e8ca-7735-b93b-c2f72a40303c",["D",1753293908093],[211],"f95b701c-67fb-11f0-95df-0224a6c84d84",".venv","f95b7300-67fb-11f0-95df-0224a6c84d84",32,["D",1753299236638],[216],"c67e6fa4-67f2-11f0-84e8-0224a6c84d84",".idea","c67e704e-67f2-11f0-84e8-0224a6c84d84",["D",1753295285829],[222],"pulls","branches","forks","envVars",{"_233":60,"_235":160},"connections",{"_233":160,"_234":160},"count","unfilledCount","emptyCount",{"_41":221,"_31":222,"_29":223,"_156":-5,"_39":40,"_38":176,"_158":56,"_36":3727,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3728,"_26":3729},{"_41":3722,"_31":3650,"_29":3667,"_156":223,"_39":40,"_38":3723,"_158":56,"_36":3724,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3725,"_26":3726},{"_41":3717,"_31":3704,"_29":3712,"_156":3667,"_39":40,"_38":3718,"_158":56,"_36":3719,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3720,"_26":3721},{"_41":3711,"_31":3652,"_29":3706,"_156":3712,"_39":40,"_38":3713,"_158":56,"_36":3714,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3715,"_26":3716},{"_41":3705,"_31":3653,"_29":3699,"_156":3706,"_39":40,"_38":3707,"_158":56,"_36":3708,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3709,"_26":3710},{"_41":3697,"_31":3643,"_29":3698,"_156":3699,"_39":40,"_38":3700,"_158":56,"_36":3701,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3702,"_26":3703},{"_41":3692,"_31":3679,"_29":3687,"_156":3667,"_39":40,"_38":3693,"_158":56,"_36":3694,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3695,"_26":3696},{"_41":3686,"_31":3652,"_29":3681,"_156":3687,"_39":40,"_38":3688,"_158":56,"_36":3689,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3690,"_26":3691},{"_41":3680,"_31":3653,"_29":3674,"_156":3681,"_39":40,"_38":3682,"_158":56,"_36":3683,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3684,"_26":3685},{"_41":3672,"_31":3643,"_29":3673,"_156":3674,"_39":40,"_38":3675,"_158":56,"_36":3676,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3677,"_26":3678},{"_41":3666,"_31":3651,"_29":3661,"_156":3667,"_39":40,"_38":3668,"_158":56,"_36":3669,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3670,"_26":3671},{"_41":3660,"_31":3652,"_29":3655,"_156":3661,"_39":40,"_38":3662,"_158":56,"_36":3663,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3664,"_26":3665},{"_41":3654,"_31":3653,"_29":3645,"_156":3655,"_39":40,"_38":3656,"_158":56,"_36":3657,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3658,"_26":3659},{"_41":3642,"_31":3643,"_29":3644,"_156":3645,"_39":40,"_38":3646,"_158":56,"_36":3647,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3648,"_26":3649},{"_41":3635,"_31":180,"_29":3636,"_156":223,"_39":40,"_38":3637,"_158":56,"_36":3638,"_13":160,"_33":20,"_34":3639,"_23":24,"_162":-5,"_651":3640,"_26":3641},{"_41":3627,"_31":3628,"_29":3629,"_156":223,"_39":40,"_38":3630,"_158":24,"_36":3631,"_13":160,"_33":20,"_34":3632,"_23":24,"_162":-5,"_651":3633,"_26":3634},{"_41":3619,"_31":3620,"_29":3621,"_156":223,"_39":40,"_38":3622,"_158":56,"_36":3623,"_13":160,"_33":20,"_34":3624,"_23":24,"_162":-5,"_651":3625,"_26":3626},{"_41":3611,"_31":3612,"_29":3613,"_156":223,"_39":40,"_38":3614,"_158":56,"_36":3615,"_13":160,"_33":20,"_34":3616,"_23":24,"_162":-5,"_651":3617,"_26":3618},{"_41":3603,"_31":3604,"_29":3605,"_156":223,"_39":40,"_38":3606,"_158":24,"_36":3607,"_13":734,"_33":20,"_34":3608,"_23":24,"_162":-5,"_651":3609,"_26":3610},{"_41":215,"_31":216,"_29":217,"_156":-5,"_39":40,"_38":218,"_158":56,"_36":3600,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3601,"_26":3602},{"_41":3595,"_31":3526,"_29":3520,"_156":217,"_39":40,"_38":3596,"_158":56,"_36":3597,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3598,"_26":3599},{"_41":3587,"_31":3588,"_29":3589,"_156":3520,"_39":40,"_38":3590,"_158":56,"_36":3591,"_13":160,"_33":20,"_34":3592,"_23":24,"_162":-5,"_651":3593,"_26":3594},{"_41":3579,"_31":3580,"_29":3581,"_156":3520,"_39":40,"_38":3582,"_158":56,"_36":3583,"_13":160,"_33":20,"_34":3584,"_23":24,"_162":-5,"_651":3585,"_26":3586},{"_41":3571,"_31":3572,"_29":3573,"_156":3520,"_39":40,"_38":3574,"_158":56,"_36":3575,"_13":160,"_33":20,"_34":3576,"_23":24,"_162":-5,"_651":3577,"_26":3578},{"_41":3563,"_31":3564,"_29":3565,"_156":3520,"_39":40,"_38":3566,"_158":56,"_36":3567,"_13":160,"_33":20,"_34":3568,"_23":24,"_162":-5,"_651":3569,"_26":3570},{"_41":3555,"_31":3556,"_29":3557,"_156":3520,"_39":40,"_38":3558,"_158":56,"_36":3559,"_13":160,"_33":20,"_34":3560,"_23":24,"_162":-5,"_651":3561,"_26":3562},{"_41":3547,"_31":3548,"_29":3549,"_156":3520,"_39":40,"_38":3550,"_158":56,"_36":3551,"_13":160,"_33":20,"_34":3552,"_23":24,"_162":-5,"_651":3553,"_26":3554},{"_41":3541,"_31":890,"_29":3542,"_156":3520,"_39":40,"_38":3543,"_158":56,"_36":3544,"_13":160,"_33":20,"_34":3523,"_23":24,"_162":-5,"_651":3545,"_26":3546},{"_41":3534,"_31":3535,"_29":3536,"_156":3520,"_39":40,"_38":3537,"_158":56,"_36":3538,"_13":160,"_33":20,"_34":3523,"_23":24,"_162":-5,"_651":3539,"_26":3540},{"_41":3527,"_31":3528,"_29":3529,"_156":3520,"_39":40,"_38":3530,"_158":56,"_36":3531,"_13":160,"_33":20,"_34":3523,"_23":24,"_162":-5,"_651":3532,"_26":3533},{"_41":3517,"_31":3518,"_29":3519,"_156":3520,"_39":40,"_38":3521,"_158":56,"_36":3522,"_13":160,"_33":20,"_34":3523,"_23":24,"_162":-5,"_651":3524,"_26":3525},{"_41":3512,"_31":809,"_29":3507,"_156":217,"_39":40,"_38":3513,"_158":56,"_36":3514,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3515,"_26":3516},{"_41":3506,"_31":810,"_29":3501,"_156":3507,"_39":40,"_38":3508,"_158":56,"_36":3509,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3510,"_26":3511},{"_41":3500,"_31":811,"_29":876,"_156":3501,"_39":40,"_38":3502,"_158":56,"_36":3503,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3504,"_26":3505},{"_41":3493,"_31":3494,"_29":3495,"_156":876,"_39":40,"_38":3496,"_158":56,"_36":3497,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3498,"_26":3499},{"_41":3488,"_31":890,"_29":2244,"_156":876,"_39":40,"_38":3489,"_158":56,"_36":3490,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3491,"_26":3492},{"_41":3483,"_31":2258,"_29":2252,"_156":2244,"_39":40,"_38":3484,"_158":56,"_36":3485,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3486,"_26":3487},{"_41":3478,"_31":3383,"_29":3377,"_156":2252,"_39":40,"_38":3479,"_158":56,"_36":3480,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3481,"_26":3482},{"_41":3471,"_31":893,"_29":3472,"_156":3377,"_39":40,"_38":3473,"_158":56,"_36":3474,"_13":160,"_33":20,"_34":3475,"_23":24,"_162":-5,"_651":3476,"_26":3477},{"_41":3463,"_31":3464,"_29":3465,"_156":3377,"_39":40,"_38":3466,"_158":56,"_36":3467,"_13":160,"_33":20,"_34":3468,"_23":24,"_162":-5,"_651":3469,"_26":3470},{"_41":3455,"_31":3456,"_29":3457,"_156":3377,"_39":40,"_38":3458,"_158":56,"_36":3459,"_13":160,"_33":20,"_34":3460,"_23":24,"_162":-5,"_651":3461,"_26":3462},{"_41":3447,"_31":3448,"_29":3449,"_156":3377,"_39":40,"_38":3450,"_158":56,"_36":3451,"_13":160,"_33":20,"_34":3452,"_23":24,"_162":-5,"_651":3453,"_26":3454},{"_41":3439,"_31":3440,"_29":3441,"_156":3377,"_39":40,"_38":3442,"_158":56,"_36":3443,"_13":160,"_33":20,"_34":3444,"_23":24,"_162":-5,"_651":3445,"_26":3446},{"_41":3431,"_31":3432,"_29":3433,"_156":3377,"_39":40,"_38":3434,"_158":56,"_36":3435,"_13":160,"_33":20,"_34":3436,"_23":24,"_162":-5,"_651":3437,"_26":3438},{"_41":3424,"_31":2276,"_29":3425,"_156":3377,"_39":40,"_38":3426,"_158":56,"_36":3427,"_13":160,"_33":20,"_34":3428,"_23":24,"_162":-5,"_651":3429,"_26":3430},{"_41":3416,"_31":3417,"_29":3418,"_156":3377,"_39":40,"_38":3419,"_158":56,"_36":3420,"_13":160,"_33":20,"_34":3421,"_23":24,"_162":-5,"_651":3422,"_26":3423},{"_41":3408,"_31":3409,"_29":3410,"_156":3377,"_39":40,"_38":3411,"_158":56,"_36":3412,"_13":160,"_33":20,"_34":3413,"_23":24,"_162":-5,"_651":3414,"_26":3415},{"_41":3400,"_31":3401,"_29":3402,"_156":3377,"_39":40,"_38":3403,"_158":56,"_36":3404,"_13":160,"_33":20,"_34":3405,"_23":24,"_162":-5,"_651":3406,"_26":3407},{"_41":3392,"_31":3393,"_29":3394,"_156":3377,"_39":40,"_38":3395,"_158":56,"_36":3396,"_13":160,"_33":20,"_34":3397,"_23":24,"_162":-5,"_651":3398,"_26":3399},{"_41":3384,"_31":3385,"_29":3386,"_156":3377,"_39":40,"_38":3387,"_158":56,"_36":3388,"_13":160,"_33":20,"_34":3389,"_23":24,"_162":-5,"_651":3390,"_26":3391},{"_41":3375,"_31":1285,"_29":3376,"_156":3377,"_39":40,"_38":3378,"_158":56,"_36":3379,"_13":160,"_33":20,"_34":3380,"_23":24,"_162":-5,"_651":3381,"_26":3382},{"_41":3371,"_31":3234,"_29":3228,"_156":2252,"_39":40,"_38":89,"_158":56,"_36":3372,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3373,"_26":3374},{"_41":3364,"_31":893,"_29":3365,"_156":3228,"_39":40,"_38":3366,"_158":56,"_36":3367,"_13":160,"_33":20,"_34":3368,"_23":24,"_162":-5,"_651":3369,"_26":3370},{"_41":3357,"_31":2178,"_29":3358,"_156":3228,"_39":40,"_38":3359,"_158":56,"_36":3360,"_13":160,"_33":20,"_34":3361,"_23":24,"_162":-5,"_651":3362,"_26":3363},{"_41":3350,"_31":2755,"_29":3351,"_156":3228,"_39":40,"_38":3352,"_158":56,"_36":3353,"_13":160,"_33":20,"_34":3354,"_23":24,"_162":-5,"_651":3355,"_26":3356},{"_41":3342,"_31":3343,"_29":3344,"_156":3228,"_39":40,"_38":3345,"_158":56,"_36":3346,"_13":160,"_33":20,"_34":3347,"_23":24,"_162":-5,"_651":3348,"_26":3349},{"_41":3335,"_31":2291,"_29":3336,"_156":3228,"_39":40,"_38":3337,"_158":56,"_36":3338,"_13":160,"_33":20,"_34":3339,"_23":24,"_162":-5,"_651":3340,"_26":3341},{"_41":3327,"_31":3328,"_29":3329,"_156":3228,"_39":40,"_38":3330,"_158":56,"_36":3331,"_13":160,"_33":20,"_34":3332,"_23":24,"_162":-5,"_651":3333,"_26":3334},{"_41":3320,"_31":2891,"_29":3321,"_156":3228,"_39":40,"_38":3322,"_158":56,"_36":3323,"_13":160,"_33":20,"_34":3324,"_23":24,"_162":-5,"_651":3325,"_26":3326},{"_41":3313,"_31":2747,"_29":3314,"_156":3228,"_39":40,"_38":3315,"_158":56,"_36":3316,"_13":160,"_33":20,"_34":3317,"_23":24,"_162":-5,"_651":3318,"_26":3319},{"_41":3305,"_31":3306,"_29":3307,"_156":3228,"_39":40,"_38":3308,"_158":56,"_36":3309,"_13":160,"_33":20,"_34":3310,"_23":24,"_162":-5,"_651":3311,"_26":3312},{"_41":3298,"_31":1325,"_29":3299,"_156":3228,"_39":40,"_38":3300,"_158":56,"_36":3301,"_13":160,"_33":20,"_34":3302,"_23":24,"_162":-5,"_651":3303,"_26":3304},{"_41":3291,"_31":2020,"_29":3292,"_156":3228,"_39":40,"_38":3293,"_158":56,"_36":3294,"_13":160,"_33":20,"_34":3295,"_23":24,"_162":-5,"_651":3296,"_26":3297},{"_41":3283,"_31":3284,"_29":3285,"_156":3228,"_39":40,"_38":3286,"_158":56,"_36":3287,"_13":160,"_33":20,"_34":3288,"_23":24,"_162":-5,"_651":3289,"_26":3290},{"_41":3275,"_31":3276,"_29":3277,"_156":3228,"_39":40,"_38":3278,"_158":56,"_36":3279,"_13":160,"_33":20,"_34":3280,"_23":24,"_162":-5,"_651":3281,"_26":3282},{"_41":3267,"_31":3268,"_29":3269,"_156":3228,"_39":40,"_38":3270,"_158":56,"_36":3271,"_13":160,"_33":20,"_34":3272,"_23":24,"_162":-5,"_651":3273,"_26":3274},{"_41":3259,"_31":3260,"_29":3261,"_156":3228,"_39":40,"_38":3262,"_158":56,"_36":3263,"_13":160,"_33":20,"_34":3264,"_23":24,"_162":-5,"_651":3265,"_26":3266},{"_41":3251,"_31":3252,"_29":3253,"_156":3228,"_39":40,"_38":3254,"_158":56,"_36":3255,"_13":160,"_33":20,"_34":3256,"_23":24,"_162":-5,"_651":3257,"_26":3258},{"_41":3243,"_31":3244,"_29":3245,"_156":3228,"_39":40,"_38":3246,"_158":56,"_36":3247,"_13":160,"_33":20,"_34":3248,"_23":24,"_162":-5,"_651":3249,"_26":3250},{"_41":3235,"_31":3236,"_29":3237,"_156":3228,"_39":40,"_38":3238,"_158":56,"_36":3239,"_13":160,"_33":20,"_34":3240,"_23":24,"_162":-5,"_651":3241,"_26":3242},{"_41":3226,"_31":1950,"_29":3227,"_156":3228,"_39":40,"_38":3229,"_158":56,"_36":3230,"_13":160,"_33":20,"_34":3231,"_23":24,"_162":-5,"_651":3232,"_26":3233},{"_41":3221,"_31":3190,"_29":3184,"_156":2252,"_39":40,"_38":3222,"_158":56,"_36":3223,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3224,"_26":3225},{"_41":3214,"_31":893,"_29":3215,"_156":3184,"_39":40,"_38":3216,"_158":56,"_36":3217,"_13":160,"_33":20,"_34":3218,"_23":24,"_162":-5,"_651":3219,"_26":3220},{"_41":3207,"_31":2579,"_29":3208,"_156":3184,"_39":40,"_38":3209,"_158":56,"_36":3210,"_13":160,"_33":20,"_34":3211,"_23":24,"_162":-5,"_651":3212,"_26":3213},{"_41":3199,"_31":3200,"_29":3201,"_156":3184,"_39":40,"_38":3202,"_158":56,"_36":3203,"_13":160,"_33":20,"_34":3204,"_23":24,"_162":-5,"_651":3205,"_26":3206},{"_41":3191,"_31":3192,"_29":3193,"_156":3184,"_39":40,"_38":3194,"_158":56,"_36":3195,"_13":160,"_33":20,"_34":3196,"_23":24,"_162":-5,"_651":3197,"_26":3198},{"_41":3182,"_31":1950,"_29":3183,"_156":3184,"_39":40,"_38":3185,"_158":56,"_36":3186,"_13":160,"_33":20,"_34":3187,"_23":24,"_162":-5,"_651":3188,"_26":3189},{"_41":3177,"_31":3153,"_29":3147,"_156":2252,"_39":40,"_38":3178,"_158":56,"_36":3179,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3180,"_26":3181},{"_41":3170,"_31":893,"_29":3171,"_156":3147,"_39":40,"_38":3172,"_158":56,"_36":3173,"_13":160,"_33":20,"_34":3174,"_23":24,"_162":-5,"_651":3175,"_26":3176},{"_41":3162,"_31":3163,"_29":3164,"_156":3147,"_39":40,"_38":3165,"_158":56,"_36":3166,"_13":160,"_33":20,"_34":3167,"_23":24,"_162":-5,"_651":3168,"_26":3169},{"_41":3154,"_31":3155,"_29":3156,"_156":3147,"_39":40,"_38":3157,"_158":56,"_36":3158,"_13":160,"_33":20,"_34":3159,"_23":24,"_162":-5,"_651":3160,"_26":3161},{"_41":3144,"_31":3145,"_29":3146,"_156":3147,"_39":40,"_38":3148,"_158":56,"_36":3149,"_13":160,"_33":20,"_34":3150,"_23":24,"_162":-5,"_651":3151,"_26":3152},{"_41":3139,"_31":3115,"_29":3109,"_156":2252,"_39":40,"_38":3140,"_158":56,"_36":3141,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3142,"_26":3143},{"_41":3132,"_31":893,"_29":3133,"_156":3109,"_39":40,"_38":3134,"_158":56,"_36":3135,"_13":160,"_33":20,"_34":3136,"_23":24,"_162":-5,"_651":3137,"_26":3138},{"_41":3124,"_31":3125,"_29":3126,"_156":3109,"_39":40,"_38":3127,"_158":56,"_36":3128,"_13":160,"_33":20,"_34":3129,"_23":24,"_162":-5,"_651":3130,"_26":3131},{"_41":3116,"_31":3117,"_29":3118,"_156":3109,"_39":40,"_38":3119,"_158":56,"_36":3120,"_13":160,"_33":20,"_34":3121,"_23":24,"_162":-5,"_651":3122,"_26":3123},{"_41":3107,"_31":2579,"_29":3108,"_156":3109,"_39":40,"_38":3110,"_158":56,"_36":3111,"_13":160,"_33":20,"_34":3112,"_23":24,"_162":-5,"_651":3113,"_26":3114},{"_41":3102,"_31":3041,"_29":3035,"_156":2252,"_39":40,"_38":3103,"_158":56,"_36":3104,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3105,"_26":3106},{"_41":3097,"_31":3073,"_29":3067,"_156":3035,"_39":40,"_38":3098,"_158":56,"_36":3099,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3100,"_26":3101},{"_41":3090,"_31":893,"_29":3091,"_156":3067,"_39":40,"_38":3092,"_158":56,"_36":3093,"_13":160,"_33":20,"_34":3094,"_23":24,"_162":-5,"_651":3095,"_26":3096},{"_41":3082,"_31":3083,"_29":3084,"_156":3067,"_39":40,"_38":3085,"_158":56,"_36":3086,"_13":160,"_33":20,"_34":3087,"_23":24,"_162":-5,"_651":3088,"_26":3089},{"_41":3074,"_31":3075,"_29":3076,"_156":3067,"_39":40,"_38":3077,"_158":56,"_36":3078,"_13":160,"_33":20,"_34":3079,"_23":24,"_162":-5,"_651":3080,"_26":3081},{"_41":3064,"_31":3065,"_29":3066,"_156":3067,"_39":40,"_38":3068,"_158":56,"_36":3069,"_13":160,"_33":20,"_34":3070,"_23":24,"_162":-5,"_651":3071,"_26":3072},{"_41":3057,"_31":893,"_29":3058,"_156":3035,"_39":40,"_38":3059,"_158":56,"_36":3060,"_13":160,"_33":20,"_34":3061,"_23":24,"_162":-5,"_651":3062,"_26":3063},{"_41":3049,"_31":3050,"_29":3051,"_156":3035,"_39":40,"_38":3052,"_158":56,"_36":3053,"_13":160,"_33":20,"_34":3054,"_23":24,"_162":-5,"_651":3055,"_26":3056},{"_41":3042,"_31":2579,"_29":3043,"_156":3035,"_39":40,"_38":3044,"_158":56,"_36":3045,"_13":160,"_33":20,"_34":3046,"_23":24,"_162":-5,"_651":3047,"_26":3048},{"_41":3032,"_31":3033,"_29":3034,"_156":3035,"_39":40,"_38":3036,"_158":56,"_36":3037,"_13":160,"_33":20,"_34":3038,"_23":24,"_162":-5,"_651":3039,"_26":3040},{"_41":3027,"_31":2932,"_29":2926,"_156":2252,"_39":40,"_38":3028,"_158":56,"_36":3029,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":3030,"_26":3031},{"_41":3020,"_31":893,"_29":3021,"_156":2926,"_39":40,"_38":3022,"_158":56,"_36":3023,"_13":160,"_33":20,"_34":3024,"_23":24,"_162":-5,"_651":3025,"_26":3026},{"_41":3012,"_31":3013,"_29":3014,"_156":2926,"_39":40,"_38":3015,"_158":56,"_36":3016,"_13":160,"_33":20,"_34":3017,"_23":24,"_162":-5,"_651":3018,"_26":3019},{"_41":3004,"_31":3005,"_29":3006,"_156":2926,"_39":40,"_38":3007,"_158":56,"_36":3008,"_13":160,"_33":20,"_34":3009,"_23":24,"_162":-5,"_651":3010,"_26":3011},{"_41":2996,"_31":2997,"_29":2998,"_156":2926,"_39":40,"_38":2999,"_158":56,"_36":3000,"_13":160,"_33":20,"_34":3001,"_23":24,"_162":-5,"_651":3002,"_26":3003},{"_41":2989,"_31":2020,"_29":2990,"_156":2926,"_39":40,"_38":2991,"_158":56,"_36":2992,"_13":160,"_33":20,"_34":2993,"_23":24,"_162":-5,"_651":2994,"_26":2995},{"_41":2981,"_31":2982,"_29":2983,"_156":2926,"_39":40,"_38":2984,"_158":56,"_36":2985,"_13":160,"_33":20,"_34":2986,"_23":24,"_162":-5,"_651":2987,"_26":2988},{"_41":2973,"_31":2974,"_29":2975,"_156":2926,"_39":40,"_38":2976,"_158":56,"_36":2977,"_13":160,"_33":20,"_34":2978,"_23":24,"_162":-5,"_651":2979,"_26":2980},{"_41":2965,"_31":2966,"_29":2967,"_156":2926,"_39":40,"_38":2968,"_158":56,"_36":2969,"_13":160,"_33":20,"_34":2970,"_23":24,"_162":-5,"_651":2971,"_26":2972},{"_41":2957,"_31":2958,"_29":2959,"_156":2926,"_39":40,"_38":2960,"_158":56,"_36":2961,"_13":160,"_33":20,"_34":2962,"_23":24,"_162":-5,"_651":2963,"_26":2964},{"_41":2949,"_31":2950,"_29":2951,"_156":2926,"_39":40,"_38":2952,"_158":56,"_36":2953,"_13":160,"_33":20,"_34":2954,"_23":24,"_162":-5,"_651":2955,"_26":2956},{"_41":2941,"_31":2942,"_29":2943,"_156":2926,"_39":40,"_38":2944,"_158":56,"_36":2945,"_13":160,"_33":20,"_34":2946,"_23":24,"_162":-5,"_651":2947,"_26":2948},{"_41":2933,"_31":2934,"_29":2935,"_156":2926,"_39":40,"_38":2936,"_158":56,"_36":2937,"_13":160,"_33":20,"_34":2938,"_23":24,"_162":-5,"_651":2939,"_26":2940},{"_41":2924,"_31":1950,"_29":2925,"_156":2926,"_39":40,"_38":2927,"_158":56,"_36":2928,"_13":160,"_33":20,"_34":2929,"_23":24,"_162":-5,"_651":2930,"_26":2931},{"_41":2919,"_31":2866,"_29":2860,"_156":2252,"_39":40,"_38":2920,"_158":56,"_36":2921,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2922,"_26":2923},{"_41":2912,"_31":893,"_29":2913,"_156":2860,"_39":40,"_38":2914,"_158":56,"_36":2915,"_13":160,"_33":20,"_34":2916,"_23":24,"_162":-5,"_651":2917,"_26":2918},{"_41":2905,"_31":1365,"_29":2906,"_156":2860,"_39":40,"_38":2907,"_158":56,"_36":2908,"_13":160,"_33":20,"_34":2909,"_23":24,"_162":-5,"_651":2910,"_26":2911},{"_41":2898,"_31":2178,"_29":2899,"_156":2860,"_39":40,"_38":2900,"_158":56,"_36":2901,"_13":160,"_33":20,"_34":2902,"_23":24,"_162":-5,"_651":2903,"_26":2904},{"_41":2890,"_31":2891,"_29":2892,"_156":2860,"_39":40,"_38":2893,"_158":56,"_36":2894,"_13":160,"_33":20,"_34":2895,"_23":24,"_162":-5,"_651":2896,"_26":2897},{"_41":2882,"_31":2883,"_29":2884,"_156":2860,"_39":40,"_38":2885,"_158":56,"_36":2886,"_13":160,"_33":20,"_34":2887,"_23":24,"_162":-5,"_651":2888,"_26":2889},{"_41":2874,"_31":2875,"_29":2876,"_156":2860,"_39":40,"_38":2877,"_158":56,"_36":2878,"_13":160,"_33":20,"_34":2879,"_23":24,"_162":-5,"_651":2880,"_26":2881},{"_41":2867,"_31":1267,"_29":2868,"_156":2860,"_39":40,"_38":2869,"_158":56,"_36":2870,"_13":160,"_33":20,"_34":2871,"_23":24,"_162":-5,"_651":2872,"_26":2873},{"_41":2857,"_31":2858,"_29":2859,"_156":2860,"_39":40,"_38":2861,"_158":56,"_36":2862,"_13":160,"_33":20,"_34":2863,"_23":24,"_162":-5,"_651":2864,"_26":2865},{"_41":2852,"_31":2745,"_29":2739,"_156":2252,"_39":40,"_38":2853,"_158":56,"_36":2854,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2855,"_26":2856},{"_41":2847,"_31":2800,"_29":2794,"_156":2739,"_39":40,"_38":2848,"_158":56,"_36":2849,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2850,"_26":2851},{"_41":2839,"_31":2840,"_29":2841,"_156":2794,"_39":40,"_38":2842,"_158":56,"_36":2843,"_13":160,"_33":20,"_34":2844,"_23":24,"_162":-5,"_651":2845,"_26":2846},{"_41":2832,"_31":1727,"_29":2833,"_156":2794,"_39":40,"_38":2834,"_158":56,"_36":2835,"_13":160,"_33":20,"_34":2836,"_23":24,"_162":-5,"_651":2837,"_26":2838},{"_41":2824,"_31":2825,"_29":2826,"_156":2794,"_39":40,"_38":2827,"_158":56,"_36":2828,"_13":160,"_33":20,"_34":2829,"_23":24,"_162":-5,"_651":2830,"_26":2831},{"_41":2816,"_31":2817,"_29":2818,"_156":2794,"_39":40,"_38":2819,"_158":56,"_36":2820,"_13":160,"_33":20,"_34":2821,"_23":24,"_162":-5,"_651":2822,"_26":2823},{"_41":2809,"_31":1950,"_29":2810,"_156":2794,"_39":40,"_38":2811,"_158":56,"_36":2812,"_13":160,"_33":20,"_34":2813,"_23":24,"_162":-5,"_651":2814,"_26":2815},{"_41":2801,"_31":2802,"_29":2803,"_156":2794,"_39":40,"_38":2804,"_158":56,"_36":2805,"_13":160,"_33":20,"_34":2806,"_23":24,"_162":-5,"_651":2807,"_26":2808},{"_41":2791,"_31":2792,"_29":2793,"_156":2794,"_39":40,"_38":2795,"_158":56,"_36":2796,"_13":160,"_33":20,"_34":2797,"_23":24,"_162":-5,"_651":2798,"_26":2799},{"_41":2786,"_31":2770,"_29":2764,"_156":2739,"_39":40,"_38":2787,"_158":56,"_36":2788,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2789,"_26":2790},{"_41":2779,"_31":893,"_29":2780,"_156":2764,"_39":40,"_38":2781,"_158":56,"_36":2782,"_13":160,"_33":20,"_34":2783,"_23":24,"_162":-5,"_651":2784,"_26":2785},{"_41":2771,"_31":2772,"_29":2773,"_156":2764,"_39":40,"_38":2774,"_158":56,"_36":2775,"_13":160,"_33":20,"_34":2776,"_23":24,"_162":-5,"_651":2777,"_26":2778},{"_41":2762,"_31":1950,"_29":2763,"_156":2764,"_39":40,"_38":2765,"_158":56,"_36":2766,"_13":160,"_33":20,"_34":2767,"_23":24,"_162":-5,"_651":2768,"_26":2769},{"_41":2754,"_31":2755,"_29":2756,"_156":2739,"_39":40,"_38":2757,"_158":56,"_36":2758,"_13":160,"_33":20,"_34":2759,"_23":24,"_162":-5,"_651":2760,"_26":2761},{"_41":2746,"_31":2747,"_29":2748,"_156":2739,"_39":40,"_38":2749,"_158":56,"_36":2750,"_13":160,"_33":20,"_34":2751,"_23":24,"_162":-5,"_651":2752,"_26":2753},{"_41":2736,"_31":2737,"_29":2738,"_156":2739,"_39":40,"_38":2740,"_158":56,"_36":2741,"_13":160,"_33":20,"_34":2742,"_23":24,"_162":-5,"_651":2743,"_26":2744},{"_41":2731,"_31":2683,"_29":2677,"_156":2252,"_39":40,"_38":2732,"_158":56,"_36":2733,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2734,"_26":2735},{"_41":2724,"_31":893,"_29":2725,"_156":2677,"_39":40,"_38":2726,"_158":56,"_36":2727,"_13":160,"_33":20,"_34":2728,"_23":24,"_162":-5,"_651":2729,"_26":2730},{"_41":2716,"_31":2717,"_29":2718,"_156":2677,"_39":40,"_38":2719,"_158":56,"_36":2720,"_13":160,"_33":20,"_34":2721,"_23":24,"_162":-5,"_651":2722,"_26":2723},{"_41":2708,"_31":2709,"_29":2710,"_156":2677,"_39":40,"_38":2711,"_158":56,"_36":2712,"_13":160,"_33":20,"_34":2713,"_23":24,"_162":-5,"_651":2714,"_26":2715},{"_41":2700,"_31":2701,"_29":2702,"_156":2677,"_39":40,"_38":2703,"_158":56,"_36":2704,"_13":160,"_33":20,"_34":2705,"_23":24,"_162":-5,"_651":2706,"_26":2707},{"_41":2692,"_31":2693,"_29":2694,"_156":2677,"_39":40,"_38":2695,"_158":56,"_36":2696,"_13":160,"_33":20,"_34":2697,"_23":24,"_162":-5,"_651":2698,"_26":2699},{"_41":2684,"_31":2685,"_29":2686,"_156":2677,"_39":40,"_38":2687,"_158":56,"_36":2688,"_13":160,"_33":20,"_34":2689,"_23":24,"_162":-5,"_651":2690,"_26":2691},{"_41":2674,"_31":2675,"_29":2676,"_156":2677,"_39":40,"_38":2678,"_158":56,"_36":2679,"_13":160,"_33":20,"_34":2680,"_23":24,"_162":-5,"_651":2681,"_26":2682},{"_41":2669,"_31":2587,"_29":2581,"_156":2252,"_39":40,"_38":2670,"_158":56,"_36":2671,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2672,"_26":2673},{"_41":2665,"_31":2664,"_29":2658,"_156":2581,"_39":40,"_38":133,"_158":56,"_36":2666,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2667,"_26":2668},{"_41":2656,"_31":2589,"_29":2657,"_156":2658,"_39":40,"_38":2659,"_158":56,"_36":2660,"_13":160,"_33":20,"_34":2661,"_23":24,"_162":-5,"_651":2662,"_26":2663},{"_41":2651,"_31":1260,"_29":2591,"_156":2581,"_39":40,"_38":2652,"_158":56,"_36":2653,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2654,"_26":2655},{"_41":2644,"_31":2579,"_29":2645,"_156":2591,"_39":40,"_38":2646,"_158":56,"_36":2647,"_13":160,"_33":20,"_34":2648,"_23":24,"_162":-5,"_651":2649,"_26":2650},{"_41":2636,"_31":2637,"_29":2638,"_156":2591,"_39":40,"_38":2639,"_158":56,"_36":2640,"_13":160,"_33":20,"_34":2641,"_23":24,"_162":-5,"_651":2642,"_26":2643},{"_41":2628,"_31":2629,"_29":2630,"_156":2591,"_39":40,"_38":2631,"_158":56,"_36":2632,"_13":160,"_33":20,"_34":2633,"_23":24,"_162":-5,"_651":2634,"_26":2635},{"_41":2620,"_31":2621,"_29":2622,"_156":2591,"_39":40,"_38":2623,"_158":56,"_36":2624,"_13":160,"_33":20,"_34":2625,"_23":24,"_162":-5,"_651":2626,"_26":2627},{"_41":2612,"_31":2613,"_29":2614,"_156":2591,"_39":40,"_38":2615,"_158":56,"_36":2616,"_13":160,"_33":20,"_34":2617,"_23":24,"_162":-5,"_651":2618,"_26":2619},{"_41":2604,"_31":2605,"_29":2606,"_156":2591,"_39":40,"_38":2607,"_158":56,"_36":2608,"_13":160,"_33":20,"_34":2609,"_23":24,"_162":-5,"_651":2610,"_26":2611},{"_41":2597,"_31":1719,"_29":2598,"_156":2591,"_39":40,"_38":2599,"_158":56,"_36":2600,"_13":160,"_33":20,"_34":2601,"_23":24,"_162":-5,"_651":2602,"_26":2603},{"_41":2588,"_31":2589,"_29":2590,"_156":2591,"_39":40,"_38":2592,"_158":56,"_36":2593,"_13":160,"_33":20,"_34":2594,"_23":24,"_162":-5,"_651":2595,"_26":2596},{"_41":2578,"_31":2579,"_29":2580,"_156":2581,"_39":40,"_38":2582,"_158":56,"_36":2583,"_13":160,"_33":20,"_34":2584,"_23":24,"_162":-5,"_651":2585,"_26":2586},{"_41":2573,"_31":2382,"_29":2376,"_156":2252,"_39":40,"_38":2574,"_158":56,"_36":2575,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2576,"_26":2577},{"_41":2565,"_31":2566,"_29":2567,"_156":2376,"_39":40,"_38":2568,"_158":56,"_36":2569,"_13":160,"_33":20,"_34":2570,"_23":24,"_162":-5,"_651":2571,"_26":2572},{"_41":2557,"_31":2558,"_29":2559,"_156":2376,"_39":40,"_38":2560,"_158":56,"_36":2561,"_13":160,"_33":20,"_34":2562,"_23":24,"_162":-5,"_651":2563,"_26":2564},{"_41":2549,"_31":2550,"_29":2551,"_156":2376,"_39":40,"_38":2552,"_158":56,"_36":2553,"_13":160,"_33":20,"_34":2554,"_23":24,"_162":-5,"_651":2555,"_26":2556},{"_41":2542,"_31":1349,"_29":2543,"_156":2376,"_39":40,"_38":2544,"_158":56,"_36":2545,"_13":160,"_33":20,"_34":2546,"_23":24,"_162":-5,"_651":2547,"_26":2548},{"_41":2534,"_31":2535,"_29":2536,"_156":2376,"_39":40,"_38":2537,"_158":56,"_36":2538,"_13":160,"_33":20,"_34":2539,"_23":24,"_162":-5,"_651":2540,"_26":2541},{"_41":2526,"_31":2527,"_29":2528,"_156":2376,"_39":40,"_38":2529,"_158":56,"_36":2530,"_13":160,"_33":20,"_34":2531,"_23":24,"_162":-5,"_651":2532,"_26":2533},{"_41":2518,"_31":2519,"_29":2520,"_156":2376,"_39":40,"_38":2521,"_158":56,"_36":2522,"_13":160,"_33":20,"_34":2523,"_23":24,"_162":-5,"_651":2524,"_26":2525},{"_41":2510,"_31":2511,"_29":2512,"_156":2376,"_39":40,"_38":2513,"_158":56,"_36":2514,"_13":160,"_33":20,"_34":2515,"_23":24,"_162":-5,"_651":2516,"_26":2517},{"_41":2502,"_31":2503,"_29":2504,"_156":2376,"_39":40,"_38":2505,"_158":56,"_36":2506,"_13":160,"_33":20,"_34":2507,"_23":24,"_162":-5,"_651":2508,"_26":2509},{"_41":2494,"_31":2495,"_29":2496,"_156":2376,"_39":40,"_38":2497,"_158":56,"_36":2498,"_13":160,"_33":20,"_34":2499,"_23":24,"_162":-5,"_651":2500,"_26":2501},{"_41":2486,"_31":2487,"_29":2488,"_156":2376,"_39":40,"_38":2489,"_158":56,"_36":2490,"_13":160,"_33":20,"_34":2491,"_23":24,"_162":-5,"_651":2492,"_26":2493},{"_41":2478,"_31":2479,"_29":2480,"_156":2376,"_39":40,"_38":2481,"_158":56,"_36":2482,"_13":160,"_33":20,"_34":2483,"_23":24,"_162":-5,"_651":2484,"_26":2485},{"_41":2470,"_31":2471,"_29":2472,"_156":2376,"_39":40,"_38":2473,"_158":56,"_36":2474,"_13":160,"_33":20,"_34":2475,"_23":24,"_162":-5,"_651":2476,"_26":2477},{"_41":2462,"_31":2463,"_29":2464,"_156":2376,"_39":40,"_38":2465,"_158":56,"_36":2466,"_13":160,"_33":20,"_34":2467,"_23":24,"_162":-5,"_651":2468,"_26":2469},{"_41":2455,"_31":1124,"_29":2456,"_156":2376,"_39":40,"_38":2457,"_158":56,"_36":2458,"_13":160,"_33":20,"_34":2459,"_23":24,"_162":-5,"_651":2460,"_26":2461},{"_41":2447,"_31":2448,"_29":2449,"_156":2376,"_39":40,"_38":2450,"_158":56,"_36":2451,"_13":160,"_33":20,"_34":2452,"_23":24,"_162":-5,"_651":2453,"_26":2454},{"_41":2439,"_31":2440,"_29":2441,"_156":2376,"_39":40,"_38":2442,"_158":56,"_36":2443,"_13":160,"_33":20,"_34":2444,"_23":24,"_162":-5,"_651":2445,"_26":2446},{"_41":2431,"_31":2432,"_29":2433,"_156":2376,"_39":40,"_38":2434,"_158":56,"_36":2435,"_13":160,"_33":20,"_34":2436,"_23":24,"_162":-5,"_651":2437,"_26":2438},{"_41":2423,"_31":2424,"_29":2425,"_156":2376,"_39":40,"_38":2426,"_158":56,"_36":2427,"_13":160,"_33":20,"_34":2428,"_23":24,"_162":-5,"_651":2429,"_26":2430},{"_41":2415,"_31":2416,"_29":2417,"_156":2376,"_39":40,"_38":2418,"_158":56,"_36":2419,"_13":160,"_33":20,"_34":2420,"_23":24,"_162":-5,"_651":2421,"_26":2422},{"_41":2407,"_31":2408,"_29":2409,"_156":2376,"_39":40,"_38":2410,"_158":56,"_36":2411,"_13":160,"_33":20,"_34":2412,"_23":24,"_162":-5,"_651":2413,"_26":2414},{"_41":2399,"_31":2400,"_29":2401,"_156":2376,"_39":40,"_38":2402,"_158":56,"_36":2403,"_13":160,"_33":20,"_34":2404,"_23":24,"_162":-5,"_651":2405,"_26":2406},{"_41":2391,"_31":2392,"_29":2393,"_156":2376,"_39":40,"_38":2394,"_158":56,"_36":2395,"_13":160,"_33":20,"_34":2396,"_23":24,"_162":-5,"_651":2397,"_26":2398},{"_41":2383,"_31":2384,"_29":2385,"_156":2376,"_39":40,"_38":2386,"_158":56,"_36":2387,"_13":160,"_33":20,"_34":2388,"_23":24,"_162":-5,"_651":2389,"_26":2390},{"_41":2374,"_31":1950,"_29":2375,"_156":2376,"_39":40,"_38":2377,"_158":56,"_36":2378,"_13":160,"_33":20,"_34":2379,"_23":24,"_162":-5,"_651":2380,"_26":2381},{"_41":2369,"_31":2329,"_29":2323,"_156":2252,"_39":40,"_38":2370,"_158":56,"_36":2371,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2372,"_26":2373},{"_41":2362,"_31":893,"_29":2363,"_156":2323,"_39":40,"_38":2364,"_158":56,"_36":2365,"_13":160,"_33":20,"_34":2366,"_23":24,"_162":-5,"_651":2367,"_26":2368},{"_41":2354,"_31":2355,"_29":2356,"_156":2323,"_39":40,"_38":2357,"_158":56,"_36":2358,"_13":160,"_33":20,"_34":2359,"_23":24,"_162":-5,"_651":2360,"_26":2361},{"_41":2346,"_31":2347,"_29":2348,"_156":2323,"_39":40,"_38":2349,"_158":56,"_36":2350,"_13":160,"_33":20,"_34":2351,"_23":24,"_162":-5,"_651":2352,"_26":2353},{"_41":2338,"_31":2339,"_29":2340,"_156":2323,"_39":40,"_38":2341,"_158":56,"_36":2342,"_13":160,"_33":20,"_34":2343,"_23":24,"_162":-5,"_651":2344,"_26":2345},{"_41":2330,"_31":2331,"_29":2332,"_156":2323,"_39":40,"_38":2333,"_158":56,"_36":2334,"_13":160,"_33":20,"_34":2335,"_23":24,"_162":-5,"_651":2336,"_26":2337},{"_41":2320,"_31":2321,"_29":2322,"_156":2323,"_39":40,"_38":2324,"_158":56,"_36":2325,"_13":160,"_33":20,"_34":2326,"_23":24,"_162":-5,"_651":2327,"_26":2328},{"_41":2313,"_31":893,"_29":2314,"_156":2252,"_39":40,"_38":2315,"_158":56,"_36":2316,"_13":160,"_33":20,"_34":2317,"_23":24,"_162":-5,"_651":2318,"_26":2319},{"_41":2305,"_31":2306,"_29":2307,"_156":2252,"_39":40,"_38":2308,"_158":56,"_36":2309,"_13":160,"_33":20,"_34":2310,"_23":24,"_162":-5,"_651":2311,"_26":2312},{"_41":2298,"_31":2178,"_29":2299,"_156":2252,"_39":40,"_38":2300,"_158":56,"_36":2301,"_13":160,"_33":20,"_34":2302,"_23":24,"_162":-5,"_651":2303,"_26":2304},{"_41":2290,"_31":2291,"_29":2292,"_156":2252,"_39":40,"_38":2293,"_158":56,"_36":2294,"_13":160,"_33":20,"_34":2295,"_23":24,"_162":-5,"_651":2296,"_26":2297},{"_41":2283,"_31":1333,"_29":2284,"_156":2252,"_39":40,"_38":2285,"_158":56,"_36":2286,"_13":160,"_33":20,"_34":2287,"_23":24,"_162":-5,"_651":2288,"_26":2289},{"_41":2275,"_31":2276,"_29":2277,"_156":2252,"_39":40,"_38":2278,"_158":56,"_36":2279,"_13":160,"_33":20,"_34":2280,"_23":24,"_162":-5,"_651":2281,"_26":2282},{"_41":2267,"_31":2268,"_29":2269,"_156":2252,"_39":40,"_38":2270,"_158":56,"_36":2271,"_13":160,"_33":20,"_34":2272,"_23":24,"_162":-5,"_651":2273,"_26":2274},{"_41":2259,"_31":2260,"_29":2261,"_156":2252,"_39":40,"_38":2262,"_158":56,"_36":2263,"_13":160,"_33":20,"_34":2264,"_23":24,"_162":-5,"_651":2265,"_26":2266},{"_41":2249,"_31":2250,"_29":2251,"_156":2252,"_39":40,"_38":2253,"_158":56,"_36":2254,"_13":160,"_33":20,"_34":2255,"_23":24,"_162":-5,"_651":2256,"_26":2257},{"_41":2243,"_31":891,"_29":884,"_156":2244,"_39":40,"_38":2245,"_158":56,"_36":2246,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2247,"_26":2248},{"_41":2238,"_31":2144,"_29":2138,"_156":884,"_39":40,"_38":2239,"_158":56,"_36":2240,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2241,"_26":2242},{"_41":2233,"_31":2217,"_29":2211,"_156":2138,"_39":40,"_38":2234,"_158":56,"_36":2235,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2236,"_26":2237},{"_41":2226,"_31":893,"_29":2227,"_156":2211,"_39":40,"_38":2228,"_158":56,"_36":2229,"_13":160,"_33":20,"_34":2230,"_23":24,"_162":-5,"_651":2231,"_26":2232},{"_41":2218,"_31":2219,"_29":2220,"_156":2211,"_39":40,"_38":2221,"_158":56,"_36":2222,"_13":160,"_33":20,"_34":2223,"_23":24,"_162":-5,"_651":2224,"_26":2225},{"_41":2208,"_31":2209,"_29":2210,"_156":2211,"_39":40,"_38":2212,"_158":56,"_36":2213,"_13":160,"_33":20,"_34":2214,"_23":24,"_162":-5,"_651":2215,"_26":2216},{"_41":2201,"_31":893,"_29":2202,"_156":2138,"_39":40,"_38":2203,"_158":56,"_36":2204,"_13":160,"_33":20,"_34":2205,"_23":24,"_162":-5,"_651":2206,"_26":2207},{"_41":2193,"_31":2194,"_29":2195,"_156":2138,"_39":40,"_38":2196,"_158":56,"_36":2197,"_13":160,"_33":20,"_34":2198,"_23":24,"_162":-5,"_651":2199,"_26":2200},{"_41":2185,"_31":2186,"_29":2187,"_156":2138,"_39":40,"_38":2188,"_158":56,"_36":2189,"_13":160,"_33":20,"_34":2190,"_23":24,"_162":-5,"_651":2191,"_26":2192},{"_41":2177,"_31":2178,"_29":2179,"_156":2138,"_39":40,"_38":2180,"_158":56,"_36":2181,"_13":160,"_33":20,"_34":2182,"_23":24,"_162":-5,"_651":2183,"_26":2184},{"_41":2169,"_31":2170,"_29":2171,"_156":2138,"_39":40,"_38":2172,"_158":56,"_36":2173,"_13":160,"_33":20,"_34":2174,"_23":24,"_162":-5,"_651":2175,"_26":2176},{"_41":2161,"_31":2162,"_29":2163,"_156":2138,"_39":40,"_38":2164,"_158":56,"_36":2165,"_13":160,"_33":20,"_34":2166,"_23":24,"_162":-5,"_651":2167,"_26":2168},{"_41":2153,"_31":2154,"_29":2155,"_156":2138,"_39":40,"_38":2156,"_158":56,"_36":2157,"_13":160,"_33":20,"_34":2158,"_23":24,"_162":-5,"_651":2159,"_26":2160},{"_41":2145,"_31":2146,"_29":2147,"_156":2138,"_39":40,"_38":2148,"_158":56,"_36":2149,"_13":160,"_33":20,"_34":2150,"_23":24,"_162":-5,"_651":2151,"_26":2152},{"_41":2135,"_31":2136,"_29":2137,"_156":2138,"_39":40,"_38":2139,"_158":56,"_36":2140,"_13":160,"_33":20,"_34":2141,"_23":24,"_162":-5,"_651":2142,"_26":2143},{"_41":2130,"_31":2115,"_29":2109,"_156":884,"_39":40,"_38":2131,"_158":56,"_36":2132,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2133,"_26":2134},{"_41":2123,"_31":893,"_29":2124,"_156":2109,"_39":40,"_38":2125,"_158":56,"_36":2126,"_13":160,"_33":20,"_34":2127,"_23":24,"_162":-5,"_651":2128,"_26":2129},{"_41":2116,"_31":1566,"_29":2117,"_156":2109,"_39":40,"_38":2118,"_158":56,"_36":2119,"_13":160,"_33":20,"_34":2120,"_23":24,"_162":-5,"_651":2121,"_26":2122},{"_41":2107,"_31":1886,"_29":2108,"_156":2109,"_39":40,"_38":2110,"_158":56,"_36":2111,"_13":160,"_33":20,"_34":2112,"_23":24,"_162":-5,"_651":2113,"_26":2114},{"_41":2102,"_31":2063,"_29":2057,"_156":884,"_39":40,"_38":2103,"_158":56,"_36":2104,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2105,"_26":2106},{"_41":2095,"_31":893,"_29":2096,"_156":2057,"_39":40,"_38":2097,"_158":56,"_36":2098,"_13":160,"_33":20,"_34":2099,"_23":24,"_162":-5,"_651":2100,"_26":2101},{"_41":2088,"_31":1566,"_29":2089,"_156":2057,"_39":40,"_38":2090,"_158":56,"_36":2091,"_13":160,"_33":20,"_34":2092,"_23":24,"_162":-5,"_651":2093,"_26":2094},{"_41":2080,"_31":2081,"_29":2082,"_156":2057,"_39":40,"_38":2083,"_158":56,"_36":2084,"_13":160,"_33":20,"_34":2085,"_23":24,"_162":-5,"_651":2086,"_26":2087},{"_41":2072,"_31":2073,"_29":2074,"_156":2057,"_39":40,"_38":2075,"_158":56,"_36":2076,"_13":160,"_33":20,"_34":2077,"_23":24,"_162":-5,"_651":2078,"_26":2079},{"_41":2064,"_31":2065,"_29":2066,"_156":2057,"_39":40,"_38":2067,"_158":56,"_36":2068,"_13":160,"_33":20,"_34":2069,"_23":24,"_162":-5,"_651":2070,"_26":2071},{"_41":2054,"_31":2055,"_29":2056,"_156":2057,"_39":40,"_38":2058,"_158":56,"_36":2059,"_13":160,"_33":20,"_34":2060,"_23":24,"_162":-5,"_651":2061,"_26":2062},{"_41":2049,"_31":1958,"_29":1952,"_156":884,"_39":40,"_38":2050,"_158":56,"_36":2051,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":2052,"_26":2053},{"_41":2042,"_31":893,"_29":2043,"_156":1952,"_39":40,"_38":2044,"_158":56,"_36":2045,"_13":160,"_33":20,"_34":2046,"_23":24,"_162":-5,"_651":2047,"_26":2048},{"_41":2035,"_31":1349,"_29":2036,"_156":1952,"_39":40,"_38":2037,"_158":56,"_36":2038,"_13":160,"_33":20,"_34":2039,"_23":24,"_162":-5,"_651":2040,"_26":2041},{"_41":2027,"_31":2028,"_29":2029,"_156":1952,"_39":40,"_38":2030,"_158":56,"_36":2031,"_13":160,"_33":20,"_34":2032,"_23":24,"_162":-5,"_651":2033,"_26":2034},{"_41":2019,"_31":2020,"_29":2021,"_156":1952,"_39":40,"_38":2022,"_158":56,"_36":2023,"_13":160,"_33":20,"_34":2024,"_23":24,"_162":-5,"_651":2025,"_26":2026},{"_41":2011,"_31":2012,"_29":2013,"_156":1952,"_39":40,"_38":2014,"_158":56,"_36":2015,"_13":160,"_33":20,"_34":2016,"_23":24,"_162":-5,"_651":2017,"_26":2018},{"_41":2003,"_31":2004,"_29":2005,"_156":1952,"_39":40,"_38":2006,"_158":56,"_36":2007,"_13":160,"_33":20,"_34":2008,"_23":24,"_162":-5,"_651":2009,"_26":2010},{"_41":1996,"_31":1735,"_29":1997,"_156":1952,"_39":40,"_38":1998,"_158":56,"_36":1999,"_13":160,"_33":20,"_34":2000,"_23":24,"_162":-5,"_651":2001,"_26":2002},{"_41":1989,"_31":1727,"_29":1990,"_156":1952,"_39":40,"_38":1991,"_158":56,"_36":1992,"_13":160,"_33":20,"_34":1993,"_23":24,"_162":-5,"_651":1994,"_26":1995},{"_41":1981,"_31":1982,"_29":1983,"_156":1952,"_39":40,"_38":1984,"_158":56,"_36":1985,"_13":160,"_33":20,"_34":1986,"_23":24,"_162":-5,"_651":1987,"_26":1988},{"_41":1973,"_31":1974,"_29":1975,"_156":1952,"_39":40,"_38":1976,"_158":56,"_36":1977,"_13":160,"_33":20,"_34":1978,"_23":24,"_162":-5,"_651":1979,"_26":1980},{"_41":1966,"_31":1461,"_29":1967,"_156":1952,"_39":40,"_38":1968,"_158":56,"_36":1969,"_13":160,"_33":20,"_34":1970,"_23":24,"_162":-5,"_651":1971,"_26":1972},{"_41":1959,"_31":1686,"_29":1960,"_156":1952,"_39":40,"_38":1961,"_158":56,"_36":1962,"_13":160,"_33":20,"_34":1963,"_23":24,"_162":-5,"_651":1964,"_26":1965},{"_41":1949,"_31":1950,"_29":1951,"_156":1952,"_39":40,"_38":1953,"_158":56,"_36":1954,"_13":160,"_33":20,"_34":1955,"_23":24,"_162":-5,"_651":1956,"_26":1957},{"_41":1944,"_31":1929,"_29":1923,"_156":884,"_39":40,"_38":1945,"_158":56,"_36":1946,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1947,"_26":1948},{"_41":1937,"_31":893,"_29":1938,"_156":1923,"_39":40,"_38":1939,"_158":56,"_36":1940,"_13":160,"_33":20,"_34":1941,"_23":24,"_162":-5,"_651":1942,"_26":1943},{"_41":1930,"_31":1566,"_29":1931,"_156":1923,"_39":40,"_38":1932,"_158":56,"_36":1933,"_13":160,"_33":20,"_34":1934,"_23":24,"_162":-5,"_651":1935,"_26":1936},{"_41":1920,"_31":1921,"_29":1922,"_156":1923,"_39":40,"_38":1924,"_158":56,"_36":1925,"_13":160,"_33":20,"_34":1926,"_23":24,"_162":-5,"_651":1927,"_26":1928},{"_41":1915,"_31":1868,"_29":1862,"_156":884,"_39":40,"_38":1916,"_158":56,"_36":1917,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1918,"_26":1919},{"_41":1908,"_31":893,"_29":1909,"_156":1862,"_39":40,"_38":1910,"_158":56,"_36":1911,"_13":160,"_33":20,"_34":1912,"_23":24,"_162":-5,"_651":1913,"_26":1914},{"_41":1900,"_31":1901,"_29":1902,"_156":1862,"_39":40,"_38":1903,"_158":56,"_36":1904,"_13":160,"_33":20,"_34":1905,"_23":24,"_162":-5,"_651":1906,"_26":1907},{"_41":1893,"_31":1349,"_29":1894,"_156":1862,"_39":40,"_38":1895,"_158":56,"_36":1896,"_13":160,"_33":20,"_34":1897,"_23":24,"_162":-5,"_651":1898,"_26":1899},{"_41":1885,"_31":1886,"_29":1887,"_156":1862,"_39":40,"_38":1888,"_158":56,"_36":1889,"_13":160,"_33":20,"_34":1890,"_23":24,"_162":-5,"_651":1891,"_26":1892},{"_41":1877,"_31":1878,"_29":1879,"_156":1862,"_39":40,"_38":1880,"_158":56,"_36":1881,"_13":160,"_33":20,"_34":1882,"_23":24,"_162":-5,"_651":1883,"_26":1884},{"_41":1869,"_31":1870,"_29":1871,"_156":1862,"_39":40,"_38":1872,"_158":56,"_36":1873,"_13":160,"_33":20,"_34":1874,"_23":24,"_162":-5,"_651":1875,"_26":1876},{"_41":1859,"_31":1860,"_29":1861,"_156":1862,"_39":40,"_38":1863,"_158":56,"_36":1864,"_13":160,"_33":20,"_34":1865,"_23":24,"_162":-5,"_651":1866,"_26":1867},{"_41":1854,"_31":1831,"_29":1825,"_156":884,"_39":40,"_38":1855,"_158":56,"_36":1856,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1857,"_26":1858},{"_41":1847,"_31":893,"_29":1848,"_156":1825,"_39":40,"_38":1849,"_158":56,"_36":1850,"_13":160,"_33":20,"_34":1851,"_23":24,"_162":-5,"_651":1852,"_26":1853},{"_41":1840,"_31":1333,"_29":1841,"_156":1825,"_39":40,"_38":1842,"_158":56,"_36":1843,"_13":160,"_33":20,"_34":1844,"_23":24,"_162":-5,"_651":1845,"_26":1846},{"_41":1832,"_31":1833,"_29":1834,"_156":1825,"_39":40,"_38":1835,"_158":56,"_36":1836,"_13":160,"_33":20,"_34":1837,"_23":24,"_162":-5,"_651":1838,"_26":1839},{"_41":1822,"_31":1823,"_29":1824,"_156":1825,"_39":40,"_38":1826,"_158":56,"_36":1827,"_13":160,"_33":20,"_34":1828,"_23":24,"_162":-5,"_651":1829,"_26":1830},{"_41":1817,"_31":1694,"_29":1688,"_156":884,"_39":40,"_38":1818,"_158":56,"_36":1819,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1820,"_26":1821},{"_41":1812,"_31":861,"_29":1799,"_156":1688,"_39":40,"_38":1813,"_158":56,"_36":1814,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1815,"_26":1816},{"_41":1805,"_31":893,"_29":1806,"_156":1799,"_39":40,"_38":1807,"_158":56,"_36":1808,"_13":160,"_33":20,"_34":1809,"_23":24,"_162":-5,"_651":1810,"_26":1811},{"_41":1796,"_31":1797,"_29":1798,"_156":1799,"_39":40,"_38":1800,"_158":56,"_36":1801,"_13":160,"_33":20,"_34":1802,"_23":24,"_162":-5,"_651":1803,"_26":1804},{"_41":1789,"_31":893,"_29":1790,"_156":1688,"_39":40,"_38":1791,"_158":56,"_36":1792,"_13":160,"_33":20,"_34":1793,"_23":24,"_162":-5,"_651":1794,"_26":1795},{"_41":1781,"_31":1782,"_29":1783,"_156":1688,"_39":40,"_38":1784,"_158":56,"_36":1785,"_13":160,"_33":20,"_34":1786,"_23":24,"_162":-5,"_651":1787,"_26":1788},{"_41":1773,"_31":1774,"_29":1775,"_156":1688,"_39":40,"_38":1776,"_158":56,"_36":1777,"_13":160,"_33":20,"_34":1778,"_23":24,"_162":-5,"_651":1779,"_26":1780},{"_41":1765,"_31":1766,"_29":1767,"_156":1688,"_39":40,"_38":1768,"_158":56,"_36":1769,"_13":160,"_33":20,"_34":1770,"_23":24,"_162":-5,"_651":1771,"_26":1772},{"_41":1758,"_31":1030,"_29":1759,"_156":1688,"_39":40,"_38":1760,"_158":56,"_36":1761,"_13":160,"_33":20,"_34":1762,"_23":24,"_162":-5,"_651":1763,"_26":1764},{"_41":1750,"_31":1751,"_29":1752,"_156":1688,"_39":40,"_38":1753,"_158":56,"_36":1754,"_13":160,"_33":20,"_34":1755,"_23":24,"_162":-5,"_651":1756,"_26":1757},{"_41":1742,"_31":1743,"_29":1744,"_156":1688,"_39":40,"_38":1745,"_158":56,"_36":1746,"_13":160,"_33":20,"_34":1747,"_23":24,"_162":-5,"_651":1748,"_26":1749},{"_41":1734,"_31":1735,"_29":1736,"_156":1688,"_39":40,"_38":1737,"_158":56,"_36":1738,"_13":160,"_33":20,"_34":1739,"_23":24,"_162":-5,"_651":1740,"_26":1741},{"_41":1726,"_31":1727,"_29":1728,"_156":1688,"_39":40,"_38":1729,"_158":56,"_36":1730,"_13":160,"_33":20,"_34":1731,"_23":24,"_162":-5,"_651":1732,"_26":1733},{"_41":1718,"_31":1719,"_29":1720,"_156":1688,"_39":40,"_38":1721,"_158":56,"_36":1722,"_13":160,"_33":20,"_34":1723,"_23":24,"_162":-5,"_651":1724,"_26":1725},{"_41":1710,"_31":1711,"_29":1712,"_156":1688,"_39":40,"_38":1713,"_158":56,"_36":1714,"_13":160,"_33":20,"_34":1715,"_23":24,"_162":-5,"_651":1716,"_26":1717},{"_41":1702,"_31":1703,"_29":1704,"_156":1688,"_39":40,"_38":1705,"_158":56,"_36":1706,"_13":160,"_33":20,"_34":1707,"_23":24,"_162":-5,"_651":1708,"_26":1709},{"_41":1695,"_31":1267,"_29":1696,"_156":1688,"_39":40,"_38":1697,"_158":56,"_36":1698,"_13":160,"_33":20,"_34":1699,"_23":24,"_162":-5,"_651":1700,"_26":1701},{"_41":1685,"_31":1686,"_29":1687,"_156":1688,"_39":40,"_38":1689,"_158":56,"_36":1690,"_13":160,"_33":20,"_34":1691,"_23":24,"_162":-5,"_651":1692,"_26":1693},{"_41":1678,"_31":1679,"_29":1680,"_156":884,"_39":40,"_38":1681,"_158":56,"_36":1682,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1683,"_26":1684},{"_41":1671,"_31":1672,"_29":1673,"_156":884,"_39":40,"_38":1674,"_158":56,"_36":1675,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1676,"_26":1677},{"_41":1666,"_31":1469,"_29":1463,"_156":884,"_39":40,"_38":1667,"_158":56,"_36":1668,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1669,"_26":1670},{"_41":1661,"_31":1660,"_29":1654,"_156":1463,"_39":40,"_38":1662,"_158":56,"_36":1663,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1664,"_26":1665},{"_41":1652,"_31":893,"_29":1653,"_156":1654,"_39":40,"_38":1655,"_158":56,"_36":1656,"_13":160,"_33":20,"_34":1657,"_23":24,"_162":-5,"_651":1658,"_26":1659},{"_41":1647,"_31":1639,"_29":1633,"_156":1463,"_39":40,"_38":1648,"_158":56,"_36":1649,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1650,"_26":1651},{"_41":1640,"_31":893,"_29":1641,"_156":1633,"_39":40,"_38":1642,"_158":56,"_36":1643,"_13":160,"_33":20,"_34":1644,"_23":24,"_162":-5,"_651":1645,"_26":1646},{"_41":1631,"_31":1581,"_29":1632,"_156":1633,"_39":40,"_38":1634,"_158":56,"_36":1635,"_13":160,"_33":20,"_34":1636,"_23":24,"_162":-5,"_651":1637,"_26":1638},{"_41":1626,"_31":1611,"_29":1605,"_156":1463,"_39":40,"_38":1627,"_158":56,"_36":1628,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1629,"_26":1630},{"_41":1619,"_31":893,"_29":1620,"_156":1605,"_39":40,"_38":1621,"_158":56,"_36":1622,"_13":160,"_33":20,"_34":1623,"_23":24,"_162":-5,"_651":1624,"_26":1625},{"_41":1612,"_31":1581,"_29":1613,"_156":1605,"_39":40,"_38":1614,"_158":56,"_36":1615,"_13":160,"_33":20,"_34":1616,"_23":24,"_162":-5,"_651":1617,"_26":1618},{"_41":1602,"_31":1603,"_29":1604,"_156":1605,"_39":40,"_38":1606,"_158":56,"_36":1607,"_13":160,"_33":20,"_34":1608,"_23":24,"_162":-5,"_651":1609,"_26":1610},{"_41":1597,"_31":1589,"_29":1583,"_156":1463,"_39":40,"_38":1598,"_158":56,"_36":1599,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1600,"_26":1601},{"_41":1590,"_31":893,"_29":1591,"_156":1583,"_39":40,"_38":1592,"_158":56,"_36":1593,"_13":160,"_33":20,"_34":1594,"_23":24,"_162":-5,"_651":1595,"_26":1596},{"_41":1580,"_31":1581,"_29":1582,"_156":1583,"_39":40,"_38":1584,"_158":56,"_36":1585,"_13":160,"_33":20,"_34":1586,"_23":24,"_162":-5,"_651":1587,"_26":1588},{"_41":1573,"_31":893,"_29":1574,"_156":1463,"_39":40,"_38":1575,"_158":56,"_36":1576,"_13":160,"_33":20,"_34":1577,"_23":24,"_162":-5,"_651":1578,"_26":1579},{"_41":1565,"_31":1566,"_29":1567,"_156":1463,"_39":40,"_38":1568,"_158":56,"_36":1569,"_13":160,"_33":20,"_34":1570,"_23":24,"_162":-5,"_651":1571,"_26":1572},{"_41":1557,"_31":1558,"_29":1559,"_156":1463,"_39":40,"_38":1560,"_158":56,"_36":1561,"_13":160,"_33":20,"_34":1562,"_23":24,"_162":-5,"_651":1563,"_26":1564},{"_41":1549,"_31":1550,"_29":1551,"_156":1463,"_39":40,"_38":1552,"_158":56,"_36":1553,"_13":160,"_33":20,"_34":1554,"_23":24,"_162":-5,"_651":1555,"_26":1556},{"_41":1541,"_31":1542,"_29":1543,"_156":1463,"_39":40,"_38":1544,"_158":56,"_36":1545,"_13":160,"_33":20,"_34":1546,"_23":24,"_162":-5,"_651":1547,"_26":1548},{"_41":1533,"_31":1534,"_29":1535,"_156":1463,"_39":40,"_38":1536,"_158":56,"_36":1537,"_13":160,"_33":20,"_34":1538,"_23":24,"_162":-5,"_651":1539,"_26":1540},{"_41":1525,"_31":1526,"_29":1527,"_156":1463,"_39":40,"_38":1528,"_158":56,"_36":1529,"_13":160,"_33":20,"_34":1530,"_23":24,"_162":-5,"_651":1531,"_26":1532},{"_41":1517,"_31":1518,"_29":1519,"_156":1463,"_39":40,"_38":1520,"_158":56,"_36":1521,"_13":160,"_33":20,"_34":1522,"_23":24,"_162":-5,"_651":1523,"_26":1524},{"_41":1509,"_31":1510,"_29":1511,"_156":1463,"_39":40,"_38":1512,"_158":56,"_36":1513,"_13":160,"_33":20,"_34":1514,"_23":24,"_162":-5,"_651":1515,"_26":1516},{"_41":1501,"_31":1502,"_29":1503,"_156":1463,"_39":40,"_38":1504,"_158":56,"_36":1505,"_13":160,"_33":20,"_34":1506,"_23":24,"_162":-5,"_651":1507,"_26":1508},{"_41":1493,"_31":1494,"_29":1495,"_156":1463,"_39":40,"_38":1496,"_158":56,"_36":1497,"_13":160,"_33":20,"_34":1498,"_23":24,"_162":-5,"_651":1499,"_26":1500},{"_41":1486,"_31":1084,"_29":1487,"_156":1463,"_39":40,"_38":1488,"_158":56,"_36":1489,"_13":160,"_33":20,"_34":1490,"_23":24,"_162":-5,"_651":1491,"_26":1492},{"_41":1478,"_31":1479,"_29":1480,"_156":1463,"_39":40,"_38":1481,"_158":56,"_36":1482,"_13":160,"_33":20,"_34":1483,"_23":24,"_162":-5,"_651":1484,"_26":1485},{"_41":1470,"_31":1471,"_29":1472,"_156":1463,"_39":40,"_38":1473,"_158":56,"_36":1474,"_13":160,"_33":20,"_34":1475,"_23":24,"_162":-5,"_651":1476,"_26":1477},{"_41":1460,"_31":1461,"_29":1462,"_156":1463,"_39":40,"_38":1464,"_158":56,"_36":1465,"_13":160,"_33":20,"_34":1466,"_23":24,"_162":-5,"_651":1467,"_26":1468},{"_41":1455,"_31":1425,"_29":1419,"_156":884,"_39":40,"_38":1456,"_158":56,"_36":1457,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1458,"_26":1459},{"_41":1450,"_31":1442,"_29":1436,"_156":1419,"_39":40,"_38":1451,"_158":56,"_36":1452,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1453,"_26":1454},{"_41":1443,"_31":893,"_29":1444,"_156":1436,"_39":40,"_38":1445,"_158":56,"_36":1446,"_13":160,"_33":20,"_34":1447,"_23":24,"_162":-5,"_651":1448,"_26":1449},{"_41":1433,"_31":1434,"_29":1435,"_156":1436,"_39":40,"_38":1437,"_158":56,"_36":1438,"_13":160,"_33":20,"_34":1439,"_23":24,"_162":-5,"_651":1440,"_26":1441},{"_41":1426,"_31":893,"_29":1427,"_156":1419,"_39":40,"_38":1428,"_158":56,"_36":1429,"_13":160,"_33":20,"_34":1430,"_23":24,"_162":-5,"_651":1431,"_26":1432},{"_41":1416,"_31":1417,"_29":1418,"_156":1419,"_39":40,"_38":1420,"_158":56,"_36":1421,"_13":160,"_33":20,"_34":1422,"_23":24,"_162":-5,"_651":1423,"_26":1424},{"_41":1411,"_31":1275,"_29":1269,"_156":884,"_39":40,"_38":1412,"_158":56,"_36":1413,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1414,"_26":1415},{"_41":1404,"_31":893,"_29":1405,"_156":1269,"_39":40,"_38":1406,"_158":56,"_36":1407,"_13":160,"_33":20,"_34":1408,"_23":24,"_162":-5,"_651":1409,"_26":1410},{"_41":1396,"_31":1397,"_29":1398,"_156":1269,"_39":40,"_38":1399,"_158":56,"_36":1400,"_13":160,"_33":20,"_34":1401,"_23":24,"_162":-5,"_651":1402,"_26":1403},{"_41":1388,"_31":1389,"_29":1390,"_156":1269,"_39":40,"_38":1391,"_158":56,"_36":1392,"_13":160,"_33":20,"_34":1393,"_23":24,"_162":-5,"_651":1394,"_26":1395},{"_41":1380,"_31":1381,"_29":1382,"_156":1269,"_39":40,"_38":1383,"_158":56,"_36":1384,"_13":160,"_33":20,"_34":1385,"_23":24,"_162":-5,"_651":1386,"_26":1387},{"_41":1372,"_31":1373,"_29":1374,"_156":1269,"_39":40,"_38":1375,"_158":56,"_36":1376,"_13":160,"_33":20,"_34":1377,"_23":24,"_162":-5,"_651":1378,"_26":1379},{"_41":1364,"_31":1365,"_29":1366,"_156":1269,"_39":40,"_38":1367,"_158":56,"_36":1368,"_13":160,"_33":20,"_34":1369,"_23":24,"_162":-5,"_651":1370,"_26":1371},{"_41":1356,"_31":1357,"_29":1358,"_156":1269,"_39":40,"_38":1359,"_158":56,"_36":1360,"_13":160,"_33":20,"_34":1361,"_23":24,"_162":-5,"_651":1362,"_26":1363},{"_41":1348,"_31":1349,"_29":1350,"_156":1269,"_39":40,"_38":1351,"_158":56,"_36":1352,"_13":160,"_33":20,"_34":1353,"_23":24,"_162":-5,"_651":1354,"_26":1355},{"_41":1340,"_31":1341,"_29":1342,"_156":1269,"_39":40,"_38":1343,"_158":56,"_36":1344,"_13":160,"_33":20,"_34":1345,"_23":24,"_162":-5,"_651":1346,"_26":1347},{"_41":1332,"_31":1333,"_29":1334,"_156":1269,"_39":40,"_38":1335,"_158":56,"_36":1336,"_13":160,"_33":20,"_34":1337,"_23":24,"_162":-5,"_651":1338,"_26":1339},{"_41":1324,"_31":1325,"_29":1326,"_156":1269,"_39":40,"_38":1327,"_158":56,"_36":1328,"_13":160,"_33":20,"_34":1329,"_23":24,"_162":-5,"_651":1330,"_26":1331},{"_41":1316,"_31":1317,"_29":1318,"_156":1269,"_39":40,"_38":1319,"_158":56,"_36":1320,"_13":160,"_33":20,"_34":1321,"_23":24,"_162":-5,"_651":1322,"_26":1323},{"_41":1308,"_31":1309,"_29":1310,"_156":1269,"_39":40,"_38":1311,"_158":56,"_36":1312,"_13":160,"_33":20,"_34":1313,"_23":24,"_162":-5,"_651":1314,"_26":1315},{"_41":1300,"_31":1301,"_29":1302,"_156":1269,"_39":40,"_38":1303,"_158":56,"_36":1304,"_13":160,"_33":20,"_34":1305,"_23":24,"_162":-5,"_651":1306,"_26":1307},{"_41":1292,"_31":1293,"_29":1294,"_156":1269,"_39":40,"_38":1295,"_158":56,"_36":1296,"_13":160,"_33":20,"_34":1297,"_23":24,"_162":-5,"_651":1298,"_26":1299},{"_41":1284,"_31":1285,"_29":1286,"_156":1269,"_39":40,"_38":1287,"_158":56,"_36":1288,"_13":160,"_33":20,"_34":1289,"_23":24,"_162":-5,"_651":1290,"_26":1291},{"_41":1276,"_31":1277,"_29":1278,"_156":1269,"_39":40,"_38":1279,"_158":56,"_36":1280,"_13":160,"_33":20,"_34":1281,"_23":24,"_162":-5,"_651":1282,"_26":1283},{"_41":1266,"_31":1267,"_29":1268,"_156":1269,"_39":40,"_38":1270,"_158":56,"_36":1271,"_13":160,"_33":20,"_34":1272,"_23":24,"_162":-5,"_651":1273,"_26":1274},{"_41":1261,"_31":1260,"_29":1255,"_156":884,"_39":40,"_38":1262,"_158":56,"_36":1263,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1264,"_26":1265},{"_41":1252,"_31":1253,"_29":1254,"_156":1255,"_39":40,"_38":1256,"_158":56,"_36":1257,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1258,"_26":1259},{"_41":1247,"_31":1058,"_29":1052,"_156":884,"_39":40,"_38":1248,"_158":56,"_36":1249,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1250,"_26":1251},{"_41":1239,"_31":1240,"_29":1241,"_156":1052,"_39":40,"_38":1242,"_158":56,"_36":1243,"_13":160,"_33":20,"_34":1244,"_23":24,"_162":-5,"_651":1245,"_26":1246},{"_41":1231,"_31":1232,"_29":1233,"_156":1052,"_39":40,"_38":1234,"_158":56,"_36":1235,"_13":160,"_33":20,"_34":1236,"_23":24,"_162":-5,"_651":1237,"_26":1238},{"_41":1223,"_31":1224,"_29":1225,"_156":1052,"_39":40,"_38":1226,"_158":56,"_36":1227,"_13":160,"_33":20,"_34":1228,"_23":24,"_162":-5,"_651":1229,"_26":1230},{"_41":1215,"_31":1216,"_29":1217,"_156":1052,"_39":40,"_38":1218,"_158":56,"_36":1219,"_13":160,"_33":20,"_34":1220,"_23":24,"_162":-5,"_651":1221,"_26":1222},{"_41":1207,"_31":1208,"_29":1209,"_156":1052,"_39":40,"_38":1210,"_158":56,"_36":1211,"_13":160,"_33":20,"_34":1212,"_23":24,"_162":-5,"_651":1213,"_26":1214},{"_41":1199,"_31":1200,"_29":1201,"_156":1052,"_39":40,"_38":1202,"_158":56,"_36":1203,"_13":160,"_33":20,"_34":1204,"_23":24,"_162":-5,"_651":1205,"_26":1206},{"_41":1191,"_31":1192,"_29":1193,"_156":1052,"_39":40,"_38":1194,"_158":56,"_36":1195,"_13":160,"_33":20,"_34":1196,"_23":24,"_162":-5,"_651":1197,"_26":1198},{"_41":1183,"_31":1184,"_29":1185,"_156":1052,"_39":40,"_38":1186,"_158":56,"_36":1187,"_13":160,"_33":20,"_34":1188,"_23":24,"_162":-5,"_651":1189,"_26":1190},{"_41":1175,"_31":1176,"_29":1177,"_156":1052,"_39":40,"_38":1178,"_158":56,"_36":1179,"_13":160,"_33":20,"_34":1180,"_23":24,"_162":-5,"_651":1181,"_26":1182},{"_41":1167,"_31":1168,"_29":1169,"_156":1052,"_39":40,"_38":1170,"_158":56,"_36":1171,"_13":160,"_33":20,"_34":1172,"_23":24,"_162":-5,"_651":1173,"_26":1174},{"_41":1163,"_31":32,"_29":30,"_156":1052,"_39":40,"_38":14,"_158":56,"_36":1164,"_13":160,"_33":20,"_34":35,"_23":24,"_162":-5,"_651":1165,"_26":1166},{"_41":1155,"_31":1156,"_29":1157,"_156":1052,"_39":40,"_38":1158,"_158":56,"_36":1159,"_13":160,"_33":20,"_34":1160,"_23":24,"_162":-5,"_651":1161,"_26":1162},{"_41":1147,"_31":1148,"_29":1149,"_156":1052,"_39":40,"_38":1150,"_158":56,"_36":1151,"_13":160,"_33":20,"_34":1152,"_23":24,"_162":-5,"_651":1153,"_26":1154},{"_41":1139,"_31":1140,"_29":1141,"_156":1052,"_39":40,"_38":1142,"_158":56,"_36":1143,"_13":160,"_33":20,"_34":1144,"_23":24,"_162":-5,"_651":1145,"_26":1146},{"_41":1131,"_31":1132,"_29":1133,"_156":1052,"_39":40,"_38":1134,"_158":56,"_36":1135,"_13":160,"_33":20,"_34":1136,"_23":24,"_162":-5,"_651":1137,"_26":1138},{"_41":1123,"_31":1124,"_29":1125,"_156":1052,"_39":40,"_38":1126,"_158":56,"_36":1127,"_13":160,"_33":20,"_34":1128,"_23":24,"_162":-5,"_651":1129,"_26":1130},{"_41":1115,"_31":1116,"_29":1117,"_156":1052,"_39":40,"_38":1118,"_158":56,"_36":1119,"_13":160,"_33":20,"_34":1120,"_23":24,"_162":-5,"_651":1121,"_26":1122},{"_41":1107,"_31":1108,"_29":1109,"_156":1052,"_39":40,"_38":1110,"_158":56,"_36":1111,"_13":160,"_33":20,"_34":1112,"_23":24,"_162":-5,"_651":1113,"_26":1114},{"_41":1099,"_31":1100,"_29":1101,"_156":1052,"_39":40,"_38":1102,"_158":56,"_36":1103,"_13":160,"_33":20,"_34":1104,"_23":24,"_162":-5,"_651":1105,"_26":1106},{"_41":1091,"_31":1092,"_29":1093,"_156":1052,"_39":40,"_38":1094,"_158":56,"_36":1095,"_13":160,"_33":20,"_34":1096,"_23":24,"_162":-5,"_651":1097,"_26":1098},{"_41":1083,"_31":1084,"_29":1085,"_156":1052,"_39":40,"_38":1086,"_158":56,"_36":1087,"_13":160,"_33":20,"_34":1088,"_23":24,"_162":-5,"_651":1089,"_26":1090},{"_41":1075,"_31":1076,"_29":1077,"_156":1052,"_39":40,"_38":1078,"_158":56,"_36":1079,"_13":160,"_33":20,"_34":1080,"_23":24,"_162":-5,"_651":1081,"_26":1082},{"_41":1067,"_31":1068,"_29":1069,"_156":1052,"_39":40,"_38":1070,"_158":56,"_36":1071,"_13":160,"_33":20,"_34":1072,"_23":24,"_162":-5,"_651":1073,"_26":1074},{"_41":1059,"_31":1060,"_29":1061,"_156":1052,"_39":40,"_38":1062,"_158":56,"_36":1063,"_13":160,"_33":20,"_34":1064,"_23":24,"_162":-5,"_651":1065,"_26":1066},{"_41":1049,"_31":1050,"_29":1051,"_156":1052,"_39":40,"_38":1053,"_158":56,"_36":1054,"_13":160,"_33":20,"_34":1055,"_23":24,"_162":-5,"_651":1056,"_26":1057},{"_41":1044,"_31":1012,"_29":1006,"_156":884,"_39":40,"_38":1045,"_158":56,"_36":1046,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1047,"_26":1048},{"_41":1037,"_31":893,"_29":1038,"_156":1006,"_39":40,"_38":1039,"_158":56,"_36":1040,"_13":160,"_33":20,"_34":1041,"_23":24,"_162":-5,"_651":1042,"_26":1043},{"_41":1029,"_31":1030,"_29":1031,"_156":1006,"_39":40,"_38":1032,"_158":56,"_36":1033,"_13":160,"_33":20,"_34":1034,"_23":24,"_162":-5,"_651":1035,"_26":1036},{"_41":1021,"_31":1022,"_29":1023,"_156":1006,"_39":40,"_38":1024,"_158":56,"_36":1025,"_13":160,"_33":20,"_34":1026,"_23":24,"_162":-5,"_651":1027,"_26":1028},{"_41":1013,"_31":1014,"_29":1015,"_156":1006,"_39":40,"_38":1016,"_158":56,"_36":1017,"_13":160,"_33":20,"_34":1018,"_23":24,"_162":-5,"_651":1019,"_26":1020},{"_41":1003,"_31":1004,"_29":1005,"_156":1006,"_39":40,"_38":1007,"_158":56,"_36":1008,"_13":160,"_33":20,"_34":1009,"_23":24,"_162":-5,"_651":1010,"_26":1011},{"_41":996,"_31":997,"_29":998,"_156":884,"_39":40,"_38":999,"_158":56,"_36":1000,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":1001,"_26":1002},{"_41":991,"_31":951,"_29":945,"_156":884,"_39":40,"_38":992,"_158":56,"_36":993,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":994,"_26":995},{"_41":984,"_31":893,"_29":985,"_156":945,"_39":40,"_38":986,"_158":56,"_36":987,"_13":160,"_33":20,"_34":988,"_23":24,"_162":-5,"_651":989,"_26":990},{"_41":976,"_31":977,"_29":978,"_156":945,"_39":40,"_38":979,"_158":56,"_36":980,"_13":160,"_33":20,"_34":981,"_23":24,"_162":-5,"_651":982,"_26":983},{"_41":968,"_31":969,"_29":970,"_156":945,"_39":40,"_38":971,"_158":56,"_36":972,"_13":160,"_33":20,"_34":973,"_23":24,"_162":-5,"_651":974,"_26":975},{"_41":960,"_31":961,"_29":962,"_156":945,"_39":40,"_38":963,"_158":56,"_36":964,"_13":160,"_33":20,"_34":965,"_23":24,"_162":-5,"_651":966,"_26":967},{"_41":952,"_31":953,"_29":954,"_156":945,"_39":40,"_38":955,"_158":56,"_36":956,"_13":160,"_33":20,"_34":957,"_23":24,"_162":-5,"_651":958,"_26":959},{"_41":942,"_31":943,"_29":944,"_156":945,"_39":40,"_38":946,"_158":56,"_36":947,"_13":160,"_33":20,"_34":948,"_23":24,"_162":-5,"_651":949,"_26":950},{"_41":937,"_31":908,"_29":903,"_156":884,"_39":40,"_38":938,"_158":56,"_36":939,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":940,"_26":941},{"_41":932,"_31":931,"_29":926,"_156":903,"_39":40,"_38":933,"_158":56,"_36":934,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":935,"_26":936},{"_41":923,"_31":924,"_29":925,"_156":926,"_39":40,"_38":927,"_158":56,"_36":928,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":929,"_26":930},{"_41":918,"_31":917,"_29":912,"_156":903,"_39":40,"_38":919,"_158":56,"_36":920,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":921,"_26":922},{"_41":909,"_31":910,"_29":911,"_156":912,"_39":40,"_38":913,"_158":56,"_36":914,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":915,"_26":916},{"_41":900,"_31":901,"_29":902,"_156":903,"_39":40,"_38":904,"_158":56,"_36":905,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":906,"_26":907},{"_41":892,"_31":893,"_29":894,"_156":884,"_39":40,"_38":895,"_158":56,"_36":896,"_13":160,"_33":20,"_34":897,"_23":24,"_162":-5,"_651":898,"_26":899},{"_41":881,"_31":882,"_29":883,"_156":884,"_39":40,"_38":885,"_158":56,"_36":886,"_13":160,"_33":20,"_34":887,"_23":24,"_162":-5,"_651":888,"_26":889},{"_41":875,"_31":812,"_29":803,"_156":876,"_39":40,"_38":877,"_158":56,"_36":878,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":879,"_26":880},{"_41":870,"_31":861,"_29":855,"_156":803,"_39":40,"_38":871,"_158":56,"_36":872,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":873,"_26":874},{"_41":862,"_31":863,"_29":864,"_156":855,"_39":40,"_38":865,"_158":56,"_36":866,"_13":160,"_33":20,"_34":867,"_23":24,"_162":-5,"_651":868,"_26":869},{"_41":852,"_31":853,"_29":854,"_156":855,"_39":40,"_38":856,"_158":56,"_36":857,"_13":160,"_33":20,"_34":858,"_23":24,"_162":-5,"_651":859,"_26":860},{"_41":845,"_31":846,"_29":847,"_156":803,"_39":40,"_38":848,"_158":56,"_36":849,"_13":160,"_33":20,"_34":806,"_23":24,"_162":-5,"_651":850,"_26":851},{"_41":837,"_31":838,"_29":839,"_156":803,"_39":40,"_38":840,"_158":56,"_36":841,"_13":160,"_33":20,"_34":842,"_23":24,"_162":-5,"_651":843,"_26":844},{"_41":829,"_31":830,"_29":831,"_156":803,"_39":40,"_38":832,"_158":56,"_36":833,"_13":160,"_33":20,"_34":834,"_23":24,"_162":-5,"_651":835,"_26":836},{"_41":821,"_31":822,"_29":823,"_156":803,"_39":40,"_38":824,"_158":56,"_36":825,"_13":160,"_33":20,"_34":826,"_23":24,"_162":-5,"_651":827,"_26":828},{"_41":813,"_31":814,"_29":815,"_156":803,"_39":40,"_38":816,"_158":56,"_36":817,"_13":160,"_33":20,"_34":818,"_23":24,"_162":-5,"_651":819,"_26":820},{"_41":800,"_31":801,"_29":802,"_156":803,"_39":40,"_38":804,"_158":56,"_36":805,"_13":160,"_33":20,"_34":806,"_23":24,"_162":-5,"_651":807,"_26":808},{"_41":793,"_31":180,"_29":794,"_156":217,"_39":40,"_38":795,"_158":56,"_36":796,"_13":160,"_33":20,"_34":797,"_23":24,"_162":-5,"_651":798,"_26":799},{"_41":785,"_31":786,"_29":787,"_156":217,"_39":40,"_38":788,"_158":56,"_36":789,"_13":160,"_33":20,"_34":790,"_23":24,"_162":-5,"_651":791,"_26":792},{"_41":777,"_31":778,"_29":779,"_156":217,"_39":40,"_38":780,"_158":56,"_36":781,"_13":160,"_33":20,"_34":782,"_23":24,"_162":-5,"_651":783,"_26":784},{"_41":210,"_31":211,"_29":212,"_156":-5,"_39":40,"_38":60,"_158":56,"_36":774,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":775,"_26":776},{"_41":769,"_31":205,"_29":763,"_156":212,"_39":40,"_38":770,"_158":56,"_36":771,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":772,"_26":773},{"_41":760,"_31":761,"_29":762,"_156":763,"_39":40,"_38":764,"_158":24,"_36":765,"_13":160,"_33":701,"_34":766,"_23":24,"_162":-5,"_651":767,"_26":768},{"_41":752,"_31":753,"_29":54,"_156":212,"_39":40,"_38":754,"_158":24,"_36":755,"_13":60,"_33":756,"_34":757,"_23":24,"_162":43,"_651":758,"_26":759},{"_41":204,"_31":205,"_29":206,"_156":-5,"_39":40,"_38":207,"_158":24,"_36":749,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":750,"_26":751},{"_41":198,"_31":199,"_29":200,"_156":-5,"_39":40,"_38":201,"_158":56,"_36":746,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":747,"_26":748},{"_41":193,"_31":194,"_29":195,"_156":-5,"_39":40,"_38":60,"_158":56,"_36":743,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":744,"_26":745},{"_41":739,"_31":730,"_29":724,"_156":195,"_39":40,"_38":60,"_158":56,"_36":740,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":741,"_26":742},{"_41":731,"_31":732,"_29":733,"_156":724,"_39":40,"_38":734,"_158":24,"_36":735,"_13":160,"_33":701,"_34":736,"_23":24,"_162":-5,"_651":737,"_26":738},{"_41":721,"_31":722,"_29":723,"_156":724,"_39":40,"_38":725,"_158":56,"_36":726,"_13":60,"_33":701,"_34":727,"_23":24,"_162":-5,"_651":728,"_26":729},{"_41":713,"_31":714,"_29":715,"_156":195,"_39":40,"_38":716,"_158":56,"_36":717,"_13":60,"_33":20,"_34":718,"_23":24,"_162":-5,"_651":719,"_26":720},{"_41":705,"_31":706,"_29":707,"_156":195,"_39":40,"_38":708,"_158":56,"_36":709,"_13":60,"_33":20,"_34":710,"_23":24,"_162":-5,"_651":711,"_26":712},{"_41":697,"_31":698,"_29":699,"_156":195,"_39":40,"_38":60,"_158":56,"_36":700,"_13":160,"_33":701,"_34":702,"_23":24,"_162":-5,"_651":703,"_26":704},{"_41":689,"_31":690,"_29":691,"_156":195,"_39":40,"_38":692,"_158":24,"_36":693,"_13":60,"_33":20,"_34":694,"_23":24,"_162":-5,"_651":695,"_26":696},{"_41":186,"_31":187,"_29":188,"_156":-5,"_39":40,"_38":189,"_158":56,"_36":686,"_13":160,"_33":191,"_34":-5,"_23":24,"_162":-5,"_651":687,"_26":688},{"_41":679,"_31":165,"_29":680,"_156":188,"_39":40,"_38":681,"_158":56,"_36":682,"_13":160,"_33":20,"_34":683,"_23":24,"_162":-5,"_651":684,"_26":685},{"_41":671,"_31":672,"_29":673,"_156":188,"_39":40,"_38":674,"_158":56,"_36":675,"_13":160,"_33":20,"_34":676,"_23":24,"_162":-5,"_651":677,"_26":678},{"_41":663,"_31":664,"_29":665,"_156":188,"_39":40,"_38":666,"_158":56,"_36":667,"_13":160,"_33":20,"_34":668,"_23":24,"_162":-5,"_651":669,"_26":670},{"_41":179,"_31":180,"_29":181,"_156":-5,"_39":40,"_38":182,"_158":24,"_36":660,"_13":176,"_33":20,"_34":184,"_23":24,"_162":-5,"_651":661,"_26":662},{"_41":171,"_31":172,"_29":173,"_156":-5,"_39":40,"_38":174,"_158":24,"_36":657,"_13":176,"_33":20,"_34":177,"_23":24,"_162":-5,"_651":658,"_26":659},{"_41":164,"_31":165,"_29":166,"_156":-5,"_39":40,"_38":167,"_158":56,"_36":654,"_13":60,"_33":20,"_34":169,"_23":24,"_162":-5,"_651":655,"_26":656},{"_41":153,"_31":154,"_29":155,"_156":-5,"_39":40,"_38":157,"_158":56,"_36":650,"_13":160,"_33":20,"_34":161,"_23":24,"_162":-5,"_651":652,"_26":653},["D",1753295286180],"children",[],[154],["D",1753295286718],[],[165],["D",1753295642961],[],[172],["D",1753295646586],[],[180],"03bcf472-67fc-11f0-a7d9-0224a6c84d84","extract_top_posts.py","03bcf558-67fc-11f0-a7d9-0224a6c84d84",108,["D",1753299254044],"#!/usr/bin/env python3\n\nimport os\nimport sqlite3\nimport sys\nfrom pathlib import Path\n\n\"\"\"\nThis script extracts the top 100 most popular posts (by score) and all their comments\nfrom AmItheAsshole.sqlite database to a new SQLite database file.\n\"\"\"\n\nSOURCE_DB_PATH = \"../db/AmItheAsshole.sqlite\"\nTARGET_DB_PATH = \"../db/top100.sqlite\"\n\n\ndef main():\n print(f\"Extracting top 100 posts from {SOURCE_DB_PATH} to {TARGET_DB_PATH}...\")\n\n # Check if source file exists before opening\n source_path = Path(SOURCE_DB_PATH)\n if not source_path.exists():\n print(f\"Error: Source database file not found: {SOURCE_DB_PATH}. Please ensure the file exists.\")\n sys.exit(1)\n elif not source_path.is_file():\n print(f\"Error: Source database path exists but is not a file: {SOURCE_DB_PATH}\")\n sys.exit(1)\n\n # Create directory for target database if needed\n target_dir = os.path.dirname(TARGET_DB_PATH)\n os.makedirs(target_dir, exist_ok=True)\n print(f\"Ensured directory {target_dir} exists.\")\n\n # Remove target file if it exists\n if os.path.exists(TARGET_DB_PATH):\n os.remove(TARGET_DB_PATH)\n print(\"Removed existing target database.\")\n\n try:\n # Open source database\n print(\"Opening source database...\")\n source_conn = sqlite3.connect(SOURCE_DB_PATH)\n source_conn.row_factory = sqlite3.Row # Use Row to access columns by name\n source_cursor = source_conn.cursor()\n print(\"Source database opened successfully.\")\n\n # Create target database\n print(\"Creating target database...\")\n target_conn = sqlite3.connect(TARGET_DB_PATH)\n target_conn.row_factory = sqlite3.Row\n target_cursor = target_conn.cursor()\n print(\"Target database created successfully.\")\n\n # Create tables in target database\n target_cursor.executescript(\"\"\"\n CREATE TABLE IF NOT EXISTS \"submission\" (\n \"id\" INTEGER NOT NULL PRIMARY KEY,\n \"submission_id\" VARCHAR(255) NOT NULL,\n \"title\" TEXT NOT NULL,\n \"selftext\" TEXT NOT NULL,\n \"created_utc\" DATE NOT NULL,\n \"permalink\" TEXT NOT NULL,\n \"score\" INTEGER NOT NULL\n );\n CREATE UNIQUE INDEX \"submission_submission_id\" ON \"submission\" (\"submission_id\");\n\n CREATE TABLE IF NOT EXISTS \"comment\" (\n \"id\" INTEGER NOT NULL PRIMARY KEY,\n \"submission_id\" INTEGER NOT NULL,\n \"message\" TEXT NOT NULL,\n \"comment_id\" VARCHAR(255) NOT NULL,\n \"parent_id\" VARCHAR(255) NOT NULL,\n \"created_utc\" DATE NOT NULL,\n \"score\" INTEGER NOT NULL,\n FOREIGN KEY (\"submission_id\") REFERENCES \"submission\" (\"id\")\n );\n CREATE INDEX \"comment_submission_id\" ON \"comment\" (\"submission_id\");\n CREATE UNIQUE INDEX \"comment_comment_id\" ON \"comment\" (\"comment_id\");\n \"\"\")\n print(\"Target database tables created.\")\n\n # Begin transaction for better performance and data integrity\n target_conn.execute('BEGIN TRANSACTION')\n\n # Get top 100 submissions by score\n source_cursor.execute(\"\"\"\n SELECT id, submission_id, title, selftext, created_utc, permalink, score \n FROM submission \n ORDER BY score DESC \n LIMIT 100\n \"\"\")\n top_submissions = source_cursor.fetchall()\n print(f\"Found {len(top_submissions)} top submissions.\")\n\n # Insert submissions into target database\n insert_submission_sql = \"\"\"\n INSERT INTO submission (id, submission_id, title, selftext, created_utc, permalink, score) \n VALUES (?, ?, ?, ?, ?, ?, ?)\n \"\"\"\n\n # Keep track of submission_id values (not the id field) for comment lookup\n submission_id_list = []\n for submission in top_submissions:\n # Convert from sqlite3.Row to tuple\n target_cursor.execute(\n insert_submission_sql, \n (\n submission['id'],\n submission['submission_id'],\n submission['title'],\n submission['selftext'],\n submission['created_utc'],\n submission['permalink'],\n submission['score']\n )\n )\n # Store the actual submission_id (Reddit ID) for comment lookup\n submission_id_list.append(submission['submission_id'])\n print(\"Inserted submissions into target database.\")\n\n # Get and insert comments for each submission\n total_comments = 0\n\n # Updated query to use submission_id instead of id\n get_comments_sql = \"\"\"\n SELECT c.id, c.submission_id, c.message, c.comment_id, c.parent_id, c.created_utc, c.score \n FROM comment c\n WHERE c.submission_id = ?\n \"\"\"\n\n insert_comment_sql = \"\"\"\n INSERT INTO comment (id, submission_id, message, comment_id, parent_id, created_utc, score) \n VALUES (?, ?, ?, ?, ?, ?, ?)\n \"\"\"\n\n for i, submission in enumerate(top_submissions):\n # Use the submission_id field (Reddit ID) to find comments\n reddit_submission_id = submission['submission_id']\n source_cursor.execute(get_comments_sql, (reddit_submission_id,))\n comments = source_cursor.fetchall()\n\n for comment in comments:\n target_cursor.execute(\n insert_comment_sql,\n (\n comment['id'],\n comment['submission_id'],\n comment['message'],\n comment['comment_id'],\n comment['parent_id'],\n comment['created_utc'],\n comment['score']\n )\n )\n\n total_comments += len(comments)\n print(f\"Processed {len(comments)} comments for submission '{reddit_submission_id}' (score: {submission['score']}).\")\n\n print(f\"Total comments processed: {total_comments}\")\n\n # Commit transaction\n target_conn.execute('COMMIT')\n print('Database transaction committed successfully.')\n\n # Close connections\n source_conn.close()\n target_conn.close()\n\n print(\"\\nExtraction complete!\")\n print(f\"Original database: {SOURCE_DB_PATH}\")\n print(f\"New database with top 100 posts: {TARGET_DB_PATH}\")\n print(f\"Total posts extracted: {len(top_submissions)}\")\n print(f\"Total comments extracted: {total_comments}\")\n\n except sqlite3.Error as e:\n print(f\"SQLite error: {e}\")\n try:\n # Try to rollback transaction if possible\n target_conn.execute('ROLLBACK')\n print('Transaction rolled back due to error.')\n except Exception as rollback_error:\n print(f\"Error during rollback: {rollback_error}\")\n sys.exit(1)\n except Exception as e:\n print(f\"Error during extraction: {e}\")\n sys.exit(1)\n\n\nif __name__ == \"__main__\":\n main()",[],[187,664],"03ba4cb8-67fc-11f0-8b06-0224a6c84d84","analyse_posts.py","03ba4d62-67fc-11f0-8b06-0224a6c84d84",107,["D",1753299254039],"#!/usr/bin/env python3\n\nimport os\nimport sqlite3\nimport sys\nimport re\nimport json\nfrom pathlib import Path\n\n\"\"\"\nThis script analyzes the top 100 posts from top100.sqlite and calculates\nthe percentage of comments that contain \"YTA\" (You're The Asshole).\nResults are stored in a new database with enhanced submission data and a JSONL file.\n\"\"\"\n\nSOURCE_DB_PATH = \"../db/top100.sqlite\"\nTARGET_DB_PATH = \"../db/top100_analyzed.sqlite\"\nOUTPUT_JSONL_PATH = \"../backend/data/top100_analyzed.jsonl\"\n\n\ndef contains_yta(comment_text):\n \"\"\"\n Check if a comment contains YTA (You're The Asshole).\n This looks for YTA as a standalone word to avoid false positives.\n \"\"\"\n if not comment_text:\n return False\n \n # Use regex to find YTA as a standalone word (case insensitive)\n # \\b ensures word boundaries to avoid matching \"YTAL\" or \"MYTA\" etc.\n pattern = r'\\bYTA\\b'\n return bool(re.search(pattern, comment_text, re.IGNORECASE))\n\n\ndef main():\n print(f\"Analyzing top 100 posts from {SOURCE_DB_PATH}...\")\n\n # Check if source file exists\n source_path = Path(SOURCE_DB_PATH)\n if not source_path.exists():\n print(f\"Error: Source database file not found: {SOURCE_DB_PATH}\")\n print(\"Please run extract_top_posts.py first to create the top100.sqlite database.\")\n sys.exit(1)\n\n # Create directory for target database if needed\n target_dir = os.path.dirname(TARGET_DB_PATH)\n os.makedirs(target_dir, exist_ok=True)\n print(f\"Ensured directory {target_dir} exists.\")\n\n # Remove target files if they exist\n if os.path.exists(TARGET_DB_PATH):\n os.remove(TARGET_DB_PATH)\n print(\"Removed existing target database.\")\n \n if os.path.exists(OUTPUT_JSONL_PATH):\n os.remove(OUTPUT_JSONL_PATH)\n print(\"Removed existing JSONL file.\")\n\n try:\n # Open source database\n print(\"Opening source database...\")\n source_conn = sqlite3.connect(SOURCE_DB_PATH)\n source_conn.row_factory = sqlite3.Row\n source_cursor = source_conn.cursor()\n print(\"Source database opened successfully.\")\n\n # Create target database\n print(\"Creating target database...\")\n target_conn = sqlite3.connect(TARGET_DB_PATH)\n target_conn.row_factory = sqlite3.Row\n target_cursor = target_conn.cursor()\n print(\"Target database created successfully.\")\n\n # Create enhanced submission table with YTA percentage - separate statements\n target_cursor.execute(\"\"\"\n CREATE TABLE IF NOT EXISTS \"submission_analysis\" (\n \"id\" INTEGER NOT NULL PRIMARY KEY,\n \"submission_id\" VARCHAR(255) NOT NULL,\n \"title\" TEXT NOT NULL,\n \"selftext\" TEXT NOT NULL,\n \"created_utc\" DATE NOT NULL,\n \"permalink\" TEXT NOT NULL,\n \"score\" INTEGER NOT NULL,\n \"total_comments\" INTEGER NOT NULL DEFAULT 0,\n \"yta_comments\" INTEGER NOT NULL DEFAULT 0,\n \"yta_percentage\" REAL NOT NULL DEFAULT 0.0\n )\n \"\"\")\n \n # Create the index in a separate statement\n target_cursor.execute(\"\"\"\n CREATE UNIQUE INDEX \"submission_analysis_submission_id\" ON \"submission_analysis\" (\"submission_id\")\n \"\"\")\n \n print(\"Target database table created.\")\n\n # Begin transaction\n target_conn.execute('BEGIN TRANSACTION')\n\n # Get all submissions from source\n source_cursor.execute(\"\"\"\n SELECT id, submission_id, title, selftext, created_utc, permalink, score \n FROM submission \n ORDER BY score DESC\n \"\"\")\n submissions = source_cursor.fetchall()\n print(f\"Found {len(submissions)} submissions to analyze.\")\n\n # Analyze each submission\n insert_sql = \"\"\"\n INSERT INTO submission_analysis \n (id, submission_id, title, selftext, created_utc, permalink, score, \n total_comments, yta_comments, yta_percentage) \n VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?)\n \"\"\"\n\n # Open JSONL file for writing\n with open(OUTPUT_JSONL_PATH, 'w', encoding='utf-8') as jsonl_file:\n total_analyzed = 0\n analyzed_posts = []\n \n for i, submission in enumerate(submissions):\n submission_db_id = submission['submission_id']\n \n # Get all comments for this submission\n source_cursor.execute(\"\"\"\n SELECT message FROM comment \n WHERE submission_id = ?\n \"\"\", (submission_db_id,))\n \n comments = source_cursor.fetchall()\n total_comments = len(comments)\n \n # Count YTA comments\n yta_comments = 0\n for comment in comments:\n if contains_yta(comment['message']):\n yta_comments += 1\n \n # Calculate percentage\n yta_percentage = (yta_comments / total_comments * 100) if total_comments > 0 else 0.0\n \n # Create a post object\n post_data = {\n \"id\": submission['id'],\n \"submission_id\": submission['submission_id'],\n \"title\": submission['title'],\n \"selftext\": submission['selftext'],\n \"created_utc\": submission['created_utc'],\n \"permalink\": submission['permalink'],\n \"score\": submission['score'],\n \"total_comments\": total_comments,\n \"yta_comments\": yta_comments,\n \"yta_percentage\": round(yta_percentage, 2)\n }\n \n # Insert into target database\n target_cursor.execute(insert_sql, (\n submission['id'],\n submission['submission_id'],\n submission['title'],\n submission['selftext'],\n submission['created_utc'],\n submission['permalink'],\n submission['score'],\n total_comments,\n yta_comments,\n round(yta_percentage, 2)\n ))\n \n # Write to JSONL file\n jsonl_file.write(json.dumps(post_data) + '\\n')\n \n total_analyzed += 1\n \n # Show progress for first 10 and every 10th after that\n if i < 10 or (i + 1) % 10 == 0:\n print(f\"Analyzed submission {i+1}: '{submission['submission_id']}' - \"\n f\"{total_comments} comments, {yta_comments} YTA ({yta_percentage:.1f}%)\")\n\n # Commit transaction\n target_conn.execute('COMMIT')\n print('Database transaction committed successfully.')\n\n # Show summary statistics\n target_cursor.execute(\"\"\"\n SELECT \n COUNT(*) as total_posts,\n AVG(yta_percentage) as avg_yta_percentage,\n MIN(yta_percentage) as min_yta_percentage,\n MAX(yta_percentage) as max_yta_percentage,\n SUM(total_comments) as total_comments_analyzed,\n SUM(yta_comments) as total_yta_comments\n FROM submission_analysis\n \"\"\")\n \n stats = target_cursor.fetchone()\n \n print(\"\\n=== ANALYSIS SUMMARY ===\")\n print(f\"Total posts analyzed: {stats['total_posts']}\")\n print(f\"Total comments analyzed: {stats['total_comments_analyzed']}\")\n print(f\"Total YTA comments: {stats['total_yta_comments']}\")\n print(f\"Average YTA percentage: {stats['avg_yta_percentage']:.2f}%\")\n print(f\"Minimum YTA percentage: {stats['min_yta_percentage']:.2f}%\")\n print(f\"Maximum YTA percentage: {stats['max_yta_percentage']:.2f}%\")\n\n # Show top 5 posts with highest YTA percentage\n target_cursor.execute(\"\"\"\n SELECT submission_id, title, total_comments, yta_comments, yta_percentage\n FROM submission_analysis \n WHERE total_comments > 0\n ORDER BY yta_percentage DESC \n LIMIT 5\n \"\"\")\n \n top_yta_posts = target_cursor.fetchall()\n \n print(\"\\n=== TOP 5 POSTS WITH HIGHEST YTA PERCENTAGE ===\")\n for i, post in enumerate(top_yta_posts, 1):\n print(f\"{i}. {post['submission_id']} ({post['yta_percentage']:.1f}% YTA)\")\n print(f\" Comments: {post['yta_comments']}/{post['total_comments']}\")\n print(f\" Title: {post['title'][:80]}{'...' if len(post['title']) > 80 else ''}\")\n print()\n\n # Close connections\n source_conn.close()\n target_conn.close()\n\n print(\"Analysis complete!\")\n print(f\"Source database: {SOURCE_DB_PATH}\")\n print(f\"Analysis results database: {TARGET_DB_PATH}\")\n print(f\"Analysis results JSONL: {OUTPUT_JSONL_PATH}\")\n print(f\"Total posts analyzed: {total_analyzed}\")\n\n except sqlite3.Error as e:\n print(f\"SQLite error: {e}\")\n try:\n # Check if transaction is active before rolling back\n target_conn.execute(\"SELECT 1 FROM sqlite_master LIMIT 1\")\n target_conn.execute('ROLLBACK')\n print('Transaction rolled back due to error.')\n except Exception as rollback_error:\n print(f\"Error during rollback: {rollback_error}\")\n sys.exit(1)\n except Exception as e:\n print(f\"Error during analysis: {e}\")\n sys.exit(1)\n\n\nif __name__ == \"__main__\":\n main()",[],[187,672],"03c2fae8-67fc-11f0-a319-0224a6c84d84","03c2fb92-67fc-11f0-a319-0224a6c84d84",109,["D",1753299254045],"# Reddit AITA Database Extraction Script\n\nThis script extracts the top 100 most popular posts (by score) and all their comments from the AmItheAsshole subreddit database to a new, smaller SQLite database file.\n\n## Prerequisites\n\n- [Deno](https://deno.land/) installed on your system\n- Original database file at `db/AmItheAsshole.sqlite`\n\n## Usage\n\nRun the script with the following command:\n\n```bash\ndeno run --allow-read --allow-write extract_top_posts.ts\n```\n\nAlternatively, you can make the script executable and run it directly:\n\n```bash\nchmod +x extract_top_posts.ts\n./extract_top_posts.ts\n```\n\n## What the Script Does\n\n1. Opens the source database (`db/AmItheAsshole.sqlite`)\n2. Creates a new target database (`db/Top100AmItheAsshole.sqlite`)\n3. Extracts the top 100 posts from the source database based on score\n4. Extracts all comments associated with those posts\n5. Preserves all original data including IDs, timestamps, and relationships\n\n## Database Schema\n\nThe script maintains the original schema structure:\n\n### Submission Table\n```sql\nCREATE TABLE IF NOT EXISTS \"submission\" (\n \"id\" INTEGER NOT NULL PRIMARY KEY,\n \"submission_id\" VARCHAR(255) NOT NULL,\n \"title\" TEXT NOT NULL,\n \"selftext\" TEXT NOT NULL,\n \"created_utc\" DATE NOT NULL,\n \"permalink\" TEXT NOT NULL,\n \"score\" INTEGER NOT NULL\n);\nCREATE UNIQUE INDEX \"submission_submission_id\" ON \"submission\" (\"submission_id\");\n```\n\n### Comment Table\n```sql\nCREATE TABLE IF NOT EXISTS \"comment\" (\n \"id\" INTEGER NOT NULL PRIMARY KEY,\n \"submission_id\" INTEGER NOT NULL,\n \"message\" TEXT NOT NULL,\n \"comment_id\" VARCHAR(255) NOT NULL,\n \"parent_id\" VARCHAR(255) NOT NULL,\n \"created_utc\" DATE NOT NULL,\n \"score\" INTEGER NOT NULL,\n FOREIGN KEY (\"submission_id\") REFERENCES \"submission\" (\"id\")\n);\nCREATE INDEX \"comment_submission_id\" ON \"comment\" (\"submission_id\");\nCREATE UNIQUE INDEX \"comment_comment_id\" ON \"comment\" (\"comment_id\");\n```\n",[],[187,165],["D",1753299236474],[643,644,645],[187],"c6f58288-67f2-11f0-ade2-0224a6c84d84","style.css","01983875-e8ca-7735-b93b-d99a041ace23",13,["D",1753295286556],"body {\n font-family: -apple-system, Arial, sans-serif;\n color: #333;\n background-color: #f8f9fa;\n margin: 0;\n padding: 0;\n}\n\n.container {\n max-width: 800px;\n margin: 0 auto;\n padding: 20px;\n}\n\n.header {\n background-color: #ff4500; /* Reddit orange */\n color: white;\n padding: 20px 0;\n text-align: center;\n margin-bottom: 30px;\n box-shadow: 0 2px 10px rgba(0, 0, 0, 0.1);\n}\n\n.header h1 {\n margin: 0;\n font-size: 2.5rem;\n}\n\n.header p {\n margin: 10px 0 0;\n opacity: 0.9;\n}\n\n.post-card {\n background-color: white;\n border-radius: 8px;\n padding: 25px;\n margin-bottom: 30px;\n box-shadow: 0 2px 15px rgba(0, 0, 0, 0.05);\n}\n\n.post-title {\n font-size: 1.6rem;\n margin-top: 0;\n margin-bottom: 20px;\n color: #1a1a1b;\n}\n\n.post-content {\n line-height: 1.6;\n margin-bottom: 30px;\n white-space: pre-wrap;\n}\n\n.slider-container {\n margin: 40px 0;\n}\n\n.slider-label {\n display: block;\n font-weight: bold;\n margin-bottom: 15px;\n text-align: center;\n font-size: 1.2rem;\n}\n\n.slider {\n width: 100%;\n -webkit-appearance: none;\n height: 10px;\n border-radius: 5px;\n background: #d3d3d3;\n outline: none;\n margin-bottom: 10px;\n}\n\n.slider::-webkit-slider-thumb {\n -webkit-appearance: none;\n appearance: none;\n width: 25px;\n height: 25px;\n border-radius: 50%;\n background: #ff4500;\n cursor: pointer;\n}\n\n.slider::-moz-range-thumb {\n width: 25px;\n height: 25px;\n border-radius: 50%;\n background: #ff4500;\n cursor: pointer;\n border: none;\n}\n\n.slider-value {\n text-align: center;\n font-size: 1.5rem;\n font-weight: bold;\n margin-top: 10px;\n color: #ff4500;\n}\n\nbutton {\n background-color: #ff4500;\n color: white;\n border: none;\n padding: 12px 24px;\n border-radius: 4px;\n cursor: pointer;\n font-size: 1rem;\n font-weight: bold;\n display: block;\n margin: 30px auto 0;\n transition: background-color 0.2s;\n}\n\nbutton:hover {\n background-color: #e03d00;\n}\n\nbutton:disabled {\n background-color: #cccccc;\n cursor: not-allowed;\n}\n\n.result {\n background-color: #f0f7ff;\n border-radius: 8px;\n padding: 20px;\n margin-top: 30px;\n text-align: center;\n animation: fadeIn 0.5s;\n}\n\n.result-heading {\n font-size: 1.3rem;\n margin-top: 0;\n margin-bottom: 15px;\n color: #1a1a1b;\n}\n\n.result-message {\n margin-bottom: 15px;\n font-size: 1.1rem;\n}\n\n.actual-value {\n font-weight: bold;\n font-size: 1.4rem;\n color: #ff4500;\n}\n\n.difference {\n margin-top: 10px;\n font-style: italic;\n}\n\n.play-again {\n background-color: #0079d3; /* Reddit blue */\n margin-top: 20px;\n}\n\n.play-again:hover {\n background-color: #0061a9;\n}\n\n@keyframes fadeIn {\n from { opacity: 0; transform: translateY(10px); }\n to { opacity: 1; transform: translateY(0); }\n}\n\n/* Responsive adjustments */\n@media (max-width: 600px) {\n .header h1 {\n font-size: 2rem;\n }\n\n .post-title {\n font-size: 1.4rem;\n }\n\n .slider-value {\n font-size: 1.3rem;\n }\n}",[],[194,690],"9158d358-67ef-11f0-97a8-0224a6c84d84","index.tsx","01983875-e8ca-7735-b93b-d722f7851bd0",["D",1753293908093],"script","/** @jsxImportSource https://esm.sh/react@18.2.0 */\nimport { createRoot } from \"https://esm.sh/react-dom@18.2.0/client\";\nimport { App } from \"./components/App.tsx\";\n\nconst root = document.getElementById(\"root\");\nif (!root) {\n throw new Error(\"No root element found\");\n}\n\ncreateRoot(root).render();",[],[194,698],"c6e7bc5c-67f2-11f0-847e-0224a6c84d84","index.html","01983875-e8ca-7735-b93b-d349eb214392",11,["D",1753295286504],"\n\n \n \n \n Am I The Asshole? Guessing Game\n \n \n \n \n

\n \n \n \n",[],[194,706],"c6fdc826-67f2-11f0-8c08-0224a6c84d84","favicon.svg","01983875-e8ca-7735-b93b-cf7591f06a1e",14,["D",1753295286663],"\n",[],[194,714],"c6ec4380-67f2-11f0-8ed4-0224a6c84d84","App.tsx","01983875-e8ca-7735-b93b-c77249497ad5","01983875-e8ca-7735-b93b-cae8cf68bf65",12,["D",1753295286516],"/** @jsxImportSource https://esm.sh/react@18.2.0 */\nimport { AITAGame } from \"./AITAGame.tsx\";\n\nexport function App() {\n return ;\n}",[],[194,730,722],"components","c6bdd8ba-67f2-11f0-bf9d-0224a6c84d84","AITAGame.tsx","c6bdd950-67f2-11f0-bf9d-0224a6c84d84",6,["D",1753295286172],"/** @jsxImportSource https://esm.sh/react@18.2.0 */\nimport { useState, useEffect } from \"https://esm.sh/react@18.2.0\";\n\ninterface AITAPost {\n id: string;\n title: string;\n content: string;\n}\n\ninterface GuessResult {\n actualPct: number;\n difference: number;\n message: string;\n}\n\nexport function AITAGame() {\n const [post, setPost] = useState(null);\n const [loading, setLoading] = useState(true);\n const [error, setError] = useState(null);\n const [guess, setGuess] = useState(50);\n const [result, setResult] = useState(null);\n\n // Fetch the AITA post when component mounts\n useEffect(() => {\n fetchPost();\n }, []);\n\n const fetchPost = async () => {\n setLoading(true);\n setError(null);\n setResult(null);\n\n try {\n const response = await fetch(`/api/posts/1`);\n if (!response.ok) {\n throw new Error('Failed to fetch post');\n }\n const data = await response.json();\n setPost(data);\n } catch (err) {\n setError('Error loading post. Please try again.');\n console.error(err);\n } finally {\n setLoading(false);\n }\n };\n\n const handleSliderChange = (e: React.ChangeEvent) => {\n setGuess(parseInt(e.target.value, 10));\n };\n\n const submitGuess = async () => {\n if (!post) return;\n\n try {\n const response = await fetch(`/api/posts/${post.id}/check`, {\n method: 'POST',\n headers: {\n 'Content-Type': 'application/json'\n },\n body: JSON.stringify({ guess })\n });\n\n if (!response.ok) {\n throw new Error('Failed to submit guess');\n }\n\n const result = await response.json();\n setResult(result);\n } catch (err) {\n setError('Error submitting guess. Please try again.');\n console.error(err);\n }\n };\n\n const playAgain = () => {\n setGuess(50);\n setResult(null);\n // In a real app with multiple posts, we would fetch a new post here\n // For now, we'll just reset the state\n };\n\n if (loading) {\n return

;\n }\n\n if (error) {\n return (\n

{error}

\n \n

\n );\n }\n\n if (!post) {\n return

No post found.

;\n }\n\n return (\n

Am I The Asshole?

Guess what percentage of Reddit users thought the poster was the asshole

\n\n

{post.title}

{post.content}

\n\n {!result ? (\n

\n What percentage of people thought this person was the asshole?\n \n

{guess}%

\n \n

\n ) : (\n

Results

{result.message}

{result.actualPct}% of people thought OP was the asshole

(You were off by {result.difference}%)

\n \n

\n )}\n

\n );\n}\n",[],[194,730,732],"9158c8f4-67ef-11f0-97a8-0224a6c84d84",["D",1753293908093],[636,637],[194,730],["D",1753293908093],[635,638,639,640,641],[194],["D",1753299236795],[],[199],["D",1753295627106],[],[205],"c7037906-67f2-11f0-bf9d-0224a6c84d84","index.ts",15,["D",1753295286686],"http","import { serveFile } from \"https://esm.town/v/std/utils@85-main/index.ts\";\nimport { Hono } from \"npm:hono\";\nimport { posts } from \"./data/posts.ts\";\n\nconst app = new Hono();\n\n// Serve index.html at the root /\napp.get(\"/\", async c => {\n return serveFile(\"/frontend/index.html\", import.meta.url);\n});\n\n// Serve all /frontend files\napp.get(\"/frontend/**/*\", c => serveFile(c.req.path, import.meta.url));\n\n// API route to get a specific post\napp.get(\"/api/posts/:id\", c => {\n const id = c.req.param(\"id\");\n const post = posts.find(p => p.id === id);\n\n if (!post) {\n return c.json({ error: \"Post not found\" }, 404);\n }\n\n return c.json(post);\n});\n\n// API route to get all posts (without the assholePct to avoid spoilers)\napp.get(\"/api/posts\", c => {\n const postsWithoutPct = posts.map(({ id, title, content }) => ({ id, title, content }));\n return c.json(postsWithoutPct);\n});\n\n// API route to check a guess\napp.post(\"/api/posts/:id/check\", async c => {\n const id = c.req.param(\"id\");\n const post = posts.find(p => p.id === id);\n\n if (!post) {\n return c.json({ error: \"Post not found\" }, 404);\n }\n\n const body = await c.req.json();\n const userGuess = body.guess;\n\n if (typeof userGuess !== \"number\" || userGuess < 0 || userGuess > 100) {\n return c.json({ error: \"Invalid guess\" }, 400);\n }\n\n const difference = Math.abs(userGuess - post.assholePct);\n let message = \"\";\n\n if (difference <= 5) {\n message = \"Excellent guess! You really understand Reddit!\";\n } else if (difference <= 15) {\n message = \"Good guess! You're pretty close.\";\n } else if (difference <= 30) {\n message = \"Not bad, but you were a bit off.\";\n } else {\n message = \"Wow, you were way off! The Reddit hivemind surprised you.\";\n }\n\n return c.json({\n actualPct: post.assholePct,\n difference,\n message\n });\n});\n\n// Unwrap and rethrow Hono errors as the original error\n// If you delete this, all errors will be \"Internal Server Error\"\napp.onError((err, c) => {\n throw err;\n});\n\n// HTTP vals expect an exported \"fetch handler\"\n// This is how you \"run the server\" in Val Town with Hono\nexport default app.fetch;",[],[211,753],"c6b2364a-67f2-11f0-9530-0224a6c84d84","posts.ts","c6b236ea-67f2-11f0-9530-0224a6c84d84","c6975654-67f2-11f0-97a0-0224a6c84d84",4,["D",1753295286169],"// Static AITA post data for the game\n\nexport interface AITAPost {\n id: string;\n title: string;\n content: string;\n assholePct: number;\n}\n\nexport const posts: AITAPost[] = [\n {\n id: \"1\",\n title: \"AITA for refusing to babysit my sister's kids after she showed up 3 hours late last time?\",\n content: \"My sister has 3 kids (ages 4, 6, and 8) and she often asks me to babysit them when she and her husband want to go out. I usually don't mind and I love spending time with my nieces and nephews. Last weekend, she asked if I could watch them from 6pm to 11pm. I agreed, but she didn't show up until 2am. No calls, no texts, nothing. When she finally arrived, she wasn't apologetic at all and just said 'you don't have kids, so it's not like you had anything better to do anyway.' I was furious but didn't want to argue in front of the kids. Yesterday she called asking if I could babysit again this weekend. I told her no, and that I wouldn't be babysitting for her anymore unless she starts respecting my time. She called me selfish and said family should help each other out. Our parents are now calling me saying I should forgive her and help my sister. AITA?\",\n assholePct: 12\n }\n];\n",[],[211,205,761],"c69755b4-67f2-11f0-97a0-0224a6c84d84",3,["D",1753295285995],[630],[211,205],["D",1753293908093],[629,631],[211],"0406b396-67fc-11f0-928e-0224a6c84d84","pyvenv.cfg","0406b45e-67fc-11f0-928e-0224a6c84d84",120,["D",1753299254535],"home = /usr/local/bin\nimplementation = CPython\nversion_info = 3.13.0.final.0\nvirtualenv = 20.31.2\ninclude-system-site-packages = false\nbase-prefix = /Library/Frameworks/Python.framework/Versions/3.13\nbase-exec-prefix = /Library/Frameworks/Python.framework/Versions/3.13\nbase-executable = /Library/Frameworks/Python.framework/Versions/3.13/bin/python3.13\n",[],[216,778],"040cb91c-67fc-11f0-8b06-0224a6c84d84","CACHEDIR.TAG","040cb9da-67fc-11f0-8b06-0224a6c84d84",121,["D",1753299254579],"Signature: 8a477f597d28d172789f06886806bc55\n# This file is a cache directory tag created by Python virtualenv.\n# For information about cache directory tags, see:\n# https://bford.info/cachedir/",[],[216,786],"040fa122-67fc-11f0-8cc3-0224a6c84d84","040fa1cc-67fc-11f0-8cc3-0224a6c84d84",122,["D",1753299254597],"# created by virtualenv automatically\n*\n",[],[216,180],"0440e0f2-67fc-11f0-aedf-0224a6c84d84","top_level.txt","0440e1d8-67fc-11f0-aedf-0224a6c84d84","fa9ff902-67fb-11f0-ad3e-0224a6c84d84",128,["D",1753299254908],"pip\n",[],[216,809,810,811,812,801],"lib","python3.13","site-packages","pip-25.1.1.dist-info","0433dbb4-67fc-11f0-8b06-0224a6c84d84","entry_points.txt","0433dc72-67fc-11f0-8b06-0224a6c84d84",126,["D",1753299254833],"[console_scripts]\npip = pip._internal.cli.main:main\npip3 = pip._internal.cli.main:main\n",[],[216,809,810,811,812,814],"04272770-67fc-11f0-9ad5-0224a6c84d84","WHEEL","0427281a-67fc-11f0-9ad5-0224a6c84d84",124,["D",1753299254750],"Wheel-Version: 1.0\nGenerator: setuptools (79.0.0)\nRoot-Is-Purelib: true\nTag: py3-none-any\n\n",[],[216,809,810,811,812,822],"04221faa-67fc-11f0-aedf-0224a6c84d84","RECORD","0422207c-67fc-11f0-aedf-0224a6c84d84",123,["D",1753299254716],"pip/__init__.py,sha256=zQQ7Na8YWi0IN86IUKEzDAJtyVpXdJXYDkQ536caUiQ,357\npip/__main__.py,sha256=WzbhHXTbSE6gBY19mNN9m4s5o_365LOvTYSgqgbdBhE,854\npip/__pip-runner__.py,sha256=JOoEZTwrtv7jRaXBkgSQKAE04yNyfFmGHxqpHiGHvL0,1450\npip/py.typed,sha256=EBVvvPRTn_eIpz5e5QztSCdrMX7Qwd7VP93RSoIlZ2I,286\npip/_internal/__init__.py,sha256=MfcoOluDZ8QMCFYal04IqOJ9q6m2V7a0aOsnI-WOxUo,513\npip/_internal/build_env.py,sha256=60_espLI9X3C2db3Ww2gIcyjNk2cAPNcc5gsVO4DOqg,10924\npip/_internal/cache.py,sha256=SjhJK1C6NbonrU4AyYXKTOH0CGOk5cJrYt60mRANnPM,10368\npip/_internal/configuration.py,sha256=-KOok6jh3hFzXMPQFPJ1_EFjBpAsge-RSreQuLHLmzo,14005\npip/_internal/exceptions.py,sha256=wpE11H0e4L9G6AH70sRG149z82X7wX530HK-9eA_DIQ,28464\npip/_internal/main.py,sha256=r-UnUe8HLo5XFJz8inTcOOTiu_sxNhgHb6VwlGUllOI,340\npip/_internal/pyproject.py,sha256=GLJ6rWRS5_2noKdajohoLyDty57Z7QXhcUAYghmTnWc,7286\npip/_internal/self_outdated_check.py,sha256=1PFtttvLAeyCVR3tPoBq2sOlPD0IJ-KSqU6bc1HUk9c,8318\npip/_internal/wheel_builder.py,sha256=Z5Z2ANADbKdSHY9BHqw9zG5-1AxstO6YM6m9yLWe7Vw,11212\npip/_internal/cli/__init__.py,sha256=Iqg_tKA771XuMO1P4t_sDHnSKPzkUb9D0DqunAmw_ko,131\npip/_internal/cli/autocompletion.py,sha256=fs0Wy16Ga5tX1IZKvww5BDi7i5zyzfCPvu7cgXlgXys,6864\npip/_internal/cli/base_command.py,sha256=0A8YuJVJh2YyXU8pdW0eidLg1eklCW5cU01mpI-FAxA,8351\npip/_internal/cli/cmdoptions.py,sha256=-_V4gjMa0c3U8-vXKAyb5xVViJNzFAxBI3Zx_6Ds5-g,31909\npip/_internal/cli/command_context.py,sha256=RHgIPwtObh5KhMrd3YZTkl8zbVG-6Okml7YbFX4Ehg0,774\npip/_internal/cli/index_command.py,sha256=kplkusUgCZy75jNCo-etaDmSG8UvqcR2W50ALDdm6dk,5720\npip/_internal/cli/main.py,sha256=1bXC7uL3tdb_EZlGVKs6_TgzC9tlKU7zhAZsbZA-IzY,2816\npip/_internal/cli/main_parser.py,sha256=chZqNmCuO_JYt8ynBCumh4crURaRoXBZ0RxoSYQIwCw,4337\npip/_internal/cli/parser.py,sha256=VCMtduzECUV87KaHNu-xJ-wLNL82yT3x16V4XBxOAqI,10825\npip/_internal/cli/progress_bars.py,sha256=r9BD4T2-egcInB1Uh9Jjw3EP9F3INy5kZhGwSePm9jo,4435\npip/_internal/cli/req_command.py,sha256=1yfssBvnUKNer8D7iT3OHqdJJNdCqRhwDqUFWgieppk,12934\npip/_internal/cli/spinners.py,sha256=hIJ83GerdFgFCdobIA23Jggetegl_uC4Sp586nzFbPE,5118\npip/_internal/cli/status_codes.py,sha256=sEFHUaUJbqv8iArL3HAtcztWZmGOFX01hTesSytDEh0,116\npip/_internal/commands/__init__.py,sha256=3405KyFv4l0ruxeF69oosFanxNQcC_fHBGv7Rpt0PXg,4009\npip/_internal/commands/cache.py,sha256=IOezTicHjGE5sWdBx2nwPVgbjuJHM3s-BZEkpZLemuY,8107\npip/_internal/commands/check.py,sha256=Hr_4eiMd9cgVDgEvjtIdw915NmL7ROIWW8enkr8slPQ,2268\npip/_internal/commands/completion.py,sha256=W9QFQTPLjy2tPACJ_y3g9EgB1pbsh7pvCUX8ocuIdPg,4554\npip/_internal/commands/configuration.py,sha256=n98enwp6y0b5G6fiRQjaZo43FlJKYve_daMhN-4BRNc,9766\npip/_internal/commands/debug.py,sha256=DNDRgE9YsKrbYzU0s3VKi8rHtKF4X13CJ_br_8PUXO0,6797\npip/_internal/commands/download.py,sha256=0qB0nys6ZEPsog451lDsjL5Bx7Z97t-B80oFZKhpzKM,5273\npip/_internal/commands/freeze.py,sha256=YW-aMmAzzOaBWWobo9g4DPKuWp0dTC32lWMqXzKFLzE,3144\npip/_internal/commands/hash.py,sha256=EVVOuvGtoPEdFi8SNnmdqlCQrhCxV-kJsdwtdcCnXGQ,1703\npip/_internal/commands/help.py,sha256=gcc6QDkcgHMOuAn5UxaZwAStsRBrnGSn_yxjS57JIoM,1132\npip/_internal/commands/index.py,sha256=8UucFVwx6FmM8cNbaPY8iI5kZdV3f6jhqDa-S8aGgpg,5068\npip/_internal/commands/inspect.py,sha256=PGrY9TRTRCM3y5Ml8Bdk8DEOXquWRfscr4DRo1LOTPc,3189\npip/_internal/commands/install.py,sha256=SRsiLpead7A8bLdxMqxTAJM3sUFHtgN9zgBT98UQz5E,29757\npip/_internal/commands/list.py,sha256=Rwtf8B0d0-WrkM7Qsv41-dWg8I_r9BLuZV30wSWnzgU,13274\npip/_internal/commands/lock.py,sha256=bUYrryKa769UXM61imojoeVVgc_1ZHK-9a0hIJmmlCg,5941\npip/_internal/commands/search.py,sha256=IrfvxcRCSoZY9A5XAlCF1wtl_y2HPcXslQdHcjzwMNk,5784\npip/_internal/commands/show.py,sha256=Yh5rGYhR2Io5TkL0fFCMWE1VqqM4xhPHjhbdS3QgEac,8028\npip/_internal/commands/uninstall.py,sha256=7pOR7enK76gimyxQbzxcG1OsyLXL3DvX939xmM8Fvtg,3892\npip/_internal/commands/wheel.py,sha256=NEfaVF4f41VBNSn93RL8gkfCEDmdGhbP9xu_dE6cdUk,6346\npip/_internal/distributions/__init__.py,sha256=Hq6kt6gXBgjNit5hTTWLAzeCNOKoB-N0pGYSqehrli8,858\npip/_internal/distributions/base.py,sha256=QeB9qvKXDIjLdPBDE5fMgpfGqMMCr-govnuoQnGuiF8,1783\npip/_internal/distributions/installed.py,sha256=QinHFbWAQ8oE0pbD8MFZWkwlnfU1QYTccA1vnhrlYOU,842\npip/_internal/distributions/sdist.py,sha256=PlcP4a6-R6c98XnOM-b6Lkb3rsvh9iG4ok8shaanrzs,6751\npip/_internal/distributions/wheel.py,sha256=THBYfnv7VVt8mYhMYUtH13S1E7FDwtDyDfmUcl8ai0E,1317\npip/_internal/index/__init__.py,sha256=tzwMH_fhQeubwMqHdSivasg1cRgTSbNg2CiMVnzMmyU,29\npip/_internal/index/collector.py,sha256=RdPO0JLAlmyBWPAWYHPyRoGjz3GNAeTngCNkbGey_mE,16265\npip/_internal/index/package_finder.py,sha256=RohRzzLExoXl7QDdTiqyxIaQEcHUn6UNOr9KzC1vjL0,38446\npip/_internal/index/sources.py,sha256=lPBLK5Xiy8Q6IQMio26Wl7ocfZOKkgGklIBNyUJ23fI,8632\npip/_internal/locations/__init__.py,sha256=vvTMNxghT0aEXrSdqpNtuRDGx08bzJxfDAUUfQ0Vb0A,14309\npip/_internal/locations/_distutils.py,sha256=x6nyVLj7X11Y4khIdf-mFlxMl2FWadtVEgeb8upc_WI,6013\npip/_internal/locations/_sysconfig.py,sha256=IGzds60qsFneRogC-oeBaY7bEh3lPt_v47kMJChQXsU,7724\npip/_internal/locations/base.py,sha256=RQiPi1d4FVM2Bxk04dQhXZ2PqkeljEL2fZZ9SYqIQ78,2556\npip/_internal/metadata/__init__.py,sha256=nGWuZvjQlIHudlMz_-bsUs2LDA2ZKNPGevZoEGcd64Y,5723\npip/_internal/metadata/_json.py,sha256=ezrIYazHCINM2QUk1eA9wEAMj3aeGWeDVgGalgUzKpc,2707\npip/_internal/metadata/base.py,sha256=jCbzdIc8MgWnPR4rfrvSQhSVzSoOyKOXhj3xe8BoG8c,25467\npip/_internal/metadata/pkg_resources.py,sha256=U07ETAINSGeSRBfWUG93E4tZZbaW_f7PGzEqZN0hulc,10542\npip/_internal/metadata/importlib/__init__.py,sha256=jUUidoxnHcfITHHaAWG1G2i5fdBYklv_uJcjo2x7VYE,135\npip/_internal/metadata/importlib/_compat.py,sha256=c6av8sP8BBjAZuFSJow1iWfygUXNM3xRTCn5nqw6B9M,2796\npip/_internal/metadata/importlib/_dists.py,sha256=ftmYiyfUGUIjnVwt6W-Ijsimy5c28KgmXly5Q5IQ2P4,8279\npip/_internal/metadata/importlib/_envs.py,sha256=X63CkdAPJCYPhefYSLiQzPf9ijMXm5nL_A_Z68yp2-w,5297\npip/_internal/models/__init__.py,sha256=AjmCEBxX_MH9f_jVjIGNCFJKYCYeSEe18yyvNx4uRKQ,62\npip/_internal/models/candidate.py,sha256=zzgFRuw_kWPjKpGw7LC0ZUMD2CQ2EberUIYs8izjdCA,753\npip/_internal/models/direct_url.py,sha256=lJ1fIVTgk5UG5SzTNR0FpgSGAQjChlH-3otgiEJAhIs,6576\npip/_internal/models/format_control.py,sha256=wtsQqSK9HaUiNxQEuB-C62eVimw6G4_VQFxV9-_KDBE,2486\npip/_internal/models/index.py,sha256=tYnL8oxGi4aSNWur0mG8DAP7rC6yuha_MwJO8xw0crI,1030\npip/_internal/models/installation_report.py,sha256=zRVZoaz-2vsrezj_H3hLOhMZCK9c7TbzWgC-jOalD00,2818\npip/_internal/models/link.py,sha256=wIAgxhiu05ycLhbtAibknXX5L6X9ju_PPLVnMcvh9B4,21511\npip/_internal/models/pylock.py,sha256=n3-I26bf2v-Kn6qcx4ATB_Zel2SLhaUxZBmsMeGgYAo,6196\npip/_internal/models/scheme.py,sha256=PakmHJM3e8OOWSZFtfz1Az7f1meONJnkGuQxFlt3wBE,575\npip/_internal/models/search_scope.py,sha256=67NEnsYY84784S-MM7ekQuo9KXLH-7MzFntXjapvAo0,4531\npip/_internal/models/selection_prefs.py,sha256=qaFfDs3ciqoXPg6xx45N1jPLqccLJw4N0s4P0PyHTQ8,2015\npip/_internal/models/target_python.py,sha256=2XaH2rZ5ZF-K5wcJbEMGEl7SqrTToDDNkrtQ2v_v_-Q,4271\npip/_internal/models/wheel.py,sha256=10NUTXIRjf2P8oe1Wzolv8oUv7-YurrOduVFUIaDhdM,5506\npip/_internal/network/__init__.py,sha256=FMy06P__y6jMjUc8z3ZcQdKF-pmZ2zM14_vBeHPGhUI,49\npip/_internal/network/auth.py,sha256=D4gASjUrqoDFlSt6gQ767KAAjv6PUyJU0puDlhXNVRE,20809\npip/_internal/network/cache.py,sha256=JGYT-BUaSMdEBwII_K1UE6qyBItz7hzGkyLl_JRzkBY,4613\npip/_internal/network/download.py,sha256=6IdZyoERWIsXXFUFL_h_e_xi8Z0G0UlpkodPy8qKv2U,11078\npip/_internal/network/lazy_wheel.py,sha256=PBdoMoNQQIA84Fhgne38jWF52W4x_KtsHjxgv4dkRKA,7622\npip/_internal/network/session.py,sha256=msM4es16LmmNEYNkrYyg8fTc7gAHbKFltawfKP27LOI,18771\npip/_internal/network/utils.py,sha256=Inaxel-NxBu4PQWkjyErdnfewsFCcgHph7dzR1-FboY,4088\npip/_internal/network/xmlrpc.py,sha256=jW9oDSWamMld3iZOO9RbonVC8ZStkHyppCszoevkuJg,1837\npip/_internal/operations/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/operations/check.py,sha256=4cnD_2eglsDe5s2CoYkxDt4HcRitTywzLMfTZ-tGQ4U,5911\npip/_internal/operations/freeze.py,sha256=1_M79jAQKnCxWr-KCCmHuVXOVFGaUJHmoWLfFzgh7K4,9843\npip/_internal/operations/prepare.py,sha256=-i9dYwwJJjN7h6sZTabcz84tizgn7EAsY0sHnLAfs3Q,28363\npip/_internal/operations/build/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/operations/build/build_tracker.py,sha256=-ARW_TcjHCOX7D2NUOGntB4Fgc6b4aolsXkAK6BWL7w,4774\npip/_internal/operations/build/metadata.py,sha256=INHaeiRfOiLYCXApfDNRo9Cw2xI4VwTc0KItvfdfOjk,1421\npip/_internal/operations/build/metadata_editable.py,sha256=oWudMsnjy4loO_Jy7g4N9nxsnaEX_iDlVRgCy7pu1rs,1509\npip/_internal/operations/build/metadata_legacy.py,sha256=wv8cFA0wTqF62Jlm9QwloYZsofOyQ7sWBBmvCcVvn1k,2189\npip/_internal/operations/build/wheel.py,sha256=sT12FBLAxDC6wyrDorh8kvcZ1jG5qInCRWzzP-UkJiQ,1075\npip/_internal/operations/build/wheel_editable.py,sha256=yOtoH6zpAkoKYEUtr8FhzrYnkNHQaQBjWQ2HYae1MQg,1417\npip/_internal/operations/build/wheel_legacy.py,sha256=KXpyGYoCQYcudXNZvohLXgWHaCk4Gf3z0dbS9ol4uu0,3620\npip/_internal/operations/install/__init__.py,sha256=ak-UETcQPKlFZaWoYKWu5QVXbpFBvg0sXc3i0O4vSYY,50\npip/_internal/operations/install/editable_legacy.py,sha256=TI6wT8sLqDTprWZLYEOBOe7a6-1B9uwKb7kTBxLIaWY,1282\npip/_internal/operations/install/wheel.py,sha256=4NYSQ9ypl69iiduh5gUPCK3WNYqouTHZ0rMXoVgkiZw,27553\npip/_internal/req/__init__.py,sha256=dX2QGlfDwEqE5pLjOeM-f2qEgXFn6f2Vdi_zIHAYy1k,3096\npip/_internal/req/constructors.py,sha256=v1qzCN1mIldwx-nCrPc8JO4lxkm3Fv8M5RWvt8LISjc,18430\npip/_internal/req/req_dependency_group.py,sha256=5PGuZidqwDeTHZkP4tnNrlPrasfvJBONd1B5S0146zs,2677\npip/_internal/req/req_file.py,sha256=eys82McgaICOGic2UZRHjD720piKJPwmeSYdXlWwl6w,20234\npip/_internal/req/req_install.py,sha256=gMoFak9zrhjHlHaOQxPFheHKtIobppFgq1WrKel_nTE,35788\npip/_internal/req/req_set.py,sha256=j3esG0s6SzoVReX9rWn4rpYNtyET_fwxbwJPRimvRxo,2858\npip/_internal/req/req_uninstall.py,sha256=PQ6SyocDycUYsLAsTpjkbdwO_qjdo-y8BvQfZ5Avdrw,24075\npip/_internal/resolution/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/resolution/base.py,sha256=qlmh325SBVfvG6Me9gc5Nsh5sdwHBwzHBq6aEXtKsLA,583\npip/_internal/resolution/legacy/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/resolution/legacy/resolver.py,sha256=3HZiJBRd1FTN6jQpI4qRO8-TbLYeIbUTS6PFvXnXs2w,24068\npip/_internal/resolution/resolvelib/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/resolution/resolvelib/base.py,sha256=DCf669FsqyQY5uqXeePDHQY1e4QO-pBzWH8O0s9-K94,5023\npip/_internal/resolution/resolvelib/candidates.py,sha256=U3Qp83jhM_RiJviyrlPCijbps6wYO6VsTDaTnCf_B3o,20241\npip/_internal/resolution/resolvelib/factory.py,sha256=FCvHc9M8UJ_7iU63QtPiHuq_BmfdnBiMJ8WaDBJNFxk,32668\npip/_internal/resolution/resolvelib/found_candidates.py,sha256=6lAF_pLQ2_Z0CBOHIFxGp6NfvT1uwIpCui6e-GgI5tk,6000\npip/_internal/resolution/resolvelib/provider.py,sha256=8ptYOOjfa336D4FZ751EQHR0LDq8jJhIGJXDou8Cv8Y,11190\npip/_internal/resolution/resolvelib/reporter.py,sha256=EwJAHOjWZ8eTHQWss7zJjmQEj6ooP6oWSwwVXFtgpqQ,3260\npip/_internal/resolution/resolvelib/requirements.py,sha256=7JG4Z72e5Yk4vU0S5ulGvbqTy4FMQGYhY5zQhX9zTtY,8065\npip/_internal/resolution/resolvelib/resolver.py,sha256=9zcR4c7UZV1j2ILTmb68Ck_5HdvQvf4cmTBE2bWHkKg,12785\npip/_internal/utils/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_internal/utils/_jaraco_text.py,sha256=M15uUPIh5NpP1tdUGBxRau6q1ZAEtI8-XyLEETscFfE,3350\npip/_internal/utils/_log.py,sha256=-jHLOE_THaZz5BFcCnoSL9EYAtJ0nXem49s9of4jvKw,1015\npip/_internal/utils/appdirs.py,sha256=zrIISCn2QxlXYw-zJZZBTrFNTyy_0WNKiI-TOoN6wJo,1705\npip/_internal/utils/compat.py,sha256=ckkFveBiYQjRWjkNsajt_oWPS57tJvE8XxoC4OIYgCY,2399\npip/_internal/utils/compatibility_tags.py,sha256=q5W7IrNlqC5ke0AqWRG6aX5pimiqh--xuPCCNwCKPsU,6662\npip/_internal/utils/datetime.py,sha256=Gt29Ml4ToPSM88j54iu43WKtrU9A-moP4QmMiiqzedU,241\npip/_internal/utils/deprecation.py,sha256=k7Qg_UBAaaTdyq82YVARA6D7RmcGTXGv7fnfcgigj4Q,3707\npip/_internal/utils/direct_url_helpers.py,sha256=r2MRtkVDACv9AGqYODBUC9CjwgtsUU1s68hmgfCJMtA,3196\npip/_internal/utils/egg_link.py,sha256=0FePZoUYKv4RGQ2t6x7w5Z427wbA_Uo3WZnAkrgsuqo,2463\npip/_internal/utils/entrypoints.py,sha256=4CheZ81OBPPLb3Gn-X_WEPtllUibpwDVzlVQ4RFh7PM,3325\npip/_internal/utils/filesystem.py,sha256=ajvA-q4ocliW9kPp8Yquh-4vssXbu-UKbo5FV9V4X64,4950\npip/_internal/utils/filetypes.py,sha256=OCPzUxq3Aa6k_95MiI8DYgkOzutTs47fA-v-vYUJp9E,715\npip/_internal/utils/glibc.py,sha256=vUkWq_1pJuzcYNcGKLlQmABoUiisK8noYY1yc8Wq4w4,3734\npip/_internal/utils/hashes.py,sha256=XGGLL0AG8-RhWnyz87xF6MFZ--BKadHU35D47eApCKI,4972\npip/_internal/utils/logging.py,sha256=zMZK1NxfhM4QMGUyaU9q1grNuDhLSVbSkGCvZBKmaPw,12076\npip/_internal/utils/misc.py,sha256=DWnYxBUItjRp7hhxEg4ih6P6YpKrykM86dbi_EcU8SQ,23450\npip/_internal/utils/packaging.py,sha256=CjJOqLNENW-U88ojOllVL40f1ab2W2Bm3KHCavwNNfw,1603\npip/_internal/utils/retry.py,sha256=mhFbykXjhTnZfgzeuy-vl9c8nECnYn_CMtwNJX2tYzQ,1392\npip/_internal/utils/setuptools_build.py,sha256=J9EyRantVgu4V-xS_qfQy2mcPLVUM7A-227QdKGUZCA,4482\npip/_internal/utils/subprocess.py,sha256=EsvqSRiSMHF98T8Txmu6NLU3U--MpTTQjtNgKP0P--M,8988\npip/_internal/utils/temp_dir.py,sha256=5qOXe8M4JeY6vaFQM867d5zkp1bSwMZ-KT5jymmP0Zg,9310\npip/_internal/utils/unpacking.py,sha256=4yCqlRAI2zxl5tfxlnLoWLNcEn-k1c3vaet_oaJ42iI,11926\npip/_internal/utils/urls.py,sha256=qceSOZb5lbNDrHNsv7_S4L4Ytszja5NwPKUMnZHbYnM,1599\npip/_internal/utils/virtualenv.py,sha256=S6f7csYorRpiD6cvn3jISZYc3I8PJC43H5iMFpRAEDU,3456\npip/_internal/utils/wheel.py,sha256=MHObYn6d7VyZL10i-W1xoJZ2hT5-wB1WkII70AsYUE8,4493\npip/_internal/vcs/__init__.py,sha256=UAqvzpbi0VbZo3Ub6skEeZAw-ooIZR-zX_WpCbxyCoU,596\npip/_internal/vcs/bazaar.py,sha256=EKStcQaKpNu0NK4p5Q10Oc4xb3DUxFw024XrJy40bFQ,3528\npip/_internal/vcs/git.py,sha256=3KLPrKsDL9xZchmz4H1Obo8fM2Fh8ChrhtDHWjbkj-I,18591\npip/_internal/vcs/mercurial.py,sha256=oULOhzJ2Uie-06d1omkL-_Gc6meGaUkyogvqG9ZCyPs,5249\npip/_internal/vcs/subversion.py,sha256=ddTugHBqHzV3ebKlU5QXHPN4gUqlyXbOx8q8NgXKvs8,11735\npip/_internal/vcs/versioncontrol.py,sha256=cvf_-hnTAjQLXJ3d17FMNhQfcO1AcKWUF10tfrYyP-c,22440\npip/_vendor/__init__.py,sha256=WzusPTGWIMeQQWSVJ0h2rafGkVTa9WKJ2HT-2-EoZrU,4907\npip/_vendor/typing_extensions.py,sha256=ipKHUPtZCqL6c-HfvGl-9t0opsXcSL72y4GYjyJXs_g,172702\npip/_vendor/vendor.txt,sha256=Fym1hhuw75IJOl33NPi5nIJJc66DioBSUWrVRIVtRUE,373\npip/_vendor/cachecontrol/__init__.py,sha256=x9ecUkiwNvAGfE3g0eaRx3VrJZnZWAluA2LRcvab3HQ,677\npip/_vendor/cachecontrol/_cmd.py,sha256=iist2EpzJvDVIhMAxXq8iFnTBsiZAd6iplxfmNboNyk,1737\npip/_vendor/cachecontrol/adapter.py,sha256=8y6rTPXOzVHmDKCW5CR9sivLVuDv-cpdGcZYdRWNaPw,6599\npip/_vendor/cachecontrol/cache.py,sha256=OXwv7Fn2AwnKNiahJHnjtvaKLndvVLv_-zO-ltlV9qI,1953\npip/_vendor/cachecontrol/controller.py,sha256=cx0Hl8xLZgUuXuy78Gih9AYjCtqurmYjVJxyA4yWt7w,19101\npip/_vendor/cachecontrol/filewrapper.py,sha256=2ktXNPE0KqnyzF24aOsKCA58HQq1xeC6l2g6_zwjghc,4291\npip/_vendor/cachecontrol/heuristics.py,sha256=gqMXU8w0gQuEQiSdu3Yg-0vd9kW7nrWKbLca75rheGE,4881\npip/_vendor/cachecontrol/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/cachecontrol/serialize.py,sha256=HQd2IllQ05HzPkVLMXTF2uX5mjEQjDBkxCqUJUODpZk,5163\npip/_vendor/cachecontrol/wrapper.py,sha256=hsGc7g8QGQTT-4f8tgz3AM5qwScg6FO0BSdLSRdEvpU,1417\npip/_vendor/cachecontrol/caches/__init__.py,sha256=dtrrroK5BnADR1GWjCZ19aZ0tFsMfvFBtLQQU1sp_ag,303\npip/_vendor/cachecontrol/caches/file_cache.py,sha256=d8upFmy_zwaCmlbWEVBlLXFddt8Zw8c5SFpxeOZsdfw,4117\npip/_vendor/cachecontrol/caches/redis_cache.py,sha256=9rmqwtYu_ljVkW6_oLqbC7EaX_a8YT_yLuna-eS0dgo,1386\npip/_vendor/certifi/__init__.py,sha256=neIaAf7BM36ygmQCmy-ZsSyjnvjWghFeu13wwEAnjj0,94\npip/_vendor/certifi/__main__.py,sha256=1k3Cr95vCxxGRGDljrW3wMdpZdL3Nhf0u1n-k2qdsCY,255\npip/_vendor/certifi/cacert.pem,sha256=xVsh-Qf3-G1IrdCTVS-1ZRdJ_1-GBQjMu0I9bB-9gMc,297255\npip/_vendor/certifi/core.py,sha256=2SRT5rIcQChFDbe37BQa-kULxAgJ8qN6l1jfqTp4HIs,4486\npip/_vendor/certifi/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/dependency_groups/__init__.py,sha256=C3OFu0NGwDzQ4LOmmSOFPsRSvkbBn-mdd4j_5YqJw-s,250\npip/_vendor/dependency_groups/__main__.py,sha256=UNTM7P5mfVtT7wDi9kOTXWgV3fu3e8bTrt1Qp1jvjKo,1709\npip/_vendor/dependency_groups/_implementation.py,sha256=Gqb2DlQELRakeHlKf6QtQSW0M-bcEomxHw4JsvID1ls,8041\npip/_vendor/dependency_groups/_lint_dependency_groups.py,sha256=yp-DDqKXtbkDTNa0ifa-FmOA8ra24lPZEXftW-R5AuI,1710\npip/_vendor/dependency_groups/_pip_wrapper.py,sha256=nuVW_w_ntVxpE26ELEvngMY0N04sFLsijXRyZZROFG8,1865\npip/_vendor/dependency_groups/_toml_compat.py,sha256=BHnXnFacm3DeolsA35GjI6qkDApvua-1F20kv3BfZWE,285\npip/_vendor/dependency_groups/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/distlib/__init__.py,sha256=dcwgYGYGQqAEawBXPDtIx80DO_3cOmFv8HTc8JMzknQ,625\npip/_vendor/distlib/compat.py,sha256=2jRSjRI4o-vlXeTK2BCGIUhkc6e9ZGhSsacRM5oseTw,41467\npip/_vendor/distlib/database.py,sha256=mHy_LxiXIsIVRb-T0-idBrVLw3Ffij5teHCpbjmJ9YU,51160\npip/_vendor/distlib/index.py,sha256=lTbw268rRhj8dw1sib3VZ_0EhSGgoJO3FKJzSFMOaeA,20797\npip/_vendor/distlib/locators.py,sha256=oBeAZpFuPQSY09MgNnLfQGGAXXvVO96BFpZyKMuK4tM,51026\npip/_vendor/distlib/manifest.py,sha256=3qfmAmVwxRqU1o23AlfXrQGZzh6g_GGzTAP_Hb9C5zQ,14168\npip/_vendor/distlib/markers.py,sha256=X6sDvkFGcYS8gUW8hfsWuKEKAqhQZAJ7iXOMLxRYjYk,5164\npip/_vendor/distlib/metadata.py,sha256=zil3sg2EUfLXVigljY2d_03IJt-JSs7nX-73fECMX2s,38724\npip/_vendor/distlib/resources.py,sha256=LwbPksc0A1JMbi6XnuPdMBUn83X7BPuFNWqPGEKI698,10820\npip/_vendor/distlib/scripts.py,sha256=BJliaDAZaVB7WAkwokgC3HXwLD2iWiHaVI50H7C6eG8,18608\npip/_vendor/distlib/t32.exe,sha256=a0GV5kCoWsMutvliiCKmIgV98eRZ33wXoS-XrqvJQVs,97792\npip/_vendor/distlib/t64-arm.exe,sha256=68TAa32V504xVBnufojh0PcenpR3U4wAqTqf-MZqbPw,182784\npip/_vendor/distlib/t64.exe,sha256=gaYY8hy4fbkHYTTnA4i26ct8IQZzkBG2pRdy0iyuBrc,108032\npip/_vendor/distlib/util.py,sha256=vMPGvsS4j9hF6Y9k3Tyom1aaHLb0rFmZAEyzeAdel9w,66682\npip/_vendor/distlib/version.py,sha256=s5VIs8wBn0fxzGxWM_aA2ZZyx525HcZbMvcTlTyZ3Rg,23727\npip/_vendor/distlib/w32.exe,sha256=R4csx3-OGM9kL4aPIzQKRo5TfmRSHZo6QWyLhDhNBks,91648\npip/_vendor/distlib/w64-arm.exe,sha256=xdyYhKj0WDcVUOCb05blQYvzdYIKMbmJn2SZvzkcey4,168448\npip/_vendor/distlib/w64.exe,sha256=ejGf-rojoBfXseGLpya6bFTFPWRG21X5KvU8J5iU-K0,101888\npip/_vendor/distlib/wheel.py,sha256=DFIVguEQHCdxnSdAO0dfFsgMcvVZitg7bCOuLwZ7A_s,43979\npip/_vendor/distro/__init__.py,sha256=2fHjF-SfgPvjyNZ1iHh_wjqWdR_Yo5ODHwZC0jLBPhc,981\npip/_vendor/distro/__main__.py,sha256=bu9d3TifoKciZFcqRBuygV3GSuThnVD_m2IK4cz96Vs,64\npip/_vendor/distro/distro.py,sha256=XqbefacAhDT4zr_trnbA15eY8vdK4GTghgmvUGrEM_4,49430\npip/_vendor/distro/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/idna/__init__.py,sha256=MPqNDLZbXqGaNdXxAFhiqFPKEQXju2jNQhCey6-5eJM,868\npip/_vendor/idna/codec.py,sha256=PEew3ItwzjW4hymbasnty2N2OXvNcgHB-JjrBuxHPYY,3422\npip/_vendor/idna/compat.py,sha256=RzLy6QQCdl9784aFhb2EX9EKGCJjg0P3PilGdeXXcx8,316\npip/_vendor/idna/core.py,sha256=YJYyAMnwiQEPjVC4-Fqu_p4CJ6yKKuDGmppBNQNQpFs,13239\npip/_vendor/idna/idnadata.py,sha256=W30GcIGvtOWYwAjZj4ZjuouUutC6ffgNuyjJy7fZ-lo,78306\npip/_vendor/idna/intranges.py,sha256=amUtkdhYcQG8Zr-CoMM_kVRacxkivC1WgxN1b63KKdU,1898\npip/_vendor/idna/package_data.py,sha256=q59S3OXsc5VI8j6vSD0sGBMyk6zZ4vWFREE88yCJYKs,21\npip/_vendor/idna/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/idna/uts46data.py,sha256=rt90K9J40gUSwppDPCrhjgi5AA6pWM65dEGRSf6rIhM,239289\npip/_vendor/msgpack/__init__.py,sha256=reRaiOtEzSjPnr7TpxjgIvbfln5pV66FhricAs2eC-g,1109\npip/_vendor/msgpack/exceptions.py,sha256=dCTWei8dpkrMsQDcjQk74ATl9HsIBH0ybt8zOPNqMYc,1081\npip/_vendor/msgpack/ext.py,sha256=kteJv03n9tYzd5oo3xYopVTo4vRaAxonBQQJhXohZZo,5726\npip/_vendor/msgpack/fallback.py,sha256=0g1Pzp0vtmBEmJ5w9F3s_-JMVURP8RS4G1cc5TRaAsI,32390\npip/_vendor/packaging/__init__.py,sha256=_0cDiPVf2S-bNfVmZguxxzmrIYWlyASxpqph4qsJWUc,494\npip/_vendor/packaging/_elffile.py,sha256=UkrbDtW7aeq3qqoAfU16ojyHZ1xsTvGke_WqMTKAKd0,3286\npip/_vendor/packaging/_manylinux.py,sha256=t4y_-dTOcfr36gLY-ztiOpxxJFGO2ikC11HgfysGxiM,9596\npip/_vendor/packaging/_musllinux.py,sha256=p9ZqNYiOItGee8KcZFeHF_YcdhVwGHdK6r-8lgixvGQ,2694\npip/_vendor/packaging/_parser.py,sha256=gYfnj0pRHflVc4RHZit13KNTyN9iiVcU2RUCGi22BwM,10221\npip/_vendor/packaging/_structures.py,sha256=q3eVNmbWJGG_S0Dit_S3Ao8qQqz_5PYTXFAKBZe5yr4,1431\npip/_vendor/packaging/_tokenizer.py,sha256=OYzt7qKxylOAJ-q0XyK1qAycyPRYLfMPdGQKRXkZWyI,5310\npip/_vendor/packaging/markers.py,sha256=P0we27jm1xUzgGMJxBjtUFCIWeBxTsMeJTOJ6chZmAY,12049\npip/_vendor/packaging/metadata.py,sha256=8IZErqQQnNm53dZZuYq4FGU4_dpyinMeH1QFBIWIkfE,34739\npip/_vendor/packaging/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/packaging/requirements.py,sha256=gYyRSAdbrIyKDY66ugIDUQjRMvxkH2ALioTmX3tnL6o,2947\npip/_vendor/packaging/specifiers.py,sha256=yc9D_MycJEmwUpZvcs1OZL9HfiNFmyw0RZaeHRNHkPw,40079\npip/_vendor/packaging/tags.py,sha256=41s97W9Zatrq2Ed7Rc3qeBDaHe8pKKvYq2mGjwahfXk,22745\npip/_vendor/packaging/utils.py,sha256=0F3Hh9OFuRgrhTgGZUl5K22Fv1YP2tZl1z_2gO6kJiA,5050\npip/_vendor/packaging/version.py,sha256=oiHqzTUv_p12hpjgsLDVcaF5hT7pDaSOViUNMD4GTW0,16688\npip/_vendor/packaging/licenses/__init__.py,sha256=3bx-gryo4sRv5LsrwApouy65VIs3u6irSORJzALkrzU,5727\npip/_vendor/packaging/licenses/_spdx.py,sha256=oAm1ztPFwlsmCKe7lAAsv_OIOfS1cWDu9bNBkeu-2ns,48398\npip/_vendor/pkg_resources/__init__.py,sha256=jrhDRbOubP74QuPXxd7U7Po42PH2l-LZ2XfcO7llpZ4,124463\npip/_vendor/platformdirs/__init__.py,sha256=UfeSHWl8AeTtbOBOoHAxK4dODOWkZtfy-m_i7cWdJ8c,22344\npip/_vendor/platformdirs/__main__.py,sha256=jBJ8zb7Mpx5ebcqF83xrpO94MaeCpNGHVf9cvDN2JLg,1505\npip/_vendor/platformdirs/android.py,sha256=r0DshVBf-RO1jXJGX8C4Til7F1XWt-bkdWMgmvEiaYg,9013\npip/_vendor/platformdirs/api.py,sha256=U9EzI3EYxcXWUCtIGRllqrcN99i2LSY1mq2-GtsUwEQ,9277\npip/_vendor/platformdirs/macos.py,sha256=UlbyFZ8Rzu3xndCqQEHrfsYTeHwYdFap1Ioz-yxveT4,6154\npip/_vendor/platformdirs/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/platformdirs/unix.py,sha256=WZmkUA--L3JNRGmz32s35YfoD3ica6xKIPdCV_HhLcs,10458\npip/_vendor/platformdirs/version.py,sha256=0fnw4ljascx7O5PfIeZ2yj6w3pAkqwp099vDcivxuvY,511\npip/_vendor/platformdirs/windows.py,sha256=IFpiohUBwxPtCzlyKwNtxyW4Jk8haa6W8o59mfrDXVo,10125\npip/_vendor/pygments/__init__.py,sha256=qMm7-KYqNpMrmjymZaqfH-_9iJtjnexAKodkb9G5D5g,2983\npip/_vendor/pygments/__main__.py,sha256=WrndpSe6i1ckX_SQ1KaxD9CTKGzD0EuCOFxcbwFpoLU,353\npip/_vendor/pygments/console.py,sha256=AagDWqwea2yBWf10KC9ptBgMpMjxKp8yABAmh-NQOVk,1718\npip/_vendor/pygments/filter.py,sha256=YLtpTnZiu07nY3oK9nfR6E9Y1FBHhP5PX8gvkJWcfag,1910\npip/_vendor/pygments/formatter.py,sha256=KZQMmyo_xkOIkQG8g66LYEkBh1bx7a0HyGCBcvhI9Ew,4390\npip/_vendor/pygments/lexer.py,sha256=_kBrOJ_NT5Tl0IVM0rA9c8eysP6_yrlGzEQI0eVYB-A,35349\npip/_vendor/pygments/modeline.py,sha256=K5eSkR8GS1r5OkXXTHOcV0aM_6xpk9eWNEIAW-OOJ2g,1005\npip/_vendor/pygments/plugin.py,sha256=tPx0rJCTIZ9ioRgLNYG4pifCbAwTRUZddvLw-NfAk2w,1891\npip/_vendor/pygments/regexopt.py,sha256=wXaP9Gjp_hKAdnICqoDkRxAOQJSc4v3X6mcxx3z-TNs,3072\npip/_vendor/pygments/scanner.py,sha256=nNcETRR1tRuiTaHmHSTTECVYFPcLf6mDZu1e4u91A9E,3092\npip/_vendor/pygments/sphinxext.py,sha256=5x7Zh9YlU6ISJ31dMwduiaanb5dWZnKg3MyEQsseNnQ,7981\npip/_vendor/pygments/style.py,sha256=PlOZqlsnTVd58RGy50vkA2cXQ_lP5bF5EGMEBTno6DA,6420\npip/_vendor/pygments/token.py,sha256=WbdWGhYm_Vosb0DDxW9lHNPgITXfWTsQmHt6cy9RbcM,6226\npip/_vendor/pygments/unistring.py,sha256=al-_rBemRuGvinsrM6atNsHTmJ6DUbw24q2O2Ru1cBc,63208\npip/_vendor/pygments/util.py,sha256=oRtSpiAo5jM9ulntkvVbgXUdiAW57jnuYGB7t9fYuhc,10031\npip/_vendor/pygments/filters/__init__.py,sha256=4U4jtA0X3iP83uQnB9-TI-HDSw8E8y8zMYHa0UjbbaI,40392\npip/_vendor/pygments/formatters/__init__.py,sha256=KTwBmnXlaopJhQDOemVHYHskiDghuq-08YtP6xPNJPg,5385\npip/_vendor/pygments/formatters/_mapping.py,sha256=1Cw37FuQlNacnxRKmtlPX4nyLoX9_ttko5ZwscNUZZ4,4176\npip/_vendor/pygments/lexers/__init__.py,sha256=wbIME35GH7bI1B9rNPJFqWT-ij_RApZDYPUlZycaLzA,12115\npip/_vendor/pygments/lexers/_mapping.py,sha256=l4tCXM8e9aPC2BD6sjIr0deT-J-z5tHgCwL-p1fS0PE,77602\npip/_vendor/pygments/lexers/python.py,sha256=vxjn1cOHclIKJKxoyiBsQTY65GHbkZtZRuKQ2AVCKaw,53853\npip/_vendor/pygments/styles/__init__.py,sha256=x9ebctfyvCAFpMTlMJ5YxwcNYBzjgq6zJaKkNm78r4M,2042\npip/_vendor/pygments/styles/_mapping.py,sha256=6lovFUE29tz6EsV3XYY4hgozJ7q1JL7cfO3UOlgnS8w,3312\npip/_vendor/pyproject_hooks/__init__.py,sha256=cPB_a9LXz5xvsRbX1o2qyAdjLatZJdQ_Lc5McNX-X7Y,691\npip/_vendor/pyproject_hooks/_impl.py,sha256=jY-raxnmyRyB57ruAitrJRUzEexuAhGTpgMygqx67Z4,14936\npip/_vendor/pyproject_hooks/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/pyproject_hooks/_in_process/__init__.py,sha256=MJNPpfIxcO-FghxpBbxkG1rFiQf6HOUbV4U5mq0HFns,557\npip/_vendor/pyproject_hooks/_in_process/_in_process.py,sha256=qcXMhmx__MIJq10gGHW3mA4Tl8dy8YzHMccwnNoKlw0,12216\npip/_vendor/requests/__init__.py,sha256=HlB_HzhrzGtfD_aaYUwUh1zWXLZ75_YCLyit75d0Vz8,5057\npip/_vendor/requests/__version__.py,sha256=FVfglgZmNQnmYPXpOohDU58F5EUb_-VnSTaAesS187g,435\npip/_vendor/requests/_internal_utils.py,sha256=nMQymr4hs32TqVo5AbCrmcJEhvPUh7xXlluyqwslLiQ,1495\npip/_vendor/requests/adapters.py,sha256=J7VeVxKBvawbtlX2DERVo05J9BXTcWYLMHNd1Baa-bk,27607\npip/_vendor/requests/api.py,sha256=_Zb9Oa7tzVIizTKwFrPjDEY9ejtm_OnSRERnADxGsQs,6449\npip/_vendor/requests/auth.py,sha256=kF75tqnLctZ9Mf_hm9TZIj4cQWnN5uxRz8oWsx5wmR0,10186\npip/_vendor/requests/certs.py,sha256=kHDlkK_beuHXeMPc5jta2wgl8gdKeUWt5f2nTDVrvt8,441\npip/_vendor/requests/compat.py,sha256=Mo9f9xZpefod8Zm-n9_StJcVTmwSukXR2p3IQyyVXvU,1485\npip/_vendor/requests/cookies.py,sha256=bNi-iqEj4NPZ00-ob-rHvzkvObzN3lEpgw3g6paS3Xw,18590\npip/_vendor/requests/exceptions.py,sha256=D1wqzYWne1mS2rU43tP9CeN1G7QAy7eqL9o1god6Ejw,4272\npip/_vendor/requests/help.py,sha256=hRKaf9u0G7fdwrqMHtF3oG16RKktRf6KiwtSq2Fo1_0,3813\npip/_vendor/requests/hooks.py,sha256=CiuysiHA39V5UfcCBXFIx83IrDpuwfN9RcTUgv28ftQ,733\npip/_vendor/requests/models.py,sha256=x4K4CmH-lC0l2Kb-iPfMN4dRXxHEcbOaEWBL_i09AwI,35483\npip/_vendor/requests/packages.py,sha256=_ZQDCJTJ8SP3kVWunSqBsRZNPzj2c1WFVqbdr08pz3U,1057\npip/_vendor/requests/sessions.py,sha256=ykTI8UWGSltOfH07HKollH7kTBGw4WhiBVaQGmckTw4,30495\npip/_vendor/requests/status_codes.py,sha256=iJUAeA25baTdw-6PfD0eF4qhpINDJRJI-yaMqxs4LEI,4322\npip/_vendor/requests/structures.py,sha256=-IbmhVz06S-5aPSZuUthZ6-6D9XOjRuTXHOabY041XM,2912\npip/_vendor/requests/utils.py,sha256=L79vnFbzJ3SFLKtJwpoWe41Tozi3RlZv94pY1TFIyow,33631\npip/_vendor/resolvelib/__init__.py,sha256=4LcBWHMH317EKEkpV5XLVnqiU1lrmCiygjsADuCgz4s,541\npip/_vendor/resolvelib/providers.py,sha256=pIWJbIdJJ9GFtNbtwTH0Ia43Vj6hYCEJj2DOLue15FM,8914\npip/_vendor/resolvelib/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/resolvelib/reporters.py,sha256=8BNa7G9cKW4Lie4BhDhd7Z57J_Vlb1CYPGSgVN2erMA,2038\npip/_vendor/resolvelib/structs.py,sha256=pu-EJiR2IBITr2SQeNPRa0rXhjlStfmO_GEgAhr3004,6420\npip/_vendor/resolvelib/resolvers/__init__.py,sha256=GMYuhrbSsYTIjOij0tuJKLvlk6UXmp3nXQetn2sOvpQ,640\npip/_vendor/resolvelib/resolvers/abstract.py,sha256=jZOBVigE4PUub9i3F-bTvBwaIXX8S9EU3CGASBvFqEU,1558\npip/_vendor/resolvelib/resolvers/criterion.py,sha256=lcmZGv5sKHOnFD_RzZwvlGSj19MeA-5rCMpdf2Sgw7Y,1768\npip/_vendor/resolvelib/resolvers/exceptions.py,sha256=ln_jaQtgLlRUSFY627yiHG2gD7AgaXzRKaElFVh7fDQ,1768\npip/_vendor/resolvelib/resolvers/resolution.py,sha256=yQegMuOmlzAElLLpgD-k6NbPDMCQf29rWhiFC26OdkM,20671\npip/_vendor/rich/__init__.py,sha256=dRxjIL-SbFVY0q3IjSMrfgBTHrm1LZDgLOygVBwiYZc,6090\npip/_vendor/rich/__main__.py,sha256=eO7Cq8JnrgG8zVoeImiAs92q3hXNMIfp0w5lMsO7Q2Y,8477\npip/_vendor/rich/_cell_widths.py,sha256=fbmeyetEdHjzE_Vx2l1uK7tnPOhMs2X1lJfO3vsKDpA,10209\npip/_vendor/rich/_emoji_codes.py,sha256=hu1VL9nbVdppJrVoijVshRlcRRe_v3dju3Mmd2sKZdY,140235\npip/_vendor/rich/_emoji_replace.py,sha256=n-kcetsEUx2ZUmhQrfeMNc-teeGhpuSQ5F8VPBsyvDo,1064\npip/_vendor/rich/_export_format.py,sha256=RI08pSrm5tBSzPMvnbTqbD9WIalaOoN5d4M1RTmLq1Y,2128\npip/_vendor/rich/_extension.py,sha256=Xt47QacCKwYruzjDi-gOBq724JReDj9Cm9xUi5fr-34,265\npip/_vendor/rich/_fileno.py,sha256=HWZxP5C2ajMbHryvAQZseflVfQoGzsKOHzKGsLD8ynQ,799\npip/_vendor/rich/_inspect.py,sha256=QM05lEFnFoTaFqpnbx-zBEI6k8oIKrD3cvjEOQNhKig,9655\npip/_vendor/rich/_log_render.py,sha256=1ByI0PA1ZpxZY3CGJOK54hjlq4X-Bz_boIjIqCd8Kns,3225\npip/_vendor/rich/_loop.py,sha256=hV_6CLdoPm0va22Wpw4zKqM0RYsz3TZxXj0PoS-9eDQ,1236\npip/_vendor/rich/_null_file.py,sha256=ADGKp1yt-k70FMKV6tnqCqecB-rSJzp-WQsD7LPL-kg,1394\npip/_vendor/rich/_palettes.py,sha256=cdev1JQKZ0JvlguV9ipHgznTdnvlIzUFDBb0It2PzjI,7063\npip/_vendor/rich/_pick.py,sha256=evDt8QN4lF5CiwrUIXlOJCntitBCOsI3ZLPEIAVRLJU,423\npip/_vendor/rich/_ratio.py,sha256=Zt58apszI6hAAcXPpgdWKpu3c31UBWebOeR4mbyptvU,5471\npip/_vendor/rich/_spinners.py,sha256=U2r1_g_1zSjsjiUdAESc2iAMc3i4ri_S8PYP6kQ5z1I,19919\npip/_vendor/rich/_stack.py,sha256=-C8OK7rxn3sIUdVwxZBBpeHhIzX0eI-VM3MemYfaXm0,351\npip/_vendor/rich/_timer.py,sha256=zelxbT6oPFZnNrwWPpc1ktUeAT-Vc4fuFcRZLQGLtMI,417\npip/_vendor/rich/_win32_console.py,sha256=BSaDRIMwBLITn_m0mTRLPqME5q-quGdSMuYMpYeYJwc,22755\npip/_vendor/rich/_windows.py,sha256=aBwaD_S56SbgopIvayVmpk0Y28uwY2C5Bab1wl3Bp-I,1925\npip/_vendor/rich/_windows_renderer.py,sha256=t74ZL3xuDCP3nmTp9pH1L5LiI2cakJuQRQleHCJerlk,2783\npip/_vendor/rich/_wrap.py,sha256=FlSsom5EX0LVkA3KWy34yHnCfLtqX-ZIepXKh-70rpc,3404\npip/_vendor/rich/abc.py,sha256=ON-E-ZqSSheZ88VrKX2M3PXpFbGEUUZPMa_Af0l-4f0,890\npip/_vendor/rich/align.py,sha256=Rh-3adnDaN1Ao07EjR2PhgE62PGLPgO8SMwJBku1urQ,10469\npip/_vendor/rich/ansi.py,sha256=Avs1LHbSdcyOvDOdpELZUoULcBiYewY76eNBp6uFBhs,6921\npip/_vendor/rich/bar.py,sha256=ldbVHOzKJOnflVNuv1xS7g6dLX2E3wMnXkdPbpzJTcs,3263\npip/_vendor/rich/box.py,sha256=nr5fYIUghB_iUCEq6y0Z3LlCT8gFPDrzN9u2kn7tJl4,10831\npip/_vendor/rich/cells.py,sha256=KrQkj5-LghCCpJLSNQIyAZjndc4bnEqOEmi5YuZ9UCY,5130\npip/_vendor/rich/color.py,sha256=3HSULVDj7qQkXUdFWv78JOiSZzfy5y1nkcYhna296V0,18211\npip/_vendor/rich/color_triplet.py,sha256=3lhQkdJbvWPoLDO-AnYImAWmJvV5dlgYNCVZ97ORaN4,1054\npip/_vendor/rich/columns.py,sha256=HUX0KcMm9dsKNi11fTbiM_h2iDtl8ySCaVcxlalEzq8,7131\npip/_vendor/rich/console.py,sha256=_RJizBQIn9qxr4Ln7Q_SC5N9ekPWPAxH0KGVxsgg69Y,100565\npip/_vendor/rich/constrain.py,sha256=1VIPuC8AgtKWrcncQrjBdYqA3JVWysu6jZo1rrh7c7Q,1288\npip/_vendor/rich/containers.py,sha256=c_56TxcedGYqDepHBMTuZdUIijitAQgnox-Qde0Z1qo,5502\npip/_vendor/rich/control.py,sha256=DSkHTUQLorfSERAKE_oTAEUFefZnZp4bQb4q8rHbKws,6630\npip/_vendor/rich/default_styles.py,sha256=khQFqqaoDs3bprMqWpHw8nO5UpG2DN6QtuTd6LzZwYc,8257\npip/_vendor/rich/diagnose.py,sha256=WNPjU2pEdrPICJ24KOaTD_hzP839qArpmF1JIM5x_EQ,998\npip/_vendor/rich/emoji.py,sha256=omTF9asaAnsM4yLY94eR_9dgRRSm1lHUszX20D1yYCQ,2501\npip/_vendor/rich/errors.py,sha256=5pP3Kc5d4QJ_c0KFsxrfyhjiPVe7J1zOqSFbFAzcV-Y,642\npip/_vendor/rich/file_proxy.py,sha256=Tl9THMDZ-Pk5Wm8sI1gGg_U5DhusmxD-FZ0fUbcU0W0,1683\npip/_vendor/rich/filesize.py,sha256=_iz9lIpRgvW7MNSeCZnLg-HwzbP4GETg543WqD8SFs0,2484\npip/_vendor/rich/highlighter.py,sha256=G_sn-8DKjM1sEjLG_oc4ovkWmiUpWvj8bXi0yed2LnY,9586\npip/_vendor/rich/json.py,sha256=vVEoKdawoJRjAFayPwXkMBPLy7RSTs-f44wSQDR2nJ0,5031\npip/_vendor/rich/jupyter.py,sha256=QyoKoE_8IdCbrtiSHp9TsTSNyTHY0FO5whE7jOTd9UE,3252\npip/_vendor/rich/layout.py,sha256=ajkSFAtEVv9EFTcFs-w4uZfft7nEXhNzL7ZVdgrT5rI,14004\npip/_vendor/rich/live.py,sha256=DhzAPEnjTxQuq9_0Y2xh2MUwQcP_aGPkenLfKETslwM,14270\npip/_vendor/rich/live_render.py,sha256=zJtB471jGziBtEwxc54x12wEQtH4BuQr1SA8v9kU82w,3666\npip/_vendor/rich/logging.py,sha256=ZgpKMMBY_BuMAI_BYzo-UtXak6t5oH9VK8m9Q2Lm0f4,12458\npip/_vendor/rich/markup.py,sha256=3euGKP5s41NCQwaSjTnJxus5iZMHjxpIM0W6fCxra38,8451\npip/_vendor/rich/measure.py,sha256=HmrIJX8sWRTHbgh8MxEay_83VkqNW_70s8aKP5ZcYI8,5305\npip/_vendor/rich/padding.py,sha256=KVEI3tOwo9sgK1YNSuH__M1_jUWmLZwRVV_KmOtVzyM,4908\npip/_vendor/rich/pager.py,sha256=SO_ETBFKbg3n_AgOzXm41Sv36YxXAyI3_R-KOY2_uSc,828\npip/_vendor/rich/palette.py,sha256=lInvR1ODDT2f3UZMfL1grq7dY_pDdKHw4bdUgOGaM4Y,3396\npip/_vendor/rich/panel.py,sha256=SUDaa3z4MU7vIjzvbi0SXuc6BslDzADwdY1AX4TbTdY,11225\npip/_vendor/rich/pretty.py,sha256=gy3S72u4FRg2ytoo7N1ZDWDIvB4unbzd5iUGdgm-8fc,36391\npip/_vendor/rich/progress.py,sha256=MtmCjTk5zYU_XtRHxRHTAEHG6hF9PeF7EMWbEPleIC0,60357\npip/_vendor/rich/progress_bar.py,sha256=mZTPpJUwcfcdgQCTTz3kyY-fc79ddLwtx6Ghhxfo064,8162\npip/_vendor/rich/prompt.py,sha256=l0RhQU-0UVTV9e08xW1BbIj0Jq2IXyChX4lC0lFNzt4,12447\npip/_vendor/rich/protocol.py,sha256=5hHHDDNHckdk8iWH5zEbi-zuIVSF5hbU2jIo47R7lTE,1391\npip/_vendor/rich/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/rich/region.py,sha256=rNT9xZrVZTYIXZC0NYn41CJQwYNbR-KecPOxTgQvB8Y,166\npip/_vendor/rich/repr.py,sha256=5MZJZmONgC6kud-QW-_m1okXwL2aR6u6y-pUcUCJz28,4431\npip/_vendor/rich/rule.py,sha256=0fNaS_aERa3UMRc3T5WMpN_sumtDxfaor2y3of1ftBk,4602\npip/_vendor/rich/scope.py,sha256=TMUU8qo17thyqQCPqjDLYpg_UU1k5qVd-WwiJvnJVas,2843\npip/_vendor/rich/screen.py,sha256=YoeReESUhx74grqb0mSSb9lghhysWmFHYhsbMVQjXO8,1591\npip/_vendor/rich/segment.py,sha256=otnKeKGEV-WRlQVosfJVeFDcDxAKHpvJ_hLzSu5lumM,24743\npip/_vendor/rich/spinner.py,sha256=PT5qgXPG3ZpqRj7n3EZQ6NW56mx3ldZqZCU7gEMyZk4,4364\npip/_vendor/rich/status.py,sha256=kkPph3YeAZBo-X-4wPp8gTqZyU466NLwZBA4PZTTewo,4424\npip/_vendor/rich/style.py,sha256=xpj4uMBZMtuNuNomfUiamigl3p1sDvTCZwrG1tcTVeg,27059\npip/_vendor/rich/styled.py,sha256=eZNnzGrI4ki_54pgY3Oj0T-x3lxdXTYh4_ryDB24wBU,1258\npip/_vendor/rich/syntax.py,sha256=qqAnEUZ4K57Po81_5RBxnsuU4KRzSdvDPAhKw8ma_3E,35763\npip/_vendor/rich/table.py,sha256=ZmT7V7MMCOYKw7TGY9SZLyYDf6JdM-WVf07FdVuVhTI,40049\npip/_vendor/rich/terminal_theme.py,sha256=1j5-ufJfnvlAo5Qsi_ACZiXDmwMXzqgmFByObT9-yJY,3370\npip/_vendor/rich/text.py,sha256=AO7JPCz6-gaN1thVLXMBntEmDPVYFgFNG1oM61_sanU,47552\npip/_vendor/rich/theme.py,sha256=oNyhXhGagtDlbDye3tVu3esWOWk0vNkuxFw-_unlaK0,3771\npip/_vendor/rich/themes.py,sha256=0xgTLozfabebYtcJtDdC5QkX5IVUEaviqDUJJh4YVFk,102\npip/_vendor/rich/traceback.py,sha256=ZA8Q67DyP5a_stpIh6GPf9IiXj_s3dAhDIr6Zbfkahk,35170\npip/_vendor/rich/tree.py,sha256=yWnQ6rAvRGJ3qZGqBrxS2SW2TKBTNrP0SdY8QxOFPuw,9451\npip/_vendor/tomli/__init__.py,sha256=PhNw_eyLgdn7McJ6nrAN8yIm3dXC75vr1sVGVVwDSpA,314\npip/_vendor/tomli/_parser.py,sha256=9w8LG0jB7fwmZZWB0vVXbeejDHcl4ANIJxB2scEnDlA,25591\npip/_vendor/tomli/_re.py,sha256=sh4sBDRgO94KJZwNIrgdcyV_qQast50YvzOAUGpRDKA,3171\npip/_vendor/tomli/_types.py,sha256=-GTG2VUqkpxwMqzmVO4F7ybKddIbAnuAHXfmWQcTi3Q,254\npip/_vendor/tomli/py.typed,sha256=8PjyZ1aVoQpRVvt71muvuq5qE-jTFZkK-GLHkhdebmc,26\npip/_vendor/tomli_w/__init__.py,sha256=0F8yDtXx3Uunhm874KrAcP76srsM98y7WyHQwCulZbo,169\npip/_vendor/tomli_w/_writer.py,sha256=dsifFS2xYf1i76mmRyfz9y125xC7Z_HQ845ZKhJsYXs,6961\npip/_vendor/tomli_w/py.typed,sha256=8PjyZ1aVoQpRVvt71muvuq5qE-jTFZkK-GLHkhdebmc,26\npip/_vendor/truststore/__init__.py,sha256=2wRSVijjRzPLVXUzWqvdZLNsEOhDfopKLd2EKAYLwKU,1320\npip/_vendor/truststore/_api.py,sha256=40I0ojO2DnITiHvOnUYvJ1bfQMBKHOkci14noNxEnCs,11246\npip/_vendor/truststore/_macos.py,sha256=nZlLkOmszUE0g6ryRwBVGY5COzPyudcsiJtDWarM5LQ,20503\npip/_vendor/truststore/_openssl.py,sha256=LLUZ7ZGaio-i5dpKKjKCSeSufmn6T8pi9lDcFnvSyq0,2324\npip/_vendor/truststore/_ssl_constants.py,sha256=NUD4fVKdSD02ri7-db0tnO0VqLP9aHuzmStcW7tAl08,1130\npip/_vendor/truststore/_windows.py,sha256=rAHyKYD8M7t-bXfG8VgOVa3TpfhVhbt4rZQlO45YuP8,17993\npip/_vendor/truststore/py.typed,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/urllib3/__init__.py,sha256=iXLcYiJySn0GNbWOOZDDApgBL1JgP44EZ8i1760S8Mc,3333\npip/_vendor/urllib3/_collections.py,sha256=pyASJJhW7wdOpqJj9QJA8FyGRfr8E8uUUhqUvhF0728,11372\npip/_vendor/urllib3/_version.py,sha256=t9wGB6ooOTXXgiY66K1m6BZS1CJyXHAU8EoWDTe6Shk,64\npip/_vendor/urllib3/connection.py,sha256=ttIA909BrbTUzwkqEe_TzZVh4JOOj7g61Ysei2mrwGg,20314\npip/_vendor/urllib3/connectionpool.py,sha256=e2eiAwNbFNCKxj4bwDKNK-w7HIdSz3OmMxU_TIt-evQ,40408\npip/_vendor/urllib3/exceptions.py,sha256=0Mnno3KHTNfXRfY7638NufOPkUb6mXOm-Lqj-4x2w8A,8217\npip/_vendor/urllib3/fields.py,sha256=kvLDCg_JmH1lLjUUEY_FLS8UhY7hBvDPuVETbY8mdrM,8579\npip/_vendor/urllib3/filepost.py,sha256=5b_qqgRHVlL7uLtdAYBzBh-GHmU5AfJVt_2N0XS3PeY,2440\npip/_vendor/urllib3/poolmanager.py,sha256=aWyhXRtNO4JUnCSVVqKTKQd8EXTvUm1VN9pgs2bcONo,19990\npip/_vendor/urllib3/request.py,sha256=YTWFNr7QIwh7E1W9dde9LM77v2VWTJ5V78XuTTw7D1A,6691\npip/_vendor/urllib3/response.py,sha256=fmDJAFkG71uFTn-sVSTh2Iw0WmcXQYqkbRjihvwBjU8,30641\npip/_vendor/urllib3/contrib/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/urllib3/contrib/_appengine_environ.py,sha256=bDbyOEhW2CKLJcQqAKAyrEHN-aklsyHFKq6vF8ZFsmk,957\npip/_vendor/urllib3/contrib/appengine.py,sha256=VR68eAVE137lxTgjBDwCna5UiBZTOKa01Aj_-5BaCz4,11036\npip/_vendor/urllib3/contrib/ntlmpool.py,sha256=NlfkW7WMdW8ziqudopjHoW299og1BTWi0IeIibquFwk,4528\npip/_vendor/urllib3/contrib/pyopenssl.py,sha256=hDJh4MhyY_p-oKlFcYcQaVQRDv6GMmBGuW9yjxyeejM,17081\npip/_vendor/urllib3/contrib/securetransport.py,sha256=Fef1IIUUFHqpevzXiDPbIGkDKchY2FVKeVeLGR1Qq3g,34446\npip/_vendor/urllib3/contrib/socks.py,sha256=aRi9eWXo9ZEb95XUxef4Z21CFlnnjbEiAo9HOseoMt4,7097\npip/_vendor/urllib3/contrib/_securetransport/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/urllib3/contrib/_securetransport/bindings.py,sha256=4Xk64qIkPBt09A5q-RIFUuDhNc9mXilVapm7WnYnzRw,17632\npip/_vendor/urllib3/contrib/_securetransport/low_level.py,sha256=B2JBB2_NRP02xK6DCa1Pa9IuxrPwxzDzZbixQkb7U9M,13922\npip/_vendor/urllib3/packages/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/urllib3/packages/six.py,sha256=b9LM0wBXv7E7SrbCjAm4wwN-hrH-iNxv18LgWNMMKPo,34665\npip/_vendor/urllib3/packages/backports/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0\npip/_vendor/urllib3/packages/backports/makefile.py,sha256=nbzt3i0agPVP07jqqgjhaYjMmuAi_W5E0EywZivVO8E,1417\npip/_vendor/urllib3/packages/backports/weakref_finalize.py,sha256=tRCal5OAhNSRyb0DhHp-38AtIlCsRP8BxF3NX-6rqIA,5343\npip/_vendor/urllib3/util/__init__.py,sha256=JEmSmmqqLyaw8P51gUImZh8Gwg9i1zSe-DoqAitn2nc,1155\npip/_vendor/urllib3/util/connection.py,sha256=5Lx2B1PW29KxBn2T0xkN1CBgRBa3gGVJBKoQoRogEVk,4901\npip/_vendor/urllib3/util/proxy.py,sha256=zUvPPCJrp6dOF0N4GAVbOcl6o-4uXKSrGiTkkr5vUS4,1605\npip/_vendor/urllib3/util/queue.py,sha256=nRgX8_eX-_VkvxoX096QWoz8Ps0QHUAExILCY_7PncM,498\npip/_vendor/urllib3/util/request.py,sha256=C0OUt2tcU6LRiQJ7YYNP9GvPrSvl7ziIBekQ-5nlBZk,3997\npip/_vendor/urllib3/util/response.py,sha256=GJpg3Egi9qaJXRwBh5wv-MNuRWan5BIu40oReoxWP28,3510\npip/_vendor/urllib3/util/retry.py,sha256=6ENvOZ8PBDzh8kgixpql9lIrb2dxH-k7ZmBanJF2Ng4,22050\npip/_vendor/urllib3/util/ssl_.py,sha256=QDuuTxPSCj1rYtZ4xpD7Ux-r20TD50aHyqKyhQ7Bq4A,17460\npip/_vendor/urllib3/util/ssl_match_hostname.py,sha256=Ir4cZVEjmAk8gUAIHWSi7wtOO83UCYABY2xFD1Ql_WA,5758\npip/_vendor/urllib3/util/ssltransport.py,sha256=NA-u5rMTrDFDFC8QzRKUEKMG0561hOD4qBTr3Z4pv6E,6895\npip/_vendor/urllib3/util/timeout.py,sha256=cwq4dMk87mJHSBktK1miYJ-85G-3T3RmT20v7SFCpno,10168\npip/_vendor/urllib3/util/url.py,sha256=lCAE7M5myA8EDdW0sJuyyZhVB9K_j38ljWhHAnFaWoE,14296\npip/_vendor/urllib3/util/wait.py,sha256=fOX0_faozG2P7iVojQoE1mbydweNyTcm-hXEfFrTtLI,5403\npip-25.1.1.dist-info/licenses/AUTHORS.txt,sha256=YzDFTYpeYnwpmODDFTgyKZNKWcfdO10L5Ex_U6kJLRc,11223\npip-25.1.1.dist-info/licenses/LICENSE.txt,sha256=Y0MApmnUmurmWxLGxIySTFGkzfPR_whtw0VtyLyqIQQ,1093\npip-25.1.1.dist-info/METADATA,sha256=QFxj1tLpk8hGWrgQLRhJYUpwo_1FqBr43OT0srIZcmU,3649\npip-25.1.1.dist-info/WHEEL,sha256=pxyMxgL8-pra_rKaQ4drOZAegBVuX-G_4nRHjjgWbmo,91\npip-25.1.1.dist-info/entry_points.txt,sha256=eeIjuzfnfR2PrhbjnbzFU6MnSS70kZLxwaHHq6M-bD0,87\npip-25.1.1.dist-info/top_level.txt,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4\npip-25.1.1.dist-info/RECORD,,\npip/_internal/cli/spinners.cpython-313.pyc,,\npip/_vendor/rich/palette.cpython-313.pyc,,\npip/_internal/operations/prepare.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/provider.cpython-313.pyc,,\npip/_internal/operations/freeze.cpython-313.pyc,,\npip/_internal/vcs/mercurial.cpython-313.pyc,,\npip/_vendor/requests/status_codes.cpython-313.pyc,,\npip/_internal/cli/parser.cpython-313.pyc,,\npip/_internal/cli/index_command.cpython-313.pyc,,\npip/_vendor/urllib3/util/ssl_match_hostname.cpython-313.pyc,,\npip/_vendor/rich/_windows.cpython-313.pyc,,\npip/_vendor/urllib3/util/ssltransport.cpython-313.pyc,,\npip/_vendor/packaging/tags.cpython-313.pyc,,\npip/_internal/metadata/importlib/__pycache__,,\npip/_vendor/packaging/__init__.cpython-313.pyc,,\npip/_vendor/tomli/_parser.cpython-313.pyc,,\npip/_vendor/rich/rule.cpython-313.pyc,,\npip/_internal/utils/_log.cpython-313.pyc,,\npip/_vendor/pygments/styles/__init__.cpython-313.pyc,,\n../../../bin/pip3.13,,\npip-25.1.1.dist-info/__pycache__,,\npip/_internal/self_outdated_check.cpython-313.pyc,,\npip/_vendor/tomli/__pycache__,,\npip/_vendor/rich/traceback.cpython-313.pyc,,\npip/_internal/cli/main_parser.cpython-313.pyc,,\npip/_vendor/rich/live.cpython-313.pyc,,\npip/_vendor/rich/filesize.cpython-313.pyc,,\npip/_internal/vcs/subversion.cpython-313.pyc,,\npip/_vendor/requests/exceptions.cpython-313.pyc,,\npip/_vendor/pygments/console.cpython-313.pyc,,\npip/_internal/cli/cmdoptions.cpython-313.pyc,,\npip/_internal/__init__.cpython-313.pyc,,\npip/_internal/utils/logging.cpython-313.pyc,,\npip/_internal/utils/datetime.cpython-313.pyc,,\npip/_vendor/typing_extensions.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/securetransport.cpython-313.pyc,,\npip/_vendor/requests/_internal_utils.cpython-313.pyc,,\npip/_vendor/rich/syntax.cpython-313.pyc,,\npip/_internal/network/session.cpython-313.pyc,,\npip/_vendor/pygments/styles/_mapping.cpython-313.pyc,,\npip/_internal/commands/freeze.cpython-313.pyc,,\npip/_vendor/rich/control.cpython-313.pyc,,\npip/_internal/commands/hash.cpython-313.pyc,,\npip/_internal/network/__pycache__,,\npip/_internal/locations/_sysconfig.cpython-313.pyc,,\npip/_vendor/pygments/formatters/_mapping.cpython-313.pyc,,\npip/_internal/utils/compatibility_tags.cpython-313.pyc,,\npip/_internal/utils/temp_dir.cpython-313.pyc,,\npip/_vendor/rich/color_triplet.cpython-313.pyc,,\npip/_vendor/idna/compat.cpython-313.pyc,,\npip/_vendor/rich/json.cpython-313.pyc,,\npip/_vendor/platformdirs/macos.cpython-313.pyc,,\npip/_internal/metadata/pkg_resources.cpython-313.pyc,,\npip/_vendor/rich/columns.cpython-313.pyc,,\npip/_vendor/rich/progress_bar.cpython-313.pyc,,\npip/_internal/operations/build/metadata_editable.cpython-313.pyc,,\npip/_vendor/resolvelib/resolvers/resolution.cpython-313.pyc,,\npip/_internal/cli/progress_bars.cpython-313.pyc,,\npip/_vendor/rich/__pycache__,,\npip/_vendor/rich/tree.cpython-313.pyc,,\npip/_vendor/urllib3/exceptions.cpython-313.pyc,,\npip/_internal/utils/subprocess.cpython-313.pyc,,\npip/_vendor/rich/text.cpython-313.pyc,,\npip/_vendor/rich/pretty.cpython-313.pyc,,\npip-25.1.1.virtualenv,,\npip/_vendor/rich/box.cpython-313.pyc,,\npip/_internal/metadata/__init__.cpython-313.pyc,,\npip/_vendor/packaging/metadata.cpython-313.pyc,,\npip/_vendor/rich/_null_file.cpython-313.pyc,,\npip/_internal/cli/base_command.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/_securetransport/bindings.cpython-313.pyc,,\npip/_internal/commands/inspect.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/_securetransport/__init__.cpython-313.pyc,,\npip/_internal/commands/completion.cpython-313.pyc,,\npip/_vendor/msgpack/__pycache__,,\npip/_vendor/cachecontrol/adapter.cpython-313.pyc,,\npip/_vendor/rich/abc.cpython-313.pyc,,\npip/_vendor/rich/_emoji_replace.cpython-313.pyc,,\npip/_internal/models/search_scope.cpython-313.pyc,,\npip/_vendor/rich/live_render.cpython-313.pyc,,\npip/_internal/operations/build/build_tracker.cpython-313.pyc,,\npip/_vendor/packaging/_tokenizer.cpython-313.pyc,,\npip/_vendor/pygments/styles/__pycache__,,\npip/_vendor/idna/idnadata.cpython-313.pyc,,\npip/_internal/commands/uninstall.cpython-313.pyc,,\npip/_vendor/rich/_log_render.cpython-313.pyc,,\npip/_internal/distributions/wheel.cpython-313.pyc,,\npip/_vendor/dependency_groups/_pip_wrapper.cpython-313.pyc,,\npip/_vendor/rich/segment.cpython-313.pyc,,\npip/_internal/resolution/base.cpython-313.pyc,,\npip/_internal/req/constructors.cpython-313.pyc,,\npip/_internal/operations/build/wheel_legacy.cpython-313.pyc,,\npip/_vendor/packaging/licenses/_spdx.cpython-313.pyc,,\npip/_vendor/rich/logging.cpython-313.pyc,,\npip/_vendor/pygments/regexopt.cpython-313.pyc,,\npip/_vendor/distro/__main__.cpython-313.pyc,,\npip/_vendor/idna/__pycache__,,\npip/_vendor/pygments/plugin.cpython-313.pyc,,\npip/_internal/vcs/git.cpython-313.pyc,,\npip/_vendor/platformdirs/__pycache__,,\npip/_internal/index/__init__.cpython-313.pyc,,\npip/_vendor/rich/file_proxy.cpython-313.pyc,,\npip/_internal/distributions/sdist.cpython-313.pyc,,\npip/_vendor/rich/_inspect.cpython-313.pyc,,\npip/_internal/utils/compat.cpython-313.pyc,,\npip/_internal/models/wheel.cpython-313.pyc,,\npip/_internal/network/cache.cpython-313.pyc,,\npip/_vendor/rich/_stack.cpython-313.pyc,,\npip/_internal/commands/wheel.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/factory.cpython-313.pyc,,\npip/_vendor/resolvelib/resolvers/abstract.cpython-313.pyc,,\npip/_internal/exceptions.cpython-313.pyc,,\npip/_vendor/pygments/modeline.cpython-313.pyc,,\npip/_vendor/cachecontrol/caches/__pycache__,,\npip/_vendor/rich/console.cpython-313.pyc,,\npip/_vendor/rich/scope.cpython-313.pyc,,\npip/_vendor/urllib3/connection.cpython-313.pyc,,\npip/_vendor/requests/api.cpython-313.pyc,,\npip/_internal/utils/__pycache__,,\npip/_vendor/urllib3/_version.cpython-313.pyc,,\npip/_vendor/tomli_w/_writer.cpython-313.pyc,,\npip/_vendor/resolvelib/resolvers/__pycache__,,\npip/_vendor/rich/_windows_renderer.cpython-313.pyc,,\npip/_vendor/platformdirs/__main__.cpython-313.pyc,,\npip/_vendor/packaging/specifiers.cpython-313.pyc,,\npip/_vendor/__pycache__,,\npip/_vendor/packaging/licenses/__init__.cpython-313.pyc,,\npip/_vendor/truststore/_ssl_constants.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/__init__.cpython-313.pyc,,\npip/_internal/operations/install/wheel.cpython-313.pyc,,\npip/_vendor/cachecontrol/caches/redis_cache.cpython-313.pyc,,\npip-25.1.1.dist-info/licenses/__pycache__,,\npip/_internal/utils/retry.cpython-313.pyc,,\npip/_vendor/rich/_loop.cpython-313.pyc,,\npip/_internal/models/candidate.cpython-313.pyc,,\npip/_vendor/packaging/_musllinux.cpython-313.pyc,,\npip/_internal/__pycache__,,\npip/_vendor/pygments/formatters/__init__.cpython-313.pyc,,\npip/_internal/utils/filetypes.cpython-313.pyc,,\npip/_vendor/dependency_groups/_lint_dependency_groups.cpython-313.pyc,,\npip/_vendor/urllib3/request.cpython-313.pyc,,\npip/_vendor/urllib3/response.cpython-313.pyc,,\npip/_vendor/requests/sessions.cpython-313.pyc,,\n../../../bin/pip3,,\npip/_vendor/urllib3/__pycache__,,\npip/_vendor/resolvelib/resolvers/criterion.cpython-313.pyc,,\npip/_vendor/rich/jupyter.cpython-313.pyc,,\npip/_internal/metadata/importlib/_compat.cpython-313.pyc,,\npip/_vendor/pygments/__main__.cpython-313.pyc,,\npip/_vendor/certifi/core.cpython-313.pyc,,\npip/_vendor/distlib/__init__.cpython-313.pyc,,\npip/_internal/req/req_dependency_group.cpython-313.pyc,,\npip/_vendor/idna/package_data.cpython-313.pyc,,\npip/_internal/utils/deprecation.cpython-313.pyc,,\npip/_internal/network/xmlrpc.cpython-313.pyc,,\npip/_internal/req/req_file.cpython-313.pyc,,\npip/__pycache__,,\npip/_vendor/rich/screen.cpython-313.pyc,,\npip/_vendor/urllib3/util/response.cpython-313.pyc,,\npip/_vendor/resolvelib/structs.cpython-313.pyc,,\npip/_internal/operations/build/wheel_editable.cpython-313.pyc,,\npip/_vendor/resolvelib/__init__.cpython-313.pyc,,\npip/_internal/commands/index.cpython-313.pyc,,\npip/_vendor/dependency_groups/_implementation.cpython-313.pyc,,\npip/_vendor/distlib/version.cpython-313.pyc,,\npip/_vendor/rich/emoji.cpython-313.pyc,,\npip/_vendor/requests/packages.cpython-313.pyc,,\npip/_internal/wheel_builder.cpython-313.pyc,,\npip/_vendor/pygments/lexers/__init__.cpython-313.pyc,,\npip/_vendor/rich/pager.cpython-313.pyc,,\npip/_vendor/cachecontrol/serialize.cpython-313.pyc,,\npip/_internal/network/__init__.cpython-313.pyc,,\npip/_vendor/dependency_groups/__init__.cpython-313.pyc,,\npip/_internal/models/scheme.cpython-313.pyc,,\npip/_vendor/truststore/_api.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/_securetransport/__pycache__,,\npip/_vendor/cachecontrol/wrapper.cpython-313.pyc,,\npip/_vendor/rich/_wrap.cpython-313.pyc,,\npip/_internal/network/lazy_wheel.cpython-313.pyc,,\npip/_internal/utils/wheel.cpython-313.pyc,,\npip/_vendor/urllib3/packages/backports/weakref_finalize.cpython-313.pyc,,\npip/_internal/models/direct_url.cpython-313.pyc,,\npip/_internal/cli/command_context.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/reporter.cpython-313.pyc,,\npip/_vendor/requests/adapters.cpython-313.pyc,,\npip/_internal/configuration.cpython-313.pyc,,\npip/_vendor/rich/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/util/__init__.cpython-313.pyc,,\npip/_internal/metadata/importlib/_dists.cpython-313.pyc,,\npip/_internal/models/selection_prefs.cpython-313.pyc,,\npip/_vendor/resolvelib/reporters.cpython-313.pyc,,\npip/_vendor/pkg_resources/__pycache__,,\npip/_internal/cli/autocompletion.cpython-313.pyc,,\npip/_internal/commands/check.cpython-313.pyc,,\npip/_vendor/__init__.cpython-313.pyc,,\npip/_vendor/platformdirs/unix.cpython-313.pyc,,\npip/_vendor/pygments/lexers/_mapping.cpython-313.pyc,,\npip/_vendor/certifi/__init__.cpython-313.pyc,,\npip/_vendor/distlib/__pycache__,,\npip/_internal/metadata/__pycache__,,\npip/_vendor/cachecontrol/filewrapper.cpython-313.pyc,,\npip/_vendor/cachecontrol/heuristics.cpython-313.pyc,,\npip/_vendor/rich/_palettes.cpython-313.pyc,,\npip/_vendor/requests/structures.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/__pycache__,,\npip/_internal/locations/base.cpython-313.pyc,,\npip/_internal/locations/__pycache__,,\npip/_internal/resolution/resolvelib/candidates.cpython-313.pyc,,\npip/_vendor/rich/table.cpython-313.pyc,,\npip/_vendor/dependency_groups/_toml_compat.cpython-313.pyc,,\npip/_internal/utils/filesystem.cpython-313.pyc,,\npip/_vendor/rich/spinner.cpython-313.pyc,,\npip/_vendor/pygments/sphinxext.cpython-313.pyc,,\npip/_vendor/pygments/unistring.cpython-313.pyc,,\npip/_vendor/pygments/filters/__init__.cpython-313.pyc,,\npip/_vendor/requests/compat.cpython-313.pyc,,\npip/_vendor/cachecontrol/_cmd.cpython-313.pyc,,\npip/_internal/metadata/_json.cpython-313.pyc,,\npip/_vendor/truststore/_macos.cpython-313.pyc,,\npip/_vendor/urllib3/__init__.cpython-313.pyc,,\npip/_vendor/pygments/lexers/__pycache__,,\npip/_internal/req/__pycache__,,\n../../../bin/pip-3.13,,\npip/_vendor/urllib3/util/retry.cpython-313.pyc,,\npip/_vendor/distlib/wheel.cpython-313.pyc,,\npip/_internal/resolution/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/poolmanager.cpython-313.pyc,,\npip/_vendor/pkg_resources/__init__.cpython-313.pyc,,\npip/_vendor/resolvelib/resolvers/__init__.cpython-313.pyc,,\npip/_vendor/cachecontrol/cache.cpython-313.pyc,,\npip/_internal/utils/setuptools_build.cpython-313.pyc,,\npip/_vendor/urllib3/util/request.cpython-313.pyc,,\npip/_vendor/distlib/manifest.cpython-313.pyc,,\npip/_vendor/rich/containers.cpython-313.pyc,,\npip/_vendor/rich/_pick.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/__pycache__,,\npip/_vendor/cachecontrol/caches/__init__.cpython-313.pyc,,\npip/_vendor/cachecontrol/__pycache__,,\npip/_internal/main.cpython-313.pyc,,\npip/_internal/utils/hashes.cpython-313.pyc,,\npip/__main__.cpython-313.pyc,,\npip/_vendor/rich/theme.cpython-313.pyc,,\npip/_vendor/idna/core.cpython-313.pyc,,\npip/_internal/utils/packaging.cpython-313.pyc,,\npip/_vendor/idna/intranges.cpython-313.pyc,,\npip/_internal/network/auth.cpython-313.pyc,,\npip/_internal/index/__pycache__,,\npip/_internal/utils/egg_link.cpython-313.pyc,,\npip/_vendor/requests/__version__.cpython-313.pyc,,\npip/_internal/commands/lock.cpython-313.pyc,,\npip/_vendor/packaging/version.cpython-313.pyc,,\npip/_vendor/rich/panel.cpython-313.pyc,,\npip/_vendor/packaging/__pycache__,,\npip/_vendor/msgpack/ext.cpython-313.pyc,,\npip/_internal/vcs/versioncontrol.cpython-313.pyc,,\npip/_internal/commands/__pycache__,,\npip/_internal/cli/req_command.cpython-313.pyc,,\npip/_internal/distributions/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/packages/backports/__pycache__,,\npip/_internal/distributions/base.cpython-313.pyc,,\npip/_vendor/rich/status.cpython-313.pyc,,\npip/_internal/commands/search.cpython-313.pyc,,\npip/_vendor/rich/markup.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/_in_process/__init__.cpython-313.pyc,,\npip/_internal/req/req_set.cpython-313.pyc,,\npip/_internal/commands/install.cpython-313.pyc,,\npip/_internal/cli/__pycache__,,\npip/_vendor/urllib3/_collections.cpython-313.pyc,,\npip/_vendor/urllib3/packages/backports/makefile.cpython-313.pyc,,\npip/_vendor/rich/region.cpython-313.pyc,,\npip/_vendor/dependency_groups/__pycache__,,\npip/_internal/operations/build/wheel.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/_securetransport/low_level.cpython-313.pyc,,\npip/_vendor/cachecontrol/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/util/wait.cpython-313.pyc,,\npip/_vendor/cachecontrol/caches/file_cache.cpython-313.pyc,,\npip/_vendor/distro/distro.cpython-313.pyc,,\npip/_vendor/requests/cookies.cpython-313.pyc,,\n../../../bin/pip,,\npip/_internal/commands/debug.cpython-313.pyc,,\npip/_vendor/cachecontrol/controller.cpython-313.pyc,,\npip/_vendor/urllib3/fields.cpython-313.pyc,,\npip/_vendor/rich/themes.cpython-313.pyc,,\npip/_internal/operations/install/editable_legacy.cpython-313.pyc,,\npip/_vendor/platformdirs/android.cpython-313.pyc,,\npip-25.1.1.dist-info/INSTALLER,,\npip/_vendor/packaging/_parser.cpython-313.pyc,,\npip/_vendor/tomli_w/__init__.cpython-313.pyc,,\npip/_internal/models/target_python.cpython-313.pyc,,\npip/_internal/pyproject.cpython-313.pyc,,\npip/_vendor/idna/__init__.cpython-313.pyc,,\npip/_vendor/rich/_win32_console.cpython-313.pyc,,\npip/_vendor/platformdirs/windows.cpython-313.pyc,,\npip/_internal/resolution/legacy/resolver.cpython-313.pyc,,\npip/_vendor/pygments/util.cpython-313.pyc,,\npip/_internal/utils/unpacking.cpython-313.pyc,,\npip/_vendor/urllib3/util/url.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/_in_process/__pycache__,,\npip/_vendor/urllib3/contrib/socks.cpython-313.pyc,,\npip/_vendor/certifi/__pycache__,,\npip/_vendor/rich/repr.cpython-313.pyc,,\npip/_vendor/urllib3/util/connection.cpython-313.pyc,,\npip/_vendor/rich/terminal_theme.cpython-313.pyc,,\npip/_internal/req/req_install.cpython-313.pyc,,\npip/_internal/network/download.cpython-313.pyc,,\npip/_internal/operations/install/__pycache__,,\npip/_vendor/pygments/filters/__pycache__,,\npip/_vendor/pygments/scanner.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/util/__pycache__,,\npip/_vendor/urllib3/packages/backports/__init__.cpython-313.pyc,,\npip/_vendor/platformdirs/__init__.cpython-313.pyc,,\npip/_vendor/pygments/formatters/__pycache__,,\npip/_vendor/distlib/locators.cpython-313.pyc,,\npip/_vendor/rich/bar.cpython-313.pyc,,\npip/_vendor/requests/certs.cpython-313.pyc,,\npip/_vendor/rich/constrain.cpython-313.pyc,,\npip/_vendor/packaging/_elffile.cpython-313.pyc,,\npip/_vendor/distlib/scripts.cpython-313.pyc,,\npip/_internal/utils/__init__.cpython-313.pyc,,\npip/_internal/utils/direct_url_helpers.cpython-313.pyc,,\npip/_vendor/rich/protocol.cpython-313.pyc,,\npip/_vendor/packaging/_manylinux.cpython-313.pyc,,\npip/_vendor/msgpack/exceptions.cpython-313.pyc,,\npip/_internal/commands/help.cpython-313.pyc,,\npip/_vendor/resolvelib/__pycache__,,\npip/_vendor/distro/__init__.cpython-313.pyc,,\npip/__pip-runner__.cpython-313.pyc,,\npip/_vendor/distlib/database.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/_in_process/_in_process.cpython-313.pyc,,\npip/_vendor/rich/highlighter.cpython-313.pyc,,\npip/_vendor/rich/diagnose.cpython-313.pyc,,\npip/_internal/req/req_uninstall.cpython-313.pyc,,\npip/_vendor/rich/__main__.cpython-313.pyc,,\npip/_vendor/rich/prompt.cpython-313.pyc,,\npip/_vendor/msgpack/fallback.cpython-313.pyc,,\npip/_vendor/rich/_fileno.cpython-313.pyc,,\npip/_internal/operations/build/__pycache__,,\npip/_internal/vcs/__init__.cpython-313.pyc,,\npip/_internal/operations/__init__.cpython-313.pyc,,\npip/_vendor/requests/__init__.cpython-313.pyc,,\npip/_internal/cli/main.cpython-313.pyc,,\npip/_internal/utils/_jaraco_text.cpython-313.pyc,,\npip/_vendor/urllib3/util/proxy.cpython-313.pyc,,\npip/_vendor/rich/_ratio.cpython-313.pyc,,\npip/_internal/utils/misc.cpython-313.pyc,,\npip/_internal/cache.cpython-313.pyc,,\npip/_internal/index/collector.cpython-313.pyc,,\npip/_vendor/tomli/_re.cpython-313.pyc,,\npip/_internal/commands/show.cpython-313.pyc,,\npip/_vendor/pygments/filter.cpython-313.pyc,,\npip/_internal/vcs/__pycache__,,\npip/_vendor/packaging/licenses/__pycache__,,\npip/_internal/metadata/base.cpython-313.pyc,,\npip/_vendor/platformdirs/api.cpython-313.pyc,,\npip/_vendor/requests/hooks.cpython-313.pyc,,\npip/_vendor/rich/layout.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/_appengine_environ.cpython-313.pyc,,\npip/_vendor/urllib3/packages/__init__.cpython-313.pyc,,\npip/_vendor/rich/align.cpython-313.pyc,,\npip/_vendor/rich/_spinners.cpython-313.pyc,,\npip/_vendor/distlib/compat.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/resolver.cpython-313.pyc,,\npip/_internal/resolution/legacy/__init__.cpython-313.pyc,,\npip/_vendor/rich/default_styles.cpython-313.pyc,,\npip/_vendor/urllib3/filepost.cpython-313.pyc,,\npip/_vendor/distlib/util.cpython-313.pyc,,\npip/_vendor/urllib3/packages/__pycache__,,\npip/_internal/operations/install/__init__.cpython-313.pyc,,\npip/_vendor/msgpack/__init__.cpython-313.pyc,,\npip/_vendor/idna/codec.cpython-313.pyc,,\npip/_internal/commands/cache.cpython-313.pyc,,\npip/_internal/operations/build/__init__.cpython-313.pyc,,\npip/_internal/index/sources.cpython-313.pyc,,\npip/_vendor/rich/styled.cpython-313.pyc,,\npip/_internal/models/__init__.cpython-313.pyc,,\npip/_internal/network/utils.cpython-313.pyc,,\npip/_internal/operations/check.cpython-313.pyc,,\npip/_internal/resolution/legacy/__pycache__,,\npip/_internal/metadata/importlib/__init__.cpython-313.pyc,,\npip/_internal/models/__pycache__,,\npip/_internal/index/package_finder.cpython-313.pyc,,\npip/_internal/metadata/importlib/_envs.cpython-313.pyc,,\npip/_vendor/distlib/metadata.cpython-313.pyc,,\npip/_vendor/packaging/markers.cpython-313.pyc,,\npip/__init__.cpython-313.pyc,,\npip/_vendor/requests/models.cpython-313.pyc,,\npip/_vendor/tomli_w/__pycache__,,\npip/_internal/models/index.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/found_candidates.cpython-313.pyc,,\npip/_vendor/truststore/__init__.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/_impl.cpython-313.pyc,,\npip/_vendor/requests/__pycache__,,\npip/_internal/operations/__pycache__,,\npip/_vendor/tomli/_types.cpython-313.pyc,,\npip/_vendor/packaging/requirements.cpython-313.pyc,,\npip/_vendor/tomli/__init__.cpython-313.pyc,,\npip/_vendor/rich/measure.cpython-313.pyc,,\npip/_vendor/rich/progress.cpython-313.pyc,,\npip/_vendor/distlib/markers.cpython-313.pyc,,\npip/_internal/operations/build/metadata_legacy.cpython-313.pyc,,\npip/_internal/commands/configuration.cpython-313.pyc,,\npip/_internal/utils/glibc.cpython-313.pyc,,\npip/_vendor/requests/help.cpython-313.pyc,,\npip/_internal/models/link.cpython-313.pyc,,\npip/_internal/utils/virtualenv.cpython-313.pyc,,\npip/_vendor/pygments/formatter.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/__init__.cpython-313.pyc,,\npip/_internal/req/__init__.cpython-313.pyc,,\npip/_vendor/pygments/token.cpython-313.pyc,,\npip/_vendor/resolvelib/providers.cpython-313.pyc,,\npip/_vendor/rich/errors.cpython-313.pyc,,\npip/_vendor/requests/auth.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/ntlmpool.cpython-313.pyc,,\npip/_vendor/urllib3/util/timeout.cpython-313.pyc,,\npip/_vendor/truststore/_windows.cpython-313.pyc,,\npip/_vendor/requests/utils.cpython-313.pyc,,\npip/_internal/utils/entrypoints.cpython-313.pyc,,\npip/_vendor/pygments/__pycache__,,\npip/_vendor/pygments/lexers/python.cpython-313.pyc,,\npip/_internal/models/format_control.cpython-313.pyc,,\npip/_vendor/idna/uts46data.cpython-313.pyc,,\npip/_vendor/rich/_extension.cpython-313.pyc,,\npip/_vendor/urllib3/connectionpool.cpython-313.pyc,,\npip/_internal/operations/build/metadata.cpython-313.pyc,,\npip/_vendor/rich/ansi.cpython-313.pyc,,\npip/_vendor/pyproject_hooks/__pycache__,,\npip/_vendor/packaging/utils.cpython-313.pyc,,\npip/_internal/utils/urls.cpython-313.pyc,,\npip/_internal/vcs/bazaar.cpython-313.pyc,,\npip/_internal/distributions/__pycache__,,\npip/_vendor/resolvelib/resolvers/exceptions.cpython-313.pyc,,\npip/_vendor/urllib3/packages/six.cpython-313.pyc,,\npip/_vendor/rich/_export_format.cpython-313.pyc,,\npip/_vendor/pygments/__init__.cpython-313.pyc,,\npip/_vendor/urllib3/util/queue.cpython-313.pyc,,\npip/_vendor/urllib3/util/ssl_.cpython-313.pyc,,\npip/_vendor/pygments/style.cpython-313.pyc,,\npip/_internal/utils/appdirs.cpython-313.pyc,,\npip/_vendor/rich/cells.cpython-313.pyc,,\npip/_internal/cli/status_codes.cpython-313.pyc,,\npip/_internal/resolution/__pycache__,,\npip/_vendor/rich/padding.cpython-313.pyc,,\npip/_vendor/distlib/resources.cpython-313.pyc,,\npip/_vendor/rich/_emoji_codes.cpython-313.pyc,,\npip/_vendor/certifi/__main__.cpython-313.pyc,,\npip/_internal/models/installation_report.cpython-313.pyc,,\npip/_internal/locations/__init__.cpython-313.pyc,,\npip/_vendor/distro/__pycache__,,\npip/_internal/locations/_distutils.cpython-313.pyc,,\npip/_vendor/rich/color.cpython-313.pyc,,\npip/_vendor/platformdirs/version.cpython-313.pyc,,\npip/_vendor/pygments/lexer.cpython-313.pyc,,\npip/_vendor/urllib3/contrib/appengine.cpython-313.pyc,,\npip/_internal/commands/list.cpython-313.pyc,,\npip/_internal/commands/__init__.cpython-313.pyc,,\npip/_internal/build_env.cpython-313.pyc,,\npip/_vendor/dependency_groups/__main__.cpython-313.pyc,,\npip/_vendor/rich/_cell_widths.cpython-313.pyc,,\npip/_vendor/rich/_timer.cpython-313.pyc,,\npip/_internal/models/pylock.cpython-313.pyc,,\npip/_vendor/truststore/_openssl.cpython-313.pyc,,\npip/_internal/cli/__init__.cpython-313.pyc,,\npip/_vendor/packaging/_structures.cpython-313.pyc,,\npip/_vendor/rich/style.cpython-313.pyc,,\npip/_vendor/truststore/__pycache__,,\npip/_vendor/urllib3/contrib/pyopenssl.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/requirements.cpython-313.pyc,,\npip/_internal/distributions/installed.cpython-313.pyc,,\npip/_internal/resolution/resolvelib/base.cpython-313.pyc,,\npip/_vendor/distlib/index.cpython-313.pyc,,\npip/_internal/commands/download.cpython-313.pyc,,",[],[216,809,810,811,812,830],"044895e0-67fc-11f0-b654-0224a6c84d84","METADATA","0448969e-67fc-11f0-b654-0224a6c84d84",130,["D",1753299254959],"Metadata-Version: 2.4\nName: pip\nVersion: 25.1.1\nSummary: The PyPA recommended tool for installing Python packages.\nAuthor-email: The pip developers \nLicense: MIT\nProject-URL: Homepage, https://pip.pypa.io/\nProject-URL: Documentation, https://pip.pypa.io\nProject-URL: Source, https://github.com/pypa/pip\nProject-URL: Changelog, https://pip.pypa.io/en/stable/news/\nClassifier: Development Status :: 5 - Production/Stable\nClassifier: Intended Audience :: Developers\nClassifier: License :: OSI Approved :: MIT License\nClassifier: Topic :: Software Development :: Build Tools\nClassifier: Programming Language :: Python\nClassifier: Programming Language :: Python :: 3\nClassifier: Programming Language :: Python :: 3 :: Only\nClassifier: Programming Language :: Python :: 3.9\nClassifier: Programming Language :: Python :: 3.10\nClassifier: Programming Language :: Python :: 3.11\nClassifier: Programming Language :: Python :: 3.12\nClassifier: Programming Language :: Python :: 3.13\nClassifier: Programming Language :: Python :: Implementation :: CPython\nClassifier: Programming Language :: Python :: Implementation :: PyPy\nRequires-Python: >=3.9\nDescription-Content-Type: text/x-rst\nLicense-File: LICENSE.txt\nLicense-File: AUTHORS.txt\nDynamic: license-file\n\npip - The Python Package Installer\n==================================\n\n.. |pypi-version| image:: https://img.shields.io/pypi/v/pip.svg\n :target: https://pypi.org/project/pip/\n :alt: PyPI\n\n.. |python-versions| image:: https://img.shields.io/pypi/pyversions/pip\n :target: https://pypi.org/project/pip\n :alt: PyPI - Python Version\n\n.. |docs-badge| image:: https://readthedocs.org/projects/pip/badge/?version=latest\n :target: https://pip.pypa.io/en/latest\n :alt: Documentation\n\n|pypi-version| |python-versions| |docs-badge|\n\npip is the `package installer`_ for Python. You can use pip to install packages from the `Python Package Index`_ and other indexes.\n\nPlease take a look at our documentation for how to install and use pip:\n\n* `Installation`_\n* `Usage`_\n\nWe release updates regularly, with a new version every 3 months. Find more details in our documentation:\n\n* `Release notes`_\n* `Release process`_\n\nIf you find bugs, need help, or want to talk to the developers, please use our mailing lists or chat rooms:\n\n* `Issue tracking`_\n* `Discourse channel`_\n* `User IRC`_\n\nIf you want to get involved head over to GitHub to get the source code, look at our development documentation and feel free to jump on the developer mailing lists and chat rooms:\n\n* `GitHub page`_\n* `Development documentation`_\n* `Development IRC`_\n\nCode of Conduct\n---------------\n\nEveryone interacting in the pip project's codebases, issue trackers, chat\nrooms, and mailing lists is expected to follow the `PSF Code of Conduct`_.\n\n.. _package installer: https://packaging.python.org/guides/tool-recommendations/\n.. _Python Package Index: https://pypi.org\n.. _Installation: https://pip.pypa.io/en/stable/installation/\n.. _Usage: https://pip.pypa.io/en/stable/\n.. _Release notes: https://pip.pypa.io/en/stable/news.html\n.. _Release process: https://pip.pypa.io/en/latest/development/release-process/\n.. _GitHub page: https://github.com/pypa/pip\n.. _Development documentation: https://pip.pypa.io/en/latest/development\n.. _Issue tracking: https://github.com/pypa/pip/issues\n.. _Discourse channel: https://discuss.python.org/c/packaging\n.. _User IRC: https://kiwiirc.com/nextclient/#ircs://irc.libera.chat:+6697/pypa\n.. _Development IRC: https://kiwiirc.com/nextclient/#ircs://irc.libera.chat:+6697/pypa-dev\n.. _PSF Code of Conduct: https://github.com/pypa/.github/blob/main/CODE_OF_CONDUCT.md\n",[],[216,809,810,811,812,838],"04457f68-67fc-11f0-84bb-0224a6c84d84","INSTALLER","04458012-67fc-11f0-84bb-0224a6c84d84",129,["D",1753299254950],[],[216,809,810,811,812,846],"042df88e-67fc-11f0-8cc3-0224a6c84d84","LICENSE.txt","042df96a-67fc-11f0-8cc3-0224a6c84d84","fb41e67c-67fb-11f0-b712-0224a6c84d84",125,["D",1753299254720],"Copyright (c) 2008-present The pip developers (see AUTHORS.txt file)\n\nPermission is hereby granted, free of charge, to any person obtaining\na copy of this software and associated documentation files (the\n\"Software\"), to deal in the Software without restriction, including\nwithout limitation the rights to use, copy, modify, merge, publish,\ndistribute, sublicense, and/or sell copies of the Software, and to\npermit persons to whom the Software is furnished to do so, subject to\nthe following conditions:\n\nThe above copyright notice and this permission notice shall be\nincluded in all copies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND,\nEXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\nMERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND\nNONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE\nLIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION\nOF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION\nWITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n",[],[216,809,810,811,812,861,853],"licenses","043bd814-67fc-11f0-928e-0224a6c84d84","AUTHORS.txt","043bd8dc-67fc-11f0-928e-0224a6c84d84",127,["D",1753299254723],"@Switch01\nA_Rog\nAakanksha Agrawal\nAbhinav Sagar\nABHYUDAY PRATAP SINGH\nabs51295\nAceGentile\nAdam Chainz\nAdam Tse\nAdam Turner\nAdam Wentz\nadmin\nAdolfo Ochagavía\nAdrien Morison\nAgus\nahayrapetyan\nAhilya\nAinsworthK\nAkash Srivastava\nAlan Yee\nAlbert Tugushev\nAlbert-Guan\nalbertg\nAlberto Sottile\nAleks Bunin\nAles Erjavec\nAlethea Flowers\nAlex Gaynor\nAlex Grönholm\nAlex Hedges\nAlex Loosley\nAlex Morega\nAlex Stachowiak\nAlexander Regueiro\nAlexander Shtyrov\nAlexandre Conrad\nAlexey Popravka\nAleš Erjavec\nAlli\nAmi Fischman\nAnanya Maiti\nAnatoly Techtonik\nAnders Kaseorg\nAndre Aguiar\nAndreas Lutro\nAndrei Geacar\nAndrew Gaul\nAndrew Shymanel\nAndrey Bienkowski\nAndrey Bulgakov\nAndrés Delfino\nAndy Freeland\nAndy Kluger\nAni Hayrapetyan\nAniruddha Basak\nAnish Tambe\nAnrs Hu\nAnthony Sottile\nAntoine Musso\nAnton Ovchinnikov\nAnton Patrushev\nAnton Zelenov\nAntonio Alvarado Hernandez\nAntony Lee\nAntti Kaihola\nAnubhav Patel\nAnudit Nagar\nAnuj Godase\nAQNOUCH Mohammed\nAraHaan\narena\narenasys\nArindam Choudhury\nArmin Ronacher\nArnon Yaari\nArtem\nArun Babu Neelicattu\nAshley Manton\nAshwin Ramaswami\natse\nAtsushi Odagiri\nAvinash Karhana\nAvner Cohen\nAwit (Ah-Wit) Ghirmai\nBaptiste Mispelon\nBarney Gale\nbarneygale\nBartek Ogryczak\nBastian Venthur\nBen Bodenmiller\nBen Darnell\nBen Hoyt\nBen Mares\nBen Rosser\nBence Nagy\nBenjamin Peterson\nBenjamin VanEvery\nBenoit Pierre\nBerker Peksag\nBernard\nBernard Tyers\nBernardo B. Marques\nBernhard M. Wiedemann\nBertil Hatt\nBhavam Vidyarthi\nBlazej Michalik\nBogdan Opanchuk\nBorisZZZ\nBrad Erickson\nBradley Ayers\nBradley Reynolds\nBranch Vincent\nBrandon L. Reiss\nBrandt Bucher\nBrannon Dorsey\nBrett Randall\nBrett Rosen\nBrian Cristante\nBrian Rosner\nbriantracy\nBrownTruck\nBruno Oliveira\nBruno Renié\nBruno S\nBstrdsmkr\nBuck Golemon\nburrows\nBussonnier Matthias\nbwoodsend\nc22\nCaleb Brown\nCaleb Martinez\nCalvin Smith\nCarl Meyer\nCarlos Liam\nCarol Willing\nCarter Thayer\nCass\nChandrasekhar Atina\nCharlie Marsh\ncharwick\nChih-Hsuan Yen\nChris Brinker\nChris Hunt\nChris Jerdonek\nChris Kuehl\nChris Markiewicz\nChris McDonough\nChris Pawley\nChris Pryer\nChris Wolfe\nChristian Clauss\nChristian Heimes\nChristian Oudard\nChristoph Reiter\nChristopher Hunt\nChristopher Snyder\nchrysle\ncjc7373\nClark Boylan\nClaudio Jolowicz\nClay McClure\nCody\nCody Soyland\nColin Watson\nCollin Anderson\nConnor Osborn\nCooper Lees\nCooper Ry Lees\nCory Benfield\nCory Wright\nCraig Kerstiens\nCristian Sorinel\nCristina\nCristina Muñoz\nctg123\nCurtis Doty\ncytolentino\nDaan De Meyer\nDale\nDamian\nDamian Quiroga\nDamian Shaw\nDan Black\nDan Savilonis\nDan Sully\nDane Hillard\ndaniel\nDaniel Collins\nDaniel Hahler\nDaniel Holth\nDaniel Jost\nDaniel Katz\nDaniel Shaulov\nDaniele Esposti\nDaniele Nicolodi\nDaniele Procida\nDaniil Konovalenko\nDanny Hermes\nDanny McClanahan\nDarren Kavanagh\nDav Clark\nDave Abrahams\nDave Jones\nDavid Aguilar\nDavid Black\nDavid Bordeynik\nDavid Caro\nDavid D Lowe\nDavid Evans\nDavid Hewitt\nDavid Linke\nDavid Poggi\nDavid Poznik\nDavid Pursehouse\nDavid Runge\nDavid Tucker\nDavid Wales\nDavidovich\nddelange\nDeepak Sharma\nDeepyaman Datta\nDenise Yu\ndependabot[bot]\nderwolfe\nDesetude\ndeveloper\nDevesh Kumar Singh\ndevsagul\nDiego Caraballo\nDiego Ramirez\nDiegoCaraballo\nDimitri Merejkowsky\nDimitri Papadopoulos\nDimitri Papadopoulos Orfanos\nDirk Stolle\nDmitry Gladkov\nDmitry Volodin\nDomen Kožar\nDominic Davis-Foster\nDonald Stufft\nDongweiming\ndoron zarhi\nDos Moonen\nDouglas Thor\nDrFeathers\nDustin Ingram\nDustin Rodrigues\nDwayne Bailey\nEd Morley\nEdgar Ramírez\nEdgar Ramírez Mondragón\nEe Durbin\nEfflam Lemaillet\nefflamlemaillet\nEitan Adler\nekristina\nelainechan\nEli Schwartz\nElisha Hollander\nEllen Marie Dash\nEmil Burzo\nEmil Styrke\nEmmanuel Arias\nEndoh Takanao\nenoch\nErdinc Mutlu\nEric Cousineau\nEric Gillingham\nEric Hanchrow\nEric Hopper\nErik M. Bray\nErik Rose\nErwin Janssen\nEugene Vereshchagin\neverdimension\nFederico\nFelipe Peter\nFelix Yan\nfiber-space\nFilip Kokosiński\nFilipe Laíns\nFinn Womack\nfinnagin\nFlavio Amurrio\nFlorian Briand\nFlorian Rathgeber\nFrancesco\nFrancesco Montesano\nFredrik Orderud\nFredrik Roubert\nFrost Ming\nGabriel Curio\nGabriel de Perthuis\nGarry Polley\ngavin\ngdanielson\nGeoffrey Sneddon\nGeorge Margaritis\nGeorge Song\nGeorgi Valkov\nGeorgy Pchelkin\nghost\nGiftlin Rajaiah\ngizmoguy1\ngkdoc\nGodefroid Chapelle\nGopinath M\nGOTO Hayato\ngousaiyang\ngpiks\nGreg Roodt\nGreg Ward\nGuilherme Espada\nGuillaume Seguin\ngutsytechster\nGuy Rozendorn\nGuy Tuval\ngzpan123\nHanjun Kim\nHari Charan\nHarsh Vardhan\nharupy\nHarutaka Kawamura\nhauntsaninja\nHenrich Hartzer\nHenry Schreiner\nHerbert Pfennig\nHolly Stotelmyer\nHonnix\nHsiaoming Yang\nHugo Lopes Tavares\nHugo van Kemenade\nHugues Bruant\nHynek Schlawack\nIan Bicking\nIan Cordasco\nIan Lee\nIan Stapleton Cordasco\nIan Wienand\nIgor Kuzmitshov\nIgor Sobreira\nIkko Ashimine\nIlan Schnell\nIllia Volochii\nIlya Baryshev\nInada Naoki\nIonel Cristian Mărieș\nIonel Maries Cristian\nItamar Turner-Trauring\niTrooz\nIvan Pozdeev\nJ. Nick Koston\nJacob Kim\nJacob Walls\nJaime Sanz\nJake Lishman\njakirkham\nJakub Kuczys\nJakub Stasiak\nJakub Vysoky\nJakub Wilk\nJames Cleveland\nJames Curtin\nJames Firth\nJames Gerity\nJames Polley\nJan Pokorný\nJannis Leidel\nJarek Potiuk\njarondl\nJason Curtis\nJason R. Coombs\nJasonMo\nJasonMo1\nJay Graves\nJean Abou Samra\nJean-Christophe Fillion-Robin\nJeff Barber\nJeff Dairiki\nJeff Widman\nJelmer Vernooĳ\njenix21\nJeremy Fleischman\nJeremy Stanley\nJeremy Zafran\nJesse Rittner\nJiashuo Li\nJim Fisher\nJim Garrison\nJinzhe Zeng\nJiun Bae\nJivan Amara\nJoa\nJoe Bylund\nJoe Michelini\nJohannes Altmanninger\nJohn Paton\nJohn Sirois\nJohn T. Wodder II\nJohn-Scott Atlakson\njohnthagen\nJon Banafato\nJon Dufresne\nJon Parise\nJonas Nockert\nJonathan Herbert\nJoonatan Partanen\nJoost Molenaar\nJorge Niedbalski\nJoseph Bylund\nJoseph Long\nJosh Bronson\nJosh Cannon\nJosh Hansen\nJosh Schneier\nJoshua\nJoshuaPerdue\nJuan Luis Cano Rodríguez\nJuanjo Bazán\nJudah Rand\nJulian Berman\nJulian Gethmann\nJulien Demoor\nJuly Tikhonov\nJussi Kukkonen\nJustin van Heek\njwg4\nJyrki Pulliainen\nKai Chen\nKai Mueller\nKamal Bin Mustafa\nKarolina Surma\nkasium\nkaustav haldar\nkeanemind\nKeith Maxwell\nKelsey Hightower\nKenneth Belitzky\nKenneth Reitz\nKevin Burke\nKevin Carter\nKevin Frommelt\nKevin R Patterson\nKexuan Sun\nKit Randel\nKlaas van Schelven\nKOLANICH\nkonstin\nkpinc\nKrishan Bhasin\nKrishna Oza\nKumar McMillan\nKuntal Majumder\nKurt McKee\nKyle Persohn\nlakshmanaram\nLaszlo Kiss-Kollar\nLaurent Bristiel\nLaurent LAPORTE\nLaurie O\nLaurie Opperman\nlayday\nLeon Sasson\nLev Givon\nLincoln de Sousa\nLipis\nlorddavidiii\nLoren Carvalho\nLucas Cimon\nLudovic Gasc\nLuis Medel\nLukas Geiger\nLukas Juhrich\nLuke Macken\nLuo Jiebin\nluojiebin\nluz.paz\nLászló Kiss Kollár\nM00nL1ght\nMalcolm Smith\nMarc Abramowitz\nMarc Tamlyn\nMarcus Smith\nMariatta\nMark Kohler\nMark McLoughlin\nMark Williams\nMarkus Hametner\nMartey Dodoo\nMartin Fischer\nMartin Häcker\nMartin Pavlasek\nMasaki\nMasklinn\nMatej Stuchlik\nMathew Jennings\nMathieu Bridon\nMathieu Kniewallner\nMatt Bacchi\nMatt Good\nMatt Maker\nMatt Robenolt\nMatt Wozniski\nmatthew\nMatthew Einhorn\nMatthew Feickert\nMatthew Gilliard\nMatthew Hughes\nMatthew Iversen\nMatthew Treinish\nMatthew Trumbell\nMatthew Willson\nMatthias Bussonnier\nmattip\nMaurits van Rees\nMax W Chase\nMaxim Kurnikov\nMaxime Rouyrre\nmayeut\nmbaluna\nMd Sujauddin Sekh\nmdebi\nmemoselyk\nmeowmeowcat\nMichael\nMichael Aquilina\nMichael E. Karpeles\nMichael Klich\nMichael Mintz\nMichael Williamson\nmichaelpacer\nMichał Górny\nMickaël Schoentgen\nMiguel Araujo Perez\nMihir Singh\nMike\nMike Hendricks\nMin RK\nMinRK\nMiro Hrončok\nMonica Baluna\nmontefra\nMonty Taylor\nmorotti\nmrKazzila\nMuha Ajjan\nNadav Wexler\nNahuel Ambrosini\nNate Coraor\nNate Prewitt\nNathan Houghton\nNathaniel J. Smith\nNehal J Wani\nNeil Botelho\nNguyễn Gia Phong\nNicholas Serra\nNick Coghlan\nNick Stenning\nNick Timkovich\nNicolas Bock\nNicole Harris\nNikhil Benesch\nNikhil Ladha\nNikita Chepanov\nNikolay Korolev\nNipunn Koorapati\nNitesh Sharma\nNiyas Sait\nNoah\nNoah Gorny\nNowell Strite\nNtaleGrey\nnucccc\nnvdv\nOBITORASU\nOfek Lev\nofrinevo\nOleg Burnaev\nOliver Freund\nOliver Jeeves\nOliver Mannion\nOliver Tonnhofer\nOlivier Girardot\nOlivier Grisel\nOllie Rutherfurd\nOMOTO Kenji\nOmry Yadan\nonlinejudge95\nOren Held\nOscar Benjamin\nOz N Tiram\nPachwenko\nPatrick Dubroy\nPatrick Jenkins\nPatrick Lawson\npatricktokeeffe\nPatrik Kopkan\nPaul Ganssle\nPaul Kehrer\nPaul Moore\nPaul Nasrat\nPaul Oswald\nPaul van der Linden\nPaulus Schoutsen\nPavel Safronov\nPavithra Eswaramoorthy\nPawel Jasinski\nPaweł Szramowski\nPekka Klärck\nPeter Gessler\nPeter Lisák\nPeter Shen\nPeter Waller\nPetr Viktorin\npetr-tik\nPhaneendra Chiruvella\nPhil Elson\nPhil Freo\nPhil Pennock\nPhil Whelan\nPhilip Jägenstedt\nPhilip Molloy\nPhilippe Ombredanne\nPi Delport\nPierre-Yves Rofes\nPieter Degroote\npip\nPrabakaran Kumaresshan\nPrabhjyotsing Surjit Singh Sodhi\nPrabhu Marappan\nPradyun Gedam\nPrashant Sharma\nPratik Mallya\npre-commit-ci[bot]\nPreet Thakkar\nPreston Holmes\nPrzemek Wrzos\nPulkit Goyal\nq0w\nQiangning Hong\nQiming Xu\nQuentin Lee\nQuentin Pradet\nR. David Murray\nRafael Caricio\nRalf Schmitt\nRan Benita\nRandy Döring\nRazzi Abuissa\nrdb\nReece Dunham\nRemi Rampin\nRene Dudfield\nRiccardo Magliocchetti\nRiccardo Schirone\nRichard Jones\nRichard Si\nRicky Ng-Adam\nRishi\nrmorotti\nRobberPhex\nRobert Collins\nRobert McGibbon\nRobert Pollak\nRobert T. McGibbon\nrobin elisha robinson\nRoey Berman\nRohan Jain\nRoman Bogorodskiy\nRoman Donchenko\nRomuald Brunet\nronaudinho\nRonny Pfannschmidt\nRory McCann\nRoss Brattain\nRoy Wellington Ⅳ\nRuairidh MacLeod\nRussell Keith-Magee\nRyan Shepherd\nRyan Wooden\nryneeverett\nS. Guliaev\nSachi King\nSalvatore Rinchiera\nsandeepkiran-js\nSander Van Balen\nSavio Jomton\nschlamar\nScott Kitterman\nSean\nseanj\nSebastian Jordan\nSebastian Schaetz\nSegev Finer\nSeongSoo Cho\nSergey Vasilyev\nSeth Michael Larson\nSeth Woodworth\nShahar Epstein\nShantanu\nshenxianpeng\nshireenrao\nShivansh-007\nShixian Sheng\nShlomi Fish\nShovan Maity\nSimeon Visser\nSimon Cross\nSimon Pichugin\nsinoroc\nsinscary\nsnook92\nsocketubs\nSorin Sbarnea\nSrinivas Nyayapati\nSrishti Hegde\nStavros Korokithakis\nStefan Scherfke\nStefano Rivera\nStephan Erb\nStephen Rosen\nstepshal\nSteve (Gadget) Barnes\nSteve Barnes\nSteve Dower\nSteve Kowalik\nSteven Myint\nSteven Silvester\nstonebig\nstudioj\nStéphane Bidoul\nStéphane Bidoul (ACSONE)\nStéphane Klein\nSumana Harihareswara\nSurbhi Sharma\nSviatoslav Sydorenko\nSviatoslav Sydorenko (Святослав Сидоренко)\nSwat009\nSylvain\nTakayuki SHIMIZUKAWA\nTaneli Hukkinen\ntbeswick\nThiago\nThijs Triemstra\nThomas Fenzl\nThomas Grainger\nThomas Guettler\nThomas Johansson\nThomas Kluyver\nThomas Smith\nThomas VINCENT\nTim D. Smith\nTim Gates\nTim Harder\nTim Heap\ntim smith\ntinruufu\nTobias Hermann\nTom Forbes\nTom Freudenheim\nTom V\nTomas Hrnciar\nTomas Orsava\nTomer Chachamu\nTommi Enenkel | AnB\nTomáš Hrnčiar\nTony Beswick\nTony Narlock\nTony Zhaocheng Tan\nTonyBeswick\ntoonarmycaptain\nToshio Kuratomi\ntoxinu\nTravis Swicegood\nTushar Sadhwani\nTzu-ping Chung\nValentin Haenel\nVictor Stinner\nvictorvpaulo\nVikram - Google\nViktor Szépe\nVille Skyttä\nVinay Sajip\nVincent Philippon\nVinicyus Macedo\nVipul Kumar\nVitaly Babiy\nVladimir Fokow\nVladimir Rutsky\nW. Trevor King\nWil Tan\nWilfred Hughes\nWilliam Edwards\nWilliam ML Leslie\nWilliam T Olson\nWilliam Woodruff\nWilson Mo\nwim glenn\nWinson Luk\nWolfgang Maier\nWu Zhenyu\nXAMES3\nXavier Fernandez\nXianpeng Shen\nxoviat\nxtreak\nYAMAMOTO Takashi\nYen Chi Hsuan\nYeray Diaz Diaz\nYoval P\nYu Jian\nYuan Jing Vincent Yan\nYusuke Hayashi\nZearin\nZhiping Deng\nziebam\nZvezdan Petkovic\nŁukasz Langa\nРоман Донченко\nСемён Марьясин\n",[],[216,809,810,811,812,861,863],"fb41e5d2-67fb-11f0-b712-0224a6c84d84",51,["D",1753299239826],[617,618],[216,809,810,811,812,861],"fa9ff7f4-67fb-11f0-ad3e-0224a6c84d84","fa3bb604-67fb-11f0-b5ac-0224a6c84d84",45,["D",1753299238766],[616,619,620,621,622,623,624],[216,809,810,811,812],"0809a052-67fc-11f0-8d4e-0224a6c84d84","vendor.txt","0809a124-67fc-11f0-8d4e-0224a6c84d84","fb750bb0-67fb-11f0-b654-0224a6c84d84",291,["D",1753299261268],"CacheControl==0.14.2\ndistlib==0.3.9\ndistro==1.9.0\nmsgpack==1.1.0\npackaging==25.0\nplatformdirs==4.3.7\npyproject-hooks==1.2.0\nrequests==2.32.3\n certifi==2025.1.31\n idna==3.10\n urllib3==1.26.20\nrich==14.0.0\n pygments==2.19.1\n typing_extensions==4.13.2\nresolvelib==1.1.0\nsetuptools==70.3.0\ntomli==2.2.1\ntomli-w==1.2.0\ntruststore==0.10.1\ndependency-groups==1.3.1\n",[],[216,809,810,811,890,891,882],"pip","_vendor","0a172914-67fc-11f0-8371-0224a6c84d84","__init__.py","0a172aea-67fc-11f0-8371-0224a6c84d84",366,["D",1753299264711],"\"\"\"\npip._vendor is for vendoring dependencies of pip to prevent needing pip to\ndepend on something external.\n\nFiles inside of pip._vendor should be considered immutable and should only be\nupdated to versions from upstream.\n\"\"\"\nfrom __future__ import absolute_import\n\nimport glob\nimport os.path\nimport sys\n\n# Downstream redistributors which have debundled our dependencies should also\n# patch this value to be true. This will trigger the additional patching\n# to cause things like \"six\" to be available as pip.\nDEBUNDLED = False\n\n# By default, look in this directory for a bunch of .whl files which we will\n# add to the beginning of sys.path before attempting to import anything. This\n# is done to support downstream re-distributors like Debian and Fedora who\n# wish to create their own Wheels for our dependencies to aid in debundling.\nWHEEL_DIR = os.path.abspath(os.path.dirname(__file__))\n\n\n# Define a small helper function to alias our vendored modules to the real ones\n# if the vendored ones do not exist. This idea of this was taken from\n# https://github.com/kennethreitz/requests/pull/2567.\ndef vendored(modulename):\n vendored_name = \"{0}.{1}\".format(__name__, modulename)\n\n try:\n __import__(modulename, globals(), locals(), level=0)\n except ImportError:\n # We can just silently allow import failures to pass here. If we\n # got to this point it means that ``import pip._vendor.whatever``\n # failed and so did ``import whatever``. Since we're importing this\n # upfront in an attempt to alias imports, not erroring here will\n # just mean we get a regular import error whenever pip *actually*\n # tries to import one of these modules to use it, which actually\n # gives us a better error message than we would have otherwise\n # gotten.\n pass\n else:\n sys.modules[vendored_name] = sys.modules[modulename]\n base, head = vendored_name.rsplit(\".\", 1)\n setattr(sys.modules[base], head, sys.modules[modulename])\n\n\n# If we're operating in a debundled setup, then we want to go ahead and trigger\n# the aliasing of our vendored libraries as well as looking for wheels to add\n# to our sys.path. This will cause all of this code to be a no-op typically\n# however downstream redistributors can enable it in a consistent way across\n# all platforms.\nif DEBUNDLED:\n # Actually look inside of WHEEL_DIR to find .whl files and add them to the\n # front of our sys.path.\n sys.path[:] = glob.glob(os.path.join(WHEEL_DIR, \"*.whl\")) + sys.path\n\n # Actually alias all of our vendored dependencies.\n vendored(\"cachecontrol\")\n vendored(\"certifi\")\n vendored(\"dependency-groups\")\n vendored(\"distlib\")\n vendored(\"distro\")\n vendored(\"packaging\")\n vendored(\"packaging.version\")\n vendored(\"packaging.specifiers\")\n vendored(\"pkg_resources\")\n vendored(\"platformdirs\")\n vendored(\"progress\")\n vendored(\"pyproject_hooks\")\n vendored(\"requests\")\n vendored(\"requests.exceptions\")\n vendored(\"requests.packages\")\n vendored(\"requests.packages.urllib3\")\n vendored(\"requests.packages.urllib3._collections\")\n vendored(\"requests.packages.urllib3.connection\")\n vendored(\"requests.packages.urllib3.connectionpool\")\n vendored(\"requests.packages.urllib3.contrib\")\n vendored(\"requests.packages.urllib3.contrib.ntlmpool\")\n vendored(\"requests.packages.urllib3.contrib.pyopenssl\")\n vendored(\"requests.packages.urllib3.exceptions\")\n vendored(\"requests.packages.urllib3.fields\")\n vendored(\"requests.packages.urllib3.filepost\")\n vendored(\"requests.packages.urllib3.packages\")\n vendored(\"requests.packages.urllib3.packages.ordered_dict\")\n vendored(\"requests.packages.urllib3.packages.six\")\n vendored(\"requests.packages.urllib3.packages.ssl_match_hostname\")\n vendored(\"requests.packages.urllib3.packages.ssl_match_hostname.\"\n \"_implementation\")\n vendored(\"requests.packages.urllib3.poolmanager\")\n vendored(\"requests.packages.urllib3.request\")\n vendored(\"requests.packages.urllib3.response\")\n vendored(\"requests.packages.urllib3.util\")\n vendored(\"requests.packages.urllib3.util.connection\")\n vendored(\"requests.packages.urllib3.util.request\")\n vendored(\"requests.packages.urllib3.util.response\")\n vendored(\"requests.packages.urllib3.util.retry\")\n vendored(\"requests.packages.urllib3.util.ssl_\")\n vendored(\"requests.packages.urllib3.util.timeout\")\n vendored(\"requests.packages.urllib3.util.url\")\n vendored(\"resolvelib\")\n vendored(\"rich\")\n vendored(\"rich.console\")\n vendored(\"rich.highlighter\")\n vendored(\"rich.logging\")\n vendored(\"rich.markup\")\n vendored(\"rich.progress\")\n vendored(\"rich.segment\")\n vendored(\"rich.style\")\n vendored(\"rich.text\")\n vendored(\"rich.traceback\")\n if sys.version_info < (3, 11):\n vendored(\"tomli\")\n vendored(\"truststore\")\n vendored(\"urllib3\")\n",[],[216,809,810,811,890,891,893],"031d8c02-67fc-11f0-b800-0224a6c84d84","util","031d8cca-67fc-11f0-b800-0224a6c84d84","fee07d8e-67fb-11f0-928e-0224a6c84d84",101,["D",1753299253008],[],[216,809,810,811,890,891,908,901],"urllib3","03a1c10c-67fc-11f0-bfb3-0224a6c84d84","backports","03a1c1c0-67fc-11f0-bfb3-0224a6c84d84","0353664c-67fc-11f0-b654-0224a6c84d84",106,["D",1753299253876],[],[216,809,810,811,890,891,908,917,910],"packages","03536584-67fc-11f0-b654-0224a6c84d84",103,["D",1753299253364],[611],[216,809,810,811,890,891,908,917],"0389883a-67fc-11f0-a988-0224a6c84d84","_securetransport","03898902-67fc-11f0-a988-0224a6c84d84","033a883e-67fc-11f0-b800-0224a6c84d84",105,["D",1753299253715],[],[216,809,810,811,890,891,908,931,924],"contrib","033a8762-67fc-11f0-b800-0224a6c84d84",102,["D",1753299253196],[609],[216,809,810,811,890,891,908,931],"fee07cbc-67fb-11f0-928e-0224a6c84d84",85,["D",1753299245897],[608,610,612],[216,809,810,811,890,891,908],"0828322e-67fc-11f0-85ab-0224a6c84d84","_windows.py","082832ce-67fc-11f0-85ab-0224a6c84d84","fd7f4d6c-67fb-11f0-aedf-0224a6c84d84",296,["D",1753299261469],"import contextlib\nimport ssl\nimport typing\nfrom ctypes import WinDLL # type: ignore\nfrom ctypes import WinError # type: ignore\nfrom ctypes import (\n POINTER,\n Structure,\n c_char_p,\n c_ulong,\n c_void_p,\n c_wchar_p,\n cast,\n create_unicode_buffer,\n pointer,\n sizeof,\n)\nfrom ctypes.wintypes import (\n BOOL,\n DWORD,\n HANDLE,\n LONG,\n LPCSTR,\n LPCVOID,\n LPCWSTR,\n LPFILETIME,\n LPSTR,\n LPWSTR,\n)\nfrom typing import TYPE_CHECKING, Any\n\nfrom ._ssl_constants import _set_ssl_context_verify_mode\n\nHCERTCHAINENGINE = HANDLE\nHCERTSTORE = HANDLE\nHCRYPTPROV_LEGACY = HANDLE\n\n\nclass CERT_CONTEXT(Structure):\n _fields_ = (\n (\"dwCertEncodingType\", DWORD),\n (\"pbCertEncoded\", c_void_p),\n (\"cbCertEncoded\", DWORD),\n (\"pCertInfo\", c_void_p),\n (\"hCertStore\", HCERTSTORE),\n )\n\n\nPCERT_CONTEXT = POINTER(CERT_CONTEXT)\nPCCERT_CONTEXT = POINTER(PCERT_CONTEXT)\n\n\nclass CERT_ENHKEY_USAGE(Structure):\n _fields_ = (\n (\"cUsageIdentifier\", DWORD),\n (\"rgpszUsageIdentifier\", POINTER(LPSTR)),\n )\n\n\nPCERT_ENHKEY_USAGE = POINTER(CERT_ENHKEY_USAGE)\n\n\nclass CERT_USAGE_MATCH(Structure):\n _fields_ = (\n (\"dwType\", DWORD),\n (\"Usage\", CERT_ENHKEY_USAGE),\n )\n\n\nclass CERT_CHAIN_PARA(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"RequestedUsage\", CERT_USAGE_MATCH),\n (\"RequestedIssuancePolicy\", CERT_USAGE_MATCH),\n (\"dwUrlRetrievalTimeout\", DWORD),\n (\"fCheckRevocationFreshnessTime\", BOOL),\n (\"dwRevocationFreshnessTime\", DWORD),\n (\"pftCacheResync\", LPFILETIME),\n (\"pStrongSignPara\", c_void_p),\n (\"dwStrongSignFlags\", DWORD),\n )\n\n\nif TYPE_CHECKING:\n PCERT_CHAIN_PARA = pointer[CERT_CHAIN_PARA] # type: ignore[misc]\nelse:\n PCERT_CHAIN_PARA = POINTER(CERT_CHAIN_PARA)\n\n\nclass CERT_TRUST_STATUS(Structure):\n _fields_ = (\n (\"dwErrorStatus\", DWORD),\n (\"dwInfoStatus\", DWORD),\n )\n\n\nclass CERT_CHAIN_ELEMENT(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"pCertContext\", PCERT_CONTEXT),\n (\"TrustStatus\", CERT_TRUST_STATUS),\n (\"pRevocationInfo\", c_void_p),\n (\"pIssuanceUsage\", PCERT_ENHKEY_USAGE),\n (\"pApplicationUsage\", PCERT_ENHKEY_USAGE),\n (\"pwszExtendedErrorInfo\", LPCWSTR),\n )\n\n\nPCERT_CHAIN_ELEMENT = POINTER(CERT_CHAIN_ELEMENT)\n\n\nclass CERT_SIMPLE_CHAIN(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"TrustStatus\", CERT_TRUST_STATUS),\n (\"cElement\", DWORD),\n (\"rgpElement\", POINTER(PCERT_CHAIN_ELEMENT)),\n (\"pTrustListInfo\", c_void_p),\n (\"fHasRevocationFreshnessTime\", BOOL),\n (\"dwRevocationFreshnessTime\", DWORD),\n )\n\n\nPCERT_SIMPLE_CHAIN = POINTER(CERT_SIMPLE_CHAIN)\n\n\nclass CERT_CHAIN_CONTEXT(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"TrustStatus\", CERT_TRUST_STATUS),\n (\"cChain\", DWORD),\n (\"rgpChain\", POINTER(PCERT_SIMPLE_CHAIN)),\n (\"cLowerQualityChainContext\", DWORD),\n (\"rgpLowerQualityChainContext\", c_void_p),\n (\"fHasRevocationFreshnessTime\", BOOL),\n (\"dwRevocationFreshnessTime\", DWORD),\n )\n\n\nPCERT_CHAIN_CONTEXT = POINTER(CERT_CHAIN_CONTEXT)\nPCCERT_CHAIN_CONTEXT = POINTER(PCERT_CHAIN_CONTEXT)\n\n\nclass SSL_EXTRA_CERT_CHAIN_POLICY_PARA(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"dwAuthType\", DWORD),\n (\"fdwChecks\", DWORD),\n (\"pwszServerName\", LPCWSTR),\n )\n\n\nclass CERT_CHAIN_POLICY_PARA(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"dwFlags\", DWORD),\n (\"pvExtraPolicyPara\", c_void_p),\n )\n\n\nPCERT_CHAIN_POLICY_PARA = POINTER(CERT_CHAIN_POLICY_PARA)\n\n\nclass CERT_CHAIN_POLICY_STATUS(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"dwError\", DWORD),\n (\"lChainIndex\", LONG),\n (\"lElementIndex\", LONG),\n (\"pvExtraPolicyStatus\", c_void_p),\n )\n\n\nPCERT_CHAIN_POLICY_STATUS = POINTER(CERT_CHAIN_POLICY_STATUS)\n\n\nclass CERT_CHAIN_ENGINE_CONFIG(Structure):\n _fields_ = (\n (\"cbSize\", DWORD),\n (\"hRestrictedRoot\", HCERTSTORE),\n (\"hRestrictedTrust\", HCERTSTORE),\n (\"hRestrictedOther\", HCERTSTORE),\n (\"cAdditionalStore\", DWORD),\n (\"rghAdditionalStore\", c_void_p),\n (\"dwFlags\", DWORD),\n (\"dwUrlRetrievalTimeout\", DWORD),\n (\"MaximumCachedCertificates\", DWORD),\n (\"CycleDetectionModulus\", DWORD),\n (\"hExclusiveRoot\", HCERTSTORE),\n (\"hExclusiveTrustedPeople\", HCERTSTORE),\n (\"dwExclusiveFlags\", DWORD),\n )\n\n\nPCERT_CHAIN_ENGINE_CONFIG = POINTER(CERT_CHAIN_ENGINE_CONFIG)\nPHCERTCHAINENGINE = POINTER(HCERTCHAINENGINE)\n\nX509_ASN_ENCODING = 0x00000001\nPKCS_7_ASN_ENCODING = 0x00010000\nCERT_STORE_PROV_MEMORY = b\"Memory\"\nCERT_STORE_ADD_USE_EXISTING = 2\nUSAGE_MATCH_TYPE_OR = 1\nOID_PKIX_KP_SERVER_AUTH = c_char_p(b\"1.3.6.1.5.5.7.3.1\")\nCERT_CHAIN_REVOCATION_CHECK_END_CERT = 0x10000000\nCERT_CHAIN_REVOCATION_CHECK_CHAIN = 0x20000000\nCERT_CHAIN_POLICY_IGNORE_ALL_NOT_TIME_VALID_FLAGS = 0x00000007\nCERT_CHAIN_POLICY_IGNORE_INVALID_BASIC_CONSTRAINTS_FLAG = 0x00000008\nCERT_CHAIN_POLICY_ALLOW_UNKNOWN_CA_FLAG = 0x00000010\nCERT_CHAIN_POLICY_IGNORE_INVALID_NAME_FLAG = 0x00000040\nCERT_CHAIN_POLICY_IGNORE_WRONG_USAGE_FLAG = 0x00000020\nCERT_CHAIN_POLICY_IGNORE_INVALID_POLICY_FLAG = 0x00000080\nCERT_CHAIN_POLICY_IGNORE_ALL_REV_UNKNOWN_FLAGS = 0x00000F00\nCERT_CHAIN_POLICY_ALLOW_TESTROOT_FLAG = 0x00008000\nCERT_CHAIN_POLICY_TRUST_TESTROOT_FLAG = 0x00004000\nSECURITY_FLAG_IGNORE_CERT_CN_INVALID = 0x00001000\nAUTHTYPE_SERVER = 2\nCERT_CHAIN_POLICY_SSL = 4\nFORMAT_MESSAGE_FROM_SYSTEM = 0x00001000\nFORMAT_MESSAGE_IGNORE_INSERTS = 0x00000200\n\n# Flags to set for SSLContext.verify_mode=CERT_NONE\nCERT_CHAIN_POLICY_VERIFY_MODE_NONE_FLAGS = (\n CERT_CHAIN_POLICY_IGNORE_ALL_NOT_TIME_VALID_FLAGS\n | CERT_CHAIN_POLICY_IGNORE_INVALID_BASIC_CONSTRAINTS_FLAG\n | CERT_CHAIN_POLICY_ALLOW_UNKNOWN_CA_FLAG\n | CERT_CHAIN_POLICY_IGNORE_INVALID_NAME_FLAG\n | CERT_CHAIN_POLICY_IGNORE_WRONG_USAGE_FLAG\n | CERT_CHAIN_POLICY_IGNORE_INVALID_POLICY_FLAG\n | CERT_CHAIN_POLICY_IGNORE_ALL_REV_UNKNOWN_FLAGS\n | CERT_CHAIN_POLICY_ALLOW_TESTROOT_FLAG\n | CERT_CHAIN_POLICY_TRUST_TESTROOT_FLAG\n)\n\nwincrypt = WinDLL(\"crypt32.dll\")\nkernel32 = WinDLL(\"kernel32.dll\")\n\n\ndef _handle_win_error(result: bool, _: Any, args: Any) -> Any:\n if not result:\n # Note, actually raises OSError after calling GetLastError and FormatMessage\n raise WinError()\n return args\n\n\nCertCreateCertificateChainEngine = wincrypt.CertCreateCertificateChainEngine\nCertCreateCertificateChainEngine.argtypes = (\n PCERT_CHAIN_ENGINE_CONFIG,\n PHCERTCHAINENGINE,\n)\nCertCreateCertificateChainEngine.errcheck = _handle_win_error\n\nCertOpenStore = wincrypt.CertOpenStore\nCertOpenStore.argtypes = (LPCSTR, DWORD, HCRYPTPROV_LEGACY, DWORD, c_void_p)\nCertOpenStore.restype = HCERTSTORE\nCertOpenStore.errcheck = _handle_win_error\n\nCertAddEncodedCertificateToStore = wincrypt.CertAddEncodedCertificateToStore\nCertAddEncodedCertificateToStore.argtypes = (\n HCERTSTORE,\n DWORD,\n c_char_p,\n DWORD,\n DWORD,\n PCCERT_CONTEXT,\n)\nCertAddEncodedCertificateToStore.restype = BOOL\n\nCertCreateCertificateContext = wincrypt.CertCreateCertificateContext\nCertCreateCertificateContext.argtypes = (DWORD, c_char_p, DWORD)\nCertCreateCertificateContext.restype = PCERT_CONTEXT\nCertCreateCertificateContext.errcheck = _handle_win_error\n\nCertGetCertificateChain = wincrypt.CertGetCertificateChain\nCertGetCertificateChain.argtypes = (\n HCERTCHAINENGINE,\n PCERT_CONTEXT,\n LPFILETIME,\n HCERTSTORE,\n PCERT_CHAIN_PARA,\n DWORD,\n c_void_p,\n PCCERT_CHAIN_CONTEXT,\n)\nCertGetCertificateChain.restype = BOOL\nCertGetCertificateChain.errcheck = _handle_win_error\n\nCertVerifyCertificateChainPolicy = wincrypt.CertVerifyCertificateChainPolicy\nCertVerifyCertificateChainPolicy.argtypes = (\n c_ulong,\n PCERT_CHAIN_CONTEXT,\n PCERT_CHAIN_POLICY_PARA,\n PCERT_CHAIN_POLICY_STATUS,\n)\nCertVerifyCertificateChainPolicy.restype = BOOL\n\nCertCloseStore = wincrypt.CertCloseStore\nCertCloseStore.argtypes = (HCERTSTORE, DWORD)\nCertCloseStore.restype = BOOL\nCertCloseStore.errcheck = _handle_win_error\n\nCertFreeCertificateChain = wincrypt.CertFreeCertificateChain\nCertFreeCertificateChain.argtypes = (PCERT_CHAIN_CONTEXT,)\n\nCertFreeCertificateContext = wincrypt.CertFreeCertificateContext\nCertFreeCertificateContext.argtypes = (PCERT_CONTEXT,)\n\nCertFreeCertificateChainEngine = wincrypt.CertFreeCertificateChainEngine\nCertFreeCertificateChainEngine.argtypes = (HCERTCHAINENGINE,)\n\nFormatMessageW = kernel32.FormatMessageW\nFormatMessageW.argtypes = (\n DWORD,\n LPCVOID,\n DWORD,\n DWORD,\n LPWSTR,\n DWORD,\n c_void_p,\n)\nFormatMessageW.restype = DWORD\n\n\ndef _verify_peercerts_impl(\n ssl_context: ssl.SSLContext,\n cert_chain: list[bytes],\n server_hostname: str | None = None,\n) -> None:\n \"\"\"Verify the cert_chain from the server using Windows APIs.\"\"\"\n\n # If the peer didn't send any certificates then\n # we can't do verification. Raise an error.\n if not cert_chain:\n raise ssl.SSLCertVerificationError(\"Peer sent no certificates to verify\")\n\n pCertContext = None\n hIntermediateCertStore = CertOpenStore(CERT_STORE_PROV_MEMORY, 0, None, 0, None)\n try:\n # Add intermediate certs to an in-memory cert store\n for cert_bytes in cert_chain[1:]:\n CertAddEncodedCertificateToStore(\n hIntermediateCertStore,\n X509_ASN_ENCODING | PKCS_7_ASN_ENCODING,\n cert_bytes,\n len(cert_bytes),\n CERT_STORE_ADD_USE_EXISTING,\n None,\n )\n\n # Cert context for leaf cert\n leaf_cert = cert_chain[0]\n pCertContext = CertCreateCertificateContext(\n X509_ASN_ENCODING | PKCS_7_ASN_ENCODING, leaf_cert, len(leaf_cert)\n )\n\n # Chain params to match certs for serverAuth extended usage\n cert_enhkey_usage = CERT_ENHKEY_USAGE()\n cert_enhkey_usage.cUsageIdentifier = 1\n cert_enhkey_usage.rgpszUsageIdentifier = (c_char_p * 1)(OID_PKIX_KP_SERVER_AUTH)\n cert_usage_match = CERT_USAGE_MATCH()\n cert_usage_match.Usage = cert_enhkey_usage\n chain_params = CERT_CHAIN_PARA()\n chain_params.RequestedUsage = cert_usage_match\n chain_params.cbSize = sizeof(chain_params)\n pChainPara = pointer(chain_params)\n\n if ssl_context.verify_flags & ssl.VERIFY_CRL_CHECK_CHAIN:\n chain_flags = CERT_CHAIN_REVOCATION_CHECK_CHAIN\n elif ssl_context.verify_flags & ssl.VERIFY_CRL_CHECK_LEAF:\n chain_flags = CERT_CHAIN_REVOCATION_CHECK_END_CERT\n else:\n chain_flags = 0\n\n try:\n # First attempt to verify using the default Windows system trust roots\n # (default chain engine).\n _get_and_verify_cert_chain(\n ssl_context,\n None,\n hIntermediateCertStore,\n pCertContext,\n pChainPara,\n server_hostname,\n chain_flags=chain_flags,\n )\n except ssl.SSLCertVerificationError as e:\n # If that fails but custom CA certs have been added\n # to the SSLContext using load_verify_locations,\n # try verifying using a custom chain engine\n # that trusts the custom CA certs.\n custom_ca_certs: list[bytes] | None = ssl_context.get_ca_certs(\n binary_form=True\n )\n if custom_ca_certs:\n try:\n _verify_using_custom_ca_certs(\n ssl_context,\n custom_ca_certs,\n hIntermediateCertStore,\n pCertContext,\n pChainPara,\n server_hostname,\n chain_flags=chain_flags,\n )\n # Raise the original error, not the new error.\n except ssl.SSLCertVerificationError:\n raise e from None\n else:\n raise\n finally:\n CertCloseStore(hIntermediateCertStore, 0)\n if pCertContext:\n CertFreeCertificateContext(pCertContext)\n\n\ndef _get_and_verify_cert_chain(\n ssl_context: ssl.SSLContext,\n hChainEngine: HCERTCHAINENGINE | None,\n hIntermediateCertStore: HCERTSTORE,\n pPeerCertContext: c_void_p,\n pChainPara: PCERT_CHAIN_PARA, # type: ignore[valid-type]\n server_hostname: str | None,\n chain_flags: int,\n) -> None:\n ppChainContext = None\n try:\n # Get cert chain\n ppChainContext = pointer(PCERT_CHAIN_CONTEXT())\n CertGetCertificateChain(\n hChainEngine, # chain engine\n pPeerCertContext, # leaf cert context\n None, # current system time\n hIntermediateCertStore, # additional in-memory cert store\n pChainPara, # chain-building parameters\n chain_flags,\n None, # reserved\n ppChainContext, # the resulting chain context\n )\n pChainContext = ppChainContext.contents\n\n # Verify cert chain\n ssl_extra_cert_chain_policy_para = SSL_EXTRA_CERT_CHAIN_POLICY_PARA()\n ssl_extra_cert_chain_policy_para.cbSize = sizeof(\n ssl_extra_cert_chain_policy_para\n )\n ssl_extra_cert_chain_policy_para.dwAuthType = AUTHTYPE_SERVER\n ssl_extra_cert_chain_policy_para.fdwChecks = 0\n if ssl_context.check_hostname is False:\n ssl_extra_cert_chain_policy_para.fdwChecks = (\n SECURITY_FLAG_IGNORE_CERT_CN_INVALID\n )\n if server_hostname:\n ssl_extra_cert_chain_policy_para.pwszServerName = c_wchar_p(server_hostname)\n\n chain_policy = CERT_CHAIN_POLICY_PARA()\n chain_policy.pvExtraPolicyPara = cast(\n pointer(ssl_extra_cert_chain_policy_para), c_void_p\n )\n if ssl_context.verify_mode == ssl.CERT_NONE:\n chain_policy.dwFlags |= CERT_CHAIN_POLICY_VERIFY_MODE_NONE_FLAGS\n chain_policy.cbSize = sizeof(chain_policy)\n\n pPolicyPara = pointer(chain_policy)\n policy_status = CERT_CHAIN_POLICY_STATUS()\n policy_status.cbSize = sizeof(policy_status)\n pPolicyStatus = pointer(policy_status)\n CertVerifyCertificateChainPolicy(\n CERT_CHAIN_POLICY_SSL,\n pChainContext,\n pPolicyPara,\n pPolicyStatus,\n )\n\n # Check status\n error_code = policy_status.dwError\n if error_code:\n # Try getting a human readable message for an error code.\n error_message_buf = create_unicode_buffer(1024)\n error_message_chars = FormatMessageW(\n FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS,\n None,\n error_code,\n 0,\n error_message_buf,\n sizeof(error_message_buf),\n None,\n )\n\n # See if we received a message for the error,\n # otherwise we use a generic error with the\n # error code and hope that it's search-able.\n if error_message_chars <= 0:\n error_message = f\"Certificate chain policy error {error_code:#x} [{policy_status.lElementIndex}]\"\n else:\n error_message = error_message_buf.value.strip()\n\n err = ssl.SSLCertVerificationError(error_message)\n err.verify_message = error_message\n err.verify_code = error_code\n raise err from None\n finally:\n if ppChainContext:\n CertFreeCertificateChain(ppChainContext.contents)\n\n\ndef _verify_using_custom_ca_certs(\n ssl_context: ssl.SSLContext,\n custom_ca_certs: list[bytes],\n hIntermediateCertStore: HCERTSTORE,\n pPeerCertContext: c_void_p,\n pChainPara: PCERT_CHAIN_PARA, # type: ignore[valid-type]\n server_hostname: str | None,\n chain_flags: int,\n) -> None:\n hChainEngine = None\n hRootCertStore = CertOpenStore(CERT_STORE_PROV_MEMORY, 0, None, 0, None)\n try:\n # Add custom CA certs to an in-memory cert store\n for cert_bytes in custom_ca_certs:\n CertAddEncodedCertificateToStore(\n hRootCertStore,\n X509_ASN_ENCODING | PKCS_7_ASN_ENCODING,\n cert_bytes,\n len(cert_bytes),\n CERT_STORE_ADD_USE_EXISTING,\n None,\n )\n\n # Create a custom cert chain engine which exclusively trusts\n # certs from our hRootCertStore\n cert_chain_engine_config = CERT_CHAIN_ENGINE_CONFIG()\n cert_chain_engine_config.cbSize = sizeof(cert_chain_engine_config)\n cert_chain_engine_config.hExclusiveRoot = hRootCertStore\n pConfig = pointer(cert_chain_engine_config)\n phChainEngine = pointer(HCERTCHAINENGINE())\n CertCreateCertificateChainEngine(\n pConfig,\n phChainEngine,\n )\n hChainEngine = phChainEngine.contents\n\n # Get and verify a cert chain using the custom chain engine\n _get_and_verify_cert_chain(\n ssl_context,\n hChainEngine,\n hIntermediateCertStore,\n pPeerCertContext,\n pChainPara,\n server_hostname,\n chain_flags,\n )\n finally:\n if hChainEngine:\n CertFreeCertificateChainEngine(hChainEngine)\n CertCloseStore(hRootCertStore, 0)\n\n\n@contextlib.contextmanager\ndef _configure_context(ctx: ssl.SSLContext) -> typing.Iterator[None]:\n check_hostname = ctx.check_hostname\n verify_mode = ctx.verify_mode\n ctx.check_hostname = False\n _set_ssl_context_verify_mode(ctx, ssl.CERT_NONE)\n try:\n yield\n finally:\n ctx.check_hostname = check_hostname\n _set_ssl_context_verify_mode(ctx, verify_mode)\n",[],[216,809,810,811,890,891,951,943],"truststore","08301322-67fc-11f0-b489-0224a6c84d84","_ssl_constants.py","083013d6-67fc-11f0-b489-0224a6c84d84",297,["D",1753299261434],"import ssl\nimport sys\nimport typing\n\n# Hold on to the original class so we can create it consistently\n# even if we inject our own SSLContext into the ssl module.\n_original_SSLContext = ssl.SSLContext\n_original_super_SSLContext = super(_original_SSLContext, _original_SSLContext)\n\n# CPython is known to be good, but non-CPython implementations\n# may implement SSLContext differently so to be safe we don't\n# subclass the SSLContext.\n\n# This is returned by truststore.SSLContext.__class__()\n_truststore_SSLContext_dunder_class: typing.Optional[type]\n\n# This value is the superclass of truststore.SSLContext.\n_truststore_SSLContext_super_class: type\n\nif sys.implementation.name == \"cpython\":\n _truststore_SSLContext_super_class = _original_SSLContext\n _truststore_SSLContext_dunder_class = None\nelse:\n _truststore_SSLContext_super_class = object\n _truststore_SSLContext_dunder_class = _original_SSLContext\n\n\ndef _set_ssl_context_verify_mode(\n ssl_context: ssl.SSLContext, verify_mode: ssl.VerifyMode\n) -> None:\n _original_super_SSLContext.verify_mode.__set__(ssl_context, verify_mode) # type: ignore[attr-defined]\n",[],[216,809,810,811,890,891,951,953],"080c7250-67fc-11f0-aedf-0224a6c84d84","_openssl.py","080c7336-67fc-11f0-aedf-0224a6c84d84",292,["D",1753299261275],"import contextlib\nimport os\nimport re\nimport ssl\nimport typing\n\n# candidates based on https://github.com/tiran/certifi-system-store by Christian Heimes\n_CA_FILE_CANDIDATES = [\n # Alpine, Arch, Fedora 34+, OpenWRT, RHEL 9+, BSD\n \"/etc/ssl/cert.pem\",\n # Fedora <= 34, RHEL <= 9, CentOS <= 9\n \"/etc/pki/tls/cert.pem\",\n # Debian, Ubuntu (requires ca-certificates)\n \"/etc/ssl/certs/ca-certificates.crt\",\n # SUSE\n \"/etc/ssl/ca-bundle.pem\",\n]\n\n_HASHED_CERT_FILENAME_RE = re.compile(r\"^[0-9a-fA-F]{8}\\.[0-9]$\")\n\n\n@contextlib.contextmanager\ndef _configure_context(ctx: ssl.SSLContext) -> typing.Iterator[None]:\n # First, check whether the default locations from OpenSSL\n # seem like they will give us a usable set of CA certs.\n # ssl.get_default_verify_paths already takes care of:\n # - getting cafile from either the SSL_CERT_FILE env var\n # or the path configured when OpenSSL was compiled,\n # and verifying that that path exists\n # - getting capath from either the SSL_CERT_DIR env var\n # or the path configured when OpenSSL was compiled,\n # and verifying that that path exists\n # In addition we'll check whether capath appears to contain certs.\n defaults = ssl.get_default_verify_paths()\n if defaults.cafile or (defaults.capath and _capath_contains_certs(defaults.capath)):\n ctx.set_default_verify_paths()\n else:\n # cafile from OpenSSL doesn't exist\n # and capath from OpenSSL doesn't contain certs.\n # Let's search other common locations instead.\n for cafile in _CA_FILE_CANDIDATES:\n if os.path.isfile(cafile):\n ctx.load_verify_locations(cafile=cafile)\n break\n\n yield\n\n\ndef _capath_contains_certs(capath: str) -> bool:\n \"\"\"Check whether capath exists and contains certs in the expected format.\"\"\"\n if not os.path.isdir(capath):\n return False\n for name in os.listdir(capath):\n if _HASHED_CERT_FILENAME_RE.match(name):\n return True\n return False\n\n\ndef _verify_peercerts_impl(\n ssl_context: ssl.SSLContext,\n cert_chain: list[bytes],\n server_hostname: str | None = None,\n) -> None:\n # This is a no-op because we've enabled SSLContext's built-in\n # verification via verify_mode=CERT_REQUIRED, and don't need to repeat it.\n pass\n",[],[216,809,810,811,890,891,951,961],"08186f88-67fc-11f0-85ab-0224a6c84d84","_macos.py","0818701e-67fc-11f0-85ab-0224a6c84d84",293,["D",1753299261365],"import contextlib\nimport ctypes\nimport platform\nimport ssl\nimport typing\nfrom ctypes import (\n CDLL,\n POINTER,\n c_bool,\n c_char_p,\n c_int32,\n c_long,\n c_uint32,\n c_ulong,\n c_void_p,\n)\nfrom ctypes.util import find_library\n\nfrom ._ssl_constants import _set_ssl_context_verify_mode\n\n_mac_version = platform.mac_ver()[0]\n_mac_version_info = tuple(map(int, _mac_version.split(\".\")))\nif _mac_version_info < (10, 8):\n raise ImportError(\n f\"Only OS X 10.8 and newer are supported, not {_mac_version_info[0]}.{_mac_version_info[1]}\"\n )\n\n_is_macos_version_10_14_or_later = _mac_version_info >= (10, 14)\n\n\ndef _load_cdll(name: str, macos10_16_path: str) -> CDLL:\n \"\"\"Loads a CDLL by name, falling back to known path on 10.16+\"\"\"\n try:\n # Big Sur is technically 11 but we use 10.16 due to the Big Sur\n # beta being labeled as 10.16.\n path: str | None\n if _mac_version_info >= (10, 16):\n path = macos10_16_path\n else:\n path = find_library(name)\n if not path:\n raise OSError # Caught and reraised as 'ImportError'\n return CDLL(path, use_errno=True)\n except OSError:\n raise ImportError(f\"The library {name} failed to load\") from None\n\n\nSecurity = _load_cdll(\n \"Security\", \"/System/Library/Frameworks/Security.framework/Security\"\n)\nCoreFoundation = _load_cdll(\n \"CoreFoundation\",\n \"/System/Library/Frameworks/CoreFoundation.framework/CoreFoundation\",\n)\n\nBoolean = c_bool\nCFIndex = c_long\nCFStringEncoding = c_uint32\nCFData = c_void_p\nCFString = c_void_p\nCFArray = c_void_p\nCFMutableArray = c_void_p\nCFError = c_void_p\nCFType = c_void_p\nCFTypeID = c_ulong\nCFTypeRef = POINTER(CFType)\nCFAllocatorRef = c_void_p\n\nOSStatus = c_int32\n\nCFErrorRef = POINTER(CFError)\nCFDataRef = POINTER(CFData)\nCFStringRef = POINTER(CFString)\nCFArrayRef = POINTER(CFArray)\nCFMutableArrayRef = POINTER(CFMutableArray)\nCFArrayCallBacks = c_void_p\nCFOptionFlags = c_uint32\n\nSecCertificateRef = POINTER(c_void_p)\nSecPolicyRef = POINTER(c_void_p)\nSecTrustRef = POINTER(c_void_p)\nSecTrustResultType = c_uint32\nSecTrustOptionFlags = c_uint32\n\ntry:\n Security.SecCertificateCreateWithData.argtypes = [CFAllocatorRef, CFDataRef]\n Security.SecCertificateCreateWithData.restype = SecCertificateRef\n\n Security.SecCertificateCopyData.argtypes = [SecCertificateRef]\n Security.SecCertificateCopyData.restype = CFDataRef\n\n Security.SecCopyErrorMessageString.argtypes = [OSStatus, c_void_p]\n Security.SecCopyErrorMessageString.restype = CFStringRef\n\n Security.SecTrustSetAnchorCertificates.argtypes = [SecTrustRef, CFArrayRef]\n Security.SecTrustSetAnchorCertificates.restype = OSStatus\n\n Security.SecTrustSetAnchorCertificatesOnly.argtypes = [SecTrustRef, Boolean]\n Security.SecTrustSetAnchorCertificatesOnly.restype = OSStatus\n\n Security.SecPolicyCreateRevocation.argtypes = [CFOptionFlags]\n Security.SecPolicyCreateRevocation.restype = SecPolicyRef\n\n Security.SecPolicyCreateSSL.argtypes = [Boolean, CFStringRef]\n Security.SecPolicyCreateSSL.restype = SecPolicyRef\n\n Security.SecTrustCreateWithCertificates.argtypes = [\n CFTypeRef,\n CFTypeRef,\n POINTER(SecTrustRef),\n ]\n Security.SecTrustCreateWithCertificates.restype = OSStatus\n\n Security.SecTrustGetTrustResult.argtypes = [\n SecTrustRef,\n POINTER(SecTrustResultType),\n ]\n Security.SecTrustGetTrustResult.restype = OSStatus\n\n Security.SecTrustEvaluate.argtypes = [\n SecTrustRef,\n POINTER(SecTrustResultType),\n ]\n Security.SecTrustEvaluate.restype = OSStatus\n\n Security.SecTrustRef = SecTrustRef # type: ignore[attr-defined]\n Security.SecTrustResultType = SecTrustResultType # type: ignore[attr-defined]\n Security.OSStatus = OSStatus # type: ignore[attr-defined]\n\n kSecRevocationUseAnyAvailableMethod = 3\n kSecRevocationRequirePositiveResponse = 8\n\n CoreFoundation.CFRelease.argtypes = [CFTypeRef]\n CoreFoundation.CFRelease.restype = None\n\n CoreFoundation.CFGetTypeID.argtypes = [CFTypeRef]\n CoreFoundation.CFGetTypeID.restype = CFTypeID\n\n CoreFoundation.CFStringCreateWithCString.argtypes = [\n CFAllocatorRef,\n c_char_p,\n CFStringEncoding,\n ]\n CoreFoundation.CFStringCreateWithCString.restype = CFStringRef\n\n CoreFoundation.CFStringGetCStringPtr.argtypes = [CFStringRef, CFStringEncoding]\n CoreFoundation.CFStringGetCStringPtr.restype = c_char_p\n\n CoreFoundation.CFStringGetCString.argtypes = [\n CFStringRef,\n c_char_p,\n CFIndex,\n CFStringEncoding,\n ]\n CoreFoundation.CFStringGetCString.restype = c_bool\n\n CoreFoundation.CFDataCreate.argtypes = [CFAllocatorRef, c_char_p, CFIndex]\n CoreFoundation.CFDataCreate.restype = CFDataRef\n\n CoreFoundation.CFDataGetLength.argtypes = [CFDataRef]\n CoreFoundation.CFDataGetLength.restype = CFIndex\n\n CoreFoundation.CFDataGetBytePtr.argtypes = [CFDataRef]\n CoreFoundation.CFDataGetBytePtr.restype = c_void_p\n\n CoreFoundation.CFArrayCreate.argtypes = [\n CFAllocatorRef,\n POINTER(CFTypeRef),\n CFIndex,\n CFArrayCallBacks,\n ]\n CoreFoundation.CFArrayCreate.restype = CFArrayRef\n\n CoreFoundation.CFArrayCreateMutable.argtypes = [\n CFAllocatorRef,\n CFIndex,\n CFArrayCallBacks,\n ]\n CoreFoundation.CFArrayCreateMutable.restype = CFMutableArrayRef\n\n CoreFoundation.CFArrayAppendValue.argtypes = [CFMutableArrayRef, c_void_p]\n CoreFoundation.CFArrayAppendValue.restype = None\n\n CoreFoundation.CFArrayGetCount.argtypes = [CFArrayRef]\n CoreFoundation.CFArrayGetCount.restype = CFIndex\n\n CoreFoundation.CFArrayGetValueAtIndex.argtypes = [CFArrayRef, CFIndex]\n CoreFoundation.CFArrayGetValueAtIndex.restype = c_void_p\n\n CoreFoundation.CFErrorGetCode.argtypes = [CFErrorRef]\n CoreFoundation.CFErrorGetCode.restype = CFIndex\n\n CoreFoundation.CFErrorCopyDescription.argtypes = [CFErrorRef]\n CoreFoundation.CFErrorCopyDescription.restype = CFStringRef\n\n CoreFoundation.kCFAllocatorDefault = CFAllocatorRef.in_dll( # type: ignore[attr-defined]\n CoreFoundation, \"kCFAllocatorDefault\"\n )\n CoreFoundation.kCFTypeArrayCallBacks = c_void_p.in_dll( # type: ignore[attr-defined]\n CoreFoundation, \"kCFTypeArrayCallBacks\"\n )\n\n CoreFoundation.CFTypeRef = CFTypeRef # type: ignore[attr-defined]\n CoreFoundation.CFArrayRef = CFArrayRef # type: ignore[attr-defined]\n CoreFoundation.CFStringRef = CFStringRef # type: ignore[attr-defined]\n CoreFoundation.CFErrorRef = CFErrorRef # type: ignore[attr-defined]\n\nexcept AttributeError as e:\n raise ImportError(f\"Error initializing ctypes: {e}\") from None\n\n# SecTrustEvaluateWithError is macOS 10.14+\nif _is_macos_version_10_14_or_later:\n try:\n Security.SecTrustEvaluateWithError.argtypes = [\n SecTrustRef,\n POINTER(CFErrorRef),\n ]\n Security.SecTrustEvaluateWithError.restype = c_bool\n except AttributeError as e:\n raise ImportError(f\"Error initializing ctypes: {e}\") from None\n\n\ndef _handle_osstatus(result: OSStatus, _: typing.Any, args: typing.Any) -> typing.Any:\n \"\"\"\n Raises an error if the OSStatus value is non-zero.\n \"\"\"\n if int(result) == 0:\n return args\n\n # Returns a CFString which we need to transform\n # into a UTF-8 Python string.\n error_message_cfstring = None\n try:\n error_message_cfstring = Security.SecCopyErrorMessageString(result, None)\n\n # First step is convert the CFString into a C string pointer.\n # We try the fast no-copy way first.\n error_message_cfstring_c_void_p = ctypes.cast(\n error_message_cfstring, ctypes.POINTER(ctypes.c_void_p)\n )\n message = CoreFoundation.CFStringGetCStringPtr(\n error_message_cfstring_c_void_p, CFConst.kCFStringEncodingUTF8\n )\n\n # Quoting the Apple dev docs:\n #\n # \"A pointer to a C string or NULL if the internal\n # storage of theString does not allow this to be\n # returned efficiently.\"\n #\n # So we need to get our hands dirty.\n if message is None:\n buffer = ctypes.create_string_buffer(1024)\n result = CoreFoundation.CFStringGetCString(\n error_message_cfstring_c_void_p,\n buffer,\n 1024,\n CFConst.kCFStringEncodingUTF8,\n )\n if not result:\n raise OSError(\"Error copying C string from CFStringRef\")\n message = buffer.value\n\n finally:\n if error_message_cfstring is not None:\n CoreFoundation.CFRelease(error_message_cfstring)\n\n # If no message can be found for this status we come\n # up with a generic one that forwards the status code.\n if message is None or message == \"\":\n message = f\"SecureTransport operation returned a non-zero OSStatus: {result}\"\n\n raise ssl.SSLError(message)\n\n\nSecurity.SecTrustCreateWithCertificates.errcheck = _handle_osstatus # type: ignore[assignment]\nSecurity.SecTrustSetAnchorCertificates.errcheck = _handle_osstatus # type: ignore[assignment]\nSecurity.SecTrustSetAnchorCertificatesOnly.errcheck = _handle_osstatus # type: ignore[assignment]\nSecurity.SecTrustGetTrustResult.errcheck = _handle_osstatus # type: ignore[assignment]\nSecurity.SecTrustEvaluate.errcheck = _handle_osstatus # type: ignore[assignment]\n\n\nclass CFConst:\n \"\"\"CoreFoundation constants\"\"\"\n\n kCFStringEncodingUTF8 = CFStringEncoding(0x08000100)\n\n errSecIncompleteCertRevocationCheck = -67635\n errSecHostNameMismatch = -67602\n errSecCertificateExpired = -67818\n errSecNotTrusted = -67843\n\n\ndef _bytes_to_cf_data_ref(value: bytes) -> CFDataRef: # type: ignore[valid-type]\n return CoreFoundation.CFDataCreate( # type: ignore[no-any-return]\n CoreFoundation.kCFAllocatorDefault, value, len(value)\n )\n\n\ndef _bytes_to_cf_string(value: bytes) -> CFString:\n \"\"\"\n Given a Python binary data, create a CFString.\n The string must be CFReleased by the caller.\n \"\"\"\n c_str = ctypes.c_char_p(value)\n cf_str = CoreFoundation.CFStringCreateWithCString(\n CoreFoundation.kCFAllocatorDefault,\n c_str,\n CFConst.kCFStringEncodingUTF8,\n )\n return cf_str # type: ignore[no-any-return]\n\n\ndef _cf_string_ref_to_str(cf_string_ref: CFStringRef) -> str | None: # type: ignore[valid-type]\n \"\"\"\n Creates a Unicode string from a CFString object. Used entirely for error\n reporting.\n Yes, it annoys me quite a lot that this function is this complex.\n \"\"\"\n\n string = CoreFoundation.CFStringGetCStringPtr(\n cf_string_ref, CFConst.kCFStringEncodingUTF8\n )\n if string is None:\n buffer = ctypes.create_string_buffer(1024)\n result = CoreFoundation.CFStringGetCString(\n cf_string_ref, buffer, 1024, CFConst.kCFStringEncodingUTF8\n )\n if not result:\n raise OSError(\"Error copying C string from CFStringRef\")\n string = buffer.value\n if string is not None:\n string = string.decode(\"utf-8\")\n return string # type: ignore[no-any-return]\n\n\ndef _der_certs_to_cf_cert_array(certs: list[bytes]) -> CFMutableArrayRef: # type: ignore[valid-type]\n \"\"\"Builds a CFArray of SecCertificateRefs from a list of DER-encoded certificates.\n Responsibility of the caller to call CoreFoundation.CFRelease on the CFArray.\n \"\"\"\n cf_array = CoreFoundation.CFArrayCreateMutable(\n CoreFoundation.kCFAllocatorDefault,\n 0,\n ctypes.byref(CoreFoundation.kCFTypeArrayCallBacks),\n )\n if not cf_array:\n raise MemoryError(\"Unable to allocate memory!\")\n\n for cert_data in certs:\n cf_data = None\n sec_cert_ref = None\n try:\n cf_data = _bytes_to_cf_data_ref(cert_data)\n sec_cert_ref = Security.SecCertificateCreateWithData(\n CoreFoundation.kCFAllocatorDefault, cf_data\n )\n CoreFoundation.CFArrayAppendValue(cf_array, sec_cert_ref)\n finally:\n if cf_data:\n CoreFoundation.CFRelease(cf_data)\n if sec_cert_ref:\n CoreFoundation.CFRelease(sec_cert_ref)\n\n return cf_array # type: ignore[no-any-return]\n\n\n@contextlib.contextmanager\ndef _configure_context(ctx: ssl.SSLContext) -> typing.Iterator[None]:\n check_hostname = ctx.check_hostname\n verify_mode = ctx.verify_mode\n ctx.check_hostname = False\n _set_ssl_context_verify_mode(ctx, ssl.CERT_NONE)\n try:\n yield\n finally:\n ctx.check_hostname = check_hostname\n _set_ssl_context_verify_mode(ctx, verify_mode)\n\n\ndef _verify_peercerts_impl(\n ssl_context: ssl.SSLContext,\n cert_chain: list[bytes],\n server_hostname: str | None = None,\n) -> None:\n certs = None\n policies = None\n trust = None\n try:\n # Only set a hostname on the policy if we're verifying the hostname\n # on the leaf certificate.\n if server_hostname is not None and ssl_context.check_hostname:\n cf_str_hostname = None\n try:\n cf_str_hostname = _bytes_to_cf_string(server_hostname.encode(\"ascii\"))\n ssl_policy = Security.SecPolicyCreateSSL(True, cf_str_hostname)\n finally:\n if cf_str_hostname:\n CoreFoundation.CFRelease(cf_str_hostname)\n else:\n ssl_policy = Security.SecPolicyCreateSSL(True, None)\n\n policies = ssl_policy\n if ssl_context.verify_flags & ssl.VERIFY_CRL_CHECK_CHAIN:\n # Add explicit policy requiring positive revocation checks\n policies = CoreFoundation.CFArrayCreateMutable(\n CoreFoundation.kCFAllocatorDefault,\n 0,\n ctypes.byref(CoreFoundation.kCFTypeArrayCallBacks),\n )\n CoreFoundation.CFArrayAppendValue(policies, ssl_policy)\n CoreFoundation.CFRelease(ssl_policy)\n revocation_policy = Security.SecPolicyCreateRevocation(\n kSecRevocationUseAnyAvailableMethod\n | kSecRevocationRequirePositiveResponse\n )\n CoreFoundation.CFArrayAppendValue(policies, revocation_policy)\n CoreFoundation.CFRelease(revocation_policy)\n elif ssl_context.verify_flags & ssl.VERIFY_CRL_CHECK_LEAF:\n raise NotImplementedError(\"VERIFY_CRL_CHECK_LEAF not implemented for macOS\")\n\n certs = None\n try:\n certs = _der_certs_to_cf_cert_array(cert_chain)\n\n # Now that we have certificates loaded and a SecPolicy\n # we can finally create a SecTrust object!\n trust = Security.SecTrustRef()\n Security.SecTrustCreateWithCertificates(\n certs, policies, ctypes.byref(trust)\n )\n\n finally:\n # The certs are now being held by SecTrust so we can\n # release our handles for the array.\n if certs:\n CoreFoundation.CFRelease(certs)\n\n # If there are additional trust anchors to load we need to transform\n # the list of DER-encoded certificates into a CFArray.\n ctx_ca_certs_der: list[bytes] | None = ssl_context.get_ca_certs(\n binary_form=True\n )\n if ctx_ca_certs_der:\n ctx_ca_certs = None\n try:\n ctx_ca_certs = _der_certs_to_cf_cert_array(ctx_ca_certs_der)\n Security.SecTrustSetAnchorCertificates(trust, ctx_ca_certs)\n finally:\n if ctx_ca_certs:\n CoreFoundation.CFRelease(ctx_ca_certs)\n\n # We always want system certificates.\n Security.SecTrustSetAnchorCertificatesOnly(trust, False)\n\n # macOS 10.13 and earlier don't support SecTrustEvaluateWithError()\n # so we use SecTrustEvaluate() which means we need to construct error\n # messages ourselves.\n if _is_macos_version_10_14_or_later:\n _verify_peercerts_impl_macos_10_14(ssl_context, trust)\n else:\n _verify_peercerts_impl_macos_10_13(ssl_context, trust)\n finally:\n if policies:\n CoreFoundation.CFRelease(policies)\n if trust:\n CoreFoundation.CFRelease(trust)\n\n\ndef _verify_peercerts_impl_macos_10_13(\n ssl_context: ssl.SSLContext, sec_trust_ref: typing.Any\n) -> None:\n \"\"\"Verify using 'SecTrustEvaluate' API for macOS 10.13 and earlier.\n macOS 10.14 added the 'SecTrustEvaluateWithError' API.\n \"\"\"\n sec_trust_result_type = Security.SecTrustResultType()\n Security.SecTrustEvaluate(sec_trust_ref, ctypes.byref(sec_trust_result_type))\n\n try:\n sec_trust_result_type_as_int = int(sec_trust_result_type.value)\n except (ValueError, TypeError):\n sec_trust_result_type_as_int = -1\n\n # Apple doesn't document these values in their own API docs.\n # See: https://github.com/xybp888/iOS-SDKs/blob/master/iPhoneOS13.0.sdk/System/Library/Frameworks/Security.framework/Headers/SecTrust.h#L84\n if (\n ssl_context.verify_mode == ssl.CERT_REQUIRED\n and sec_trust_result_type_as_int not in (1, 4)\n ):\n # Note that we're not able to ignore only hostname errors\n # for macOS 10.13 and earlier, so check_hostname=False will\n # still return an error.\n sec_trust_result_type_to_message = {\n 0: \"Invalid trust result type\",\n # 1: \"Trust evaluation succeeded\",\n 2: \"User confirmation required\",\n 3: \"User specified that certificate is not trusted\",\n # 4: \"Trust result is unspecified\",\n 5: \"Recoverable trust failure occurred\",\n 6: \"Fatal trust failure occurred\",\n 7: \"Other error occurred, certificate may be revoked\",\n }\n error_message = sec_trust_result_type_to_message.get(\n sec_trust_result_type_as_int,\n f\"Unknown trust result: {sec_trust_result_type_as_int}\",\n )\n\n err = ssl.SSLCertVerificationError(error_message)\n err.verify_message = error_message\n err.verify_code = sec_trust_result_type_as_int\n raise err\n\n\ndef _verify_peercerts_impl_macos_10_14(\n ssl_context: ssl.SSLContext, sec_trust_ref: typing.Any\n) -> None:\n \"\"\"Verify using 'SecTrustEvaluateWithError' API for macOS 10.14+.\"\"\"\n cf_error = CoreFoundation.CFErrorRef()\n sec_trust_eval_result = Security.SecTrustEvaluateWithError(\n sec_trust_ref, ctypes.byref(cf_error)\n )\n # sec_trust_eval_result is a bool (0 or 1)\n # where 1 means that the certs are trusted.\n if sec_trust_eval_result == 1:\n is_trusted = True\n elif sec_trust_eval_result == 0:\n is_trusted = False\n else:\n raise ssl.SSLError(\n f\"Unknown result from Security.SecTrustEvaluateWithError: {sec_trust_eval_result!r}\"\n )\n\n cf_error_code = 0\n if not is_trusted:\n cf_error_code = CoreFoundation.CFErrorGetCode(cf_error)\n\n # If the error is a known failure that we're\n # explicitly okay with from SSLContext configuration\n # we can set is_trusted accordingly.\n if ssl_context.verify_mode != ssl.CERT_REQUIRED and (\n cf_error_code == CFConst.errSecNotTrusted\n or cf_error_code == CFConst.errSecCertificateExpired\n ):\n is_trusted = True\n\n # If we're still not trusted then we start to\n # construct and raise the SSLCertVerificationError.\n if not is_trusted:\n cf_error_string_ref = None\n try:\n cf_error_string_ref = CoreFoundation.CFErrorCopyDescription(cf_error)\n\n # Can this ever return 'None' if there's a CFError?\n cf_error_message = (\n _cf_string_ref_to_str(cf_error_string_ref)\n or \"Certificate verification failed\"\n )\n\n # TODO: Not sure if we need the SecTrustResultType for anything?\n # We only care whether or not it's a success or failure for now.\n sec_trust_result_type = Security.SecTrustResultType()\n Security.SecTrustGetTrustResult(\n sec_trust_ref, ctypes.byref(sec_trust_result_type)\n )\n\n err = ssl.SSLCertVerificationError(cf_error_message)\n err.verify_message = cf_error_message\n err.verify_code = cf_error_code\n raise err\n finally:\n if cf_error_string_ref:\n CoreFoundation.CFRelease(cf_error_string_ref)\n",[],[216,809,810,811,890,891,951,969],"081bd272-67fc-11f0-95df-0224a6c84d84","_api.py","081bd312-67fc-11f0-95df-0224a6c84d84",294,["D",1753299261376],"import os\nimport platform\nimport socket\nimport ssl\nimport sys\nimport typing\n\nimport _ssl\n\nfrom ._ssl_constants import (\n _original_SSLContext,\n _original_super_SSLContext,\n _truststore_SSLContext_dunder_class,\n _truststore_SSLContext_super_class,\n)\n\nif platform.system() == \"Windows\":\n from ._windows import _configure_context, _verify_peercerts_impl\nelif platform.system() == \"Darwin\":\n from ._macos import _configure_context, _verify_peercerts_impl\nelse:\n from ._openssl import _configure_context, _verify_peercerts_impl\n\nif typing.TYPE_CHECKING:\n from pip._vendor.typing_extensions import Buffer\n\n# From typeshed/stdlib/ssl.pyi\n_StrOrBytesPath: typing.TypeAlias = str | bytes | os.PathLike[str] | os.PathLike[bytes]\n_PasswordType: typing.TypeAlias = str | bytes | typing.Callable[[], str | bytes]\n\n\ndef inject_into_ssl() -> None:\n \"\"\"Injects the :class:`truststore.SSLContext` into the ``ssl``\n module by replacing :class:`ssl.SSLContext`.\n \"\"\"\n setattr(ssl, \"SSLContext\", SSLContext)\n # urllib3 holds on to its own reference of ssl.SSLContext\n # so we need to replace that reference too.\n try:\n import pip._vendor.urllib3.util.ssl_ as urllib3_ssl\n\n setattr(urllib3_ssl, \"SSLContext\", SSLContext)\n except ImportError:\n pass\n\n # requests starting with 2.32.0 added a preloaded SSL context to improve concurrent performance;\n # this unfortunately leads to a RecursionError, which can be avoided by patching the preloaded SSL context with\n # the truststore patched instance\n # also see https://github.com/psf/requests/pull/6667\n try:\n from pip._vendor.requests import adapters as requests_adapters\n\n preloaded_context = getattr(requests_adapters, \"_preloaded_ssl_context\", None)\n if preloaded_context is not None:\n setattr(\n requests_adapters,\n \"_preloaded_ssl_context\",\n SSLContext(ssl.PROTOCOL_TLS_CLIENT),\n )\n except ImportError:\n pass\n\n\ndef extract_from_ssl() -> None:\n \"\"\"Restores the :class:`ssl.SSLContext` class to its original state\"\"\"\n setattr(ssl, \"SSLContext\", _original_SSLContext)\n try:\n import pip._vendor.urllib3.util.ssl_ as urllib3_ssl\n\n urllib3_ssl.SSLContext = _original_SSLContext # type: ignore[assignment]\n except ImportError:\n pass\n\n\nclass SSLContext(_truststore_SSLContext_super_class): # type: ignore[misc]\n \"\"\"SSLContext API that uses system certificates on all platforms\"\"\"\n\n @property # type: ignore[misc]\n def __class__(self) -> type:\n # Dirty hack to get around isinstance() checks\n # for ssl.SSLContext instances in aiohttp/trustme\n # when using non-CPython implementations.\n return _truststore_SSLContext_dunder_class or SSLContext\n\n def __init__(self, protocol: int = None) -> None: # type: ignore[assignment]\n self._ctx = _original_SSLContext(protocol)\n\n class TruststoreSSLObject(ssl.SSLObject):\n # This object exists because wrap_bio() doesn't\n # immediately do the handshake so we need to do\n # certificate verifications after SSLObject.do_handshake()\n\n def do_handshake(self) -> None:\n ret = super().do_handshake()\n _verify_peercerts(self, server_hostname=self.server_hostname)\n return ret\n\n self._ctx.sslobject_class = TruststoreSSLObject\n\n def wrap_socket(\n self,\n sock: socket.socket,\n server_side: bool = False,\n do_handshake_on_connect: bool = True,\n suppress_ragged_eofs: bool = True,\n server_hostname: str | None = None,\n session: ssl.SSLSession | None = None,\n ) -> ssl.SSLSocket:\n # Use a context manager here because the\n # inner SSLContext holds on to our state\n # but also does the actual handshake.\n with _configure_context(self._ctx):\n ssl_sock = self._ctx.wrap_socket(\n sock,\n server_side=server_side,\n server_hostname=server_hostname,\n do_handshake_on_connect=do_handshake_on_connect,\n suppress_ragged_eofs=suppress_ragged_eofs,\n session=session,\n )\n try:\n _verify_peercerts(ssl_sock, server_hostname=server_hostname)\n except Exception:\n ssl_sock.close()\n raise\n return ssl_sock\n\n def wrap_bio(\n self,\n incoming: ssl.MemoryBIO,\n outgoing: ssl.MemoryBIO,\n server_side: bool = False,\n server_hostname: str | None = None,\n session: ssl.SSLSession | None = None,\n ) -> ssl.SSLObject:\n with _configure_context(self._ctx):\n ssl_obj = self._ctx.wrap_bio(\n incoming,\n outgoing,\n server_hostname=server_hostname,\n server_side=server_side,\n session=session,\n )\n return ssl_obj\n\n def load_verify_locations(\n self,\n cafile: str | bytes | os.PathLike[str] | os.PathLike[bytes] | None = None,\n capath: str | bytes | os.PathLike[str] | os.PathLike[bytes] | None = None,\n cadata: typing.Union[str, \"Buffer\", None] = None,\n ) -> None:\n return self._ctx.load_verify_locations(\n cafile=cafile, capath=capath, cadata=cadata\n )\n\n def load_cert_chain(\n self,\n certfile: _StrOrBytesPath,\n keyfile: _StrOrBytesPath | None = None,\n password: _PasswordType | None = None,\n ) -> None:\n return self._ctx.load_cert_chain(\n certfile=certfile, keyfile=keyfile, password=password\n )\n\n def load_default_certs(\n self, purpose: ssl.Purpose = ssl.Purpose.SERVER_AUTH\n ) -> None:\n return self._ctx.load_default_certs(purpose)\n\n def set_alpn_protocols(self, alpn_protocols: typing.Iterable[str]) -> None:\n return self._ctx.set_alpn_protocols(alpn_protocols)\n\n def set_npn_protocols(self, npn_protocols: typing.Iterable[str]) -> None:\n return self._ctx.set_npn_protocols(npn_protocols)\n\n def set_ciphers(self, __cipherlist: str) -> None:\n return self._ctx.set_ciphers(__cipherlist)\n\n def get_ciphers(self) -> typing.Any:\n return self._ctx.get_ciphers()\n\n def session_stats(self) -> dict[str, int]:\n return self._ctx.session_stats()\n\n def cert_store_stats(self) -> dict[str, int]:\n raise NotImplementedError()\n\n def set_default_verify_paths(self) -> None:\n self._ctx.set_default_verify_paths()\n\n @typing.overload\n def get_ca_certs(\n self, binary_form: typing.Literal[False] = ...\n ) -> list[typing.Any]: ...\n\n @typing.overload\n def get_ca_certs(self, binary_form: typing.Literal[True] = ...) -> list[bytes]: ...\n\n @typing.overload\n def get_ca_certs(self, binary_form: bool = ...) -> typing.Any: ...\n\n def get_ca_certs(self, binary_form: bool = False) -> list[typing.Any] | list[bytes]:\n raise NotImplementedError()\n\n @property\n def check_hostname(self) -> bool:\n return self._ctx.check_hostname\n\n @check_hostname.setter\n def check_hostname(self, value: bool) -> None:\n self._ctx.check_hostname = value\n\n @property\n def hostname_checks_common_name(self) -> bool:\n return self._ctx.hostname_checks_common_name\n\n @hostname_checks_common_name.setter\n def hostname_checks_common_name(self, value: bool) -> None:\n self._ctx.hostname_checks_common_name = value\n\n @property\n def keylog_filename(self) -> str:\n return self._ctx.keylog_filename\n\n @keylog_filename.setter\n def keylog_filename(self, value: str) -> None:\n self._ctx.keylog_filename = value\n\n @property\n def maximum_version(self) -> ssl.TLSVersion:\n return self._ctx.maximum_version\n\n @maximum_version.setter\n def maximum_version(self, value: ssl.TLSVersion) -> None:\n _original_super_SSLContext.maximum_version.__set__( # type: ignore[attr-defined]\n self._ctx, value\n )\n\n @property\n def minimum_version(self) -> ssl.TLSVersion:\n return self._ctx.minimum_version\n\n @minimum_version.setter\n def minimum_version(self, value: ssl.TLSVersion) -> None:\n _original_super_SSLContext.minimum_version.__set__( # type: ignore[attr-defined]\n self._ctx, value\n )\n\n @property\n def options(self) -> ssl.Options:\n return self._ctx.options\n\n @options.setter\n def options(self, value: ssl.Options) -> None:\n _original_super_SSLContext.options.__set__( # type: ignore[attr-defined]\n self._ctx, value\n )\n\n @property\n def post_handshake_auth(self) -> bool:\n return self._ctx.post_handshake_auth\n\n @post_handshake_auth.setter\n def post_handshake_auth(self, value: bool) -> None:\n self._ctx.post_handshake_auth = value\n\n @property\n def protocol(self) -> ssl._SSLMethod:\n return self._ctx.protocol\n\n @property\n def security_level(self) -> int:\n return self._ctx.security_level\n\n @property\n def verify_flags(self) -> ssl.VerifyFlags:\n return self._ctx.verify_flags\n\n @verify_flags.setter\n def verify_flags(self, value: ssl.VerifyFlags) -> None:\n _original_super_SSLContext.verify_flags.__set__( # type: ignore[attr-defined]\n self._ctx, value\n )\n\n @property\n def verify_mode(self) -> ssl.VerifyMode:\n return self._ctx.verify_mode\n\n @verify_mode.setter\n def verify_mode(self, value: ssl.VerifyMode) -> None:\n _original_super_SSLContext.verify_mode.__set__( # type: ignore[attr-defined]\n self._ctx, value\n )\n\n\n# Python 3.13+ makes get_unverified_chain() a public API that only returns DER\n# encoded certificates. We detect whether we need to call public_bytes() for 3.10->3.12\n# Pre-3.13 returned None instead of an empty list from get_unverified_chain()\nif sys.version_info >= (3, 13):\n\n def _get_unverified_chain_bytes(sslobj: ssl.SSLObject) -> list[bytes]:\n unverified_chain = sslobj.get_unverified_chain() or () # type: ignore[attr-defined]\n return [\n cert if isinstance(cert, bytes) else cert.public_bytes(_ssl.ENCODING_DER)\n for cert in unverified_chain\n ]\n\nelse:\n\n def _get_unverified_chain_bytes(sslobj: ssl.SSLObject) -> list[bytes]:\n unverified_chain = sslobj.get_unverified_chain() or () # type: ignore[attr-defined]\n return [cert.public_bytes(_ssl.ENCODING_DER) for cert in unverified_chain]\n\n\ndef _verify_peercerts(\n sock_or_sslobj: ssl.SSLSocket | ssl.SSLObject, server_hostname: str | None\n) -> None:\n \"\"\"\n Verifies the peer certificates from an SSLSocket or SSLObject\n against the certificates in the OS trust store.\n \"\"\"\n sslobj: ssl.SSLObject = sock_or_sslobj # type: ignore[assignment]\n try:\n while not hasattr(sslobj, \"get_unverified_chain\"):\n sslobj = sslobj._sslobj # type: ignore[attr-defined]\n except AttributeError:\n pass\n\n cert_bytes = _get_unverified_chain_bytes(sslobj)\n _verify_peercerts_impl(\n sock_or_sslobj.context, cert_bytes, server_hostname=server_hostname\n )\n",[],[216,809,810,811,890,891,951,977],"082173f8-67fc-11f0-8791-0224a6c84d84","082175ec-67fc-11f0-8791-0224a6c84d84",295,["D",1753299261387],"\"\"\"Verify certificates using native system trust stores\"\"\"\n\nimport sys as _sys\n\nif _sys.version_info < (3, 10):\n raise ImportError(\"truststore requires Python 3.10 or later\")\n\n# Detect Python runtimes which don't implement SSLObject.get_unverified_chain() API\n# This API only became public in Python 3.13 but was available in CPython and PyPy since 3.10.\nif _sys.version_info < (3, 13) and _sys.implementation.name not in (\"cpython\", \"pypy\"):\n try:\n import ssl as _ssl\n except ImportError:\n raise ImportError(\"truststore requires the 'ssl' module\")\n else:\n _sslmem = _ssl.MemoryBIO()\n _sslobj = _ssl.create_default_context().wrap_bio(\n _sslmem,\n _sslmem,\n )\n try:\n while not hasattr(_sslobj, \"get_unverified_chain\"):\n _sslobj = _sslobj._sslobj # type: ignore[attr-defined]\n except AttributeError:\n raise ImportError(\n \"truststore requires peer certificate chain APIs to be available\"\n ) from None\n\n del _ssl, _sslobj, _sslmem # noqa: F821\n\nfrom ._api import SSLContext, extract_from_ssl, inject_into_ssl # noqa: E402\n\ndel _api, _sys # type: ignore[name-defined] # noqa: F821\n\n__all__ = [\"SSLContext\", \"inject_into_ssl\", \"extract_from_ssl\"]\n__version__ = \"0.10.1\"\n",[],[216,809,810,811,890,891,951,893],"fd7f4ca4-67fb-11f0-aedf-0224a6c84d84",71,["D",1753299243586],[601,602,603,604,605,606],[216,809,810,811,890,891,951],"fec7f980-67fb-11f0-ad3e-0224a6c84d84","tomli_w","fec7fa5c-67fb-11f0-ad3e-0224a6c84d84",84,["D",1753299245739],[],[216,809,810,811,890,891,997],"0aa31550-67fc-11f0-9454-0224a6c84d84","py.typed","0aa3160e-67fc-11f0-9454-0224a6c84d84","fe628a00-67fb-11f0-847e-0224a6c84d84",387,["D",1753299265628],"# Marker file for PEP 561\n",[],[216,809,810,811,890,891,1012,1004],"tomli","0a871ca6-67fc-11f0-9454-0224a6c84d84","_types.py","0a871d6e-67fc-11f0-9454-0224a6c84d84",385,["D",1753299265438],"# SPDX-License-Identifier: MIT\n# SPDX-FileCopyrightText: 2021 Taneli Hukkinen\n# Licensed to PSF under a Contributor Agreement.\n\nfrom typing import Any, Callable, Tuple\n\n# Type annotations\nParseFloat = Callable[[str], Any]\nKey = Tuple[str, ...]\nPos = int\n",[],[216,809,810,811,890,891,1012,1014],"0aab2aa6-67fc-11f0-aad3-0224a6c84d84","_re.py","0aab2b5a-67fc-11f0-aad3-0224a6c84d84",389,["D",1753299265585],"# SPDX-License-Identifier: MIT\n# SPDX-FileCopyrightText: 2021 Taneli Hukkinen\n# Licensed to PSF under a Contributor Agreement.\n\nfrom __future__ import annotations\n\nfrom datetime import date, datetime, time, timedelta, timezone, tzinfo\nfrom functools import lru_cache\nimport re\nfrom typing import Any, Final\n\nfrom ._types import ParseFloat\n\n# E.g.\n# - 00:32:00.999999\n# - 00:32:00\n_TIME_RE_STR: Final = (\n r\"([01][0-9]|2[0-3]):([0-5][0-9]):([0-5][0-9])(?:\\.([0-9]{1,6})[0-9]*)?\"\n)\n\nRE_NUMBER: Final = re.compile(\n r\"\"\"\n0\n(?:\n x[0-9A-Fa-f](?:_?[0-9A-Fa-f])* # hex\n |\n b[01](?:_?[01])* # bin\n |\n o[0-7](?:_?[0-7])* # oct\n)\n|\n[+-]?(?:0|[1-9](?:_?[0-9])*) # dec, integer part\n(?P\n (?:\\.[0-9](?:_?[0-9])*)? # optional fractional part\n (?:[eE][+-]?[0-9](?:_?[0-9])*)? # optional exponent part\n)\n\"\"\",\n flags=re.VERBOSE,\n)\nRE_LOCALTIME: Final = re.compile(_TIME_RE_STR)\nRE_DATETIME: Final = re.compile(\n rf\"\"\"\n([0-9]{{4}})-(0[1-9]|1[0-2])-(0[1-9]|[12][0-9]|3[01]) # date, e.g. 1988-10-27\n(?:\n [Tt ]\n {_TIME_RE_STR}\n (?:([Zz])|([+-])([01][0-9]|2[0-3]):([0-5][0-9]))? # optional time offset\n)?\n\"\"\",\n flags=re.VERBOSE,\n)\n\n\ndef match_to_datetime(match: re.Match) -> datetime | date:\n \"\"\"Convert a `RE_DATETIME` match to `datetime.datetime` or `datetime.date`.\n\n Raises ValueError if the match does not correspond to a valid date\n or datetime.\n \"\"\"\n (\n year_str,\n month_str,\n day_str,\n hour_str,\n minute_str,\n sec_str,\n micros_str,\n zulu_time,\n offset_sign_str,\n offset_hour_str,\n offset_minute_str,\n ) = match.groups()\n year, month, day = int(year_str), int(month_str), int(day_str)\n if hour_str is None:\n return date(year, month, day)\n hour, minute, sec = int(hour_str), int(minute_str), int(sec_str)\n micros = int(micros_str.ljust(6, \"0\")) if micros_str else 0\n if offset_sign_str:\n tz: tzinfo | None = cached_tz(\n offset_hour_str, offset_minute_str, offset_sign_str\n )\n elif zulu_time:\n tz = timezone.utc\n else: # local date-time\n tz = None\n return datetime(year, month, day, hour, minute, sec, micros, tzinfo=tz)\n\n\n# No need to limit cache size. This is only ever called on input\n# that matched RE_DATETIME, so there is an implicit bound of\n# 24 (hours) * 60 (minutes) * 2 (offset direction) = 2880.\n@lru_cache(maxsize=None)\ndef cached_tz(hour_str: str, minute_str: str, sign_str: str) -> timezone:\n sign = 1 if sign_str == \"+\" else -1\n return timezone(\n timedelta(\n hours=sign * int(hour_str),\n minutes=sign * int(minute_str),\n )\n )\n\n\ndef match_to_localtime(match: re.Match) -> time:\n hour_str, minute_str, sec_str, micros_str = match.groups()\n micros = int(micros_str.ljust(6, \"0\")) if micros_str else 0\n return time(int(hour_str), int(minute_str), int(sec_str), micros)\n\n\ndef match_to_number(match: re.Match, parse_float: ParseFloat) -> Any:\n if match.group(\"floatpart\"):\n return parse_float(match.group())\n return int(match.group(), 0)\n",[],[216,809,810,811,890,891,1012,1022],"0a9790fe-67fc-11f0-bfb3-0224a6c84d84","_parser.py","0a97919e-67fc-11f0-bfb3-0224a6c84d84",386,["D",1753299265548],"# SPDX-License-Identifier: MIT\n# SPDX-FileCopyrightText: 2021 Taneli Hukkinen\n# Licensed to PSF under a Contributor Agreement.\n\nfrom __future__ import annotations\n\nfrom collections.abc import Iterable\nimport string\nimport sys\nfrom types import MappingProxyType\nfrom typing import IO, Any, Final, NamedTuple\nimport warnings\n\nfrom ._re import (\n RE_DATETIME,\n RE_LOCALTIME,\n RE_NUMBER,\n match_to_datetime,\n match_to_localtime,\n match_to_number,\n)\nfrom ._types import Key, ParseFloat, Pos\n\n# Inline tables/arrays are implemented using recursion. Pathologically\n# nested documents cause pure Python to raise RecursionError (which is OK),\n# but mypyc binary wheels will crash unrecoverably (not OK). According to\n# mypyc docs this will be fixed in the future:\n# https://mypyc.readthedocs.io/en/latest/differences_from_python.html#stack-overflows\n# Before mypyc's fix is in, recursion needs to be limited by this library.\n# Choosing `sys.getrecursionlimit()` as maximum inline table/array nesting\n# level, as it allows more nesting than pure Python, but still seems a far\n# lower number than where mypyc binaries crash.\nMAX_INLINE_NESTING: Final = sys.getrecursionlimit()\n\nASCII_CTRL: Final = frozenset(chr(i) for i in range(32)) | frozenset(chr(127))\n\n# Neither of these sets include quotation mark or backslash. They are\n# currently handled as separate cases in the parser functions.\nILLEGAL_BASIC_STR_CHARS: Final = ASCII_CTRL - frozenset(\"\\t\")\nILLEGAL_MULTILINE_BASIC_STR_CHARS: Final = ASCII_CTRL - frozenset(\"\\t\\n\")\n\nILLEGAL_LITERAL_STR_CHARS: Final = ILLEGAL_BASIC_STR_CHARS\nILLEGAL_MULTILINE_LITERAL_STR_CHARS: Final = ILLEGAL_MULTILINE_BASIC_STR_CHARS\n\nILLEGAL_COMMENT_CHARS: Final = ILLEGAL_BASIC_STR_CHARS\n\nTOML_WS: Final = frozenset(\" \\t\")\nTOML_WS_AND_NEWLINE: Final = TOML_WS | frozenset(\"\\n\")\nBARE_KEY_CHARS: Final = frozenset(string.ascii_letters + string.digits + \"-_\")\nKEY_INITIAL_CHARS: Final = BARE_KEY_CHARS | frozenset(\"\\\"'\")\nHEXDIGIT_CHARS: Final = frozenset(string.hexdigits)\n\nBASIC_STR_ESCAPE_REPLACEMENTS: Final = MappingProxyType(\n {\n \"\\\\b\": \"\\u0008\", # backspace\n \"\\\\t\": \"\\u0009\", # tab\n \"\\\\n\": \"\\u000A\", # linefeed\n \"\\\\f\": \"\\u000C\", # form feed\n \"\\\\r\": \"\\u000D\", # carriage return\n '\\\\\"': \"\\u0022\", # quote\n \"\\\\\\\\\": \"\\u005C\", # backslash\n }\n)\n\n\nclass DEPRECATED_DEFAULT:\n \"\"\"Sentinel to be used as default arg during deprecation\n period of TOMLDecodeError's free-form arguments.\"\"\"\n\n\nclass TOMLDecodeError(ValueError):\n \"\"\"An error raised if a document is not valid TOML.\n\n Adds the following attributes to ValueError:\n msg: The unformatted error message\n doc: The TOML document being parsed\n pos: The index of doc where parsing failed\n lineno: The line corresponding to pos\n colno: The column corresponding to pos\n \"\"\"\n\n def __init__(\n self,\n msg: str | type[DEPRECATED_DEFAULT] = DEPRECATED_DEFAULT,\n doc: str | type[DEPRECATED_DEFAULT] = DEPRECATED_DEFAULT,\n pos: Pos | type[DEPRECATED_DEFAULT] = DEPRECATED_DEFAULT,\n *args: Any,\n ):\n if (\n args\n or not isinstance(msg, str)\n or not isinstance(doc, str)\n or not isinstance(pos, int)\n ):\n warnings.warn(\n \"Free-form arguments for TOMLDecodeError are deprecated. \"\n \"Please set 'msg' (str), 'doc' (str) and 'pos' (int) arguments only.\",\n DeprecationWarning,\n stacklevel=2,\n )\n if pos is not DEPRECATED_DEFAULT:\n args = pos, *args\n if doc is not DEPRECATED_DEFAULT:\n args = doc, *args\n if msg is not DEPRECATED_DEFAULT:\n args = msg, *args\n ValueError.__init__(self, *args)\n return\n\n lineno = doc.count(\"\\n\", 0, pos) + 1\n if lineno == 1:\n colno = pos + 1\n else:\n colno = pos - doc.rindex(\"\\n\", 0, pos)\n\n if pos >= len(doc):\n coord_repr = \"end of document\"\n else:\n coord_repr = f\"line {lineno}, column {colno}\"\n errmsg = f\"{msg} (at {coord_repr})\"\n ValueError.__init__(self, errmsg)\n\n self.msg = msg\n self.doc = doc\n self.pos = pos\n self.lineno = lineno\n self.colno = colno\n\n\ndef load(__fp: IO[bytes], *, parse_float: ParseFloat = float) -> dict[str, Any]:\n \"\"\"Parse TOML from a binary file object.\"\"\"\n b = __fp.read()\n try:\n s = b.decode()\n except AttributeError:\n raise TypeError(\n \"File must be opened in binary mode, e.g. use `open('foo.toml', 'rb')`\"\n ) from None\n return loads(s, parse_float=parse_float)\n\n\ndef loads(__s: str, *, parse_float: ParseFloat = float) -> dict[str, Any]: # noqa: C901\n \"\"\"Parse TOML from a string.\"\"\"\n\n # The spec allows converting \"\\r\\n\" to \"\\n\", even in string\n # literals. Let's do so to simplify parsing.\n try:\n src = __s.replace(\"\\r\\n\", \"\\n\")\n except (AttributeError, TypeError):\n raise TypeError(\n f\"Expected str object, not '{type(__s).__qualname__}'\"\n ) from None\n pos = 0\n out = Output(NestedDict(), Flags())\n header: Key = ()\n parse_float = make_safe_parse_float(parse_float)\n\n # Parse one statement at a time\n # (typically means one line in TOML source)\n while True:\n # 1. Skip line leading whitespace\n pos = skip_chars(src, pos, TOML_WS)\n\n # 2. Parse rules. Expect one of the following:\n # - end of file\n # - end of line\n # - comment\n # - key/value pair\n # - append dict to list (and move to its namespace)\n # - create dict (and move to its namespace)\n # Skip trailing whitespace when applicable.\n try:\n char = src[pos]\n except IndexError:\n break\n if char == \"\\n\":\n pos += 1\n continue\n if char in KEY_INITIAL_CHARS:\n pos = key_value_rule(src, pos, out, header, parse_float)\n pos = skip_chars(src, pos, TOML_WS)\n elif char == \"[\":\n try:\n second_char: str | None = src[pos + 1]\n except IndexError:\n second_char = None\n out.flags.finalize_pending()\n if second_char == \"[\":\n pos, header = create_list_rule(src, pos, out)\n else:\n pos, header = create_dict_rule(src, pos, out)\n pos = skip_chars(src, pos, TOML_WS)\n elif char != \"#\":\n raise TOMLDecodeError(\"Invalid statement\", src, pos)\n\n # 3. Skip comment\n pos = skip_comment(src, pos)\n\n # 4. Expect end of line or end of file\n try:\n char = src[pos]\n except IndexError:\n break\n if char != \"\\n\":\n raise TOMLDecodeError(\n \"Expected newline or end of document after a statement\", src, pos\n )\n pos += 1\n\n return out.data.dict\n\n\nclass Flags:\n \"\"\"Flags that map to parsed keys/namespaces.\"\"\"\n\n # Marks an immutable namespace (inline array or inline table).\n FROZEN: Final = 0\n # Marks a nest that has been explicitly created and can no longer\n # be opened using the \"[table]\" syntax.\n EXPLICIT_NEST: Final = 1\n\n def __init__(self) -> None:\n self._flags: dict[str, dict] = {}\n self._pending_flags: set[tuple[Key, int]] = set()\n\n def add_pending(self, key: Key, flag: int) -> None:\n self._pending_flags.add((key, flag))\n\n def finalize_pending(self) -> None:\n for key, flag in self._pending_flags:\n self.set(key, flag, recursive=False)\n self._pending_flags.clear()\n\n def unset_all(self, key: Key) -> None:\n cont = self._flags\n for k in key[:-1]:\n if k not in cont:\n return\n cont = cont[k][\"nested\"]\n cont.pop(key[-1], None)\n\n def set(self, key: Key, flag: int, *, recursive: bool) -> None: # noqa: A003\n cont = self._flags\n key_parent, key_stem = key[:-1], key[-1]\n for k in key_parent:\n if k not in cont:\n cont[k] = {\"flags\": set(), \"recursive_flags\": set(), \"nested\": {}}\n cont = cont[k][\"nested\"]\n if key_stem not in cont:\n cont[key_stem] = {\"flags\": set(), \"recursive_flags\": set(), \"nested\": {}}\n cont[key_stem][\"recursive_flags\" if recursive else \"flags\"].add(flag)\n\n def is_(self, key: Key, flag: int) -> bool:\n if not key:\n return False # document root has no flags\n cont = self._flags\n for k in key[:-1]:\n if k not in cont:\n return False\n inner_cont = cont[k]\n if flag in inner_cont[\"recursive_flags\"]:\n return True\n cont = inner_cont[\"nested\"]\n key_stem = key[-1]\n if key_stem in cont:\n inner_cont = cont[key_stem]\n return flag in inner_cont[\"flags\"] or flag in inner_cont[\"recursive_flags\"]\n return False\n\n\nclass NestedDict:\n def __init__(self) -> None:\n # The parsed content of the TOML document\n self.dict: dict[str, Any] = {}\n\n def get_or_create_nest(\n self,\n key: Key,\n *,\n access_lists: bool = True,\n ) -> dict:\n cont: Any = self.dict\n for k in key:\n if k not in cont:\n cont[k] = {}\n cont = cont[k]\n if access_lists and isinstance(cont, list):\n cont = cont[-1]\n if not isinstance(cont, dict):\n raise KeyError(\"There is no nest behind this key\")\n return cont\n\n def append_nest_to_list(self, key: Key) -> None:\n cont = self.get_or_create_nest(key[:-1])\n last_key = key[-1]\n if last_key in cont:\n list_ = cont[last_key]\n if not isinstance(list_, list):\n raise KeyError(\"An object other than list found behind this key\")\n list_.append({})\n else:\n cont[last_key] = [{}]\n\n\nclass Output(NamedTuple):\n data: NestedDict\n flags: Flags\n\n\ndef skip_chars(src: str, pos: Pos, chars: Iterable[str]) -> Pos:\n try:\n while src[pos] in chars:\n pos += 1\n except IndexError:\n pass\n return pos\n\n\ndef skip_until(\n src: str,\n pos: Pos,\n expect: str,\n *,\n error_on: frozenset[str],\n error_on_eof: bool,\n) -> Pos:\n try:\n new_pos = src.index(expect, pos)\n except ValueError:\n new_pos = len(src)\n if error_on_eof:\n raise TOMLDecodeError(f\"Expected {expect!r}\", src, new_pos) from None\n\n if not error_on.isdisjoint(src[pos:new_pos]):\n while src[pos] not in error_on:\n pos += 1\n raise TOMLDecodeError(f\"Found invalid character {src[pos]!r}\", src, pos)\n return new_pos\n\n\ndef skip_comment(src: str, pos: Pos) -> Pos:\n try:\n char: str | None = src[pos]\n except IndexError:\n char = None\n if char == \"#\":\n return skip_until(\n src, pos + 1, \"\\n\", error_on=ILLEGAL_COMMENT_CHARS, error_on_eof=False\n )\n return pos\n\n\ndef skip_comments_and_array_ws(src: str, pos: Pos) -> Pos:\n while True:\n pos_before_skip = pos\n pos = skip_chars(src, pos, TOML_WS_AND_NEWLINE)\n pos = skip_comment(src, pos)\n if pos == pos_before_skip:\n return pos\n\n\ndef create_dict_rule(src: str, pos: Pos, out: Output) -> tuple[Pos, Key]:\n pos += 1 # Skip \"[\"\n pos = skip_chars(src, pos, TOML_WS)\n pos, key = parse_key(src, pos)\n\n if out.flags.is_(key, Flags.EXPLICIT_NEST) or out.flags.is_(key, Flags.FROZEN):\n raise TOMLDecodeError(f\"Cannot declare {key} twice\", src, pos)\n out.flags.set(key, Flags.EXPLICIT_NEST, recursive=False)\n try:\n out.data.get_or_create_nest(key)\n except KeyError:\n raise TOMLDecodeError(\"Cannot overwrite a value\", src, pos) from None\n\n if not src.startswith(\"]\", pos):\n raise TOMLDecodeError(\n \"Expected ']' at the end of a table declaration\", src, pos\n )\n return pos + 1, key\n\n\ndef create_list_rule(src: str, pos: Pos, out: Output) -> tuple[Pos, Key]:\n pos += 2 # Skip \"[[\"\n pos = skip_chars(src, pos, TOML_WS)\n pos, key = parse_key(src, pos)\n\n if out.flags.is_(key, Flags.FROZEN):\n raise TOMLDecodeError(f\"Cannot mutate immutable namespace {key}\", src, pos)\n # Free the namespace now that it points to another empty list item...\n out.flags.unset_all(key)\n # ...but this key precisely is still prohibited from table declaration\n out.flags.set(key, Flags.EXPLICIT_NEST, recursive=False)\n try:\n out.data.append_nest_to_list(key)\n except KeyError:\n raise TOMLDecodeError(\"Cannot overwrite a value\", src, pos) from None\n\n if not src.startswith(\"]]\", pos):\n raise TOMLDecodeError(\n \"Expected ']]' at the end of an array declaration\", src, pos\n )\n return pos + 2, key\n\n\ndef key_value_rule(\n src: str, pos: Pos, out: Output, header: Key, parse_float: ParseFloat\n) -> Pos:\n pos, key, value = parse_key_value_pair(src, pos, parse_float, nest_lvl=0)\n key_parent, key_stem = key[:-1], key[-1]\n abs_key_parent = header + key_parent\n\n relative_path_cont_keys = (header + key[:i] for i in range(1, len(key)))\n for cont_key in relative_path_cont_keys:\n # Check that dotted key syntax does not redefine an existing table\n if out.flags.is_(cont_key, Flags.EXPLICIT_NEST):\n raise TOMLDecodeError(f\"Cannot redefine namespace {cont_key}\", src, pos)\n # Containers in the relative path can't be opened with the table syntax or\n # dotted key/value syntax in following table sections.\n out.flags.add_pending(cont_key, Flags.EXPLICIT_NEST)\n\n if out.flags.is_(abs_key_parent, Flags.FROZEN):\n raise TOMLDecodeError(\n f\"Cannot mutate immutable namespace {abs_key_parent}\", src, pos\n )\n\n try:\n nest = out.data.get_or_create_nest(abs_key_parent)\n except KeyError:\n raise TOMLDecodeError(\"Cannot overwrite a value\", src, pos) from None\n if key_stem in nest:\n raise TOMLDecodeError(\"Cannot overwrite a value\", src, pos)\n # Mark inline table and array namespaces recursively immutable\n if isinstance(value, (dict, list)):\n out.flags.set(header + key, Flags.FROZEN, recursive=True)\n nest[key_stem] = value\n return pos\n\n\ndef parse_key_value_pair(\n src: str, pos: Pos, parse_float: ParseFloat, nest_lvl: int\n) -> tuple[Pos, Key, Any]:\n pos, key = parse_key(src, pos)\n try:\n char: str | None = src[pos]\n except IndexError:\n char = None\n if char != \"=\":\n raise TOMLDecodeError(\"Expected '=' after a key in a key/value pair\", src, pos)\n pos += 1\n pos = skip_chars(src, pos, TOML_WS)\n pos, value = parse_value(src, pos, parse_float, nest_lvl)\n return pos, key, value\n\n\ndef parse_key(src: str, pos: Pos) -> tuple[Pos, Key]:\n pos, key_part = parse_key_part(src, pos)\n key: Key = (key_part,)\n pos = skip_chars(src, pos, TOML_WS)\n while True:\n try:\n char: str | None = src[pos]\n except IndexError:\n char = None\n if char != \".\":\n return pos, key\n pos += 1\n pos = skip_chars(src, pos, TOML_WS)\n pos, key_part = parse_key_part(src, pos)\n key += (key_part,)\n pos = skip_chars(src, pos, TOML_WS)\n\n\ndef parse_key_part(src: str, pos: Pos) -> tuple[Pos, str]:\n try:\n char: str | None = src[pos]\n except IndexError:\n char = None\n if char in BARE_KEY_CHARS:\n start_pos = pos\n pos = skip_chars(src, pos, BARE_KEY_CHARS)\n return pos, src[start_pos:pos]\n if char == \"'\":\n return parse_literal_str(src, pos)\n if char == '\"':\n return parse_one_line_basic_str(src, pos)\n raise TOMLDecodeError(\"Invalid initial character for a key part\", src, pos)\n\n\ndef parse_one_line_basic_str(src: str, pos: Pos) -> tuple[Pos, str]:\n pos += 1\n return parse_basic_str(src, pos, multiline=False)\n\n\ndef parse_array(\n src: str, pos: Pos, parse_float: ParseFloat, nest_lvl: int\n) -> tuple[Pos, list]:\n pos += 1\n array: list = []\n\n pos = skip_comments_and_array_ws(src, pos)\n if src.startswith(\"]\", pos):\n return pos + 1, array\n while True:\n pos, val = parse_value(src, pos, parse_float, nest_lvl)\n array.append(val)\n pos = skip_comments_and_array_ws(src, pos)\n\n c = src[pos : pos + 1]\n if c == \"]\":\n return pos + 1, array\n if c != \",\":\n raise TOMLDecodeError(\"Unclosed array\", src, pos)\n pos += 1\n\n pos = skip_comments_and_array_ws(src, pos)\n if src.startswith(\"]\", pos):\n return pos + 1, array\n\n\ndef parse_inline_table(\n src: str, pos: Pos, parse_float: ParseFloat, nest_lvl: int\n) -> tuple[Pos, dict]:\n pos += 1\n nested_dict = NestedDict()\n flags = Flags()\n\n pos = skip_chars(src, pos, TOML_WS)\n if src.startswith(\"}\", pos):\n return pos + 1, nested_dict.dict\n while True:\n pos, key, value = parse_key_value_pair(src, pos, parse_float, nest_lvl)\n key_parent, key_stem = key[:-1], key[-1]\n if flags.is_(key, Flags.FROZEN):\n raise TOMLDecodeError(f\"Cannot mutate immutable namespace {key}\", src, pos)\n try:\n nest = nested_dict.get_or_create_nest(key_parent, access_lists=False)\n except KeyError:\n raise TOMLDecodeError(\"Cannot overwrite a value\", src, pos) from None\n if key_stem in nest:\n raise TOMLDecodeError(f\"Duplicate inline table key {key_stem!r}\", src, pos)\n nest[key_stem] = value\n pos = skip_chars(src, pos, TOML_WS)\n c = src[pos : pos + 1]\n if c == \"}\":\n return pos + 1, nested_dict.dict\n if c != \",\":\n raise TOMLDecodeError(\"Unclosed inline table\", src, pos)\n if isinstance(value, (dict, list)):\n flags.set(key, Flags.FROZEN, recursive=True)\n pos += 1\n pos = skip_chars(src, pos, TOML_WS)\n\n\ndef parse_basic_str_escape(\n src: str, pos: Pos, *, multiline: bool = False\n) -> tuple[Pos, str]:\n escape_id = src[pos : pos + 2]\n pos += 2\n if multiline and escape_id in {\"\\\\ \", \"\\\\\\t\", \"\\\\\\n\"}:\n # Skip whitespace until next non-whitespace character or end of\n # the doc. Error if non-whitespace is found before newline.\n if escape_id != \"\\\\\\n\":\n pos = skip_chars(src, pos, TOML_WS)\n try:\n char = src[pos]\n except IndexError:\n return pos, \"\"\n if char != \"\\n\":\n raise TOMLDecodeError(\"Unescaped '\\\\' in a string\", src, pos)\n pos += 1\n pos = skip_chars(src, pos, TOML_WS_AND_NEWLINE)\n return pos, \"\"\n if escape_id == \"\\\\u\":\n return parse_hex_char(src, pos, 4)\n if escape_id == \"\\\\U\":\n return parse_hex_char(src, pos, 8)\n try:\n return pos, BASIC_STR_ESCAPE_REPLACEMENTS[escape_id]\n except KeyError:\n raise TOMLDecodeError(\"Unescaped '\\\\' in a string\", src, pos) from None\n\n\ndef parse_basic_str_escape_multiline(src: str, pos: Pos) -> tuple[Pos, str]:\n return parse_basic_str_escape(src, pos, multiline=True)\n\n\ndef parse_hex_char(src: str, pos: Pos, hex_len: int) -> tuple[Pos, str]:\n hex_str = src[pos : pos + hex_len]\n if len(hex_str) != hex_len or not HEXDIGIT_CHARS.issuperset(hex_str):\n raise TOMLDecodeError(\"Invalid hex value\", src, pos)\n pos += hex_len\n hex_int = int(hex_str, 16)\n if not is_unicode_scalar_value(hex_int):\n raise TOMLDecodeError(\n \"Escaped character is not a Unicode scalar value\", src, pos\n )\n return pos, chr(hex_int)\n\n\ndef parse_literal_str(src: str, pos: Pos) -> tuple[Pos, str]:\n pos += 1 # Skip starting apostrophe\n start_pos = pos\n pos = skip_until(\n src, pos, \"'\", error_on=ILLEGAL_LITERAL_STR_CHARS, error_on_eof=True\n )\n return pos + 1, src[start_pos:pos] # Skip ending apostrophe\n\n\ndef parse_multiline_str(src: str, pos: Pos, *, literal: bool) -> tuple[Pos, str]:\n pos += 3\n if src.startswith(\"\\n\", pos):\n pos += 1\n\n if literal:\n delim = \"'\"\n end_pos = skip_until(\n src,\n pos,\n \"'''\",\n error_on=ILLEGAL_MULTILINE_LITERAL_STR_CHARS,\n error_on_eof=True,\n )\n result = src[pos:end_pos]\n pos = end_pos + 3\n else:\n delim = '\"'\n pos, result = parse_basic_str(src, pos, multiline=True)\n\n # Add at maximum two extra apostrophes/quotes if the end sequence\n # is 4 or 5 chars long instead of just 3.\n if not src.startswith(delim, pos):\n return pos, result\n pos += 1\n if not src.startswith(delim, pos):\n return pos, result + delim\n pos += 1\n return pos, result + (delim * 2)\n\n\ndef parse_basic_str(src: str, pos: Pos, *, multiline: bool) -> tuple[Pos, str]:\n if multiline:\n error_on = ILLEGAL_MULTILINE_BASIC_STR_CHARS\n parse_escapes = parse_basic_str_escape_multiline\n else:\n error_on = ILLEGAL_BASIC_STR_CHARS\n parse_escapes = parse_basic_str_escape\n result = \"\"\n start_pos = pos\n while True:\n try:\n char = src[pos]\n except IndexError:\n raise TOMLDecodeError(\"Unterminated string\", src, pos) from None\n if char == '\"':\n if not multiline:\n return pos + 1, result + src[start_pos:pos]\n if src.startswith('\"\"\"', pos):\n return pos + 3, result + src[start_pos:pos]\n pos += 1\n continue\n if char == \"\\\\\":\n result += src[start_pos:pos]\n pos, parsed_escape = parse_escapes(src, pos)\n result += parsed_escape\n start_pos = pos\n continue\n if char in error_on:\n raise TOMLDecodeError(f\"Illegal character {char!r}\", src, pos)\n pos += 1\n\n\ndef parse_value( # noqa: C901\n src: str, pos: Pos, parse_float: ParseFloat, nest_lvl: int\n) -> tuple[Pos, Any]:\n if nest_lvl > MAX_INLINE_NESTING:\n # Pure Python should have raised RecursionError already.\n # This ensures mypyc binaries eventually do the same.\n raise RecursionError( # pragma: no cover\n \"TOML inline arrays/tables are nested more than the allowed\"\n f\" {MAX_INLINE_NESTING} levels\"\n )\n\n try:\n char: str | None = src[pos]\n except IndexError:\n char = None\n\n # IMPORTANT: order conditions based on speed of checking and likelihood\n\n # Basic strings\n if char == '\"':\n if src.startswith('\"\"\"', pos):\n return parse_multiline_str(src, pos, literal=False)\n return parse_one_line_basic_str(src, pos)\n\n # Literal strings\n if char == \"'\":\n if src.startswith(\"'''\", pos):\n return parse_multiline_str(src, pos, literal=True)\n return parse_literal_str(src, pos)\n\n # Booleans\n if char == \"t\":\n if src.startswith(\"true\", pos):\n return pos + 4, True\n if char == \"f\":\n if src.startswith(\"false\", pos):\n return pos + 5, False\n\n # Arrays\n if char == \"[\":\n return parse_array(src, pos, parse_float, nest_lvl + 1)\n\n # Inline tables\n if char == \"{\":\n return parse_inline_table(src, pos, parse_float, nest_lvl + 1)\n\n # Dates and times\n datetime_match = RE_DATETIME.match(src, pos)\n if datetime_match:\n try:\n datetime_obj = match_to_datetime(datetime_match)\n except ValueError as e:\n raise TOMLDecodeError(\"Invalid date or datetime\", src, pos) from e\n return datetime_match.end(), datetime_obj\n localtime_match = RE_LOCALTIME.match(src, pos)\n if localtime_match:\n return localtime_match.end(), match_to_localtime(localtime_match)\n\n # Integers and \"normal\" floats.\n # The regex will greedily match any type starting with a decimal\n # char, so needs to be located after handling of dates and times.\n number_match = RE_NUMBER.match(src, pos)\n if number_match:\n return number_match.end(), match_to_number(number_match, parse_float)\n\n # Special floats\n first_three = src[pos : pos + 3]\n if first_three in {\"inf\", \"nan\"}:\n return pos + 3, parse_float(first_three)\n first_four = src[pos : pos + 4]\n if first_four in {\"-inf\", \"+inf\", \"-nan\", \"+nan\"}:\n return pos + 4, parse_float(first_four)\n\n raise TOMLDecodeError(\"Invalid value\", src, pos)\n\n\ndef is_unicode_scalar_value(codepoint: int) -> bool:\n return (0 <= codepoint <= 55295) or (57344 <= codepoint <= 1114111)\n\n\ndef make_safe_parse_float(parse_float: ParseFloat) -> ParseFloat:\n \"\"\"A decorator to make `parse_float` safe.\n\n `parse_float` must not return dicts or lists, because these types\n would be mixed with parsed TOML tables and arrays, thus confusing\n the parser. The returned decorated callable raises `ValueError`\n instead of returning illegal types.\n \"\"\"\n # The default `float` callable never returns illegal types. Optimize it.\n if parse_float is float:\n return float\n\n def safe_parse_float(float_str: str) -> Any:\n float_value = parse_float(float_str)\n if isinstance(float_value, (dict, list)):\n raise ValueError(\"parse_float must not return dicts or lists\")\n return float_value\n\n return safe_parse_float\n",[],[216,809,810,811,890,891,1012,1030],"0aaf6256-67fc-11f0-a516-0224a6c84d84","0aaf6314-67fc-11f0-a516-0224a6c84d84",390,["D",1753299265605],"# SPDX-License-Identifier: MIT\n# SPDX-FileCopyrightText: 2021 Taneli Hukkinen\n# Licensed to PSF under a Contributor Agreement.\n\n__all__ = (\"loads\", \"load\", \"TOMLDecodeError\")\n__version__ = \"2.2.1\" # DO NOT EDIT THIS LINE MANUALLY. LET bump2version UTILITY DO IT\n\nfrom ._parser import TOMLDecodeError, load, loads\n",[],[216,809,810,811,890,891,1012,893],"fe62894c-67fb-11f0-847e-0224a6c84d84",80,["D",1753299245074],[594,595,596,597,598],[216,809,810,811,890,891,1012],"0af8b00a-67fc-11f0-8d4e-0224a6c84d84","tree.py","0af8b226-67fc-11f0-8d4e-0224a6c84d84","feb14ac8-67fb-11f0-b5ac-0224a6c84d84",400,["D",1753299266190],"from typing import Iterator, List, Optional, Tuple\n\nfrom ._loop import loop_first, loop_last\nfrom .console import Console, ConsoleOptions, RenderableType, RenderResult\nfrom .jupyter import JupyterMixin\nfrom .measure import Measurement\nfrom .segment import Segment\nfrom .style import Style, StyleStack, StyleType\nfrom .styled import Styled\n\nGuideType = Tuple[str, str, str, str]\n\n\nclass Tree(JupyterMixin):\n \"\"\"A renderable for a tree structure.\n\n Attributes:\n ASCII_GUIDES (GuideType): Guide lines used when Console.ascii_only is True.\n TREE_GUIDES (List[GuideType, GuideType, GuideType]): Default guide lines.\n\n Args:\n label (RenderableType): The renderable or str for the tree label.\n style (StyleType, optional): Style of this tree. Defaults to \"tree\".\n guide_style (StyleType, optional): Style of the guide lines. Defaults to \"tree.line\".\n expanded (bool, optional): Also display children. Defaults to True.\n highlight (bool, optional): Highlight renderable (if str). Defaults to False.\n hide_root (bool, optional): Hide the root node. Defaults to False.\n \"\"\"\n\n ASCII_GUIDES = (\" \", \"| \", \"+-- \", \"`-- \")\n TREE_GUIDES = [\n (\" \", \"│ \", \"├── \", \"└── \"),\n (\" \", \"┃ \", \"┣━━ \", \"┗━━ \"),\n (\" \", \"║ \", \"╠══ \", \"╚══ \"),\n ]\n\n def __init__(\n self,\n label: RenderableType,\n *,\n style: StyleType = \"tree\",\n guide_style: StyleType = \"tree.line\",\n expanded: bool = True,\n highlight: bool = False,\n hide_root: bool = False,\n ) -> None:\n self.label = label\n self.style = style\n self.guide_style = guide_style\n self.children: List[Tree] = []\n self.expanded = expanded\n self.highlight = highlight\n self.hide_root = hide_root\n\n def add(\n self,\n label: RenderableType,\n *,\n style: Optional[StyleType] = None,\n guide_style: Optional[StyleType] = None,\n expanded: bool = True,\n highlight: Optional[bool] = False,\n ) -> \"Tree\":\n \"\"\"Add a child tree.\n\n Args:\n label (RenderableType): The renderable or str for the tree label.\n style (StyleType, optional): Style of this tree. Defaults to \"tree\".\n guide_style (StyleType, optional): Style of the guide lines. Defaults to \"tree.line\".\n expanded (bool, optional): Also display children. Defaults to True.\n highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False.\n\n Returns:\n Tree: A new child Tree, which may be further modified.\n \"\"\"\n node = Tree(\n label,\n style=self.style if style is None else style,\n guide_style=self.guide_style if guide_style is None else guide_style,\n expanded=expanded,\n highlight=self.highlight if highlight is None else highlight,\n )\n self.children.append(node)\n return node\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n stack: List[Iterator[Tuple[bool, Tree]]] = []\n pop = stack.pop\n push = stack.append\n new_line = Segment.line()\n\n get_style = console.get_style\n null_style = Style.null()\n guide_style = get_style(self.guide_style, default=\"\") or null_style\n SPACE, CONTINUE, FORK, END = range(4)\n\n _Segment = Segment\n\n def make_guide(index: int, style: Style) -> Segment:\n \"\"\"Make a Segment for a level of the guide lines.\"\"\"\n if options.ascii_only:\n line = self.ASCII_GUIDES[index]\n else:\n guide = 1 if style.bold else (2 if style.underline2 else 0)\n line = self.TREE_GUIDES[0 if options.legacy_windows else guide][index]\n return _Segment(line, style)\n\n levels: List[Segment] = [make_guide(CONTINUE, guide_style)]\n push(iter(loop_last([self])))\n\n guide_style_stack = StyleStack(get_style(self.guide_style))\n style_stack = StyleStack(get_style(self.style))\n remove_guide_styles = Style(bold=False, underline2=False)\n\n depth = 0\n\n while stack:\n stack_node = pop()\n try:\n last, node = next(stack_node)\n except StopIteration:\n levels.pop()\n if levels:\n guide_style = levels[-1].style or null_style\n levels[-1] = make_guide(FORK, guide_style)\n guide_style_stack.pop()\n style_stack.pop()\n continue\n push(stack_node)\n if last:\n levels[-1] = make_guide(END, levels[-1].style or null_style)\n\n guide_style = guide_style_stack.current + get_style(node.guide_style)\n style = style_stack.current + get_style(node.style)\n prefix = levels[(2 if self.hide_root else 1) :]\n renderable_lines = console.render_lines(\n Styled(node.label, style),\n options.update(\n width=options.max_width\n - sum(level.cell_length for level in prefix),\n highlight=self.highlight,\n height=None,\n ),\n pad=options.justify is not None,\n )\n\n if not (depth == 0 and self.hide_root):\n for first, line in loop_first(renderable_lines):\n if prefix:\n yield from _Segment.apply_style(\n prefix,\n style.background_style,\n post_style=remove_guide_styles,\n )\n yield from line\n yield new_line\n if first and prefix:\n prefix[-1] = make_guide(\n SPACE if last else CONTINUE, prefix[-1].style or null_style\n )\n\n if node.expanded and node.children:\n levels[-1] = make_guide(\n SPACE if last else CONTINUE, levels[-1].style or null_style\n )\n levels.append(\n make_guide(END if len(node.children) == 1 else FORK, guide_style)\n )\n style_stack.push(get_style(node.style))\n guide_style_stack.push(get_style(node.guide_style))\n push(iter(loop_last(node.children)))\n depth += 1\n\n def __rich_measure__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"Measurement\":\n stack: List[Iterator[Tree]] = [iter([self])]\n pop = stack.pop\n push = stack.append\n minimum = 0\n maximum = 0\n measure = Measurement.get\n level = 0\n while stack:\n iter_tree = pop()\n try:\n tree = next(iter_tree)\n except StopIteration:\n level -= 1\n continue\n push(iter_tree)\n min_measure, max_measure = measure(console, options, tree.label)\n indent = level * 4\n minimum = max(min_measure + indent, minimum)\n maximum = max(max_measure + indent, maximum)\n if tree.expanded and tree.children:\n push(iter(tree.children))\n level += 1\n return Measurement(minimum, maximum)\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from pip._vendor.rich.console import Group\n from pip._vendor.rich.markdown import Markdown\n from pip._vendor.rich.panel import Panel\n from pip._vendor.rich.syntax import Syntax\n from pip._vendor.rich.table import Table\n\n table = Table(row_styles=[\"\", \"dim\"])\n\n table.add_column(\"Released\", style=\"cyan\", no_wrap=True)\n table.add_column(\"Title\", style=\"magenta\")\n table.add_column(\"Box Office\", justify=\"right\", style=\"green\")\n\n table.add_row(\"Dec 20, 2019\", \"Star Wars: The Rise of Skywalker\", \"$952,110,690\")\n table.add_row(\"May 25, 2018\", \"Solo: A Star Wars Story\", \"$393,151,347\")\n table.add_row(\"Dec 15, 2017\", \"Star Wars Ep. V111: The Last Jedi\", \"$1,332,539,889\")\n table.add_row(\"Dec 16, 2016\", \"Rogue One: A Star Wars Story\", \"$1,332,439,889\")\n\n code = \"\"\"\\\nclass Segment(NamedTuple):\n text: str = \"\"\n style: Optional[Style] = None\n is_control: bool = False\n\"\"\"\n syntax = Syntax(code, \"python\", theme=\"monokai\", line_numbers=True)\n\n markdown = Markdown(\n \"\"\"\\\n### example.md\n> Hello, World!\n>\n> Markdown _all_ the things\n\"\"\"\n )\n\n root = Tree(\"🌲 [b green]Rich Tree\", highlight=True, hide_root=True)\n\n node = root.add(\":file_folder: Renderables\", guide_style=\"red\")\n simple_node = node.add(\":file_folder: [bold yellow]Atomic\", guide_style=\"uu green\")\n simple_node.add(Group(\"📄 Syntax\", syntax))\n simple_node.add(Group(\"📄 Markdown\", Panel(markdown, border_style=\"green\")))\n\n containers_node = node.add(\n \":file_folder: [bold magenta]Containers\", guide_style=\"bold magenta\"\n )\n containers_node.expanded = True\n panel = Panel.fit(\"Just a panel\", border_style=\"red\")\n containers_node.add(Group(\"📄 Panels\", panel))\n\n containers_node.add(Group(\"📄 [b magenta]Table\", table))\n\n console = Console()\n\n console.print(root)\n",[],[216,809,810,811,890,891,1058,1050],"rich","0b61bc9e-67fc-11f0-bcbe-0224a6c84d84","traceback.py","0b61bd3e-67fc-11f0-bcbe-0224a6c84d84",417,["D",1753299266865],"import inspect\nimport linecache\nimport os\nimport sys\nfrom dataclasses import dataclass, field\nfrom itertools import islice\nfrom traceback import walk_tb\nfrom types import ModuleType, TracebackType\nfrom typing import (\n Any,\n Callable,\n Dict,\n Iterable,\n List,\n Optional,\n Sequence,\n Tuple,\n Type,\n Union,\n)\n\nfrom pip._vendor.pygments.lexers import guess_lexer_for_filename\nfrom pip._vendor.pygments.token import Comment, Keyword, Name, Number, Operator, String\nfrom pip._vendor.pygments.token import Text as TextToken\nfrom pip._vendor.pygments.token import Token\nfrom pip._vendor.pygments.util import ClassNotFound\n\nfrom . import pretty\nfrom ._loop import loop_first_last, loop_last\nfrom .columns import Columns\nfrom .console import (\n Console,\n ConsoleOptions,\n ConsoleRenderable,\n Group,\n RenderResult,\n group,\n)\nfrom .constrain import Constrain\nfrom .highlighter import RegexHighlighter, ReprHighlighter\nfrom .panel import Panel\nfrom .scope import render_scope\nfrom .style import Style\nfrom .syntax import Syntax, SyntaxPosition\nfrom .text import Text\nfrom .theme import Theme\n\nWINDOWS = sys.platform == \"win32\"\n\nLOCALS_MAX_LENGTH = 10\nLOCALS_MAX_STRING = 80\n\n\ndef _iter_syntax_lines(\n start: SyntaxPosition, end: SyntaxPosition\n) -> Iterable[Tuple[int, int, int]]:\n \"\"\"Yield start and end positions per line.\n\n Args:\n start: Start position.\n end: End position.\n\n Returns:\n Iterable of (LINE, COLUMN1, COLUMN2).\n \"\"\"\n\n line1, column1 = start\n line2, column2 = end\n\n if line1 == line2:\n yield line1, column1, column2\n else:\n for first, last, line_no in loop_first_last(range(line1, line2 + 1)):\n if first:\n yield line_no, column1, -1\n elif last:\n yield line_no, 0, column2\n else:\n yield line_no, 0, -1\n\n\ndef install(\n *,\n console: Optional[Console] = None,\n width: Optional[int] = 100,\n code_width: Optional[int] = 88,\n extra_lines: int = 3,\n theme: Optional[str] = None,\n word_wrap: bool = False,\n show_locals: bool = False,\n locals_max_length: int = LOCALS_MAX_LENGTH,\n locals_max_string: int = LOCALS_MAX_STRING,\n locals_hide_dunder: bool = True,\n locals_hide_sunder: Optional[bool] = None,\n indent_guides: bool = True,\n suppress: Iterable[Union[str, ModuleType]] = (),\n max_frames: int = 100,\n) -> Callable[[Type[BaseException], BaseException, Optional[TracebackType]], Any]:\n \"\"\"Install a rich traceback handler.\n\n Once installed, any tracebacks will be printed with syntax highlighting and rich formatting.\n\n\n Args:\n console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance.\n width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100.\n code_width (Optional[int], optional): Code width (in characters) of traceback. Defaults to 88.\n extra_lines (int, optional): Extra lines of code. Defaults to 3.\n theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick\n a theme appropriate for the platform.\n word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.\n show_locals (bool, optional): Enable display of local variables. Defaults to False.\n locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.\n Defaults to 10.\n locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.\n locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True.\n locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False.\n indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.\n suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.\n\n Returns:\n Callable: The previous exception handler that was replaced.\n\n \"\"\"\n traceback_console = Console(stderr=True) if console is None else console\n\n locals_hide_sunder = (\n True\n if (traceback_console.is_jupyter and locals_hide_sunder is None)\n else locals_hide_sunder\n )\n\n def excepthook(\n type_: Type[BaseException],\n value: BaseException,\n traceback: Optional[TracebackType],\n ) -> None:\n exception_traceback = Traceback.from_exception(\n type_,\n value,\n traceback,\n width=width,\n code_width=code_width,\n extra_lines=extra_lines,\n theme=theme,\n word_wrap=word_wrap,\n show_locals=show_locals,\n locals_max_length=locals_max_length,\n locals_max_string=locals_max_string,\n locals_hide_dunder=locals_hide_dunder,\n locals_hide_sunder=bool(locals_hide_sunder),\n indent_guides=indent_guides,\n suppress=suppress,\n max_frames=max_frames,\n )\n traceback_console.print(exception_traceback)\n\n def ipy_excepthook_closure(ip: Any) -> None: # pragma: no cover\n tb_data = {} # store information about showtraceback call\n default_showtraceback = ip.showtraceback # keep reference of default traceback\n\n def ipy_show_traceback(*args: Any, **kwargs: Any) -> None:\n \"\"\"wrap the default ip.showtraceback to store info for ip._showtraceback\"\"\"\n nonlocal tb_data\n tb_data = kwargs\n default_showtraceback(*args, **kwargs)\n\n def ipy_display_traceback(\n *args: Any, is_syntax: bool = False, **kwargs: Any\n ) -> None:\n \"\"\"Internally called traceback from ip._showtraceback\"\"\"\n nonlocal tb_data\n exc_tuple = ip._get_exc_info()\n\n # do not display trace on syntax error\n tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2]\n\n # determine correct tb_offset\n compiled = tb_data.get(\"running_compiled_code\", False)\n tb_offset = tb_data.get(\"tb_offset\", 1 if compiled else 0)\n # remove ipython internal frames from trace with tb_offset\n for _ in range(tb_offset):\n if tb is None:\n break\n tb = tb.tb_next\n\n excepthook(exc_tuple[0], exc_tuple[1], tb)\n tb_data = {} # clear data upon usage\n\n # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work\n # this is also what the ipython docs recommends to modify when subclassing InteractiveShell\n ip._showtraceback = ipy_display_traceback\n # add wrapper to capture tb_data\n ip.showtraceback = ipy_show_traceback\n ip.showsyntaxerror = lambda *args, **kwargs: ipy_display_traceback(\n *args, is_syntax=True, **kwargs\n )\n\n try: # pragma: no cover\n # if within ipython, use customized traceback\n ip = get_ipython() # type: ignore[name-defined]\n ipy_excepthook_closure(ip)\n return sys.excepthook\n except Exception:\n # otherwise use default system hook\n old_excepthook = sys.excepthook\n sys.excepthook = excepthook\n return old_excepthook\n\n\n@dataclass\nclass Frame:\n filename: str\n lineno: int\n name: str\n line: str = \"\"\n locals: Optional[Dict[str, pretty.Node]] = None\n last_instruction: Optional[Tuple[Tuple[int, int], Tuple[int, int]]] = None\n\n\n@dataclass\nclass _SyntaxError:\n offset: int\n filename: str\n line: str\n lineno: int\n msg: str\n notes: List[str] = field(default_factory=list)\n\n\n@dataclass\nclass Stack:\n exc_type: str\n exc_value: str\n syntax_error: Optional[_SyntaxError] = None\n is_cause: bool = False\n frames: List[Frame] = field(default_factory=list)\n notes: List[str] = field(default_factory=list)\n is_group: bool = False\n exceptions: List[\"Trace\"] = field(default_factory=list)\n\n\n@dataclass\nclass Trace:\n stacks: List[Stack]\n\n\nclass PathHighlighter(RegexHighlighter):\n highlights = [r\"(?P.*/)(?P.+)\"]\n\n\nclass Traceback:\n \"\"\"A Console renderable that renders a traceback.\n\n Args:\n trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses\n the last exception.\n width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.\n code_width (Optional[int], optional): Number of code characters used to traceback. Defaults to 88.\n extra_lines (int, optional): Additional lines of code to render. Defaults to 3.\n theme (str, optional): Override pygments theme used in traceback.\n word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.\n show_locals (bool, optional): Enable display of local variables. Defaults to False.\n indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.\n locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.\n Defaults to 10.\n locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.\n locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True.\n locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False.\n suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.\n max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.\n\n \"\"\"\n\n LEXERS = {\n \"\": \"text\",\n \".py\": \"python\",\n \".pxd\": \"cython\",\n \".pyx\": \"cython\",\n \".pxi\": \"pyrex\",\n }\n\n def __init__(\n self,\n trace: Optional[Trace] = None,\n *,\n width: Optional[int] = 100,\n code_width: Optional[int] = 88,\n extra_lines: int = 3,\n theme: Optional[str] = None,\n word_wrap: bool = False,\n show_locals: bool = False,\n locals_max_length: int = LOCALS_MAX_LENGTH,\n locals_max_string: int = LOCALS_MAX_STRING,\n locals_hide_dunder: bool = True,\n locals_hide_sunder: bool = False,\n indent_guides: bool = True,\n suppress: Iterable[Union[str, ModuleType]] = (),\n max_frames: int = 100,\n ):\n if trace is None:\n exc_type, exc_value, traceback = sys.exc_info()\n if exc_type is None or exc_value is None or traceback is None:\n raise ValueError(\n \"Value for 'trace' required if not called in except: block\"\n )\n trace = self.extract(\n exc_type, exc_value, traceback, show_locals=show_locals\n )\n self.trace = trace\n self.width = width\n self.code_width = code_width\n self.extra_lines = extra_lines\n self.theme = Syntax.get_theme(theme or \"ansi_dark\")\n self.word_wrap = word_wrap\n self.show_locals = show_locals\n self.indent_guides = indent_guides\n self.locals_max_length = locals_max_length\n self.locals_max_string = locals_max_string\n self.locals_hide_dunder = locals_hide_dunder\n self.locals_hide_sunder = locals_hide_sunder\n\n self.suppress: Sequence[str] = []\n for suppress_entity in suppress:\n if not isinstance(suppress_entity, str):\n assert (\n suppress_entity.__file__ is not None\n ), f\"{suppress_entity!r} must be a module with '__file__' attribute\"\n path = os.path.dirname(suppress_entity.__file__)\n else:\n path = suppress_entity\n path = os.path.normpath(os.path.abspath(path))\n self.suppress.append(path)\n self.max_frames = max(4, max_frames) if max_frames > 0 else 0\n\n @classmethod\n def from_exception(\n cls,\n exc_type: Type[Any],\n exc_value: BaseException,\n traceback: Optional[TracebackType],\n *,\n width: Optional[int] = 100,\n code_width: Optional[int] = 88,\n extra_lines: int = 3,\n theme: Optional[str] = None,\n word_wrap: bool = False,\n show_locals: bool = False,\n locals_max_length: int = LOCALS_MAX_LENGTH,\n locals_max_string: int = LOCALS_MAX_STRING,\n locals_hide_dunder: bool = True,\n locals_hide_sunder: bool = False,\n indent_guides: bool = True,\n suppress: Iterable[Union[str, ModuleType]] = (),\n max_frames: int = 100,\n ) -> \"Traceback\":\n \"\"\"Create a traceback from exception info\n\n Args:\n exc_type (Type[BaseException]): Exception type.\n exc_value (BaseException): Exception value.\n traceback (TracebackType): Python Traceback object.\n width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.\n code_width (Optional[int], optional): Number of code characters used to traceback. Defaults to 88.\n extra_lines (int, optional): Additional lines of code to render. Defaults to 3.\n theme (str, optional): Override pygments theme used in traceback.\n word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.\n show_locals (bool, optional): Enable display of local variables. Defaults to False.\n indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.\n locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.\n Defaults to 10.\n locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.\n locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True.\n locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False.\n suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.\n max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.\n\n Returns:\n Traceback: A Traceback instance that may be printed.\n \"\"\"\n rich_traceback = cls.extract(\n exc_type,\n exc_value,\n traceback,\n show_locals=show_locals,\n locals_max_length=locals_max_length,\n locals_max_string=locals_max_string,\n locals_hide_dunder=locals_hide_dunder,\n locals_hide_sunder=locals_hide_sunder,\n )\n\n return cls(\n rich_traceback,\n width=width,\n code_width=code_width,\n extra_lines=extra_lines,\n theme=theme,\n word_wrap=word_wrap,\n show_locals=show_locals,\n indent_guides=indent_guides,\n locals_max_length=locals_max_length,\n locals_max_string=locals_max_string,\n locals_hide_dunder=locals_hide_dunder,\n locals_hide_sunder=locals_hide_sunder,\n suppress=suppress,\n max_frames=max_frames,\n )\n\n @classmethod\n def extract(\n cls,\n exc_type: Type[BaseException],\n exc_value: BaseException,\n traceback: Optional[TracebackType],\n *,\n show_locals: bool = False,\n locals_max_length: int = LOCALS_MAX_LENGTH,\n locals_max_string: int = LOCALS_MAX_STRING,\n locals_hide_dunder: bool = True,\n locals_hide_sunder: bool = False,\n ) -> Trace:\n \"\"\"Extract traceback information.\n\n Args:\n exc_type (Type[BaseException]): Exception type.\n exc_value (BaseException): Exception value.\n traceback (TracebackType): Python Traceback object.\n show_locals (bool, optional): Enable display of local variables. Defaults to False.\n locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.\n Defaults to 10.\n locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.\n locals_hide_dunder (bool, optional): Hide locals prefixed with double underscore. Defaults to True.\n locals_hide_sunder (bool, optional): Hide locals prefixed with single underscore. Defaults to False.\n\n Returns:\n Trace: A Trace instance which you can use to construct a `Traceback`.\n \"\"\"\n\n stacks: List[Stack] = []\n is_cause = False\n\n from pip._vendor.rich import _IMPORT_CWD\n\n notes: List[str] = getattr(exc_value, \"__notes__\", None) or []\n\n def safe_str(_object: Any) -> str:\n \"\"\"Don't allow exceptions from __str__ to propagate.\"\"\"\n try:\n return str(_object)\n except Exception:\n return \"\"\n\n while True:\n stack = Stack(\n exc_type=safe_str(exc_type.__name__),\n exc_value=safe_str(exc_value),\n is_cause=is_cause,\n notes=notes,\n )\n\n if sys.version_info >= (3, 11):\n if isinstance(exc_value, (BaseExceptionGroup, ExceptionGroup)):\n stack.is_group = True\n for exception in exc_value.exceptions:\n stack.exceptions.append(\n Traceback.extract(\n type(exception),\n exception,\n exception.__traceback__,\n show_locals=show_locals,\n locals_max_length=locals_max_length,\n locals_hide_dunder=locals_hide_dunder,\n locals_hide_sunder=locals_hide_sunder,\n )\n )\n\n if isinstance(exc_value, SyntaxError):\n stack.syntax_error = _SyntaxError(\n offset=exc_value.offset or 0,\n filename=exc_value.filename or \"?\",\n lineno=exc_value.lineno or 0,\n line=exc_value.text or \"\",\n msg=exc_value.msg,\n notes=notes,\n )\n\n stacks.append(stack)\n append = stack.frames.append\n\n def get_locals(\n iter_locals: Iterable[Tuple[str, object]],\n ) -> Iterable[Tuple[str, object]]:\n \"\"\"Extract locals from an iterator of key pairs.\"\"\"\n if not (locals_hide_dunder or locals_hide_sunder):\n yield from iter_locals\n return\n for key, value in iter_locals:\n if locals_hide_dunder and key.startswith(\"__\"):\n continue\n if locals_hide_sunder and key.startswith(\"_\"):\n continue\n yield key, value\n\n for frame_summary, line_no in walk_tb(traceback):\n filename = frame_summary.f_code.co_filename\n\n last_instruction: Optional[Tuple[Tuple[int, int], Tuple[int, int]]]\n last_instruction = None\n if sys.version_info >= (3, 11):\n instruction_index = frame_summary.f_lasti // 2\n instruction_position = next(\n islice(\n frame_summary.f_code.co_positions(),\n instruction_index,\n instruction_index + 1,\n )\n )\n (\n start_line,\n end_line,\n start_column,\n end_column,\n ) = instruction_position\n if (\n start_line is not None\n and end_line is not None\n and start_column is not None\n and end_column is not None\n ):\n last_instruction = (\n (start_line, start_column),\n (end_line, end_column),\n )\n\n if filename and not filename.startswith(\"<\"):\n if not os.path.isabs(filename):\n filename = os.path.join(_IMPORT_CWD, filename)\n if frame_summary.f_locals.get(\"_rich_traceback_omit\", False):\n continue\n\n frame = Frame(\n filename=filename or \"?\",\n lineno=line_no,\n name=frame_summary.f_code.co_name,\n locals=(\n {\n key: pretty.traverse(\n value,\n max_length=locals_max_length,\n max_string=locals_max_string,\n )\n for key, value in get_locals(frame_summary.f_locals.items())\n if not (inspect.isfunction(value) or inspect.isclass(value))\n }\n if show_locals\n else None\n ),\n last_instruction=last_instruction,\n )\n append(frame)\n if frame_summary.f_locals.get(\"_rich_traceback_guard\", False):\n del stack.frames[:]\n\n cause = getattr(exc_value, \"__cause__\", None)\n if cause:\n exc_type = cause.__class__\n exc_value = cause\n # __traceback__ can be None, e.g. for exceptions raised by the\n # 'multiprocessing' module\n traceback = cause.__traceback__\n is_cause = True\n continue\n\n cause = exc_value.__context__\n if cause and not getattr(exc_value, \"__suppress_context__\", False):\n exc_type = cause.__class__\n exc_value = cause\n traceback = cause.__traceback__\n is_cause = False\n continue\n # No cover, code is reached but coverage doesn't recognize it.\n break # pragma: no cover\n\n trace = Trace(stacks=stacks)\n\n return trace\n\n def __rich_console__(\n self, console: Console, options: ConsoleOptions\n ) -> RenderResult:\n theme = self.theme\n background_style = theme.get_background_style()\n token_style = theme.get_style_for_token\n\n traceback_theme = Theme(\n {\n \"pretty\": token_style(TextToken),\n \"pygments.text\": token_style(Token),\n \"pygments.string\": token_style(String),\n \"pygments.function\": token_style(Name.Function),\n \"pygments.number\": token_style(Number),\n \"repr.indent\": token_style(Comment) + Style(dim=True),\n \"repr.str\": token_style(String),\n \"repr.brace\": token_style(TextToken) + Style(bold=True),\n \"repr.number\": token_style(Number),\n \"repr.bool_true\": token_style(Keyword.Constant),\n \"repr.bool_false\": token_style(Keyword.Constant),\n \"repr.none\": token_style(Keyword.Constant),\n \"scope.border\": token_style(String.Delimiter),\n \"scope.equals\": token_style(Operator),\n \"scope.key\": token_style(Name),\n \"scope.key.special\": token_style(Name.Constant) + Style(dim=True),\n },\n inherit=False,\n )\n\n highlighter = ReprHighlighter()\n\n @group()\n def render_stack(stack: Stack, last: bool) -> RenderResult:\n if stack.frames:\n stack_renderable: ConsoleRenderable = Panel(\n self._render_stack(stack),\n title=\"[traceback.title]Traceback [dim](most recent call last)\",\n style=background_style,\n border_style=\"traceback.border\",\n expand=True,\n padding=(0, 1),\n )\n stack_renderable = Constrain(stack_renderable, self.width)\n with console.use_theme(traceback_theme):\n yield stack_renderable\n\n if stack.syntax_error is not None:\n with console.use_theme(traceback_theme):\n yield Constrain(\n Panel(\n self._render_syntax_error(stack.syntax_error),\n style=background_style,\n border_style=\"traceback.border.syntax_error\",\n expand=True,\n padding=(0, 1),\n width=self.width,\n ),\n self.width,\n )\n yield Text.assemble(\n (f\"{stack.exc_type}: \", \"traceback.exc_type\"),\n highlighter(stack.syntax_error.msg),\n )\n elif stack.exc_value:\n yield Text.assemble(\n (f\"{stack.exc_type}: \", \"traceback.exc_type\"),\n highlighter(stack.exc_value),\n )\n else:\n yield Text.assemble((f\"{stack.exc_type}\", \"traceback.exc_type\"))\n\n for note in stack.notes:\n yield Text.assemble((\"[NOTE] \", \"traceback.note\"), highlighter(note))\n\n if stack.is_group:\n for group_no, group_exception in enumerate(stack.exceptions, 1):\n grouped_exceptions: List[Group] = []\n for group_last, group_stack in loop_last(group_exception.stacks):\n grouped_exceptions.append(render_stack(group_stack, group_last))\n yield \"\"\n yield Constrain(\n Panel(\n Group(*grouped_exceptions),\n title=f\"Sub-exception #{group_no}\",\n border_style=\"traceback.group.border\",\n ),\n self.width,\n )\n\n if not last:\n if stack.is_cause:\n yield Text.from_markup(\n \"\\n[i]The above exception was the direct cause of the following exception:\\n\",\n )\n else:\n yield Text.from_markup(\n \"\\n[i]During handling of the above exception, another exception occurred:\\n\",\n )\n\n for last, stack in loop_last(reversed(self.trace.stacks)):\n yield render_stack(stack, last)\n\n @group()\n def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult:\n highlighter = ReprHighlighter()\n path_highlighter = PathHighlighter()\n if syntax_error.filename != \"\":\n if os.path.exists(syntax_error.filename):\n text = Text.assemble(\n (f\" {syntax_error.filename}\", \"pygments.string\"),\n (\":\", \"pygments.text\"),\n (str(syntax_error.lineno), \"pygments.number\"),\n style=\"pygments.text\",\n )\n yield path_highlighter(text)\n syntax_error_text = highlighter(syntax_error.line.rstrip())\n syntax_error_text.no_wrap = True\n offset = min(syntax_error.offset - 1, len(syntax_error_text))\n syntax_error_text.stylize(\"bold underline\", offset, offset)\n syntax_error_text += Text.from_markup(\n \"\\n\" + \" \" * offset + \"[traceback.offset]▲[/]\",\n style=\"pygments.text\",\n )\n yield syntax_error_text\n\n @classmethod\n def _guess_lexer(cls, filename: str, code: str) -> str:\n ext = os.path.splitext(filename)[-1]\n if not ext:\n # No extension, look at first line to see if it is a hashbang\n # Note, this is an educated guess and not a guarantee\n # If it fails, the only downside is that the code is highlighted strangely\n new_line_index = code.index(\"\\n\")\n first_line = code[:new_line_index] if new_line_index != -1 else code\n if first_line.startswith(\"#!\") and \"python\" in first_line.lower():\n return \"python\"\n try:\n return cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name\n except ClassNotFound:\n return \"text\"\n\n @group()\n def _render_stack(self, stack: Stack) -> RenderResult:\n path_highlighter = PathHighlighter()\n theme = self.theme\n\n def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]:\n if frame.locals:\n yield render_scope(\n frame.locals,\n title=\"locals\",\n indent_guides=self.indent_guides,\n max_length=self.locals_max_length,\n max_string=self.locals_max_string,\n )\n\n exclude_frames: Optional[range] = None\n if self.max_frames != 0:\n exclude_frames = range(\n self.max_frames // 2,\n len(stack.frames) - self.max_frames // 2,\n )\n\n excluded = False\n for frame_index, frame in enumerate(stack.frames):\n if exclude_frames and frame_index in exclude_frames:\n excluded = True\n continue\n\n if excluded:\n assert exclude_frames is not None\n yield Text(\n f\"\\n... {len(exclude_frames)} frames hidden ...\",\n justify=\"center\",\n style=\"traceback.error\",\n )\n excluded = False\n\n first = frame_index == 0\n frame_filename = frame.filename\n suppressed = any(frame_filename.startswith(path) for path in self.suppress)\n\n if os.path.exists(frame.filename):\n text = Text.assemble(\n path_highlighter(Text(frame.filename, style=\"pygments.string\")),\n (\":\", \"pygments.text\"),\n (str(frame.lineno), \"pygments.number\"),\n \" in \",\n (frame.name, \"pygments.function\"),\n style=\"pygments.text\",\n )\n else:\n text = Text.assemble(\n \"in \",\n (frame.name, \"pygments.function\"),\n (\":\", \"pygments.text\"),\n (str(frame.lineno), \"pygments.number\"),\n style=\"pygments.text\",\n )\n if not frame.filename.startswith(\"<\") and not first:\n yield \"\"\n yield text\n if frame.filename.startswith(\"<\"):\n yield from render_locals(frame)\n continue\n if not suppressed:\n try:\n code_lines = linecache.getlines(frame.filename)\n code = \"\".join(code_lines)\n if not code:\n # code may be an empty string if the file doesn't exist, OR\n # if the traceback filename is generated dynamically\n continue\n lexer_name = self._guess_lexer(frame.filename, code)\n syntax = Syntax(\n code,\n lexer_name,\n theme=theme,\n line_numbers=True,\n line_range=(\n frame.lineno - self.extra_lines,\n frame.lineno + self.extra_lines,\n ),\n highlight_lines={frame.lineno},\n word_wrap=self.word_wrap,\n code_width=self.code_width,\n indent_guides=self.indent_guides,\n dedent=False,\n )\n yield \"\"\n except Exception as error:\n yield Text.assemble(\n (f\"\\n{error}\", \"traceback.error\"),\n )\n else:\n if frame.last_instruction is not None:\n start, end = frame.last_instruction\n\n # Stylize a line at a time\n # So that indentation isn't underlined (which looks bad)\n for line1, column1, column2 in _iter_syntax_lines(start, end):\n try:\n if column1 == 0:\n line = code_lines[line1 - 1]\n column1 = len(line) - len(line.lstrip())\n if column2 == -1:\n column2 = len(code_lines[line1 - 1])\n except IndexError:\n # Being defensive here\n # If last_instruction reports a line out-of-bounds, we don't want to crash\n continue\n\n syntax.stylize_range(\n style=\"traceback.error_range\",\n start=(line1, column1),\n end=(line1, column2),\n )\n yield (\n Columns(\n [\n syntax,\n *render_locals(frame),\n ],\n padding=1,\n )\n if frame.locals\n else syntax\n )\n\n\nif __name__ == \"__main__\": # pragma: no cover\n install(show_locals=True)\n import sys\n\n def bar(\n a: Any,\n ) -> None: # 这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑\n one = 1\n print(one / a)\n\n def foo(a: Any) -> None:\n _rich_traceback_guard = True\n zed = {\n \"characters\": {\n \"Paul Atreides\",\n \"Vladimir Harkonnen\",\n \"Thufir Hawat\",\n \"Duncan Idaho\",\n },\n \"atomic_types\": (None, False, True),\n }\n bar(a)\n\n def error() -> None:\n foo(0)\n\n error()\n",[],[216,809,810,811,890,891,1058,1060],"0ae4b514-67fc-11f0-a516-0224a6c84d84","themes.py","0ae4b604-67fc-11f0-a516-0224a6c84d84",397,["D",1753299266055],"from .default_styles import DEFAULT_STYLES\nfrom .theme import Theme\n\n\nDEFAULT = Theme(DEFAULT_STYLES)\n",[],[216,809,810,811,890,891,1058,1068],"0b2296f4-67fc-11f0-a516-0224a6c84d84","theme.py","0b229794-67fc-11f0-a516-0224a6c84d84",407,["D",1753299266463],"import configparser\nfrom typing import IO, Dict, List, Mapping, Optional\n\nfrom .default_styles import DEFAULT_STYLES\nfrom .style import Style, StyleType\n\n\nclass Theme:\n \"\"\"A container for style information, used by :class:`~rich.console.Console`.\n\n Args:\n styles (Dict[str, Style], optional): A mapping of style names on to styles. Defaults to None for a theme with no styles.\n inherit (bool, optional): Inherit default styles. Defaults to True.\n \"\"\"\n\n styles: Dict[str, Style]\n\n def __init__(\n self, styles: Optional[Mapping[str, StyleType]] = None, inherit: bool = True\n ):\n self.styles = DEFAULT_STYLES.copy() if inherit else {}\n if styles is not None:\n self.styles.update(\n {\n name: style if isinstance(style, Style) else Style.parse(style)\n for name, style in styles.items()\n }\n )\n\n @property\n def config(self) -> str:\n \"\"\"Get contents of a config file for this theme.\"\"\"\n config = \"[styles]\\n\" + \"\\n\".join(\n f\"{name} = {style}\" for name, style in sorted(self.styles.items())\n )\n return config\n\n @classmethod\n def from_file(\n cls, config_file: IO[str], source: Optional[str] = None, inherit: bool = True\n ) -> \"Theme\":\n \"\"\"Load a theme from a text mode file.\n\n Args:\n config_file (IO[str]): An open conf file.\n source (str, optional): The filename of the open file. Defaults to None.\n inherit (bool, optional): Inherit default styles. Defaults to True.\n\n Returns:\n Theme: A New theme instance.\n \"\"\"\n config = configparser.ConfigParser()\n config.read_file(config_file, source=source)\n styles = {name: Style.parse(value) for name, value in config.items(\"styles\")}\n theme = Theme(styles, inherit=inherit)\n return theme\n\n @classmethod\n def read(\n cls, path: str, inherit: bool = True, encoding: Optional[str] = None\n ) -> \"Theme\":\n \"\"\"Read a theme from a path.\n\n Args:\n path (str): Path to a config file readable by Python configparser module.\n inherit (bool, optional): Inherit default styles. Defaults to True.\n encoding (str, optional): Encoding of the config file. Defaults to None.\n\n Returns:\n Theme: A new theme instance.\n \"\"\"\n with open(path, encoding=encoding) as config_file:\n return cls.from_file(config_file, source=path, inherit=inherit)\n\n\nclass ThemeStackError(Exception):\n \"\"\"Base exception for errors related to the theme stack.\"\"\"\n\n\nclass ThemeStack:\n \"\"\"A stack of themes.\n\n Args:\n theme (Theme): A theme instance\n \"\"\"\n\n def __init__(self, theme: Theme) -> None:\n self._entries: List[Dict[str, Style]] = [theme.styles]\n self.get = self._entries[-1].get\n\n def push_theme(self, theme: Theme, inherit: bool = True) -> None:\n \"\"\"Push a theme on the top of the stack.\n\n Args:\n theme (Theme): A Theme instance.\n inherit (boolean, optional): Inherit styles from current top of stack.\n \"\"\"\n styles: Dict[str, Style]\n styles = (\n {**self._entries[-1], **theme.styles} if inherit else theme.styles.copy()\n )\n self._entries.append(styles)\n self.get = self._entries[-1].get\n\n def pop_theme(self) -> None:\n \"\"\"Pop (and discard) the top-most theme.\"\"\"\n if len(self._entries) == 1:\n raise ThemeStackError(\"Unable to pop base theme\")\n self._entries.pop()\n self.get = self._entries[-1].get\n\n\nif __name__ == \"__main__\": # pragma: no cover\n theme = Theme()\n print(theme.config)\n",[],[216,809,810,811,890,891,1058,1076],"0b29fbf6-67fc-11f0-a319-0224a6c84d84","style.py","0b29fd5e-67fc-11f0-a319-0224a6c84d84",408,["D",1753299266510],"import sys\nfrom functools import lru_cache\nfrom marshal import dumps, loads\nfrom random import randint\nfrom typing import Any, Dict, Iterable, List, Optional, Type, Union, cast\n\nfrom . import errors\nfrom .color import Color, ColorParseError, ColorSystem, blend_rgb\nfrom .repr import Result, rich_repr\nfrom .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme\n\n# Style instances and style definitions are often interchangeable\nStyleType = Union[str, \"Style\"]\n\n\nclass _Bit:\n \"\"\"A descriptor to get/set a style attribute bit.\"\"\"\n\n __slots__ = [\"bit\"]\n\n def __init__(self, bit_no: int) -> None:\n self.bit = 1 << bit_no\n\n def __get__(self, obj: \"Style\", objtype: Type[\"Style\"]) -> Optional[bool]:\n if obj._set_attributes & self.bit:\n return obj._attributes & self.bit != 0\n return None\n\n\n@rich_repr\nclass Style:\n \"\"\"A terminal style.\n\n A terminal style consists of a color (`color`), a background color (`bgcolor`), and a number of attributes, such\n as bold, italic etc. The attributes have 3 states: they can either be on\n (``True``), off (``False``), or not set (``None``).\n\n Args:\n color (Union[Color, str], optional): Color of terminal text. Defaults to None.\n bgcolor (Union[Color, str], optional): Color of terminal background. Defaults to None.\n bold (bool, optional): Enable bold text. Defaults to None.\n dim (bool, optional): Enable dim text. Defaults to None.\n italic (bool, optional): Enable italic text. Defaults to None.\n underline (bool, optional): Enable underlined text. Defaults to None.\n blink (bool, optional): Enabled blinking text. Defaults to None.\n blink2 (bool, optional): Enable fast blinking text. Defaults to None.\n reverse (bool, optional): Enabled reverse text. Defaults to None.\n conceal (bool, optional): Enable concealed text. Defaults to None.\n strike (bool, optional): Enable strikethrough text. Defaults to None.\n underline2 (bool, optional): Enable doubly underlined text. Defaults to None.\n frame (bool, optional): Enable framed text. Defaults to None.\n encircle (bool, optional): Enable encircled text. Defaults to None.\n overline (bool, optional): Enable overlined text. Defaults to None.\n link (str, link): Link URL. Defaults to None.\n\n \"\"\"\n\n _color: Optional[Color]\n _bgcolor: Optional[Color]\n _attributes: int\n _set_attributes: int\n _hash: Optional[int]\n _null: bool\n _meta: Optional[bytes]\n\n __slots__ = [\n \"_color\",\n \"_bgcolor\",\n \"_attributes\",\n \"_set_attributes\",\n \"_link\",\n \"_link_id\",\n \"_ansi\",\n \"_style_definition\",\n \"_hash\",\n \"_null\",\n \"_meta\",\n ]\n\n # maps bits on to SGR parameter\n _style_map = {\n 0: \"1\",\n 1: \"2\",\n 2: \"3\",\n 3: \"4\",\n 4: \"5\",\n 5: \"6\",\n 6: \"7\",\n 7: \"8\",\n 8: \"9\",\n 9: \"21\",\n 10: \"51\",\n 11: \"52\",\n 12: \"53\",\n }\n\n STYLE_ATTRIBUTES = {\n \"dim\": \"dim\",\n \"d\": \"dim\",\n \"bold\": \"bold\",\n \"b\": \"bold\",\n \"italic\": \"italic\",\n \"i\": \"italic\",\n \"underline\": \"underline\",\n \"u\": \"underline\",\n \"blink\": \"blink\",\n \"blink2\": \"blink2\",\n \"reverse\": \"reverse\",\n \"r\": \"reverse\",\n \"conceal\": \"conceal\",\n \"c\": \"conceal\",\n \"strike\": \"strike\",\n \"s\": \"strike\",\n \"underline2\": \"underline2\",\n \"uu\": \"underline2\",\n \"frame\": \"frame\",\n \"encircle\": \"encircle\",\n \"overline\": \"overline\",\n \"o\": \"overline\",\n }\n\n def __init__(\n self,\n *,\n color: Optional[Union[Color, str]] = None,\n bgcolor: Optional[Union[Color, str]] = None,\n bold: Optional[bool] = None,\n dim: Optional[bool] = None,\n italic: Optional[bool] = None,\n underline: Optional[bool] = None,\n blink: Optional[bool] = None,\n blink2: Optional[bool] = None,\n reverse: Optional[bool] = None,\n conceal: Optional[bool] = None,\n strike: Optional[bool] = None,\n underline2: Optional[bool] = None,\n frame: Optional[bool] = None,\n encircle: Optional[bool] = None,\n overline: Optional[bool] = None,\n link: Optional[str] = None,\n meta: Optional[Dict[str, Any]] = None,\n ):\n self._ansi: Optional[str] = None\n self._style_definition: Optional[str] = None\n\n def _make_color(color: Union[Color, str]) -> Color:\n return color if isinstance(color, Color) else Color.parse(color)\n\n self._color = None if color is None else _make_color(color)\n self._bgcolor = None if bgcolor is None else _make_color(bgcolor)\n self._set_attributes = sum(\n (\n bold is not None,\n dim is not None and 2,\n italic is not None and 4,\n underline is not None and 8,\n blink is not None and 16,\n blink2 is not None and 32,\n reverse is not None and 64,\n conceal is not None and 128,\n strike is not None and 256,\n underline2 is not None and 512,\n frame is not None and 1024,\n encircle is not None and 2048,\n overline is not None and 4096,\n )\n )\n self._attributes = (\n sum(\n (\n bold and 1 or 0,\n dim and 2 or 0,\n italic and 4 or 0,\n underline and 8 or 0,\n blink and 16 or 0,\n blink2 and 32 or 0,\n reverse and 64 or 0,\n conceal and 128 or 0,\n strike and 256 or 0,\n underline2 and 512 or 0,\n frame and 1024 or 0,\n encircle and 2048 or 0,\n overline and 4096 or 0,\n )\n )\n if self._set_attributes\n else 0\n )\n\n self._link = link\n self._meta = None if meta is None else dumps(meta)\n self._link_id = (\n f\"{randint(0, 999999)}{hash(self._meta)}\" if (link or meta) else \"\"\n )\n self._hash: Optional[int] = None\n self._null = not (self._set_attributes or color or bgcolor or link or meta)\n\n @classmethod\n def null(cls) -> \"Style\":\n \"\"\"Create an 'null' style, equivalent to Style(), but more performant.\"\"\"\n return NULL_STYLE\n\n @classmethod\n def from_color(\n cls, color: Optional[Color] = None, bgcolor: Optional[Color] = None\n ) -> \"Style\":\n \"\"\"Create a new style with colors and no attributes.\n\n Returns:\n color (Optional[Color]): A (foreground) color, or None for no color. Defaults to None.\n bgcolor (Optional[Color]): A (background) color, or None for no color. Defaults to None.\n \"\"\"\n style: Style = cls.__new__(Style)\n style._ansi = None\n style._style_definition = None\n style._color = color\n style._bgcolor = bgcolor\n style._set_attributes = 0\n style._attributes = 0\n style._link = None\n style._link_id = \"\"\n style._meta = None\n style._null = not (color or bgcolor)\n style._hash = None\n return style\n\n @classmethod\n def from_meta(cls, meta: Optional[Dict[str, Any]]) -> \"Style\":\n \"\"\"Create a new style with meta data.\n\n Returns:\n meta (Optional[Dict[str, Any]]): A dictionary of meta data. Defaults to None.\n \"\"\"\n style: Style = cls.__new__(Style)\n style._ansi = None\n style._style_definition = None\n style._color = None\n style._bgcolor = None\n style._set_attributes = 0\n style._attributes = 0\n style._link = None\n style._meta = dumps(meta)\n style._link_id = f\"{randint(0, 999999)}{hash(style._meta)}\"\n style._hash = None\n style._null = not (meta)\n return style\n\n @classmethod\n def on(cls, meta: Optional[Dict[str, Any]] = None, **handlers: Any) -> \"Style\":\n \"\"\"Create a blank style with meta information.\n\n Example:\n style = Style.on(click=self.on_click)\n\n Args:\n meta (Optional[Dict[str, Any]], optional): An optional dict of meta information.\n **handlers (Any): Keyword arguments are translated in to handlers.\n\n Returns:\n Style: A Style with meta information attached.\n \"\"\"\n meta = {} if meta is None else meta\n meta.update({f\"@{key}\": value for key, value in handlers.items()})\n return cls.from_meta(meta)\n\n bold = _Bit(0)\n dim = _Bit(1)\n italic = _Bit(2)\n underline = _Bit(3)\n blink = _Bit(4)\n blink2 = _Bit(5)\n reverse = _Bit(6)\n conceal = _Bit(7)\n strike = _Bit(8)\n underline2 = _Bit(9)\n frame = _Bit(10)\n encircle = _Bit(11)\n overline = _Bit(12)\n\n @property\n def link_id(self) -> str:\n \"\"\"Get a link id, used in ansi code for links.\"\"\"\n return self._link_id\n\n def __str__(self) -> str:\n \"\"\"Re-generate style definition from attributes.\"\"\"\n if self._style_definition is None:\n attributes: List[str] = []\n append = attributes.append\n bits = self._set_attributes\n if bits & 0b0000000001111:\n if bits & 1:\n append(\"bold\" if self.bold else \"not bold\")\n if bits & (1 << 1):\n append(\"dim\" if self.dim else \"not dim\")\n if bits & (1 << 2):\n append(\"italic\" if self.italic else \"not italic\")\n if bits & (1 << 3):\n append(\"underline\" if self.underline else \"not underline\")\n if bits & 0b0000111110000:\n if bits & (1 << 4):\n append(\"blink\" if self.blink else \"not blink\")\n if bits & (1 << 5):\n append(\"blink2\" if self.blink2 else \"not blink2\")\n if bits & (1 << 6):\n append(\"reverse\" if self.reverse else \"not reverse\")\n if bits & (1 << 7):\n append(\"conceal\" if self.conceal else \"not conceal\")\n if bits & (1 << 8):\n append(\"strike\" if self.strike else \"not strike\")\n if bits & 0b1111000000000:\n if bits & (1 << 9):\n append(\"underline2\" if self.underline2 else \"not underline2\")\n if bits & (1 << 10):\n append(\"frame\" if self.frame else \"not frame\")\n if bits & (1 << 11):\n append(\"encircle\" if self.encircle else \"not encircle\")\n if bits & (1 << 12):\n append(\"overline\" if self.overline else \"not overline\")\n if self._color is not None:\n append(self._color.name)\n if self._bgcolor is not None:\n append(\"on\")\n append(self._bgcolor.name)\n if self._link:\n append(\"link\")\n append(self._link)\n self._style_definition = \" \".join(attributes) or \"none\"\n return self._style_definition\n\n def __bool__(self) -> bool:\n \"\"\"A Style is false if it has no attributes, colors, or links.\"\"\"\n return not self._null\n\n def _make_ansi_codes(self, color_system: ColorSystem) -> str:\n \"\"\"Generate ANSI codes for this style.\n\n Args:\n color_system (ColorSystem): Color system.\n\n Returns:\n str: String containing codes.\n \"\"\"\n\n if self._ansi is None:\n sgr: List[str] = []\n append = sgr.append\n _style_map = self._style_map\n attributes = self._attributes & self._set_attributes\n if attributes:\n if attributes & 1:\n append(_style_map[0])\n if attributes & 2:\n append(_style_map[1])\n if attributes & 4:\n append(_style_map[2])\n if attributes & 8:\n append(_style_map[3])\n if attributes & 0b0000111110000:\n for bit in range(4, 9):\n if attributes & (1 << bit):\n append(_style_map[bit])\n if attributes & 0b1111000000000:\n for bit in range(9, 13):\n if attributes & (1 << bit):\n append(_style_map[bit])\n if self._color is not None:\n sgr.extend(self._color.downgrade(color_system).get_ansi_codes())\n if self._bgcolor is not None:\n sgr.extend(\n self._bgcolor.downgrade(color_system).get_ansi_codes(\n foreground=False\n )\n )\n self._ansi = \";\".join(sgr)\n return self._ansi\n\n @classmethod\n @lru_cache(maxsize=1024)\n def normalize(cls, style: str) -> str:\n \"\"\"Normalize a style definition so that styles with the same effect have the same string\n representation.\n\n Args:\n style (str): A style definition.\n\n Returns:\n str: Normal form of style definition.\n \"\"\"\n try:\n return str(cls.parse(style))\n except errors.StyleSyntaxError:\n return style.strip().lower()\n\n @classmethod\n def pick_first(cls, *values: Optional[StyleType]) -> StyleType:\n \"\"\"Pick first non-None style.\"\"\"\n for value in values:\n if value is not None:\n return value\n raise ValueError(\"expected at least one non-None style\")\n\n def __rich_repr__(self) -> Result:\n yield \"color\", self.color, None\n yield \"bgcolor\", self.bgcolor, None\n yield \"bold\", self.bold, None,\n yield \"dim\", self.dim, None,\n yield \"italic\", self.italic, None\n yield \"underline\", self.underline, None,\n yield \"blink\", self.blink, None\n yield \"blink2\", self.blink2, None\n yield \"reverse\", self.reverse, None\n yield \"conceal\", self.conceal, None\n yield \"strike\", self.strike, None\n yield \"underline2\", self.underline2, None\n yield \"frame\", self.frame, None\n yield \"encircle\", self.encircle, None\n yield \"link\", self.link, None\n if self._meta:\n yield \"meta\", self.meta\n\n def __eq__(self, other: Any) -> bool:\n if not isinstance(other, Style):\n return NotImplemented\n return self.__hash__() == other.__hash__()\n\n def __ne__(self, other: Any) -> bool:\n if not isinstance(other, Style):\n return NotImplemented\n return self.__hash__() != other.__hash__()\n\n def __hash__(self) -> int:\n if self._hash is not None:\n return self._hash\n self._hash = hash(\n (\n self._color,\n self._bgcolor,\n self._attributes,\n self._set_attributes,\n self._link,\n self._meta,\n )\n )\n return self._hash\n\n @property\n def color(self) -> Optional[Color]:\n \"\"\"The foreground color or None if it is not set.\"\"\"\n return self._color\n\n @property\n def bgcolor(self) -> Optional[Color]:\n \"\"\"The background color or None if it is not set.\"\"\"\n return self._bgcolor\n\n @property\n def link(self) -> Optional[str]:\n \"\"\"Link text, if set.\"\"\"\n return self._link\n\n @property\n def transparent_background(self) -> bool:\n \"\"\"Check if the style specified a transparent background.\"\"\"\n return self.bgcolor is None or self.bgcolor.is_default\n\n @property\n def background_style(self) -> \"Style\":\n \"\"\"A Style with background only.\"\"\"\n return Style(bgcolor=self.bgcolor)\n\n @property\n def meta(self) -> Dict[str, Any]:\n \"\"\"Get meta information (can not be changed after construction).\"\"\"\n return {} if self._meta is None else cast(Dict[str, Any], loads(self._meta))\n\n @property\n def without_color(self) -> \"Style\":\n \"\"\"Get a copy of the style with color removed.\"\"\"\n if self._null:\n return NULL_STYLE\n style: Style = self.__new__(Style)\n style._ansi = None\n style._style_definition = None\n style._color = None\n style._bgcolor = None\n style._attributes = self._attributes\n style._set_attributes = self._set_attributes\n style._link = self._link\n style._link_id = f\"{randint(0, 999999)}\" if self._link else \"\"\n style._null = False\n style._meta = None\n style._hash = None\n return style\n\n @classmethod\n @lru_cache(maxsize=4096)\n def parse(cls, style_definition: str) -> \"Style\":\n \"\"\"Parse a style definition.\n\n Args:\n style_definition (str): A string containing a style.\n\n Raises:\n errors.StyleSyntaxError: If the style definition syntax is invalid.\n\n Returns:\n `Style`: A Style instance.\n \"\"\"\n if style_definition.strip() == \"none\" or not style_definition:\n return cls.null()\n\n STYLE_ATTRIBUTES = cls.STYLE_ATTRIBUTES\n color: Optional[str] = None\n bgcolor: Optional[str] = None\n attributes: Dict[str, Optional[Any]] = {}\n link: Optional[str] = None\n\n words = iter(style_definition.split())\n for original_word in words:\n word = original_word.lower()\n if word == \"on\":\n word = next(words, \"\")\n if not word:\n raise errors.StyleSyntaxError(\"color expected after 'on'\")\n try:\n Color.parse(word)\n except ColorParseError as error:\n raise errors.StyleSyntaxError(\n f\"unable to parse {word!r} as background color; {error}\"\n ) from None\n bgcolor = word\n\n elif word == \"not\":\n word = next(words, \"\")\n attribute = STYLE_ATTRIBUTES.get(word)\n if attribute is None:\n raise errors.StyleSyntaxError(\n f\"expected style attribute after 'not', found {word!r}\"\n )\n attributes[attribute] = False\n\n elif word == \"link\":\n word = next(words, \"\")\n if not word:\n raise errors.StyleSyntaxError(\"URL expected after 'link'\")\n link = word\n\n elif word in STYLE_ATTRIBUTES:\n attributes[STYLE_ATTRIBUTES[word]] = True\n\n else:\n try:\n Color.parse(word)\n except ColorParseError as error:\n raise errors.StyleSyntaxError(\n f\"unable to parse {word!r} as color; {error}\"\n ) from None\n color = word\n style = Style(color=color, bgcolor=bgcolor, link=link, **attributes)\n return style\n\n @lru_cache(maxsize=1024)\n def get_html_style(self, theme: Optional[TerminalTheme] = None) -> str:\n \"\"\"Get a CSS style rule.\"\"\"\n theme = theme or DEFAULT_TERMINAL_THEME\n css: List[str] = []\n append = css.append\n\n color = self.color\n bgcolor = self.bgcolor\n if self.reverse:\n color, bgcolor = bgcolor, color\n if self.dim:\n foreground_color = (\n theme.foreground_color if color is None else color.get_truecolor(theme)\n )\n color = Color.from_triplet(\n blend_rgb(foreground_color, theme.background_color, 0.5)\n )\n if color is not None:\n theme_color = color.get_truecolor(theme)\n append(f\"color: {theme_color.hex}\")\n append(f\"text-decoration-color: {theme_color.hex}\")\n if bgcolor is not None:\n theme_color = bgcolor.get_truecolor(theme, foreground=False)\n append(f\"background-color: {theme_color.hex}\")\n if self.bold:\n append(\"font-weight: bold\")\n if self.italic:\n append(\"font-style: italic\")\n if self.underline:\n append(\"text-decoration: underline\")\n if self.strike:\n append(\"text-decoration: line-through\")\n if self.overline:\n append(\"text-decoration: overline\")\n return \"; \".join(css)\n\n @classmethod\n def combine(cls, styles: Iterable[\"Style\"]) -> \"Style\":\n \"\"\"Combine styles and get result.\n\n Args:\n styles (Iterable[Style]): Styles to combine.\n\n Returns:\n Style: A new style instance.\n \"\"\"\n iter_styles = iter(styles)\n return sum(iter_styles, next(iter_styles))\n\n @classmethod\n def chain(cls, *styles: \"Style\") -> \"Style\":\n \"\"\"Combine styles from positional argument in to a single style.\n\n Args:\n *styles (Iterable[Style]): Styles to combine.\n\n Returns:\n Style: A new style instance.\n \"\"\"\n iter_styles = iter(styles)\n return sum(iter_styles, next(iter_styles))\n\n def copy(self) -> \"Style\":\n \"\"\"Get a copy of this style.\n\n Returns:\n Style: A new Style instance with identical attributes.\n \"\"\"\n if self._null:\n return NULL_STYLE\n style: Style = self.__new__(Style)\n style._ansi = self._ansi\n style._style_definition = self._style_definition\n style._color = self._color\n style._bgcolor = self._bgcolor\n style._attributes = self._attributes\n style._set_attributes = self._set_attributes\n style._link = self._link\n style._link_id = f\"{randint(0, 999999)}\" if self._link else \"\"\n style._hash = self._hash\n style._null = False\n style._meta = self._meta\n return style\n\n @lru_cache(maxsize=128)\n def clear_meta_and_links(self) -> \"Style\":\n \"\"\"Get a copy of this style with link and meta information removed.\n\n Returns:\n Style: New style object.\n \"\"\"\n if self._null:\n return NULL_STYLE\n style: Style = self.__new__(Style)\n style._ansi = self._ansi\n style._style_definition = self._style_definition\n style._color = self._color\n style._bgcolor = self._bgcolor\n style._attributes = self._attributes\n style._set_attributes = self._set_attributes\n style._link = None\n style._link_id = \"\"\n style._hash = None\n style._null = False\n style._meta = None\n return style\n\n def update_link(self, link: Optional[str] = None) -> \"Style\":\n \"\"\"Get a copy with a different value for link.\n\n Args:\n link (str, optional): New value for link. Defaults to None.\n\n Returns:\n Style: A new Style instance.\n \"\"\"\n style: Style = self.__new__(Style)\n style._ansi = self._ansi\n style._style_definition = self._style_definition\n style._color = self._color\n style._bgcolor = self._bgcolor\n style._attributes = self._attributes\n style._set_attributes = self._set_attributes\n style._link = link\n style._link_id = f\"{randint(0, 999999)}\" if link else \"\"\n style._hash = None\n style._null = False\n style._meta = self._meta\n return style\n\n def render(\n self,\n text: str = \"\",\n *,\n color_system: Optional[ColorSystem] = ColorSystem.TRUECOLOR,\n legacy_windows: bool = False,\n ) -> str:\n \"\"\"Render the ANSI codes for the style.\n\n Args:\n text (str, optional): A string to style. Defaults to \"\".\n color_system (Optional[ColorSystem], optional): Color system to render to. Defaults to ColorSystem.TRUECOLOR.\n\n Returns:\n str: A string containing ANSI style codes.\n \"\"\"\n if not text or color_system is None:\n return text\n attrs = self._ansi or self._make_ansi_codes(color_system)\n rendered = f\"\\x1b[{attrs}m{text}\\x1b[0m\" if attrs else text\n if self._link and not legacy_windows:\n rendered = (\n f\"\\x1b]8;id={self._link_id};{self._link}\\x1b\\\\{rendered}\\x1b]8;;\\x1b\\\\\"\n )\n return rendered\n\n def test(self, text: Optional[str] = None) -> None:\n \"\"\"Write text with style directly to terminal.\n\n This method is for testing purposes only.\n\n Args:\n text (Optional[str], optional): Text to style or None for style name.\n\n \"\"\"\n text = text or str(self)\n sys.stdout.write(f\"{self.render(text)}\\n\")\n\n @lru_cache(maxsize=1024)\n def _add(self, style: Optional[\"Style\"]) -> \"Style\":\n if style is None or style._null:\n return self\n if self._null:\n return style\n new_style: Style = self.__new__(Style)\n new_style._ansi = None\n new_style._style_definition = None\n new_style._color = style._color or self._color\n new_style._bgcolor = style._bgcolor or self._bgcolor\n new_style._attributes = (self._attributes & ~style._set_attributes) | (\n style._attributes & style._set_attributes\n )\n new_style._set_attributes = self._set_attributes | style._set_attributes\n new_style._link = style._link or self._link\n new_style._link_id = style._link_id or self._link_id\n new_style._null = style._null\n if self._meta and style._meta:\n new_style._meta = dumps({**self.meta, **style.meta})\n else:\n new_style._meta = self._meta or style._meta\n new_style._hash = None\n return new_style\n\n def __add__(self, style: Optional[\"Style\"]) -> \"Style\":\n combined_style = self._add(style)\n return combined_style.copy() if combined_style.link else combined_style\n\n\nNULL_STYLE = Style()\n\n\nclass StyleStack:\n \"\"\"A stack of styles.\"\"\"\n\n __slots__ = [\"_stack\"]\n\n def __init__(self, default_style: \"Style\") -> None:\n self._stack: List[Style] = [default_style]\n\n def __repr__(self) -> str:\n return f\"\"\n\n @property\n def current(self) -> Style:\n \"\"\"Get the Style at the top of the stack.\"\"\"\n return self._stack[-1]\n\n def push(self, style: Style) -> None:\n \"\"\"Push a new style on to the stack.\n\n Args:\n style (Style): New style to combine with current style.\n \"\"\"\n self._stack.append(self._stack[-1] + style)\n\n def pop(self) -> Style:\n \"\"\"Pop last style and discard.\n\n Returns:\n Style: New current style (also available as stack.current)\n \"\"\"\n self._stack.pop()\n return self._stack[-1]\n",[],[216,809,810,811,890,891,1058,1084],"0af13758-67fc-11f0-9ad5-0224a6c84d84","screen.py","0af1383e-67fc-11f0-9ad5-0224a6c84d84",399,["D",1753299266062],"from typing import Optional, TYPE_CHECKING\n\nfrom .segment import Segment\nfrom .style import StyleType\nfrom ._loop import loop_last\n\n\nif TYPE_CHECKING:\n from .console import (\n Console,\n ConsoleOptions,\n RenderResult,\n RenderableType,\n Group,\n )\n\n\nclass Screen:\n \"\"\"A renderable that fills the terminal screen and crops excess.\n\n Args:\n renderable (RenderableType): Child renderable.\n style (StyleType, optional): Optional background style. Defaults to None.\n \"\"\"\n\n renderable: \"RenderableType\"\n\n def __init__(\n self,\n *renderables: \"RenderableType\",\n style: Optional[StyleType] = None,\n application_mode: bool = False,\n ) -> None:\n from pip._vendor.rich.console import Group\n\n self.renderable = Group(*renderables)\n self.style = style\n self.application_mode = application_mode\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n width, height = options.size\n style = console.get_style(self.style) if self.style else None\n render_options = options.update(width=width, height=height)\n lines = console.render_lines(\n self.renderable or \"\", render_options, style=style, pad=True\n )\n lines = Segment.set_shape(lines, width, height, style=style)\n new_line = Segment(\"\\n\\r\") if self.application_mode else Segment.line()\n for last, line in loop_last(lines):\n yield from line\n if not last:\n yield new_line\n",[],[216,809,810,811,890,891,1058,1092],"0b6e2c54-67fc-11f0-a319-0224a6c84d84","region.py","0b6e2d12-67fc-11f0-a319-0224a6c84d84",419,["D",1753299266946],"from typing import NamedTuple\n\n\nclass Region(NamedTuple):\n \"\"\"Defines a rectangular region of the screen.\"\"\"\n\n x: int\n y: int\n width: int\n height: int\n",[],[216,809,810,811,890,891,1058,1100],"0b69e7ca-67fc-11f0-aad3-0224a6c84d84","protocol.py","0b69e96e-67fc-11f0-aad3-0224a6c84d84",418,["D",1753299266933],"from typing import Any, cast, Set, TYPE_CHECKING\nfrom inspect import isclass\n\nif TYPE_CHECKING:\n from pip._vendor.rich.console import RenderableType\n\n_GIBBERISH = \"\"\"aihwerij235234ljsdnp34ksodfipwoe234234jlskjdf\"\"\"\n\n\ndef is_renderable(check_object: Any) -> bool:\n \"\"\"Check if an object may be rendered by Rich.\"\"\"\n return (\n isinstance(check_object, str)\n or hasattr(check_object, \"__rich__\")\n or hasattr(check_object, \"__rich_console__\")\n )\n\n\ndef rich_cast(renderable: object) -> \"RenderableType\":\n \"\"\"Cast an object to a renderable by calling __rich__ if present.\n\n Args:\n renderable (object): A potentially renderable object\n\n Returns:\n object: The result of recursively calling __rich__.\n \"\"\"\n from pip._vendor.rich.console import RenderableType\n\n rich_visited_set: Set[type] = set() # Prevent potential infinite loop\n while hasattr(renderable, \"__rich__\") and not isclass(renderable):\n # Detect object which claim to have all the attributes\n if hasattr(renderable, _GIBBERISH):\n return repr(renderable)\n cast_method = getattr(renderable, \"__rich__\")\n renderable = cast_method()\n renderable_type = type(renderable)\n if renderable_type in rich_visited_set:\n break\n rich_visited_set.add(renderable_type)\n\n return cast(RenderableType, renderable)\n",[],[216,809,810,811,890,891,1058,1108],"0aff1850-67fc-11f0-9b65-0224a6c84d84","measure.py","0aff1a4e-67fc-11f0-9b65-0224a6c84d84",401,["D",1753299266141],"from operator import itemgetter\nfrom typing import TYPE_CHECKING, Callable, NamedTuple, Optional, Sequence\n\nfrom . import errors\nfrom .protocol import is_renderable, rich_cast\n\nif TYPE_CHECKING:\n from .console import Console, ConsoleOptions, RenderableType\n\n\nclass Measurement(NamedTuple):\n \"\"\"Stores the minimum and maximum widths (in characters) required to render an object.\"\"\"\n\n minimum: int\n \"\"\"Minimum number of cells required to render.\"\"\"\n maximum: int\n \"\"\"Maximum number of cells required to render.\"\"\"\n\n @property\n def span(self) -> int:\n \"\"\"Get difference between maximum and minimum.\"\"\"\n return self.maximum - self.minimum\n\n def normalize(self) -> \"Measurement\":\n \"\"\"Get measurement that ensures that minimum <= maximum and minimum >= 0\n\n Returns:\n Measurement: A normalized measurement.\n \"\"\"\n minimum, maximum = self\n minimum = min(max(0, minimum), maximum)\n return Measurement(max(0, minimum), max(0, max(minimum, maximum)))\n\n def with_maximum(self, width: int) -> \"Measurement\":\n \"\"\"Get a RenderableWith where the widths are <= width.\n\n Args:\n width (int): Maximum desired width.\n\n Returns:\n Measurement: New Measurement object.\n \"\"\"\n minimum, maximum = self\n return Measurement(min(minimum, width), min(maximum, width))\n\n def with_minimum(self, width: int) -> \"Measurement\":\n \"\"\"Get a RenderableWith where the widths are >= width.\n\n Args:\n width (int): Minimum desired width.\n\n Returns:\n Measurement: New Measurement object.\n \"\"\"\n minimum, maximum = self\n width = max(0, width)\n return Measurement(max(minimum, width), max(maximum, width))\n\n def clamp(\n self, min_width: Optional[int] = None, max_width: Optional[int] = None\n ) -> \"Measurement\":\n \"\"\"Clamp a measurement within the specified range.\n\n Args:\n min_width (int): Minimum desired width, or ``None`` for no minimum. Defaults to None.\n max_width (int): Maximum desired width, or ``None`` for no maximum. Defaults to None.\n\n Returns:\n Measurement: New Measurement object.\n \"\"\"\n measurement = self\n if min_width is not None:\n measurement = measurement.with_minimum(min_width)\n if max_width is not None:\n measurement = measurement.with_maximum(max_width)\n return measurement\n\n @classmethod\n def get(\n cls, console: \"Console\", options: \"ConsoleOptions\", renderable: \"RenderableType\"\n ) -> \"Measurement\":\n \"\"\"Get a measurement for a renderable.\n\n Args:\n console (~rich.console.Console): Console instance.\n options (~rich.console.ConsoleOptions): Console options.\n renderable (RenderableType): An object that may be rendered with Rich.\n\n Raises:\n errors.NotRenderableError: If the object is not renderable.\n\n Returns:\n Measurement: Measurement object containing range of character widths required to render the object.\n \"\"\"\n _max_width = options.max_width\n if _max_width < 1:\n return Measurement(0, 0)\n if isinstance(renderable, str):\n renderable = console.render_str(\n renderable, markup=options.markup, highlight=False\n )\n renderable = rich_cast(renderable)\n if is_renderable(renderable):\n get_console_width: Optional[\n Callable[[\"Console\", \"ConsoleOptions\"], \"Measurement\"]\n ] = getattr(renderable, \"__rich_measure__\", None)\n if get_console_width is not None:\n render_width = (\n get_console_width(console, options)\n .normalize()\n .with_maximum(_max_width)\n )\n if render_width.maximum < 1:\n return Measurement(0, 0)\n return render_width.normalize()\n else:\n return Measurement(0, _max_width)\n else:\n raise errors.NotRenderableError(\n f\"Unable to get render width for {renderable!r}; \"\n \"a str, Segment, or object with __rich_console__ method is required\"\n )\n\n\ndef measure_renderables(\n console: \"Console\",\n options: \"ConsoleOptions\",\n renderables: Sequence[\"RenderableType\"],\n) -> \"Measurement\":\n \"\"\"Get a measurement that would fit a number of renderables.\n\n Args:\n console (~rich.console.Console): Console instance.\n options (~rich.console.ConsoleOptions): Console options.\n renderables (Iterable[RenderableType]): One or more renderable objects.\n\n Returns:\n Measurement: Measurement object containing range of character widths required to\n contain all given renderables.\n \"\"\"\n if not renderables:\n return Measurement(0, 0)\n get_measurement = Measurement.get\n measurements = [\n get_measurement(console, options, renderable) for renderable in renderables\n ]\n measured_width = Measurement(\n max(measurements, key=itemgetter(0)).minimum,\n max(measurements, key=itemgetter(1)).maximum,\n )\n return measured_width\n",[],[216,809,810,811,890,891,1058,1116],"0aeac36e-67fc-11f0-9f6f-0224a6c84d84","logging.py","0aeac422-67fc-11f0-9f6f-0224a6c84d84",398,["D",1753299266083],"import logging\nfrom datetime import datetime\nfrom logging import Handler, LogRecord\nfrom pathlib import Path\nfrom types import ModuleType\nfrom typing import ClassVar, Iterable, List, Optional, Type, Union\n\nfrom pip._vendor.rich._null_file import NullFile\n\nfrom . import get_console\nfrom ._log_render import FormatTimeCallable, LogRender\nfrom .console import Console, ConsoleRenderable\nfrom .highlighter import Highlighter, ReprHighlighter\nfrom .text import Text\nfrom .traceback import Traceback\n\n\nclass RichHandler(Handler):\n \"\"\"A logging handler that renders output with Rich. The time / level / message and file are displayed in columns.\n The level is color coded, and the message is syntax highlighted.\n\n Note:\n Be careful when enabling console markup in log messages if you have configured logging for libraries not\n under your control. If a dependency writes messages containing square brackets, it may not produce the intended output.\n\n Args:\n level (Union[int, str], optional): Log level. Defaults to logging.NOTSET.\n console (:class:`~rich.console.Console`, optional): Optional console instance to write logs.\n Default will use a global console instance writing to stdout.\n show_time (bool, optional): Show a column for the time. Defaults to True.\n omit_repeated_times (bool, optional): Omit repetition of the same time. Defaults to True.\n show_level (bool, optional): Show a column for the level. Defaults to True.\n show_path (bool, optional): Show the path to the original log call. Defaults to True.\n enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True.\n highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None.\n markup (bool, optional): Enable console markup in log messages. Defaults to False.\n rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False.\n tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None.\n tracebacks_code_width (int, optional): Number of code characters used to render tracebacks, or None for full width. Defaults to 88.\n tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None.\n tracebacks_theme (str, optional): Override pygments theme used in traceback.\n tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True.\n tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False.\n tracebacks_suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.\n tracebacks_max_frames (int, optional): Optional maximum number of frames returned by traceback.\n locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.\n Defaults to 10.\n locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.\n log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to \"[%x %X] \".\n keywords (List[str], optional): List of words to highlight instead of ``RichHandler.KEYWORDS``.\n \"\"\"\n\n KEYWORDS: ClassVar[Optional[List[str]]] = [\n \"GET\",\n \"POST\",\n \"HEAD\",\n \"PUT\",\n \"DELETE\",\n \"OPTIONS\",\n \"TRACE\",\n \"PATCH\",\n ]\n HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter\n\n def __init__(\n self,\n level: Union[int, str] = logging.NOTSET,\n console: Optional[Console] = None,\n *,\n show_time: bool = True,\n omit_repeated_times: bool = True,\n show_level: bool = True,\n show_path: bool = True,\n enable_link_path: bool = True,\n highlighter: Optional[Highlighter] = None,\n markup: bool = False,\n rich_tracebacks: bool = False,\n tracebacks_width: Optional[int] = None,\n tracebacks_code_width: int = 88,\n tracebacks_extra_lines: int = 3,\n tracebacks_theme: Optional[str] = None,\n tracebacks_word_wrap: bool = True,\n tracebacks_show_locals: bool = False,\n tracebacks_suppress: Iterable[Union[str, ModuleType]] = (),\n tracebacks_max_frames: int = 100,\n locals_max_length: int = 10,\n locals_max_string: int = 80,\n log_time_format: Union[str, FormatTimeCallable] = \"[%x %X]\",\n keywords: Optional[List[str]] = None,\n ) -> None:\n super().__init__(level=level)\n self.console = console or get_console()\n self.highlighter = highlighter or self.HIGHLIGHTER_CLASS()\n self._log_render = LogRender(\n show_time=show_time,\n show_level=show_level,\n show_path=show_path,\n time_format=log_time_format,\n omit_repeated_times=omit_repeated_times,\n level_width=None,\n )\n self.enable_link_path = enable_link_path\n self.markup = markup\n self.rich_tracebacks = rich_tracebacks\n self.tracebacks_width = tracebacks_width\n self.tracebacks_extra_lines = tracebacks_extra_lines\n self.tracebacks_theme = tracebacks_theme\n self.tracebacks_word_wrap = tracebacks_word_wrap\n self.tracebacks_show_locals = tracebacks_show_locals\n self.tracebacks_suppress = tracebacks_suppress\n self.tracebacks_max_frames = tracebacks_max_frames\n self.tracebacks_code_width = tracebacks_code_width\n self.locals_max_length = locals_max_length\n self.locals_max_string = locals_max_string\n self.keywords = keywords\n\n def get_level_text(self, record: LogRecord) -> Text:\n \"\"\"Get the level name from the record.\n\n Args:\n record (LogRecord): LogRecord instance.\n\n Returns:\n Text: A tuple of the style and level name.\n \"\"\"\n level_name = record.levelname\n level_text = Text.styled(\n level_name.ljust(8), f\"logging.level.{level_name.lower()}\"\n )\n return level_text\n\n def emit(self, record: LogRecord) -> None:\n \"\"\"Invoked by logging.\"\"\"\n message = self.format(record)\n traceback = None\n if (\n self.rich_tracebacks\n and record.exc_info\n and record.exc_info != (None, None, None)\n ):\n exc_type, exc_value, exc_traceback = record.exc_info\n assert exc_type is not None\n assert exc_value is not None\n traceback = Traceback.from_exception(\n exc_type,\n exc_value,\n exc_traceback,\n width=self.tracebacks_width,\n code_width=self.tracebacks_code_width,\n extra_lines=self.tracebacks_extra_lines,\n theme=self.tracebacks_theme,\n word_wrap=self.tracebacks_word_wrap,\n show_locals=self.tracebacks_show_locals,\n locals_max_length=self.locals_max_length,\n locals_max_string=self.locals_max_string,\n suppress=self.tracebacks_suppress,\n max_frames=self.tracebacks_max_frames,\n )\n message = record.getMessage()\n if self.formatter:\n record.message = record.getMessage()\n formatter = self.formatter\n if hasattr(formatter, \"usesTime\") and formatter.usesTime():\n record.asctime = formatter.formatTime(record, formatter.datefmt)\n message = formatter.formatMessage(record)\n\n message_renderable = self.render_message(record, message)\n log_renderable = self.render(\n record=record, traceback=traceback, message_renderable=message_renderable\n )\n if isinstance(self.console.file, NullFile):\n # Handles pythonw, where stdout/stderr are null, and we return NullFile\n # instance from Console.file. In this case, we still want to make a log record\n # even though we won't be writing anything to a file.\n self.handleError(record)\n else:\n try:\n self.console.print(log_renderable)\n except Exception:\n self.handleError(record)\n\n def render_message(self, record: LogRecord, message: str) -> \"ConsoleRenderable\":\n \"\"\"Render message text in to Text.\n\n Args:\n record (LogRecord): logging Record.\n message (str): String containing log message.\n\n Returns:\n ConsoleRenderable: Renderable to display log message.\n \"\"\"\n use_markup = getattr(record, \"markup\", self.markup)\n message_text = Text.from_markup(message) if use_markup else Text(message)\n\n highlighter = getattr(record, \"highlighter\", self.highlighter)\n if highlighter:\n message_text = highlighter(message_text)\n\n if self.keywords is None:\n self.keywords = self.KEYWORDS\n\n if self.keywords:\n message_text.highlight_words(self.keywords, \"logging.keyword\")\n\n return message_text\n\n def render(\n self,\n *,\n record: LogRecord,\n traceback: Optional[Traceback],\n message_renderable: \"ConsoleRenderable\",\n ) -> \"ConsoleRenderable\":\n \"\"\"Render log for display.\n\n Args:\n record (LogRecord): logging Record.\n traceback (Optional[Traceback]): Traceback instance or None for no Traceback.\n message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents.\n\n Returns:\n ConsoleRenderable: Renderable to display log.\n \"\"\"\n path = Path(record.pathname).name\n level = self.get_level_text(record)\n time_format = None if self.formatter is None else self.formatter.datefmt\n log_time = datetime.fromtimestamp(record.created)\n\n log_renderable = self._log_render(\n self.console,\n [message_renderable] if not traceback else [message_renderable, traceback],\n log_time=log_time,\n time_format=time_format,\n level=level,\n path=path,\n line_no=record.lineno,\n link_path=record.pathname if self.enable_link_path else None,\n )\n return log_renderable\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from time import sleep\n\n FORMAT = \"%(message)s\"\n # FORMAT = \"%(asctime)-15s - %(levelname)s - %(message)s\"\n logging.basicConfig(\n level=\"NOTSET\",\n format=FORMAT,\n datefmt=\"[%X]\",\n handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)],\n )\n log = logging.getLogger(\"rich\")\n\n log.info(\"Server starting...\")\n log.info(\"Listening on http://127.0.0.1:8080\")\n sleep(1)\n\n log.info(\"GET /index.html 200 1298\")\n log.info(\"GET /imgs/backgrounds/back1.jpg 200 54386\")\n log.info(\"GET /css/styles.css 200 54386\")\n log.warning(\"GET /favicon.ico 404 242\")\n sleep(1)\n\n log.debug(\n \"JSONRPC request\\n--> %r\\n<-- %r\",\n {\n \"version\": \"1.1\",\n \"method\": \"confirmFruitPurchase\",\n \"params\": [[\"apple\", \"orange\", \"mangoes\", \"pomelo\"], 1.123],\n \"id\": \"194521489\",\n },\n {\"version\": \"1.1\", \"result\": True, \"error\": None, \"id\": \"194521489\"},\n )\n log.debug(\n \"Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer\"\n )\n log.error(\"Unable to find 'pomelo' in database!\")\n log.info(\"POST /jsonrpc/ 200 65532\")\n log.info(\"POST /admin/ 401 42234\")\n log.warning(\"password was rejected for admin site.\")\n\n def divide() -> None:\n number = 1\n divisor = 0\n foos = [\"foo\"] * 100\n log.debug(\"in divide\")\n try:\n number / divisor\n except:\n log.exception(\"An error of some kind occurred!\")\n\n divide()\n sleep(1)\n log.critical(\"Out of memory!\")\n log.info(\"Server exited with code=-1\")\n log.info(\"[bold]EXITING...[/bold]\", extra=dict(markup=True))\n",[],[216,809,810,811,890,891,1058,1124],"0b037de6-67fc-11f0-95df-0224a6c84d84","live_render.py","0b037fe4-67fc-11f0-95df-0224a6c84d84",402,["D",1753299266249],"import sys\nfrom typing import Optional, Tuple\n\nif sys.version_info >= (3, 8):\n from typing import Literal\nelse:\n from pip._vendor.typing_extensions import Literal # pragma: no cover\n\n\nfrom ._loop import loop_last\nfrom .console import Console, ConsoleOptions, RenderableType, RenderResult\nfrom .control import Control\nfrom .segment import ControlType, Segment\nfrom .style import StyleType\nfrom .text import Text\n\nVerticalOverflowMethod = Literal[\"crop\", \"ellipsis\", \"visible\"]\n\n\nclass LiveRender:\n \"\"\"Creates a renderable that may be updated.\n\n Args:\n renderable (RenderableType): Any renderable object.\n style (StyleType, optional): An optional style to apply to the renderable. Defaults to \"\".\n \"\"\"\n\n def __init__(\n self,\n renderable: RenderableType,\n style: StyleType = \"\",\n vertical_overflow: VerticalOverflowMethod = \"ellipsis\",\n ) -> None:\n self.renderable = renderable\n self.style = style\n self.vertical_overflow = vertical_overflow\n self._shape: Optional[Tuple[int, int]] = None\n\n def set_renderable(self, renderable: RenderableType) -> None:\n \"\"\"Set a new renderable.\n\n Args:\n renderable (RenderableType): Any renderable object, including str.\n \"\"\"\n self.renderable = renderable\n\n def position_cursor(self) -> Control:\n \"\"\"Get control codes to move cursor to beginning of live render.\n\n Returns:\n Control: A control instance that may be printed.\n \"\"\"\n if self._shape is not None:\n _, height = self._shape\n return Control(\n ControlType.CARRIAGE_RETURN,\n (ControlType.ERASE_IN_LINE, 2),\n *(\n (\n (ControlType.CURSOR_UP, 1),\n (ControlType.ERASE_IN_LINE, 2),\n )\n * (height - 1)\n )\n )\n return Control()\n\n def restore_cursor(self) -> Control:\n \"\"\"Get control codes to clear the render and restore the cursor to its previous position.\n\n Returns:\n Control: A Control instance that may be printed.\n \"\"\"\n if self._shape is not None:\n _, height = self._shape\n return Control(\n ControlType.CARRIAGE_RETURN,\n *((ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2)) * height\n )\n return Control()\n\n def __rich_console__(\n self, console: Console, options: ConsoleOptions\n ) -> RenderResult:\n renderable = self.renderable\n style = console.get_style(self.style)\n lines = console.render_lines(renderable, options, style=style, pad=False)\n shape = Segment.get_shape(lines)\n\n _, height = shape\n if height > options.size.height:\n if self.vertical_overflow == \"crop\":\n lines = lines[: options.size.height]\n shape = Segment.get_shape(lines)\n elif self.vertical_overflow == \"ellipsis\":\n lines = lines[: (options.size.height - 1)]\n overflow_text = Text(\n \"...\",\n overflow=\"crop\",\n justify=\"center\",\n end=\"\",\n style=\"live.ellipsis\",\n )\n lines.append(list(console.render(overflow_text)))\n shape = Segment.get_shape(lines)\n self._shape = shape\n\n new_line = Segment.line()\n for last, line in loop_last(lines):\n yield from line\n if not last:\n yield new_line\n",[],[216,809,810,811,890,891,1058,1132],"0b4fafe0-67fc-11f0-a7d9-0224a6c84d84","layout.py","0b4fb0b2-67fc-11f0-a7d9-0224a6c84d84",414,["D",1753299266760],"from abc import ABC, abstractmethod\nfrom itertools import islice\nfrom operator import itemgetter\nfrom threading import RLock\nfrom typing import (\n TYPE_CHECKING,\n Dict,\n Iterable,\n List,\n NamedTuple,\n Optional,\n Sequence,\n Tuple,\n Union,\n)\n\nfrom ._ratio import ratio_resolve\nfrom .align import Align\nfrom .console import Console, ConsoleOptions, RenderableType, RenderResult\nfrom .highlighter import ReprHighlighter\nfrom .panel import Panel\nfrom .pretty import Pretty\nfrom .region import Region\nfrom .repr import Result, rich_repr\nfrom .segment import Segment\nfrom .style import StyleType\n\nif TYPE_CHECKING:\n from pip._vendor.rich.tree import Tree\n\n\nclass LayoutRender(NamedTuple):\n \"\"\"An individual layout render.\"\"\"\n\n region: Region\n render: List[List[Segment]]\n\n\nRegionMap = Dict[\"Layout\", Region]\nRenderMap = Dict[\"Layout\", LayoutRender]\n\n\nclass LayoutError(Exception):\n \"\"\"Layout related error.\"\"\"\n\n\nclass NoSplitter(LayoutError):\n \"\"\"Requested splitter does not exist.\"\"\"\n\n\nclass _Placeholder:\n \"\"\"An internal renderable used as a Layout placeholder.\"\"\"\n\n highlighter = ReprHighlighter()\n\n def __init__(self, layout: \"Layout\", style: StyleType = \"\") -> None:\n self.layout = layout\n self.style = style\n\n def __rich_console__(\n self, console: Console, options: ConsoleOptions\n ) -> RenderResult:\n width = options.max_width\n height = options.height or options.size.height\n layout = self.layout\n title = (\n f\"{layout.name!r} ({width} x {height})\"\n if layout.name\n else f\"({width} x {height})\"\n )\n yield Panel(\n Align.center(Pretty(layout), vertical=\"middle\"),\n style=self.style,\n title=self.highlighter(title),\n border_style=\"blue\",\n height=height,\n )\n\n\nclass Splitter(ABC):\n \"\"\"Base class for a splitter.\"\"\"\n\n name: str = \"\"\n\n @abstractmethod\n def get_tree_icon(self) -> str:\n \"\"\"Get the icon (emoji) used in layout.tree\"\"\"\n\n @abstractmethod\n def divide(\n self, children: Sequence[\"Layout\"], region: Region\n ) -> Iterable[Tuple[\"Layout\", Region]]:\n \"\"\"Divide a region amongst several child layouts.\n\n Args:\n children (Sequence(Layout)): A number of child layouts.\n region (Region): A rectangular region to divide.\n \"\"\"\n\n\nclass RowSplitter(Splitter):\n \"\"\"Split a layout region in to rows.\"\"\"\n\n name = \"row\"\n\n def get_tree_icon(self) -> str:\n return \"[layout.tree.row]⬌\"\n\n def divide(\n self, children: Sequence[\"Layout\"], region: Region\n ) -> Iterable[Tuple[\"Layout\", Region]]:\n x, y, width, height = region\n render_widths = ratio_resolve(width, children)\n offset = 0\n _Region = Region\n for child, child_width in zip(children, render_widths):\n yield child, _Region(x + offset, y, child_width, height)\n offset += child_width\n\n\nclass ColumnSplitter(Splitter):\n \"\"\"Split a layout region in to columns.\"\"\"\n\n name = \"column\"\n\n def get_tree_icon(self) -> str:\n return \"[layout.tree.column]⬍\"\n\n def divide(\n self, children: Sequence[\"Layout\"], region: Region\n ) -> Iterable[Tuple[\"Layout\", Region]]:\n x, y, width, height = region\n render_heights = ratio_resolve(height, children)\n offset = 0\n _Region = Region\n for child, child_height in zip(children, render_heights):\n yield child, _Region(x, y + offset, width, child_height)\n offset += child_height\n\n\n@rich_repr\nclass Layout:\n \"\"\"A renderable to divide a fixed height in to rows or columns.\n\n Args:\n renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None.\n name (str, optional): Optional identifier for Layout. Defaults to None.\n size (int, optional): Optional fixed size of layout. Defaults to None.\n minimum_size (int, optional): Minimum size of layout. Defaults to 1.\n ratio (int, optional): Optional ratio for flexible layout. Defaults to 1.\n visible (bool, optional): Visibility of layout. Defaults to True.\n \"\"\"\n\n splitters = {\"row\": RowSplitter, \"column\": ColumnSplitter}\n\n def __init__(\n self,\n renderable: Optional[RenderableType] = None,\n *,\n name: Optional[str] = None,\n size: Optional[int] = None,\n minimum_size: int = 1,\n ratio: int = 1,\n visible: bool = True,\n ) -> None:\n self._renderable = renderable or _Placeholder(self)\n self.size = size\n self.minimum_size = minimum_size\n self.ratio = ratio\n self.name = name\n self.visible = visible\n self.splitter: Splitter = self.splitters[\"column\"]()\n self._children: List[Layout] = []\n self._render_map: RenderMap = {}\n self._lock = RLock()\n\n def __rich_repr__(self) -> Result:\n yield \"name\", self.name, None\n yield \"size\", self.size, None\n yield \"minimum_size\", self.minimum_size, 1\n yield \"ratio\", self.ratio, 1\n\n @property\n def renderable(self) -> RenderableType:\n \"\"\"Layout renderable.\"\"\"\n return self if self._children else self._renderable\n\n @property\n def children(self) -> List[\"Layout\"]:\n \"\"\"Gets (visible) layout children.\"\"\"\n return [child for child in self._children if child.visible]\n\n @property\n def map(self) -> RenderMap:\n \"\"\"Get a map of the last render.\"\"\"\n return self._render_map\n\n def get(self, name: str) -> Optional[\"Layout\"]:\n \"\"\"Get a named layout, or None if it doesn't exist.\n\n Args:\n name (str): Name of layout.\n\n Returns:\n Optional[Layout]: Layout instance or None if no layout was found.\n \"\"\"\n if self.name == name:\n return self\n else:\n for child in self._children:\n named_layout = child.get(name)\n if named_layout is not None:\n return named_layout\n return None\n\n def __getitem__(self, name: str) -> \"Layout\":\n layout = self.get(name)\n if layout is None:\n raise KeyError(f\"No layout with name {name!r}\")\n return layout\n\n @property\n def tree(self) -> \"Tree\":\n \"\"\"Get a tree renderable to show layout structure.\"\"\"\n from pip._vendor.rich.styled import Styled\n from pip._vendor.rich.table import Table\n from pip._vendor.rich.tree import Tree\n\n def summary(layout: \"Layout\") -> Table:\n icon = layout.splitter.get_tree_icon()\n\n table = Table.grid(padding=(0, 1, 0, 0))\n\n text: RenderableType = (\n Pretty(layout) if layout.visible else Styled(Pretty(layout), \"dim\")\n )\n table.add_row(icon, text)\n _summary = table\n return _summary\n\n layout = self\n tree = Tree(\n summary(layout),\n guide_style=f\"layout.tree.{layout.splitter.name}\",\n highlight=True,\n )\n\n def recurse(tree: \"Tree\", layout: \"Layout\") -> None:\n for child in layout._children:\n recurse(\n tree.add(\n summary(child),\n guide_style=f\"layout.tree.{child.splitter.name}\",\n ),\n child,\n )\n\n recurse(tree, self)\n return tree\n\n def split(\n self,\n *layouts: Union[\"Layout\", RenderableType],\n splitter: Union[Splitter, str] = \"column\",\n ) -> None:\n \"\"\"Split the layout in to multiple sub-layouts.\n\n Args:\n *layouts (Layout): Positional arguments should be (sub) Layout instances.\n splitter (Union[Splitter, str]): Splitter instance or name of splitter.\n \"\"\"\n _layouts = [\n layout if isinstance(layout, Layout) else Layout(layout)\n for layout in layouts\n ]\n try:\n self.splitter = (\n splitter\n if isinstance(splitter, Splitter)\n else self.splitters[splitter]()\n )\n except KeyError:\n raise NoSplitter(f\"No splitter called {splitter!r}\")\n self._children[:] = _layouts\n\n def add_split(self, *layouts: Union[\"Layout\", RenderableType]) -> None:\n \"\"\"Add a new layout(s) to existing split.\n\n Args:\n *layouts (Union[Layout, RenderableType]): Positional arguments should be renderables or (sub) Layout instances.\n\n \"\"\"\n _layouts = (\n layout if isinstance(layout, Layout) else Layout(layout)\n for layout in layouts\n )\n self._children.extend(_layouts)\n\n def split_row(self, *layouts: Union[\"Layout\", RenderableType]) -> None:\n \"\"\"Split the layout in to a row (layouts side by side).\n\n Args:\n *layouts (Layout): Positional arguments should be (sub) Layout instances.\n \"\"\"\n self.split(*layouts, splitter=\"row\")\n\n def split_column(self, *layouts: Union[\"Layout\", RenderableType]) -> None:\n \"\"\"Split the layout in to a column (layouts stacked on top of each other).\n\n Args:\n *layouts (Layout): Positional arguments should be (sub) Layout instances.\n \"\"\"\n self.split(*layouts, splitter=\"column\")\n\n def unsplit(self) -> None:\n \"\"\"Reset splits to initial state.\"\"\"\n del self._children[:]\n\n def update(self, renderable: RenderableType) -> None:\n \"\"\"Update renderable.\n\n Args:\n renderable (RenderableType): New renderable object.\n \"\"\"\n with self._lock:\n self._renderable = renderable\n\n def refresh_screen(self, console: \"Console\", layout_name: str) -> None:\n \"\"\"Refresh a sub-layout.\n\n Args:\n console (Console): Console instance where Layout is to be rendered.\n layout_name (str): Name of layout.\n \"\"\"\n with self._lock:\n layout = self[layout_name]\n region, _lines = self._render_map[layout]\n (x, y, width, height) = region\n lines = console.render_lines(\n layout, console.options.update_dimensions(width, height)\n )\n self._render_map[layout] = LayoutRender(region, lines)\n console.update_screen_lines(lines, x, y)\n\n def _make_region_map(self, width: int, height: int) -> RegionMap:\n \"\"\"Create a dict that maps layout on to Region.\"\"\"\n stack: List[Tuple[Layout, Region]] = [(self, Region(0, 0, width, height))]\n push = stack.append\n pop = stack.pop\n layout_regions: List[Tuple[Layout, Region]] = []\n append_layout_region = layout_regions.append\n while stack:\n append_layout_region(pop())\n layout, region = layout_regions[-1]\n children = layout.children\n if children:\n for child_and_region in layout.splitter.divide(children, region):\n push(child_and_region)\n\n region_map = {\n layout: region\n for layout, region in sorted(layout_regions, key=itemgetter(1))\n }\n return region_map\n\n def render(self, console: Console, options: ConsoleOptions) -> RenderMap:\n \"\"\"Render the sub_layouts.\n\n Args:\n console (Console): Console instance.\n options (ConsoleOptions): Console options.\n\n Returns:\n RenderMap: A dict that maps Layout on to a tuple of Region, lines\n \"\"\"\n render_width = options.max_width\n render_height = options.height or console.height\n region_map = self._make_region_map(render_width, render_height)\n layout_regions = [\n (layout, region)\n for layout, region in region_map.items()\n if not layout.children\n ]\n render_map: Dict[\"Layout\", \"LayoutRender\"] = {}\n render_lines = console.render_lines\n update_dimensions = options.update_dimensions\n\n for layout, region in layout_regions:\n lines = render_lines(\n layout.renderable, update_dimensions(region.width, region.height)\n )\n render_map[layout] = LayoutRender(region, lines)\n return render_map\n\n def __rich_console__(\n self, console: Console, options: ConsoleOptions\n ) -> RenderResult:\n with self._lock:\n width = options.max_width or console.width\n height = options.height or console.height\n render_map = self.render(console, options.update_dimensions(width, height))\n self._render_map = render_map\n layout_lines: List[List[Segment]] = [[] for _ in range(height)]\n _islice = islice\n for region, lines in render_map.values():\n _x, y, _layout_width, layout_height = region\n for row, line in zip(\n _islice(layout_lines, y, y + layout_height), lines\n ):\n row.extend(line)\n\n new_line = Segment.line()\n for layout_row in layout_lines:\n yield from layout_row\n yield new_line\n\n\nif __name__ == \"__main__\":\n from pip._vendor.rich.console import Console\n\n console = Console()\n layout = Layout()\n\n layout.split_column(\n Layout(name=\"header\", size=3),\n Layout(ratio=1, name=\"main\"),\n Layout(size=10, name=\"footer\"),\n )\n\n layout[\"main\"].split_row(Layout(name=\"side\"), Layout(name=\"body\", ratio=2))\n\n layout[\"body\"].split_row(Layout(name=\"content\", ratio=2), Layout(name=\"s2\"))\n\n layout[\"s2\"].split_column(\n Layout(name=\"top\"), Layout(name=\"middle\"), Layout(name=\"bottom\")\n )\n\n layout[\"side\"].split_column(Layout(layout.tree, name=\"left1\"), Layout(name=\"left2\"))\n\n layout[\"content\"].update(\"foo\")\n\n console.print(layout)\n",[],[216,809,810,811,890,891,1058,1140],"0b484d9a-67fc-11f0-bcbe-0224a6c84d84","emoji.py","0b484e3a-67fc-11f0-bcbe-0224a6c84d84",413,["D",1753299266698],"import sys\nfrom typing import TYPE_CHECKING, Optional, Union\n\nfrom .jupyter import JupyterMixin\nfrom .segment import Segment\nfrom .style import Style\nfrom ._emoji_codes import EMOJI\nfrom ._emoji_replace import _emoji_replace\n\nif sys.version_info >= (3, 8):\n from typing import Literal\nelse:\n from pip._vendor.typing_extensions import Literal # pragma: no cover\n\n\nif TYPE_CHECKING:\n from .console import Console, ConsoleOptions, RenderResult\n\n\nEmojiVariant = Literal[\"emoji\", \"text\"]\n\n\nclass NoEmoji(Exception):\n \"\"\"No emoji by that name.\"\"\"\n\n\nclass Emoji(JupyterMixin):\n __slots__ = [\"name\", \"style\", \"_char\", \"variant\"]\n\n VARIANTS = {\"text\": \"\\uFE0E\", \"emoji\": \"\\uFE0F\"}\n\n def __init__(\n self,\n name: str,\n style: Union[str, Style] = \"none\",\n variant: Optional[EmojiVariant] = None,\n ) -> None:\n \"\"\"A single emoji character.\n\n Args:\n name (str): Name of emoji.\n style (Union[str, Style], optional): Optional style. Defaults to None.\n\n Raises:\n NoEmoji: If the emoji doesn't exist.\n \"\"\"\n self.name = name\n self.style = style\n self.variant = variant\n try:\n self._char = EMOJI[name]\n except KeyError:\n raise NoEmoji(f\"No emoji called {name!r}\")\n if variant is not None:\n self._char += self.VARIANTS.get(variant, \"\")\n\n @classmethod\n def replace(cls, text: str) -> str:\n \"\"\"Replace emoji markup with corresponding unicode characters.\n\n Args:\n text (str): A string with emojis codes, e.g. \"Hello :smiley:!\"\n\n Returns:\n str: A string with emoji codes replaces with actual emoji.\n \"\"\"\n return _emoji_replace(text)\n\n def __repr__(self) -> str:\n return f\"\"\n\n def __str__(self) -> str:\n return self._char\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n yield Segment(self._char, console.get_style(self.style))\n\n\nif __name__ == \"__main__\": # pragma: no cover\n import sys\n\n from pip._vendor.rich.columns import Columns\n from pip._vendor.rich.console import Console\n\n console = Console(record=True)\n\n columns = Columns(\n (f\":{name}: {name}\" for name in sorted(EMOJI.keys()) if \"\\u200D\" not in name),\n column_first=True,\n )\n\n console.print(columns)\n if len(sys.argv) > 1:\n console.save_html(sys.argv[1])\n",[],[216,809,810,811,890,891,1058,1148],"0b349e26-67fc-11f0-aedf-0224a6c84d84","default_styles.py","0b349eee-67fc-11f0-aedf-0224a6c84d84",409,["D",1753299266584],"from typing import Dict\n\nfrom .style import Style\n\nDEFAULT_STYLES: Dict[str, Style] = {\n \"none\": Style.null(),\n \"reset\": Style(\n color=\"default\",\n bgcolor=\"default\",\n dim=False,\n bold=False,\n italic=False,\n underline=False,\n blink=False,\n blink2=False,\n reverse=False,\n conceal=False,\n strike=False,\n ),\n \"dim\": Style(dim=True),\n \"bright\": Style(dim=False),\n \"bold\": Style(bold=True),\n \"strong\": Style(bold=True),\n \"code\": Style(reverse=True, bold=True),\n \"italic\": Style(italic=True),\n \"emphasize\": Style(italic=True),\n \"underline\": Style(underline=True),\n \"blink\": Style(blink=True),\n \"blink2\": Style(blink2=True),\n \"reverse\": Style(reverse=True),\n \"strike\": Style(strike=True),\n \"black\": Style(color=\"black\"),\n \"red\": Style(color=\"red\"),\n \"green\": Style(color=\"green\"),\n \"yellow\": Style(color=\"yellow\"),\n \"magenta\": Style(color=\"magenta\"),\n \"cyan\": Style(color=\"cyan\"),\n \"white\": Style(color=\"white\"),\n \"inspect.attr\": Style(color=\"yellow\", italic=True),\n \"inspect.attr.dunder\": Style(color=\"yellow\", italic=True, dim=True),\n \"inspect.callable\": Style(bold=True, color=\"red\"),\n \"inspect.async_def\": Style(italic=True, color=\"bright_cyan\"),\n \"inspect.def\": Style(italic=True, color=\"bright_cyan\"),\n \"inspect.class\": Style(italic=True, color=\"bright_cyan\"),\n \"inspect.error\": Style(bold=True, color=\"red\"),\n \"inspect.equals\": Style(),\n \"inspect.help\": Style(color=\"cyan\"),\n \"inspect.doc\": Style(dim=True),\n \"inspect.value.border\": Style(color=\"green\"),\n \"live.ellipsis\": Style(bold=True, color=\"red\"),\n \"layout.tree.row\": Style(dim=False, color=\"red\"),\n \"layout.tree.column\": Style(dim=False, color=\"blue\"),\n \"logging.keyword\": Style(bold=True, color=\"yellow\"),\n \"logging.level.notset\": Style(dim=True),\n \"logging.level.debug\": Style(color=\"green\"),\n \"logging.level.info\": Style(color=\"blue\"),\n \"logging.level.warning\": Style(color=\"yellow\"),\n \"logging.level.error\": Style(color=\"red\", bold=True),\n \"logging.level.critical\": Style(color=\"red\", bold=True, reverse=True),\n \"log.level\": Style.null(),\n \"log.time\": Style(color=\"cyan\", dim=True),\n \"log.message\": Style.null(),\n \"log.path\": Style(dim=True),\n \"repr.ellipsis\": Style(color=\"yellow\"),\n \"repr.indent\": Style(color=\"green\", dim=True),\n \"repr.error\": Style(color=\"red\", bold=True),\n \"repr.str\": Style(color=\"green\", italic=False, bold=False),\n \"repr.brace\": Style(bold=True),\n \"repr.comma\": Style(bold=True),\n \"repr.ipv4\": Style(bold=True, color=\"bright_green\"),\n \"repr.ipv6\": Style(bold=True, color=\"bright_green\"),\n \"repr.eui48\": Style(bold=True, color=\"bright_green\"),\n \"repr.eui64\": Style(bold=True, color=\"bright_green\"),\n \"repr.tag_start\": Style(bold=True),\n \"repr.tag_name\": Style(color=\"bright_magenta\", bold=True),\n \"repr.tag_contents\": Style(color=\"default\"),\n \"repr.tag_end\": Style(bold=True),\n \"repr.attrib_name\": Style(color=\"yellow\", italic=False),\n \"repr.attrib_equal\": Style(bold=True),\n \"repr.attrib_value\": Style(color=\"magenta\", italic=False),\n \"repr.number\": Style(color=\"cyan\", bold=True, italic=False),\n \"repr.number_complex\": Style(color=\"cyan\", bold=True, italic=False), # same\n \"repr.bool_true\": Style(color=\"bright_green\", italic=True),\n \"repr.bool_false\": Style(color=\"bright_red\", italic=True),\n \"repr.none\": Style(color=\"magenta\", italic=True),\n \"repr.url\": Style(underline=True, color=\"bright_blue\", italic=False, bold=False),\n \"repr.uuid\": Style(color=\"bright_yellow\", bold=False),\n \"repr.call\": Style(color=\"magenta\", bold=True),\n \"repr.path\": Style(color=\"magenta\"),\n \"repr.filename\": Style(color=\"bright_magenta\"),\n \"rule.line\": Style(color=\"bright_green\"),\n \"rule.text\": Style.null(),\n \"json.brace\": Style(bold=True),\n \"json.bool_true\": Style(color=\"bright_green\", italic=True),\n \"json.bool_false\": Style(color=\"bright_red\", italic=True),\n \"json.null\": Style(color=\"magenta\", italic=True),\n \"json.number\": Style(color=\"cyan\", bold=True, italic=False),\n \"json.str\": Style(color=\"green\", italic=False, bold=False),\n \"json.key\": Style(color=\"blue\", bold=True),\n \"prompt\": Style.null(),\n \"prompt.choices\": Style(color=\"magenta\", bold=True),\n \"prompt.default\": Style(color=\"cyan\", bold=True),\n \"prompt.invalid\": Style(color=\"red\"),\n \"prompt.invalid.choice\": Style(color=\"red\"),\n \"pretty\": Style.null(),\n \"scope.border\": Style(color=\"blue\"),\n \"scope.key\": Style(color=\"yellow\", italic=True),\n \"scope.key.special\": Style(color=\"yellow\", italic=True, dim=True),\n \"scope.equals\": Style(color=\"red\"),\n \"table.header\": Style(bold=True),\n \"table.footer\": Style(bold=True),\n \"table.cell\": Style.null(),\n \"table.title\": Style(italic=True),\n \"table.caption\": Style(italic=True, dim=True),\n \"traceback.error\": Style(color=\"red\", italic=True),\n \"traceback.border.syntax_error\": Style(color=\"bright_red\"),\n \"traceback.border\": Style(color=\"red\"),\n \"traceback.text\": Style.null(),\n \"traceback.title\": Style(color=\"red\", bold=True),\n \"traceback.exc_type\": Style(color=\"bright_red\", bold=True),\n \"traceback.exc_value\": Style.null(),\n \"traceback.offset\": Style(color=\"bright_red\", bold=True),\n \"traceback.error_range\": Style(underline=True, bold=True),\n \"traceback.note\": Style(color=\"green\", bold=True),\n \"traceback.group.border\": Style(color=\"magenta\"),\n \"bar.back\": Style(color=\"grey23\"),\n \"bar.complete\": Style(color=\"rgb(249,38,114)\"),\n \"bar.finished\": Style(color=\"rgb(114,156,31)\"),\n \"bar.pulse\": Style(color=\"rgb(249,38,114)\"),\n \"progress.description\": Style.null(),\n \"progress.filesize\": Style(color=\"green\"),\n \"progress.filesize.total\": Style(color=\"green\"),\n \"progress.download\": Style(color=\"green\"),\n \"progress.elapsed\": Style(color=\"yellow\"),\n \"progress.percentage\": Style(color=\"magenta\"),\n \"progress.remaining\": Style(color=\"cyan\"),\n \"progress.data.speed\": Style(color=\"red\"),\n \"progress.spinner\": Style(color=\"green\"),\n \"status.spinner\": Style(color=\"green\"),\n \"tree\": Style(),\n \"tree.line\": Style(),\n \"markdown.paragraph\": Style(),\n \"markdown.text\": Style(),\n \"markdown.em\": Style(italic=True),\n \"markdown.emph\": Style(italic=True), # For commonmark backwards compatibility\n \"markdown.strong\": Style(bold=True),\n \"markdown.code\": Style(bold=True, color=\"cyan\", bgcolor=\"black\"),\n \"markdown.code_block\": Style(color=\"cyan\", bgcolor=\"black\"),\n \"markdown.block_quote\": Style(color=\"magenta\"),\n \"markdown.list\": Style(color=\"cyan\"),\n \"markdown.item\": Style(),\n \"markdown.item.bullet\": Style(color=\"yellow\", bold=True),\n \"markdown.item.number\": Style(color=\"yellow\", bold=True),\n \"markdown.hr\": Style(color=\"yellow\"),\n \"markdown.h1.border\": Style(),\n \"markdown.h1\": Style(bold=True),\n \"markdown.h2\": Style(bold=True, underline=True),\n \"markdown.h3\": Style(bold=True),\n \"markdown.h4\": Style(bold=True, dim=True),\n \"markdown.h5\": Style(underline=True),\n \"markdown.h6\": Style(italic=True),\n \"markdown.h7\": Style(italic=True, dim=True),\n \"markdown.link\": Style(color=\"bright_blue\"),\n \"markdown.link_url\": Style(color=\"blue\", underline=True),\n \"markdown.s\": Style(strike=True),\n \"iso8601.date\": Style(color=\"blue\"),\n \"iso8601.time\": Style(color=\"magenta\"),\n \"iso8601.timezone\": Style(color=\"yellow\"),\n}\n\n\nif __name__ == \"__main__\": # pragma: no cover\n import argparse\n import io\n\n from pip._vendor.rich.console import Console\n from pip._vendor.rich.table import Table\n from pip._vendor.rich.text import Text\n\n parser = argparse.ArgumentParser()\n parser.add_argument(\"--html\", action=\"store_true\", help=\"Export as HTML table\")\n args = parser.parse_args()\n html: bool = args.html\n console = Console(record=True, width=70, file=io.StringIO()) if html else Console()\n\n table = Table(\"Name\", \"Styling\")\n\n for style_name, style in DEFAULT_STYLES.items():\n table.add_row(Text(style_name, style=style), str(style))\n\n console.print(table)\n if html:\n print(console.export_html(inline_styles=True))\n",[],[216,809,810,811,890,891,1058,1156],"0b7a13fc-67fc-11f0-bcbe-0224a6c84d84",["D",1753299267039],[],[216,809,810,811,890,891,1058,32],"0b54fff4-67fc-11f0-9bd1-0224a6c84d84","containers.py","0b5500a8-67fc-11f0-9bd1-0224a6c84d84",415,["D",1753299266796],"from itertools import zip_longest\nfrom typing import (\n TYPE_CHECKING,\n Iterable,\n Iterator,\n List,\n Optional,\n TypeVar,\n Union,\n overload,\n)\n\nif TYPE_CHECKING:\n from .console import (\n Console,\n ConsoleOptions,\n JustifyMethod,\n OverflowMethod,\n RenderResult,\n RenderableType,\n )\n from .text import Text\n\nfrom .cells import cell_len\nfrom .measure import Measurement\n\nT = TypeVar(\"T\")\n\n\nclass Renderables:\n \"\"\"A list subclass which renders its contents to the console.\"\"\"\n\n def __init__(\n self, renderables: Optional[Iterable[\"RenderableType\"]] = None\n ) -> None:\n self._renderables: List[\"RenderableType\"] = (\n list(renderables) if renderables is not None else []\n )\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n \"\"\"Console render method to insert line-breaks.\"\"\"\n yield from self._renderables\n\n def __rich_measure__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"Measurement\":\n dimensions = [\n Measurement.get(console, options, renderable)\n for renderable in self._renderables\n ]\n if not dimensions:\n return Measurement(1, 1)\n _min = max(dimension.minimum for dimension in dimensions)\n _max = max(dimension.maximum for dimension in dimensions)\n return Measurement(_min, _max)\n\n def append(self, renderable: \"RenderableType\") -> None:\n self._renderables.append(renderable)\n\n def __iter__(self) -> Iterable[\"RenderableType\"]:\n return iter(self._renderables)\n\n\nclass Lines:\n \"\"\"A list subclass which can render to the console.\"\"\"\n\n def __init__(self, lines: Iterable[\"Text\"] = ()) -> None:\n self._lines: List[\"Text\"] = list(lines)\n\n def __repr__(self) -> str:\n return f\"Lines({self._lines!r})\"\n\n def __iter__(self) -> Iterator[\"Text\"]:\n return iter(self._lines)\n\n @overload\n def __getitem__(self, index: int) -> \"Text\":\n ...\n\n @overload\n def __getitem__(self, index: slice) -> List[\"Text\"]:\n ...\n\n def __getitem__(self, index: Union[slice, int]) -> Union[\"Text\", List[\"Text\"]]:\n return self._lines[index]\n\n def __setitem__(self, index: int, value: \"Text\") -> \"Lines\":\n self._lines[index] = value\n return self\n\n def __len__(self) -> int:\n return self._lines.__len__()\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n \"\"\"Console render method to insert line-breaks.\"\"\"\n yield from self._lines\n\n def append(self, line: \"Text\") -> None:\n self._lines.append(line)\n\n def extend(self, lines: Iterable[\"Text\"]) -> None:\n self._lines.extend(lines)\n\n def pop(self, index: int = -1) -> \"Text\":\n return self._lines.pop(index)\n\n def justify(\n self,\n console: \"Console\",\n width: int,\n justify: \"JustifyMethod\" = \"left\",\n overflow: \"OverflowMethod\" = \"fold\",\n ) -> None:\n \"\"\"Justify and overflow text to a given width.\n\n Args:\n console (Console): Console instance.\n width (int): Number of cells available per line.\n justify (str, optional): Default justify method for text: \"left\", \"center\", \"full\" or \"right\". Defaults to \"left\".\n overflow (str, optional): Default overflow for text: \"crop\", \"fold\", or \"ellipsis\". Defaults to \"fold\".\n\n \"\"\"\n from .text import Text\n\n if justify == \"left\":\n for line in self._lines:\n line.truncate(width, overflow=overflow, pad=True)\n elif justify == \"center\":\n for line in self._lines:\n line.rstrip()\n line.truncate(width, overflow=overflow)\n line.pad_left((width - cell_len(line.plain)) // 2)\n line.pad_right(width - cell_len(line.plain))\n elif justify == \"right\":\n for line in self._lines:\n line.rstrip()\n line.truncate(width, overflow=overflow)\n line.pad_left(width - cell_len(line.plain))\n elif justify == \"full\":\n for line_index, line in enumerate(self._lines):\n if line_index == len(self._lines) - 1:\n break\n words = line.split(\" \")\n words_size = sum(cell_len(word.plain) for word in words)\n num_spaces = len(words) - 1\n spaces = [1 for _ in range(num_spaces)]\n index = 0\n if spaces:\n while words_size + num_spaces < width:\n spaces[len(spaces) - index - 1] += 1\n num_spaces += 1\n index = (index + 1) % len(spaces)\n tokens: List[Text] = []\n for index, (word, next_word) in enumerate(\n zip_longest(words, words[1:])\n ):\n tokens.append(word)\n if index < len(spaces):\n style = word.get_style_at_offset(console, -1)\n next_style = next_word.get_style_at_offset(console, 0)\n space_style = style if style == next_style else line.style\n tokens.append(Text(\" \" * spaces[index], style=space_style))\n self[line_index] = Text(\"\").join(tokens)\n",[],[216,809,810,811,890,891,1058,1168],"0b0cf218-67fc-11f0-b6cd-0224a6c84d84","color.py","0b0cf2cc-67fc-11f0-b6cd-0224a6c84d84",404,["D",1753299266320],"import re\nimport sys\nfrom colorsys import rgb_to_hls\nfrom enum import IntEnum\nfrom functools import lru_cache\nfrom typing import TYPE_CHECKING, NamedTuple, Optional, Tuple\n\nfrom ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE\nfrom .color_triplet import ColorTriplet\nfrom .repr import Result, rich_repr\nfrom .terminal_theme import DEFAULT_TERMINAL_THEME\n\nif TYPE_CHECKING: # pragma: no cover\n from .terminal_theme import TerminalTheme\n from .text import Text\n\n\nWINDOWS = sys.platform == \"win32\"\n\n\nclass ColorSystem(IntEnum):\n \"\"\"One of the 3 color system supported by terminals.\"\"\"\n\n STANDARD = 1\n EIGHT_BIT = 2\n TRUECOLOR = 3\n WINDOWS = 4\n\n def __repr__(self) -> str:\n return f\"ColorSystem.{self.name}\"\n\n def __str__(self) -> str:\n return repr(self)\n\n\nclass ColorType(IntEnum):\n \"\"\"Type of color stored in Color class.\"\"\"\n\n DEFAULT = 0\n STANDARD = 1\n EIGHT_BIT = 2\n TRUECOLOR = 3\n WINDOWS = 4\n\n def __repr__(self) -> str:\n return f\"ColorType.{self.name}\"\n\n\nANSI_COLOR_NAMES = {\n \"black\": 0,\n \"red\": 1,\n \"green\": 2,\n \"yellow\": 3,\n \"blue\": 4,\n \"magenta\": 5,\n \"cyan\": 6,\n \"white\": 7,\n \"bright_black\": 8,\n \"bright_red\": 9,\n \"bright_green\": 10,\n \"bright_yellow\": 11,\n \"bright_blue\": 12,\n \"bright_magenta\": 13,\n \"bright_cyan\": 14,\n \"bright_white\": 15,\n \"grey0\": 16,\n \"gray0\": 16,\n \"navy_blue\": 17,\n \"dark_blue\": 18,\n \"blue3\": 20,\n \"blue1\": 21,\n \"dark_green\": 22,\n \"deep_sky_blue4\": 25,\n \"dodger_blue3\": 26,\n \"dodger_blue2\": 27,\n \"green4\": 28,\n \"spring_green4\": 29,\n \"turquoise4\": 30,\n \"deep_sky_blue3\": 32,\n \"dodger_blue1\": 33,\n \"green3\": 40,\n \"spring_green3\": 41,\n \"dark_cyan\": 36,\n \"light_sea_green\": 37,\n \"deep_sky_blue2\": 38,\n \"deep_sky_blue1\": 39,\n \"spring_green2\": 47,\n \"cyan3\": 43,\n \"dark_turquoise\": 44,\n \"turquoise2\": 45,\n \"green1\": 46,\n \"spring_green1\": 48,\n \"medium_spring_green\": 49,\n \"cyan2\": 50,\n \"cyan1\": 51,\n \"dark_red\": 88,\n \"deep_pink4\": 125,\n \"purple4\": 55,\n \"purple3\": 56,\n \"blue_violet\": 57,\n \"orange4\": 94,\n \"grey37\": 59,\n \"gray37\": 59,\n \"medium_purple4\": 60,\n \"slate_blue3\": 62,\n \"royal_blue1\": 63,\n \"chartreuse4\": 64,\n \"dark_sea_green4\": 71,\n \"pale_turquoise4\": 66,\n \"steel_blue\": 67,\n \"steel_blue3\": 68,\n \"cornflower_blue\": 69,\n \"chartreuse3\": 76,\n \"cadet_blue\": 73,\n \"sky_blue3\": 74,\n \"steel_blue1\": 81,\n \"pale_green3\": 114,\n \"sea_green3\": 78,\n \"aquamarine3\": 79,\n \"medium_turquoise\": 80,\n \"chartreuse2\": 112,\n \"sea_green2\": 83,\n \"sea_green1\": 85,\n \"aquamarine1\": 122,\n \"dark_slate_gray2\": 87,\n \"dark_magenta\": 91,\n \"dark_violet\": 128,\n \"purple\": 129,\n \"light_pink4\": 95,\n \"plum4\": 96,\n \"medium_purple3\": 98,\n \"slate_blue1\": 99,\n \"yellow4\": 106,\n \"wheat4\": 101,\n \"grey53\": 102,\n \"gray53\": 102,\n \"light_slate_grey\": 103,\n \"light_slate_gray\": 103,\n \"medium_purple\": 104,\n \"light_slate_blue\": 105,\n \"dark_olive_green3\": 149,\n \"dark_sea_green\": 108,\n \"light_sky_blue3\": 110,\n \"sky_blue2\": 111,\n \"dark_sea_green3\": 150,\n \"dark_slate_gray3\": 116,\n \"sky_blue1\": 117,\n \"chartreuse1\": 118,\n \"light_green\": 120,\n \"pale_green1\": 156,\n \"dark_slate_gray1\": 123,\n \"red3\": 160,\n \"medium_violet_red\": 126,\n \"magenta3\": 164,\n \"dark_orange3\": 166,\n \"indian_red\": 167,\n \"hot_pink3\": 168,\n \"medium_orchid3\": 133,\n \"medium_orchid\": 134,\n \"medium_purple2\": 140,\n \"dark_goldenrod\": 136,\n \"light_salmon3\": 173,\n \"rosy_brown\": 138,\n \"grey63\": 139,\n \"gray63\": 139,\n \"medium_purple1\": 141,\n \"gold3\": 178,\n \"dark_khaki\": 143,\n \"navajo_white3\": 144,\n \"grey69\": 145,\n \"gray69\": 145,\n \"light_steel_blue3\": 146,\n \"light_steel_blue\": 147,\n \"yellow3\": 184,\n \"dark_sea_green2\": 157,\n \"light_cyan3\": 152,\n \"light_sky_blue1\": 153,\n \"green_yellow\": 154,\n \"dark_olive_green2\": 155,\n \"dark_sea_green1\": 193,\n \"pale_turquoise1\": 159,\n \"deep_pink3\": 162,\n \"magenta2\": 200,\n \"hot_pink2\": 169,\n \"orchid\": 170,\n \"medium_orchid1\": 207,\n \"orange3\": 172,\n \"light_pink3\": 174,\n \"pink3\": 175,\n \"plum3\": 176,\n \"violet\": 177,\n \"light_goldenrod3\": 179,\n \"tan\": 180,\n \"misty_rose3\": 181,\n \"thistle3\": 182,\n \"plum2\": 183,\n \"khaki3\": 185,\n \"light_goldenrod2\": 222,\n \"light_yellow3\": 187,\n \"grey84\": 188,\n \"gray84\": 188,\n \"light_steel_blue1\": 189,\n \"yellow2\": 190,\n \"dark_olive_green1\": 192,\n \"honeydew2\": 194,\n \"light_cyan1\": 195,\n \"red1\": 196,\n \"deep_pink2\": 197,\n \"deep_pink1\": 199,\n \"magenta1\": 201,\n \"orange_red1\": 202,\n \"indian_red1\": 204,\n \"hot_pink\": 206,\n \"dark_orange\": 208,\n \"salmon1\": 209,\n \"light_coral\": 210,\n \"pale_violet_red1\": 211,\n \"orchid2\": 212,\n \"orchid1\": 213,\n \"orange1\": 214,\n \"sandy_brown\": 215,\n \"light_salmon1\": 216,\n \"light_pink1\": 217,\n \"pink1\": 218,\n \"plum1\": 219,\n \"gold1\": 220,\n \"navajo_white1\": 223,\n \"misty_rose1\": 224,\n \"thistle1\": 225,\n \"yellow1\": 226,\n \"light_goldenrod1\": 227,\n \"khaki1\": 228,\n \"wheat1\": 229,\n \"cornsilk1\": 230,\n \"grey100\": 231,\n \"gray100\": 231,\n \"grey3\": 232,\n \"gray3\": 232,\n \"grey7\": 233,\n \"gray7\": 233,\n \"grey11\": 234,\n \"gray11\": 234,\n \"grey15\": 235,\n \"gray15\": 235,\n \"grey19\": 236,\n \"gray19\": 236,\n \"grey23\": 237,\n \"gray23\": 237,\n \"grey27\": 238,\n \"gray27\": 238,\n \"grey30\": 239,\n \"gray30\": 239,\n \"grey35\": 240,\n \"gray35\": 240,\n \"grey39\": 241,\n \"gray39\": 241,\n \"grey42\": 242,\n \"gray42\": 242,\n \"grey46\": 243,\n \"gray46\": 243,\n \"grey50\": 244,\n \"gray50\": 244,\n \"grey54\": 245,\n \"gray54\": 245,\n \"grey58\": 246,\n \"gray58\": 246,\n \"grey62\": 247,\n \"gray62\": 247,\n \"grey66\": 248,\n \"gray66\": 248,\n \"grey70\": 249,\n \"gray70\": 249,\n \"grey74\": 250,\n \"gray74\": 250,\n \"grey78\": 251,\n \"gray78\": 251,\n \"grey82\": 252,\n \"gray82\": 252,\n \"grey85\": 253,\n \"gray85\": 253,\n \"grey89\": 254,\n \"gray89\": 254,\n \"grey93\": 255,\n \"gray93\": 255,\n}\n\n\nclass ColorParseError(Exception):\n \"\"\"The color could not be parsed.\"\"\"\n\n\nRE_COLOR = re.compile(\n r\"\"\"^\n\\#([0-9a-f]{6})$|\ncolor\$([0-9]{1,3})\$$|\nrgb\$([\\d\\s,]+)\$$\n\"\"\",\n re.VERBOSE,\n)\n\n\n@rich_repr\nclass Color(NamedTuple):\n \"\"\"Terminal color definition.\"\"\"\n\n name: str\n \"\"\"The name of the color (typically the input to Color.parse).\"\"\"\n type: ColorType\n \"\"\"The type of the color.\"\"\"\n number: Optional[int] = None\n \"\"\"The color number, if a standard color, or None.\"\"\"\n triplet: Optional[ColorTriplet] = None\n \"\"\"A triplet of color components, if an RGB color.\"\"\"\n\n def __rich__(self) -> \"Text\":\n \"\"\"Displays the actual color if Rich printed.\"\"\"\n from .style import Style\n from .text import Text\n\n return Text.assemble(\n f\"\",\n )\n\n def __rich_repr__(self) -> Result:\n yield self.name\n yield self.type\n yield \"number\", self.number, None\n yield \"triplet\", self.triplet, None\n\n @property\n def system(self) -> ColorSystem:\n \"\"\"Get the native color system for this color.\"\"\"\n if self.type == ColorType.DEFAULT:\n return ColorSystem.STANDARD\n return ColorSystem(int(self.type))\n\n @property\n def is_system_defined(self) -> bool:\n \"\"\"Check if the color is ultimately defined by the system.\"\"\"\n return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR)\n\n @property\n def is_default(self) -> bool:\n \"\"\"Check if the color is a default color.\"\"\"\n return self.type == ColorType.DEFAULT\n\n def get_truecolor(\n self, theme: Optional[\"TerminalTheme\"] = None, foreground: bool = True\n ) -> ColorTriplet:\n \"\"\"Get an equivalent color triplet for this color.\n\n Args:\n theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None.\n foreground (bool, optional): True for a foreground color, or False for background. Defaults to True.\n\n Returns:\n ColorTriplet: A color triplet containing RGB components.\n \"\"\"\n\n if theme is None:\n theme = DEFAULT_TERMINAL_THEME\n if self.type == ColorType.TRUECOLOR:\n assert self.triplet is not None\n return self.triplet\n elif self.type == ColorType.EIGHT_BIT:\n assert self.number is not None\n return EIGHT_BIT_PALETTE[self.number]\n elif self.type == ColorType.STANDARD:\n assert self.number is not None\n return theme.ansi_colors[self.number]\n elif self.type == ColorType.WINDOWS:\n assert self.number is not None\n return WINDOWS_PALETTE[self.number]\n else: # self.type == ColorType.DEFAULT:\n assert self.number is None\n return theme.foreground_color if foreground else theme.background_color\n\n @classmethod\n def from_ansi(cls, number: int) -> \"Color\":\n \"\"\"Create a Color number from it's 8-bit ansi number.\n\n Args:\n number (int): A number between 0-255 inclusive.\n\n Returns:\n Color: A new Color instance.\n \"\"\"\n return cls(\n name=f\"color({number})\",\n type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),\n number=number,\n )\n\n @classmethod\n def from_triplet(cls, triplet: \"ColorTriplet\") -> \"Color\":\n \"\"\"Create a truecolor RGB color from a triplet of values.\n\n Args:\n triplet (ColorTriplet): A color triplet containing red, green and blue components.\n\n Returns:\n Color: A new color object.\n \"\"\"\n return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet)\n\n @classmethod\n def from_rgb(cls, red: float, green: float, blue: float) -> \"Color\":\n \"\"\"Create a truecolor from three color components in the range(0->255).\n\n Args:\n red (float): Red component in range 0-255.\n green (float): Green component in range 0-255.\n blue (float): Blue component in range 0-255.\n\n Returns:\n Color: A new color object.\n \"\"\"\n return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue)))\n\n @classmethod\n def default(cls) -> \"Color\":\n \"\"\"Get a Color instance representing the default color.\n\n Returns:\n Color: Default color.\n \"\"\"\n return cls(name=\"default\", type=ColorType.DEFAULT)\n\n @classmethod\n @lru_cache(maxsize=1024)\n def parse(cls, color: str) -> \"Color\":\n \"\"\"Parse a color definition.\"\"\"\n original_color = color\n color = color.lower().strip()\n\n if color == \"default\":\n return cls(color, type=ColorType.DEFAULT)\n\n color_number = ANSI_COLOR_NAMES.get(color)\n if color_number is not None:\n return cls(\n color,\n type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT),\n number=color_number,\n )\n\n color_match = RE_COLOR.match(color)\n if color_match is None:\n raise ColorParseError(f\"{original_color!r} is not a valid color\")\n\n color_24, color_8, color_rgb = color_match.groups()\n if color_24:\n triplet = ColorTriplet(\n int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16)\n )\n return cls(color, ColorType.TRUECOLOR, triplet=triplet)\n\n elif color_8:\n number = int(color_8)\n if number > 255:\n raise ColorParseError(f\"color number must be <= 255 in {color!r}\")\n return cls(\n color,\n type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),\n number=number,\n )\n\n else: # color_rgb:\n components = color_rgb.split(\",\")\n if len(components) != 3:\n raise ColorParseError(\n f\"expected three components in {original_color!r}\"\n )\n red, green, blue = components\n triplet = ColorTriplet(int(red), int(green), int(blue))\n if not all(component <= 255 for component in triplet):\n raise ColorParseError(\n f\"color components must be <= 255 in {original_color!r}\"\n )\n return cls(color, ColorType.TRUECOLOR, triplet=triplet)\n\n @lru_cache(maxsize=1024)\n def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]:\n \"\"\"Get the ANSI escape codes for this color.\"\"\"\n _type = self.type\n if _type == ColorType.DEFAULT:\n return (\"39\" if foreground else \"49\",)\n\n elif _type == ColorType.WINDOWS:\n number = self.number\n assert number is not None\n fore, back = (30, 40) if number < 8 else (82, 92)\n return (str(fore + number if foreground else back + number),)\n\n elif _type == ColorType.STANDARD:\n number = self.number\n assert number is not None\n fore, back = (30, 40) if number < 8 else (82, 92)\n return (str(fore + number if foreground else back + number),)\n\n elif _type == ColorType.EIGHT_BIT:\n assert self.number is not None\n return (\"38\" if foreground else \"48\", \"5\", str(self.number))\n\n else: # self.standard == ColorStandard.TRUECOLOR:\n assert self.triplet is not None\n red, green, blue = self.triplet\n return (\"38\" if foreground else \"48\", \"2\", str(red), str(green), str(blue))\n\n @lru_cache(maxsize=1024)\n def downgrade(self, system: ColorSystem) -> \"Color\":\n \"\"\"Downgrade a color system to a system with fewer colors.\"\"\"\n\n if self.type in (ColorType.DEFAULT, system):\n return self\n # Convert to 8-bit color from truecolor color\n if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR:\n assert self.triplet is not None\n _h, l, s = rgb_to_hls(*self.triplet.normalized)\n # If saturation is under 15% assume it is grayscale\n if s < 0.15:\n gray = round(l * 25.0)\n if gray == 0:\n color_number = 16\n elif gray == 25:\n color_number = 231\n else:\n color_number = 231 + gray\n return Color(self.name, ColorType.EIGHT_BIT, number=color_number)\n\n red, green, blue = self.triplet\n six_red = red / 95 if red < 95 else 1 + (red - 95) / 40\n six_green = green / 95 if green < 95 else 1 + (green - 95) / 40\n six_blue = blue / 95 if blue < 95 else 1 + (blue - 95) / 40\n\n color_number = (\n 16 + 36 * round(six_red) + 6 * round(six_green) + round(six_blue)\n )\n return Color(self.name, ColorType.EIGHT_BIT, number=color_number)\n\n # Convert to standard from truecolor or 8-bit\n elif system == ColorSystem.STANDARD:\n if self.system == ColorSystem.TRUECOLOR:\n assert self.triplet is not None\n triplet = self.triplet\n else: # self.system == ColorSystem.EIGHT_BIT\n assert self.number is not None\n triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])\n\n color_number = STANDARD_PALETTE.match(triplet)\n return Color(self.name, ColorType.STANDARD, number=color_number)\n\n elif system == ColorSystem.WINDOWS:\n if self.system == ColorSystem.TRUECOLOR:\n assert self.triplet is not None\n triplet = self.triplet\n else: # self.system == ColorSystem.EIGHT_BIT\n assert self.number is not None\n if self.number < 16:\n return Color(self.name, ColorType.WINDOWS, number=self.number)\n triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])\n\n color_number = WINDOWS_PALETTE.match(triplet)\n return Color(self.name, ColorType.WINDOWS, number=color_number)\n\n return self\n\n\ndef parse_rgb_hex(hex_color: str) -> ColorTriplet:\n \"\"\"Parse six hex characters in to RGB triplet.\"\"\"\n assert len(hex_color) == 6, \"must be 6 characters\"\n color = ColorTriplet(\n int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16)\n )\n return color\n\n\ndef blend_rgb(\n color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5\n) -> ColorTriplet:\n \"\"\"Blend one RGB color in to another.\"\"\"\n r1, g1, b1 = color1\n r2, g2, b2 = color2\n new_color = ColorTriplet(\n int(r1 + (r2 - r1) * cross_fade),\n int(g1 + (g2 - g1) * cross_fade),\n int(b1 + (b2 - b1) * cross_fade),\n )\n return new_color\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from .console import Console\n from .table import Table\n from .text import Text\n\n console = Console()\n\n table = Table(show_footer=False, show_edge=True)\n table.add_column(\"Color\", width=10, overflow=\"ellipsis\")\n table.add_column(\"Number\", justify=\"right\", style=\"yellow\")\n table.add_column(\"Name\", style=\"green\")\n table.add_column(\"Hex\", style=\"blue\")\n table.add_column(\"RGB\", style=\"magenta\")\n\n colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items())\n for color_number, name in colors:\n if \"grey\" in name:\n continue\n color_cell = Text(\" \" * 10, style=f\"on {name}\")\n if color_number < 16:\n table.add_row(color_cell, f\"{color_number}\", Text(f'\"{name}\"'))\n else:\n color = EIGHT_BIT_PALETTE[color_number] # type: ignore[has-type]\n table.add_row(\n color_cell, str(color_number), Text(f'\"{name}\"'), color.hex, color.rgb\n )\n\n console.print(table)\n",[],[216,809,810,811,890,891,1058,1176],"0b074c46-67fc-11f0-b666-0224a6c84d84","box.py","0b074d18-67fc-11f0-b666-0224a6c84d84",403,["D",1753299266275],"import sys\nfrom typing import TYPE_CHECKING, Iterable, List\n\nif sys.version_info >= (3, 8):\n from typing import Literal\nelse:\n from pip._vendor.typing_extensions import Literal # pragma: no cover\n\n\nfrom ._loop import loop_last\n\nif TYPE_CHECKING:\n from pip._vendor.rich.console import ConsoleOptions\n\n\nclass Box:\n \"\"\"Defines characters to render boxes.\n\n ┌─┬┐ top\n │ ││ head\n ├─┼┤ head_row\n │ ││ mid\n ├─┼┤ row\n ├─┼┤ foot_row\n │ ││ foot\n └─┴┘ bottom\n\n Args:\n box (str): Characters making up box.\n ascii (bool, optional): True if this box uses ascii characters only. Default is False.\n \"\"\"\n\n def __init__(self, box: str, *, ascii: bool = False) -> None:\n self._box = box\n self.ascii = ascii\n line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines()\n # top\n self.top_left, self.top, self.top_divider, self.top_right = iter(line1)\n # head\n self.head_left, _, self.head_vertical, self.head_right = iter(line2)\n # head_row\n (\n self.head_row_left,\n self.head_row_horizontal,\n self.head_row_cross,\n self.head_row_right,\n ) = iter(line3)\n\n # mid\n self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4)\n # row\n self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5)\n # foot_row\n (\n self.foot_row_left,\n self.foot_row_horizontal,\n self.foot_row_cross,\n self.foot_row_right,\n ) = iter(line6)\n # foot\n self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7)\n # bottom\n self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter(\n line8\n )\n\n def __repr__(self) -> str:\n return \"Box(...)\"\n\n def __str__(self) -> str:\n return self._box\n\n def substitute(self, options: \"ConsoleOptions\", safe: bool = True) -> \"Box\":\n \"\"\"Substitute this box for another if it won't render due to platform issues.\n\n Args:\n options (ConsoleOptions): Console options used in rendering.\n safe (bool, optional): Substitute this for another Box if there are known problems\n displaying on the platform (currently only relevant on Windows). Default is True.\n\n Returns:\n Box: A different Box or the same Box.\n \"\"\"\n box = self\n if options.legacy_windows and safe:\n box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box)\n if options.ascii_only and not box.ascii:\n box = ASCII\n return box\n\n def get_plain_headed_box(self) -> \"Box\":\n \"\"\"If this box uses special characters for the borders of the header, then\n return the equivalent box that does not.\n\n Returns:\n Box: The most similar Box that doesn't use header-specific box characters.\n If the current Box already satisfies this criterion, then it's returned.\n \"\"\"\n return PLAIN_HEADED_SUBSTITUTIONS.get(self, self)\n\n def get_top(self, widths: Iterable[int]) -> str:\n \"\"\"Get the top of a simple box.\n\n Args:\n widths (List[int]): Widths of columns.\n\n Returns:\n str: A string of box characters.\n \"\"\"\n\n parts: List[str] = []\n append = parts.append\n append(self.top_left)\n for last, width in loop_last(widths):\n append(self.top * width)\n if not last:\n append(self.top_divider)\n append(self.top_right)\n return \"\".join(parts)\n\n def get_row(\n self,\n widths: Iterable[int],\n level: Literal[\"head\", \"row\", \"foot\", \"mid\"] = \"row\",\n edge: bool = True,\n ) -> str:\n \"\"\"Get the top of a simple box.\n\n Args:\n width (List[int]): Widths of columns.\n\n Returns:\n str: A string of box characters.\n \"\"\"\n if level == \"head\":\n left = self.head_row_left\n horizontal = self.head_row_horizontal\n cross = self.head_row_cross\n right = self.head_row_right\n elif level == \"row\":\n left = self.row_left\n horizontal = self.row_horizontal\n cross = self.row_cross\n right = self.row_right\n elif level == \"mid\":\n left = self.mid_left\n horizontal = \" \"\n cross = self.mid_vertical\n right = self.mid_right\n elif level == \"foot\":\n left = self.foot_row_left\n horizontal = self.foot_row_horizontal\n cross = self.foot_row_cross\n right = self.foot_row_right\n else:\n raise ValueError(\"level must be 'head', 'row' or 'foot'\")\n\n parts: List[str] = []\n append = parts.append\n if edge:\n append(left)\n for last, width in loop_last(widths):\n append(horizontal * width)\n if not last:\n append(cross)\n if edge:\n append(right)\n return \"\".join(parts)\n\n def get_bottom(self, widths: Iterable[int]) -> str:\n \"\"\"Get the bottom of a simple box.\n\n Args:\n widths (List[int]): Widths of columns.\n\n Returns:\n str: A string of box characters.\n \"\"\"\n\n parts: List[str] = []\n append = parts.append\n append(self.bottom_left)\n for last, width in loop_last(widths):\n append(self.bottom * width)\n if not last:\n append(self.bottom_divider)\n append(self.bottom_right)\n return \"\".join(parts)\n\n\n# fmt: off\nASCII: Box = Box(\n \"+--+\\n\"\n \"| ||\\n\"\n \"|-+|\\n\"\n \"| ||\\n\"\n \"|-+|\\n\"\n \"|-+|\\n\"\n \"| ||\\n\"\n \"+--+\\n\",\n ascii=True,\n)\n\nASCII2: Box = Box(\n \"+-++\\n\"\n \"| ||\\n\"\n \"+-++\\n\"\n \"| ||\\n\"\n \"+-++\\n\"\n \"+-++\\n\"\n \"| ||\\n\"\n \"+-++\\n\",\n ascii=True,\n)\n\nASCII_DOUBLE_HEAD: Box = Box(\n \"+-++\\n\"\n \"| ||\\n\"\n \"+=++\\n\"\n \"| ||\\n\"\n \"+-++\\n\"\n \"+-++\\n\"\n \"| ||\\n\"\n \"+-++\\n\",\n ascii=True,\n)\n\nSQUARE: Box = Box(\n \"┌─┬┐\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"└─┴┘\\n\"\n)\n\nSQUARE_DOUBLE_HEAD: Box = Box(\n \"┌─┬┐\\n\"\n \"│ ││\\n\"\n \"╞═╪╡\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"└─┴┘\\n\"\n)\n\nMINIMAL: Box = Box(\n \" ╷ \\n\"\n \" │ \\n\"\n \"╶─┼╴\\n\"\n \" │ \\n\"\n \"╶─┼╴\\n\"\n \"╶─┼╴\\n\"\n \" │ \\n\"\n \" ╵ \\n\"\n)\n\n\nMINIMAL_HEAVY_HEAD: Box = Box(\n \" ╷ \\n\"\n \" │ \\n\"\n \"╺━┿╸\\n\"\n \" │ \\n\"\n \"╶─┼╴\\n\"\n \"╶─┼╴\\n\"\n \" │ \\n\"\n \" ╵ \\n\"\n)\n\nMINIMAL_DOUBLE_HEAD: Box = Box(\n \" ╷ \\n\"\n \" │ \\n\"\n \" ═╪ \\n\"\n \" │ \\n\"\n \" ─┼ \\n\"\n \" ─┼ \\n\"\n \" │ \\n\"\n \" ╵ \\n\"\n)\n\n\nSIMPLE: Box = Box(\n \" \\n\"\n \" \\n\"\n \" ── \\n\"\n \" \\n\"\n \" \\n\"\n \" ── \\n\"\n \" \\n\"\n \" \\n\"\n)\n\nSIMPLE_HEAD: Box = Box(\n \" \\n\"\n \" \\n\"\n \" ── \\n\"\n \" \\n\"\n \" \\n\"\n \" \\n\"\n \" \\n\"\n \" \\n\"\n)\n\n\nSIMPLE_HEAVY: Box = Box(\n \" \\n\"\n \" \\n\"\n \" ━━ \\n\"\n \" \\n\"\n \" \\n\"\n \" ━━ \\n\"\n \" \\n\"\n \" \\n\"\n)\n\n\nHORIZONTALS: Box = Box(\n \" ── \\n\"\n \" \\n\"\n \" ── \\n\"\n \" \\n\"\n \" ── \\n\"\n \" ── \\n\"\n \" \\n\"\n \" ── \\n\"\n)\n\nROUNDED: Box = Box(\n \"╭─┬╮\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"╰─┴╯\\n\"\n)\n\nHEAVY: Box = Box(\n \"┏━┳┓\\n\"\n \"┃ ┃┃\\n\"\n \"┣━╋┫\\n\"\n \"┃ ┃┃\\n\"\n \"┣━╋┫\\n\"\n \"┣━╋┫\\n\"\n \"┃ ┃┃\\n\"\n \"┗━┻┛\\n\"\n)\n\nHEAVY_EDGE: Box = Box(\n \"┏━┯┓\\n\"\n \"┃ │┃\\n\"\n \"┠─┼┨\\n\"\n \"┃ │┃\\n\"\n \"┠─┼┨\\n\"\n \"┠─┼┨\\n\"\n \"┃ │┃\\n\"\n \"┗━┷┛\\n\"\n)\n\nHEAVY_HEAD: Box = Box(\n \"┏━┳┓\\n\"\n \"┃ ┃┃\\n\"\n \"┡━╇┩\\n\"\n \"│ ││\\n\"\n \"├─┼┤\\n\"\n \"├─┼┤\\n\"\n \"│ ││\\n\"\n \"└─┴┘\\n\"\n)\n\nDOUBLE: Box = Box(\n \"╔═╦╗\\n\"\n \"║ ║║\\n\"\n \"╠═╬╣\\n\"\n \"║ ║║\\n\"\n \"╠═╬╣\\n\"\n \"╠═╬╣\\n\"\n \"║ ║║\\n\"\n \"╚═╩╝\\n\"\n)\n\nDOUBLE_EDGE: Box = Box(\n \"╔═╤╗\\n\"\n \"║ │║\\n\"\n \"╟─┼╢\\n\"\n \"║ │║\\n\"\n \"╟─┼╢\\n\"\n \"╟─┼╢\\n\"\n \"║ │║\\n\"\n \"╚═╧╝\\n\"\n)\n\nMARKDOWN: Box = Box(\n \" \\n\"\n \"| ||\\n\"\n \"|-||\\n\"\n \"| ||\\n\"\n \"|-||\\n\"\n \"|-||\\n\"\n \"| ||\\n\"\n \" \\n\",\n ascii=True,\n)\n# fmt: on\n\n# Map Boxes that don't render with raster fonts on to equivalent that do\nLEGACY_WINDOWS_SUBSTITUTIONS = {\n ROUNDED: SQUARE,\n MINIMAL_HEAVY_HEAD: MINIMAL,\n SIMPLE_HEAVY: SIMPLE,\n HEAVY: SQUARE,\n HEAVY_EDGE: SQUARE,\n HEAVY_HEAD: SQUARE,\n}\n\n# Map headed boxes to their headerless equivalents\nPLAIN_HEADED_SUBSTITUTIONS = {\n HEAVY_HEAD: SQUARE,\n SQUARE_DOUBLE_HEAD: SQUARE,\n MINIMAL_DOUBLE_HEAD: MINIMAL,\n MINIMAL_HEAVY_HEAD: MINIMAL,\n ASCII_DOUBLE_HEAD: ASCII2,\n}\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from pip._vendor.rich.columns import Columns\n from pip._vendor.rich.panel import Panel\n\n from . import box as box\n from .console import Console\n from .table import Table\n from .text import Text\n\n console = Console(record=True)\n\n BOXES = [\n \"ASCII\",\n \"ASCII2\",\n \"ASCII_DOUBLE_HEAD\",\n \"SQUARE\",\n \"SQUARE_DOUBLE_HEAD\",\n \"MINIMAL\",\n \"MINIMAL_HEAVY_HEAD\",\n \"MINIMAL_DOUBLE_HEAD\",\n \"SIMPLE\",\n \"SIMPLE_HEAD\",\n \"SIMPLE_HEAVY\",\n \"HORIZONTALS\",\n \"ROUNDED\",\n \"HEAVY\",\n \"HEAVY_EDGE\",\n \"HEAVY_HEAD\",\n \"DOUBLE\",\n \"DOUBLE_EDGE\",\n \"MARKDOWN\",\n ]\n\n console.print(Panel(\"[bold green]Box Constants\", style=\"green\"), justify=\"center\")\n console.print()\n\n columns = Columns(expand=True, padding=2)\n for box_name in sorted(BOXES):\n table = Table(\n show_footer=True, style=\"dim\", border_style=\"not dim\", expand=True\n )\n table.add_column(\"Header 1\", \"Footer 1\")\n table.add_column(\"Header 2\", \"Footer 2\")\n table.add_row(\"Cell\", \"Cell\")\n table.add_row(\"Cell\", \"Cell\")\n table.box = getattr(box, box_name)\n table.title = Text(f\"box.{box_name}\", style=\"magenta\")\n columns.add_renderable(table)\n console.print(columns)\n\n # console.save_svg(\"box.svg\")\n",[],[216,809,810,811,890,891,1058,1184],"0b1f0c78-67fc-11f0-b666-0224a6c84d84","align.py","0b1f0d68-67fc-11f0-b666-0224a6c84d84",406,["D",1753299266441],"import sys\nfrom itertools import chain\nfrom typing import TYPE_CHECKING, Iterable, Optional\n\nif sys.version_info >= (3, 8):\n from typing import Literal\nelse:\n from pip._vendor.typing_extensions import Literal # pragma: no cover\n\nfrom .constrain import Constrain\nfrom .jupyter import JupyterMixin\nfrom .measure import Measurement\nfrom .segment import Segment\nfrom .style import StyleType\n\nif TYPE_CHECKING:\n from .console import Console, ConsoleOptions, RenderableType, RenderResult\n\nAlignMethod = Literal[\"left\", \"center\", \"right\"]\nVerticalAlignMethod = Literal[\"top\", \"middle\", \"bottom\"]\n\n\nclass Align(JupyterMixin):\n \"\"\"Align a renderable by adding spaces if necessary.\n\n Args:\n renderable (RenderableType): A console renderable.\n align (AlignMethod): One of \"left\", \"center\", or \"right\"\"\n style (StyleType, optional): An optional style to apply to the background.\n vertical (Optional[VerticalAlignMethod], optional): Optional vertical align, one of \"top\", \"middle\", or \"bottom\". Defaults to None.\n pad (bool, optional): Pad the right with spaces. Defaults to True.\n width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None.\n height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None.\n\n Raises:\n ValueError: if ``align`` is not one of the expected values.\n \"\"\"\n\n def __init__(\n self,\n renderable: \"RenderableType\",\n align: AlignMethod = \"left\",\n style: Optional[StyleType] = None,\n *,\n vertical: Optional[VerticalAlignMethod] = None,\n pad: bool = True,\n width: Optional[int] = None,\n height: Optional[int] = None,\n ) -> None:\n if align not in (\"left\", \"center\", \"right\"):\n raise ValueError(\n f'invalid value for align, expected \"left\", \"center\", or \"right\" (not {align!r})'\n )\n if vertical is not None and vertical not in (\"top\", \"middle\", \"bottom\"):\n raise ValueError(\n f'invalid value for vertical, expected \"top\", \"middle\", or \"bottom\" (not {vertical!r})'\n )\n self.renderable = renderable\n self.align = align\n self.style = style\n self.vertical = vertical\n self.pad = pad\n self.width = width\n self.height = height\n\n def __repr__(self) -> str:\n return f\"Align({self.renderable!r}, {self.align!r})\"\n\n @classmethod\n def left(\n cls,\n renderable: \"RenderableType\",\n style: Optional[StyleType] = None,\n *,\n vertical: Optional[VerticalAlignMethod] = None,\n pad: bool = True,\n width: Optional[int] = None,\n height: Optional[int] = None,\n ) -> \"Align\":\n \"\"\"Align a renderable to the left.\"\"\"\n return cls(\n renderable,\n \"left\",\n style=style,\n vertical=vertical,\n pad=pad,\n width=width,\n height=height,\n )\n\n @classmethod\n def center(\n cls,\n renderable: \"RenderableType\",\n style: Optional[StyleType] = None,\n *,\n vertical: Optional[VerticalAlignMethod] = None,\n pad: bool = True,\n width: Optional[int] = None,\n height: Optional[int] = None,\n ) -> \"Align\":\n \"\"\"Align a renderable to the center.\"\"\"\n return cls(\n renderable,\n \"center\",\n style=style,\n vertical=vertical,\n pad=pad,\n width=width,\n height=height,\n )\n\n @classmethod\n def right(\n cls,\n renderable: \"RenderableType\",\n style: Optional[StyleType] = None,\n *,\n vertical: Optional[VerticalAlignMethod] = None,\n pad: bool = True,\n width: Optional[int] = None,\n height: Optional[int] = None,\n ) -> \"Align\":\n \"\"\"Align a renderable to the right.\"\"\"\n return cls(\n renderable,\n \"right\",\n style=style,\n vertical=vertical,\n pad=pad,\n width=width,\n height=height,\n )\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n align = self.align\n width = console.measure(self.renderable, options=options).maximum\n rendered = console.render(\n Constrain(\n self.renderable, width if self.width is None else min(width, self.width)\n ),\n options.update(height=None),\n )\n lines = list(Segment.split_lines(rendered))\n width, height = Segment.get_shape(lines)\n lines = Segment.set_shape(lines, width, height)\n new_line = Segment.line()\n excess_space = options.max_width - width\n style = console.get_style(self.style) if self.style is not None else None\n\n def generate_segments() -> Iterable[Segment]:\n if excess_space <= 0:\n # Exact fit\n for line in lines:\n yield from line\n yield new_line\n\n elif align == \"left\":\n # Pad on the right\n pad = Segment(\" \" * excess_space, style) if self.pad else None\n for line in lines:\n yield from line\n if pad:\n yield pad\n yield new_line\n\n elif align == \"center\":\n # Pad left and right\n left = excess_space // 2\n pad = Segment(\" \" * left, style)\n pad_right = (\n Segment(\" \" * (excess_space - left), style) if self.pad else None\n )\n for line in lines:\n if left:\n yield pad\n yield from line\n if pad_right:\n yield pad_right\n yield new_line\n\n elif align == \"right\":\n # Padding on left\n pad = Segment(\" \" * excess_space, style)\n for line in lines:\n yield pad\n yield from line\n yield new_line\n\n blank_line = (\n Segment(f\"{' ' * (self.width or options.max_width)}\\n\", style)\n if self.pad\n else Segment(\"\\n\")\n )\n\n def blank_lines(count: int) -> Iterable[Segment]:\n if count > 0:\n for _ in range(count):\n yield blank_line\n\n vertical_height = self.height or options.height\n iter_segments: Iterable[Segment]\n if self.vertical and vertical_height is not None:\n if self.vertical == \"top\":\n bottom_space = vertical_height - height\n iter_segments = chain(generate_segments(), blank_lines(bottom_space))\n elif self.vertical == \"middle\":\n top_space = (vertical_height - height) // 2\n bottom_space = vertical_height - top_space - height\n iter_segments = chain(\n blank_lines(top_space),\n generate_segments(),\n blank_lines(bottom_space),\n )\n else: # self.vertical == \"bottom\":\n top_space = vertical_height - height\n iter_segments = chain(blank_lines(top_space), generate_segments())\n else:\n iter_segments = generate_segments()\n if self.style:\n style = console.get_style(self.style)\n iter_segments = Segment.apply_style(iter_segments, style)\n yield from iter_segments\n\n def __rich_measure__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> Measurement:\n measurement = Measurement.get(console, options, self.renderable)\n return measurement\n\n\nclass VerticalCenter(JupyterMixin):\n \"\"\"Vertically aligns a renderable.\n\n Warn:\n This class is deprecated and may be removed in a future version. Use Align class with\n `vertical=\"middle\"`.\n\n Args:\n renderable (RenderableType): A renderable object.\n style (StyleType, optional): An optional style to apply to the background. Defaults to None.\n \"\"\"\n\n def __init__(\n self,\n renderable: \"RenderableType\",\n style: Optional[StyleType] = None,\n ) -> None:\n self.renderable = renderable\n self.style = style\n\n def __repr__(self) -> str:\n return f\"VerticalCenter({self.renderable!r})\"\n\n def __rich_console__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> \"RenderResult\":\n style = console.get_style(self.style) if self.style is not None else None\n lines = console.render_lines(\n self.renderable, options.update(height=None), pad=False\n )\n width, _height = Segment.get_shape(lines)\n new_line = Segment.line()\n height = options.height or options.size.height\n top_space = (height - len(lines)) // 2\n bottom_space = height - top_space - len(lines)\n blank_line = Segment(f\"{' ' * width}\", style)\n\n def blank_lines(count: int) -> Iterable[Segment]:\n for _ in range(count):\n yield blank_line\n yield new_line\n\n if top_space > 0:\n yield from blank_lines(top_space)\n for line in lines:\n yield from line\n yield new_line\n if bottom_space > 0:\n yield from blank_lines(bottom_space)\n\n def __rich_measure__(\n self, console: \"Console\", options: \"ConsoleOptions\"\n ) -> Measurement:\n measurement = Measurement.get(console, options, self.renderable)\n return measurement\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from pip._vendor.rich.console import Console, Group\n from pip._vendor.rich.highlighter import ReprHighlighter\n from pip._vendor.rich.panel import Panel\n\n highlighter = ReprHighlighter()\n console = Console()\n\n panel = Panel(\n Group(\n Align.left(highlighter(\"align='left'\")),\n Align.center(highlighter(\"align='center'\")),\n Align.right(highlighter(\"align='right'\")),\n ),\n width=60,\n style=\"on dark_blue\",\n title=\"Align\",\n )\n\n console.print(\n Align.center(panel, vertical=\"middle\", style=\"on red\", height=console.height)\n )\n",[],[216,809,810,811,890,891,1058,1192],"0b3e165e-67fc-11f0-9454-0224a6c84d84","_wrap.py","0b3e1708-67fc-11f0-9454-0224a6c84d84",411,["D",1753299266626],"from __future__ import annotations\n\nimport re\nfrom typing import Iterable\n\nfrom ._loop import loop_last\nfrom .cells import cell_len, chop_cells\n\nre_word = re.compile(r\"\\s*\\S+\\s*\")\n\n\ndef words(text: str) -> Iterable[tuple[int, int, str]]:\n \"\"\"Yields each word from the text as a tuple\n containing (start_index, end_index, word). A \"word\" in this context may\n include the actual word and any whitespace to the right.\n \"\"\"\n position = 0\n word_match = re_word.match(text, position)\n while word_match is not None:\n start, end = word_match.span()\n word = word_match.group(0)\n yield start, end, word\n word_match = re_word.match(text, end)\n\n\ndef divide_line(text: str, width: int, fold: bool = True) -> list[int]:\n \"\"\"Given a string of text, and a width (measured in cells), return a list\n of cell offsets which the string should be split at in order for it to fit\n within the given width.\n\n Args:\n text: The text to examine.\n width: The available cell width.\n fold: If True, words longer than `width` will be folded onto a new line.\n\n Returns:\n A list of indices to break the line at.\n \"\"\"\n break_positions: list[int] = [] # offsets to insert the breaks at\n append = break_positions.append\n cell_offset = 0\n _cell_len = cell_len\n\n for start, _end, word in words(text):\n word_length = _cell_len(word.rstrip())\n remaining_space = width - cell_offset\n word_fits_remaining_space = remaining_space >= word_length\n\n if word_fits_remaining_space:\n # Simplest case - the word fits within the remaining width for this line.\n cell_offset += _cell_len(word)\n else:\n # Not enough space remaining for this word on the current line.\n if word_length > width:\n # The word doesn't fit on any line, so we can't simply\n # place it on the next line...\n if fold:\n # Fold the word across multiple lines.\n folded_word = chop_cells(word, width=width)\n for last, line in loop_last(folded_word):\n if start:\n append(start)\n if last:\n cell_offset = _cell_len(line)\n else:\n start += len(line)\n else:\n # Folding isn't allowed, so crop the word.\n if start:\n append(start)\n cell_offset = _cell_len(word)\n elif cell_offset and start:\n # The word doesn't fit within the remaining space on the current\n # line, but it *can* fit on to the next (empty) line.\n append(start)\n cell_offset = _cell_len(word)\n\n return break_positions\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from .console import Console\n\n console = Console(width=10)\n console.print(\"12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345\")\n print(chop_cells(\"abcdefghijklmnopqrstuvwxyz\", 10))\n\n console = Console(width=20)\n console.rule()\n console.print(\"TextualはPythonの高速アプリケーション開発フレームワークです\")\n\n console.rule()\n console.print(\"アプリケーションは1670万色を使用でき\")\n",[],[216,809,810,811,890,891,1058,1200],"0b193898-67fc-11f0-b6cd-0224a6c84d84","_timer.py","0b19396a-67fc-11f0-b6cd-0224a6c84d84",405,["D",1753299266398],"\"\"\"\nTimer context manager, only used in debug.\n\n\"\"\"\n\nfrom time import time\n\nimport contextlib\nfrom typing import Generator\n\n\n@contextlib.contextmanager\ndef timer(subject: str = \"time\") -> Generator[None, None, None]:\n \"\"\"print the elapsed time. (only used in debugging)\"\"\"\n start = time()\n yield\n elapsed = time() - start\n elapsed_ms = elapsed * 1000\n print(f\"{subject} elapsed {elapsed_ms:.1f}ms\")\n",[],[216,809,810,811,890,891,1058,1208],"0b71df02-67fc-11f0-8d4e-0224a6c84d84","_loop.py","0b71dfb6-67fc-11f0-8d4e-0224a6c84d84",420,["D",1753299266970],"from typing import Iterable, Tuple, TypeVar\n\nT = TypeVar(\"T\")\n\n\ndef loop_first(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:\n \"\"\"Iterate and generate a tuple with a flag for first value.\"\"\"\n iter_values = iter(values)\n try:\n value = next(iter_values)\n except StopIteration:\n return\n yield True, value\n for value in iter_values:\n yield False, value\n\n\ndef loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:\n \"\"\"Iterate and generate a tuple with a flag for last value.\"\"\"\n iter_values = iter(values)\n try:\n previous_value = next(iter_values)\n except StopIteration:\n return\n for value in iter_values:\n yield False, previous_value\n previous_value = value\n yield True, previous_value\n\n\ndef loop_first_last(values: Iterable[T]) -> Iterable[Tuple[bool, bool, T]]:\n \"\"\"Iterate and generate a tuple with a flag for first and last value.\"\"\"\n iter_values = iter(values)\n try:\n previous_value = next(iter_values)\n except StopIteration:\n return\n first = True\n for value in iter_values:\n yield first, False, previous_value\n first = False\n previous_value = value\n yield first, True, previous_value\n",[],[216,809,810,811,890,891,1058,1216],"0b441ea0-67fc-11f0-8d4e-0224a6c84d84","_log_render.py","0b441f68-67fc-11f0-8d4e-0224a6c84d84",412,["D",1753299266650],"from datetime import datetime\nfrom typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable\n\n\nfrom .text import Text, TextType\n\nif TYPE_CHECKING:\n from .console import Console, ConsoleRenderable, RenderableType\n from .table import Table\n\nFormatTimeCallable = Callable[[datetime], Text]\n\n\nclass LogRender:\n def __init__(\n self,\n show_time: bool = True,\n show_level: bool = False,\n show_path: bool = True,\n time_format: Union[str, FormatTimeCallable] = \"[%x %X]\",\n omit_repeated_times: bool = True,\n level_width: Optional[int] = 8,\n ) -> None:\n self.show_time = show_time\n self.show_level = show_level\n self.show_path = show_path\n self.time_format = time_format\n self.omit_repeated_times = omit_repeated_times\n self.level_width = level_width\n self._last_time: Optional[Text] = None\n\n def __call__(\n self,\n console: \"Console\",\n renderables: Iterable[\"ConsoleRenderable\"],\n log_time: Optional[datetime] = None,\n time_format: Optional[Union[str, FormatTimeCallable]] = None,\n level: TextType = \"\",\n path: Optional[str] = None,\n line_no: Optional[int] = None,\n link_path: Optional[str] = None,\n ) -> \"Table\":\n from .containers import Renderables\n from .table import Table\n\n output = Table.grid(padding=(0, 1))\n output.expand = True\n if self.show_time:\n output.add_column(style=\"log.time\")\n if self.show_level:\n output.add_column(style=\"log.level\", width=self.level_width)\n output.add_column(ratio=1, style=\"log.message\", overflow=\"fold\")\n if self.show_path and path:\n output.add_column(style=\"log.path\")\n row: List[\"RenderableType\"] = []\n if self.show_time:\n log_time = log_time or console.get_datetime()\n time_format = time_format or self.time_format\n if callable(time_format):\n log_time_display = time_format(log_time)\n else:\n log_time_display = Text(log_time.strftime(time_format))\n if log_time_display == self._last_time and self.omit_repeated_times:\n row.append(Text(\" \" * len(log_time_display)))\n else:\n row.append(log_time_display)\n self._last_time = log_time_display\n if self.show_level:\n row.append(level)\n\n row.append(Renderables(renderables))\n if self.show_path and path:\n path_text = Text()\n path_text.append(\n path, style=f\"link file://{link_path}\" if link_path else \"\"\n )\n if line_no:\n path_text.append(\":\")\n path_text.append(\n f\"{line_no}\",\n style=f\"link file://{link_path}#{line_no}\" if link_path else \"\",\n )\n row.append(path_text)\n\n output.add_row(*row)\n return output\n\n\nif __name__ == \"__main__\": # pragma: no cover\n from pip._vendor.rich.console import Console\n\n c = Console()\n c.print(\"[on blue]Hello\", justify=\"right\")\n c.log(\"[on blue]hello\", justify=\"right\")\n",[],[216,809,810,811,890,891,1058,1224],"0b393f08-67fc-11f0-a7d9-0224a6c84d84","_fileno.py","0b393fa8-67fc-11f0-a7d9-0224a6c84d84",410,["D",1753299266442],"from __future__ import annotations\n\nfrom typing import IO, Callable\n\n\ndef get_fileno(file_like: IO[str]) -> int | None:\n \"\"\"Get fileno() from a file, accounting for poorly implemented file-like objects.\n\n Args:\n file_like (IO): A file-like object.\n\n Returns:\n int | None: The result of fileno if available, or None if operation failed.\n \"\"\"\n fileno: Callable[[], int] | None = getattr(file_like, \"fileno\", None)\n if fileno is not None:\n try:\n return fileno()\n except Exception:\n # `fileno` is documented as potentially raising a OSError\n # Alas, from the issues, there are so many poorly implemented file-like objects,\n # that `fileno()` can raise just about anything.\n return None\n return None\n",[],[216,809,810,811,890,891,1058,1232],"0b5ea87e-67fc-11f0-a7d9-0224a6c84d84","_emoji_replace.py","0b5ea978-67fc-11f0-a7d9-0224a6c84d84",416,["D",1753299266856],"from typing import Callable, Match, Optional\nimport re\n\nfrom ._emoji_codes import EMOJI\n\n\n_ReStringMatch = Match[str] # regex match object\n_ReSubCallable = Callable[[_ReStringMatch], str] # Callable invoked by re.sub\n_EmojiSubMethod = Callable[[_ReSubCallable, str], str] # Sub method of a compiled re\n\n\ndef _emoji_replace(\n text: str,\n default_variant: Optional[str] = None,\n _emoji_sub: _EmojiSubMethod = re.compile(r\"(:(\\S*?)(?:(?:\\-)(emoji|text))?:)\").sub,\n) -> str:\n \"\"\"Replace emoji code in text.\"\"\"\n get_emoji = EMOJI.__getitem__\n variants = {\"text\": \"\\uFE0E\", \"emoji\": \"\\uFE0F\"}\n get_variant = variants.get\n default_variant_code = variants.get(default_variant, \"\") if default_variant else \"\"\n\n def do_replace(match: Match[str]) -> str:\n emoji_code, emoji_name, variant = match.groups()\n try:\n return get_emoji(emoji_name.lower()) + get_variant(\n variant, default_variant_code\n )\n except KeyError:\n return emoji_code\n\n return _emoji_sub(do_replace, text)\n",[],[216,809,810,811,890,891,1058,1240],"feb14a0a-67fb-11f0-b5ac-0224a6c84d84",83,["D",1753299245576],[568,569,570,571,572,573,574,575,576,577,578,579,580,581,582,583,584,585,586,587,588,589,590,591,592],[216,809,810,811,890,891,1058],"036e5be6-67fc-11f0-928e-0224a6c84d84","resolvers","036e5c90-67fc-11f0-928e-0224a6c84d84","ff116098-67fb-11f0-9c7e-0224a6c84d84",104,["D",1753299253538],[],[216,809,810,811,890,891,1260,1253],"resolvelib","ff115fd0-67fb-11f0-9c7e-0224a6c84d84",87,["D",1753299246219],[566],[216,809,810,811,890,891,1260],"0a6159ee-67fc-11f0-8cd1-0224a6c84d84","utils.py","0a615aac-67fc-11f0-8cd1-0224a6c84d84","fe4aa57a-67fb-11f0-847e-0224a6c84d84",379,["D",1753299265190],"\"\"\"\nrequests.utils\n~~~~~~~~~~~~~~\n\nThis module provides utility functions that are used within Requests\nthat are also useful for external consumption.\n\"\"\"\n\nimport codecs\nimport contextlib\nimport io\nimport os\nimport re\nimport socket\nimport struct\nimport sys\nimport tempfile\nimport warnings\nimport zipfile\nfrom collections import OrderedDict\n\nfrom pip._vendor.urllib3.util import make_headers, parse_url\n\nfrom . import certs\nfrom .__version__ import __version__\n\n# to_native_string is unused here, but imported here for backwards compatibility\nfrom ._internal_utils import ( # noqa: F401\n _HEADER_VALIDATORS_BYTE,\n _HEADER_VALIDATORS_STR,\n HEADER_VALIDATORS,\n to_native_string,\n)\nfrom .compat import (\n Mapping,\n basestring,\n bytes,\n getproxies,\n getproxies_environment,\n integer_types,\n)\nfrom .compat import parse_http_list as _parse_list_header\nfrom .compat import (\n proxy_bypass,\n proxy_bypass_environment,\n quote,\n str,\n unquote,\n urlparse,\n urlunparse,\n)\nfrom .cookies import cookiejar_from_dict\nfrom .exceptions import (\n FileModeWarning,\n InvalidHeader,\n InvalidURL,\n UnrewindableBodyError,\n)\nfrom .structures import CaseInsensitiveDict\n\nNETRC_FILES = (\".netrc\", \"_netrc\")\n\nDEFAULT_CA_BUNDLE_PATH = certs.where()\n\nDEFAULT_PORTS = {\"http\": 80, \"https\": 443}\n\n# Ensure that ', ' is used to preserve previous delimiter behavior.\nDEFAULT_ACCEPT_ENCODING = \", \".join(\n re.split(r\",\\s*\", make_headers(accept_encoding=True)[\"accept-encoding\"])\n)\n\n\nif sys.platform == \"win32\":\n # provide a proxy_bypass version on Windows without DNS lookups\n\n def proxy_bypass_registry(host):\n try:\n import winreg\n except ImportError:\n return False\n\n try:\n internetSettings = winreg.OpenKey(\n winreg.HKEY_CURRENT_USER,\n r\"Software\\Microsoft\\Windows\\CurrentVersion\\Internet Settings\",\n )\n # ProxyEnable could be REG_SZ or REG_DWORD, normalizing it\n proxyEnable = int(winreg.QueryValueEx(internetSettings, \"ProxyEnable\")[0])\n # ProxyOverride is almost always a string\n proxyOverride = winreg.QueryValueEx(internetSettings, \"ProxyOverride\")[0]\n except (OSError, ValueError):\n return False\n if not proxyEnable or not proxyOverride:\n return False\n\n # make a check value list from the registry entry: replace the\n # '' string by the localhost entry and the corresponding\n # canonical entry.\n proxyOverride = proxyOverride.split(\";\")\n # filter out empty strings to avoid re.match return true in the following code.\n proxyOverride = filter(None, proxyOverride)\n # now check if we match one of the registry values.\n for test in proxyOverride:\n if test == \"\":\n if \".\" not in host:\n return True\n test = test.replace(\".\", r\"\\.\") # mask dots\n test = test.replace(\"*\", r\".*\") # change glob sequence\n test = test.replace(\"?\", r\".\") # change glob char\n if re.match(test, host, re.I):\n return True\n return False\n\n def proxy_bypass(host): # noqa\n \"\"\"Return True, if the host should be bypassed.\n\n Checks proxy settings gathered from the environment, if specified,\n or the registry.\n \"\"\"\n if getproxies_environment():\n return proxy_bypass_environment(host)\n else:\n return proxy_bypass_registry(host)\n\n\ndef dict_to_sequence(d):\n \"\"\"Returns an internal sequence dictionary update.\"\"\"\n\n if hasattr(d, \"items\"):\n d = d.items()\n\n return d\n\n\ndef super_len(o):\n total_length = None\n current_position = 0\n\n if isinstance(o, str):\n o = o.encode(\"utf-8\")\n\n if hasattr(o, \"__len__\"):\n total_length = len(o)\n\n elif hasattr(o, \"len\"):\n total_length = o.len\n\n elif hasattr(o, \"fileno\"):\n try:\n fileno = o.fileno()\n except (io.UnsupportedOperation, AttributeError):\n # AttributeError is a surprising exception, seeing as how we've just checked\n # that `hasattr(o, 'fileno')`. It happens for objects obtained via\n # `Tarfile.extractfile()`, per issue 5229.\n pass\n else:\n total_length = os.fstat(fileno).st_size\n\n # Having used fstat to determine the file length, we need to\n # confirm that this file was opened up in binary mode.\n if \"b\" not in o.mode:\n warnings.warn(\n (\n \"Requests has determined the content-length for this \"\n \"request using the binary size of the file: however, the \"\n \"file has been opened in text mode (i.e. without the 'b' \"\n \"flag in the mode). This may lead to an incorrect \"\n \"content-length. In Requests 3.0, support will be removed \"\n \"for files in text mode.\"\n ),\n FileModeWarning,\n )\n\n if hasattr(o, \"tell\"):\n try:\n current_position = o.tell()\n except OSError:\n # This can happen in some weird situations, such as when the file\n # is actually a special file descriptor like stdin. In this\n # instance, we don't know what the length is, so set it to zero and\n # let requests chunk it instead.\n if total_length is not None:\n current_position = total_length\n else:\n if hasattr(o, \"seek\") and total_length is None:\n # StringIO and BytesIO have seek but no usable fileno\n try:\n # seek to end of file\n o.seek(0, 2)\n total_length = o.tell()\n\n # seek back to current position to support\n # partially read file-like objects\n o.seek(current_position or 0)\n except OSError:\n total_length = 0\n\n if total_length is None:\n total_length = 0\n\n return max(0, total_length - current_position)\n\n\ndef get_netrc_auth(url, raise_errors=False):\n \"\"\"Returns the Requests tuple auth for a given url from netrc.\"\"\"\n\n netrc_file = os.environ.get(\"NETRC\")\n if netrc_file is not None:\n netrc_locations = (netrc_file,)\n else:\n netrc_locations = (f\"~/{f}\" for f in NETRC_FILES)\n\n try:\n from netrc import NetrcParseError, netrc\n\n netrc_path = None\n\n for f in netrc_locations:\n try:\n loc = os.path.expanduser(f)\n except KeyError:\n # os.path.expanduser can fail when $HOME is undefined and\n # getpwuid fails. See https://bugs.python.org/issue20164 &\n # https://github.com/psf/requests/issues/1846\n return\n\n if os.path.exists(loc):\n netrc_path = loc\n break\n\n # Abort early if there isn't one.\n if netrc_path is None:\n return\n\n ri = urlparse(url)\n\n # Strip port numbers from netloc. This weird `if...encode`` dance is\n # used for Python 3.2, which doesn't support unicode literals.\n splitstr = b\":\"\n if isinstance(url, str):\n splitstr = splitstr.decode(\"ascii\")\n host = ri.netloc.split(splitstr)[0]\n\n try:\n _netrc = netrc(netrc_path).authenticators(host)\n if _netrc:\n # Return with login / password\n login_i = 0 if _netrc[0] else 1\n return (_netrc[login_i], _netrc[2])\n except (NetrcParseError, OSError):\n # If there was a parsing error or a permissions issue reading the file,\n # we'll just skip netrc auth unless explicitly asked to raise errors.\n if raise_errors:\n raise\n\n # App Engine hackiness.\n except (ImportError, AttributeError):\n pass\n\n\ndef guess_filename(obj):\n \"\"\"Tries to guess the filename of the given object.\"\"\"\n name = getattr(obj, \"name\", None)\n if name and isinstance(name, basestring) and name[0] != \"<\" and name[-1] != \">\":\n return os.path.basename(name)\n\n\ndef extract_zipped_paths(path):\n \"\"\"Replace nonexistent paths that look like they refer to a member of a zip\n archive with the location of an extracted copy of the target, or else\n just return the provided path unchanged.\n \"\"\"\n if os.path.exists(path):\n # this is already a valid path, no need to do anything further\n return path\n\n # find the first valid part of the provided path and treat that as a zip archive\n # assume the rest of the path is the name of a member in the archive\n archive, member = os.path.split(path)\n while archive and not os.path.exists(archive):\n archive, prefix = os.path.split(archive)\n if not prefix:\n # If we don't check for an empty prefix after the split (in other words, archive remains unchanged after the split),\n # we _can_ end up in an infinite loop on a rare corner case affecting a small number of users\n break\n member = \"/\".join([prefix, member])\n\n if not zipfile.is_zipfile(archive):\n return path\n\n zip_file = zipfile.ZipFile(archive)\n if member not in zip_file.namelist():\n return path\n\n # we have a valid zip archive and a valid member of that archive\n tmp = tempfile.gettempdir()\n extracted_path = os.path.join(tmp, member.split(\"/\")[-1])\n if not os.path.exists(extracted_path):\n # use read + write to avoid the creating nested folders, we only want the file, avoids mkdir racing condition\n with atomic_open(extracted_path) as file_handler:\n file_handler.write(zip_file.read(member))\n return extracted_path\n\n\n@contextlib.contextmanager\ndef atomic_open(filename):\n \"\"\"Write a file to the disk in an atomic fashion\"\"\"\n tmp_descriptor, tmp_name = tempfile.mkstemp(dir=os.path.dirname(filename))\n try:\n with os.fdopen(tmp_descriptor, \"wb\") as tmp_handler:\n yield tmp_handler\n os.replace(tmp_name, filename)\n except BaseException:\n os.remove(tmp_name)\n raise\n\n\ndef from_key_val_list(value):\n \"\"\"Take an object and test to see if it can be represented as a\n dictionary. Unless it can not be represented as such, return an\n OrderedDict, e.g.,\n\n ::\n\n >>> from_key_val_list([('key', 'val')])\n OrderedDict([('key', 'val')])\n >>> from_key_val_list('string')\n Traceback (most recent call last):\n ...\n ValueError: cannot encode objects that are not 2-tuples\n >>> from_key_val_list({'key': 'val'})\n OrderedDict([('key', 'val')])\n\n :rtype: OrderedDict\n \"\"\"\n if value is None:\n return None\n\n if isinstance(value, (str, bytes, bool, int)):\n raise ValueError(\"cannot encode objects that are not 2-tuples\")\n\n return OrderedDict(value)\n\n\ndef to_key_val_list(value):\n \"\"\"Take an object and test to see if it can be represented as a\n dictionary. If it can be, return a list of tuples, e.g.,\n\n ::\n\n >>> to_key_val_list([('key', 'val')])\n [('key', 'val')]\n >>> to_key_val_list({'key': 'val'})\n [('key', 'val')]\n >>> to_key_val_list('string')\n Traceback (most recent call last):\n ...\n ValueError: cannot encode objects that are not 2-tuples\n\n :rtype: list\n \"\"\"\n if value is None:\n return None\n\n if isinstance(value, (str, bytes, bool, int)):\n raise ValueError(\"cannot encode objects that are not 2-tuples\")\n\n if isinstance(value, Mapping):\n value = value.items()\n\n return list(value)\n\n\n# From mitsuhiko/werkzeug (used with permission).\ndef parse_list_header(value):\n \"\"\"Parse lists as described by RFC 2068 Section 2.\n\n In particular, parse comma-separated lists where the elements of\n the list may include quoted-strings. A quoted-string could\n contain a comma. A non-quoted string could have quotes in the\n middle. Quotes are removed automatically after parsing.\n\n It basically works like :func:`parse_set_header` just that items\n may appear multiple times and case sensitivity is preserved.\n\n The return value is a standard :class:`list`:\n\n >>> parse_list_header('token, \"quoted value\"')\n ['token', 'quoted value']\n\n To create a header from the :class:`list` again, use the\n :func:`dump_header` function.\n\n :param value: a string with a list header.\n :return: :class:`list`\n :rtype: list\n \"\"\"\n result = []\n for item in _parse_list_header(value):\n if item[:1] == item[-1:] == '\"':\n item = unquote_header_value(item[1:-1])\n result.append(item)\n return result\n\n\n# From mitsuhiko/werkzeug (used with permission).\ndef parse_dict_header(value):\n \"\"\"Parse lists of key, value pairs as described by RFC 2068 Section 2 and\n convert them into a python dict:\n\n >>> d = parse_dict_header('foo=\"is a fish\", bar=\"as well\"')\n >>> type(d) is dict\n True\n >>> sorted(d.items())\n [('bar', 'as well'), ('foo', 'is a fish')]\n\n If there is no value for a key it will be `None`:\n\n >>> parse_dict_header('key_without_value')\n {'key_without_value': None}\n\n To create a header from the :class:`dict` again, use the\n :func:`dump_header` function.\n\n :param value: a string with a dict header.\n :return: :class:`dict`\n :rtype: dict\n \"\"\"\n result = {}\n for item in _parse_list_header(value):\n if \"=\" not in item:\n result[item] = None\n continue\n name, value = item.split(\"=\", 1)\n if value[:1] == value[-1:] == '\"':\n value = unquote_header_value(value[1:-1])\n result[name] = value\n return result\n\n\n# From mitsuhiko/werkzeug (used with permission).\ndef unquote_header_value(value, is_filename=False):\n r\"\"\"Unquotes a header value. (Reversal of :func:`quote_header_value`).\n This does not use the real unquoting but what browsers are actually\n using for quoting.\n\n :param value: the header value to unquote.\n :rtype: str\n \"\"\"\n if value and value[0] == value[-1] == '\"':\n # this is not the real unquoting, but fixing this so that the\n # RFC is met will result in bugs with internet explorer and\n # probably some other browsers as well. IE for example is\n # uploading files with \"C:\\foo\\bar.txt\" as filename\n value = value[1:-1]\n\n # if this is a filename and the starting characters look like\n # a UNC path, then just return the value without quotes. Using the\n # replace sequence below on a UNC path has the effect of turning\n # the leading double slash into a single slash and then\n # _fix_ie_filename() doesn't work correctly. See #458.\n if not is_filename or value[:2] != \"\\\\\\\\\":\n return value.replace(\"\\\\\\\\\", \"\\\\\").replace('\\\\\"', '\"')\n return value\n\n\ndef dict_from_cookiejar(cj):\n \"\"\"Returns a key/value dictionary from a CookieJar.\n\n :param cj: CookieJar object to extract cookies from.\n :rtype: dict\n \"\"\"\n\n cookie_dict = {cookie.name: cookie.value for cookie in cj}\n return cookie_dict\n\n\ndef add_dict_to_cookiejar(cj, cookie_dict):\n \"\"\"Returns a CookieJar from a key/value dictionary.\n\n :param cj: CookieJar to insert cookies into.\n :param cookie_dict: Dict of key/values to insert into CookieJar.\n :rtype: CookieJar\n \"\"\"\n\n return cookiejar_from_dict(cookie_dict, cj)\n\n\ndef get_encodings_from_content(content):\n \"\"\"Returns encodings from given content string.\n\n :param content: bytestring to extract encodings from.\n \"\"\"\n warnings.warn(\n (\n \"In requests 3.0, get_encodings_from_content will be removed. For \"\n \"more information, please see the discussion on issue #2266. (This\"\n \" warning should only appear once.)\"\n ),\n DeprecationWarning,\n )\n\n charset_re = re.compile(r']', flags=re.I)\n pragma_re = re.compile(r']', flags=re.I)\n xml_re = re.compile(r'^<\\?xml.*?encoding=[\"\\']*(.+?)[\"\\'>]')\n\n return (\n charset_re.findall(content)\n + pragma_re.findall(content)\n + xml_re.findall(content)\n )\n\n\ndef _parse_content_type_header(header):\n \"\"\"Returns content type and parameters from given header\n\n :param header: string\n :return: tuple containing content type and dictionary of\n parameters\n \"\"\"\n\n tokens = header.split(\";\")\n content_type, params = tokens[0].strip(), tokens[1:]\n params_dict = {}\n items_to_strip = \"\\\"' \"\n\n for param in params:\n param = param.strip()\n if param:\n key, value = param, True\n index_of_equals = param.find(\"=\")\n if index_of_equals != -1:\n key = param[:index_of_equals].strip(items_to_strip)\n value = param[index_of_equals + 1 :].strip(items_to_strip)\n params_dict[key.lower()] = value\n return content_type, params_dict\n\n\ndef get_encoding_from_headers(headers):\n \"\"\"Returns encodings from given HTTP Header Dict.\n\n :param headers: dictionary to extract encoding from.\n :rtype: str\n \"\"\"\n\n content_type = headers.get(\"content-type\")\n\n if not content_type:\n return None\n\n content_type, params = _parse_content_type_header(content_type)\n\n if \"charset\" in params:\n return params[\"charset\"].strip(\"'\\\"\")\n\n if \"text\" in content_type:\n return \"ISO-8859-1\"\n\n if \"application/json\" in content_type:\n # Assume UTF-8 based on RFC 4627: https://www.ietf.org/rfc/rfc4627.txt since the charset was unset\n return \"utf-8\"\n\n\ndef stream_decode_response_unicode(iterator, r):\n \"\"\"Stream decodes an iterator.\"\"\"\n\n if r.encoding is None:\n yield from iterator\n return\n\n decoder = codecs.getincrementaldecoder(r.encoding)(errors=\"replace\")\n for chunk in iterator:\n rv = decoder.decode(chunk)\n if rv:\n yield rv\n rv = decoder.decode(b\"\", final=True)\n if rv:\n yield rv\n\n\ndef iter_slices(string, slice_length):\n \"\"\"Iterate over slices of a string.\"\"\"\n pos = 0\n if slice_length is None or slice_length <= 0:\n slice_length = len(string)\n while pos < len(string):\n yield string[pos : pos + slice_length]\n pos += slice_length\n\n\ndef get_unicode_from_response(r):\n \"\"\"Returns the requested content back in unicode.\n\n :param r: Response object to get unicode content from.\n\n Tried:\n\n 1. charset from content-type\n 2. fall back and replace all unicode characters\n\n :rtype: str\n \"\"\"\n warnings.warn(\n (\n \"In requests 3.0, get_unicode_from_response will be removed. For \"\n \"more information, please see the discussion on issue #2266. (This\"\n \" warning should only appear once.)\"\n ),\n DeprecationWarning,\n )\n\n tried_encodings = []\n\n # Try charset from content-type\n encoding = get_encoding_from_headers(r.headers)\n\n if encoding:\n try:\n return str(r.content, encoding)\n except UnicodeError:\n tried_encodings.append(encoding)\n\n # Fall back:\n try:\n return str(r.content, encoding, errors=\"replace\")\n except TypeError:\n return r.content\n\n\n# The unreserved URI characters (RFC 3986)\nUNRESERVED_SET = frozenset(\n \"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz\" + \"0123456789-._~\"\n)\n\n\ndef unquote_unreserved(uri):\n \"\"\"Un-escape any percent-escape sequences in a URI that are unreserved\n characters. This leaves all reserved, illegal and non-ASCII bytes encoded.\n\n :rtype: str\n \"\"\"\n parts = uri.split(\"%\")\n for i in range(1, len(parts)):\n h = parts[i][0:2]\n if len(h) == 2 and h.isalnum():\n try:\n c = chr(int(h, 16))\n except ValueError:\n raise InvalidURL(f\"Invalid percent-escape sequence: '{h}'\")\n\n if c in UNRESERVED_SET:\n parts[i] = c + parts[i][2:]\n else:\n parts[i] = f\"%{parts[i]}\"\n else:\n parts[i] = f\"%{parts[i]}\"\n return \"\".join(parts)\n\n\ndef requote_uri(uri):\n \"\"\"Re-quote the given URI.\n\n This function passes the given URI through an unquote/quote cycle to\n ensure that it is fully and consistently quoted.\n\n :rtype: str\n \"\"\"\n safe_with_percent = \"!#$%&'()*+,/:;=?@[]~\"\n safe_without_percent = \"!#$&'()*+,/:;=?@[]~\"\n try:\n # Unquote only the unreserved characters\n # Then quote only illegal characters (do not quote reserved,\n # unreserved, or '%')\n return quote(unquote_unreserved(uri), safe=safe_with_percent)\n except InvalidURL:\n # We couldn't unquote the given URI, so let's try quoting it, but\n # there may be unquoted '%'s in the URI. We need to make sure they're\n # properly quoted so they do not cause issues elsewhere.\n return quote(uri, safe=safe_without_percent)\n\n\ndef address_in_network(ip, net):\n \"\"\"This function allows you to check if an IP belongs to a network subnet\n\n Example: returns True if ip = 192.168.1.1 and net = 192.168.1.0/24\n returns False if ip = 192.168.1.1 and net = 192.168.100.0/24\n\n :rtype: bool\n \"\"\"\n ipaddr = struct.unpack(\"=L\", socket.inet_aton(ip))[0]\n netaddr, bits = net.split(\"/\")\n netmask = struct.unpack(\"=L\", socket.inet_aton(dotted_netmask(int(bits))))[0]\n network = struct.unpack(\"=L\", socket.inet_aton(netaddr))[0] & netmask\n return (ipaddr & netmask) == (network & netmask)\n\n\ndef dotted_netmask(mask):\n \"\"\"Converts mask from /xx format to xxx.xxx.xxx.xxx\n\n Example: if mask is 24 function returns 255.255.255.0\n\n :rtype: str\n \"\"\"\n bits = 0xFFFFFFFF ^ (1 << 32 - mask) - 1\n return socket.inet_ntoa(struct.pack(\">I\", bits))\n\n\ndef is_ipv4_address(string_ip):\n \"\"\"\n :rtype: bool\n \"\"\"\n try:\n socket.inet_aton(string_ip)\n except OSError:\n return False\n return True\n\n\ndef is_valid_cidr(string_network):\n \"\"\"\n Very simple check of the cidr format in no_proxy variable.\n\n :rtype: bool\n \"\"\"\n if string_network.count(\"/\") == 1:\n try:\n mask = int(string_network.split(\"/\")[1])\n except ValueError:\n return False\n\n if mask < 1 or mask > 32:\n return False\n\n try:\n socket.inet_aton(string_network.split(\"/\")[0])\n except OSError:\n return False\n else:\n return False\n return True\n\n\n@contextlib.contextmanager\ndef set_environ(env_name, value):\n \"\"\"Set the environment variable 'env_name' to 'value'\n\n Save previous value, yield, and then restore the previous value stored in\n the environment variable 'env_name'.\n\n If 'value' is None, do nothing\"\"\"\n value_changed = value is not None\n if value_changed:\n old_value = os.environ.get(env_name)\n os.environ[env_name] = value\n try:\n yield\n finally:\n if value_changed:\n if old_value is None:\n del os.environ[env_name]\n else:\n os.environ[env_name] = old_value\n\n\ndef should_bypass_proxies(url, no_proxy):\n \"\"\"\n Returns whether we should bypass proxies or not.\n\n :rtype: bool\n \"\"\"\n\n # Prioritize lowercase environment variables over uppercase\n # to keep a consistent behaviour with other http projects (curl, wget).\n def get_proxy(key):\n return os.environ.get(key) or os.environ.get(key.upper())\n\n # First check whether no_proxy is defined. If it is, check that the URL\n # we're getting isn't in the no_proxy list.\n no_proxy_arg = no_proxy\n if no_proxy is None:\n no_proxy = get_proxy(\"no_proxy\")\n parsed = urlparse(url)\n\n if parsed.hostname is None:\n # URLs don't always have hostnames, e.g. file:/// urls.\n return True\n\n if no_proxy:\n # We need to check whether we match here. We need to see if we match\n # the end of the hostname, both with and without the port.\n no_proxy = (host for host in no_proxy.replace(\" \", \"\").split(\",\") if host)\n\n if is_ipv4_address(parsed.hostname):\n for proxy_ip in no_proxy:\n if is_valid_cidr(proxy_ip):\n if address_in_network(parsed.hostname, proxy_ip):\n return True\n elif parsed.hostname == proxy_ip:\n # If no_proxy ip was defined in plain IP notation instead of cidr notation &\n # matches the IP of the index\n return True\n else:\n host_with_port = parsed.hostname\n if parsed.port:\n host_with_port += f\":{parsed.port}\"\n\n for host in no_proxy:\n if parsed.hostname.endswith(host) or host_with_port.endswith(host):\n # The URL does match something in no_proxy, so we don't want\n # to apply the proxies on this URL.\n return True\n\n with set_environ(\"no_proxy\", no_proxy_arg):\n # parsed.hostname can be `None` in cases such as a file URI.\n try:\n bypass = proxy_bypass(parsed.hostname)\n except (TypeError, socket.gaierror):\n bypass = False\n\n if bypass:\n return True\n\n return False\n\n\ndef get_environ_proxies(url, no_proxy=None):\n \"\"\"\n Return a dict of environment proxies.\n\n :rtype: dict\n \"\"\"\n if should_bypass_proxies(url, no_proxy=no_proxy):\n return {}\n else:\n return getproxies()\n\n\ndef select_proxy(url, proxies):\n \"\"\"Select a proxy for the url, if applicable.\n\n :param url: The url being for the request\n :param proxies: A dictionary of schemes or schemes and hosts to proxy URLs\n \"\"\"\n proxies = proxies or {}\n urlparts = urlparse(url)\n if urlparts.hostname is None:\n return proxies.get(urlparts.scheme, proxies.get(\"all\"))\n\n proxy_keys = [\n urlparts.scheme + \"://\" + urlparts.hostname,\n urlparts.scheme,\n \"all://\" + urlparts.hostname,\n \"all\",\n ]\n proxy = None\n for proxy_key in proxy_keys:\n if proxy_key in proxies:\n proxy = proxies[proxy_key]\n break\n\n return proxy\n\n\ndef resolve_proxies(request, proxies, trust_env=True):\n \"\"\"This method takes proxy information from a request and configuration\n input to resolve a mapping of target proxies. This will consider settings\n such as NO_PROXY to strip proxy configurations.\n\n :param request: Request or PreparedRequest\n :param proxies: A dictionary of schemes or schemes and hosts to proxy URLs\n :param trust_env: Boolean declaring whether to trust environment configs\n\n :rtype: dict\n \"\"\"\n proxies = proxies if proxies is not None else {}\n url = request.url\n scheme = urlparse(url).scheme\n no_proxy = proxies.get(\"no_proxy\")\n new_proxies = proxies.copy()\n\n if trust_env and not should_bypass_proxies(url, no_proxy=no_proxy):\n environ_proxies = get_environ_proxies(url, no_proxy=no_proxy)\n\n proxy = environ_proxies.get(scheme, environ_proxies.get(\"all\"))\n\n if proxy:\n new_proxies.setdefault(scheme, proxy)\n return new_proxies\n\n\ndef default_user_agent(name=\"python-requests\"):\n \"\"\"\n Return a string representing the default user agent.\n\n :rtype: str\n \"\"\"\n return f\"{name}/{__version__}\"\n\n\ndef default_headers():\n \"\"\"\n :rtype: requests.structures.CaseInsensitiveDict\n \"\"\"\n return CaseInsensitiveDict(\n {\n \"User-Agent\": default_user_agent(),\n \"Accept-Encoding\": DEFAULT_ACCEPT_ENCODING,\n \"Accept\": \"*/*\",\n \"Connection\": \"keep-alive\",\n }\n )\n\n\ndef parse_header_links(value):\n \"\"\"Return a list of parsed link headers proxies.\n\n i.e. Link: ; rel=front; type=\"image/jpeg\",; rel=back;type=\"image/jpeg\"\n\n :rtype: list\n \"\"\"\n\n links = []\n\n replace_chars = \" '\\\"\"\n\n value = value.strip(replace_chars)\n if not value:\n return links\n\n for val in re.split(\", *<\", value):\n try:\n url, params = val.split(\";\", 1)\n except ValueError:\n url, params = val, \"\"\n\n link = {\"url\": url.strip(\"<> '\\\"\")}\n\n for param in params.split(\";\"):\n try:\n key, value = param.split(\"=\")\n except ValueError:\n break\n\n link[key.strip(replace_chars)] = value.strip(replace_chars)\n\n links.append(link)\n\n return links\n\n\n# Null bytes; no need to recreate these on each call to guess_json_utf\n_null = \"\\x00\".encode(\"ascii\") # encoding to ASCII for Python 3\n_null2 = _null * 2\n_null3 = _null * 3\n\n\ndef guess_json_utf(data):\n \"\"\"\n :rtype: str\n \"\"\"\n # JSON always starts with two ASCII characters, so detection is as\n # easy as counting the nulls and from their location and count\n # determine the encoding. Also detect a BOM, if present.\n sample = data[:4]\n if sample in (codecs.BOM_UTF32_LE, codecs.BOM_UTF32_BE):\n return \"utf-32\" # BOM included\n if sample[:3] == codecs.BOM_UTF8:\n return \"utf-8-sig\" # BOM included, MS style (discouraged)\n if sample[:2] in (codecs.BOM_UTF16_LE, codecs.BOM_UTF16_BE):\n return \"utf-16\" # BOM included\n nullcount = sample.count(_null)\n if nullcount == 0:\n return \"utf-8\"\n if nullcount == 2:\n if sample[::2] == _null2: # 1st and 3rd are null\n return \"utf-16-be\"\n if sample[1::2] == _null2: # 2nd and 4th are null\n return \"utf-16-le\"\n # Did not detect 2 valid UTF-16 ascii-range characters\n if nullcount == 3:\n if sample[:3] == _null3:\n return \"utf-32-be\"\n if sample[1:] == _null3:\n return \"utf-32-le\"\n # Did not detect a valid UTF-32 ascii-range character\n return None\n\n\ndef prepend_scheme_if_needed(url, new_scheme):\n \"\"\"Given a URL that may or may not have a scheme, prepend the given scheme.\n Does not replace a present scheme with the one provided as an argument.\n\n :rtype: str\n \"\"\"\n parsed = parse_url(url)\n scheme, auth, host, port, path, query, fragment = parsed\n\n # A defect in urlparse determines that there isn't a netloc present in some\n # urls. We previously assumed parsing was overly cautious, and swapped the\n # netloc and path. Due to a lack of tests on the original defect, this is\n # maintained with parse_url for backwards compatibility.\n netloc = parsed.netloc\n if not netloc:\n netloc, path = path, netloc\n\n if auth:\n # parse_url doesn't provide the netloc with auth\n # so we'll add it ourselves.\n netloc = \"@\".join([auth, netloc])\n if scheme is None:\n scheme = new_scheme\n if path is None:\n path = \"\"\n\n return urlunparse((scheme, netloc, path, \"\", query, fragment))\n\n\ndef get_auth_from_url(url):\n \"\"\"Given a url with authentication components, extract them into a tuple of\n username,password.\n\n :rtype: (str,str)\n \"\"\"\n parsed = urlparse(url)\n\n try:\n auth = (unquote(parsed.username), unquote(parsed.password))\n except (AttributeError, TypeError):\n auth = (\"\", \"\")\n\n return auth\n\n\ndef check_header_validity(header):\n \"\"\"Verifies that header parts don't contain leading whitespace\n reserved characters, or return characters.\n\n :param header: tuple, in the format (name, value).\n \"\"\"\n name, value = header\n _validate_header_part(header, name, 0)\n _validate_header_part(header, value, 1)\n\n\ndef _validate_header_part(header, header_part, header_validator_index):\n if isinstance(header_part, str):\n validator = _HEADER_VALIDATORS_STR[header_validator_index]\n elif isinstance(header_part, bytes):\n validator = _HEADER_VALIDATORS_BYTE[header_validator_index]\n else:\n raise InvalidHeader(\n f\"Header part ({header_part!r}) from {header} \"\n f\"must be of type str or bytes, not {type(header_part)}\"\n )\n\n if not validator.match(header_part):\n header_kind = \"name\" if header_validator_index == 0 else \"value\"\n raise InvalidHeader(\n f\"Invalid leading whitespace, reserved character(s), or return \"\n f\"character(s) in header {header_kind}: {header_part!r}\"\n )\n\n\ndef urldefragauth(url):\n \"\"\"\n Given a url remove the fragment and the authentication part.\n\n :rtype: str\n \"\"\"\n scheme, netloc, path, params, query, fragment = urlparse(url)\n\n # see func:`prepend_scheme_if_needed`\n if not netloc:\n netloc, path = path, netloc\n\n netloc = netloc.rsplit(\"@\", 1)[-1]\n\n return urlunparse((scheme, netloc, path, params, query, \"\"))\n\n\ndef rewind_body(prepared_request):\n \"\"\"Move file pointer back to its recorded starting position\n so it can be read again on redirect.\n \"\"\"\n body_seek = getattr(prepared_request.body, \"seek\", None)\n if body_seek is not None and isinstance(\n prepared_request._body_position, integer_types\n ):\n try:\n body_seek(prepared_request._body_position)\n except OSError:\n raise UnrewindableBodyError(\n \"An error occurred when rewinding request body for redirect.\"\n )\n else:\n raise UnrewindableBodyError(\"Unable to rewind request body for redirect.\")\n",[],[216,809,810,811,890,891,1275,1267],"requests","0a74c7ae-67fc-11f0-805e-0224a6c84d84","structures.py","0a74c858-67fc-11f0-805e-0224a6c84d84",382,["D",1753299265325],"\"\"\"\nrequests.structures\n~~~~~~~~~~~~~~~~~~~\n\nData structures that power Requests.\n\"\"\"\n\nfrom collections import OrderedDict\n\nfrom .compat import Mapping, MutableMapping\n\n\nclass CaseInsensitiveDict(MutableMapping):\n \"\"\"A case-insensitive ``dict``-like object.\n\n Implements all methods and operations of\n ``MutableMapping`` as well as dict's ``copy``. Also\n provides ``lower_items``.\n\n All keys are expected to be strings. The structure remembers the\n case of the last key to be set, and ``iter(instance)``,\n ``keys()``, ``items()``, ``iterkeys()``, and ``iteritems()``\n will contain case-sensitive keys. However, querying and contains\n testing is case insensitive::\n\n cid = CaseInsensitiveDict()\n cid['Accept'] = 'application/json'\n cid['aCCEPT'] == 'application/json' # True\n list(cid) == ['Accept'] # True\n\n For example, ``headers['content-encoding']`` will return the\n value of a ``'Content-Encoding'`` response header, regardless\n of how the header name was originally stored.\n\n If the constructor, ``.update``, or equality comparison\n operations are given keys that have equal ``.lower()``s, the\n behavior is undefined.\n \"\"\"\n\n def __init__(self, data=None, **kwargs):\n self._store = OrderedDict()\n if data is None:\n data = {}\n self.update(data, **kwargs)\n\n def __setitem__(self, key, value):\n # Use the lowercased key for lookups, but store the actual\n # key alongside the value.\n self._store[key.lower()] = (key, value)\n\n def __getitem__(self, key):\n return self._store[key.lower()][1]\n\n def __delitem__(self, key):\n del self._store[key.lower()]\n\n def __iter__(self):\n return (casedkey for casedkey, mappedvalue in self._store.values())\n\n def __len__(self):\n return len(self._store)\n\n def lower_items(self):\n \"\"\"Like iteritems(), but with all lowercase keys.\"\"\"\n return ((lowerkey, keyval[1]) for (lowerkey, keyval) in self._store.items())\n\n def __eq__(self, other):\n if isinstance(other, Mapping):\n other = CaseInsensitiveDict(other)\n else:\n return NotImplemented\n # Compare insensitively\n return dict(self.lower_items()) == dict(other.lower_items())\n\n # Copy is required\n def copy(self):\n return CaseInsensitiveDict(self._store.values())\n\n def __repr__(self):\n return str(dict(self.items()))\n\n\nclass LookupDict(dict):\n \"\"\"Dictionary lookup object.\"\"\"\n\n def __init__(self, name=None):\n self.name = name\n super().__init__()\n\n def __repr__(self):\n return f\"\"\n\n def __getitem__(self, key):\n # We allow fall-through here, so values default to None\n\n return self.__dict__.get(key, None)\n\n def get(self, key, default=None):\n return self.__dict__.get(key, default)\n",[],[216,809,810,811,890,891,1275,1277],"0a45f906-67fc-11f0-8737-0224a6c84d84","status_codes.py","0a45f99c-67fc-11f0-8737-0224a6c84d84",375,["D",1753299265020],"r\"\"\"\nThe ``codes`` object defines a mapping from common names for HTTP statuses\nto their numerical codes, accessible either as attributes or as dictionary\nitems.\n\nExample::\n\n >>> import requests\n >>> requests.codes['temporary_redirect']\n 307\n >>> requests.codes.teapot\n 418\n >>> requests.codes['\\o/']\n 200\n\nSome codes have multiple names, and both upper- and lower-case versions of\nthe names are allowed. For example, ``codes.ok``, ``codes.OK``, and\n``codes.okay`` all correspond to the HTTP status code 200.\n\"\"\"\n\nfrom .structures import LookupDict\n\n_codes = {\n # Informational.\n 100: (\"continue\",),\n 101: (\"switching_protocols\",),\n 102: (\"processing\", \"early-hints\"),\n 103: (\"checkpoint\",),\n 122: (\"uri_too_long\", \"request_uri_too_long\"),\n 200: (\"ok\", \"okay\", \"all_ok\", \"all_okay\", \"all_good\", \"\\\\o/\", \"✓\"),\n 201: (\"created\",),\n 202: (\"accepted\",),\n 203: (\"non_authoritative_info\", \"non_authoritative_information\"),\n 204: (\"no_content\",),\n 205: (\"reset_content\", \"reset\"),\n 206: (\"partial_content\", \"partial\"),\n 207: (\"multi_status\", \"multiple_status\", \"multi_stati\", \"multiple_stati\"),\n 208: (\"already_reported\",),\n 226: (\"im_used\",),\n # Redirection.\n 300: (\"multiple_choices\",),\n 301: (\"moved_permanently\", \"moved\", \"\\\\o-\"),\n 302: (\"found\",),\n 303: (\"see_other\", \"other\"),\n 304: (\"not_modified\",),\n 305: (\"use_proxy\",),\n 306: (\"switch_proxy\",),\n 307: (\"temporary_redirect\", \"temporary_moved\", \"temporary\"),\n 308: (\n \"permanent_redirect\",\n \"resume_incomplete\",\n \"resume\",\n ), # \"resume\" and \"resume_incomplete\" to be removed in 3.0\n # Client Error.\n 400: (\"bad_request\", \"bad\"),\n 401: (\"unauthorized\",),\n 402: (\"payment_required\", \"payment\"),\n 403: (\"forbidden\",),\n 404: (\"not_found\", \"-o-\"),\n 405: (\"method_not_allowed\", \"not_allowed\"),\n 406: (\"not_acceptable\",),\n 407: (\"proxy_authentication_required\", \"proxy_auth\", \"proxy_authentication\"),\n 408: (\"request_timeout\", \"timeout\"),\n 409: (\"conflict\",),\n 410: (\"gone\",),\n 411: (\"length_required\",),\n 412: (\"precondition_failed\", \"precondition\"),\n 413: (\"request_entity_too_large\", \"content_too_large\"),\n 414: (\"request_uri_too_large\", \"uri_too_long\"),\n 415: (\"unsupported_media_type\", \"unsupported_media\", \"media_type\"),\n 416: (\n \"requested_range_not_satisfiable\",\n \"requested_range\",\n \"range_not_satisfiable\",\n ),\n 417: (\"expectation_failed\",),\n 418: (\"im_a_teapot\", \"teapot\", \"i_am_a_teapot\"),\n 421: (\"misdirected_request\",),\n 422: (\"unprocessable_entity\", \"unprocessable\", \"unprocessable_content\"),\n 423: (\"locked\",),\n 424: (\"failed_dependency\", \"dependency\"),\n 425: (\"unordered_collection\", \"unordered\", \"too_early\"),\n 426: (\"upgrade_required\", \"upgrade\"),\n 428: (\"precondition_required\", \"precondition\"),\n 429: (\"too_many_requests\", \"too_many\"),\n 431: (\"header_fields_too_large\", \"fields_too_large\"),\n 444: (\"no_response\", \"none\"),\n 449: (\"retry_with\", \"retry\"),\n 450: (\"blocked_by_windows_parental_controls\", \"parental_controls\"),\n 451: (\"unavailable_for_legal_reasons\", \"legal_reasons\"),\n 499: (\"client_closed_request\",),\n # Server Error.\n 500: (\"internal_server_error\", \"server_error\", \"/o\\\\\", \"✗\"),\n 501: (\"not_implemented\",),\n 502: (\"bad_gateway\",),\n 503: (\"service_unavailable\", \"unavailable\"),\n 504: (\"gateway_timeout\",),\n 505: (\"http_version_not_supported\", \"http_version\"),\n 506: (\"variant_also_negotiates\",),\n 507: (\"insufficient_storage\",),\n 509: (\"bandwidth_limit_exceeded\", \"bandwidth\"),\n 510: (\"not_extended\",),\n 511: (\"network_authentication_required\", \"network_auth\", \"network_authentication\"),\n}\n\ncodes = LookupDict(name=\"status_codes\")\n\n\ndef _init():\n for code, titles in _codes.items():\n for title in titles:\n setattr(codes, title, code)\n if not title.startswith((\"\\\\\", \"/\")):\n setattr(codes, title.upper(), code)\n\n def doc(code):\n names = \", \".join(f\"``{n}``\" for n in _codes[code])\n return \"* %d: %s\" % (code, names)\n\n global __doc__\n __doc__ = (\n __doc__ + \"\\n\" + \"\\n\".join(doc(code) for code in sorted(_codes))\n if __doc__ is not None\n else None\n )\n\n\n_init()\n",[],[216,809,810,811,890,891,1275,1285],"0a262216-67fc-11f0-8cd1-0224a6c84d84","sessions.py","0a2622b6-67fc-11f0-8cd1-0224a6c84d84",369,["D",1753299264813],"\"\"\"\nrequests.sessions\n~~~~~~~~~~~~~~~~~\n\nThis module provides a Session object to manage and persist settings across\nrequests (cookies, auth, proxies).\n\"\"\"\nimport os\nimport sys\nimport time\nfrom collections import OrderedDict\nfrom datetime import timedelta\n\nfrom ._internal_utils import to_native_string\nfrom .adapters import HTTPAdapter\nfrom .auth import _basic_auth_str\nfrom .compat import Mapping, cookielib, urljoin, urlparse\nfrom .cookies import (\n RequestsCookieJar,\n cookiejar_from_dict,\n extract_cookies_to_jar,\n merge_cookies,\n)\nfrom .exceptions import (\n ChunkedEncodingError,\n ContentDecodingError,\n InvalidSchema,\n TooManyRedirects,\n)\nfrom .hooks import default_hooks, dispatch_hook\n\n# formerly defined here, reexposed here for backward compatibility\nfrom .models import ( # noqa: F401\n DEFAULT_REDIRECT_LIMIT,\n REDIRECT_STATI,\n PreparedRequest,\n Request,\n)\nfrom .status_codes import codes\nfrom .structures import CaseInsensitiveDict\nfrom .utils import ( # noqa: F401\n DEFAULT_PORTS,\n default_headers,\n get_auth_from_url,\n get_environ_proxies,\n get_netrc_auth,\n requote_uri,\n resolve_proxies,\n rewind_body,\n should_bypass_proxies,\n to_key_val_list,\n)\n\n# Preferred clock, based on which one is more accurate on a given system.\nif sys.platform == \"win32\":\n preferred_clock = time.perf_counter\nelse:\n preferred_clock = time.time\n\n\ndef merge_setting(request_setting, session_setting, dict_class=OrderedDict):\n \"\"\"Determines appropriate setting for a given request, taking into account\n the explicit setting on that request, and the setting in the session. If a\n setting is a dictionary, they will be merged together using `dict_class`\n \"\"\"\n\n if session_setting is None:\n return request_setting\n\n if request_setting is None:\n return session_setting\n\n # Bypass if not a dictionary (e.g. verify)\n if not (\n isinstance(session_setting, Mapping) and isinstance(request_setting, Mapping)\n ):\n return request_setting\n\n merged_setting = dict_class(to_key_val_list(session_setting))\n merged_setting.update(to_key_val_list(request_setting))\n\n # Remove keys that are set to None. Extract keys first to avoid altering\n # the dictionary during iteration.\n none_keys = [k for (k, v) in merged_setting.items() if v is None]\n for key in none_keys:\n del merged_setting[key]\n\n return merged_setting\n\n\ndef merge_hooks(request_hooks, session_hooks, dict_class=OrderedDict):\n \"\"\"Properly merges both requests and session hooks.\n\n This is necessary because when request_hooks == {'response': []}, the\n merge breaks Session hooks entirely.\n \"\"\"\n if session_hooks is None or session_hooks.get(\"response\") == []:\n return request_hooks\n\n if request_hooks is None or request_hooks.get(\"response\") == []:\n return session_hooks\n\n return merge_setting(request_hooks, session_hooks, dict_class)\n\n\nclass SessionRedirectMixin:\n def get_redirect_target(self, resp):\n \"\"\"Receives a Response. Returns a redirect URI or ``None``\"\"\"\n # Due to the nature of how requests processes redirects this method will\n # be called at least once upon the original response and at least twice\n # on each subsequent redirect response (if any).\n # If a custom mixin is used to handle this logic, it may be advantageous\n # to cache the redirect location onto the response object as a private\n # attribute.\n if resp.is_redirect:\n location = resp.headers[\"location\"]\n # Currently the underlying http module on py3 decode headers\n # in latin1, but empirical evidence suggests that latin1 is very\n # rarely used with non-ASCII characters in HTTP headers.\n # It is more likely to get UTF8 header rather than latin1.\n # This causes incorrect handling of UTF8 encoded location headers.\n # To solve this, we re-encode the location in latin1.\n location = location.encode(\"latin1\")\n return to_native_string(location, \"utf8\")\n return None\n\n def should_strip_auth(self, old_url, new_url):\n \"\"\"Decide whether Authorization header should be removed when redirecting\"\"\"\n old_parsed = urlparse(old_url)\n new_parsed = urlparse(new_url)\n if old_parsed.hostname != new_parsed.hostname:\n return True\n # Special case: allow http -> https redirect when using the standard\n # ports. This isn't specified by RFC 7235, but is kept to avoid\n # breaking backwards compatibility with older versions of requests\n # that allowed any redirects on the same host.\n if (\n old_parsed.scheme == \"http\"\n and old_parsed.port in (80, None)\n and new_parsed.scheme == \"https\"\n and new_parsed.port in (443, None)\n ):\n return False\n\n # Handle default port usage corresponding to scheme.\n changed_port = old_parsed.port != new_parsed.port\n changed_scheme = old_parsed.scheme != new_parsed.scheme\n default_port = (DEFAULT_PORTS.get(old_parsed.scheme, None), None)\n if (\n not changed_scheme\n and old_parsed.port in default_port\n and new_parsed.port in default_port\n ):\n return False\n\n # Standard case: root URI must match\n return changed_port or changed_scheme\n\n def resolve_redirects(\n self,\n resp,\n req,\n stream=False,\n timeout=None,\n verify=True,\n cert=None,\n proxies=None,\n yield_requests=False,\n **adapter_kwargs,\n ):\n \"\"\"Receives a Response. Returns a generator of Responses or Requests.\"\"\"\n\n hist = [] # keep track of history\n\n url = self.get_redirect_target(resp)\n previous_fragment = urlparse(req.url).fragment\n while url:\n prepared_request = req.copy()\n\n # Update history and keep track of redirects.\n # resp.history must ignore the original request in this loop\n hist.append(resp)\n resp.history = hist[1:]\n\n try:\n resp.content # Consume socket so it can be released\n except (ChunkedEncodingError, ContentDecodingError, RuntimeError):\n resp.raw.read(decode_content=False)\n\n if len(resp.history) >= self.max_redirects:\n raise TooManyRedirects(\n f\"Exceeded {self.max_redirects} redirects.\", response=resp\n )\n\n # Release the connection back into the pool.\n resp.close()\n\n # Handle redirection without scheme (see: RFC 1808 Section 4)\n if url.startswith(\"//\"):\n parsed_rurl = urlparse(resp.url)\n url = \":\".join([to_native_string(parsed_rurl.scheme), url])\n\n # Normalize url case and attach previous fragment if needed (RFC 7231 7.1.2)\n parsed = urlparse(url)\n if parsed.fragment == \"\" and previous_fragment:\n parsed = parsed._replace(fragment=previous_fragment)\n elif parsed.fragment:\n previous_fragment = parsed.fragment\n url = parsed.geturl()\n\n # Facilitate relative 'location' headers, as allowed by RFC 7231.\n # (e.g. '/path/to/resource' instead of 'http://domain.tld/path/to/resource')\n # Compliant with RFC3986, we percent encode the url.\n if not parsed.netloc:\n url = urljoin(resp.url, requote_uri(url))\n else:\n url = requote_uri(url)\n\n prepared_request.url = to_native_string(url)\n\n self.rebuild_method(prepared_request, resp)\n\n # https://github.com/psf/requests/issues/1084\n if resp.status_code not in (\n codes.temporary_redirect,\n codes.permanent_redirect,\n ):\n # https://github.com/psf/requests/issues/3490\n purged_headers = (\"Content-Length\", \"Content-Type\", \"Transfer-Encoding\")\n for header in purged_headers:\n prepared_request.headers.pop(header, None)\n prepared_request.body = None\n\n headers = prepared_request.headers\n headers.pop(\"Cookie\", None)\n\n # Extract any cookies sent on the response to the cookiejar\n # in the new request. Because we've mutated our copied prepared\n # request, use the old one that we haven't yet touched.\n extract_cookies_to_jar(prepared_request._cookies, req, resp.raw)\n merge_cookies(prepared_request._cookies, self.cookies)\n prepared_request.prepare_cookies(prepared_request._cookies)\n\n # Rebuild auth and proxy information.\n proxies = self.rebuild_proxies(prepared_request, proxies)\n self.rebuild_auth(prepared_request, resp)\n\n # A failed tell() sets `_body_position` to `object()`. This non-None\n # value ensures `rewindable` will be True, allowing us to raise an\n # UnrewindableBodyError, instead of hanging the connection.\n rewindable = prepared_request._body_position is not None and (\n \"Content-Length\" in headers or \"Transfer-Encoding\" in headers\n )\n\n # Attempt to rewind consumed file-like object.\n if rewindable:\n rewind_body(prepared_request)\n\n # Override the original request.\n req = prepared_request\n\n if yield_requests:\n yield req\n else:\n resp = self.send(\n req,\n stream=stream,\n timeout=timeout,\n verify=verify,\n cert=cert,\n proxies=proxies,\n allow_redirects=False,\n **adapter_kwargs,\n )\n\n extract_cookies_to_jar(self.cookies, prepared_request, resp.raw)\n\n # extract redirect url, if any, for the next loop\n url = self.get_redirect_target(resp)\n yield resp\n\n def rebuild_auth(self, prepared_request, response):\n \"\"\"When being redirected we may want to strip authentication from the\n request to avoid leaking credentials. This method intelligently removes\n and reapplies authentication where possible to avoid credential loss.\n \"\"\"\n headers = prepared_request.headers\n url = prepared_request.url\n\n if \"Authorization\" in headers and self.should_strip_auth(\n response.request.url, url\n ):\n # If we get redirected to a new host, we should strip out any\n # authentication headers.\n del headers[\"Authorization\"]\n\n # .netrc might have more auth for us on our new host.\n new_auth = get_netrc_auth(url) if self.trust_env else None\n if new_auth is not None:\n prepared_request.prepare_auth(new_auth)\n\n def rebuild_proxies(self, prepared_request, proxies):\n \"\"\"This method re-evaluates the proxy configuration by considering the\n environment variables. If we are redirected to a URL covered by\n NO_PROXY, we strip the proxy configuration. Otherwise, we set missing\n proxy keys for this URL (in case they were stripped by a previous\n redirect).\n\n This method also replaces the Proxy-Authorization header where\n necessary.\n\n :rtype: dict\n \"\"\"\n headers = prepared_request.headers\n scheme = urlparse(prepared_request.url).scheme\n new_proxies = resolve_proxies(prepared_request, proxies, self.trust_env)\n\n if \"Proxy-Authorization\" in headers:\n del headers[\"Proxy-Authorization\"]\n\n try:\n username, password = get_auth_from_url(new_proxies[scheme])\n except KeyError:\n username, password = None, None\n\n # urllib3 handles proxy authorization for us in the standard adapter.\n # Avoid appending this to TLS tunneled requests where it may be leaked.\n if not scheme.startswith(\"https\") and username and password:\n headers[\"Proxy-Authorization\"] = _basic_auth_str(username, password)\n\n return new_proxies\n\n def rebuild_method(self, prepared_request, response):\n \"\"\"When being redirected we may want to change the method of the request\n based on certain specs or browser behavior.\n \"\"\"\n method = prepared_request.method\n\n # https://tools.ietf.org/html/rfc7231#section-6.4.4\n if response.status_code == codes.see_other and method != \"HEAD\":\n method = \"GET\"\n\n # Do what the browsers do, despite standards...\n # First, turn 302s into GETs.\n if response.status_code == codes.found and method != \"HEAD\":\n method = \"GET\"\n\n # Second, if a POST is responded to with a 301, turn it into a GET.\n # This bizarre behaviour is explained in Issue 1704.\n if response.status_code == codes.moved and method == \"POST\":\n method = \"GET\"\n\n prepared_request.method = method\n\n\nclass Session(SessionRedirectMixin):\n \"\"\"A Requests session.\n\n Provides cookie persistence, connection-pooling, and configuration.\n\n Basic Usage::\n\n >>> import requests\n >>> s = requests.Session()\n >>> s.get('https://httpbin.org/get')\n \n\n Or as a context manager::\n\n >>> with requests.Session() as s:\n ... s.get('https://httpbin.org/get')\n \n \"\"\"\n\n __attrs__ = [\n \"headers\",\n \"cookies\",\n \"auth\",\n \"proxies\",\n \"hooks\",\n \"params\",\n \"verify\",\n \"cert\",\n \"adapters\",\n \"stream\",\n \"trust_env\",\n \"max_redirects\",\n ]\n\n def __init__(self):\n #: A case-insensitive dictionary of headers to be sent on each\n #: :class:`Request ` sent from this\n #: :class:`Session `.\n self.headers = default_headers()\n\n #: Default Authentication tuple or object to attach to\n #: :class:`Request `.\n self.auth = None\n\n #: Dictionary mapping protocol or protocol and host to the URL of the proxy\n #: (e.g. {'http': 'foo.bar:3128', 'http://host.name': 'foo.bar:4012'}) to\n #: be used on each :class:`Request `.\n self.proxies = {}\n\n #: Event-handling hooks.\n self.hooks = default_hooks()\n\n #: Dictionary of querystring data to attach to each\n #: :class:`Request `. The dictionary values may be lists for\n #: representing multivalued query parameters.\n self.params = {}\n\n #: Stream response content default.\n self.stream = False\n\n #: SSL Verification default.\n #: Defaults to `True`, requiring requests to verify the TLS certificate at the\n #: remote end.\n #: If verify is set to `False`, requests will accept any TLS certificate\n #: presented by the server, and will ignore hostname mismatches and/or\n #: expired certificates, which will make your application vulnerable to\n #: man-in-the-middle (MitM) attacks.\n #: Only set this to `False` for testing.\n self.verify = True\n\n #: SSL client certificate default, if String, path to ssl client\n #: cert file (.pem). If Tuple, ('cert', 'key') pair.\n self.cert = None\n\n #: Maximum number of redirects allowed. If the request exceeds this\n #: limit, a :class:`TooManyRedirects` exception is raised.\n #: This defaults to requests.models.DEFAULT_REDIRECT_LIMIT, which is\n #: 30.\n self.max_redirects = DEFAULT_REDIRECT_LIMIT\n\n #: Trust environment settings for proxy configuration, default\n #: authentication and similar.\n self.trust_env = True\n\n #: A CookieJar containing all currently outstanding cookies set on this\n #: session. By default it is a\n #: :class:`RequestsCookieJar `, but\n #: may be any other ``cookielib.CookieJar`` compatible object.\n self.cookies = cookiejar_from_dict({})\n\n # Default connection adapters.\n self.adapters = OrderedDict()\n self.mount(\"https://\", HTTPAdapter())\n self.mount(\"http://\", HTTPAdapter())\n\n def __enter__(self):\n return self\n\n def __exit__(self, *args):\n self.close()\n\n def prepare_request(self, request):\n \"\"\"Constructs a :class:`PreparedRequest ` for\n transmission and returns it. The :class:`PreparedRequest` has settings\n merged from the :class:`Request ` instance and those of the\n :class:`Session`.\n\n :param request: :class:`Request` instance to prepare with this\n session's settings.\n :rtype: requests.PreparedRequest\n \"\"\"\n cookies = request.cookies or {}\n\n # Bootstrap CookieJar.\n if not isinstance(cookies, cookielib.CookieJar):\n cookies = cookiejar_from_dict(cookies)\n\n # Merge with session cookies\n merged_cookies = merge_cookies(\n merge_cookies(RequestsCookieJar(), self.cookies), cookies\n )\n\n # Set environment's basic authentication if not explicitly set.\n auth = request.auth\n if self.trust_env and not auth and not self.auth:\n auth = get_netrc_auth(request.url)\n\n p = PreparedRequest()\n p.prepare(\n method=request.method.upper(),\n url=request.url,\n files=request.files,\n data=request.data,\n json=request.json,\n headers=merge_setting(\n request.headers, self.headers, dict_class=CaseInsensitiveDict\n ),\n params=merge_setting(request.params, self.params),\n auth=merge_setting(auth, self.auth),\n cookies=merged_cookies,\n hooks=merge_hooks(request.hooks, self.hooks),\n )\n return p\n\n def request(\n self,\n method,\n url,\n params=None,\n data=None,\n headers=None,\n cookies=None,\n files=None,\n auth=None,\n timeout=None,\n allow_redirects=True,\n proxies=None,\n hooks=None,\n stream=None,\n verify=None,\n cert=None,\n json=None,\n ):\n \"\"\"Constructs a :class:`Request `, prepares it and sends it.\n Returns :class:`Response ` object.\n\n :param method: method for the new :class:`Request` object.\n :param url: URL for the new :class:`Request` object.\n :param params: (optional) Dictionary or bytes to be sent in the query\n string for the :class:`Request`.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) json to send in the body of the\n :class:`Request`.\n :param headers: (optional) Dictionary of HTTP Headers to send with the\n :class:`Request`.\n :param cookies: (optional) Dict or CookieJar object to send with the\n :class:`Request`.\n :param files: (optional) Dictionary of ``'filename': file-like-objects``\n for multipart encoding upload.\n :param auth: (optional) Auth tuple or callable to enable\n Basic/Digest/Custom HTTP Auth.\n :param timeout: (optional) How long to wait for the server to send\n data before giving up, as a float, or a :ref:`(connect timeout,\n read timeout) ` tuple.\n :type timeout: float or tuple\n :param allow_redirects: (optional) Set to True by default.\n :type allow_redirects: bool\n :param proxies: (optional) Dictionary mapping protocol or protocol and\n hostname to the URL of the proxy.\n :param hooks: (optional) Dictionary mapping hook name to one event or\n list of events, event must be callable.\n :param stream: (optional) whether to immediately download the response\n content. Defaults to ``False``.\n :param verify: (optional) Either a boolean, in which case it controls whether we verify\n the server's TLS certificate, or a string, in which case it must be a path\n to a CA bundle to use. Defaults to ``True``. When set to\n ``False``, requests will accept any TLS certificate presented by\n the server, and will ignore hostname mismatches and/or expired\n certificates, which will make your application vulnerable to\n man-in-the-middle (MitM) attacks. Setting verify to ``False``\n may be useful during local development or testing.\n :param cert: (optional) if String, path to ssl client cert file (.pem).\n If Tuple, ('cert', 'key') pair.\n :rtype: requests.Response\n \"\"\"\n # Create the Request.\n req = Request(\n method=method.upper(),\n url=url,\n headers=headers,\n files=files,\n data=data or {},\n json=json,\n params=params or {},\n auth=auth,\n cookies=cookies,\n hooks=hooks,\n )\n prep = self.prepare_request(req)\n\n proxies = proxies or {}\n\n settings = self.merge_environment_settings(\n prep.url, proxies, stream, verify, cert\n )\n\n # Send the request.\n send_kwargs = {\n \"timeout\": timeout,\n \"allow_redirects\": allow_redirects,\n }\n send_kwargs.update(settings)\n resp = self.send(prep, **send_kwargs)\n\n return resp\n\n def get(self, url, **kwargs):\n r\"\"\"Sends a GET request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n kwargs.setdefault(\"allow_redirects\", True)\n return self.request(\"GET\", url, **kwargs)\n\n def options(self, url, **kwargs):\n r\"\"\"Sends a OPTIONS request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n kwargs.setdefault(\"allow_redirects\", True)\n return self.request(\"OPTIONS\", url, **kwargs)\n\n def head(self, url, **kwargs):\n r\"\"\"Sends a HEAD request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n kwargs.setdefault(\"allow_redirects\", False)\n return self.request(\"HEAD\", url, **kwargs)\n\n def post(self, url, data=None, json=None, **kwargs):\n r\"\"\"Sends a POST request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) json to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n return self.request(\"POST\", url, data=data, json=json, **kwargs)\n\n def put(self, url, data=None, **kwargs):\n r\"\"\"Sends a PUT request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n return self.request(\"PUT\", url, data=data, **kwargs)\n\n def patch(self, url, data=None, **kwargs):\n r\"\"\"Sends a PATCH request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n return self.request(\"PATCH\", url, data=data, **kwargs)\n\n def delete(self, url, **kwargs):\n r\"\"\"Sends a DELETE request. Returns :class:`Response` object.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :rtype: requests.Response\n \"\"\"\n\n return self.request(\"DELETE\", url, **kwargs)\n\n def send(self, request, **kwargs):\n \"\"\"Send a given PreparedRequest.\n\n :rtype: requests.Response\n \"\"\"\n # Set defaults that the hooks can utilize to ensure they always have\n # the correct parameters to reproduce the previous request.\n kwargs.setdefault(\"stream\", self.stream)\n kwargs.setdefault(\"verify\", self.verify)\n kwargs.setdefault(\"cert\", self.cert)\n if \"proxies\" not in kwargs:\n kwargs[\"proxies\"] = resolve_proxies(request, self.proxies, self.trust_env)\n\n # It's possible that users might accidentally send a Request object.\n # Guard against that specific failure case.\n if isinstance(request, Request):\n raise ValueError(\"You can only send PreparedRequests.\")\n\n # Set up variables needed for resolve_redirects and dispatching of hooks\n allow_redirects = kwargs.pop(\"allow_redirects\", True)\n stream = kwargs.get(\"stream\")\n hooks = request.hooks\n\n # Get the appropriate adapter to use\n adapter = self.get_adapter(url=request.url)\n\n # Start time (approximately) of the request\n start = preferred_clock()\n\n # Send the request\n r = adapter.send(request, **kwargs)\n\n # Total elapsed time of the request (approximately)\n elapsed = preferred_clock() - start\n r.elapsed = timedelta(seconds=elapsed)\n\n # Response manipulation hooks\n r = dispatch_hook(\"response\", hooks, r, **kwargs)\n\n # Persist cookies\n if r.history:\n # If the hooks create history then we want those cookies too\n for resp in r.history:\n extract_cookies_to_jar(self.cookies, resp.request, resp.raw)\n\n extract_cookies_to_jar(self.cookies, request, r.raw)\n\n # Resolve redirects if allowed.\n if allow_redirects:\n # Redirect resolving generator.\n gen = self.resolve_redirects(r, request, **kwargs)\n history = [resp for resp in gen]\n else:\n history = []\n\n # Shuffle things around if there's history.\n if history:\n # Insert the first (original) request at the start\n history.insert(0, r)\n # Get the last request made\n r = history.pop()\n r.history = history\n\n # If redirects aren't being followed, store the response on the Request for Response.next().\n if not allow_redirects:\n try:\n r._next = next(\n self.resolve_redirects(r, request, yield_requests=True, **kwargs)\n )\n except StopIteration:\n pass\n\n if not stream:\n r.content\n\n return r\n\n def merge_environment_settings(self, url, proxies, stream, verify, cert):\n \"\"\"\n Check the environment and merge it with some settings.\n\n :rtype: dict\n \"\"\"\n # Gather clues from the surrounding environment.\n if self.trust_env:\n # Set environment's proxies.\n no_proxy = proxies.get(\"no_proxy\") if proxies is not None else None\n env_proxies = get_environ_proxies(url, no_proxy=no_proxy)\n for k, v in env_proxies.items():\n proxies.setdefault(k, v)\n\n # Look for requests environment configuration\n # and be compatible with cURL.\n if verify is True or verify is None:\n verify = (\n os.environ.get(\"REQUESTS_CA_BUNDLE\")\n or os.environ.get(\"CURL_CA_BUNDLE\")\n or verify\n )\n\n # Merge all the kwargs.\n proxies = merge_setting(proxies, self.proxies)\n stream = merge_setting(stream, self.stream)\n verify = merge_setting(verify, self.verify)\n cert = merge_setting(cert, self.cert)\n\n return {\"proxies\": proxies, \"stream\": stream, \"verify\": verify, \"cert\": cert}\n\n def get_adapter(self, url):\n \"\"\"\n Returns the appropriate connection adapter for the given URL.\n\n :rtype: requests.adapters.BaseAdapter\n \"\"\"\n for prefix, adapter in self.adapters.items():\n if url.lower().startswith(prefix.lower()):\n return adapter\n\n # Nothing matches :-/\n raise InvalidSchema(f\"No connection adapters were found for {url!r}\")\n\n def close(self):\n \"\"\"Closes all adapters and as such the session\"\"\"\n for v in self.adapters.values():\n v.close()\n\n def mount(self, prefix, adapter):\n \"\"\"Registers a connection adapter to a prefix.\n\n Adapters are sorted in descending order by prefix length.\n \"\"\"\n self.adapters[prefix] = adapter\n keys_to_move = [k for k in self.adapters if len(k) < len(prefix)]\n\n for key in keys_to_move:\n self.adapters[key] = self.adapters.pop(key)\n\n def __getstate__(self):\n state = {attr: getattr(self, attr, None) for attr in self.__attrs__}\n return state\n\n def __setstate__(self, state):\n for attr, value in state.items():\n setattr(self, attr, value)\n\n\ndef session():\n \"\"\"\n Returns a :class:`Session` for context-management.\n\n .. deprecated:: 1.0.0\n\n This method has been deprecated since version 1.0.0 and is only kept for\n backwards compatibility. New code should use :class:`~requests.sessions.Session`\n to create a session. This may be removed at a future date.\n\n :rtype: Session\n \"\"\"\n return Session()\n",[],[216,809,810,811,890,891,1275,1293],"0a522654-67fc-11f0-8371-0224a6c84d84","packages.py","0a522708-67fc-11f0-8371-0224a6c84d84",376,["D",1753299265099],"import sys\n\nfrom .compat import chardet\n\n# This code exists for backwards compatibility reasons.\n# I don't like it either. Just look the other way. :)\n\nfor package in (\"urllib3\", \"idna\"):\n vendored_package = \"pip._vendor.\" + package\n locals()[package] = __import__(vendored_package)\n # This traversal is apparently necessary such that the identities are\n # preserved (requests.packages.urllib3.* is urllib3.*)\n for mod in list(sys.modules):\n if mod == vendored_package or mod.startswith(vendored_package + '.'):\n unprefixed_mod = mod[len(\"pip._vendor.\"):]\n sys.modules['pip._vendor.requests.packages.' + unprefixed_mod] = sys.modules[mod]\n\nif chardet is not None:\n target = chardet.__name__\n for mod in list(sys.modules):\n if mod == target or mod.startswith(f\"{target}.\"):\n imported_mod = sys.modules[mod]\n sys.modules[f\"requests.packages.{mod}\"] = imported_mod\n mod = mod.replace(target, \"chardet\")\n sys.modules[f\"requests.packages.{mod}\"] = imported_mod\n",[],[216,809,810,811,890,891,1275,1301],"0a37fbee-67fc-11f0-bcbe-0224a6c84d84","models.py","0a37fc98-67fc-11f0-bcbe-0224a6c84d84",372,["D",1753299264926],"\"\"\"\nrequests.models\n~~~~~~~~~~~~~~~\n\nThis module contains the primary objects that power Requests.\n\"\"\"\n\nimport datetime\n\n# Import encoding now, to avoid implicit import later.\n# Implicit import within threads may cause LookupError when standard library is in a ZIP,\n# such as in Embedded Python. See https://github.com/psf/requests/issues/3578.\nimport encodings.idna # noqa: F401\nfrom io import UnsupportedOperation\n\nfrom pip._vendor.urllib3.exceptions import (\n DecodeError,\n LocationParseError,\n ProtocolError,\n ReadTimeoutError,\n SSLError,\n)\nfrom pip._vendor.urllib3.fields import RequestField\nfrom pip._vendor.urllib3.filepost import encode_multipart_formdata\nfrom pip._vendor.urllib3.util import parse_url\n\nfrom ._internal_utils import to_native_string, unicode_is_ascii\nfrom .auth import HTTPBasicAuth\nfrom .compat import (\n Callable,\n JSONDecodeError,\n Mapping,\n basestring,\n builtin_str,\n chardet,\n cookielib,\n)\nfrom .compat import json as complexjson\nfrom .compat import urlencode, urlsplit, urlunparse\nfrom .cookies import _copy_cookie_jar, cookiejar_from_dict, get_cookie_header\nfrom .exceptions import (\n ChunkedEncodingError,\n ConnectionError,\n ContentDecodingError,\n HTTPError,\n InvalidJSONError,\n InvalidURL,\n)\nfrom .exceptions import JSONDecodeError as RequestsJSONDecodeError\nfrom .exceptions import MissingSchema\nfrom .exceptions import SSLError as RequestsSSLError\nfrom .exceptions import StreamConsumedError\nfrom .hooks import default_hooks\nfrom .status_codes import codes\nfrom .structures import CaseInsensitiveDict\nfrom .utils import (\n check_header_validity,\n get_auth_from_url,\n guess_filename,\n guess_json_utf,\n iter_slices,\n parse_header_links,\n requote_uri,\n stream_decode_response_unicode,\n super_len,\n to_key_val_list,\n)\n\n#: The set of HTTP status codes that indicate an automatically\n#: processable redirect.\nREDIRECT_STATI = (\n codes.moved, # 301\n codes.found, # 302\n codes.other, # 303\n codes.temporary_redirect, # 307\n codes.permanent_redirect, # 308\n)\n\nDEFAULT_REDIRECT_LIMIT = 30\nCONTENT_CHUNK_SIZE = 10 * 1024\nITER_CHUNK_SIZE = 512\n\n\nclass RequestEncodingMixin:\n @property\n def path_url(self):\n \"\"\"Build the path URL to use.\"\"\"\n\n url = []\n\n p = urlsplit(self.url)\n\n path = p.path\n if not path:\n path = \"/\"\n\n url.append(path)\n\n query = p.query\n if query:\n url.append(\"?\")\n url.append(query)\n\n return \"\".join(url)\n\n @staticmethod\n def _encode_params(data):\n \"\"\"Encode parameters in a piece of data.\n\n Will successfully encode parameters when passed as a dict or a list of\n 2-tuples. Order is retained if data is a list of 2-tuples but arbitrary\n if parameters are supplied as a dict.\n \"\"\"\n\n if isinstance(data, (str, bytes)):\n return data\n elif hasattr(data, \"read\"):\n return data\n elif hasattr(data, \"__iter__\"):\n result = []\n for k, vs in to_key_val_list(data):\n if isinstance(vs, basestring) or not hasattr(vs, \"__iter__\"):\n vs = [vs]\n for v in vs:\n if v is not None:\n result.append(\n (\n k.encode(\"utf-8\") if isinstance(k, str) else k,\n v.encode(\"utf-8\") if isinstance(v, str) else v,\n )\n )\n return urlencode(result, doseq=True)\n else:\n return data\n\n @staticmethod\n def _encode_files(files, data):\n \"\"\"Build the body for a multipart/form-data request.\n\n Will successfully encode files when passed as a dict or a list of\n tuples. Order is retained if data is a list of tuples but arbitrary\n if parameters are supplied as a dict.\n The tuples may be 2-tuples (filename, fileobj), 3-tuples (filename, fileobj, contentype)\n or 4-tuples (filename, fileobj, contentype, custom_headers).\n \"\"\"\n if not files:\n raise ValueError(\"Files must be provided.\")\n elif isinstance(data, basestring):\n raise ValueError(\"Data must not be a string.\")\n\n new_fields = []\n fields = to_key_val_list(data or {})\n files = to_key_val_list(files or {})\n\n for field, val in fields:\n if isinstance(val, basestring) or not hasattr(val, \"__iter__\"):\n val = [val]\n for v in val:\n if v is not None:\n # Don't call str() on bytestrings: in Py3 it all goes wrong.\n if not isinstance(v, bytes):\n v = str(v)\n\n new_fields.append(\n (\n field.decode(\"utf-8\")\n if isinstance(field, bytes)\n else field,\n v.encode(\"utf-8\") if isinstance(v, str) else v,\n )\n )\n\n for k, v in files:\n # support for explicit filename\n ft = None\n fh = None\n if isinstance(v, (tuple, list)):\n if len(v) == 2:\n fn, fp = v\n elif len(v) == 3:\n fn, fp, ft = v\n else:\n fn, fp, ft, fh = v\n else:\n fn = guess_filename(v) or k\n fp = v\n\n if isinstance(fp, (str, bytes, bytearray)):\n fdata = fp\n elif hasattr(fp, \"read\"):\n fdata = fp.read()\n elif fp is None:\n continue\n else:\n fdata = fp\n\n rf = RequestField(name=k, data=fdata, filename=fn, headers=fh)\n rf.make_multipart(content_type=ft)\n new_fields.append(rf)\n\n body, content_type = encode_multipart_formdata(new_fields)\n\n return body, content_type\n\n\nclass RequestHooksMixin:\n def register_hook(self, event, hook):\n \"\"\"Properly register a hook.\"\"\"\n\n if event not in self.hooks:\n raise ValueError(f'Unsupported event specified, with event name \"{event}\"')\n\n if isinstance(hook, Callable):\n self.hooks[event].append(hook)\n elif hasattr(hook, \"__iter__\"):\n self.hooks[event].extend(h for h in hook if isinstance(h, Callable))\n\n def deregister_hook(self, event, hook):\n \"\"\"Deregister a previously registered hook.\n Returns True if the hook existed, False if not.\n \"\"\"\n\n try:\n self.hooks[event].remove(hook)\n return True\n except ValueError:\n return False\n\n\nclass Request(RequestHooksMixin):\n \"\"\"A user-created :class:`Request ` object.\n\n Used to prepare a :class:`PreparedRequest `, which is sent to the server.\n\n :param method: HTTP method to use.\n :param url: URL to send.\n :param headers: dictionary of headers to send.\n :param files: dictionary of {filename: fileobject} files to multipart upload.\n :param data: the body to attach to the request. If a dictionary or\n list of tuples ``[(key, value)]`` is provided, form-encoding will\n take place.\n :param json: json for the body to attach to the request (if files or data is not specified).\n :param params: URL parameters to append to the URL. If a dictionary or\n list of tuples ``[(key, value)]`` is provided, form-encoding will\n take place.\n :param auth: Auth handler or (user, pass) tuple.\n :param cookies: dictionary or CookieJar of cookies to attach to this request.\n :param hooks: dictionary of callback hooks, for internal usage.\n\n Usage::\n\n >>> import requests\n >>> req = requests.Request('GET', 'https://httpbin.org/get')\n >>> req.prepare()\n \n \"\"\"\n\n def __init__(\n self,\n method=None,\n url=None,\n headers=None,\n files=None,\n data=None,\n params=None,\n auth=None,\n cookies=None,\n hooks=None,\n json=None,\n ):\n # Default empty dicts for dict params.\n data = [] if data is None else data\n files = [] if files is None else files\n headers = {} if headers is None else headers\n params = {} if params is None else params\n hooks = {} if hooks is None else hooks\n\n self.hooks = default_hooks()\n for k, v in list(hooks.items()):\n self.register_hook(event=k, hook=v)\n\n self.method = method\n self.url = url\n self.headers = headers\n self.files = files\n self.data = data\n self.json = json\n self.params = params\n self.auth = auth\n self.cookies = cookies\n\n def __repr__(self):\n return f\"\"\n\n def prepare(self):\n \"\"\"Constructs a :class:`PreparedRequest ` for transmission and returns it.\"\"\"\n p = PreparedRequest()\n p.prepare(\n method=self.method,\n url=self.url,\n headers=self.headers,\n files=self.files,\n data=self.data,\n json=self.json,\n params=self.params,\n auth=self.auth,\n cookies=self.cookies,\n hooks=self.hooks,\n )\n return p\n\n\nclass PreparedRequest(RequestEncodingMixin, RequestHooksMixin):\n \"\"\"The fully mutable :class:`PreparedRequest ` object,\n containing the exact bytes that will be sent to the server.\n\n Instances are generated from a :class:`Request ` object, and\n should not be instantiated manually; doing so may produce undesirable\n effects.\n\n Usage::\n\n >>> import requests\n >>> req = requests.Request('GET', 'https://httpbin.org/get')\n >>> r = req.prepare()\n >>> r\n \n\n >>> s = requests.Session()\n >>> s.send(r)\n \n \"\"\"\n\n def __init__(self):\n #: HTTP verb to send to the server.\n self.method = None\n #: HTTP URL to send the request to.\n self.url = None\n #: dictionary of HTTP headers.\n self.headers = None\n # The `CookieJar` used to create the Cookie header will be stored here\n # after prepare_cookies is called\n self._cookies = None\n #: request body to send to the server.\n self.body = None\n #: dictionary of callback hooks, for internal usage.\n self.hooks = default_hooks()\n #: integer denoting starting position of a readable file-like body.\n self._body_position = None\n\n def prepare(\n self,\n method=None,\n url=None,\n headers=None,\n files=None,\n data=None,\n params=None,\n auth=None,\n cookies=None,\n hooks=None,\n json=None,\n ):\n \"\"\"Prepares the entire request with the given parameters.\"\"\"\n\n self.prepare_method(method)\n self.prepare_url(url, params)\n self.prepare_headers(headers)\n self.prepare_cookies(cookies)\n self.prepare_body(data, files, json)\n self.prepare_auth(auth, url)\n\n # Note that prepare_auth must be last to enable authentication schemes\n # such as OAuth to work on a fully prepared request.\n\n # This MUST go after prepare_auth. Authenticators could add a hook\n self.prepare_hooks(hooks)\n\n def __repr__(self):\n return f\"\"\n\n def copy(self):\n p = PreparedRequest()\n p.method = self.method\n p.url = self.url\n p.headers = self.headers.copy() if self.headers is not None else None\n p._cookies = _copy_cookie_jar(self._cookies)\n p.body = self.body\n p.hooks = self.hooks\n p._body_position = self._body_position\n return p\n\n def prepare_method(self, method):\n \"\"\"Prepares the given HTTP method.\"\"\"\n self.method = method\n if self.method is not None:\n self.method = to_native_string(self.method.upper())\n\n @staticmethod\n def _get_idna_encoded_host(host):\n from pip._vendor import idna\n\n try:\n host = idna.encode(host, uts46=True).decode(\"utf-8\")\n except idna.IDNAError:\n raise UnicodeError\n return host\n\n def prepare_url(self, url, params):\n \"\"\"Prepares the given HTTP URL.\"\"\"\n #: Accept objects that have string representations.\n #: We're unable to blindly call unicode/str functions\n #: as this will include the bytestring indicator (b'')\n #: on python 3.x.\n #: https://github.com/psf/requests/pull/2238\n if isinstance(url, bytes):\n url = url.decode(\"utf8\")\n else:\n url = str(url)\n\n # Remove leading whitespaces from url\n url = url.lstrip()\n\n # Don't do any URL preparation for non-HTTP schemes like `mailto`,\n # `data` etc to work around exceptions from `url_parse`, which\n # handles RFC 3986 only.\n if \":\" in url and not url.lower().startswith(\"http\"):\n self.url = url\n return\n\n # Support for unicode domain names and paths.\n try:\n scheme, auth, host, port, path, query, fragment = parse_url(url)\n except LocationParseError as e:\n raise InvalidURL(*e.args)\n\n if not scheme:\n raise MissingSchema(\n f\"Invalid URL {url!r}: No scheme supplied. \"\n f\"Perhaps you meant https://{url}?\"\n )\n\n if not host:\n raise InvalidURL(f\"Invalid URL {url!r}: No host supplied\")\n\n # In general, we want to try IDNA encoding the hostname if the string contains\n # non-ASCII characters. This allows users to automatically get the correct IDNA\n # behaviour. For strings containing only ASCII characters, we need to also verify\n # it doesn't start with a wildcard (*), before allowing the unencoded hostname.\n if not unicode_is_ascii(host):\n try:\n host = self._get_idna_encoded_host(host)\n except UnicodeError:\n raise InvalidURL(\"URL has an invalid label.\")\n elif host.startswith((\"*\", \".\")):\n raise InvalidURL(\"URL has an invalid label.\")\n\n # Carefully reconstruct the network location\n netloc = auth or \"\"\n if netloc:\n netloc += \"@\"\n netloc += host\n if port:\n netloc += f\":{port}\"\n\n # Bare domains aren't valid URLs.\n if not path:\n path = \"/\"\n\n if isinstance(params, (str, bytes)):\n params = to_native_string(params)\n\n enc_params = self._encode_params(params)\n if enc_params:\n if query:\n query = f\"{query}&{enc_params}\"\n else:\n query = enc_params\n\n url = requote_uri(urlunparse([scheme, netloc, path, None, query, fragment]))\n self.url = url\n\n def prepare_headers(self, headers):\n \"\"\"Prepares the given HTTP headers.\"\"\"\n\n self.headers = CaseInsensitiveDict()\n if headers:\n for header in headers.items():\n # Raise exception on invalid header value.\n check_header_validity(header)\n name, value = header\n self.headers[to_native_string(name)] = value\n\n def prepare_body(self, data, files, json=None):\n \"\"\"Prepares the given HTTP body data.\"\"\"\n\n # Check if file, fo, generator, iterator.\n # If not, run through normal process.\n\n # Nottin' on you.\n body = None\n content_type = None\n\n if not data and json is not None:\n # urllib3 requires a bytes-like body. Python 2's json.dumps\n # provides this natively, but Python 3 gives a Unicode string.\n content_type = \"application/json\"\n\n try:\n body = complexjson.dumps(json, allow_nan=False)\n except ValueError as ve:\n raise InvalidJSONError(ve, request=self)\n\n if not isinstance(body, bytes):\n body = body.encode(\"utf-8\")\n\n is_stream = all(\n [\n hasattr(data, \"__iter__\"),\n not isinstance(data, (basestring, list, tuple, Mapping)),\n ]\n )\n\n if is_stream:\n try:\n length = super_len(data)\n except (TypeError, AttributeError, UnsupportedOperation):\n length = None\n\n body = data\n\n if getattr(body, \"tell\", None) is not None:\n # Record the current file position before reading.\n # This will allow us to rewind a file in the event\n # of a redirect.\n try:\n self._body_position = body.tell()\n except OSError:\n # This differentiates from None, allowing us to catch\n # a failed `tell()` later when trying to rewind the body\n self._body_position = object()\n\n if files:\n raise NotImplementedError(\n \"Streamed bodies and files are mutually exclusive.\"\n )\n\n if length:\n self.headers[\"Content-Length\"] = builtin_str(length)\n else:\n self.headers[\"Transfer-Encoding\"] = \"chunked\"\n else:\n # Multi-part file uploads.\n if files:\n (body, content_type) = self._encode_files(files, data)\n else:\n if data:\n body = self._encode_params(data)\n if isinstance(data, basestring) or hasattr(data, \"read\"):\n content_type = None\n else:\n content_type = \"application/x-www-form-urlencoded\"\n\n self.prepare_content_length(body)\n\n # Add content-type if it wasn't explicitly provided.\n if content_type and (\"content-type\" not in self.headers):\n self.headers[\"Content-Type\"] = content_type\n\n self.body = body\n\n def prepare_content_length(self, body):\n \"\"\"Prepare Content-Length header based on request method and body\"\"\"\n if body is not None:\n length = super_len(body)\n if length:\n # If length exists, set it. Otherwise, we fallback\n # to Transfer-Encoding: chunked.\n self.headers[\"Content-Length\"] = builtin_str(length)\n elif (\n self.method not in (\"GET\", \"HEAD\")\n and self.headers.get(\"Content-Length\") is None\n ):\n # Set Content-Length to 0 for methods that can have a body\n # but don't provide one. (i.e. not GET or HEAD)\n self.headers[\"Content-Length\"] = \"0\"\n\n def prepare_auth(self, auth, url=\"\"):\n \"\"\"Prepares the given HTTP auth data.\"\"\"\n\n # If no Auth is explicitly provided, extract it from the URL first.\n if auth is None:\n url_auth = get_auth_from_url(self.url)\n auth = url_auth if any(url_auth) else None\n\n if auth:\n if isinstance(auth, tuple) and len(auth) == 2:\n # special-case basic HTTP auth\n auth = HTTPBasicAuth(*auth)\n\n # Allow auth to make its changes.\n r = auth(self)\n\n # Update self to reflect the auth changes.\n self.__dict__.update(r.__dict__)\n\n # Recompute Content-Length\n self.prepare_content_length(self.body)\n\n def prepare_cookies(self, cookies):\n \"\"\"Prepares the given HTTP cookie data.\n\n This function eventually generates a ``Cookie`` header from the\n given cookies using cookielib. Due to cookielib's design, the header\n will not be regenerated if it already exists, meaning this function\n can only be called once for the life of the\n :class:`PreparedRequest ` object. Any subsequent calls\n to ``prepare_cookies`` will have no actual effect, unless the \"Cookie\"\n header is removed beforehand.\n \"\"\"\n if isinstance(cookies, cookielib.CookieJar):\n self._cookies = cookies\n else:\n self._cookies = cookiejar_from_dict(cookies)\n\n cookie_header = get_cookie_header(self._cookies, self)\n if cookie_header is not None:\n self.headers[\"Cookie\"] = cookie_header\n\n def prepare_hooks(self, hooks):\n \"\"\"Prepares the given hooks.\"\"\"\n # hooks can be passed as None to the prepare method and to this\n # method. To prevent iterating over None, simply use an empty list\n # if hooks is False-y\n hooks = hooks or []\n for event in hooks:\n self.register_hook(event, hooks[event])\n\n\nclass Response:\n \"\"\"The :class:`Response ` object, which contains a\n server's response to an HTTP request.\n \"\"\"\n\n __attrs__ = [\n \"_content\",\n \"status_code\",\n \"headers\",\n \"url\",\n \"history\",\n \"encoding\",\n \"reason\",\n \"cookies\",\n \"elapsed\",\n \"request\",\n ]\n\n def __init__(self):\n self._content = False\n self._content_consumed = False\n self._next = None\n\n #: Integer Code of responded HTTP Status, e.g. 404 or 200.\n self.status_code = None\n\n #: Case-insensitive Dictionary of Response Headers.\n #: For example, ``headers['content-encoding']`` will return the\n #: value of a ``'Content-Encoding'`` response header.\n self.headers = CaseInsensitiveDict()\n\n #: File-like object representation of response (for advanced usage).\n #: Use of ``raw`` requires that ``stream=True`` be set on the request.\n #: This requirement does not apply for use internally to Requests.\n self.raw = None\n\n #: Final URL location of Response.\n self.url = None\n\n #: Encoding to decode with when accessing r.text.\n self.encoding = None\n\n #: A list of :class:`Response ` objects from\n #: the history of the Request. Any redirect responses will end\n #: up here. The list is sorted from the oldest to the most recent request.\n self.history = []\n\n #: Textual reason of responded HTTP Status, e.g. \"Not Found\" or \"OK\".\n self.reason = None\n\n #: A CookieJar of Cookies the server sent back.\n self.cookies = cookiejar_from_dict({})\n\n #: The amount of time elapsed between sending the request\n #: and the arrival of the response (as a timedelta).\n #: This property specifically measures the time taken between sending\n #: the first byte of the request and finishing parsing the headers. It\n #: is therefore unaffected by consuming the response content or the\n #: value of the ``stream`` keyword argument.\n self.elapsed = datetime.timedelta(0)\n\n #: The :class:`PreparedRequest ` object to which this\n #: is a response.\n self.request = None\n\n def __enter__(self):\n return self\n\n def __exit__(self, *args):\n self.close()\n\n def __getstate__(self):\n # Consume everything; accessing the content attribute makes\n # sure the content has been fully read.\n if not self._content_consumed:\n self.content\n\n return {attr: getattr(self, attr, None) for attr in self.__attrs__}\n\n def __setstate__(self, state):\n for name, value in state.items():\n setattr(self, name, value)\n\n # pickled objects do not have .raw\n setattr(self, \"_content_consumed\", True)\n setattr(self, \"raw\", None)\n\n def __repr__(self):\n return f\"\"\n\n def __bool__(self):\n \"\"\"Returns True if :attr:`status_code` is less than 400.\n\n This attribute checks if the status code of the response is between\n 400 and 600 to see if there was a client error or a server error. If\n the status code, is between 200 and 400, this will return True. This\n is **not** a check to see if the response code is ``200 OK``.\n \"\"\"\n return self.ok\n\n def __nonzero__(self):\n \"\"\"Returns True if :attr:`status_code` is less than 400.\n\n This attribute checks if the status code of the response is between\n 400 and 600 to see if there was a client error or a server error. If\n the status code, is between 200 and 400, this will return True. This\n is **not** a check to see if the response code is ``200 OK``.\n \"\"\"\n return self.ok\n\n def __iter__(self):\n \"\"\"Allows you to use a response as an iterator.\"\"\"\n return self.iter_content(128)\n\n @property\n def ok(self):\n \"\"\"Returns True if :attr:`status_code` is less than 400, False if not.\n\n This attribute checks if the status code of the response is between\n 400 and 600 to see if there was a client error or a server error. If\n the status code is between 200 and 400, this will return True. This\n is **not** a check to see if the response code is ``200 OK``.\n \"\"\"\n try:\n self.raise_for_status()\n except HTTPError:\n return False\n return True\n\n @property\n def is_redirect(self):\n \"\"\"True if this Response is a well-formed HTTP redirect that could have\n been processed automatically (by :meth:`Session.resolve_redirects`).\n \"\"\"\n return \"location\" in self.headers and self.status_code in REDIRECT_STATI\n\n @property\n def is_permanent_redirect(self):\n \"\"\"True if this Response one of the permanent versions of redirect.\"\"\"\n return \"location\" in self.headers and self.status_code in (\n codes.moved_permanently,\n codes.permanent_redirect,\n )\n\n @property\n def next(self):\n \"\"\"Returns a PreparedRequest for the next request in a redirect chain, if there is one.\"\"\"\n return self._next\n\n @property\n def apparent_encoding(self):\n \"\"\"The apparent encoding, provided by the charset_normalizer or chardet libraries.\"\"\"\n if chardet is not None:\n return chardet.detect(self.content)[\"encoding\"]\n else:\n # If no character detection library is available, we'll fall back\n # to a standard Python utf-8 str.\n return \"utf-8\"\n\n def iter_content(self, chunk_size=1, decode_unicode=False):\n \"\"\"Iterates over the response data. When stream=True is set on the\n request, this avoids reading the content at once into memory for\n large responses. The chunk size is the number of bytes it should\n read into memory. This is not necessarily the length of each item\n returned as decoding can take place.\n\n chunk_size must be of type int or None. A value of None will\n function differently depending on the value of `stream`.\n stream=True will read data as it arrives in whatever size the\n chunks are received. If stream=False, data is returned as\n a single chunk.\n\n If decode_unicode is True, content will be decoded using the best\n available encoding based on the response.\n \"\"\"\n\n def generate():\n # Special case for urllib3.\n if hasattr(self.raw, \"stream\"):\n try:\n yield from self.raw.stream(chunk_size, decode_content=True)\n except ProtocolError as e:\n raise ChunkedEncodingError(e)\n except DecodeError as e:\n raise ContentDecodingError(e)\n except ReadTimeoutError as e:\n raise ConnectionError(e)\n except SSLError as e:\n raise RequestsSSLError(e)\n else:\n # Standard file-like object.\n while True:\n chunk = self.raw.read(chunk_size)\n if not chunk:\n break\n yield chunk\n\n self._content_consumed = True\n\n if self._content_consumed and isinstance(self._content, bool):\n raise StreamConsumedError()\n elif chunk_size is not None and not isinstance(chunk_size, int):\n raise TypeError(\n f\"chunk_size must be an int, it is instead a {type(chunk_size)}.\"\n )\n # simulate reading small chunks of the content\n reused_chunks = iter_slices(self._content, chunk_size)\n\n stream_chunks = generate()\n\n chunks = reused_chunks if self._content_consumed else stream_chunks\n\n if decode_unicode:\n chunks = stream_decode_response_unicode(chunks, self)\n\n return chunks\n\n def iter_lines(\n self, chunk_size=ITER_CHUNK_SIZE, decode_unicode=False, delimiter=None\n ):\n \"\"\"Iterates over the response data, one line at a time. When\n stream=True is set on the request, this avoids reading the\n content at once into memory for large responses.\n\n .. note:: This method is not reentrant safe.\n \"\"\"\n\n pending = None\n\n for chunk in self.iter_content(\n chunk_size=chunk_size, decode_unicode=decode_unicode\n ):\n if pending is not None:\n chunk = pending + chunk\n\n if delimiter:\n lines = chunk.split(delimiter)\n else:\n lines = chunk.splitlines()\n\n if lines and lines[-1] and chunk and lines[-1][-1] == chunk[-1]:\n pending = lines.pop()\n else:\n pending = None\n\n yield from lines\n\n if pending is not None:\n yield pending\n\n @property\n def content(self):\n \"\"\"Content of the response, in bytes.\"\"\"\n\n if self._content is False:\n # Read the contents.\n if self._content_consumed:\n raise RuntimeError(\"The content for this response was already consumed\")\n\n if self.status_code == 0 or self.raw is None:\n self._content = None\n else:\n self._content = b\"\".join(self.iter_content(CONTENT_CHUNK_SIZE)) or b\"\"\n\n self._content_consumed = True\n # don't need to release the connection; that's been handled by urllib3\n # since we exhausted the data.\n return self._content\n\n @property\n def text(self):\n \"\"\"Content of the response, in unicode.\n\n If Response.encoding is None, encoding will be guessed using\n ``charset_normalizer`` or ``chardet``.\n\n The encoding of the response content is determined based solely on HTTP\n headers, following RFC 2616 to the letter. If you can take advantage of\n non-HTTP knowledge to make a better guess at the encoding, you should\n set ``r.encoding`` appropriately before accessing this property.\n \"\"\"\n\n # Try charset from content-type\n content = None\n encoding = self.encoding\n\n if not self.content:\n return \"\"\n\n # Fallback to auto-detected encoding.\n if self.encoding is None:\n encoding = self.apparent_encoding\n\n # Decode unicode from given encoding.\n try:\n content = str(self.content, encoding, errors=\"replace\")\n except (LookupError, TypeError):\n # A LookupError is raised if the encoding was not found which could\n # indicate a misspelling or similar mistake.\n #\n # A TypeError can be raised if encoding is None\n #\n # So we try blindly encoding.\n content = str(self.content, errors=\"replace\")\n\n return content\n\n def json(self, **kwargs):\n r\"\"\"Returns the json-encoded content of a response, if any.\n\n :param \\*\\*kwargs: Optional arguments that ``json.loads`` takes.\n :raises requests.exceptions.JSONDecodeError: If the response body does not\n contain valid json.\n \"\"\"\n\n if not self.encoding and self.content and len(self.content) > 3:\n # No encoding set. JSON RFC 4627 section 3 states we should expect\n # UTF-8, -16 or -32. Detect which one to use; If the detection or\n # decoding fails, fall back to `self.text` (using charset_normalizer to make\n # a best guess).\n encoding = guess_json_utf(self.content)\n if encoding is not None:\n try:\n return complexjson.loads(self.content.decode(encoding), **kwargs)\n except UnicodeDecodeError:\n # Wrong UTF codec detected; usually because it's not UTF-8\n # but some other 8-bit codec. This is an RFC violation,\n # and the server didn't bother to tell us what codec *was*\n # used.\n pass\n except JSONDecodeError as e:\n raise RequestsJSONDecodeError(e.msg, e.doc, e.pos)\n\n try:\n return complexjson.loads(self.text, **kwargs)\n except JSONDecodeError as e:\n # Catch JSON-related errors and raise as requests.JSONDecodeError\n # This aliases json.JSONDecodeError and simplejson.JSONDecodeError\n raise RequestsJSONDecodeError(e.msg, e.doc, e.pos)\n\n @property\n def links(self):\n \"\"\"Returns the parsed header links of the response, if any.\"\"\"\n\n header = self.headers.get(\"link\")\n\n resolved_links = {}\n\n if header:\n links = parse_header_links(header)\n\n for link in links:\n key = link.get(\"rel\") or link.get(\"url\")\n resolved_links[key] = link\n\n return resolved_links\n\n def raise_for_status(self):\n \"\"\"Raises :class:`HTTPError`, if one occurred.\"\"\"\n\n http_error_msg = \"\"\n if isinstance(self.reason, bytes):\n # We attempt to decode utf-8 first because some servers\n # choose to localize their reason strings. If the string\n # isn't utf-8, we fall back to iso-8859-1 for all other\n # encodings. (See PR #3538)\n try:\n reason = self.reason.decode(\"utf-8\")\n except UnicodeDecodeError:\n reason = self.reason.decode(\"iso-8859-1\")\n else:\n reason = self.reason\n\n if 400 <= self.status_code < 500:\n http_error_msg = (\n f\"{self.status_code} Client Error: {reason} for url: {self.url}\"\n )\n\n elif 500 <= self.status_code < 600:\n http_error_msg = (\n f\"{self.status_code} Server Error: {reason} for url: {self.url}\"\n )\n\n if http_error_msg:\n raise HTTPError(http_error_msg, response=self)\n\n def close(self):\n \"\"\"Releases the connection back to the pool. Once this method has been\n called the underlying ``raw`` object must not be accessed again.\n\n *Note: Should not normally need to be called explicitly.*\n \"\"\"\n if not self._content_consumed:\n self.raw.close()\n\n release_conn = getattr(self.raw, \"release_conn\", None)\n if release_conn is not None:\n release_conn()\n",[],[216,809,810,811,890,891,1275,1309],"0a2bd2ec-67fc-11f0-b489-0224a6c84d84","hooks.py","0a2bd38c-67fc-11f0-b489-0224a6c84d84",370,["D",1753299264851],"\"\"\"\nrequests.hooks\n~~~~~~~~~~~~~~\n\nThis module provides the capabilities for the Requests hooks system.\n\nAvailable hooks:\n\n``response``:\n The response generated from a Request.\n\"\"\"\nHOOKS = [\"response\"]\n\n\ndef default_hooks():\n return {event: [] for event in HOOKS}\n\n\n# TODO: response is the only one\n\n\ndef dispatch_hook(key, hooks, hook_data, **kwargs):\n \"\"\"Dispatches a hook dictionary on a given piece of data.\"\"\"\n hooks = hooks or {}\n hooks = hooks.get(key)\n if hooks:\n if hasattr(hooks, \"__call__\"):\n hooks = [hooks]\n for hook in hooks:\n _hook_data = hook(hook_data, **kwargs)\n if _hook_data is not None:\n hook_data = _hook_data\n return hook_data\n",[],[216,809,810,811,890,891,1275,1317],"0a7cea1a-67fc-11f0-96d6-0224a6c84d84","help.py","0a7ceac4-67fc-11f0-96d6-0224a6c84d84",383,["D",1753299265347],"\"\"\"Module containing bug report helper(s).\"\"\"\n\nimport json\nimport platform\nimport ssl\nimport sys\n\nfrom pip._vendor import idna\nfrom pip._vendor import urllib3\n\nfrom . import __version__ as requests_version\n\ncharset_normalizer = None\nchardet = None\n\ntry:\n from pip._vendor.urllib3.contrib import pyopenssl\nexcept ImportError:\n pyopenssl = None\n OpenSSL = None\n cryptography = None\nelse:\n import cryptography\n import OpenSSL\n\n\ndef _implementation():\n \"\"\"Return a dict with the Python implementation and version.\n\n Provide both the name and the version of the Python implementation\n currently running. For example, on CPython 3.10.3 it will return\n {'name': 'CPython', 'version': '3.10.3'}.\n\n This function works best on CPython and PyPy: in particular, it probably\n doesn't work for Jython or IronPython. Future investigation should be done\n to work out the correct shape of the code for those platforms.\n \"\"\"\n implementation = platform.python_implementation()\n\n if implementation == \"CPython\":\n implementation_version = platform.python_version()\n elif implementation == \"PyPy\":\n implementation_version = \"{}.{}.{}\".format(\n sys.pypy_version_info.major,\n sys.pypy_version_info.minor,\n sys.pypy_version_info.micro,\n )\n if sys.pypy_version_info.releaselevel != \"final\":\n implementation_version = \"\".join(\n [implementation_version, sys.pypy_version_info.releaselevel]\n )\n elif implementation == \"Jython\":\n implementation_version = platform.python_version() # Complete Guess\n elif implementation == \"IronPython\":\n implementation_version = platform.python_version() # Complete Guess\n else:\n implementation_version = \"Unknown\"\n\n return {\"name\": implementation, \"version\": implementation_version}\n\n\ndef info():\n \"\"\"Generate information for a bug report.\"\"\"\n try:\n platform_info = {\n \"system\": platform.system(),\n \"release\": platform.release(),\n }\n except OSError:\n platform_info = {\n \"system\": \"Unknown\",\n \"release\": \"Unknown\",\n }\n\n implementation_info = _implementation()\n urllib3_info = {\"version\": urllib3.__version__}\n charset_normalizer_info = {\"version\": None}\n chardet_info = {\"version\": None}\n if charset_normalizer:\n charset_normalizer_info = {\"version\": charset_normalizer.__version__}\n if chardet:\n chardet_info = {\"version\": chardet.__version__}\n\n pyopenssl_info = {\n \"version\": None,\n \"openssl_version\": \"\",\n }\n if OpenSSL:\n pyopenssl_info = {\n \"version\": OpenSSL.__version__,\n \"openssl_version\": f\"{OpenSSL.SSL.OPENSSL_VERSION_NUMBER:x}\",\n }\n cryptography_info = {\n \"version\": getattr(cryptography, \"__version__\", \"\"),\n }\n idna_info = {\n \"version\": getattr(idna, \"__version__\", \"\"),\n }\n\n system_ssl = ssl.OPENSSL_VERSION_NUMBER\n system_ssl_info = {\"version\": f\"{system_ssl:x}\" if system_ssl is not None else \"\"}\n\n return {\n \"platform\": platform_info,\n \"implementation\": implementation_info,\n \"system_ssl\": system_ssl_info,\n \"using_pyopenssl\": pyopenssl is not None,\n \"using_charset_normalizer\": chardet is None,\n \"pyOpenSSL\": pyopenssl_info,\n \"urllib3\": urllib3_info,\n \"chardet\": chardet_info,\n \"charset_normalizer\": charset_normalizer_info,\n \"cryptography\": cryptography_info,\n \"idna\": idna_info,\n \"requests\": {\n \"version\": requests_version,\n },\n }\n\n\ndef main():\n \"\"\"Pretty-print the bug information as JSON.\"\"\"\n print(json.dumps(info(), sort_keys=True, indent=2))\n\n\nif __name__ == \"__main__\":\n main()\n",[],[216,809,810,811,890,891,1275,1325],"0a6c8eea-67fc-11f0-8cd1-0224a6c84d84","exceptions.py","0a6c8fd0-67fc-11f0-8cd1-0224a6c84d84",381,["D",1753299265275],"\"\"\"\nrequests.exceptions\n~~~~~~~~~~~~~~~~~~~\n\nThis module contains the set of Requests' exceptions.\n\"\"\"\nfrom pip._vendor.urllib3.exceptions import HTTPError as BaseHTTPError\n\nfrom .compat import JSONDecodeError as CompatJSONDecodeError\n\n\nclass RequestException(IOError):\n \"\"\"There was an ambiguous exception that occurred while handling your\n request.\n \"\"\"\n\n def __init__(self, *args, **kwargs):\n \"\"\"Initialize RequestException with `request` and `response` objects.\"\"\"\n response = kwargs.pop(\"response\", None)\n self.response = response\n self.request = kwargs.pop(\"request\", None)\n if response is not None and not self.request and hasattr(response, \"request\"):\n self.request = self.response.request\n super().__init__(*args, **kwargs)\n\n\nclass InvalidJSONError(RequestException):\n \"\"\"A JSON error occurred.\"\"\"\n\n\nclass JSONDecodeError(InvalidJSONError, CompatJSONDecodeError):\n \"\"\"Couldn't decode the text into json\"\"\"\n\n def __init__(self, *args, **kwargs):\n \"\"\"\n Construct the JSONDecodeError instance first with all\n args. Then use it's args to construct the IOError so that\n the json specific args aren't used as IOError specific args\n and the error message from JSONDecodeError is preserved.\n \"\"\"\n CompatJSONDecodeError.__init__(self, *args)\n InvalidJSONError.__init__(self, *self.args, **kwargs)\n\n def __reduce__(self):\n \"\"\"\n The __reduce__ method called when pickling the object must\n be the one from the JSONDecodeError (be it json/simplejson)\n as it expects all the arguments for instantiation, not just\n one like the IOError, and the MRO would by default call the\n __reduce__ method from the IOError due to the inheritance order.\n \"\"\"\n return CompatJSONDecodeError.__reduce__(self)\n\n\nclass HTTPError(RequestException):\n \"\"\"An HTTP error occurred.\"\"\"\n\n\nclass ConnectionError(RequestException):\n \"\"\"A Connection error occurred.\"\"\"\n\n\nclass ProxyError(ConnectionError):\n \"\"\"A proxy error occurred.\"\"\"\n\n\nclass SSLError(ConnectionError):\n \"\"\"An SSL error occurred.\"\"\"\n\n\nclass Timeout(RequestException):\n \"\"\"The request timed out.\n\n Catching this error will catch both\n :exc:`~requests.exceptions.ConnectTimeout` and\n :exc:`~requests.exceptions.ReadTimeout` errors.\n \"\"\"\n\n\nclass ConnectTimeout(ConnectionError, Timeout):\n \"\"\"The request timed out while trying to connect to the remote server.\n\n Requests that produced this error are safe to retry.\n \"\"\"\n\n\nclass ReadTimeout(Timeout):\n \"\"\"The server did not send any data in the allotted amount of time.\"\"\"\n\n\nclass URLRequired(RequestException):\n \"\"\"A valid URL is required to make a request.\"\"\"\n\n\nclass TooManyRedirects(RequestException):\n \"\"\"Too many redirects.\"\"\"\n\n\nclass MissingSchema(RequestException, ValueError):\n \"\"\"The URL scheme (e.g. http or https) is missing.\"\"\"\n\n\nclass InvalidSchema(RequestException, ValueError):\n \"\"\"The URL scheme provided is either invalid or unsupported.\"\"\"\n\n\nclass InvalidURL(RequestException, ValueError):\n \"\"\"The URL provided was somehow invalid.\"\"\"\n\n\nclass InvalidHeader(RequestException, ValueError):\n \"\"\"The header value provided was somehow invalid.\"\"\"\n\n\nclass InvalidProxyURL(InvalidURL):\n \"\"\"The proxy URL provided is invalid.\"\"\"\n\n\nclass ChunkedEncodingError(RequestException):\n \"\"\"The server declared chunked encoding but sent an invalid chunk.\"\"\"\n\n\nclass ContentDecodingError(RequestException, BaseHTTPError):\n \"\"\"Failed to decode response content.\"\"\"\n\n\nclass StreamConsumedError(RequestException, TypeError):\n \"\"\"The content for this response was already consumed.\"\"\"\n\n\nclass RetryError(RequestException):\n \"\"\"Custom retries logic failed\"\"\"\n\n\nclass UnrewindableBodyError(RequestException):\n \"\"\"Requests encountered an error when trying to rewind a body.\"\"\"\n\n\n# Warnings\n\n\nclass RequestsWarning(Warning):\n \"\"\"Base warning for Requests.\"\"\"\n\n\nclass FileModeWarning(RequestsWarning, DeprecationWarning):\n \"\"\"A file was opened in text mode, but Requests determined its binary length.\"\"\"\n\n\nclass RequestsDependencyWarning(RequestsWarning):\n \"\"\"An imported dependency doesn't match the expected version range.\"\"\"\n",[],[216,809,810,811,890,891,1275,1333],"0a1b55b6-67fc-11f0-bcbe-0224a6c84d84","cookies.py","0a1b564c-67fc-11f0-bcbe-0224a6c84d84",367,["D",1753299264739],"\"\"\"\nrequests.cookies\n~~~~~~~~~~~~~~~~\n\nCompatibility code to be able to use `http.cookiejar.CookieJar` with requests.\n\nrequests.utils imports from here, so be careful with imports.\n\"\"\"\n\nimport calendar\nimport copy\nimport time\n\nfrom ._internal_utils import to_native_string\nfrom .compat import Morsel, MutableMapping, cookielib, urlparse, urlunparse\n\ntry:\n import threading\nexcept ImportError:\n import dummy_threading as threading\n\n\nclass MockRequest:\n \"\"\"Wraps a `requests.Request` to mimic a `urllib2.Request`.\n\n The code in `http.cookiejar.CookieJar` expects this interface in order to correctly\n manage cookie policies, i.e., determine whether a cookie can be set, given the\n domains of the request and the cookie.\n\n The original request object is read-only. The client is responsible for collecting\n the new headers via `get_new_headers()` and interpreting them appropriately. You\n probably want `get_cookie_header`, defined below.\n \"\"\"\n\n def __init__(self, request):\n self._r = request\n self._new_headers = {}\n self.type = urlparse(self._r.url).scheme\n\n def get_type(self):\n return self.type\n\n def get_host(self):\n return urlparse(self._r.url).netloc\n\n def get_origin_req_host(self):\n return self.get_host()\n\n def get_full_url(self):\n # Only return the response's URL if the user hadn't set the Host\n # header\n if not self._r.headers.get(\"Host\"):\n return self._r.url\n # If they did set it, retrieve it and reconstruct the expected domain\n host = to_native_string(self._r.headers[\"Host\"], encoding=\"utf-8\")\n parsed = urlparse(self._r.url)\n # Reconstruct the URL as we expect it\n return urlunparse(\n [\n parsed.scheme,\n host,\n parsed.path,\n parsed.params,\n parsed.query,\n parsed.fragment,\n ]\n )\n\n def is_unverifiable(self):\n return True\n\n def has_header(self, name):\n return name in self._r.headers or name in self._new_headers\n\n def get_header(self, name, default=None):\n return self._r.headers.get(name, self._new_headers.get(name, default))\n\n def add_header(self, key, val):\n \"\"\"cookiejar has no legitimate use for this method; add it back if you find one.\"\"\"\n raise NotImplementedError(\n \"Cookie headers should be added with add_unredirected_header()\"\n )\n\n def add_unredirected_header(self, name, value):\n self._new_headers[name] = value\n\n def get_new_headers(self):\n return self._new_headers\n\n @property\n def unverifiable(self):\n return self.is_unverifiable()\n\n @property\n def origin_req_host(self):\n return self.get_origin_req_host()\n\n @property\n def host(self):\n return self.get_host()\n\n\nclass MockResponse:\n \"\"\"Wraps a `httplib.HTTPMessage` to mimic a `urllib.addinfourl`.\n\n ...what? Basically, expose the parsed HTTP headers from the server response\n the way `http.cookiejar` expects to see them.\n \"\"\"\n\n def __init__(self, headers):\n \"\"\"Make a MockResponse for `cookiejar` to read.\n\n :param headers: a httplib.HTTPMessage or analogous carrying the headers\n \"\"\"\n self._headers = headers\n\n def info(self):\n return self._headers\n\n def getheaders(self, name):\n self._headers.getheaders(name)\n\n\ndef extract_cookies_to_jar(jar, request, response):\n \"\"\"Extract the cookies from the response into a CookieJar.\n\n :param jar: http.cookiejar.CookieJar (not necessarily a RequestsCookieJar)\n :param request: our own requests.Request object\n :param response: urllib3.HTTPResponse object\n \"\"\"\n if not (hasattr(response, \"_original_response\") and response._original_response):\n return\n # the _original_response field is the wrapped httplib.HTTPResponse object,\n req = MockRequest(request)\n # pull out the HTTPMessage with the headers and put it in the mock:\n res = MockResponse(response._original_response.msg)\n jar.extract_cookies(res, req)\n\n\ndef get_cookie_header(jar, request):\n \"\"\"\n Produce an appropriate Cookie header string to be sent with `request`, or None.\n\n :rtype: str\n \"\"\"\n r = MockRequest(request)\n jar.add_cookie_header(r)\n return r.get_new_headers().get(\"Cookie\")\n\n\ndef remove_cookie_by_name(cookiejar, name, domain=None, path=None):\n \"\"\"Unsets a cookie by name, by default over all domains and paths.\n\n Wraps CookieJar.clear(), is O(n).\n \"\"\"\n clearables = []\n for cookie in cookiejar:\n if cookie.name != name:\n continue\n if domain is not None and domain != cookie.domain:\n continue\n if path is not None and path != cookie.path:\n continue\n clearables.append((cookie.domain, cookie.path, cookie.name))\n\n for domain, path, name in clearables:\n cookiejar.clear(domain, path, name)\n\n\nclass CookieConflictError(RuntimeError):\n \"\"\"There are two cookies that meet the criteria specified in the cookie jar.\n Use .get and .set and include domain and path args in order to be more specific.\n \"\"\"\n\n\nclass RequestsCookieJar(cookielib.CookieJar, MutableMapping):\n \"\"\"Compatibility class; is a http.cookiejar.CookieJar, but exposes a dict\n interface.\n\n This is the CookieJar we create by default for requests and sessions that\n don't specify one, since some clients may expect response.cookies and\n session.cookies to support dict operations.\n\n Requests does not use the dict interface internally; it's just for\n compatibility with external client code. All requests code should work\n out of the box with externally provided instances of ``CookieJar``, e.g.\n ``LWPCookieJar`` and ``FileCookieJar``.\n\n Unlike a regular CookieJar, this class is pickleable.\n\n .. warning:: dictionary operations that are normally O(1) may be O(n).\n \"\"\"\n\n def get(self, name, default=None, domain=None, path=None):\n \"\"\"Dict-like get() that also supports optional domain and path args in\n order to resolve naming collisions from using one cookie jar over\n multiple domains.\n\n .. warning:: operation is O(n), not O(1).\n \"\"\"\n try:\n return self._find_no_duplicates(name, domain, path)\n except KeyError:\n return default\n\n def set(self, name, value, **kwargs):\n \"\"\"Dict-like set() that also supports optional domain and path args in\n order to resolve naming collisions from using one cookie jar over\n multiple domains.\n \"\"\"\n # support client code that unsets cookies by assignment of a None value:\n if value is None:\n remove_cookie_by_name(\n self, name, domain=kwargs.get(\"domain\"), path=kwargs.get(\"path\")\n )\n return\n\n if isinstance(value, Morsel):\n c = morsel_to_cookie(value)\n else:\n c = create_cookie(name, value, **kwargs)\n self.set_cookie(c)\n return c\n\n def iterkeys(self):\n \"\"\"Dict-like iterkeys() that returns an iterator of names of cookies\n from the jar.\n\n .. seealso:: itervalues() and iteritems().\n \"\"\"\n for cookie in iter(self):\n yield cookie.name\n\n def keys(self):\n \"\"\"Dict-like keys() that returns a list of names of cookies from the\n jar.\n\n .. seealso:: values() and items().\n \"\"\"\n return list(self.iterkeys())\n\n def itervalues(self):\n \"\"\"Dict-like itervalues() that returns an iterator of values of cookies\n from the jar.\n\n .. seealso:: iterkeys() and iteritems().\n \"\"\"\n for cookie in iter(self):\n yield cookie.value\n\n def values(self):\n \"\"\"Dict-like values() that returns a list of values of cookies from the\n jar.\n\n .. seealso:: keys() and items().\n \"\"\"\n return list(self.itervalues())\n\n def iteritems(self):\n \"\"\"Dict-like iteritems() that returns an iterator of name-value tuples\n from the jar.\n\n .. seealso:: iterkeys() and itervalues().\n \"\"\"\n for cookie in iter(self):\n yield cookie.name, cookie.value\n\n def items(self):\n \"\"\"Dict-like items() that returns a list of name-value tuples from the\n jar. Allows client-code to call ``dict(RequestsCookieJar)`` and get a\n vanilla python dict of key value pairs.\n\n .. seealso:: keys() and values().\n \"\"\"\n return list(self.iteritems())\n\n def list_domains(self):\n \"\"\"Utility method to list all the domains in the jar.\"\"\"\n domains = []\n for cookie in iter(self):\n if cookie.domain not in domains:\n domains.append(cookie.domain)\n return domains\n\n def list_paths(self):\n \"\"\"Utility method to list all the paths in the jar.\"\"\"\n paths = []\n for cookie in iter(self):\n if cookie.path not in paths:\n paths.append(cookie.path)\n return paths\n\n def multiple_domains(self):\n \"\"\"Returns True if there are multiple domains in the jar.\n Returns False otherwise.\n\n :rtype: bool\n \"\"\"\n domains = []\n for cookie in iter(self):\n if cookie.domain is not None and cookie.domain in domains:\n return True\n domains.append(cookie.domain)\n return False # there is only one domain in jar\n\n def get_dict(self, domain=None, path=None):\n \"\"\"Takes as an argument an optional domain and path and returns a plain\n old Python dict of name-value pairs of cookies that meet the\n requirements.\n\n :rtype: dict\n \"\"\"\n dictionary = {}\n for cookie in iter(self):\n if (domain is None or cookie.domain == domain) and (\n path is None or cookie.path == path\n ):\n dictionary[cookie.name] = cookie.value\n return dictionary\n\n def __contains__(self, name):\n try:\n return super().__contains__(name)\n except CookieConflictError:\n return True\n\n def __getitem__(self, name):\n \"\"\"Dict-like __getitem__() for compatibility with client code. Throws\n exception if there are more than one cookie with name. In that case,\n use the more explicit get() method instead.\n\n .. warning:: operation is O(n), not O(1).\n \"\"\"\n return self._find_no_duplicates(name)\n\n def __setitem__(self, name, value):\n \"\"\"Dict-like __setitem__ for compatibility with client code. Throws\n exception if there is already a cookie of that name in the jar. In that\n case, use the more explicit set() method instead.\n \"\"\"\n self.set(name, value)\n\n def __delitem__(self, name):\n \"\"\"Deletes a cookie given a name. Wraps ``http.cookiejar.CookieJar``'s\n ``remove_cookie_by_name()``.\n \"\"\"\n remove_cookie_by_name(self, name)\n\n def set_cookie(self, cookie, *args, **kwargs):\n if (\n hasattr(cookie.value, \"startswith\")\n and cookie.value.startswith('\"')\n and cookie.value.endswith('\"')\n ):\n cookie.value = cookie.value.replace('\\\\\"', \"\")\n return super().set_cookie(cookie, *args, **kwargs)\n\n def update(self, other):\n \"\"\"Updates this jar with cookies from another CookieJar or dict-like\"\"\"\n if isinstance(other, cookielib.CookieJar):\n for cookie in other:\n self.set_cookie(copy.copy(cookie))\n else:\n super().update(other)\n\n def _find(self, name, domain=None, path=None):\n \"\"\"Requests uses this method internally to get cookie values.\n\n If there are conflicting cookies, _find arbitrarily chooses one.\n See _find_no_duplicates if you want an exception thrown if there are\n conflicting cookies.\n\n :param name: a string containing name of cookie\n :param domain: (optional) string containing domain of cookie\n :param path: (optional) string containing path of cookie\n :return: cookie.value\n \"\"\"\n for cookie in iter(self):\n if cookie.name == name:\n if domain is None or cookie.domain == domain:\n if path is None or cookie.path == path:\n return cookie.value\n\n raise KeyError(f\"name={name!r}, domain={domain!r}, path={path!r}\")\n\n def _find_no_duplicates(self, name, domain=None, path=None):\n \"\"\"Both ``__get_item__`` and ``get`` call this function: it's never\n used elsewhere in Requests.\n\n :param name: a string containing name of cookie\n :param domain: (optional) string containing domain of cookie\n :param path: (optional) string containing path of cookie\n :raises KeyError: if cookie is not found\n :raises CookieConflictError: if there are multiple cookies\n that match name and optionally domain and path\n :return: cookie.value\n \"\"\"\n toReturn = None\n for cookie in iter(self):\n if cookie.name == name:\n if domain is None or cookie.domain == domain:\n if path is None or cookie.path == path:\n if toReturn is not None:\n # if there are multiple cookies that meet passed in criteria\n raise CookieConflictError(\n f\"There are multiple cookies with name, {name!r}\"\n )\n # we will eventually return this as long as no cookie conflict\n toReturn = cookie.value\n\n if toReturn:\n return toReturn\n raise KeyError(f\"name={name!r}, domain={domain!r}, path={path!r}\")\n\n def __getstate__(self):\n \"\"\"Unlike a normal CookieJar, this class is pickleable.\"\"\"\n state = self.__dict__.copy()\n # remove the unpickleable RLock object\n state.pop(\"_cookies_lock\")\n return state\n\n def __setstate__(self, state):\n \"\"\"Unlike a normal CookieJar, this class is pickleable.\"\"\"\n self.__dict__.update(state)\n if \"_cookies_lock\" not in self.__dict__:\n self._cookies_lock = threading.RLock()\n\n def copy(self):\n \"\"\"Return a copy of this RequestsCookieJar.\"\"\"\n new_cj = RequestsCookieJar()\n new_cj.set_policy(self.get_policy())\n new_cj.update(self)\n return new_cj\n\n def get_policy(self):\n \"\"\"Return the CookiePolicy instance used.\"\"\"\n return self._policy\n\n\ndef _copy_cookie_jar(jar):\n if jar is None:\n return None\n\n if hasattr(jar, \"copy\"):\n # We're dealing with an instance of RequestsCookieJar\n return jar.copy()\n # We're dealing with a generic CookieJar instance\n new_jar = copy.copy(jar)\n new_jar.clear()\n for cookie in jar:\n new_jar.set_cookie(copy.copy(cookie))\n return new_jar\n\n\ndef create_cookie(name, value, **kwargs):\n \"\"\"Make a cookie from underspecified parameters.\n\n By default, the pair of `name` and `value` will be set for the domain ''\n and sent on every request (this is sometimes called a \"supercookie\").\n \"\"\"\n result = {\n \"version\": 0,\n \"name\": name,\n \"value\": value,\n \"port\": None,\n \"domain\": \"\",\n \"path\": \"/\",\n \"secure\": False,\n \"expires\": None,\n \"discard\": True,\n \"comment\": None,\n \"comment_url\": None,\n \"rest\": {\"HttpOnly\": None},\n \"rfc2109\": False,\n }\n\n badargs = set(kwargs) - set(result)\n if badargs:\n raise TypeError(\n f\"create_cookie() got unexpected keyword arguments: {list(badargs)}\"\n )\n\n result.update(kwargs)\n result[\"port_specified\"] = bool(result[\"port\"])\n result[\"domain_specified\"] = bool(result[\"domain\"])\n result[\"domain_initial_dot\"] = result[\"domain\"].startswith(\".\")\n result[\"path_specified\"] = bool(result[\"path\"])\n\n return cookielib.Cookie(**result)\n\n\ndef morsel_to_cookie(morsel):\n \"\"\"Convert a Morsel object into a Cookie containing the one k/v pair.\"\"\"\n\n expires = None\n if morsel[\"max-age\"]:\n try:\n expires = int(time.time() + int(morsel[\"max-age\"]))\n except ValueError:\n raise TypeError(f\"max-age: {morsel['max-age']} must be integer\")\n elif morsel[\"expires\"]:\n time_template = \"%a, %d-%b-%Y %H:%M:%S GMT\"\n expires = calendar.timegm(time.strptime(morsel[\"expires\"], time_template))\n return create_cookie(\n comment=morsel[\"comment\"],\n comment_url=bool(morsel[\"comment\"]),\n discard=False,\n domain=morsel[\"domain\"],\n expires=expires,\n name=morsel.key,\n path=morsel[\"path\"],\n port=None,\n rest={\"HttpOnly\": morsel[\"httponly\"]},\n rfc2109=False,\n secure=bool(morsel[\"secure\"]),\n value=morsel.value,\n version=morsel[\"version\"] or 0,\n )\n\n\ndef cookiejar_from_dict(cookie_dict, cookiejar=None, overwrite=True):\n \"\"\"Returns a CookieJar from a key/value dictionary.\n\n :param cookie_dict: Dict of key/values to insert into CookieJar.\n :param cookiejar: (optional) A cookiejar to add the cookies to.\n :param overwrite: (optional) If False, will not replace cookies\n already in the jar with new ones.\n :rtype: CookieJar\n \"\"\"\n if cookiejar is None:\n cookiejar = RequestsCookieJar()\n\n if cookie_dict is not None:\n names_from_jar = [cookie.name for cookie in cookiejar]\n for name in cookie_dict:\n if overwrite or (name not in names_from_jar):\n cookiejar.set_cookie(create_cookie(name, cookie_dict[name]))\n\n return cookiejar\n\n\ndef merge_cookies(cookiejar, cookies):\n \"\"\"Add cookies to cookiejar and returns a merged CookieJar.\n\n :param cookiejar: CookieJar object to add the cookies to.\n :param cookies: Dictionary or CookieJar object to be added.\n :rtype: CookieJar\n \"\"\"\n if not isinstance(cookiejar, cookielib.CookieJar):\n raise ValueError(\"You can only merge into CookieJar\")\n\n if isinstance(cookies, dict):\n cookiejar = cookiejar_from_dict(cookies, cookiejar=cookiejar, overwrite=False)\n elif isinstance(cookies, cookielib.CookieJar):\n try:\n cookiejar.update(cookies)\n except AttributeError:\n for cookie_in_jar in cookies:\n cookiejar.set_cookie(cookie_in_jar)\n\n return cookiejar\n",[],[216,809,810,811,890,891,1275,1341],"0a3200cc-67fc-11f0-95df-0224a6c84d84","compat.py","0a32018a-67fc-11f0-95df-0224a6c84d84",371,["D",1753299264889],"\"\"\"\nrequests.compat\n~~~~~~~~~~~~~~~\n\nThis module previously handled import compatibility issues\nbetween Python 2 and Python 3. It remains for backwards\ncompatibility until the next major version.\n\"\"\"\n\nimport sys\n\n# -------------------\n# Character Detection\n# -------------------\n\n\ndef _resolve_char_detection():\n \"\"\"Find supported character detection libraries.\"\"\"\n chardet = None\n return chardet\n\n\nchardet = _resolve_char_detection()\n\n# -------\n# Pythons\n# -------\n\n# Syntax sugar.\n_ver = sys.version_info\n\n#: Python 2.x?\nis_py2 = _ver[0] == 2\n\n#: Python 3.x?\nis_py3 = _ver[0] == 3\n\n# Note: We've patched out simplejson support in pip because it prevents\n# upgrading simplejson on Windows.\nimport json\nfrom json import JSONDecodeError\n\n# Keep OrderedDict for backwards compatibility.\nfrom collections import OrderedDict\nfrom collections.abc import Callable, Mapping, MutableMapping\nfrom http import cookiejar as cookielib\nfrom http.cookies import Morsel\nfrom io import StringIO\n\n# --------------\n# Legacy Imports\n# --------------\nfrom urllib.parse import (\n quote,\n quote_plus,\n unquote,\n unquote_plus,\n urldefrag,\n urlencode,\n urljoin,\n urlparse,\n urlsplit,\n urlunparse,\n)\nfrom urllib.request import (\n getproxies,\n getproxies_environment,\n parse_http_list,\n proxy_bypass,\n proxy_bypass_environment,\n)\n\nbuiltin_str = str\nstr = str\nbytes = bytes\nbasestring = (str, bytes)\nnumeric_types = (int, float)\ninteger_types = (int,)\n",[],[216,809,810,811,890,891,1275,1349],"0a3c851a-67fc-11f0-a319-0224a6c84d84","certs.py","0a3c85d8-67fc-11f0-a319-0224a6c84d84",373,["D",1753299264937],"#!/usr/bin/env python\n\n\"\"\"\nrequests.certs\n~~~~~~~~~~~~~~\n\nThis module returns the preferred default CA certificate bundle. There is\nonly one — the one from the certifi package.\n\nIf you are packaging Requests, e.g., for a Linux distribution or a managed\nenvironment, you can change the definition of where() to return a separately\npackaged CA bundle.\n\"\"\"\nfrom pip._vendor.certifi import where\n\nif __name__ == \"__main__\":\n print(where())\n",[],[216,809,810,811,890,891,1275,1357],"0a1e941a-67fc-11f0-95df-0224a6c84d84","auth.py","0a1e94ec-67fc-11f0-95df-0224a6c84d84",368,["D",1753299264762],"\"\"\"\nrequests.auth\n~~~~~~~~~~~~~\n\nThis module contains the authentication handlers for Requests.\n\"\"\"\n\nimport hashlib\nimport os\nimport re\nimport threading\nimport time\nimport warnings\nfrom base64 import b64encode\n\nfrom ._internal_utils import to_native_string\nfrom .compat import basestring, str, urlparse\nfrom .cookies import extract_cookies_to_jar\nfrom .utils import parse_dict_header\n\nCONTENT_TYPE_FORM_URLENCODED = \"application/x-www-form-urlencoded\"\nCONTENT_TYPE_MULTI_PART = \"multipart/form-data\"\n\n\ndef _basic_auth_str(username, password):\n \"\"\"Returns a Basic Auth string.\"\"\"\n\n # \"I want us to put a big-ol' comment on top of it that\n # says that this behaviour is dumb but we need to preserve\n # it because people are relying on it.\"\n # - Lukasa\n #\n # These are here solely to maintain backwards compatibility\n # for things like ints. This will be removed in 3.0.0.\n if not isinstance(username, basestring):\n warnings.warn(\n \"Non-string usernames will no longer be supported in Requests \"\n \"3.0.0. Please convert the object you've passed in ({!r}) to \"\n \"a string or bytes object in the near future to avoid \"\n \"problems.\".format(username),\n category=DeprecationWarning,\n )\n username = str(username)\n\n if not isinstance(password, basestring):\n warnings.warn(\n \"Non-string passwords will no longer be supported in Requests \"\n \"3.0.0. Please convert the object you've passed in ({!r}) to \"\n \"a string or bytes object in the near future to avoid \"\n \"problems.\".format(type(password)),\n category=DeprecationWarning,\n )\n password = str(password)\n # -- End Removal --\n\n if isinstance(username, str):\n username = username.encode(\"latin1\")\n\n if isinstance(password, str):\n password = password.encode(\"latin1\")\n\n authstr = \"Basic \" + to_native_string(\n b64encode(b\":\".join((username, password))).strip()\n )\n\n return authstr\n\n\nclass AuthBase:\n \"\"\"Base class that all auth implementations derive from\"\"\"\n\n def __call__(self, r):\n raise NotImplementedError(\"Auth hooks must be callable.\")\n\n\nclass HTTPBasicAuth(AuthBase):\n \"\"\"Attaches HTTP Basic Authentication to the given Request object.\"\"\"\n\n def __init__(self, username, password):\n self.username = username\n self.password = password\n\n def __eq__(self, other):\n return all(\n [\n self.username == getattr(other, \"username\", None),\n self.password == getattr(other, \"password\", None),\n ]\n )\n\n def __ne__(self, other):\n return not self == other\n\n def __call__(self, r):\n r.headers[\"Authorization\"] = _basic_auth_str(self.username, self.password)\n return r\n\n\nclass HTTPProxyAuth(HTTPBasicAuth):\n \"\"\"Attaches HTTP Proxy Authentication to a given Request object.\"\"\"\n\n def __call__(self, r):\n r.headers[\"Proxy-Authorization\"] = _basic_auth_str(self.username, self.password)\n return r\n\n\nclass HTTPDigestAuth(AuthBase):\n \"\"\"Attaches HTTP Digest Authentication to the given Request object.\"\"\"\n\n def __init__(self, username, password):\n self.username = username\n self.password = password\n # Keep state in per-thread local storage\n self._thread_local = threading.local()\n\n def init_per_thread_state(self):\n # Ensure state is initialized just once per-thread\n if not hasattr(self._thread_local, \"init\"):\n self._thread_local.init = True\n self._thread_local.last_nonce = \"\"\n self._thread_local.nonce_count = 0\n self._thread_local.chal = {}\n self._thread_local.pos = None\n self._thread_local.num_401_calls = None\n\n def build_digest_header(self, method, url):\n \"\"\"\n :rtype: str\n \"\"\"\n\n realm = self._thread_local.chal[\"realm\"]\n nonce = self._thread_local.chal[\"nonce\"]\n qop = self._thread_local.chal.get(\"qop\")\n algorithm = self._thread_local.chal.get(\"algorithm\")\n opaque = self._thread_local.chal.get(\"opaque\")\n hash_utf8 = None\n\n if algorithm is None:\n _algorithm = \"MD5\"\n else:\n _algorithm = algorithm.upper()\n # lambdas assume digest modules are imported at the top level\n if _algorithm == \"MD5\" or _algorithm == \"MD5-SESS\":\n\n def md5_utf8(x):\n if isinstance(x, str):\n x = x.encode(\"utf-8\")\n return hashlib.md5(x).hexdigest()\n\n hash_utf8 = md5_utf8\n elif _algorithm == \"SHA\":\n\n def sha_utf8(x):\n if isinstance(x, str):\n x = x.encode(\"utf-8\")\n return hashlib.sha1(x).hexdigest()\n\n hash_utf8 = sha_utf8\n elif _algorithm == \"SHA-256\":\n\n def sha256_utf8(x):\n if isinstance(x, str):\n x = x.encode(\"utf-8\")\n return hashlib.sha256(x).hexdigest()\n\n hash_utf8 = sha256_utf8\n elif _algorithm == \"SHA-512\":\n\n def sha512_utf8(x):\n if isinstance(x, str):\n x = x.encode(\"utf-8\")\n return hashlib.sha512(x).hexdigest()\n\n hash_utf8 = sha512_utf8\n\n KD = lambda s, d: hash_utf8(f\"{s}:{d}\") # noqa:E731\n\n if hash_utf8 is None:\n return None\n\n # XXX not implemented yet\n entdig = None\n p_parsed = urlparse(url)\n #: path is request-uri defined in RFC 2616 which should not be empty\n path = p_parsed.path or \"/\"\n if p_parsed.query:\n path += f\"?{p_parsed.query}\"\n\n A1 = f\"{self.username}:{realm}:{self.password}\"\n A2 = f\"{method}:{path}\"\n\n HA1 = hash_utf8(A1)\n HA2 = hash_utf8(A2)\n\n if nonce == self._thread_local.last_nonce:\n self._thread_local.nonce_count += 1\n else:\n self._thread_local.nonce_count = 1\n ncvalue = f\"{self._thread_local.nonce_count:08x}\"\n s = str(self._thread_local.nonce_count).encode(\"utf-8\")\n s += nonce.encode(\"utf-8\")\n s += time.ctime().encode(\"utf-8\")\n s += os.urandom(8)\n\n cnonce = hashlib.sha1(s).hexdigest()[:16]\n if _algorithm == \"MD5-SESS\":\n HA1 = hash_utf8(f\"{HA1}:{nonce}:{cnonce}\")\n\n if not qop:\n respdig = KD(HA1, f\"{nonce}:{HA2}\")\n elif qop == \"auth\" or \"auth\" in qop.split(\",\"):\n noncebit = f\"{nonce}:{ncvalue}:{cnonce}:auth:{HA2}\"\n respdig = KD(HA1, noncebit)\n else:\n # XXX handle auth-int.\n return None\n\n self._thread_local.last_nonce = nonce\n\n # XXX should the partial digests be encoded too?\n base = (\n f'username=\"{self.username}\", realm=\"{realm}\", nonce=\"{nonce}\", '\n f'uri=\"{path}\", response=\"{respdig}\"'\n )\n if opaque:\n base += f', opaque=\"{opaque}\"'\n if algorithm:\n base += f', algorithm=\"{algorithm}\"'\n if entdig:\n base += f', digest=\"{entdig}\"'\n if qop:\n base += f', qop=\"auth\", nc={ncvalue}, cnonce=\"{cnonce}\"'\n\n return f\"Digest {base}\"\n\n def handle_redirect(self, r, **kwargs):\n \"\"\"Reset num_401_calls counter on redirects.\"\"\"\n if r.is_redirect:\n self._thread_local.num_401_calls = 1\n\n def handle_401(self, r, **kwargs):\n \"\"\"\n Takes the given response and tries digest-auth, if needed.\n\n :rtype: requests.Response\n \"\"\"\n\n # If response is not 4xx, do not auth\n # See https://github.com/psf/requests/issues/3772\n if not 400 <= r.status_code < 500:\n self._thread_local.num_401_calls = 1\n return r\n\n if self._thread_local.pos is not None:\n # Rewind the file position indicator of the body to where\n # it was to resend the request.\n r.request.body.seek(self._thread_local.pos)\n s_auth = r.headers.get(\"www-authenticate\", \"\")\n\n if \"digest\" in s_auth.lower() and self._thread_local.num_401_calls < 2:\n self._thread_local.num_401_calls += 1\n pat = re.compile(r\"digest \", flags=re.IGNORECASE)\n self._thread_local.chal = parse_dict_header(pat.sub(\"\", s_auth, count=1))\n\n # Consume content and release the original connection\n # to allow our new request to reuse the same one.\n r.content\n r.close()\n prep = r.request.copy()\n extract_cookies_to_jar(prep._cookies, r.request, r.raw)\n prep.prepare_cookies(prep._cookies)\n\n prep.headers[\"Authorization\"] = self.build_digest_header(\n prep.method, prep.url\n )\n _r = r.connection.send(prep, **kwargs)\n _r.history.append(r)\n _r.request = prep\n\n return _r\n\n self._thread_local.num_401_calls = 1\n return r\n\n def __call__(self, r):\n # Initialize per-thread state, if needed\n self.init_per_thread_state()\n # If we have a saved nonce, skip the 401\n if self._thread_local.last_nonce:\n r.headers[\"Authorization\"] = self.build_digest_header(r.method, r.url)\n try:\n self._thread_local.pos = r.body.tell()\n except AttributeError:\n # In the case of HTTPDigestAuth being reused and the body of\n # the previous request was a file-like object, pos has the\n # file position of the previous body. Ensure it's set to\n # None.\n self._thread_local.pos = None\n r.register_hook(\"response\", self.handle_401)\n r.register_hook(\"response\", self.handle_redirect)\n self._thread_local.num_401_calls = 1\n\n return r\n\n def __eq__(self, other):\n return all(\n [\n self.username == getattr(other, \"username\", None),\n self.password == getattr(other, \"password\", None),\n ]\n )\n\n def __ne__(self, other):\n return not self == other\n",[],[216,809,810,811,890,891,1275,1365],"0a647fb6-67fc-11f0-8737-0224a6c84d84","api.py","0a64804c-67fc-11f0-8737-0224a6c84d84",380,["D",1753299265142],"\"\"\"\nrequests.api\n~~~~~~~~~~~~\n\nThis module implements the Requests API.\n\n:copyright: (c) 2012 by Kenneth Reitz.\n:license: Apache2, see LICENSE for more details.\n\"\"\"\n\nfrom . import sessions\n\n\ndef request(method, url, **kwargs):\n \"\"\"Constructs and sends a :class:`Request `.\n\n :param method: method for the new :class:`Request` object: ``GET``, ``OPTIONS``, ``HEAD``, ``POST``, ``PUT``, ``PATCH``, or ``DELETE``.\n :param url: URL for the new :class:`Request` object.\n :param params: (optional) Dictionary, list of tuples or bytes to send\n in the query string for the :class:`Request`.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) A JSON serializable Python object to send in the body of the :class:`Request`.\n :param headers: (optional) Dictionary of HTTP Headers to send with the :class:`Request`.\n :param cookies: (optional) Dict or CookieJar object to send with the :class:`Request`.\n :param files: (optional) Dictionary of ``'name': file-like-objects`` (or ``{'name': file-tuple}``) for multipart encoding upload.\n ``file-tuple`` can be a 2-tuple ``('filename', fileobj)``, 3-tuple ``('filename', fileobj, 'content_type')``\n or a 4-tuple ``('filename', fileobj, 'content_type', custom_headers)``, where ``'content_type'`` is a string\n defining the content type of the given file and ``custom_headers`` a dict-like object containing additional headers\n to add for the file.\n :param auth: (optional) Auth tuple to enable Basic/Digest/Custom HTTP Auth.\n :param timeout: (optional) How many seconds to wait for the server to send data\n before giving up, as a float, or a :ref:`(connect timeout, read\n timeout) ` tuple.\n :type timeout: float or tuple\n :param allow_redirects: (optional) Boolean. Enable/disable GET/OPTIONS/POST/PUT/PATCH/DELETE/HEAD redirection. Defaults to ``True``.\n :type allow_redirects: bool\n :param proxies: (optional) Dictionary mapping protocol to the URL of the proxy.\n :param verify: (optional) Either a boolean, in which case it controls whether we verify\n the server's TLS certificate, or a string, in which case it must be a path\n to a CA bundle to use. Defaults to ``True``.\n :param stream: (optional) if ``False``, the response content will be immediately downloaded.\n :param cert: (optional) if String, path to ssl client cert file (.pem). If Tuple, ('cert', 'key') pair.\n :return: :class:`Response ` object\n :rtype: requests.Response\n\n Usage::\n\n >>> import requests\n >>> req = requests.request('GET', 'https://httpbin.org/get')\n >>> req\n \n \"\"\"\n\n # By using the 'with' statement we are sure the session is closed, thus we\n # avoid leaving sockets open which can trigger a ResourceWarning in some\n # cases, and look like a memory leak in others.\n with sessions.Session() as session:\n return session.request(method=method, url=url, **kwargs)\n\n\ndef get(url, params=None, **kwargs):\n r\"\"\"Sends a GET request.\n\n :param url: URL for the new :class:`Request` object.\n :param params: (optional) Dictionary, list of tuples or bytes to send\n in the query string for the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"get\", url, params=params, **kwargs)\n\n\ndef options(url, **kwargs):\n r\"\"\"Sends an OPTIONS request.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"options\", url, **kwargs)\n\n\ndef head(url, **kwargs):\n r\"\"\"Sends a HEAD request.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes. If\n `allow_redirects` is not provided, it will be set to `False` (as\n opposed to the default :meth:`request` behavior).\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n kwargs.setdefault(\"allow_redirects\", False)\n return request(\"head\", url, **kwargs)\n\n\ndef post(url, data=None, json=None, **kwargs):\n r\"\"\"Sends a POST request.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) A JSON serializable Python object to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"post\", url, data=data, json=json, **kwargs)\n\n\ndef put(url, data=None, **kwargs):\n r\"\"\"Sends a PUT request.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) A JSON serializable Python object to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"put\", url, data=data, **kwargs)\n\n\ndef patch(url, data=None, **kwargs):\n r\"\"\"Sends a PATCH request.\n\n :param url: URL for the new :class:`Request` object.\n :param data: (optional) Dictionary, list of tuples, bytes, or file-like\n object to send in the body of the :class:`Request`.\n :param json: (optional) A JSON serializable Python object to send in the body of the :class:`Request`.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"patch\", url, data=data, **kwargs)\n\n\ndef delete(url, **kwargs):\n r\"\"\"Sends a DELETE request.\n\n :param url: URL for the new :class:`Request` object.\n :param \\*\\*kwargs: Optional arguments that ``request`` takes.\n :return: :class:`Response ` object\n :rtype: requests.Response\n \"\"\"\n\n return request(\"delete\", url, **kwargs)\n",[],[216,809,810,811,890,891,1275,1373],"0a8122b0-67fc-11f0-befa-0224a6c84d84","adapters.py","0a812346-67fc-11f0-befa-0224a6c84d84",384,["D",1753299265396],"\"\"\"\nrequests.adapters\n~~~~~~~~~~~~~~~~~\n\nThis module contains the transport adapters that Requests uses to define\nand maintain connections.\n\"\"\"\n\nimport os.path\nimport socket # noqa: F401\nimport typing\nimport warnings\n\nfrom pip._vendor.urllib3.exceptions import ClosedPoolError, ConnectTimeoutError\nfrom pip._vendor.urllib3.exceptions import HTTPError as _HTTPError\nfrom pip._vendor.urllib3.exceptions import InvalidHeader as _InvalidHeader\nfrom pip._vendor.urllib3.exceptions import (\n LocationValueError,\n MaxRetryError,\n NewConnectionError,\n ProtocolError,\n)\nfrom pip._vendor.urllib3.exceptions import ProxyError as _ProxyError\nfrom pip._vendor.urllib3.exceptions import ReadTimeoutError, ResponseError\nfrom pip._vendor.urllib3.exceptions import SSLError as _SSLError\nfrom pip._vendor.urllib3.poolmanager import PoolManager, proxy_from_url\nfrom pip._vendor.urllib3.util import Timeout as TimeoutSauce\nfrom pip._vendor.urllib3.util import parse_url\nfrom pip._vendor.urllib3.util.retry import Retry\nfrom pip._vendor.urllib3.util.ssl_ import create_urllib3_context\n\nfrom .auth import _basic_auth_str\nfrom .compat import basestring, urlparse\nfrom .cookies import extract_cookies_to_jar\nfrom .exceptions import (\n ConnectionError,\n ConnectTimeout,\n InvalidHeader,\n InvalidProxyURL,\n InvalidSchema,\n InvalidURL,\n ProxyError,\n ReadTimeout,\n RetryError,\n SSLError,\n)\nfrom .models import Response\nfrom .structures import CaseInsensitiveDict\nfrom .utils import (\n DEFAULT_CA_BUNDLE_PATH,\n extract_zipped_paths,\n get_auth_from_url,\n get_encoding_from_headers,\n prepend_scheme_if_needed,\n select_proxy,\n urldefragauth,\n)\n\ntry:\n from pip._vendor.urllib3.contrib.socks import SOCKSProxyManager\nexcept ImportError:\n\n def SOCKSProxyManager(*args, **kwargs):\n raise InvalidSchema(\"Missing dependencies for SOCKS support.\")\n\n\nif typing.TYPE_CHECKING:\n from .models import PreparedRequest\n\n\nDEFAULT_POOLBLOCK = False\nDEFAULT_POOLSIZE = 10\nDEFAULT_RETRIES = 0\nDEFAULT_POOL_TIMEOUT = None\n\n\ntry:\n import ssl # noqa: F401\n\n _preloaded_ssl_context = create_urllib3_context()\n _preloaded_ssl_context.load_verify_locations(\n extract_zipped_paths(DEFAULT_CA_BUNDLE_PATH)\n )\nexcept ImportError:\n # Bypass default SSLContext creation when Python\n # interpreter isn't built with the ssl module.\n _preloaded_ssl_context = None\n\n\ndef _urllib3_request_context(\n request: \"PreparedRequest\",\n verify: \"bool | str | None\",\n client_cert: \"typing.Tuple[str, str] | str | None\",\n poolmanager: \"PoolManager\",\n) -> \"(typing.Dict[str, typing.Any], typing.Dict[str, typing.Any])\":\n host_params = {}\n pool_kwargs = {}\n parsed_request_url = urlparse(request.url)\n scheme = parsed_request_url.scheme.lower()\n port = parsed_request_url.port\n\n # Determine if we have and should use our default SSLContext\n # to optimize performance on standard requests.\n poolmanager_kwargs = getattr(poolmanager, \"connection_pool_kw\", {})\n has_poolmanager_ssl_context = poolmanager_kwargs.get(\"ssl_context\")\n should_use_default_ssl_context = (\n _preloaded_ssl_context is not None and not has_poolmanager_ssl_context\n )\n\n cert_reqs = \"CERT_REQUIRED\"\n if verify is False:\n cert_reqs = \"CERT_NONE\"\n elif verify is True and should_use_default_ssl_context:\n pool_kwargs[\"ssl_context\"] = _preloaded_ssl_context\n elif isinstance(verify, str):\n if not os.path.isdir(verify):\n pool_kwargs[\"ca_certs\"] = verify\n else:\n pool_kwargs[\"ca_cert_dir\"] = verify\n pool_kwargs[\"cert_reqs\"] = cert_reqs\n if client_cert is not None:\n if isinstance(client_cert, tuple) and len(client_cert) == 2:\n pool_kwargs[\"cert_file\"] = client_cert[0]\n pool_kwargs[\"key_file\"] = client_cert[1]\n else:\n # According to our docs, we allow users to specify just the client\n # cert path\n pool_kwargs[\"cert_file\"] = client_cert\n host_params = {\n \"scheme\": scheme,\n \"host\": parsed_request_url.hostname,\n \"port\": port,\n }\n return host_params, pool_kwargs\n\n\nclass BaseAdapter:\n \"\"\"The Base Transport Adapter\"\"\"\n\n def __init__(self):\n super().__init__()\n\n def send(\n self, request, stream=False, timeout=None, verify=True, cert=None, proxies=None\n ):\n \"\"\"Sends PreparedRequest object. Returns Response object.\n\n :param request: The :class:`PreparedRequest ` being sent.\n :param stream: (optional) Whether to stream the request content.\n :param timeout: (optional) How long to wait for the server to send\n data before giving up, as a float, or a :ref:`(connect timeout,\n read timeout) ` tuple.\n :type timeout: float or tuple\n :param verify: (optional) Either a boolean, in which case it controls whether we verify\n the server's TLS certificate, or a string, in which case it must be a path\n to a CA bundle to use\n :param cert: (optional) Any user-provided SSL certificate to be trusted.\n :param proxies: (optional) The proxies dictionary to apply to the request.\n \"\"\"\n raise NotImplementedError\n\n def close(self):\n \"\"\"Cleans up adapter specific items.\"\"\"\n raise NotImplementedError\n\n\nclass HTTPAdapter(BaseAdapter):\n \"\"\"The built-in HTTP Adapter for urllib3.\n\n Provides a general-case interface for Requests sessions to contact HTTP and\n HTTPS urls by implementing the Transport Adapter interface. This class will\n usually be created by the :class:`Session ` class under the\n covers.\n\n :param pool_connections: The number of urllib3 connection pools to cache.\n :param pool_maxsize: The maximum number of connections to save in the pool.\n :param max_retries: The maximum number of retries each connection\n should attempt. Note, this applies only to failed DNS lookups, socket\n connections and connection timeouts, never to requests where data has\n made it to the server. By default, Requests does not retry failed\n connections. If you need granular control over the conditions under\n which we retry a request, import urllib3's ``Retry`` class and pass\n that instead.\n :param pool_block: Whether the connection pool should block for connections.\n\n Usage::\n\n >>> import requests\n >>> s = requests.Session()\n >>> a = requests.adapters.HTTPAdapter(max_retries=3)\n >>> s.mount('http://', a)\n \"\"\"\n\n __attrs__ = [\n \"max_retries\",\n \"config\",\n \"_pool_connections\",\n \"_pool_maxsize\",\n \"_pool_block\",\n ]\n\n def __init__(\n self,\n pool_connections=DEFAULT_POOLSIZE,\n pool_maxsize=DEFAULT_POOLSIZE,\n max_retries=DEFAULT_RETRIES,\n pool_block=DEFAULT_POOLBLOCK,\n ):\n if max_retries == DEFAULT_RETRIES:\n self.max_retries = Retry(0, read=False)\n else:\n self.max_retries = Retry.from_int(max_retries)\n self.config = {}\n self.proxy_manager = {}\n\n super().__init__()\n\n self._pool_connections = pool_connections\n self._pool_maxsize = pool_maxsize\n self._pool_block = pool_block\n\n self.init_poolmanager(pool_connections, pool_maxsize, block=pool_block)\n\n def __getstate__(self):\n return {attr: getattr(self, attr, None) for attr in self.__attrs__}\n\n def __setstate__(self, state):\n # Can't handle by adding 'proxy_manager' to self.__attrs__ because\n # self.poolmanager uses a lambda function, which isn't pickleable.\n self.proxy_manager = {}\n self.config = {}\n\n for attr, value in state.items():\n setattr(self, attr, value)\n\n self.init_poolmanager(\n self._pool_connections, self._pool_maxsize, block=self._pool_block\n )\n\n def init_poolmanager(\n self, connections, maxsize, block=DEFAULT_POOLBLOCK, **pool_kwargs\n ):\n \"\"\"Initializes a urllib3 PoolManager.\n\n This method should not be called from user code, and is only\n exposed for use when subclassing the\n :class:`HTTPAdapter `.\n\n :param connections: The number of urllib3 connection pools to cache.\n :param maxsize: The maximum number of connections to save in the pool.\n :param block: Block when no free connections are available.\n :param pool_kwargs: Extra keyword arguments used to initialize the Pool Manager.\n \"\"\"\n # save these values for pickling\n self._pool_connections = connections\n self._pool_maxsize = maxsize\n self._pool_block = block\n\n self.poolmanager = PoolManager(\n num_pools=connections,\n maxsize=maxsize,\n block=block,\n **pool_kwargs,\n )\n\n def proxy_manager_for(self, proxy, **proxy_kwargs):\n \"\"\"Return urllib3 ProxyManager for the given proxy.\n\n This method should not be called from user code, and is only\n exposed for use when subclassing the\n :class:`HTTPAdapter `.\n\n :param proxy: The proxy to return a urllib3 ProxyManager for.\n :param proxy_kwargs: Extra keyword arguments used to configure the Proxy Manager.\n :returns: ProxyManager\n :rtype: urllib3.ProxyManager\n \"\"\"\n if proxy in self.proxy_manager:\n manager = self.proxy_manager[proxy]\n elif proxy.lower().startswith(\"socks\"):\n username, password = get_auth_from_url(proxy)\n manager = self.proxy_manager[proxy] = SOCKSProxyManager(\n proxy,\n username=username,\n password=password,\n num_pools=self._pool_connections,\n maxsize=self._pool_maxsize,\n block=self._pool_block,\n **proxy_kwargs,\n )\n else:\n proxy_headers = self.proxy_headers(proxy)\n manager = self.proxy_manager[proxy] = proxy_from_url(\n proxy,\n proxy_headers=proxy_headers,\n num_pools=self._pool_connections,\n maxsize=self._pool_maxsize,\n block=self._pool_block,\n **proxy_kwargs,\n )\n\n return manager\n\n def cert_verify(self, conn, url, verify, cert):\n \"\"\"Verify a SSL certificate. This method should not be called from user\n code, and is only exposed for use when subclassing the\n :class:`HTTPAdapter `.\n\n :param conn: The urllib3 connection object associated with the cert.\n :param url: The requested URL.\n :param verify: Either a boolean, in which case it controls whether we verify\n the server's TLS certificate, or a string, in which case it must be a path\n to a CA bundle to use\n :param cert: The SSL certificate to verify.\n \"\"\"\n if url.lower().startswith(\"https\") and verify:\n conn.cert_reqs = \"CERT_REQUIRED\"\n\n # Only load the CA certificates if 'verify' is a string indicating the CA bundle to use.\n # Otherwise, if verify is a boolean, we don't load anything since\n # the connection will be using a context with the default certificates already loaded,\n # and this avoids a call to the slow load_verify_locations()\n if verify is not True:\n # `verify` must be a str with a path then\n cert_loc = verify\n\n if not os.path.exists(cert_loc):\n raise OSError(\n f\"Could not find a suitable TLS CA certificate bundle, \"\n f\"invalid path: {cert_loc}\"\n )\n\n if not os.path.isdir(cert_loc):\n conn.ca_certs = cert_loc\n else:\n conn.ca_cert_dir = cert_loc\n else:\n conn.cert_reqs = \"CERT_NONE\"\n conn.ca_certs = None\n conn.ca_cert_dir = None\n\n if cert:\n if not isinstance(cert, basestring):\n conn.cert_file = cert[0]\n conn.key_file = cert[1]\n else:\n conn.cert_file = cert\n conn.key_file = None\n if conn.cert_file and not os.path.exists(conn.cert_file):\n raise OSError(\n f\"Could not find the TLS certificate file, \"\n f\"invalid path: {conn.cert_file}\"\n )\n if conn.key_file and not os.path.exists(conn.key_file):\n raise OSError(\n f\"Could not find the TLS key file, invalid path: {conn.key_file}\"\n )\n\n def build_response(self, req, resp):\n \"\"\"Builds a :class:`Response ` object from a urllib3\n response. This should not be called from user code, and is only exposed\n for use when subclassing the\n :class:`HTTPAdapter `\n\n :param req: The :class:`PreparedRequest ` used to generate the response.\n :param resp: The urllib3 response object.\n :rtype: requests.Response\n \"\"\"\n response = Response()\n\n # Fallback to None if there's no status_code, for whatever reason.\n response.status_code = getattr(resp, \"status\", None)\n\n # Make headers case-insensitive.\n response.headers = CaseInsensitiveDict(getattr(resp, \"headers\", {}))\n\n # Set encoding.\n response.encoding = get_encoding_from_headers(response.headers)\n response.raw = resp\n response.reason = response.raw.reason\n\n if isinstance(req.url, bytes):\n response.url = req.url.decode(\"utf-8\")\n else:\n response.url = req.url\n\n # Add new cookies from the server.\n extract_cookies_to_jar(response.cookies, req, resp)\n\n # Give the Response some context.\n response.request = req\n response.connection = self\n\n return response\n\n def build_connection_pool_key_attributes(self, request, verify, cert=None):\n \"\"\"Build the PoolKey attributes used by urllib3 to return a connection.\n\n This looks at the PreparedRequest, the user-specified verify value,\n and the value of the cert parameter to determine what PoolKey values\n to use to select a connection from a given urllib3 Connection Pool.\n\n The SSL related pool key arguments are not consistently set. As of\n this writing, use the following to determine what keys may be in that\n dictionary:\n\n * If ``verify`` is ``True``, ``\"ssl_context\"`` will be set and will be the\n default Requests SSL Context\n * If ``verify`` is ``False``, ``\"ssl_context\"`` will not be set but\n ``\"cert_reqs\"`` will be set\n * If ``verify`` is a string, (i.e., it is a user-specified trust bundle)\n ``\"ca_certs\"`` will be set if the string is not a directory recognized\n by :py:func:`os.path.isdir`, otherwise ``\"ca_certs_dir\"`` will be\n set.\n * If ``\"cert\"`` is specified, ``\"cert_file\"`` will always be set. If\n ``\"cert\"`` is a tuple with a second item, ``\"key_file\"`` will also\n be present\n\n To override these settings, one may subclass this class, call this\n method and use the above logic to change parameters as desired. For\n example, if one wishes to use a custom :py:class:`ssl.SSLContext` one\n must both set ``\"ssl_context\"`` and based on what else they require,\n alter the other keys to ensure the desired behaviour.\n\n :param request:\n The PreparedReqest being sent over the connection.\n :type request:\n :class:`~requests.models.PreparedRequest`\n :param verify:\n Either a boolean, in which case it controls whether\n we verify the server's TLS certificate, or a string, in which case it\n must be a path to a CA bundle to use.\n :param cert:\n (optional) Any user-provided SSL certificate for client\n authentication (a.k.a., mTLS). This may be a string (i.e., just\n the path to a file which holds both certificate and key) or a\n tuple of length 2 with the certificate file path and key file\n path.\n :returns:\n A tuple of two dictionaries. The first is the \"host parameters\"\n portion of the Pool Key including scheme, hostname, and port. The\n second is a dictionary of SSLContext related parameters.\n \"\"\"\n return _urllib3_request_context(request, verify, cert, self.poolmanager)\n\n def get_connection_with_tls_context(self, request, verify, proxies=None, cert=None):\n \"\"\"Returns a urllib3 connection for the given request and TLS settings.\n This should not be called from user code, and is only exposed for use\n when subclassing the :class:`HTTPAdapter `.\n\n :param request:\n The :class:`PreparedRequest ` object to be sent\n over the connection.\n :param verify:\n Either a boolean, in which case it controls whether we verify the\n server's TLS certificate, or a string, in which case it must be a\n path to a CA bundle to use.\n :param proxies:\n (optional) The proxies dictionary to apply to the request.\n :param cert:\n (optional) Any user-provided SSL certificate to be used for client\n authentication (a.k.a., mTLS).\n :rtype:\n urllib3.ConnectionPool\n \"\"\"\n proxy = select_proxy(request.url, proxies)\n try:\n host_params, pool_kwargs = self.build_connection_pool_key_attributes(\n request,\n verify,\n cert,\n )\n except ValueError as e:\n raise InvalidURL(e, request=request)\n if proxy:\n proxy = prepend_scheme_if_needed(proxy, \"http\")\n proxy_url = parse_url(proxy)\n if not proxy_url.host:\n raise InvalidProxyURL(\n \"Please check proxy URL. It is malformed \"\n \"and could be missing the host.\"\n )\n proxy_manager = self.proxy_manager_for(proxy)\n conn = proxy_manager.connection_from_host(\n **host_params, pool_kwargs=pool_kwargs\n )\n else:\n # Only scheme should be lower case\n conn = self.poolmanager.connection_from_host(\n **host_params, pool_kwargs=pool_kwargs\n )\n\n return conn\n\n def get_connection(self, url, proxies=None):\n \"\"\"DEPRECATED: Users should move to `get_connection_with_tls_context`\n for all subclasses of HTTPAdapter using Requests>=2.32.2.\n\n Returns a urllib3 connection for the given URL. This should not be\n called from user code, and is only exposed for use when subclassing the\n :class:`HTTPAdapter `.\n\n :param url: The URL to connect to.\n :param proxies: (optional) A Requests-style dictionary of proxies used on this request.\n :rtype: urllib3.ConnectionPool\n \"\"\"\n warnings.warn(\n (\n \"`get_connection` has been deprecated in favor of \"\n \"`get_connection_with_tls_context`. Custom HTTPAdapter subclasses \"\n \"will need to migrate for Requests>=2.32.2. Please see \"\n \"https://github.com/psf/requests/pull/6710 for more details.\"\n ),\n DeprecationWarning,\n )\n proxy = select_proxy(url, proxies)\n\n if proxy:\n proxy = prepend_scheme_if_needed(proxy, \"http\")\n proxy_url = parse_url(proxy)\n if not proxy_url.host:\n raise InvalidProxyURL(\n \"Please check proxy URL. It is malformed \"\n \"and could be missing the host.\"\n )\n proxy_manager = self.proxy_manager_for(proxy)\n conn = proxy_manager.connection_from_url(url)\n else:\n # Only scheme should be lower case\n parsed = urlparse(url)\n url = parsed.geturl()\n conn = self.poolmanager.connection_from_url(url)\n\n return conn\n\n def close(self):\n \"\"\"Disposes of any internal state.\n\n Currently, this closes the PoolManager and any active ProxyManager,\n which closes any pooled connections.\n \"\"\"\n self.poolmanager.clear()\n for proxy in self.proxy_manager.values():\n proxy.clear()\n\n def request_url(self, request, proxies):\n \"\"\"Obtain the url to use when making the final request.\n\n If the message is being sent through a HTTP proxy, the full URL has to\n be used. Otherwise, we should only use the path portion of the URL.\n\n This should not be called from user code, and is only exposed for use\n when subclassing the\n :class:`HTTPAdapter `.\n\n :param request: The :class:`PreparedRequest ` being sent.\n :param proxies: A dictionary of schemes or schemes and hosts to proxy URLs.\n :rtype: str\n \"\"\"\n proxy = select_proxy(request.url, proxies)\n scheme = urlparse(request.url).scheme\n\n is_proxied_http_request = proxy and scheme != \"https\"\n using_socks_proxy = False\n if proxy:\n proxy_scheme = urlparse(proxy).scheme.lower()\n using_socks_proxy = proxy_scheme.startswith(\"socks\")\n\n url = request.path_url\n if url.startswith(\"//\"): # Don't confuse urllib3\n url = f\"/{url.lstrip('/')}\"\n\n if is_proxied_http_request and not using_socks_proxy:\n url = urldefragauth(request.url)\n\n return url\n\n def add_headers(self, request, **kwargs):\n \"\"\"Add any headers needed by the connection. As of v2.0 this does\n nothing by default, but is left for overriding by users that subclass\n the :class:`HTTPAdapter `.\n\n This should not be called from user code, and is only exposed for use\n when subclassing the\n :class:`HTTPAdapter `.\n\n :param request: The :class:`PreparedRequest ` to add headers to.\n :param kwargs: The keyword arguments from the call to send().\n \"\"\"\n pass\n\n def proxy_headers(self, proxy):\n \"\"\"Returns a dictionary of the headers to add to any request sent\n through a proxy. This works with urllib3 magic to ensure that they are\n correctly sent to the proxy, rather than in a tunnelled request if\n CONNECT is being used.\n\n This should not be called from user code, and is only exposed for use\n when subclassing the\n :class:`HTTPAdapter `.\n\n :param proxy: The url of the proxy being used for this request.\n :rtype: dict\n \"\"\"\n headers = {}\n username, password = get_auth_from_url(proxy)\n\n if username:\n headers[\"Proxy-Authorization\"] = _basic_auth_str(username, password)\n\n return headers\n\n def send(\n self, request, stream=False, timeout=None, verify=True, cert=None, proxies=None\n ):\n \"\"\"Sends PreparedRequest object. Returns Response object.\n\n :param request: The :class:`PreparedRequest ` being sent.\n :param stream: (optional) Whether to stream the request content.\n :param timeout: (optional) How long to wait for the server to send\n data before giving up, as a float, or a :ref:`(connect timeout,\n read timeout) ` tuple.\n :type timeout: float or tuple or urllib3 Timeout object\n :param verify: (optional) Either a boolean, in which case it controls whether\n we verify the server's TLS certificate, or a string, in which case it\n must be a path to a CA bundle to use\n :param cert: (optional) Any user-provided SSL certificate to be trusted.\n :param proxies: (optional) The proxies dictionary to apply to the request.\n :rtype: requests.Response\n \"\"\"\n\n try:\n conn = self.get_connection_with_tls_context(\n request, verify, proxies=proxies, cert=cert\n )\n except LocationValueError as e:\n raise InvalidURL(e, request=request)\n\n self.cert_verify(conn, request.url, verify, cert)\n url = self.request_url(request, proxies)\n self.add_headers(\n request,\n stream=stream,\n timeout=timeout,\n verify=verify,\n cert=cert,\n proxies=proxies,\n )\n\n chunked = not (request.body is None or \"Content-Length\" in request.headers)\n\n if isinstance(timeout, tuple):\n try:\n connect, read = timeout\n timeout = TimeoutSauce(connect=connect, read=read)\n except ValueError:\n raise ValueError(\n f\"Invalid timeout {timeout}. Pass a (connect, read) timeout tuple, \"\n f\"or a single float to set both timeouts to the same value.\"\n )\n elif isinstance(timeout, TimeoutSauce):\n pass\n else:\n timeout = TimeoutSauce(connect=timeout, read=timeout)\n\n try:\n resp = conn.urlopen(\n method=request.method,\n url=url,\n body=request.body,\n headers=request.headers,\n redirect=False,\n assert_same_host=False,\n preload_content=False,\n decode_content=False,\n retries=self.max_retries,\n timeout=timeout,\n chunked=chunked,\n )\n\n except (ProtocolError, OSError) as err:\n raise ConnectionError(err, request=request)\n\n except MaxRetryError as e:\n if isinstance(e.reason, ConnectTimeoutError):\n # TODO: Remove this in 3.0.0: see #2811\n if not isinstance(e.reason, NewConnectionError):\n raise ConnectTimeout(e, request=request)\n\n if isinstance(e.reason, ResponseError):\n raise RetryError(e, request=request)\n\n if isinstance(e.reason, _ProxyError):\n raise ProxyError(e, request=request)\n\n if isinstance(e.reason, _SSLError):\n # This branch is for urllib3 v1.22 and later.\n raise SSLError(e, request=request)\n\n raise ConnectionError(e, request=request)\n\n except ClosedPoolError as e:\n raise ConnectionError(e, request=request)\n\n except _ProxyError as e:\n raise ProxyError(e)\n\n except (_SSLError, _HTTPError) as e:\n if isinstance(e, _SSLError):\n # This branch is for urllib3 versions earlier than v1.22\n raise SSLError(e, request=request)\n elif isinstance(e, ReadTimeoutError):\n raise ReadTimeout(e, request=request)\n elif isinstance(e, _InvalidHeader):\n raise InvalidHeader(e, request=request)\n else:\n raise\n\n return self.build_response(request, resp)\n",[],[216,809,810,811,890,891,1275,1381],"0a5d84ea-67fc-11f0-805e-0224a6c84d84","_internal_utils.py","0a5d8594-67fc-11f0-805e-0224a6c84d84",378,["D",1753299265161],"\"\"\"\nrequests._internal_utils\n~~~~~~~~~~~~~~\n\nProvides utility functions that are consumed internally by Requests\nwhich depend on extremely few external helpers (such as compat)\n\"\"\"\nimport re\n\nfrom .compat import builtin_str\n\n_VALID_HEADER_NAME_RE_BYTE = re.compile(rb\"^[^:\\s][^:\\r\\n]*$\")\n_VALID_HEADER_NAME_RE_STR = re.compile(r\"^[^:\\s][^:\\r\\n]*$\")\n_VALID_HEADER_VALUE_RE_BYTE = re.compile(rb\"^\\S[^\\r\\n]*$|^$\")\n_VALID_HEADER_VALUE_RE_STR = re.compile(r\"^\\S[^\\r\\n]*$|^$\")\n\n_HEADER_VALIDATORS_STR = (_VALID_HEADER_NAME_RE_STR, _VALID_HEADER_VALUE_RE_STR)\n_HEADER_VALIDATORS_BYTE = (_VALID_HEADER_NAME_RE_BYTE, _VALID_HEADER_VALUE_RE_BYTE)\nHEADER_VALIDATORS = {\n bytes: _HEADER_VALIDATORS_BYTE,\n str: _HEADER_VALIDATORS_STR,\n}\n\n\ndef to_native_string(string, encoding=\"ascii\"):\n \"\"\"Given a string object, regardless of type, returns a representation of\n that string in the native string type, encoding and decoding where\n necessary. This assumes ASCII unless told otherwise.\n \"\"\"\n if isinstance(string, builtin_str):\n out = string\n else:\n out = string.decode(encoding)\n\n return out\n\n\ndef unicode_is_ascii(u_string):\n \"\"\"Determine if unicode string only contains ASCII characters.\n\n :param str u_string: unicode string to check. Must be unicode\n and not Python 2 `str`.\n :rtype: bool\n \"\"\"\n assert isinstance(u_string, str)\n try:\n u_string.encode(\"ascii\")\n return True\n except UnicodeEncodeError:\n return False\n",[],[216,809,810,811,890,891,1275,1389],"0a5924e0-67fc-11f0-9454-0224a6c84d84","__version__.py","0a592594-67fc-11f0-9454-0224a6c84d84",377,["D",1753299265141],"# .-. .-. .-. . . .-. .-. .-. .-.\n# |( |- |.| | | |- `-. | `-.\n# ' ' `-' `-`.`-' `-' `-' ' `-'\n\n__title__ = \"requests\"\n__description__ = \"Python HTTP for Humans.\"\n__url__ = \"https://requests.readthedocs.io\"\n__version__ = \"2.32.3\"\n__build__ = 0x023203\n__author__ = \"Kenneth Reitz\"\n__author_email__ = \"me@kennethreitz.org\"\n__license__ = \"Apache-2.0\"\n__copyright__ = \"Copyright Kenneth Reitz\"\n__cake__ = \"\\u2728 \\U0001f370 \\u2728\"\n",[],[216,809,810,811,890,891,1275,1397],"0a40b23e-67fc-11f0-befa-0224a6c84d84","0a40b2d4-67fc-11f0-befa-0224a6c84d84",374,["D",1753299264986],"# __\n# /__) _ _ _ _ _/ _\n# / ( (- (/ (/ (- _) / _)\n# /\n\n\"\"\"\nRequests HTTP Library\n~~~~~~~~~~~~~~~~~~~~~\n\nRequests is an HTTP library, written in Python, for human beings.\nBasic GET usage:\n\n >>> import requests\n >>> r = requests.get('https://www.python.org')\n >>> r.status_code\n 200\n >>> b'Python is a programming language' in r.content\n True\n\n... or POST:\n\n >>> payload = dict(key1='value1', key2='value2')\n >>> r = requests.post('https://httpbin.org/post', data=payload)\n >>> print(r.text)\n {\n ...\n \"form\": {\n \"key1\": \"value1\",\n \"key2\": \"value2\"\n },\n ...\n }\n\nThe other HTTP methods are supported - see `requests.api`. Full documentation\nis at .\n\n:copyright: (c) 2017 by Kenneth Reitz.\n:license: Apache 2.0, see LICENSE for more details.\n\"\"\"\n\nimport warnings\n\nfrom pip._vendor import urllib3\n\nfrom .exceptions import RequestsDependencyWarning\n\ncharset_normalizer_version = None\nchardet_version = None\n\n\ndef check_compatibility(urllib3_version, chardet_version, charset_normalizer_version):\n urllib3_version = urllib3_version.split(\".\")\n assert urllib3_version != [\"dev\"] # Verify urllib3 isn't installed from git.\n\n # Sometimes, urllib3 only reports its version as 16.1.\n if len(urllib3_version) == 2:\n urllib3_version.append(\"0\")\n\n # Check urllib3 for compatibility.\n major, minor, patch = urllib3_version # noqa: F811\n major, minor, patch = int(major), int(minor), int(patch)\n # urllib3 >= 1.21.1\n assert major >= 1\n if major == 1:\n assert minor >= 21\n\n # Check charset_normalizer for compatibility.\n if chardet_version:\n major, minor, patch = chardet_version.split(\".\")[:3]\n major, minor, patch = int(major), int(minor), int(patch)\n # chardet_version >= 3.0.2, < 6.0.0\n assert (3, 0, 2) <= (major, minor, patch) < (6, 0, 0)\n elif charset_normalizer_version:\n major, minor, patch = charset_normalizer_version.split(\".\")[:3]\n major, minor, patch = int(major), int(minor), int(patch)\n # charset_normalizer >= 2.0.0 < 4.0.0\n assert (2, 0, 0) <= (major, minor, patch) < (4, 0, 0)\n else:\n # pip does not need or use character detection\n pass\n\n\ndef _check_cryptography(cryptography_version):\n # cryptography < 1.3.4\n try:\n cryptography_version = list(map(int, cryptography_version.split(\".\")))\n except ValueError:\n return\n\n if cryptography_version < [1, 3, 4]:\n warning = \"Old version of cryptography ({}) may cause slowdown.\".format(\n cryptography_version\n )\n warnings.warn(warning, RequestsDependencyWarning)\n\n\n# Check imported dependencies for compatibility.\ntry:\n check_compatibility(\n urllib3.__version__, chardet_version, charset_normalizer_version\n )\nexcept (AssertionError, ValueError):\n warnings.warn(\n \"urllib3 ({}) or chardet ({})/charset_normalizer ({}) doesn't match a supported \"\n \"version!\".format(\n urllib3.__version__, chardet_version, charset_normalizer_version\n ),\n RequestsDependencyWarning,\n )\n\n# Attempt to enable urllib3's fallback for SNI support\n# if the standard library doesn't support SNI or the\n# 'ssl' library isn't available.\ntry:\n # Note: This logic prevents upgrading cryptography on Windows, if imported\n # as part of pip.\n from pip._internal.utils.compat import WINDOWS\n if not WINDOWS:\n raise ImportError(\"pip internals: don't import cryptography on Windows\")\n try:\n import ssl\n except ImportError:\n ssl = None\n\n if not getattr(ssl, \"HAS_SNI\", False):\n from pip._vendor.urllib3.contrib import pyopenssl\n\n pyopenssl.inject_into_urllib3()\n\n # Check cryptography version\n from cryptography import __version__ as cryptography_version\n\n _check_cryptography(cryptography_version)\nexcept ImportError:\n pass\n\n# urllib3's DependencyWarnings should be silenced.\nfrom pip._vendor.urllib3.exceptions import DependencyWarning\n\nwarnings.simplefilter(\"ignore\", DependencyWarning)\n\n# Set default logging handler to avoid \"No handler found\" warnings.\nimport logging\nfrom logging import NullHandler\n\nfrom . import packages, utils\nfrom .__version__ import (\n __author__,\n __author_email__,\n __build__,\n __cake__,\n __copyright__,\n __description__,\n __license__,\n __title__,\n __url__,\n __version__,\n)\nfrom .api import delete, get, head, options, patch, post, put, request\nfrom .exceptions import (\n ConnectionError,\n ConnectTimeout,\n FileModeWarning,\n HTTPError,\n JSONDecodeError,\n ReadTimeout,\n RequestException,\n Timeout,\n TooManyRedirects,\n URLRequired,\n)\nfrom .models import PreparedRequest, Request, Response\nfrom .sessions import Session, session\nfrom .status_codes import codes\n\nlogging.getLogger(__name__).addHandler(NullHandler())\n\n# FileModeWarnings go off per the default.\nwarnings.simplefilter(\"default\", FileModeWarning, append=True)\n",[],[216,809,810,811,890,891,1275,893],"fe4aa4a8-67fb-11f0-847e-0224a6c84d84",79,["D",1753299244917],[547,548,549,550,551,552,553,554,555,556,557,558,559,560,561,562,563,564],[216,809,810,811,890,891,1275],"0ac892b2-67fc-11f0-847e-0224a6c84d84","_impl.py","0ac89352-67fc-11f0-847e-0224a6c84d84","fe96f47a-67fb-11f0-9c7e-0224a6c84d84",393,["D",1753299265840],"import json\nimport os\nimport sys\nimport tempfile\nfrom contextlib import contextmanager\nfrom os.path import abspath\nfrom os.path import join as pjoin\nfrom subprocess import STDOUT, check_call, check_output\nfrom typing import TYPE_CHECKING, Any, Iterator, Mapping, Optional, Sequence\n\nfrom ._in_process import _in_proc_script_path\n\nif TYPE_CHECKING:\n from typing import Protocol\n\n class SubprocessRunner(Protocol):\n \"\"\"A protocol for the subprocess runner.\"\"\"\n\n def __call__(\n self,\n cmd: Sequence[str],\n cwd: Optional[str] = None,\n extra_environ: Optional[Mapping[str, str]] = None,\n ) -> None:\n ...\n\n\ndef write_json(obj: Mapping[str, Any], path: str, **kwargs) -> None:\n with open(path, \"w\", encoding=\"utf-8\") as f:\n json.dump(obj, f, **kwargs)\n\n\ndef read_json(path: str) -> Mapping[str, Any]:\n with open(path, encoding=\"utf-8\") as f:\n return json.load(f)\n\n\nclass BackendUnavailable(Exception):\n \"\"\"Will be raised if the backend cannot be imported in the hook process.\"\"\"\n\n def __init__(\n self,\n traceback: str,\n message: Optional[str] = None,\n backend_name: Optional[str] = None,\n backend_path: Optional[Sequence[str]] = None,\n ) -> None:\n # Preserving arg order for the sake of API backward compatibility.\n self.backend_name = backend_name\n self.backend_path = backend_path\n self.traceback = traceback\n super().__init__(message or \"Error while importing backend\")\n\n\nclass HookMissing(Exception):\n \"\"\"Will be raised on missing hooks (if a fallback can't be used).\"\"\"\n\n def __init__(self, hook_name: str) -> None:\n super().__init__(hook_name)\n self.hook_name = hook_name\n\n\nclass UnsupportedOperation(Exception):\n \"\"\"May be raised by build_sdist if the backend indicates that it can't.\"\"\"\n\n def __init__(self, traceback: str) -> None:\n self.traceback = traceback\n\n\ndef default_subprocess_runner(\n cmd: Sequence[str],\n cwd: Optional[str] = None,\n extra_environ: Optional[Mapping[str, str]] = None,\n) -> None:\n \"\"\"The default method of calling the wrapper subprocess.\n\n This uses :func:`subprocess.check_call` under the hood.\n \"\"\"\n env = os.environ.copy()\n if extra_environ:\n env.update(extra_environ)\n\n check_call(cmd, cwd=cwd, env=env)\n\n\ndef quiet_subprocess_runner(\n cmd: Sequence[str],\n cwd: Optional[str] = None,\n extra_environ: Optional[Mapping[str, str]] = None,\n) -> None:\n \"\"\"Call the subprocess while suppressing output.\n\n This uses :func:`subprocess.check_output` under the hood.\n \"\"\"\n env = os.environ.copy()\n if extra_environ:\n env.update(extra_environ)\n\n check_output(cmd, cwd=cwd, env=env, stderr=STDOUT)\n\n\ndef norm_and_check(source_tree: str, requested: str) -> str:\n \"\"\"Normalise and check a backend path.\n\n Ensure that the requested backend path is specified as a relative path,\n and resolves to a location under the given source tree.\n\n Return an absolute version of the requested path.\n \"\"\"\n if os.path.isabs(requested):\n raise ValueError(\"paths must be relative\")\n\n abs_source = os.path.abspath(source_tree)\n abs_requested = os.path.normpath(os.path.join(abs_source, requested))\n # We have to use commonprefix for Python 2.7 compatibility. So we\n # normalise case to avoid problems because commonprefix is a character\n # based comparison :-(\n norm_source = os.path.normcase(abs_source)\n norm_requested = os.path.normcase(abs_requested)\n if os.path.commonprefix([norm_source, norm_requested]) != norm_source:\n raise ValueError(\"paths must be inside source tree\")\n\n return abs_requested\n\n\nclass BuildBackendHookCaller:\n \"\"\"A wrapper to call the build backend hooks for a source directory.\"\"\"\n\n def __init__(\n self,\n source_dir: str,\n build_backend: str,\n backend_path: Optional[Sequence[str]] = None,\n runner: Optional[\"SubprocessRunner\"] = None,\n python_executable: Optional[str] = None,\n ) -> None:\n \"\"\"\n :param source_dir: The source directory to invoke the build backend for\n :param build_backend: The build backend spec\n :param backend_path: Additional path entries for the build backend spec\n :param runner: The :ref:`subprocess runner ` to use\n :param python_executable:\n The Python executable used to invoke the build backend\n \"\"\"\n if runner is None:\n runner = default_subprocess_runner\n\n self.source_dir = abspath(source_dir)\n self.build_backend = build_backend\n if backend_path:\n backend_path = [norm_and_check(self.source_dir, p) for p in backend_path]\n self.backend_path = backend_path\n self._subprocess_runner = runner\n if not python_executable:\n python_executable = sys.executable\n self.python_executable = python_executable\n\n @contextmanager\n def subprocess_runner(self, runner: \"SubprocessRunner\") -> Iterator[None]:\n \"\"\"A context manager for temporarily overriding the default\n :ref:`subprocess runner `.\n\n :param runner: The new subprocess runner to use within the context.\n\n .. code-block:: python\n\n hook_caller = BuildBackendHookCaller(...)\n with hook_caller.subprocess_runner(quiet_subprocess_runner):\n ...\n \"\"\"\n prev = self._subprocess_runner\n self._subprocess_runner = runner\n try:\n yield\n finally:\n self._subprocess_runner = prev\n\n def _supported_features(self) -> Sequence[str]:\n \"\"\"Return the list of optional features supported by the backend.\"\"\"\n return self._call_hook(\"_supported_features\", {})\n\n def get_requires_for_build_wheel(\n self,\n config_settings: Optional[Mapping[str, Any]] = None,\n ) -> Sequence[str]:\n \"\"\"Get additional dependencies required for building a wheel.\n\n :param config_settings: The configuration settings for the build backend\n :returns: A list of :pep:`dependency specifiers <508>`.\n\n .. admonition:: Fallback\n\n If the build backend does not defined a hook with this name, an\n empty list will be returned.\n \"\"\"\n return self._call_hook(\n \"get_requires_for_build_wheel\", {\"config_settings\": config_settings}\n )\n\n def prepare_metadata_for_build_wheel(\n self,\n metadata_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n _allow_fallback: bool = True,\n ) -> str:\n \"\"\"Prepare a ``*.dist-info`` folder with metadata for this project.\n\n :param metadata_directory: The directory to write the metadata to\n :param config_settings: The configuration settings for the build backend\n :param _allow_fallback:\n Whether to allow the fallback to building a wheel and extracting\n the metadata from it. Should be passed as a keyword argument only.\n\n :returns: Name of the newly created subfolder within\n ``metadata_directory``, containing the metadata.\n\n .. admonition:: Fallback\n\n If the build backend does not define a hook with this name and\n ``_allow_fallback`` is truthy, the backend will be asked to build a\n wheel via the ``build_wheel`` hook and the dist-info extracted from\n that will be returned.\n \"\"\"\n return self._call_hook(\n \"prepare_metadata_for_build_wheel\",\n {\n \"metadata_directory\": abspath(metadata_directory),\n \"config_settings\": config_settings,\n \"_allow_fallback\": _allow_fallback,\n },\n )\n\n def build_wheel(\n self,\n wheel_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n metadata_directory: Optional[str] = None,\n ) -> str:\n \"\"\"Build a wheel from this project.\n\n :param wheel_directory: The directory to write the wheel to\n :param config_settings: The configuration settings for the build backend\n :param metadata_directory: The directory to reuse existing metadata from\n :returns:\n The name of the newly created wheel within ``wheel_directory``.\n\n .. admonition:: Interaction with fallback\n\n If the ``build_wheel`` hook was called in the fallback for\n :meth:`prepare_metadata_for_build_wheel`, the build backend would\n not be invoked. Instead, the previously built wheel will be copied\n to ``wheel_directory`` and the name of that file will be returned.\n \"\"\"\n if metadata_directory is not None:\n metadata_directory = abspath(metadata_directory)\n return self._call_hook(\n \"build_wheel\",\n {\n \"wheel_directory\": abspath(wheel_directory),\n \"config_settings\": config_settings,\n \"metadata_directory\": metadata_directory,\n },\n )\n\n def get_requires_for_build_editable(\n self,\n config_settings: Optional[Mapping[str, Any]] = None,\n ) -> Sequence[str]:\n \"\"\"Get additional dependencies required for building an editable wheel.\n\n :param config_settings: The configuration settings for the build backend\n :returns: A list of :pep:`dependency specifiers <508>`.\n\n .. admonition:: Fallback\n\n If the build backend does not defined a hook with this name, an\n empty list will be returned.\n \"\"\"\n return self._call_hook(\n \"get_requires_for_build_editable\", {\"config_settings\": config_settings}\n )\n\n def prepare_metadata_for_build_editable(\n self,\n metadata_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n _allow_fallback: bool = True,\n ) -> Optional[str]:\n \"\"\"Prepare a ``*.dist-info`` folder with metadata for this project.\n\n :param metadata_directory: The directory to write the metadata to\n :param config_settings: The configuration settings for the build backend\n :param _allow_fallback:\n Whether to allow the fallback to building a wheel and extracting\n the metadata from it. Should be passed as a keyword argument only.\n :returns: Name of the newly created subfolder within\n ``metadata_directory``, containing the metadata.\n\n .. admonition:: Fallback\n\n If the build backend does not define a hook with this name and\n ``_allow_fallback`` is truthy, the backend will be asked to build a\n wheel via the ``build_editable`` hook and the dist-info\n extracted from that will be returned.\n \"\"\"\n return self._call_hook(\n \"prepare_metadata_for_build_editable\",\n {\n \"metadata_directory\": abspath(metadata_directory),\n \"config_settings\": config_settings,\n \"_allow_fallback\": _allow_fallback,\n },\n )\n\n def build_editable(\n self,\n wheel_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n metadata_directory: Optional[str] = None,\n ) -> str:\n \"\"\"Build an editable wheel from this project.\n\n :param wheel_directory: The directory to write the wheel to\n :param config_settings: The configuration settings for the build backend\n :param metadata_directory: The directory to reuse existing metadata from\n :returns:\n The name of the newly created wheel within ``wheel_directory``.\n\n .. admonition:: Interaction with fallback\n\n If the ``build_editable`` hook was called in the fallback for\n :meth:`prepare_metadata_for_build_editable`, the build backend\n would not be invoked. Instead, the previously built wheel will be\n copied to ``wheel_directory`` and the name of that file will be\n returned.\n \"\"\"\n if metadata_directory is not None:\n metadata_directory = abspath(metadata_directory)\n return self._call_hook(\n \"build_editable\",\n {\n \"wheel_directory\": abspath(wheel_directory),\n \"config_settings\": config_settings,\n \"metadata_directory\": metadata_directory,\n },\n )\n\n def get_requires_for_build_sdist(\n self,\n config_settings: Optional[Mapping[str, Any]] = None,\n ) -> Sequence[str]:\n \"\"\"Get additional dependencies required for building an sdist.\n\n :returns: A list of :pep:`dependency specifiers <508>`.\n \"\"\"\n return self._call_hook(\n \"get_requires_for_build_sdist\", {\"config_settings\": config_settings}\n )\n\n def build_sdist(\n self,\n sdist_directory: str,\n config_settings: Optional[Mapping[str, Any]] = None,\n ) -> str:\n \"\"\"Build an sdist from this project.\n\n :returns:\n The name of the newly created sdist within ``wheel_directory``.\n \"\"\"\n return self._call_hook(\n \"build_sdist\",\n {\n \"sdist_directory\": abspath(sdist_directory),\n \"config_settings\": config_settings,\n },\n )\n\n def _call_hook(self, hook_name: str, kwargs: Mapping[str, Any]) -> Any:\n extra_environ = {\"_PYPROJECT_HOOKS_BUILD_BACKEND\": self.build_backend}\n\n if self.backend_path:\n backend_path = os.pathsep.join(self.backend_path)\n extra_environ[\"_PYPROJECT_HOOKS_BACKEND_PATH\"] = backend_path\n\n with tempfile.TemporaryDirectory() as td:\n hook_input = {\"kwargs\": kwargs}\n write_json(hook_input, pjoin(td, \"input.json\"), indent=2)\n\n # Run the hook in a subprocess\n with _in_proc_script_path() as script:\n python = self.python_executable\n self._subprocess_runner(\n [python, abspath(str(script)), hook_name, td],\n cwd=self.source_dir,\n extra_environ=extra_environ,\n )\n\n data = read_json(pjoin(td, \"output.json\"))\n if data.get(\"unsupported\"):\n raise UnsupportedOperation(data.get(\"traceback\", \"\"))\n if data.get(\"no_backend\"):\n raise BackendUnavailable(\n data.get(\"traceback\", \"\"),\n message=data.get(\"backend_error\", \"\"),\n backend_name=self.build_backend,\n backend_path=self.backend_path,\n )\n if data.get(\"hook_missing\"):\n raise HookMissing(data.get(\"missing_hook_name\") or hook_name)\n return data[\"return_val\"]\n",[],[216,809,810,811,890,891,1425,1417],"pyproject_hooks","0acc1324-67fc-11f0-a516-0224a6c84d84","0acc13d8-67fc-11f0-a516-0224a6c84d84",394,["D",1753299265885],"\"\"\"Wrappers to call pyproject.toml-based build backend hooks.\n\"\"\"\n\nfrom typing import TYPE_CHECKING\n\nfrom ._impl import (\n BackendUnavailable,\n BuildBackendHookCaller,\n HookMissing,\n UnsupportedOperation,\n default_subprocess_runner,\n quiet_subprocess_runner,\n)\n\n__version__ = \"1.2.0\"\n__all__ = [\n \"BackendUnavailable\",\n \"BackendInvalid\",\n \"HookMissing\",\n \"UnsupportedOperation\",\n \"default_subprocess_runner\",\n \"quiet_subprocess_runner\",\n \"BuildBackendHookCaller\",\n]\n\nBackendInvalid = BackendUnavailable # Deprecated alias, previously a separate exception\n\nif TYPE_CHECKING:\n from ._impl import SubprocessRunner\n\n __all__ += [\"SubprocessRunner\"]\n",[],[216,809,810,811,890,891,1425,893],"0ad58b48-67fc-11f0-9bd1-0224a6c84d84","_in_process.py","0ad58c10-67fc-11f0-9bd1-0224a6c84d84","030546a6-67fc-11f0-95df-0224a6c84d84",395,["D",1753299265887],"\"\"\"This is invoked in a subprocess to call the build backend hooks.\n\nIt expects:\n- Command line args: hook_name, control_dir\n- Environment variables:\n _PYPROJECT_HOOKS_BUILD_BACKEND=entry.point:spec\n _PYPROJECT_HOOKS_BACKEND_PATH=paths (separated with os.pathsep)\n- control_dir/input.json:\n - {\"kwargs\": {...}}\n\nResults:\n- control_dir/output.json\n - {\"return_val\": ...}\n\"\"\"\nimport json\nimport os\nimport os.path\nimport re\nimport shutil\nimport sys\nimport traceback\nfrom glob import glob\nfrom importlib import import_module\nfrom importlib.machinery import PathFinder\nfrom os.path import join as pjoin\n\n# This file is run as a script, and `import wrappers` is not zip-safe, so we\n# include write_json() and read_json() from wrappers.py.\n\n\ndef write_json(obj, path, **kwargs):\n with open(path, \"w\", encoding=\"utf-8\") as f:\n json.dump(obj, f, **kwargs)\n\n\ndef read_json(path):\n with open(path, encoding=\"utf-8\") as f:\n return json.load(f)\n\n\nclass BackendUnavailable(Exception):\n \"\"\"Raised if we cannot import the backend\"\"\"\n\n def __init__(self, message, traceback=None):\n super().__init__(message)\n self.message = message\n self.traceback = traceback\n\n\nclass HookMissing(Exception):\n \"\"\"Raised if a hook is missing and we are not executing the fallback\"\"\"\n\n def __init__(self, hook_name=None):\n super().__init__(hook_name)\n self.hook_name = hook_name\n\n\ndef _build_backend():\n \"\"\"Find and load the build backend\"\"\"\n backend_path = os.environ.get(\"_PYPROJECT_HOOKS_BACKEND_PATH\")\n ep = os.environ[\"_PYPROJECT_HOOKS_BUILD_BACKEND\"]\n mod_path, _, obj_path = ep.partition(\":\")\n\n if backend_path:\n # Ensure in-tree backend directories have the highest priority when importing.\n extra_pathitems = backend_path.split(os.pathsep)\n sys.meta_path.insert(0, _BackendPathFinder(extra_pathitems, mod_path))\n\n try:\n obj = import_module(mod_path)\n except ImportError:\n msg = f\"Cannot import {mod_path!r}\"\n raise BackendUnavailable(msg, traceback.format_exc())\n\n if obj_path:\n for path_part in obj_path.split(\".\"):\n obj = getattr(obj, path_part)\n return obj\n\n\nclass _BackendPathFinder:\n \"\"\"Implements the MetaPathFinder interface to locate modules in ``backend-path``.\n\n Since the environment provided by the frontend can contain all sorts of\n MetaPathFinders, the only way to ensure the backend is loaded from the\n right place is to prepend our own.\n \"\"\"\n\n def __init__(self, backend_path, backend_module):\n self.backend_path = backend_path\n self.backend_module = backend_module\n self.backend_parent, _, _ = backend_module.partition(\".\")\n\n def find_spec(self, fullname, _path, _target=None):\n if \".\" in fullname:\n # Rely on importlib to find nested modules based on parent's path\n return None\n\n # Ignore other items in _path or sys.path and use backend_path instead:\n spec = PathFinder.find_spec(fullname, path=self.backend_path)\n if spec is None and fullname == self.backend_parent:\n # According to the spec, the backend MUST be loaded from backend-path.\n # Therefore, we can halt the import machinery and raise a clean error.\n msg = f\"Cannot find module {self.backend_module!r} in {self.backend_path!r}\"\n raise BackendUnavailable(msg)\n\n return spec\n\n if sys.version_info >= (3, 8):\n\n def find_distributions(self, context=None):\n # Delayed import: Python 3.7 does not contain importlib.metadata\n from importlib.metadata import DistributionFinder, MetadataPathFinder\n\n context = DistributionFinder.Context(path=self.backend_path)\n return MetadataPathFinder.find_distributions(context=context)\n\n\ndef _supported_features():\n \"\"\"Return the list of options features supported by the backend.\n\n Returns a list of strings.\n The only possible value is 'build_editable'.\n \"\"\"\n backend = _build_backend()\n features = []\n if hasattr(backend, \"build_editable\"):\n features.append(\"build_editable\")\n return features\n\n\ndef get_requires_for_build_wheel(config_settings):\n \"\"\"Invoke the optional get_requires_for_build_wheel hook\n\n Returns [] if the hook is not defined.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.get_requires_for_build_wheel\n except AttributeError:\n return []\n else:\n return hook(config_settings)\n\n\ndef get_requires_for_build_editable(config_settings):\n \"\"\"Invoke the optional get_requires_for_build_editable hook\n\n Returns [] if the hook is not defined.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.get_requires_for_build_editable\n except AttributeError:\n return []\n else:\n return hook(config_settings)\n\n\ndef prepare_metadata_for_build_wheel(\n metadata_directory, config_settings, _allow_fallback\n):\n \"\"\"Invoke optional prepare_metadata_for_build_wheel\n\n Implements a fallback by building a wheel if the hook isn't defined,\n unless _allow_fallback is False in which case HookMissing is raised.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.prepare_metadata_for_build_wheel\n except AttributeError:\n if not _allow_fallback:\n raise HookMissing()\n else:\n return hook(metadata_directory, config_settings)\n # fallback to build_wheel outside the try block to avoid exception chaining\n # which can be confusing to users and is not relevant\n whl_basename = backend.build_wheel(metadata_directory, config_settings)\n return _get_wheel_metadata_from_wheel(\n whl_basename, metadata_directory, config_settings\n )\n\n\ndef prepare_metadata_for_build_editable(\n metadata_directory, config_settings, _allow_fallback\n):\n \"\"\"Invoke optional prepare_metadata_for_build_editable\n\n Implements a fallback by building an editable wheel if the hook isn't\n defined, unless _allow_fallback is False in which case HookMissing is\n raised.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.prepare_metadata_for_build_editable\n except AttributeError:\n if not _allow_fallback:\n raise HookMissing()\n try:\n build_hook = backend.build_editable\n except AttributeError:\n raise HookMissing(hook_name=\"build_editable\")\n else:\n whl_basename = build_hook(metadata_directory, config_settings)\n return _get_wheel_metadata_from_wheel(\n whl_basename, metadata_directory, config_settings\n )\n else:\n return hook(metadata_directory, config_settings)\n\n\nWHEEL_BUILT_MARKER = \"PYPROJECT_HOOKS_ALREADY_BUILT_WHEEL\"\n\n\ndef _dist_info_files(whl_zip):\n \"\"\"Identify the .dist-info folder inside a wheel ZipFile.\"\"\"\n res = []\n for path in whl_zip.namelist():\n m = re.match(r\"[^/\\\\]+-[^/\\\\]+\\.dist-info/\", path)\n if m:\n res.append(path)\n if res:\n return res\n raise Exception(\"No .dist-info folder found in wheel\")\n\n\ndef _get_wheel_metadata_from_wheel(whl_basename, metadata_directory, config_settings):\n \"\"\"Extract the metadata from a wheel.\n\n Fallback for when the build backend does not\n define the 'get_wheel_metadata' hook.\n \"\"\"\n from zipfile import ZipFile\n\n with open(os.path.join(metadata_directory, WHEEL_BUILT_MARKER), \"wb\"):\n pass # Touch marker file\n\n whl_file = os.path.join(metadata_directory, whl_basename)\n with ZipFile(whl_file) as zipf:\n dist_info = _dist_info_files(zipf)\n zipf.extractall(path=metadata_directory, members=dist_info)\n return dist_info[0].split(\"/\")[0]\n\n\ndef _find_already_built_wheel(metadata_directory):\n \"\"\"Check for a wheel already built during the get_wheel_metadata hook.\"\"\"\n if not metadata_directory:\n return None\n metadata_parent = os.path.dirname(metadata_directory)\n if not os.path.isfile(pjoin(metadata_parent, WHEEL_BUILT_MARKER)):\n return None\n\n whl_files = glob(os.path.join(metadata_parent, \"*.whl\"))\n if not whl_files:\n print(\"Found wheel built marker, but no .whl files\")\n return None\n if len(whl_files) > 1:\n print(\n \"Found multiple .whl files; unspecified behaviour. \"\n \"Will call build_wheel.\"\n )\n return None\n\n # Exactly one .whl file\n return whl_files[0]\n\n\ndef build_wheel(wheel_directory, config_settings, metadata_directory=None):\n \"\"\"Invoke the mandatory build_wheel hook.\n\n If a wheel was already built in the\n prepare_metadata_for_build_wheel fallback, this\n will copy it rather than rebuilding the wheel.\n \"\"\"\n prebuilt_whl = _find_already_built_wheel(metadata_directory)\n if prebuilt_whl:\n shutil.copy2(prebuilt_whl, wheel_directory)\n return os.path.basename(prebuilt_whl)\n\n return _build_backend().build_wheel(\n wheel_directory, config_settings, metadata_directory\n )\n\n\ndef build_editable(wheel_directory, config_settings, metadata_directory=None):\n \"\"\"Invoke the optional build_editable hook.\n\n If a wheel was already built in the\n prepare_metadata_for_build_editable fallback, this\n will copy it rather than rebuilding the wheel.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.build_editable\n except AttributeError:\n raise HookMissing()\n else:\n prebuilt_whl = _find_already_built_wheel(metadata_directory)\n if prebuilt_whl:\n shutil.copy2(prebuilt_whl, wheel_directory)\n return os.path.basename(prebuilt_whl)\n\n return hook(wheel_directory, config_settings, metadata_directory)\n\n\ndef get_requires_for_build_sdist(config_settings):\n \"\"\"Invoke the optional get_requires_for_build_wheel hook\n\n Returns [] if the hook is not defined.\n \"\"\"\n backend = _build_backend()\n try:\n hook = backend.get_requires_for_build_sdist\n except AttributeError:\n return []\n else:\n return hook(config_settings)\n\n\nclass _DummyException(Exception):\n \"\"\"Nothing should ever raise this exception\"\"\"\n\n\nclass GotUnsupportedOperation(Exception):\n \"\"\"For internal use when backend raises UnsupportedOperation\"\"\"\n\n def __init__(self, traceback):\n self.traceback = traceback\n\n\ndef build_sdist(sdist_directory, config_settings):\n \"\"\"Invoke the mandatory build_sdist hook.\"\"\"\n backend = _build_backend()\n try:\n return backend.build_sdist(sdist_directory, config_settings)\n except getattr(backend, \"UnsupportedOperation\", _DummyException):\n raise GotUnsupportedOperation(traceback.format_exc())\n\n\nHOOK_NAMES = {\n \"get_requires_for_build_wheel\",\n \"prepare_metadata_for_build_wheel\",\n \"build_wheel\",\n \"get_requires_for_build_editable\",\n \"prepare_metadata_for_build_editable\",\n \"build_editable\",\n \"get_requires_for_build_sdist\",\n \"build_sdist\",\n \"_supported_features\",\n}\n\n\ndef main():\n if len(sys.argv) < 3:\n sys.exit(\"Needs args: hook_name, control_dir\")\n hook_name = sys.argv[1]\n control_dir = sys.argv[2]\n if hook_name not in HOOK_NAMES:\n sys.exit(\"Unknown hook: %s\" % hook_name)\n\n # Remove the parent directory from sys.path to avoid polluting the backend\n # import namespace with this directory.\n here = os.path.dirname(__file__)\n if here in sys.path:\n sys.path.remove(here)\n\n hook = globals()[hook_name]\n\n hook_input = read_json(pjoin(control_dir, \"input.json\"))\n\n json_out = {\"unsupported\": False, \"return_val\": None}\n try:\n json_out[\"return_val\"] = hook(**hook_input[\"kwargs\"])\n except BackendUnavailable as e:\n json_out[\"no_backend\"] = True\n json_out[\"traceback\"] = e.traceback\n json_out[\"backend_error\"] = e.message\n except GotUnsupportedOperation as e:\n json_out[\"unsupported\"] = True\n json_out[\"traceback\"] = e.traceback\n except HookMissing as e:\n json_out[\"hook_missing\"] = True\n json_out[\"missing_hook_name\"] = e.hook_name or hook_name\n\n write_json(json_out, pjoin(control_dir, \"output.json\"), indent=2)\n\n\nif __name__ == \"__main__\":\n main()\n",[],[216,809,810,811,890,891,1425,1442,1434],"_in_process","0adce082-67fc-11f0-a7d9-0224a6c84d84","0adce118-67fc-11f0-a7d9-0224a6c84d84",396,["D",1753299266004],"\"\"\"This is a subpackage because the directory is on sys.path for _in_process.py\n\nThe subpackage should stay as empty as possible to avoid shadowing modules that\nthe backend might import.\n\"\"\"\n\nimport importlib.resources as resources\n\ntry:\n resources.files\nexcept AttributeError:\n # Python 3.8 compatibility\n def _in_proc_script_path():\n return resources.path(__package__, \"_in_process.py\")\n\nelse:\n\n def _in_proc_script_path():\n return resources.as_file(\n resources.files(__package__).joinpath(\"_in_process.py\")\n )\n",[],[216,809,810,811,890,891,1425,1442,893],"030545b6-67fc-11f0-95df-0224a6c84d84",100,["D",1753299252852],[542,543],[216,809,810,811,890,891,1425,1442],"fe96f3d0-67fb-11f0-9c7e-0224a6c84d84",82,["D",1753299245415],[541,544,545],[216,809,810,811,890,891,1425],"08c86c44-67fc-11f0-8791-0224a6c84d84","util.py","08c86cf8-67fc-11f0-8791-0224a6c84d84","fdca9452-67fb-11f0-847e-0224a6c84d84",317,["D",1753299262481],"\"\"\"\n pygments.util\n ~~~~~~~~~~~~~\n\n Utility functions.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\nfrom io import TextIOWrapper\n\n\nsplit_path_re = re.compile(r'[/\\\\ ]')\ndoctype_lookup_re = re.compile(r'''\n ]*>\n''', re.DOTALL | re.MULTILINE | re.VERBOSE)\ntag_re = re.compile(r'<(.+?)(\\s.*?)?>.*?',\n re.IGNORECASE | re.DOTALL | re.MULTILINE)\nxml_decl_re = re.compile(r'\\s*<\\?xml[^>]*\\?>', re.I)\n\n\nclass ClassNotFound(ValueError):\n \"\"\"Raised if one of the lookup functions didn't find a matching class.\"\"\"\n\n\nclass OptionError(Exception):\n \"\"\"\n This exception will be raised by all option processing functions if\n the type or value of the argument is not correct.\n \"\"\"\n\ndef get_choice_opt(options, optname, allowed, default=None, normcase=False):\n \"\"\"\n If the key `optname` from the dictionary is not in the sequence\n `allowed`, raise an error, otherwise return it.\n \"\"\"\n string = options.get(optname, default)\n if normcase:\n string = string.lower()\n if string not in allowed:\n raise OptionError('Value for option {} must be one of {}'.format(optname, ', '.join(map(str, allowed))))\n return string\n\n\ndef get_bool_opt(options, optname, default=None):\n \"\"\"\n Intuitively, this is `options.get(optname, default)`, but restricted to\n Boolean value. The Booleans can be represented as string, in order to accept\n Boolean value from the command line arguments. If the key `optname` is\n present in the dictionary `options` and is not associated with a Boolean,\n raise an `OptionError`. If it is absent, `default` is returned instead.\n\n The valid string values for ``True`` are ``1``, ``yes``, ``true`` and\n ``on``, the ones for ``False`` are ``0``, ``no``, ``false`` and ``off``\n (matched case-insensitively).\n \"\"\"\n string = options.get(optname, default)\n if isinstance(string, bool):\n return string\n elif isinstance(string, int):\n return bool(string)\n elif not isinstance(string, str):\n raise OptionError(f'Invalid type {string!r} for option {optname}; use '\n '1/0, yes/no, true/false, on/off')\n elif string.lower() in ('1', 'yes', 'true', 'on'):\n return True\n elif string.lower() in ('0', 'no', 'false', 'off'):\n return False\n else:\n raise OptionError(f'Invalid value {string!r} for option {optname}; use '\n '1/0, yes/no, true/false, on/off')\n\n\ndef get_int_opt(options, optname, default=None):\n \"\"\"As :func:`get_bool_opt`, but interpret the value as an integer.\"\"\"\n string = options.get(optname, default)\n try:\n return int(string)\n except TypeError:\n raise OptionError(f'Invalid type {string!r} for option {optname}; you '\n 'must give an integer value')\n except ValueError:\n raise OptionError(f'Invalid value {string!r} for option {optname}; you '\n 'must give an integer value')\n\ndef get_list_opt(options, optname, default=None):\n \"\"\"\n If the key `optname` from the dictionary `options` is a string,\n split it at whitespace and return it. If it is already a list\n or a tuple, it is returned as a list.\n \"\"\"\n val = options.get(optname, default)\n if isinstance(val, str):\n return val.split()\n elif isinstance(val, (list, tuple)):\n return list(val)\n else:\n raise OptionError(f'Invalid type {val!r} for option {optname}; you '\n 'must give a list value')\n\n\ndef docstring_headline(obj):\n if not obj.__doc__:\n return ''\n res = []\n for line in obj.__doc__.strip().splitlines():\n if line.strip():\n res.append(\" \" + line.strip())\n else:\n break\n return ''.join(res).lstrip()\n\n\ndef make_analysator(f):\n \"\"\"Return a static text analyser function that returns float values.\"\"\"\n def text_analyse(text):\n try:\n rv = f(text)\n except Exception:\n return 0.0\n if not rv:\n return 0.0\n try:\n return min(1.0, max(0.0, float(rv)))\n except (ValueError, TypeError):\n return 0.0\n text_analyse.__doc__ = f.__doc__\n return staticmethod(text_analyse)\n\n\ndef shebang_matches(text, regex):\n r\"\"\"Check if the given regular expression matches the last part of the\n shebang if one exists.\n\n >>> from pygments.util import shebang_matches\n >>> shebang_matches('#!/usr/bin/env python', r'python(2\\.\\d)?')\n True\n >>> shebang_matches('#!/usr/bin/python2.4', r'python(2\\.\\d)?')\n True\n >>> shebang_matches('#!/usr/bin/python-ruby', r'python(2\\.\\d)?')\n False\n >>> shebang_matches('#!/usr/bin/python/ruby', r'python(2\\.\\d)?')\n False\n >>> shebang_matches('#!/usr/bin/startsomethingwith python',\n ... r'python(2\\.\\d)?')\n True\n\n It also checks for common windows executable file extensions::\n\n >>> shebang_matches('#!C:\\\\Python2.4\\\\Python.exe', r'python(2\\.\\d)?')\n True\n\n Parameters (``'-f'`` or ``'--foo'`` are ignored so ``'perl'`` does\n the same as ``'perl -e'``)\n\n Note that this method automatically searches the whole string (eg:\n the regular expression is wrapped in ``'^$'``)\n \"\"\"\n index = text.find('\\n')\n if index >= 0:\n first_line = text[:index].lower()\n else:\n first_line = text.lower()\n if first_line.startswith('#!'):\n try:\n found = [x for x in split_path_re.split(first_line[2:].strip())\n if x and not x.startswith('-')][-1]\n except IndexError:\n return False\n regex = re.compile(rf'^{regex}(\\.(exe|cmd|bat|bin))?$', re.IGNORECASE)\n if regex.search(found) is not None:\n return True\n return False\n\n\ndef doctype_matches(text, regex):\n \"\"\"Check if the doctype matches a regular expression (if present).\n\n Note that this method only checks the first part of a DOCTYPE.\n eg: 'html PUBLIC \"-//W3C//DTD XHTML 1.0 Strict//EN\"'\n \"\"\"\n m = doctype_lookup_re.search(text)\n if m is None:\n return False\n doctype = m.group(1)\n return re.compile(regex, re.I).match(doctype.strip()) is not None\n\n\ndef html_doctype_matches(text):\n \"\"\"Check if the file looks like it has a html doctype.\"\"\"\n return doctype_matches(text, r'html')\n\n\n_looks_like_xml_cache = {}\n\n\ndef looks_like_xml(text):\n \"\"\"Check if a doctype exists or if we have some tags.\"\"\"\n if xml_decl_re.match(text):\n return True\n key = hash(text)\n try:\n return _looks_like_xml_cache[key]\n except KeyError:\n m = doctype_lookup_re.search(text)\n if m is not None:\n return True\n rv = tag_re.search(text[:1000]) is not None\n _looks_like_xml_cache[key] = rv\n return rv\n\n\ndef surrogatepair(c):\n \"\"\"Given a unicode character code with length greater than 16 bits,\n return the two 16 bit surrogate pair.\n \"\"\"\n # From example D28 of:\n # http://www.unicode.org/book/ch03.pdf\n return (0xd7c0 + (c >> 10), (0xdc00 + (c & 0x3ff)))\n\n\ndef format_lines(var_name, seq, raw=False, indent_level=0):\n \"\"\"Formats a sequence of strings for output.\"\"\"\n lines = []\n base_indent = ' ' * indent_level * 4\n inner_indent = ' ' * (indent_level + 1) * 4\n lines.append(base_indent + var_name + ' = (')\n if raw:\n # These should be preformatted reprs of, say, tuples.\n for i in seq:\n lines.append(inner_indent + i + ',')\n else:\n for i in seq:\n # Force use of single quotes\n r = repr(i + '\"')\n lines.append(inner_indent + r[:-2] + r[-1] + ',')\n lines.append(base_indent + ')')\n return '\\n'.join(lines)\n\n\ndef duplicates_removed(it, already_seen=()):\n \"\"\"\n Returns a list with duplicates removed from the iterable `it`.\n\n Order is preserved.\n \"\"\"\n lst = []\n seen = set()\n for i in it:\n if i in seen or i in already_seen:\n continue\n lst.append(i)\n seen.add(i)\n return lst\n\n\nclass Future:\n \"\"\"Generic class to defer some work.\n\n Handled specially in RegexLexerMeta, to support regex string construction at\n first use.\n \"\"\"\n def get(self):\n raise NotImplementedError\n\n\ndef guess_decode(text):\n \"\"\"Decode *text* with guessed encoding.\n\n First try UTF-8; this should fail for non-UTF-8 encodings.\n Then try the preferred locale encoding.\n Fall back to latin-1, which always works.\n \"\"\"\n try:\n text = text.decode('utf-8')\n return text, 'utf-8'\n except UnicodeDecodeError:\n try:\n import locale\n prefencoding = locale.getpreferredencoding()\n text = text.decode()\n return text, prefencoding\n except (UnicodeDecodeError, LookupError):\n text = text.decode('latin1')\n return text, 'latin1'\n\n\ndef guess_decode_from_terminal(text, term):\n \"\"\"Decode *text* coming from terminal *term*.\n\n First try the terminal encoding, if given.\n Then try UTF-8. Then try the preferred locale encoding.\n Fall back to latin-1, which always works.\n \"\"\"\n if getattr(term, 'encoding', None):\n try:\n text = text.decode(term.encoding)\n except UnicodeDecodeError:\n pass\n else:\n return text, term.encoding\n return guess_decode(text)\n\n\ndef terminal_encoding(term):\n \"\"\"Return our best guess of encoding for the given *term*.\"\"\"\n if getattr(term, 'encoding', None):\n return term.encoding\n import locale\n return locale.getpreferredencoding()\n\n\nclass UnclosingTextIOWrapper(TextIOWrapper):\n # Don't close underlying buffer on destruction.\n def close(self):\n self.flush()\n",[],[216,809,810,811,890,891,1469,1461],"pygments","091a433e-67fc-11f0-8d4e-0224a6c84d84","unistring.py","091a4410-67fc-11f0-8d4e-0224a6c84d84",328,["D",1753299262978],"\"\"\"\n pygments.unistring\n ~~~~~~~~~~~~~~~~~~\n\n Strings of all Unicode characters of a certain category.\n Used for matching in Unicode-aware languages. Run to regenerate.\n\n Inspired by chartypes_create.py from the MoinMoin project.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nCc = '\\x00-\\x1f\\x7f-\\x9f'\n\nCf = '\\xad\\u0600-\\u0605\\u061c\\u06dd\\u070f\\u08e2\\u180e\\u200b-\\u200f\\u202a-\\u202e\\u2060-\\u2064\\u2066-\\u206f\\ufeff\\ufff9-\\ufffb\\U000110bd\\U000110cd\\U0001bca0-\\U0001bca3\\U0001d173-\\U0001d17a\\U000e0001\\U000e0020-\\U000e007f'\n\nCn = '\\u0378-\\u0379\\u0380-\\u0383\\u038b\\u038d\\u03a2\\u0530\\u0557-\\u0558\\u058b-\\u058c\\u0590\\u05c8-\\u05cf\\u05eb-\\u05ee\\u05f5-\\u05ff\\u061d\\u070e\\u074b-\\u074c\\u07b2-\\u07bf\\u07fb-\\u07fc\\u082e-\\u082f\\u083f\\u085c-\\u085d\\u085f\\u086b-\\u089f\\u08b5\\u08be-\\u08d2\\u0984\\u098d-\\u098e\\u0991-\\u0992\\u09a9\\u09b1\\u09b3-\\u09b5\\u09ba-\\u09bb\\u09c5-\\u09c6\\u09c9-\\u09ca\\u09cf-\\u09d6\\u09d8-\\u09db\\u09de\\u09e4-\\u09e5\\u09ff-\\u0a00\\u0a04\\u0a0b-\\u0a0e\\u0a11-\\u0a12\\u0a29\\u0a31\\u0a34\\u0a37\\u0a3a-\\u0a3b\\u0a3d\\u0a43-\\u0a46\\u0a49-\\u0a4a\\u0a4e-\\u0a50\\u0a52-\\u0a58\\u0a5d\\u0a5f-\\u0a65\\u0a77-\\u0a80\\u0a84\\u0a8e\\u0a92\\u0aa9\\u0ab1\\u0ab4\\u0aba-\\u0abb\\u0ac6\\u0aca\\u0ace-\\u0acf\\u0ad1-\\u0adf\\u0ae4-\\u0ae5\\u0af2-\\u0af8\\u0b00\\u0b04\\u0b0d-\\u0b0e\\u0b11-\\u0b12\\u0b29\\u0b31\\u0b34\\u0b3a-\\u0b3b\\u0b45-\\u0b46\\u0b49-\\u0b4a\\u0b4e-\\u0b55\\u0b58-\\u0b5b\\u0b5e\\u0b64-\\u0b65\\u0b78-\\u0b81\\u0b84\\u0b8b-\\u0b8d\\u0b91\\u0b96-\\u0b98\\u0b9b\\u0b9d\\u0ba0-\\u0ba2\\u0ba5-\\u0ba7\\u0bab-\\u0bad\\u0bba-\\u0bbd\\u0bc3-\\u0bc5\\u0bc9\\u0bce-\\u0bcf\\u0bd1-\\u0bd6\\u0bd8-\\u0be5\\u0bfb-\\u0bff\\u0c0d\\u0c11\\u0c29\\u0c3a-\\u0c3c\\u0c45\\u0c49\\u0c4e-\\u0c54\\u0c57\\u0c5b-\\u0c5f\\u0c64-\\u0c65\\u0c70-\\u0c77\\u0c8d\\u0c91\\u0ca9\\u0cb4\\u0cba-\\u0cbb\\u0cc5\\u0cc9\\u0cce-\\u0cd4\\u0cd7-\\u0cdd\\u0cdf\\u0ce4-\\u0ce5\\u0cf0\\u0cf3-\\u0cff\\u0d04\\u0d0d\\u0d11\\u0d45\\u0d49\\u0d50-\\u0d53\\u0d64-\\u0d65\\u0d80-\\u0d81\\u0d84\\u0d97-\\u0d99\\u0db2\\u0dbc\\u0dbe-\\u0dbf\\u0dc7-\\u0dc9\\u0dcb-\\u0dce\\u0dd5\\u0dd7\\u0de0-\\u0de5\\u0df0-\\u0df1\\u0df5-\\u0e00\\u0e3b-\\u0e3e\\u0e5c-\\u0e80\\u0e83\\u0e85-\\u0e86\\u0e89\\u0e8b-\\u0e8c\\u0e8e-\\u0e93\\u0e98\\u0ea0\\u0ea4\\u0ea6\\u0ea8-\\u0ea9\\u0eac\\u0eba\\u0ebe-\\u0ebf\\u0ec5\\u0ec7\\u0ece-\\u0ecf\\u0eda-\\u0edb\\u0ee0-\\u0eff\\u0f48\\u0f6d-\\u0f70\\u0f98\\u0fbd\\u0fcd\\u0fdb-\\u0fff\\u10c6\\u10c8-\\u10cc\\u10ce-\\u10cf\\u1249\\u124e-\\u124f\\u1257\\u1259\\u125e-\\u125f\\u1289\\u128e-\\u128f\\u12b1\\u12b6-\\u12b7\\u12bf\\u12c1\\u12c6-\\u12c7\\u12d7\\u1311\\u1316-\\u1317\\u135b-\\u135c\\u137d-\\u137f\\u139a-\\u139f\\u13f6-\\u13f7\\u13fe-\\u13ff\\u169d-\\u169f\\u16f9-\\u16ff\\u170d\\u1715-\\u171f\\u1737-\\u173f\\u1754-\\u175f\\u176d\\u1771\\u1774-\\u177f\\u17de-\\u17df\\u17ea-\\u17ef\\u17fa-\\u17ff\\u180f\\u181a-\\u181f\\u1879-\\u187f\\u18ab-\\u18af\\u18f6-\\u18ff\\u191f\\u192c-\\u192f\\u193c-\\u193f\\u1941-\\u1943\\u196e-\\u196f\\u1975-\\u197f\\u19ac-\\u19af\\u19ca-\\u19cf\\u19db-\\u19dd\\u1a1c-\\u1a1d\\u1a5f\\u1a7d-\\u1a7e\\u1a8a-\\u1a8f\\u1a9a-\\u1a9f\\u1aae-\\u1aaf\\u1abf-\\u1aff\\u1b4c-\\u1b4f\\u1b7d-\\u1b7f\\u1bf4-\\u1bfb\\u1c38-\\u1c3a\\u1c4a-\\u1c4c\\u1c89-\\u1c8f\\u1cbb-\\u1cbc\\u1cc8-\\u1ccf\\u1cfa-\\u1cff\\u1dfa\\u1f16-\\u1f17\\u1f1e-\\u1f1f\\u1f46-\\u1f47\\u1f4e-\\u1f4f\\u1f58\\u1f5a\\u1f5c\\u1f5e\\u1f7e-\\u1f7f\\u1fb5\\u1fc5\\u1fd4-\\u1fd5\\u1fdc\\u1ff0-\\u1ff1\\u1ff5\\u1fff\\u2065\\u2072-\\u2073\\u208f\\u209d-\\u209f\\u20c0-\\u20cf\\u20f1-\\u20ff\\u218c-\\u218f\\u2427-\\u243f\\u244b-\\u245f\\u2b74-\\u2b75\\u2b96-\\u2b97\\u2bc9\\u2bff\\u2c2f\\u2c5f\\u2cf4-\\u2cf8\\u2d26\\u2d28-\\u2d2c\\u2d2e-\\u2d2f\\u2d68-\\u2d6e\\u2d71-\\u2d7e\\u2d97-\\u2d9f\\u2da7\\u2daf\\u2db7\\u2dbf\\u2dc7\\u2dcf\\u2dd7\\u2ddf\\u2e4f-\\u2e7f\\u2e9a\\u2ef4-\\u2eff\\u2fd6-\\u2fef\\u2ffc-\\u2fff\\u3040\\u3097-\\u3098\\u3100-\\u3104\\u3130\\u318f\\u31bb-\\u31bf\\u31e4-\\u31ef\\u321f\\u32ff\\u4db6-\\u4dbf\\u9ff0-\\u9fff\\ua48d-\\ua48f\\ua4c7-\\ua4cf\\ua62c-\\ua63f\\ua6f8-\\ua6ff\\ua7ba-\\ua7f6\\ua82c-\\ua82f\\ua83a-\\ua83f\\ua878-\\ua87f\\ua8c6-\\ua8cd\\ua8da-\\ua8df\\ua954-\\ua95e\\ua97d-\\ua97f\\ua9ce\\ua9da-\\ua9dd\\ua9ff\\uaa37-\\uaa3f\\uaa4e-\\uaa4f\\uaa5a-\\uaa5b\\uaac3-\\uaada\\uaaf7-\\uab00\\uab07-\\uab08\\uab0f-\\uab10\\uab17-\\uab1f\\uab27\\uab2f\\uab66-\\uab6f\\uabee-\\uabef\\uabfa-\\uabff\\ud7a4-\\ud7af\\ud7c7-\\ud7ca\\ud7fc-\\ud7ff\\ufa6e-\\ufa6f\\ufada-\\ufaff\\ufb07-\\ufb12\\ufb18-\\ufb1c\\ufb37\\ufb3d\\ufb3f\\ufb42\\ufb45\\ufbc2-\\ufbd2\\ufd40-\\ufd4f\\ufd90-\\ufd91\\ufdc8-\\ufdef\\ufdfe-\\ufdff\\ufe1a-\\ufe1f\\ufe53\\ufe67\\ufe6c-\\ufe6f\\ufe75\\ufefd-\\ufefe\\uff00\\uffbf-\\uffc1\\uffc8-\\uffc9\\uffd0-\\uffd1\\uffd8-\\uffd9\\uffdd-\\uffdf\\uffe7\\uffef-\\ufff8\\ufffe-\\uffff\\U0001000c\\U00010027\\U0001003b\\U0001003e\\U0001004e-\\U0001004f\\U0001005e-\\U0001007f\\U000100fb-\\U000100ff\\U00010103-\\U00010106\\U00010134-\\U00010136\\U0001018f\\U0001019c-\\U0001019f\\U000101a1-\\U000101cf\\U000101fe-\\U0001027f\\U0001029d-\\U0001029f\\U000102d1-\\U000102df\\U000102fc-\\U000102ff\\U00010324-\\U0001032c\\U0001034b-\\U0001034f\\U0001037b-\\U0001037f\\U0001039e\\U000103c4-\\U000103c7\\U000103d6-\\U000103ff\\U0001049e-\\U0001049f\\U000104aa-\\U000104af\\U000104d4-\\U000104d7\\U000104fc-\\U000104ff\\U00010528-\\U0001052f\\U00010564-\\U0001056e\\U00010570-\\U000105ff\\U00010737-\\U0001073f\\U00010756-\\U0001075f\\U00010768-\\U000107ff\\U00010806-\\U00010807\\U00010809\\U00010836\\U00010839-\\U0001083b\\U0001083d-\\U0001083e\\U00010856\\U0001089f-\\U000108a6\\U000108b0-\\U000108df\\U000108f3\\U000108f6-\\U000108fa\\U0001091c-\\U0001091e\\U0001093a-\\U0001093e\\U00010940-\\U0001097f\\U000109b8-\\U000109bb\\U000109d0-\\U000109d1\\U00010a04\\U00010a07-\\U00010a0b\\U00010a14\\U00010a18\\U00010a36-\\U00010a37\\U00010a3b-\\U00010a3e\\U00010a49-\\U00010a4f\\U00010a59-\\U00010a5f\\U00010aa0-\\U00010abf\\U00010ae7-\\U00010aea\\U00010af7-\\U00010aff\\U00010b36-\\U00010b38\\U00010b56-\\U00010b57\\U00010b73-\\U00010b77\\U00010b92-\\U00010b98\\U00010b9d-\\U00010ba8\\U00010bb0-\\U00010bff\\U00010c49-\\U00010c7f\\U00010cb3-\\U00010cbf\\U00010cf3-\\U00010cf9\\U00010d28-\\U00010d2f\\U00010d3a-\\U00010e5f\\U00010e7f-\\U00010eff\\U00010f28-\\U00010f2f\\U00010f5a-\\U00010fff\\U0001104e-\\U00011051\\U00011070-\\U0001107e\\U000110c2-\\U000110cc\\U000110ce-\\U000110cf\\U000110e9-\\U000110ef\\U000110fa-\\U000110ff\\U00011135\\U00011147-\\U0001114f\\U00011177-\\U0001117f\\U000111ce-\\U000111cf\\U000111e0\\U000111f5-\\U000111ff\\U00011212\\U0001123f-\\U0001127f\\U00011287\\U00011289\\U0001128e\\U0001129e\\U000112aa-\\U000112af\\U000112eb-\\U000112ef\\U000112fa-\\U000112ff\\U00011304\\U0001130d-\\U0001130e\\U00011311-\\U00011312\\U00011329\\U00011331\\U00011334\\U0001133a\\U00011345-\\U00011346\\U00011349-\\U0001134a\\U0001134e-\\U0001134f\\U00011351-\\U00011356\\U00011358-\\U0001135c\\U00011364-\\U00011365\\U0001136d-\\U0001136f\\U00011375-\\U000113ff\\U0001145a\\U0001145c\\U0001145f-\\U0001147f\\U000114c8-\\U000114cf\\U000114da-\\U0001157f\\U000115b6-\\U000115b7\\U000115de-\\U000115ff\\U00011645-\\U0001164f\\U0001165a-\\U0001165f\\U0001166d-\\U0001167f\\U000116b8-\\U000116bf\\U000116ca-\\U000116ff\\U0001171b-\\U0001171c\\U0001172c-\\U0001172f\\U00011740-\\U000117ff\\U0001183c-\\U0001189f\\U000118f3-\\U000118fe\\U00011900-\\U000119ff\\U00011a48-\\U00011a4f\\U00011a84-\\U00011a85\\U00011aa3-\\U00011abf\\U00011af9-\\U00011bff\\U00011c09\\U00011c37\\U00011c46-\\U00011c4f\\U00011c6d-\\U00011c6f\\U00011c90-\\U00011c91\\U00011ca8\\U00011cb7-\\U00011cff\\U00011d07\\U00011d0a\\U00011d37-\\U00011d39\\U00011d3b\\U00011d3e\\U00011d48-\\U00011d4f\\U00011d5a-\\U00011d5f\\U00011d66\\U00011d69\\U00011d8f\\U00011d92\\U00011d99-\\U00011d9f\\U00011daa-\\U00011edf\\U00011ef9-\\U00011fff\\U0001239a-\\U000123ff\\U0001246f\\U00012475-\\U0001247f\\U00012544-\\U00012fff\\U0001342f-\\U000143ff\\U00014647-\\U000167ff\\U00016a39-\\U00016a3f\\U00016a5f\\U00016a6a-\\U00016a6d\\U00016a70-\\U00016acf\\U00016aee-\\U00016aef\\U00016af6-\\U00016aff\\U00016b46-\\U00016b4f\\U00016b5a\\U00016b62\\U00016b78-\\U00016b7c\\U00016b90-\\U00016e3f\\U00016e9b-\\U00016eff\\U00016f45-\\U00016f4f\\U00016f7f-\\U00016f8e\\U00016fa0-\\U00016fdf\\U00016fe2-\\U00016fff\\U000187f2-\\U000187ff\\U00018af3-\\U0001afff\\U0001b11f-\\U0001b16f\\U0001b2fc-\\U0001bbff\\U0001bc6b-\\U0001bc6f\\U0001bc7d-\\U0001bc7f\\U0001bc89-\\U0001bc8f\\U0001bc9a-\\U0001bc9b\\U0001bca4-\\U0001cfff\\U0001d0f6-\\U0001d0ff\\U0001d127-\\U0001d128\\U0001d1e9-\\U0001d1ff\\U0001d246-\\U0001d2df\\U0001d2f4-\\U0001d2ff\\U0001d357-\\U0001d35f\\U0001d379-\\U0001d3ff\\U0001d455\\U0001d49d\\U0001d4a0-\\U0001d4a1\\U0001d4a3-\\U0001d4a4\\U0001d4a7-\\U0001d4a8\\U0001d4ad\\U0001d4ba\\U0001d4bc\\U0001d4c4\\U0001d506\\U0001d50b-\\U0001d50c\\U0001d515\\U0001d51d\\U0001d53a\\U0001d53f\\U0001d545\\U0001d547-\\U0001d549\\U0001d551\\U0001d6a6-\\U0001d6a7\\U0001d7cc-\\U0001d7cd\\U0001da8c-\\U0001da9a\\U0001daa0\\U0001dab0-\\U0001dfff\\U0001e007\\U0001e019-\\U0001e01a\\U0001e022\\U0001e025\\U0001e02b-\\U0001e7ff\\U0001e8c5-\\U0001e8c6\\U0001e8d7-\\U0001e8ff\\U0001e94b-\\U0001e94f\\U0001e95a-\\U0001e95d\\U0001e960-\\U0001ec70\\U0001ecb5-\\U0001edff\\U0001ee04\\U0001ee20\\U0001ee23\\U0001ee25-\\U0001ee26\\U0001ee28\\U0001ee33\\U0001ee38\\U0001ee3a\\U0001ee3c-\\U0001ee41\\U0001ee43-\\U0001ee46\\U0001ee48\\U0001ee4a\\U0001ee4c\\U0001ee50\\U0001ee53\\U0001ee55-\\U0001ee56\\U0001ee58\\U0001ee5a\\U0001ee5c\\U0001ee5e\\U0001ee60\\U0001ee63\\U0001ee65-\\U0001ee66\\U0001ee6b\\U0001ee73\\U0001ee78\\U0001ee7d\\U0001ee7f\\U0001ee8a\\U0001ee9c-\\U0001eea0\\U0001eea4\\U0001eeaa\\U0001eebc-\\U0001eeef\\U0001eef2-\\U0001efff\\U0001f02c-\\U0001f02f\\U0001f094-\\U0001f09f\\U0001f0af-\\U0001f0b0\\U0001f0c0\\U0001f0d0\\U0001f0f6-\\U0001f0ff\\U0001f10d-\\U0001f10f\\U0001f16c-\\U0001f16f\\U0001f1ad-\\U0001f1e5\\U0001f203-\\U0001f20f\\U0001f23c-\\U0001f23f\\U0001f249-\\U0001f24f\\U0001f252-\\U0001f25f\\U0001f266-\\U0001f2ff\\U0001f6d5-\\U0001f6df\\U0001f6ed-\\U0001f6ef\\U0001f6fa-\\U0001f6ff\\U0001f774-\\U0001f77f\\U0001f7d9-\\U0001f7ff\\U0001f80c-\\U0001f80f\\U0001f848-\\U0001f84f\\U0001f85a-\\U0001f85f\\U0001f888-\\U0001f88f\\U0001f8ae-\\U0001f8ff\\U0001f90c-\\U0001f90f\\U0001f93f\\U0001f971-\\U0001f972\\U0001f977-\\U0001f979\\U0001f97b\\U0001f9a3-\\U0001f9af\\U0001f9ba-\\U0001f9bf\\U0001f9c3-\\U0001f9cf\\U0001fa00-\\U0001fa5f\\U0001fa6e-\\U0001ffff\\U0002a6d7-\\U0002a6ff\\U0002b735-\\U0002b73f\\U0002b81e-\\U0002b81f\\U0002cea2-\\U0002ceaf\\U0002ebe1-\\U0002f7ff\\U0002fa1e-\\U000e0000\\U000e0002-\\U000e001f\\U000e0080-\\U000e00ff\\U000e01f0-\\U000effff\\U000ffffe-\\U000fffff\\U0010fffe-\\U0010ffff'\n\nCo = '\\ue000-\\uf8ff\\U000f0000-\\U000ffffd\\U00100000-\\U0010fffd'\n\nCs = '\\ud800-\\udbff\\\\\\udc00\\udc01-\\udfff'\n\nLl = 'a-z\\xb5\\xdf-\\xf6\\xf8-\\xff\\u0101\\u0103\\u0105\\u0107\\u0109\\u010b\\u010d\\u010f\\u0111\\u0113\\u0115\\u0117\\u0119\\u011b\\u011d\\u011f\\u0121\\u0123\\u0125\\u0127\\u0129\\u012b\\u012d\\u012f\\u0131\\u0133\\u0135\\u0137-\\u0138\\u013a\\u013c\\u013e\\u0140\\u0142\\u0144\\u0146\\u0148-\\u0149\\u014b\\u014d\\u014f\\u0151\\u0153\\u0155\\u0157\\u0159\\u015b\\u015d\\u015f\\u0161\\u0163\\u0165\\u0167\\u0169\\u016b\\u016d\\u016f\\u0171\\u0173\\u0175\\u0177\\u017a\\u017c\\u017e-\\u0180\\u0183\\u0185\\u0188\\u018c-\\u018d\\u0192\\u0195\\u0199-\\u019b\\u019e\\u01a1\\u01a3\\u01a5\\u01a8\\u01aa-\\u01ab\\u01ad\\u01b0\\u01b4\\u01b6\\u01b9-\\u01ba\\u01bd-\\u01bf\\u01c6\\u01c9\\u01cc\\u01ce\\u01d0\\u01d2\\u01d4\\u01d6\\u01d8\\u01da\\u01dc-\\u01dd\\u01df\\u01e1\\u01e3\\u01e5\\u01e7\\u01e9\\u01eb\\u01ed\\u01ef-\\u01f0\\u01f3\\u01f5\\u01f9\\u01fb\\u01fd\\u01ff\\u0201\\u0203\\u0205\\u0207\\u0209\\u020b\\u020d\\u020f\\u0211\\u0213\\u0215\\u0217\\u0219\\u021b\\u021d\\u021f\\u0221\\u0223\\u0225\\u0227\\u0229\\u022b\\u022d\\u022f\\u0231\\u0233-\\u0239\\u023c\\u023f-\\u0240\\u0242\\u0247\\u0249\\u024b\\u024d\\u024f-\\u0293\\u0295-\\u02af\\u0371\\u0373\\u0377\\u037b-\\u037d\\u0390\\u03ac-\\u03ce\\u03d0-\\u03d1\\u03d5-\\u03d7\\u03d9\\u03db\\u03dd\\u03df\\u03e1\\u03e3\\u03e5\\u03e7\\u03e9\\u03eb\\u03ed\\u03ef-\\u03f3\\u03f5\\u03f8\\u03fb-\\u03fc\\u0430-\\u045f\\u0461\\u0463\\u0465\\u0467\\u0469\\u046b\\u046d\\u046f\\u0471\\u0473\\u0475\\u0477\\u0479\\u047b\\u047d\\u047f\\u0481\\u048b\\u048d\\u048f\\u0491\\u0493\\u0495\\u0497\\u0499\\u049b\\u049d\\u049f\\u04a1\\u04a3\\u04a5\\u04a7\\u04a9\\u04ab\\u04ad\\u04af\\u04b1\\u04b3\\u04b5\\u04b7\\u04b9\\u04bb\\u04bd\\u04bf\\u04c2\\u04c4\\u04c6\\u04c8\\u04ca\\u04cc\\u04ce-\\u04cf\\u04d1\\u04d3\\u04d5\\u04d7\\u04d9\\u04db\\u04dd\\u04df\\u04e1\\u04e3\\u04e5\\u04e7\\u04e9\\u04eb\\u04ed\\u04ef\\u04f1\\u04f3\\u04f5\\u04f7\\u04f9\\u04fb\\u04fd\\u04ff\\u0501\\u0503\\u0505\\u0507\\u0509\\u050b\\u050d\\u050f\\u0511\\u0513\\u0515\\u0517\\u0519\\u051b\\u051d\\u051f\\u0521\\u0523\\u0525\\u0527\\u0529\\u052b\\u052d\\u052f\\u0560-\\u0588\\u10d0-\\u10fa\\u10fd-\\u10ff\\u13f8-\\u13fd\\u1c80-\\u1c88\\u1d00-\\u1d2b\\u1d6b-\\u1d77\\u1d79-\\u1d9a\\u1e01\\u1e03\\u1e05\\u1e07\\u1e09\\u1e0b\\u1e0d\\u1e0f\\u1e11\\u1e13\\u1e15\\u1e17\\u1e19\\u1e1b\\u1e1d\\u1e1f\\u1e21\\u1e23\\u1e25\\u1e27\\u1e29\\u1e2b\\u1e2d\\u1e2f\\u1e31\\u1e33\\u1e35\\u1e37\\u1e39\\u1e3b\\u1e3d\\u1e3f\\u1e41\\u1e43\\u1e45\\u1e47\\u1e49\\u1e4b\\u1e4d\\u1e4f\\u1e51\\u1e53\\u1e55\\u1e57\\u1e59\\u1e5b\\u1e5d\\u1e5f\\u1e61\\u1e63\\u1e65\\u1e67\\u1e69\\u1e6b\\u1e6d\\u1e6f\\u1e71\\u1e73\\u1e75\\u1e77\\u1e79\\u1e7b\\u1e7d\\u1e7f\\u1e81\\u1e83\\u1e85\\u1e87\\u1e89\\u1e8b\\u1e8d\\u1e8f\\u1e91\\u1e93\\u1e95-\\u1e9d\\u1e9f\\u1ea1\\u1ea3\\u1ea5\\u1ea7\\u1ea9\\u1eab\\u1ead\\u1eaf\\u1eb1\\u1eb3\\u1eb5\\u1eb7\\u1eb9\\u1ebb\\u1ebd\\u1ebf\\u1ec1\\u1ec3\\u1ec5\\u1ec7\\u1ec9\\u1ecb\\u1ecd\\u1ecf\\u1ed1\\u1ed3\\u1ed5\\u1ed7\\u1ed9\\u1edb\\u1edd\\u1edf\\u1ee1\\u1ee3\\u1ee5\\u1ee7\\u1ee9\\u1eeb\\u1eed\\u1eef\\u1ef1\\u1ef3\\u1ef5\\u1ef7\\u1ef9\\u1efb\\u1efd\\u1eff-\\u1f07\\u1f10-\\u1f15\\u1f20-\\u1f27\\u1f30-\\u1f37\\u1f40-\\u1f45\\u1f50-\\u1f57\\u1f60-\\u1f67\\u1f70-\\u1f7d\\u1f80-\\u1f87\\u1f90-\\u1f97\\u1fa0-\\u1fa7\\u1fb0-\\u1fb4\\u1fb6-\\u1fb7\\u1fbe\\u1fc2-\\u1fc4\\u1fc6-\\u1fc7\\u1fd0-\\u1fd3\\u1fd6-\\u1fd7\\u1fe0-\\u1fe7\\u1ff2-\\u1ff4\\u1ff6-\\u1ff7\\u210a\\u210e-\\u210f\\u2113\\u212f\\u2134\\u2139\\u213c-\\u213d\\u2146-\\u2149\\u214e\\u2184\\u2c30-\\u2c5e\\u2c61\\u2c65-\\u2c66\\u2c68\\u2c6a\\u2c6c\\u2c71\\u2c73-\\u2c74\\u2c76-\\u2c7b\\u2c81\\u2c83\\u2c85\\u2c87\\u2c89\\u2c8b\\u2c8d\\u2c8f\\u2c91\\u2c93\\u2c95\\u2c97\\u2c99\\u2c9b\\u2c9d\\u2c9f\\u2ca1\\u2ca3\\u2ca5\\u2ca7\\u2ca9\\u2cab\\u2cad\\u2caf\\u2cb1\\u2cb3\\u2cb5\\u2cb7\\u2cb9\\u2cbb\\u2cbd\\u2cbf\\u2cc1\\u2cc3\\u2cc5\\u2cc7\\u2cc9\\u2ccb\\u2ccd\\u2ccf\\u2cd1\\u2cd3\\u2cd5\\u2cd7\\u2cd9\\u2cdb\\u2cdd\\u2cdf\\u2ce1\\u2ce3-\\u2ce4\\u2cec\\u2cee\\u2cf3\\u2d00-\\u2d25\\u2d27\\u2d2d\\ua641\\ua643\\ua645\\ua647\\ua649\\ua64b\\ua64d\\ua64f\\ua651\\ua653\\ua655\\ua657\\ua659\\ua65b\\ua65d\\ua65f\\ua661\\ua663\\ua665\\ua667\\ua669\\ua66b\\ua66d\\ua681\\ua683\\ua685\\ua687\\ua689\\ua68b\\ua68d\\ua68f\\ua691\\ua693\\ua695\\ua697\\ua699\\ua69b\\ua723\\ua725\\ua727\\ua729\\ua72b\\ua72d\\ua72f-\\ua731\\ua733\\ua735\\ua737\\ua739\\ua73b\\ua73d\\ua73f\\ua741\\ua743\\ua745\\ua747\\ua749\\ua74b\\ua74d\\ua74f\\ua751\\ua753\\ua755\\ua757\\ua759\\ua75b\\ua75d\\ua75f\\ua761\\ua763\\ua765\\ua767\\ua769\\ua76b\\ua76d\\ua76f\\ua771-\\ua778\\ua77a\\ua77c\\ua77f\\ua781\\ua783\\ua785\\ua787\\ua78c\\ua78e\\ua791\\ua793-\\ua795\\ua797\\ua799\\ua79b\\ua79d\\ua79f\\ua7a1\\ua7a3\\ua7a5\\ua7a7\\ua7a9\\ua7af\\ua7b5\\ua7b7\\ua7b9\\ua7fa\\uab30-\\uab5a\\uab60-\\uab65\\uab70-\\uabbf\\ufb00-\\ufb06\\ufb13-\\ufb17\\uff41-\\uff5a\\U00010428-\\U0001044f\\U000104d8-\\U000104fb\\U00010cc0-\\U00010cf2\\U000118c0-\\U000118df\\U00016e60-\\U00016e7f\\U0001d41a-\\U0001d433\\U0001d44e-\\U0001d454\\U0001d456-\\U0001d467\\U0001d482-\\U0001d49b\\U0001d4b6-\\U0001d4b9\\U0001d4bb\\U0001d4bd-\\U0001d4c3\\U0001d4c5-\\U0001d4cf\\U0001d4ea-\\U0001d503\\U0001d51e-\\U0001d537\\U0001d552-\\U0001d56b\\U0001d586-\\U0001d59f\\U0001d5ba-\\U0001d5d3\\U0001d5ee-\\U0001d607\\U0001d622-\\U0001d63b\\U0001d656-\\U0001d66f\\U0001d68a-\\U0001d6a5\\U0001d6c2-\\U0001d6da\\U0001d6dc-\\U0001d6e1\\U0001d6fc-\\U0001d714\\U0001d716-\\U0001d71b\\U0001d736-\\U0001d74e\\U0001d750-\\U0001d755\\U0001d770-\\U0001d788\\U0001d78a-\\U0001d78f\\U0001d7aa-\\U0001d7c2\\U0001d7c4-\\U0001d7c9\\U0001d7cb\\U0001e922-\\U0001e943'\n\nLm = '\\u02b0-\\u02c1\\u02c6-\\u02d1\\u02e0-\\u02e4\\u02ec\\u02ee\\u0374\\u037a\\u0559\\u0640\\u06e5-\\u06e6\\u07f4-\\u07f5\\u07fa\\u081a\\u0824\\u0828\\u0971\\u0e46\\u0ec6\\u10fc\\u17d7\\u1843\\u1aa7\\u1c78-\\u1c7d\\u1d2c-\\u1d6a\\u1d78\\u1d9b-\\u1dbf\\u2071\\u207f\\u2090-\\u209c\\u2c7c-\\u2c7d\\u2d6f\\u2e2f\\u3005\\u3031-\\u3035\\u303b\\u309d-\\u309e\\u30fc-\\u30fe\\ua015\\ua4f8-\\ua4fd\\ua60c\\ua67f\\ua69c-\\ua69d\\ua717-\\ua71f\\ua770\\ua788\\ua7f8-\\ua7f9\\ua9cf\\ua9e6\\uaa70\\uaadd\\uaaf3-\\uaaf4\\uab5c-\\uab5f\\uff70\\uff9e-\\uff9f\\U00016b40-\\U00016b43\\U00016f93-\\U00016f9f\\U00016fe0-\\U00016fe1'\n\nLo = '\\xaa\\xba\\u01bb\\u01c0-\\u01c3\\u0294\\u05d0-\\u05ea\\u05ef-\\u05f2\\u0620-\\u063f\\u0641-\\u064a\\u066e-\\u066f\\u0671-\\u06d3\\u06d5\\u06ee-\\u06ef\\u06fa-\\u06fc\\u06ff\\u0710\\u0712-\\u072f\\u074d-\\u07a5\\u07b1\\u07ca-\\u07ea\\u0800-\\u0815\\u0840-\\u0858\\u0860-\\u086a\\u08a0-\\u08b4\\u08b6-\\u08bd\\u0904-\\u0939\\u093d\\u0950\\u0958-\\u0961\\u0972-\\u0980\\u0985-\\u098c\\u098f-\\u0990\\u0993-\\u09a8\\u09aa-\\u09b0\\u09b2\\u09b6-\\u09b9\\u09bd\\u09ce\\u09dc-\\u09dd\\u09df-\\u09e1\\u09f0-\\u09f1\\u09fc\\u0a05-\\u0a0a\\u0a0f-\\u0a10\\u0a13-\\u0a28\\u0a2a-\\u0a30\\u0a32-\\u0a33\\u0a35-\\u0a36\\u0a38-\\u0a39\\u0a59-\\u0a5c\\u0a5e\\u0a72-\\u0a74\\u0a85-\\u0a8d\\u0a8f-\\u0a91\\u0a93-\\u0aa8\\u0aaa-\\u0ab0\\u0ab2-\\u0ab3\\u0ab5-\\u0ab9\\u0abd\\u0ad0\\u0ae0-\\u0ae1\\u0af9\\u0b05-\\u0b0c\\u0b0f-\\u0b10\\u0b13-\\u0b28\\u0b2a-\\u0b30\\u0b32-\\u0b33\\u0b35-\\u0b39\\u0b3d\\u0b5c-\\u0b5d\\u0b5f-\\u0b61\\u0b71\\u0b83\\u0b85-\\u0b8a\\u0b8e-\\u0b90\\u0b92-\\u0b95\\u0b99-\\u0b9a\\u0b9c\\u0b9e-\\u0b9f\\u0ba3-\\u0ba4\\u0ba8-\\u0baa\\u0bae-\\u0bb9\\u0bd0\\u0c05-\\u0c0c\\u0c0e-\\u0c10\\u0c12-\\u0c28\\u0c2a-\\u0c39\\u0c3d\\u0c58-\\u0c5a\\u0c60-\\u0c61\\u0c80\\u0c85-\\u0c8c\\u0c8e-\\u0c90\\u0c92-\\u0ca8\\u0caa-\\u0cb3\\u0cb5-\\u0cb9\\u0cbd\\u0cde\\u0ce0-\\u0ce1\\u0cf1-\\u0cf2\\u0d05-\\u0d0c\\u0d0e-\\u0d10\\u0d12-\\u0d3a\\u0d3d\\u0d4e\\u0d54-\\u0d56\\u0d5f-\\u0d61\\u0d7a-\\u0d7f\\u0d85-\\u0d96\\u0d9a-\\u0db1\\u0db3-\\u0dbb\\u0dbd\\u0dc0-\\u0dc6\\u0e01-\\u0e30\\u0e32-\\u0e33\\u0e40-\\u0e45\\u0e81-\\u0e82\\u0e84\\u0e87-\\u0e88\\u0e8a\\u0e8d\\u0e94-\\u0e97\\u0e99-\\u0e9f\\u0ea1-\\u0ea3\\u0ea5\\u0ea7\\u0eaa-\\u0eab\\u0ead-\\u0eb0\\u0eb2-\\u0eb3\\u0ebd\\u0ec0-\\u0ec4\\u0edc-\\u0edf\\u0f00\\u0f40-\\u0f47\\u0f49-\\u0f6c\\u0f88-\\u0f8c\\u1000-\\u102a\\u103f\\u1050-\\u1055\\u105a-\\u105d\\u1061\\u1065-\\u1066\\u106e-\\u1070\\u1075-\\u1081\\u108e\\u1100-\\u1248\\u124a-\\u124d\\u1250-\\u1256\\u1258\\u125a-\\u125d\\u1260-\\u1288\\u128a-\\u128d\\u1290-\\u12b0\\u12b2-\\u12b5\\u12b8-\\u12be\\u12c0\\u12c2-\\u12c5\\u12c8-\\u12d6\\u12d8-\\u1310\\u1312-\\u1315\\u1318-\\u135a\\u1380-\\u138f\\u1401-\\u166c\\u166f-\\u167f\\u1681-\\u169a\\u16a0-\\u16ea\\u16f1-\\u16f8\\u1700-\\u170c\\u170e-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176c\\u176e-\\u1770\\u1780-\\u17b3\\u17dc\\u1820-\\u1842\\u1844-\\u1878\\u1880-\\u1884\\u1887-\\u18a8\\u18aa\\u18b0-\\u18f5\\u1900-\\u191e\\u1950-\\u196d\\u1970-\\u1974\\u1980-\\u19ab\\u19b0-\\u19c9\\u1a00-\\u1a16\\u1a20-\\u1a54\\u1b05-\\u1b33\\u1b45-\\u1b4b\\u1b83-\\u1ba0\\u1bae-\\u1baf\\u1bba-\\u1be5\\u1c00-\\u1c23\\u1c4d-\\u1c4f\\u1c5a-\\u1c77\\u1ce9-\\u1cec\\u1cee-\\u1cf1\\u1cf5-\\u1cf6\\u2135-\\u2138\\u2d30-\\u2d67\\u2d80-\\u2d96\\u2da0-\\u2da6\\u2da8-\\u2dae\\u2db0-\\u2db6\\u2db8-\\u2dbe\\u2dc0-\\u2dc6\\u2dc8-\\u2dce\\u2dd0-\\u2dd6\\u2dd8-\\u2dde\\u3006\\u303c\\u3041-\\u3096\\u309f\\u30a1-\\u30fa\\u30ff\\u3105-\\u312f\\u3131-\\u318e\\u31a0-\\u31ba\\u31f0-\\u31ff\\u3400-\\u4db5\\u4e00-\\u9fef\\ua000-\\ua014\\ua016-\\ua48c\\ua4d0-\\ua4f7\\ua500-\\ua60b\\ua610-\\ua61f\\ua62a-\\ua62b\\ua66e\\ua6a0-\\ua6e5\\ua78f\\ua7f7\\ua7fb-\\ua801\\ua803-\\ua805\\ua807-\\ua80a\\ua80c-\\ua822\\ua840-\\ua873\\ua882-\\ua8b3\\ua8f2-\\ua8f7\\ua8fb\\ua8fd-\\ua8fe\\ua90a-\\ua925\\ua930-\\ua946\\ua960-\\ua97c\\ua984-\\ua9b2\\ua9e0-\\ua9e4\\ua9e7-\\ua9ef\\ua9fa-\\ua9fe\\uaa00-\\uaa28\\uaa40-\\uaa42\\uaa44-\\uaa4b\\uaa60-\\uaa6f\\uaa71-\\uaa76\\uaa7a\\uaa7e-\\uaaaf\\uaab1\\uaab5-\\uaab6\\uaab9-\\uaabd\\uaac0\\uaac2\\uaadb-\\uaadc\\uaae0-\\uaaea\\uaaf2\\uab01-\\uab06\\uab09-\\uab0e\\uab11-\\uab16\\uab20-\\uab26\\uab28-\\uab2e\\uabc0-\\uabe2\\uac00-\\ud7a3\\ud7b0-\\ud7c6\\ud7cb-\\ud7fb\\uf900-\\ufa6d\\ufa70-\\ufad9\\ufb1d\\ufb1f-\\ufb28\\ufb2a-\\ufb36\\ufb38-\\ufb3c\\ufb3e\\ufb40-\\ufb41\\ufb43-\\ufb44\\ufb46-\\ufbb1\\ufbd3-\\ufd3d\\ufd50-\\ufd8f\\ufd92-\\ufdc7\\ufdf0-\\ufdfb\\ufe70-\\ufe74\\ufe76-\\ufefc\\uff66-\\uff6f\\uff71-\\uff9d\\uffa0-\\uffbe\\uffc2-\\uffc7\\uffca-\\uffcf\\uffd2-\\uffd7\\uffda-\\uffdc\\U00010000-\\U0001000b\\U0001000d-\\U00010026\\U00010028-\\U0001003a\\U0001003c-\\U0001003d\\U0001003f-\\U0001004d\\U00010050-\\U0001005d\\U00010080-\\U000100fa\\U00010280-\\U0001029c\\U000102a0-\\U000102d0\\U00010300-\\U0001031f\\U0001032d-\\U00010340\\U00010342-\\U00010349\\U00010350-\\U00010375\\U00010380-\\U0001039d\\U000103a0-\\U000103c3\\U000103c8-\\U000103cf\\U00010450-\\U0001049d\\U00010500-\\U00010527\\U00010530-\\U00010563\\U00010600-\\U00010736\\U00010740-\\U00010755\\U00010760-\\U00010767\\U00010800-\\U00010805\\U00010808\\U0001080a-\\U00010835\\U00010837-\\U00010838\\U0001083c\\U0001083f-\\U00010855\\U00010860-\\U00010876\\U00010880-\\U0001089e\\U000108e0-\\U000108f2\\U000108f4-\\U000108f5\\U00010900-\\U00010915\\U00010920-\\U00010939\\U00010980-\\U000109b7\\U000109be-\\U000109bf\\U00010a00\\U00010a10-\\U00010a13\\U00010a15-\\U00010a17\\U00010a19-\\U00010a35\\U00010a60-\\U00010a7c\\U00010a80-\\U00010a9c\\U00010ac0-\\U00010ac7\\U00010ac9-\\U00010ae4\\U00010b00-\\U00010b35\\U00010b40-\\U00010b55\\U00010b60-\\U00010b72\\U00010b80-\\U00010b91\\U00010c00-\\U00010c48\\U00010d00-\\U00010d23\\U00010f00-\\U00010f1c\\U00010f27\\U00010f30-\\U00010f45\\U00011003-\\U00011037\\U00011083-\\U000110af\\U000110d0-\\U000110e8\\U00011103-\\U00011126\\U00011144\\U00011150-\\U00011172\\U00011176\\U00011183-\\U000111b2\\U000111c1-\\U000111c4\\U000111da\\U000111dc\\U00011200-\\U00011211\\U00011213-\\U0001122b\\U00011280-\\U00011286\\U00011288\\U0001128a-\\U0001128d\\U0001128f-\\U0001129d\\U0001129f-\\U000112a8\\U000112b0-\\U000112de\\U00011305-\\U0001130c\\U0001130f-\\U00011310\\U00011313-\\U00011328\\U0001132a-\\U00011330\\U00011332-\\U00011333\\U00011335-\\U00011339\\U0001133d\\U00011350\\U0001135d-\\U00011361\\U00011400-\\U00011434\\U00011447-\\U0001144a\\U00011480-\\U000114af\\U000114c4-\\U000114c5\\U000114c7\\U00011580-\\U000115ae\\U000115d8-\\U000115db\\U00011600-\\U0001162f\\U00011644\\U00011680-\\U000116aa\\U00011700-\\U0001171a\\U00011800-\\U0001182b\\U000118ff\\U00011a00\\U00011a0b-\\U00011a32\\U00011a3a\\U00011a50\\U00011a5c-\\U00011a83\\U00011a86-\\U00011a89\\U00011a9d\\U00011ac0-\\U00011af8\\U00011c00-\\U00011c08\\U00011c0a-\\U00011c2e\\U00011c40\\U00011c72-\\U00011c8f\\U00011d00-\\U00011d06\\U00011d08-\\U00011d09\\U00011d0b-\\U00011d30\\U00011d46\\U00011d60-\\U00011d65\\U00011d67-\\U00011d68\\U00011d6a-\\U00011d89\\U00011d98\\U00011ee0-\\U00011ef2\\U00012000-\\U00012399\\U00012480-\\U00012543\\U00013000-\\U0001342e\\U00014400-\\U00014646\\U00016800-\\U00016a38\\U00016a40-\\U00016a5e\\U00016ad0-\\U00016aed\\U00016b00-\\U00016b2f\\U00016b63-\\U00016b77\\U00016b7d-\\U00016b8f\\U00016f00-\\U00016f44\\U00016f50\\U00017000-\\U000187f1\\U00018800-\\U00018af2\\U0001b000-\\U0001b11e\\U0001b170-\\U0001b2fb\\U0001bc00-\\U0001bc6a\\U0001bc70-\\U0001bc7c\\U0001bc80-\\U0001bc88\\U0001bc90-\\U0001bc99\\U0001e800-\\U0001e8c4\\U0001ee00-\\U0001ee03\\U0001ee05-\\U0001ee1f\\U0001ee21-\\U0001ee22\\U0001ee24\\U0001ee27\\U0001ee29-\\U0001ee32\\U0001ee34-\\U0001ee37\\U0001ee39\\U0001ee3b\\U0001ee42\\U0001ee47\\U0001ee49\\U0001ee4b\\U0001ee4d-\\U0001ee4f\\U0001ee51-\\U0001ee52\\U0001ee54\\U0001ee57\\U0001ee59\\U0001ee5b\\U0001ee5d\\U0001ee5f\\U0001ee61-\\U0001ee62\\U0001ee64\\U0001ee67-\\U0001ee6a\\U0001ee6c-\\U0001ee72\\U0001ee74-\\U0001ee77\\U0001ee79-\\U0001ee7c\\U0001ee7e\\U0001ee80-\\U0001ee89\\U0001ee8b-\\U0001ee9b\\U0001eea1-\\U0001eea3\\U0001eea5-\\U0001eea9\\U0001eeab-\\U0001eebb\\U00020000-\\U0002a6d6\\U0002a700-\\U0002b734\\U0002b740-\\U0002b81d\\U0002b820-\\U0002cea1\\U0002ceb0-\\U0002ebe0\\U0002f800-\\U0002fa1d'\n\nLt = '\\u01c5\\u01c8\\u01cb\\u01f2\\u1f88-\\u1f8f\\u1f98-\\u1f9f\\u1fa8-\\u1faf\\u1fbc\\u1fcc\\u1ffc'\n\nLu = 'A-Z\\xc0-\\xd6\\xd8-\\xde\\u0100\\u0102\\u0104\\u0106\\u0108\\u010a\\u010c\\u010e\\u0110\\u0112\\u0114\\u0116\\u0118\\u011a\\u011c\\u011e\\u0120\\u0122\\u0124\\u0126\\u0128\\u012a\\u012c\\u012e\\u0130\\u0132\\u0134\\u0136\\u0139\\u013b\\u013d\\u013f\\u0141\\u0143\\u0145\\u0147\\u014a\\u014c\\u014e\\u0150\\u0152\\u0154\\u0156\\u0158\\u015a\\u015c\\u015e\\u0160\\u0162\\u0164\\u0166\\u0168\\u016a\\u016c\\u016e\\u0170\\u0172\\u0174\\u0176\\u0178-\\u0179\\u017b\\u017d\\u0181-\\u0182\\u0184\\u0186-\\u0187\\u0189-\\u018b\\u018e-\\u0191\\u0193-\\u0194\\u0196-\\u0198\\u019c-\\u019d\\u019f-\\u01a0\\u01a2\\u01a4\\u01a6-\\u01a7\\u01a9\\u01ac\\u01ae-\\u01af\\u01b1-\\u01b3\\u01b5\\u01b7-\\u01b8\\u01bc\\u01c4\\u01c7\\u01ca\\u01cd\\u01cf\\u01d1\\u01d3\\u01d5\\u01d7\\u01d9\\u01db\\u01de\\u01e0\\u01e2\\u01e4\\u01e6\\u01e8\\u01ea\\u01ec\\u01ee\\u01f1\\u01f4\\u01f6-\\u01f8\\u01fa\\u01fc\\u01fe\\u0200\\u0202\\u0204\\u0206\\u0208\\u020a\\u020c\\u020e\\u0210\\u0212\\u0214\\u0216\\u0218\\u021a\\u021c\\u021e\\u0220\\u0222\\u0224\\u0226\\u0228\\u022a\\u022c\\u022e\\u0230\\u0232\\u023a-\\u023b\\u023d-\\u023e\\u0241\\u0243-\\u0246\\u0248\\u024a\\u024c\\u024e\\u0370\\u0372\\u0376\\u037f\\u0386\\u0388-\\u038a\\u038c\\u038e-\\u038f\\u0391-\\u03a1\\u03a3-\\u03ab\\u03cf\\u03d2-\\u03d4\\u03d8\\u03da\\u03dc\\u03de\\u03e0\\u03e2\\u03e4\\u03e6\\u03e8\\u03ea\\u03ec\\u03ee\\u03f4\\u03f7\\u03f9-\\u03fa\\u03fd-\\u042f\\u0460\\u0462\\u0464\\u0466\\u0468\\u046a\\u046c\\u046e\\u0470\\u0472\\u0474\\u0476\\u0478\\u047a\\u047c\\u047e\\u0480\\u048a\\u048c\\u048e\\u0490\\u0492\\u0494\\u0496\\u0498\\u049a\\u049c\\u049e\\u04a0\\u04a2\\u04a4\\u04a6\\u04a8\\u04aa\\u04ac\\u04ae\\u04b0\\u04b2\\u04b4\\u04b6\\u04b8\\u04ba\\u04bc\\u04be\\u04c0-\\u04c1\\u04c3\\u04c5\\u04c7\\u04c9\\u04cb\\u04cd\\u04d0\\u04d2\\u04d4\\u04d6\\u04d8\\u04da\\u04dc\\u04de\\u04e0\\u04e2\\u04e4\\u04e6\\u04e8\\u04ea\\u04ec\\u04ee\\u04f0\\u04f2\\u04f4\\u04f6\\u04f8\\u04fa\\u04fc\\u04fe\\u0500\\u0502\\u0504\\u0506\\u0508\\u050a\\u050c\\u050e\\u0510\\u0512\\u0514\\u0516\\u0518\\u051a\\u051c\\u051e\\u0520\\u0522\\u0524\\u0526\\u0528\\u052a\\u052c\\u052e\\u0531-\\u0556\\u10a0-\\u10c5\\u10c7\\u10cd\\u13a0-\\u13f5\\u1c90-\\u1cba\\u1cbd-\\u1cbf\\u1e00\\u1e02\\u1e04\\u1e06\\u1e08\\u1e0a\\u1e0c\\u1e0e\\u1e10\\u1e12\\u1e14\\u1e16\\u1e18\\u1e1a\\u1e1c\\u1e1e\\u1e20\\u1e22\\u1e24\\u1e26\\u1e28\\u1e2a\\u1e2c\\u1e2e\\u1e30\\u1e32\\u1e34\\u1e36\\u1e38\\u1e3a\\u1e3c\\u1e3e\\u1e40\\u1e42\\u1e44\\u1e46\\u1e48\\u1e4a\\u1e4c\\u1e4e\\u1e50\\u1e52\\u1e54\\u1e56\\u1e58\\u1e5a\\u1e5c\\u1e5e\\u1e60\\u1e62\\u1e64\\u1e66\\u1e68\\u1e6a\\u1e6c\\u1e6e\\u1e70\\u1e72\\u1e74\\u1e76\\u1e78\\u1e7a\\u1e7c\\u1e7e\\u1e80\\u1e82\\u1e84\\u1e86\\u1e88\\u1e8a\\u1e8c\\u1e8e\\u1e90\\u1e92\\u1e94\\u1e9e\\u1ea0\\u1ea2\\u1ea4\\u1ea6\\u1ea8\\u1eaa\\u1eac\\u1eae\\u1eb0\\u1eb2\\u1eb4\\u1eb6\\u1eb8\\u1eba\\u1ebc\\u1ebe\\u1ec0\\u1ec2\\u1ec4\\u1ec6\\u1ec8\\u1eca\\u1ecc\\u1ece\\u1ed0\\u1ed2\\u1ed4\\u1ed6\\u1ed8\\u1eda\\u1edc\\u1ede\\u1ee0\\u1ee2\\u1ee4\\u1ee6\\u1ee8\\u1eea\\u1eec\\u1eee\\u1ef0\\u1ef2\\u1ef4\\u1ef6\\u1ef8\\u1efa\\u1efc\\u1efe\\u1f08-\\u1f0f\\u1f18-\\u1f1d\\u1f28-\\u1f2f\\u1f38-\\u1f3f\\u1f48-\\u1f4d\\u1f59\\u1f5b\\u1f5d\\u1f5f\\u1f68-\\u1f6f\\u1fb8-\\u1fbb\\u1fc8-\\u1fcb\\u1fd8-\\u1fdb\\u1fe8-\\u1fec\\u1ff8-\\u1ffb\\u2102\\u2107\\u210b-\\u210d\\u2110-\\u2112\\u2115\\u2119-\\u211d\\u2124\\u2126\\u2128\\u212a-\\u212d\\u2130-\\u2133\\u213e-\\u213f\\u2145\\u2183\\u2c00-\\u2c2e\\u2c60\\u2c62-\\u2c64\\u2c67\\u2c69\\u2c6b\\u2c6d-\\u2c70\\u2c72\\u2c75\\u2c7e-\\u2c80\\u2c82\\u2c84\\u2c86\\u2c88\\u2c8a\\u2c8c\\u2c8e\\u2c90\\u2c92\\u2c94\\u2c96\\u2c98\\u2c9a\\u2c9c\\u2c9e\\u2ca0\\u2ca2\\u2ca4\\u2ca6\\u2ca8\\u2caa\\u2cac\\u2cae\\u2cb0\\u2cb2\\u2cb4\\u2cb6\\u2cb8\\u2cba\\u2cbc\\u2cbe\\u2cc0\\u2cc2\\u2cc4\\u2cc6\\u2cc8\\u2cca\\u2ccc\\u2cce\\u2cd0\\u2cd2\\u2cd4\\u2cd6\\u2cd8\\u2cda\\u2cdc\\u2cde\\u2ce0\\u2ce2\\u2ceb\\u2ced\\u2cf2\\ua640\\ua642\\ua644\\ua646\\ua648\\ua64a\\ua64c\\ua64e\\ua650\\ua652\\ua654\\ua656\\ua658\\ua65a\\ua65c\\ua65e\\ua660\\ua662\\ua664\\ua666\\ua668\\ua66a\\ua66c\\ua680\\ua682\\ua684\\ua686\\ua688\\ua68a\\ua68c\\ua68e\\ua690\\ua692\\ua694\\ua696\\ua698\\ua69a\\ua722\\ua724\\ua726\\ua728\\ua72a\\ua72c\\ua72e\\ua732\\ua734\\ua736\\ua738\\ua73a\\ua73c\\ua73e\\ua740\\ua742\\ua744\\ua746\\ua748\\ua74a\\ua74c\\ua74e\\ua750\\ua752\\ua754\\ua756\\ua758\\ua75a\\ua75c\\ua75e\\ua760\\ua762\\ua764\\ua766\\ua768\\ua76a\\ua76c\\ua76e\\ua779\\ua77b\\ua77d-\\ua77e\\ua780\\ua782\\ua784\\ua786\\ua78b\\ua78d\\ua790\\ua792\\ua796\\ua798\\ua79a\\ua79c\\ua79e\\ua7a0\\ua7a2\\ua7a4\\ua7a6\\ua7a8\\ua7aa-\\ua7ae\\ua7b0-\\ua7b4\\ua7b6\\ua7b8\\uff21-\\uff3a\\U00010400-\\U00010427\\U000104b0-\\U000104d3\\U00010c80-\\U00010cb2\\U000118a0-\\U000118bf\\U00016e40-\\U00016e5f\\U0001d400-\\U0001d419\\U0001d434-\\U0001d44d\\U0001d468-\\U0001d481\\U0001d49c\\U0001d49e-\\U0001d49f\\U0001d4a2\\U0001d4a5-\\U0001d4a6\\U0001d4a9-\\U0001d4ac\\U0001d4ae-\\U0001d4b5\\U0001d4d0-\\U0001d4e9\\U0001d504-\\U0001d505\\U0001d507-\\U0001d50a\\U0001d50d-\\U0001d514\\U0001d516-\\U0001d51c\\U0001d538-\\U0001d539\\U0001d53b-\\U0001d53e\\U0001d540-\\U0001d544\\U0001d546\\U0001d54a-\\U0001d550\\U0001d56c-\\U0001d585\\U0001d5a0-\\U0001d5b9\\U0001d5d4-\\U0001d5ed\\U0001d608-\\U0001d621\\U0001d63c-\\U0001d655\\U0001d670-\\U0001d689\\U0001d6a8-\\U0001d6c0\\U0001d6e2-\\U0001d6fa\\U0001d71c-\\U0001d734\\U0001d756-\\U0001d76e\\U0001d790-\\U0001d7a8\\U0001d7ca\\U0001e900-\\U0001e921'\n\nMc = '\\u0903\\u093b\\u093e-\\u0940\\u0949-\\u094c\\u094e-\\u094f\\u0982-\\u0983\\u09be-\\u09c0\\u09c7-\\u09c8\\u09cb-\\u09cc\\u09d7\\u0a03\\u0a3e-\\u0a40\\u0a83\\u0abe-\\u0ac0\\u0ac9\\u0acb-\\u0acc\\u0b02-\\u0b03\\u0b3e\\u0b40\\u0b47-\\u0b48\\u0b4b-\\u0b4c\\u0b57\\u0bbe-\\u0bbf\\u0bc1-\\u0bc2\\u0bc6-\\u0bc8\\u0bca-\\u0bcc\\u0bd7\\u0c01-\\u0c03\\u0c41-\\u0c44\\u0c82-\\u0c83\\u0cbe\\u0cc0-\\u0cc4\\u0cc7-\\u0cc8\\u0cca-\\u0ccb\\u0cd5-\\u0cd6\\u0d02-\\u0d03\\u0d3e-\\u0d40\\u0d46-\\u0d48\\u0d4a-\\u0d4c\\u0d57\\u0d82-\\u0d83\\u0dcf-\\u0dd1\\u0dd8-\\u0ddf\\u0df2-\\u0df3\\u0f3e-\\u0f3f\\u0f7f\\u102b-\\u102c\\u1031\\u1038\\u103b-\\u103c\\u1056-\\u1057\\u1062-\\u1064\\u1067-\\u106d\\u1083-\\u1084\\u1087-\\u108c\\u108f\\u109a-\\u109c\\u17b6\\u17be-\\u17c5\\u17c7-\\u17c8\\u1923-\\u1926\\u1929-\\u192b\\u1930-\\u1931\\u1933-\\u1938\\u1a19-\\u1a1a\\u1a55\\u1a57\\u1a61\\u1a63-\\u1a64\\u1a6d-\\u1a72\\u1b04\\u1b35\\u1b3b\\u1b3d-\\u1b41\\u1b43-\\u1b44\\u1b82\\u1ba1\\u1ba6-\\u1ba7\\u1baa\\u1be7\\u1bea-\\u1bec\\u1bee\\u1bf2-\\u1bf3\\u1c24-\\u1c2b\\u1c34-\\u1c35\\u1ce1\\u1cf2-\\u1cf3\\u1cf7\\u302e-\\u302f\\ua823-\\ua824\\ua827\\ua880-\\ua881\\ua8b4-\\ua8c3\\ua952-\\ua953\\ua983\\ua9b4-\\ua9b5\\ua9ba-\\ua9bb\\ua9bd-\\ua9c0\\uaa2f-\\uaa30\\uaa33-\\uaa34\\uaa4d\\uaa7b\\uaa7d\\uaaeb\\uaaee-\\uaaef\\uaaf5\\uabe3-\\uabe4\\uabe6-\\uabe7\\uabe9-\\uabea\\uabec\\U00011000\\U00011002\\U00011082\\U000110b0-\\U000110b2\\U000110b7-\\U000110b8\\U0001112c\\U00011145-\\U00011146\\U00011182\\U000111b3-\\U000111b5\\U000111bf-\\U000111c0\\U0001122c-\\U0001122e\\U00011232-\\U00011233\\U00011235\\U000112e0-\\U000112e2\\U00011302-\\U00011303\\U0001133e-\\U0001133f\\U00011341-\\U00011344\\U00011347-\\U00011348\\U0001134b-\\U0001134d\\U00011357\\U00011362-\\U00011363\\U00011435-\\U00011437\\U00011440-\\U00011441\\U00011445\\U000114b0-\\U000114b2\\U000114b9\\U000114bb-\\U000114be\\U000114c1\\U000115af-\\U000115b1\\U000115b8-\\U000115bb\\U000115be\\U00011630-\\U00011632\\U0001163b-\\U0001163c\\U0001163e\\U000116ac\\U000116ae-\\U000116af\\U000116b6\\U00011720-\\U00011721\\U00011726\\U0001182c-\\U0001182e\\U00011838\\U00011a39\\U00011a57-\\U00011a58\\U00011a97\\U00011c2f\\U00011c3e\\U00011ca9\\U00011cb1\\U00011cb4\\U00011d8a-\\U00011d8e\\U00011d93-\\U00011d94\\U00011d96\\U00011ef5-\\U00011ef6\\U00016f51-\\U00016f7e\\U0001d165-\\U0001d166\\U0001d16d-\\U0001d172'\n\nMe = '\\u0488-\\u0489\\u1abe\\u20dd-\\u20e0\\u20e2-\\u20e4\\ua670-\\ua672'\n\nMn = '\\u0300-\\u036f\\u0483-\\u0487\\u0591-\\u05bd\\u05bf\\u05c1-\\u05c2\\u05c4-\\u05c5\\u05c7\\u0610-\\u061a\\u064b-\\u065f\\u0670\\u06d6-\\u06dc\\u06df-\\u06e4\\u06e7-\\u06e8\\u06ea-\\u06ed\\u0711\\u0730-\\u074a\\u07a6-\\u07b0\\u07eb-\\u07f3\\u07fd\\u0816-\\u0819\\u081b-\\u0823\\u0825-\\u0827\\u0829-\\u082d\\u0859-\\u085b\\u08d3-\\u08e1\\u08e3-\\u0902\\u093a\\u093c\\u0941-\\u0948\\u094d\\u0951-\\u0957\\u0962-\\u0963\\u0981\\u09bc\\u09c1-\\u09c4\\u09cd\\u09e2-\\u09e3\\u09fe\\u0a01-\\u0a02\\u0a3c\\u0a41-\\u0a42\\u0a47-\\u0a48\\u0a4b-\\u0a4d\\u0a51\\u0a70-\\u0a71\\u0a75\\u0a81-\\u0a82\\u0abc\\u0ac1-\\u0ac5\\u0ac7-\\u0ac8\\u0acd\\u0ae2-\\u0ae3\\u0afa-\\u0aff\\u0b01\\u0b3c\\u0b3f\\u0b41-\\u0b44\\u0b4d\\u0b56\\u0b62-\\u0b63\\u0b82\\u0bc0\\u0bcd\\u0c00\\u0c04\\u0c3e-\\u0c40\\u0c46-\\u0c48\\u0c4a-\\u0c4d\\u0c55-\\u0c56\\u0c62-\\u0c63\\u0c81\\u0cbc\\u0cbf\\u0cc6\\u0ccc-\\u0ccd\\u0ce2-\\u0ce3\\u0d00-\\u0d01\\u0d3b-\\u0d3c\\u0d41-\\u0d44\\u0d4d\\u0d62-\\u0d63\\u0dca\\u0dd2-\\u0dd4\\u0dd6\\u0e31\\u0e34-\\u0e3a\\u0e47-\\u0e4e\\u0eb1\\u0eb4-\\u0eb9\\u0ebb-\\u0ebc\\u0ec8-\\u0ecd\\u0f18-\\u0f19\\u0f35\\u0f37\\u0f39\\u0f71-\\u0f7e\\u0f80-\\u0f84\\u0f86-\\u0f87\\u0f8d-\\u0f97\\u0f99-\\u0fbc\\u0fc6\\u102d-\\u1030\\u1032-\\u1037\\u1039-\\u103a\\u103d-\\u103e\\u1058-\\u1059\\u105e-\\u1060\\u1071-\\u1074\\u1082\\u1085-\\u1086\\u108d\\u109d\\u135d-\\u135f\\u1712-\\u1714\\u1732-\\u1734\\u1752-\\u1753\\u1772-\\u1773\\u17b4-\\u17b5\\u17b7-\\u17bd\\u17c6\\u17c9-\\u17d3\\u17dd\\u180b-\\u180d\\u1885-\\u1886\\u18a9\\u1920-\\u1922\\u1927-\\u1928\\u1932\\u1939-\\u193b\\u1a17-\\u1a18\\u1a1b\\u1a56\\u1a58-\\u1a5e\\u1a60\\u1a62\\u1a65-\\u1a6c\\u1a73-\\u1a7c\\u1a7f\\u1ab0-\\u1abd\\u1b00-\\u1b03\\u1b34\\u1b36-\\u1b3a\\u1b3c\\u1b42\\u1b6b-\\u1b73\\u1b80-\\u1b81\\u1ba2-\\u1ba5\\u1ba8-\\u1ba9\\u1bab-\\u1bad\\u1be6\\u1be8-\\u1be9\\u1bed\\u1bef-\\u1bf1\\u1c2c-\\u1c33\\u1c36-\\u1c37\\u1cd0-\\u1cd2\\u1cd4-\\u1ce0\\u1ce2-\\u1ce8\\u1ced\\u1cf4\\u1cf8-\\u1cf9\\u1dc0-\\u1df9\\u1dfb-\\u1dff\\u20d0-\\u20dc\\u20e1\\u20e5-\\u20f0\\u2cef-\\u2cf1\\u2d7f\\u2de0-\\u2dff\\u302a-\\u302d\\u3099-\\u309a\\ua66f\\ua674-\\ua67d\\ua69e-\\ua69f\\ua6f0-\\ua6f1\\ua802\\ua806\\ua80b\\ua825-\\ua826\\ua8c4-\\ua8c5\\ua8e0-\\ua8f1\\ua8ff\\ua926-\\ua92d\\ua947-\\ua951\\ua980-\\ua982\\ua9b3\\ua9b6-\\ua9b9\\ua9bc\\ua9e5\\uaa29-\\uaa2e\\uaa31-\\uaa32\\uaa35-\\uaa36\\uaa43\\uaa4c\\uaa7c\\uaab0\\uaab2-\\uaab4\\uaab7-\\uaab8\\uaabe-\\uaabf\\uaac1\\uaaec-\\uaaed\\uaaf6\\uabe5\\uabe8\\uabed\\ufb1e\\ufe00-\\ufe0f\\ufe20-\\ufe2f\\U000101fd\\U000102e0\\U00010376-\\U0001037a\\U00010a01-\\U00010a03\\U00010a05-\\U00010a06\\U00010a0c-\\U00010a0f\\U00010a38-\\U00010a3a\\U00010a3f\\U00010ae5-\\U00010ae6\\U00010d24-\\U00010d27\\U00010f46-\\U00010f50\\U00011001\\U00011038-\\U00011046\\U0001107f-\\U00011081\\U000110b3-\\U000110b6\\U000110b9-\\U000110ba\\U00011100-\\U00011102\\U00011127-\\U0001112b\\U0001112d-\\U00011134\\U00011173\\U00011180-\\U00011181\\U000111b6-\\U000111be\\U000111c9-\\U000111cc\\U0001122f-\\U00011231\\U00011234\\U00011236-\\U00011237\\U0001123e\\U000112df\\U000112e3-\\U000112ea\\U00011300-\\U00011301\\U0001133b-\\U0001133c\\U00011340\\U00011366-\\U0001136c\\U00011370-\\U00011374\\U00011438-\\U0001143f\\U00011442-\\U00011444\\U00011446\\U0001145e\\U000114b3-\\U000114b8\\U000114ba\\U000114bf-\\U000114c0\\U000114c2-\\U000114c3\\U000115b2-\\U000115b5\\U000115bc-\\U000115bd\\U000115bf-\\U000115c0\\U000115dc-\\U000115dd\\U00011633-\\U0001163a\\U0001163d\\U0001163f-\\U00011640\\U000116ab\\U000116ad\\U000116b0-\\U000116b5\\U000116b7\\U0001171d-\\U0001171f\\U00011722-\\U00011725\\U00011727-\\U0001172b\\U0001182f-\\U00011837\\U00011839-\\U0001183a\\U00011a01-\\U00011a0a\\U00011a33-\\U00011a38\\U00011a3b-\\U00011a3e\\U00011a47\\U00011a51-\\U00011a56\\U00011a59-\\U00011a5b\\U00011a8a-\\U00011a96\\U00011a98-\\U00011a99\\U00011c30-\\U00011c36\\U00011c38-\\U00011c3d\\U00011c3f\\U00011c92-\\U00011ca7\\U00011caa-\\U00011cb0\\U00011cb2-\\U00011cb3\\U00011cb5-\\U00011cb6\\U00011d31-\\U00011d36\\U00011d3a\\U00011d3c-\\U00011d3d\\U00011d3f-\\U00011d45\\U00011d47\\U00011d90-\\U00011d91\\U00011d95\\U00011d97\\U00011ef3-\\U00011ef4\\U00016af0-\\U00016af4\\U00016b30-\\U00016b36\\U00016f8f-\\U00016f92\\U0001bc9d-\\U0001bc9e\\U0001d167-\\U0001d169\\U0001d17b-\\U0001d182\\U0001d185-\\U0001d18b\\U0001d1aa-\\U0001d1ad\\U0001d242-\\U0001d244\\U0001da00-\\U0001da36\\U0001da3b-\\U0001da6c\\U0001da75\\U0001da84\\U0001da9b-\\U0001da9f\\U0001daa1-\\U0001daaf\\U0001e000-\\U0001e006\\U0001e008-\\U0001e018\\U0001e01b-\\U0001e021\\U0001e023-\\U0001e024\\U0001e026-\\U0001e02a\\U0001e8d0-\\U0001e8d6\\U0001e944-\\U0001e94a\\U000e0100-\\U000e01ef'\n\nNd = '0-9\\u0660-\\u0669\\u06f0-\\u06f9\\u07c0-\\u07c9\\u0966-\\u096f\\u09e6-\\u09ef\\u0a66-\\u0a6f\\u0ae6-\\u0aef\\u0b66-\\u0b6f\\u0be6-\\u0bef\\u0c66-\\u0c6f\\u0ce6-\\u0cef\\u0d66-\\u0d6f\\u0de6-\\u0def\\u0e50-\\u0e59\\u0ed0-\\u0ed9\\u0f20-\\u0f29\\u1040-\\u1049\\u1090-\\u1099\\u17e0-\\u17e9\\u1810-\\u1819\\u1946-\\u194f\\u19d0-\\u19d9\\u1a80-\\u1a89\\u1a90-\\u1a99\\u1b50-\\u1b59\\u1bb0-\\u1bb9\\u1c40-\\u1c49\\u1c50-\\u1c59\\ua620-\\ua629\\ua8d0-\\ua8d9\\ua900-\\ua909\\ua9d0-\\ua9d9\\ua9f0-\\ua9f9\\uaa50-\\uaa59\\uabf0-\\uabf9\\uff10-\\uff19\\U000104a0-\\U000104a9\\U00010d30-\\U00010d39\\U00011066-\\U0001106f\\U000110f0-\\U000110f9\\U00011136-\\U0001113f\\U000111d0-\\U000111d9\\U000112f0-\\U000112f9\\U00011450-\\U00011459\\U000114d0-\\U000114d9\\U00011650-\\U00011659\\U000116c0-\\U000116c9\\U00011730-\\U00011739\\U000118e0-\\U000118e9\\U00011c50-\\U00011c59\\U00011d50-\\U00011d59\\U00011da0-\\U00011da9\\U00016a60-\\U00016a69\\U00016b50-\\U00016b59\\U0001d7ce-\\U0001d7ff\\U0001e950-\\U0001e959'\n\nNl = '\\u16ee-\\u16f0\\u2160-\\u2182\\u2185-\\u2188\\u3007\\u3021-\\u3029\\u3038-\\u303a\\ua6e6-\\ua6ef\\U00010140-\\U00010174\\U00010341\\U0001034a\\U000103d1-\\U000103d5\\U00012400-\\U0001246e'\n\nNo = '\\xb2-\\xb3\\xb9\\xbc-\\xbe\\u09f4-\\u09f9\\u0b72-\\u0b77\\u0bf0-\\u0bf2\\u0c78-\\u0c7e\\u0d58-\\u0d5e\\u0d70-\\u0d78\\u0f2a-\\u0f33\\u1369-\\u137c\\u17f0-\\u17f9\\u19da\\u2070\\u2074-\\u2079\\u2080-\\u2089\\u2150-\\u215f\\u2189\\u2460-\\u249b\\u24ea-\\u24ff\\u2776-\\u2793\\u2cfd\\u3192-\\u3195\\u3220-\\u3229\\u3248-\\u324f\\u3251-\\u325f\\u3280-\\u3289\\u32b1-\\u32bf\\ua830-\\ua835\\U00010107-\\U00010133\\U00010175-\\U00010178\\U0001018a-\\U0001018b\\U000102e1-\\U000102fb\\U00010320-\\U00010323\\U00010858-\\U0001085f\\U00010879-\\U0001087f\\U000108a7-\\U000108af\\U000108fb-\\U000108ff\\U00010916-\\U0001091b\\U000109bc-\\U000109bd\\U000109c0-\\U000109cf\\U000109d2-\\U000109ff\\U00010a40-\\U00010a48\\U00010a7d-\\U00010a7e\\U00010a9d-\\U00010a9f\\U00010aeb-\\U00010aef\\U00010b58-\\U00010b5f\\U00010b78-\\U00010b7f\\U00010ba9-\\U00010baf\\U00010cfa-\\U00010cff\\U00010e60-\\U00010e7e\\U00010f1d-\\U00010f26\\U00010f51-\\U00010f54\\U00011052-\\U00011065\\U000111e1-\\U000111f4\\U0001173a-\\U0001173b\\U000118ea-\\U000118f2\\U00011c5a-\\U00011c6c\\U00016b5b-\\U00016b61\\U00016e80-\\U00016e96\\U0001d2e0-\\U0001d2f3\\U0001d360-\\U0001d378\\U0001e8c7-\\U0001e8cf\\U0001ec71-\\U0001ecab\\U0001ecad-\\U0001ecaf\\U0001ecb1-\\U0001ecb4\\U0001f100-\\U0001f10c'\n\nPc = '_\\u203f-\\u2040\\u2054\\ufe33-\\ufe34\\ufe4d-\\ufe4f\\uff3f'\n\nPd = '\\\\-\\u058a\\u05be\\u1400\\u1806\\u2010-\\u2015\\u2e17\\u2e1a\\u2e3a-\\u2e3b\\u2e40\\u301c\\u3030\\u30a0\\ufe31-\\ufe32\\ufe58\\ufe63\\uff0d'\n\nPe = ')\\\\]}\\u0f3b\\u0f3d\\u169c\\u2046\\u207e\\u208e\\u2309\\u230b\\u232a\\u2769\\u276b\\u276d\\u276f\\u2771\\u2773\\u2775\\u27c6\\u27e7\\u27e9\\u27eb\\u27ed\\u27ef\\u2984\\u2986\\u2988\\u298a\\u298c\\u298e\\u2990\\u2992\\u2994\\u2996\\u2998\\u29d9\\u29db\\u29fd\\u2e23\\u2e25\\u2e27\\u2e29\\u3009\\u300b\\u300d\\u300f\\u3011\\u3015\\u3017\\u3019\\u301b\\u301e-\\u301f\\ufd3e\\ufe18\\ufe36\\ufe38\\ufe3a\\ufe3c\\ufe3e\\ufe40\\ufe42\\ufe44\\ufe48\\ufe5a\\ufe5c\\ufe5e\\uff09\\uff3d\\uff5d\\uff60\\uff63'\n\nPf = '\\xbb\\u2019\\u201d\\u203a\\u2e03\\u2e05\\u2e0a\\u2e0d\\u2e1d\\u2e21'\n\nPi = '\\xab\\u2018\\u201b-\\u201c\\u201f\\u2039\\u2e02\\u2e04\\u2e09\\u2e0c\\u2e1c\\u2e20'\n\nPo = \"!-#%-'*,.-/:-;?-@\\\\\\\\\\xa1\\xa7\\xb6-\\xb7\\xbf\\u037e\\u0387\\u055a-\\u055f\\u0589\\u05c0\\u05c3\\u05c6\\u05f3-\\u05f4\\u0609-\\u060a\\u060c-\\u060d\\u061b\\u061e-\\u061f\\u066a-\\u066d\\u06d4\\u0700-\\u070d\\u07f7-\\u07f9\\u0830-\\u083e\\u085e\\u0964-\\u0965\\u0970\\u09fd\\u0a76\\u0af0\\u0c84\\u0df4\\u0e4f\\u0e5a-\\u0e5b\\u0f04-\\u0f12\\u0f14\\u0f85\\u0fd0-\\u0fd4\\u0fd9-\\u0fda\\u104a-\\u104f\\u10fb\\u1360-\\u1368\\u166d-\\u166e\\u16eb-\\u16ed\\u1735-\\u1736\\u17d4-\\u17d6\\u17d8-\\u17da\\u1800-\\u1805\\u1807-\\u180a\\u1944-\\u1945\\u1a1e-\\u1a1f\\u1aa0-\\u1aa6\\u1aa8-\\u1aad\\u1b5a-\\u1b60\\u1bfc-\\u1bff\\u1c3b-\\u1c3f\\u1c7e-\\u1c7f\\u1cc0-\\u1cc7\\u1cd3\\u2016-\\u2017\\u2020-\\u2027\\u2030-\\u2038\\u203b-\\u203e\\u2041-\\u2043\\u2047-\\u2051\\u2053\\u2055-\\u205e\\u2cf9-\\u2cfc\\u2cfe-\\u2cff\\u2d70\\u2e00-\\u2e01\\u2e06-\\u2e08\\u2e0b\\u2e0e-\\u2e16\\u2e18-\\u2e19\\u2e1b\\u2e1e-\\u2e1f\\u2e2a-\\u2e2e\\u2e30-\\u2e39\\u2e3c-\\u2e3f\\u2e41\\u2e43-\\u2e4e\\u3001-\\u3003\\u303d\\u30fb\\ua4fe-\\ua4ff\\ua60d-\\ua60f\\ua673\\ua67e\\ua6f2-\\ua6f7\\ua874-\\ua877\\ua8ce-\\ua8cf\\ua8f8-\\ua8fa\\ua8fc\\ua92e-\\ua92f\\ua95f\\ua9c1-\\ua9cd\\ua9de-\\ua9df\\uaa5c-\\uaa5f\\uaade-\\uaadf\\uaaf0-\\uaaf1\\uabeb\\ufe10-\\ufe16\\ufe19\\ufe30\\ufe45-\\ufe46\\ufe49-\\ufe4c\\ufe50-\\ufe52\\ufe54-\\ufe57\\ufe5f-\\ufe61\\ufe68\\ufe6a-\\ufe6b\\uff01-\\uff03\\uff05-\\uff07\\uff0a\\uff0c\\uff0e-\\uff0f\\uff1a-\\uff1b\\uff1f-\\uff20\\uff3c\\uff61\\uff64-\\uff65\\U00010100-\\U00010102\\U0001039f\\U000103d0\\U0001056f\\U00010857\\U0001091f\\U0001093f\\U00010a50-\\U00010a58\\U00010a7f\\U00010af0-\\U00010af6\\U00010b39-\\U00010b3f\\U00010b99-\\U00010b9c\\U00010f55-\\U00010f59\\U00011047-\\U0001104d\\U000110bb-\\U000110bc\\U000110be-\\U000110c1\\U00011140-\\U00011143\\U00011174-\\U00011175\\U000111c5-\\U000111c8\\U000111cd\\U000111db\\U000111dd-\\U000111df\\U00011238-\\U0001123d\\U000112a9\\U0001144b-\\U0001144f\\U0001145b\\U0001145d\\U000114c6\\U000115c1-\\U000115d7\\U00011641-\\U00011643\\U00011660-\\U0001166c\\U0001173c-\\U0001173e\\U0001183b\\U00011a3f-\\U00011a46\\U00011a9a-\\U00011a9c\\U00011a9e-\\U00011aa2\\U00011c41-\\U00011c45\\U00011c70-\\U00011c71\\U00011ef7-\\U00011ef8\\U00012470-\\U00012474\\U00016a6e-\\U00016a6f\\U00016af5\\U00016b37-\\U00016b3b\\U00016b44\\U00016e97-\\U00016e9a\\U0001bc9f\\U0001da87-\\U0001da8b\\U0001e95e-\\U0001e95f\"\n\nPs = '(\\\\[{\\u0f3a\\u0f3c\\u169b\\u201a\\u201e\\u2045\\u207d\\u208d\\u2308\\u230a\\u2329\\u2768\\u276a\\u276c\\u276e\\u2770\\u2772\\u2774\\u27c5\\u27e6\\u27e8\\u27ea\\u27ec\\u27ee\\u2983\\u2985\\u2987\\u2989\\u298b\\u298d\\u298f\\u2991\\u2993\\u2995\\u2997\\u29d8\\u29da\\u29fc\\u2e22\\u2e24\\u2e26\\u2e28\\u2e42\\u3008\\u300a\\u300c\\u300e\\u3010\\u3014\\u3016\\u3018\\u301a\\u301d\\ufd3f\\ufe17\\ufe35\\ufe37\\ufe39\\ufe3b\\ufe3d\\ufe3f\\ufe41\\ufe43\\ufe47\\ufe59\\ufe5b\\ufe5d\\uff08\\uff3b\\uff5b\\uff5f\\uff62'\n\nSc = '$\\xa2-\\xa5\\u058f\\u060b\\u07fe-\\u07ff\\u09f2-\\u09f3\\u09fb\\u0af1\\u0bf9\\u0e3f\\u17db\\u20a0-\\u20bf\\ua838\\ufdfc\\ufe69\\uff04\\uffe0-\\uffe1\\uffe5-\\uffe6\\U0001ecb0'\n\nSk = '\\\\^`\\xa8\\xaf\\xb4\\xb8\\u02c2-\\u02c5\\u02d2-\\u02df\\u02e5-\\u02eb\\u02ed\\u02ef-\\u02ff\\u0375\\u0384-\\u0385\\u1fbd\\u1fbf-\\u1fc1\\u1fcd-\\u1fcf\\u1fdd-\\u1fdf\\u1fed-\\u1fef\\u1ffd-\\u1ffe\\u309b-\\u309c\\ua700-\\ua716\\ua720-\\ua721\\ua789-\\ua78a\\uab5b\\ufbb2-\\ufbc1\\uff3e\\uff40\\uffe3\\U0001f3fb-\\U0001f3ff'\n\nSm = '+<->|~\\xac\\xb1\\xd7\\xf7\\u03f6\\u0606-\\u0608\\u2044\\u2052\\u207a-\\u207c\\u208a-\\u208c\\u2118\\u2140-\\u2144\\u214b\\u2190-\\u2194\\u219a-\\u219b\\u21a0\\u21a3\\u21a6\\u21ae\\u21ce-\\u21cf\\u21d2\\u21d4\\u21f4-\\u22ff\\u2320-\\u2321\\u237c\\u239b-\\u23b3\\u23dc-\\u23e1\\u25b7\\u25c1\\u25f8-\\u25ff\\u266f\\u27c0-\\u27c4\\u27c7-\\u27e5\\u27f0-\\u27ff\\u2900-\\u2982\\u2999-\\u29d7\\u29dc-\\u29fb\\u29fe-\\u2aff\\u2b30-\\u2b44\\u2b47-\\u2b4c\\ufb29\\ufe62\\ufe64-\\ufe66\\uff0b\\uff1c-\\uff1e\\uff5c\\uff5e\\uffe2\\uffe9-\\uffec\\U0001d6c1\\U0001d6db\\U0001d6fb\\U0001d715\\U0001d735\\U0001d74f\\U0001d76f\\U0001d789\\U0001d7a9\\U0001d7c3\\U0001eef0-\\U0001eef1'\n\nSo = '\\xa6\\xa9\\xae\\xb0\\u0482\\u058d-\\u058e\\u060e-\\u060f\\u06de\\u06e9\\u06fd-\\u06fe\\u07f6\\u09fa\\u0b70\\u0bf3-\\u0bf8\\u0bfa\\u0c7f\\u0d4f\\u0d79\\u0f01-\\u0f03\\u0f13\\u0f15-\\u0f17\\u0f1a-\\u0f1f\\u0f34\\u0f36\\u0f38\\u0fbe-\\u0fc5\\u0fc7-\\u0fcc\\u0fce-\\u0fcf\\u0fd5-\\u0fd8\\u109e-\\u109f\\u1390-\\u1399\\u1940\\u19de-\\u19ff\\u1b61-\\u1b6a\\u1b74-\\u1b7c\\u2100-\\u2101\\u2103-\\u2106\\u2108-\\u2109\\u2114\\u2116-\\u2117\\u211e-\\u2123\\u2125\\u2127\\u2129\\u212e\\u213a-\\u213b\\u214a\\u214c-\\u214d\\u214f\\u218a-\\u218b\\u2195-\\u2199\\u219c-\\u219f\\u21a1-\\u21a2\\u21a4-\\u21a5\\u21a7-\\u21ad\\u21af-\\u21cd\\u21d0-\\u21d1\\u21d3\\u21d5-\\u21f3\\u2300-\\u2307\\u230c-\\u231f\\u2322-\\u2328\\u232b-\\u237b\\u237d-\\u239a\\u23b4-\\u23db\\u23e2-\\u2426\\u2440-\\u244a\\u249c-\\u24e9\\u2500-\\u25b6\\u25b8-\\u25c0\\u25c2-\\u25f7\\u2600-\\u266e\\u2670-\\u2767\\u2794-\\u27bf\\u2800-\\u28ff\\u2b00-\\u2b2f\\u2b45-\\u2b46\\u2b4d-\\u2b73\\u2b76-\\u2b95\\u2b98-\\u2bc8\\u2bca-\\u2bfe\\u2ce5-\\u2cea\\u2e80-\\u2e99\\u2e9b-\\u2ef3\\u2f00-\\u2fd5\\u2ff0-\\u2ffb\\u3004\\u3012-\\u3013\\u3020\\u3036-\\u3037\\u303e-\\u303f\\u3190-\\u3191\\u3196-\\u319f\\u31c0-\\u31e3\\u3200-\\u321e\\u322a-\\u3247\\u3250\\u3260-\\u327f\\u328a-\\u32b0\\u32c0-\\u32fe\\u3300-\\u33ff\\u4dc0-\\u4dff\\ua490-\\ua4c6\\ua828-\\ua82b\\ua836-\\ua837\\ua839\\uaa77-\\uaa79\\ufdfd\\uffe4\\uffe8\\uffed-\\uffee\\ufffc-\\ufffd\\U00010137-\\U0001013f\\U00010179-\\U00010189\\U0001018c-\\U0001018e\\U00010190-\\U0001019b\\U000101a0\\U000101d0-\\U000101fc\\U00010877-\\U00010878\\U00010ac8\\U0001173f\\U00016b3c-\\U00016b3f\\U00016b45\\U0001bc9c\\U0001d000-\\U0001d0f5\\U0001d100-\\U0001d126\\U0001d129-\\U0001d164\\U0001d16a-\\U0001d16c\\U0001d183-\\U0001d184\\U0001d18c-\\U0001d1a9\\U0001d1ae-\\U0001d1e8\\U0001d200-\\U0001d241\\U0001d245\\U0001d300-\\U0001d356\\U0001d800-\\U0001d9ff\\U0001da37-\\U0001da3a\\U0001da6d-\\U0001da74\\U0001da76-\\U0001da83\\U0001da85-\\U0001da86\\U0001ecac\\U0001f000-\\U0001f02b\\U0001f030-\\U0001f093\\U0001f0a0-\\U0001f0ae\\U0001f0b1-\\U0001f0bf\\U0001f0c1-\\U0001f0cf\\U0001f0d1-\\U0001f0f5\\U0001f110-\\U0001f16b\\U0001f170-\\U0001f1ac\\U0001f1e6-\\U0001f202\\U0001f210-\\U0001f23b\\U0001f240-\\U0001f248\\U0001f250-\\U0001f251\\U0001f260-\\U0001f265\\U0001f300-\\U0001f3fa\\U0001f400-\\U0001f6d4\\U0001f6e0-\\U0001f6ec\\U0001f6f0-\\U0001f6f9\\U0001f700-\\U0001f773\\U0001f780-\\U0001f7d8\\U0001f800-\\U0001f80b\\U0001f810-\\U0001f847\\U0001f850-\\U0001f859\\U0001f860-\\U0001f887\\U0001f890-\\U0001f8ad\\U0001f900-\\U0001f90b\\U0001f910-\\U0001f93e\\U0001f940-\\U0001f970\\U0001f973-\\U0001f976\\U0001f97a\\U0001f97c-\\U0001f9a2\\U0001f9b0-\\U0001f9b9\\U0001f9c0-\\U0001f9c2\\U0001f9d0-\\U0001f9ff\\U0001fa60-\\U0001fa6d'\n\nZl = '\\u2028'\n\nZp = '\\u2029'\n\nZs = ' \\xa0\\u1680\\u2000-\\u200a\\u202f\\u205f\\u3000'\n\nxid_continue = '0-9A-Z_a-z\\xaa\\xb5\\xb7\\xba\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\u02c1\\u02c6-\\u02d1\\u02e0-\\u02e4\\u02ec\\u02ee\\u0300-\\u0374\\u0376-\\u0377\\u037b-\\u037d\\u037f\\u0386-\\u038a\\u038c\\u038e-\\u03a1\\u03a3-\\u03f5\\u03f7-\\u0481\\u0483-\\u0487\\u048a-\\u052f\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u0591-\\u05bd\\u05bf\\u05c1-\\u05c2\\u05c4-\\u05c5\\u05c7\\u05d0-\\u05ea\\u05ef-\\u05f2\\u0610-\\u061a\\u0620-\\u0669\\u066e-\\u06d3\\u06d5-\\u06dc\\u06df-\\u06e8\\u06ea-\\u06fc\\u06ff\\u0710-\\u074a\\u074d-\\u07b1\\u07c0-\\u07f5\\u07fa\\u07fd\\u0800-\\u082d\\u0840-\\u085b\\u0860-\\u086a\\u08a0-\\u08b4\\u08b6-\\u08bd\\u08d3-\\u08e1\\u08e3-\\u0963\\u0966-\\u096f\\u0971-\\u0983\\u0985-\\u098c\\u098f-\\u0990\\u0993-\\u09a8\\u09aa-\\u09b0\\u09b2\\u09b6-\\u09b9\\u09bc-\\u09c4\\u09c7-\\u09c8\\u09cb-\\u09ce\\u09d7\\u09dc-\\u09dd\\u09df-\\u09e3\\u09e6-\\u09f1\\u09fc\\u09fe\\u0a01-\\u0a03\\u0a05-\\u0a0a\\u0a0f-\\u0a10\\u0a13-\\u0a28\\u0a2a-\\u0a30\\u0a32-\\u0a33\\u0a35-\\u0a36\\u0a38-\\u0a39\\u0a3c\\u0a3e-\\u0a42\\u0a47-\\u0a48\\u0a4b-\\u0a4d\\u0a51\\u0a59-\\u0a5c\\u0a5e\\u0a66-\\u0a75\\u0a81-\\u0a83\\u0a85-\\u0a8d\\u0a8f-\\u0a91\\u0a93-\\u0aa8\\u0aaa-\\u0ab0\\u0ab2-\\u0ab3\\u0ab5-\\u0ab9\\u0abc-\\u0ac5\\u0ac7-\\u0ac9\\u0acb-\\u0acd\\u0ad0\\u0ae0-\\u0ae3\\u0ae6-\\u0aef\\u0af9-\\u0aff\\u0b01-\\u0b03\\u0b05-\\u0b0c\\u0b0f-\\u0b10\\u0b13-\\u0b28\\u0b2a-\\u0b30\\u0b32-\\u0b33\\u0b35-\\u0b39\\u0b3c-\\u0b44\\u0b47-\\u0b48\\u0b4b-\\u0b4d\\u0b56-\\u0b57\\u0b5c-\\u0b5d\\u0b5f-\\u0b63\\u0b66-\\u0b6f\\u0b71\\u0b82-\\u0b83\\u0b85-\\u0b8a\\u0b8e-\\u0b90\\u0b92-\\u0b95\\u0b99-\\u0b9a\\u0b9c\\u0b9e-\\u0b9f\\u0ba3-\\u0ba4\\u0ba8-\\u0baa\\u0bae-\\u0bb9\\u0bbe-\\u0bc2\\u0bc6-\\u0bc8\\u0bca-\\u0bcd\\u0bd0\\u0bd7\\u0be6-\\u0bef\\u0c00-\\u0c0c\\u0c0e-\\u0c10\\u0c12-\\u0c28\\u0c2a-\\u0c39\\u0c3d-\\u0c44\\u0c46-\\u0c48\\u0c4a-\\u0c4d\\u0c55-\\u0c56\\u0c58-\\u0c5a\\u0c60-\\u0c63\\u0c66-\\u0c6f\\u0c80-\\u0c83\\u0c85-\\u0c8c\\u0c8e-\\u0c90\\u0c92-\\u0ca8\\u0caa-\\u0cb3\\u0cb5-\\u0cb9\\u0cbc-\\u0cc4\\u0cc6-\\u0cc8\\u0cca-\\u0ccd\\u0cd5-\\u0cd6\\u0cde\\u0ce0-\\u0ce3\\u0ce6-\\u0cef\\u0cf1-\\u0cf2\\u0d00-\\u0d03\\u0d05-\\u0d0c\\u0d0e-\\u0d10\\u0d12-\\u0d44\\u0d46-\\u0d48\\u0d4a-\\u0d4e\\u0d54-\\u0d57\\u0d5f-\\u0d63\\u0d66-\\u0d6f\\u0d7a-\\u0d7f\\u0d82-\\u0d83\\u0d85-\\u0d96\\u0d9a-\\u0db1\\u0db3-\\u0dbb\\u0dbd\\u0dc0-\\u0dc6\\u0dca\\u0dcf-\\u0dd4\\u0dd6\\u0dd8-\\u0ddf\\u0de6-\\u0def\\u0df2-\\u0df3\\u0e01-\\u0e3a\\u0e40-\\u0e4e\\u0e50-\\u0e59\\u0e81-\\u0e82\\u0e84\\u0e87-\\u0e88\\u0e8a\\u0e8d\\u0e94-\\u0e97\\u0e99-\\u0e9f\\u0ea1-\\u0ea3\\u0ea5\\u0ea7\\u0eaa-\\u0eab\\u0ead-\\u0eb9\\u0ebb-\\u0ebd\\u0ec0-\\u0ec4\\u0ec6\\u0ec8-\\u0ecd\\u0ed0-\\u0ed9\\u0edc-\\u0edf\\u0f00\\u0f18-\\u0f19\\u0f20-\\u0f29\\u0f35\\u0f37\\u0f39\\u0f3e-\\u0f47\\u0f49-\\u0f6c\\u0f71-\\u0f84\\u0f86-\\u0f97\\u0f99-\\u0fbc\\u0fc6\\u1000-\\u1049\\u1050-\\u109d\\u10a0-\\u10c5\\u10c7\\u10cd\\u10d0-\\u10fa\\u10fc-\\u1248\\u124a-\\u124d\\u1250-\\u1256\\u1258\\u125a-\\u125d\\u1260-\\u1288\\u128a-\\u128d\\u1290-\\u12b0\\u12b2-\\u12b5\\u12b8-\\u12be\\u12c0\\u12c2-\\u12c5\\u12c8-\\u12d6\\u12d8-\\u1310\\u1312-\\u1315\\u1318-\\u135a\\u135d-\\u135f\\u1369-\\u1371\\u1380-\\u138f\\u13a0-\\u13f5\\u13f8-\\u13fd\\u1401-\\u166c\\u166f-\\u167f\\u1681-\\u169a\\u16a0-\\u16ea\\u16ee-\\u16f8\\u1700-\\u170c\\u170e-\\u1714\\u1720-\\u1734\\u1740-\\u1753\\u1760-\\u176c\\u176e-\\u1770\\u1772-\\u1773\\u1780-\\u17d3\\u17d7\\u17dc-\\u17dd\\u17e0-\\u17e9\\u180b-\\u180d\\u1810-\\u1819\\u1820-\\u1878\\u1880-\\u18aa\\u18b0-\\u18f5\\u1900-\\u191e\\u1920-\\u192b\\u1930-\\u193b\\u1946-\\u196d\\u1970-\\u1974\\u1980-\\u19ab\\u19b0-\\u19c9\\u19d0-\\u19da\\u1a00-\\u1a1b\\u1a20-\\u1a5e\\u1a60-\\u1a7c\\u1a7f-\\u1a89\\u1a90-\\u1a99\\u1aa7\\u1ab0-\\u1abd\\u1b00-\\u1b4b\\u1b50-\\u1b59\\u1b6b-\\u1b73\\u1b80-\\u1bf3\\u1c00-\\u1c37\\u1c40-\\u1c49\\u1c4d-\\u1c7d\\u1c80-\\u1c88\\u1c90-\\u1cba\\u1cbd-\\u1cbf\\u1cd0-\\u1cd2\\u1cd4-\\u1cf9\\u1d00-\\u1df9\\u1dfb-\\u1f15\\u1f18-\\u1f1d\\u1f20-\\u1f45\\u1f48-\\u1f4d\\u1f50-\\u1f57\\u1f59\\u1f5b\\u1f5d\\u1f5f-\\u1f7d\\u1f80-\\u1fb4\\u1fb6-\\u1fbc\\u1fbe\\u1fc2-\\u1fc4\\u1fc6-\\u1fcc\\u1fd0-\\u1fd3\\u1fd6-\\u1fdb\\u1fe0-\\u1fec\\u1ff2-\\u1ff4\\u1ff6-\\u1ffc\\u203f-\\u2040\\u2054\\u2071\\u207f\\u2090-\\u209c\\u20d0-\\u20dc\\u20e1\\u20e5-\\u20f0\\u2102\\u2107\\u210a-\\u2113\\u2115\\u2118-\\u211d\\u2124\\u2126\\u2128\\u212a-\\u2139\\u213c-\\u213f\\u2145-\\u2149\\u214e\\u2160-\\u2188\\u2c00-\\u2c2e\\u2c30-\\u2c5e\\u2c60-\\u2ce4\\u2ceb-\\u2cf3\\u2d00-\\u2d25\\u2d27\\u2d2d\\u2d30-\\u2d67\\u2d6f\\u2d7f-\\u2d96\\u2da0-\\u2da6\\u2da8-\\u2dae\\u2db0-\\u2db6\\u2db8-\\u2dbe\\u2dc0-\\u2dc6\\u2dc8-\\u2dce\\u2dd0-\\u2dd6\\u2dd8-\\u2dde\\u2de0-\\u2dff\\u3005-\\u3007\\u3021-\\u302f\\u3031-\\u3035\\u3038-\\u303c\\u3041-\\u3096\\u3099-\\u309a\\u309d-\\u309f\\u30a1-\\u30fa\\u30fc-\\u30ff\\u3105-\\u312f\\u3131-\\u318e\\u31a0-\\u31ba\\u31f0-\\u31ff\\u3400-\\u4db5\\u4e00-\\u9fef\\ua000-\\ua48c\\ua4d0-\\ua4fd\\ua500-\\ua60c\\ua610-\\ua62b\\ua640-\\ua66f\\ua674-\\ua67d\\ua67f-\\ua6f1\\ua717-\\ua71f\\ua722-\\ua788\\ua78b-\\ua7b9\\ua7f7-\\ua827\\ua840-\\ua873\\ua880-\\ua8c5\\ua8d0-\\ua8d9\\ua8e0-\\ua8f7\\ua8fb\\ua8fd-\\ua92d\\ua930-\\ua953\\ua960-\\ua97c\\ua980-\\ua9c0\\ua9cf-\\ua9d9\\ua9e0-\\ua9fe\\uaa00-\\uaa36\\uaa40-\\uaa4d\\uaa50-\\uaa59\\uaa60-\\uaa76\\uaa7a-\\uaac2\\uaadb-\\uaadd\\uaae0-\\uaaef\\uaaf2-\\uaaf6\\uab01-\\uab06\\uab09-\\uab0e\\uab11-\\uab16\\uab20-\\uab26\\uab28-\\uab2e\\uab30-\\uab5a\\uab5c-\\uab65\\uab70-\\uabea\\uabec-\\uabed\\uabf0-\\uabf9\\uac00-\\ud7a3\\ud7b0-\\ud7c6\\ud7cb-\\ud7fb\\uf900-\\ufa6d\\ufa70-\\ufad9\\ufb00-\\ufb06\\ufb13-\\ufb17\\ufb1d-\\ufb28\\ufb2a-\\ufb36\\ufb38-\\ufb3c\\ufb3e\\ufb40-\\ufb41\\ufb43-\\ufb44\\ufb46-\\ufbb1\\ufbd3-\\ufc5d\\ufc64-\\ufd3d\\ufd50-\\ufd8f\\ufd92-\\ufdc7\\ufdf0-\\ufdf9\\ufe00-\\ufe0f\\ufe20-\\ufe2f\\ufe33-\\ufe34\\ufe4d-\\ufe4f\\ufe71\\ufe73\\ufe77\\ufe79\\ufe7b\\ufe7d\\ufe7f-\\ufefc\\uff10-\\uff19\\uff21-\\uff3a\\uff3f\\uff41-\\uff5a\\uff66-\\uffbe\\uffc2-\\uffc7\\uffca-\\uffcf\\uffd2-\\uffd7\\uffda-\\uffdc\\U00010000-\\U0001000b\\U0001000d-\\U00010026\\U00010028-\\U0001003a\\U0001003c-\\U0001003d\\U0001003f-\\U0001004d\\U00010050-\\U0001005d\\U00010080-\\U000100fa\\U00010140-\\U00010174\\U000101fd\\U00010280-\\U0001029c\\U000102a0-\\U000102d0\\U000102e0\\U00010300-\\U0001031f\\U0001032d-\\U0001034a\\U00010350-\\U0001037a\\U00010380-\\U0001039d\\U000103a0-\\U000103c3\\U000103c8-\\U000103cf\\U000103d1-\\U000103d5\\U00010400-\\U0001049d\\U000104a0-\\U000104a9\\U000104b0-\\U000104d3\\U000104d8-\\U000104fb\\U00010500-\\U00010527\\U00010530-\\U00010563\\U00010600-\\U00010736\\U00010740-\\U00010755\\U00010760-\\U00010767\\U00010800-\\U00010805\\U00010808\\U0001080a-\\U00010835\\U00010837-\\U00010838\\U0001083c\\U0001083f-\\U00010855\\U00010860-\\U00010876\\U00010880-\\U0001089e\\U000108e0-\\U000108f2\\U000108f4-\\U000108f5\\U00010900-\\U00010915\\U00010920-\\U00010939\\U00010980-\\U000109b7\\U000109be-\\U000109bf\\U00010a00-\\U00010a03\\U00010a05-\\U00010a06\\U00010a0c-\\U00010a13\\U00010a15-\\U00010a17\\U00010a19-\\U00010a35\\U00010a38-\\U00010a3a\\U00010a3f\\U00010a60-\\U00010a7c\\U00010a80-\\U00010a9c\\U00010ac0-\\U00010ac7\\U00010ac9-\\U00010ae6\\U00010b00-\\U00010b35\\U00010b40-\\U00010b55\\U00010b60-\\U00010b72\\U00010b80-\\U00010b91\\U00010c00-\\U00010c48\\U00010c80-\\U00010cb2\\U00010cc0-\\U00010cf2\\U00010d00-\\U00010d27\\U00010d30-\\U00010d39\\U00010f00-\\U00010f1c\\U00010f27\\U00010f30-\\U00010f50\\U00011000-\\U00011046\\U00011066-\\U0001106f\\U0001107f-\\U000110ba\\U000110d0-\\U000110e8\\U000110f0-\\U000110f9\\U00011100-\\U00011134\\U00011136-\\U0001113f\\U00011144-\\U00011146\\U00011150-\\U00011173\\U00011176\\U00011180-\\U000111c4\\U000111c9-\\U000111cc\\U000111d0-\\U000111da\\U000111dc\\U00011200-\\U00011211\\U00011213-\\U00011237\\U0001123e\\U00011280-\\U00011286\\U00011288\\U0001128a-\\U0001128d\\U0001128f-\\U0001129d\\U0001129f-\\U000112a8\\U000112b0-\\U000112ea\\U000112f0-\\U000112f9\\U00011300-\\U00011303\\U00011305-\\U0001130c\\U0001130f-\\U00011310\\U00011313-\\U00011328\\U0001132a-\\U00011330\\U00011332-\\U00011333\\U00011335-\\U00011339\\U0001133b-\\U00011344\\U00011347-\\U00011348\\U0001134b-\\U0001134d\\U00011350\\U00011357\\U0001135d-\\U00011363\\U00011366-\\U0001136c\\U00011370-\\U00011374\\U00011400-\\U0001144a\\U00011450-\\U00011459\\U0001145e\\U00011480-\\U000114c5\\U000114c7\\U000114d0-\\U000114d9\\U00011580-\\U000115b5\\U000115b8-\\U000115c0\\U000115d8-\\U000115dd\\U00011600-\\U00011640\\U00011644\\U00011650-\\U00011659\\U00011680-\\U000116b7\\U000116c0-\\U000116c9\\U00011700-\\U0001171a\\U0001171d-\\U0001172b\\U00011730-\\U00011739\\U00011800-\\U0001183a\\U000118a0-\\U000118e9\\U000118ff\\U00011a00-\\U00011a3e\\U00011a47\\U00011a50-\\U00011a83\\U00011a86-\\U00011a99\\U00011a9d\\U00011ac0-\\U00011af8\\U00011c00-\\U00011c08\\U00011c0a-\\U00011c36\\U00011c38-\\U00011c40\\U00011c50-\\U00011c59\\U00011c72-\\U00011c8f\\U00011c92-\\U00011ca7\\U00011ca9-\\U00011cb6\\U00011d00-\\U00011d06\\U00011d08-\\U00011d09\\U00011d0b-\\U00011d36\\U00011d3a\\U00011d3c-\\U00011d3d\\U00011d3f-\\U00011d47\\U00011d50-\\U00011d59\\U00011d60-\\U00011d65\\U00011d67-\\U00011d68\\U00011d6a-\\U00011d8e\\U00011d90-\\U00011d91\\U00011d93-\\U00011d98\\U00011da0-\\U00011da9\\U00011ee0-\\U00011ef6\\U00012000-\\U00012399\\U00012400-\\U0001246e\\U00012480-\\U00012543\\U00013000-\\U0001342e\\U00014400-\\U00014646\\U00016800-\\U00016a38\\U00016a40-\\U00016a5e\\U00016a60-\\U00016a69\\U00016ad0-\\U00016aed\\U00016af0-\\U00016af4\\U00016b00-\\U00016b36\\U00016b40-\\U00016b43\\U00016b50-\\U00016b59\\U00016b63-\\U00016b77\\U00016b7d-\\U00016b8f\\U00016e40-\\U00016e7f\\U00016f00-\\U00016f44\\U00016f50-\\U00016f7e\\U00016f8f-\\U00016f9f\\U00016fe0-\\U00016fe1\\U00017000-\\U000187f1\\U00018800-\\U00018af2\\U0001b000-\\U0001b11e\\U0001b170-\\U0001b2fb\\U0001bc00-\\U0001bc6a\\U0001bc70-\\U0001bc7c\\U0001bc80-\\U0001bc88\\U0001bc90-\\U0001bc99\\U0001bc9d-\\U0001bc9e\\U0001d165-\\U0001d169\\U0001d16d-\\U0001d172\\U0001d17b-\\U0001d182\\U0001d185-\\U0001d18b\\U0001d1aa-\\U0001d1ad\\U0001d242-\\U0001d244\\U0001d400-\\U0001d454\\U0001d456-\\U0001d49c\\U0001d49e-\\U0001d49f\\U0001d4a2\\U0001d4a5-\\U0001d4a6\\U0001d4a9-\\U0001d4ac\\U0001d4ae-\\U0001d4b9\\U0001d4bb\\U0001d4bd-\\U0001d4c3\\U0001d4c5-\\U0001d505\\U0001d507-\\U0001d50a\\U0001d50d-\\U0001d514\\U0001d516-\\U0001d51c\\U0001d51e-\\U0001d539\\U0001d53b-\\U0001d53e\\U0001d540-\\U0001d544\\U0001d546\\U0001d54a-\\U0001d550\\U0001d552-\\U0001d6a5\\U0001d6a8-\\U0001d6c0\\U0001d6c2-\\U0001d6da\\U0001d6dc-\\U0001d6fa\\U0001d6fc-\\U0001d714\\U0001d716-\\U0001d734\\U0001d736-\\U0001d74e\\U0001d750-\\U0001d76e\\U0001d770-\\U0001d788\\U0001d78a-\\U0001d7a8\\U0001d7aa-\\U0001d7c2\\U0001d7c4-\\U0001d7cb\\U0001d7ce-\\U0001d7ff\\U0001da00-\\U0001da36\\U0001da3b-\\U0001da6c\\U0001da75\\U0001da84\\U0001da9b-\\U0001da9f\\U0001daa1-\\U0001daaf\\U0001e000-\\U0001e006\\U0001e008-\\U0001e018\\U0001e01b-\\U0001e021\\U0001e023-\\U0001e024\\U0001e026-\\U0001e02a\\U0001e800-\\U0001e8c4\\U0001e8d0-\\U0001e8d6\\U0001e900-\\U0001e94a\\U0001e950-\\U0001e959\\U0001ee00-\\U0001ee03\\U0001ee05-\\U0001ee1f\\U0001ee21-\\U0001ee22\\U0001ee24\\U0001ee27\\U0001ee29-\\U0001ee32\\U0001ee34-\\U0001ee37\\U0001ee39\\U0001ee3b\\U0001ee42\\U0001ee47\\U0001ee49\\U0001ee4b\\U0001ee4d-\\U0001ee4f\\U0001ee51-\\U0001ee52\\U0001ee54\\U0001ee57\\U0001ee59\\U0001ee5b\\U0001ee5d\\U0001ee5f\\U0001ee61-\\U0001ee62\\U0001ee64\\U0001ee67-\\U0001ee6a\\U0001ee6c-\\U0001ee72\\U0001ee74-\\U0001ee77\\U0001ee79-\\U0001ee7c\\U0001ee7e\\U0001ee80-\\U0001ee89\\U0001ee8b-\\U0001ee9b\\U0001eea1-\\U0001eea3\\U0001eea5-\\U0001eea9\\U0001eeab-\\U0001eebb\\U00020000-\\U0002a6d6\\U0002a700-\\U0002b734\\U0002b740-\\U0002b81d\\U0002b820-\\U0002cea1\\U0002ceb0-\\U0002ebe0\\U0002f800-\\U0002fa1d\\U000e0100-\\U000e01ef'\n\nxid_start = 'A-Z_a-z\\xaa\\xb5\\xba\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\u02c1\\u02c6-\\u02d1\\u02e0-\\u02e4\\u02ec\\u02ee\\u0370-\\u0374\\u0376-\\u0377\\u037b-\\u037d\\u037f\\u0386\\u0388-\\u038a\\u038c\\u038e-\\u03a1\\u03a3-\\u03f5\\u03f7-\\u0481\\u048a-\\u052f\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05d0-\\u05ea\\u05ef-\\u05f2\\u0620-\\u064a\\u066e-\\u066f\\u0671-\\u06d3\\u06d5\\u06e5-\\u06e6\\u06ee-\\u06ef\\u06fa-\\u06fc\\u06ff\\u0710\\u0712-\\u072f\\u074d-\\u07a5\\u07b1\\u07ca-\\u07ea\\u07f4-\\u07f5\\u07fa\\u0800-\\u0815\\u081a\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086a\\u08a0-\\u08b4\\u08b6-\\u08bd\\u0904-\\u0939\\u093d\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098c\\u098f-\\u0990\\u0993-\\u09a8\\u09aa-\\u09b0\\u09b2\\u09b6-\\u09b9\\u09bd\\u09ce\\u09dc-\\u09dd\\u09df-\\u09e1\\u09f0-\\u09f1\\u09fc\\u0a05-\\u0a0a\\u0a0f-\\u0a10\\u0a13-\\u0a28\\u0a2a-\\u0a30\\u0a32-\\u0a33\\u0a35-\\u0a36\\u0a38-\\u0a39\\u0a59-\\u0a5c\\u0a5e\\u0a72-\\u0a74\\u0a85-\\u0a8d\\u0a8f-\\u0a91\\u0a93-\\u0aa8\\u0aaa-\\u0ab0\\u0ab2-\\u0ab3\\u0ab5-\\u0ab9\\u0abd\\u0ad0\\u0ae0-\\u0ae1\\u0af9\\u0b05-\\u0b0c\\u0b0f-\\u0b10\\u0b13-\\u0b28\\u0b2a-\\u0b30\\u0b32-\\u0b33\\u0b35-\\u0b39\\u0b3d\\u0b5c-\\u0b5d\\u0b5f-\\u0b61\\u0b71\\u0b83\\u0b85-\\u0b8a\\u0b8e-\\u0b90\\u0b92-\\u0b95\\u0b99-\\u0b9a\\u0b9c\\u0b9e-\\u0b9f\\u0ba3-\\u0ba4\\u0ba8-\\u0baa\\u0bae-\\u0bb9\\u0bd0\\u0c05-\\u0c0c\\u0c0e-\\u0c10\\u0c12-\\u0c28\\u0c2a-\\u0c39\\u0c3d\\u0c58-\\u0c5a\\u0c60-\\u0c61\\u0c80\\u0c85-\\u0c8c\\u0c8e-\\u0c90\\u0c92-\\u0ca8\\u0caa-\\u0cb3\\u0cb5-\\u0cb9\\u0cbd\\u0cde\\u0ce0-\\u0ce1\\u0cf1-\\u0cf2\\u0d05-\\u0d0c\\u0d0e-\\u0d10\\u0d12-\\u0d3a\\u0d3d\\u0d4e\\u0d54-\\u0d56\\u0d5f-\\u0d61\\u0d7a-\\u0d7f\\u0d85-\\u0d96\\u0d9a-\\u0db1\\u0db3-\\u0dbb\\u0dbd\\u0dc0-\\u0dc6\\u0e01-\\u0e30\\u0e32\\u0e40-\\u0e46\\u0e81-\\u0e82\\u0e84\\u0e87-\\u0e88\\u0e8a\\u0e8d\\u0e94-\\u0e97\\u0e99-\\u0e9f\\u0ea1-\\u0ea3\\u0ea5\\u0ea7\\u0eaa-\\u0eab\\u0ead-\\u0eb0\\u0eb2\\u0ebd\\u0ec0-\\u0ec4\\u0ec6\\u0edc-\\u0edf\\u0f00\\u0f40-\\u0f47\\u0f49-\\u0f6c\\u0f88-\\u0f8c\\u1000-\\u102a\\u103f\\u1050-\\u1055\\u105a-\\u105d\\u1061\\u1065-\\u1066\\u106e-\\u1070\\u1075-\\u1081\\u108e\\u10a0-\\u10c5\\u10c7\\u10cd\\u10d0-\\u10fa\\u10fc-\\u1248\\u124a-\\u124d\\u1250-\\u1256\\u1258\\u125a-\\u125d\\u1260-\\u1288\\u128a-\\u128d\\u1290-\\u12b0\\u12b2-\\u12b5\\u12b8-\\u12be\\u12c0\\u12c2-\\u12c5\\u12c8-\\u12d6\\u12d8-\\u1310\\u1312-\\u1315\\u1318-\\u135a\\u1380-\\u138f\\u13a0-\\u13f5\\u13f8-\\u13fd\\u1401-\\u166c\\u166f-\\u167f\\u1681-\\u169a\\u16a0-\\u16ea\\u16ee-\\u16f8\\u1700-\\u170c\\u170e-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176c\\u176e-\\u1770\\u1780-\\u17b3\\u17d7\\u17dc\\u1820-\\u1878\\u1880-\\u18a8\\u18aa\\u18b0-\\u18f5\\u1900-\\u191e\\u1950-\\u196d\\u1970-\\u1974\\u1980-\\u19ab\\u19b0-\\u19c9\\u1a00-\\u1a16\\u1a20-\\u1a54\\u1aa7\\u1b05-\\u1b33\\u1b45-\\u1b4b\\u1b83-\\u1ba0\\u1bae-\\u1baf\\u1bba-\\u1be5\\u1c00-\\u1c23\\u1c4d-\\u1c4f\\u1c5a-\\u1c7d\\u1c80-\\u1c88\\u1c90-\\u1cba\\u1cbd-\\u1cbf\\u1ce9-\\u1cec\\u1cee-\\u1cf1\\u1cf5-\\u1cf6\\u1d00-\\u1dbf\\u1e00-\\u1f15\\u1f18-\\u1f1d\\u1f20-\\u1f45\\u1f48-\\u1f4d\\u1f50-\\u1f57\\u1f59\\u1f5b\\u1f5d\\u1f5f-\\u1f7d\\u1f80-\\u1fb4\\u1fb6-\\u1fbc\\u1fbe\\u1fc2-\\u1fc4\\u1fc6-\\u1fcc\\u1fd0-\\u1fd3\\u1fd6-\\u1fdb\\u1fe0-\\u1fec\\u1ff2-\\u1ff4\\u1ff6-\\u1ffc\\u2071\\u207f\\u2090-\\u209c\\u2102\\u2107\\u210a-\\u2113\\u2115\\u2118-\\u211d\\u2124\\u2126\\u2128\\u212a-\\u2139\\u213c-\\u213f\\u2145-\\u2149\\u214e\\u2160-\\u2188\\u2c00-\\u2c2e\\u2c30-\\u2c5e\\u2c60-\\u2ce4\\u2ceb-\\u2cee\\u2cf2-\\u2cf3\\u2d00-\\u2d25\\u2d27\\u2d2d\\u2d30-\\u2d67\\u2d6f\\u2d80-\\u2d96\\u2da0-\\u2da6\\u2da8-\\u2dae\\u2db0-\\u2db6\\u2db8-\\u2dbe\\u2dc0-\\u2dc6\\u2dc8-\\u2dce\\u2dd0-\\u2dd6\\u2dd8-\\u2dde\\u3005-\\u3007\\u3021-\\u3029\\u3031-\\u3035\\u3038-\\u303c\\u3041-\\u3096\\u309d-\\u309f\\u30a1-\\u30fa\\u30fc-\\u30ff\\u3105-\\u312f\\u3131-\\u318e\\u31a0-\\u31ba\\u31f0-\\u31ff\\u3400-\\u4db5\\u4e00-\\u9fef\\ua000-\\ua48c\\ua4d0-\\ua4fd\\ua500-\\ua60c\\ua610-\\ua61f\\ua62a-\\ua62b\\ua640-\\ua66e\\ua67f-\\ua69d\\ua6a0-\\ua6ef\\ua717-\\ua71f\\ua722-\\ua788\\ua78b-\\ua7b9\\ua7f7-\\ua801\\ua803-\\ua805\\ua807-\\ua80a\\ua80c-\\ua822\\ua840-\\ua873\\ua882-\\ua8b3\\ua8f2-\\ua8f7\\ua8fb\\ua8fd-\\ua8fe\\ua90a-\\ua925\\ua930-\\ua946\\ua960-\\ua97c\\ua984-\\ua9b2\\ua9cf\\ua9e0-\\ua9e4\\ua9e6-\\ua9ef\\ua9fa-\\ua9fe\\uaa00-\\uaa28\\uaa40-\\uaa42\\uaa44-\\uaa4b\\uaa60-\\uaa76\\uaa7a\\uaa7e-\\uaaaf\\uaab1\\uaab5-\\uaab6\\uaab9-\\uaabd\\uaac0\\uaac2\\uaadb-\\uaadd\\uaae0-\\uaaea\\uaaf2-\\uaaf4\\uab01-\\uab06\\uab09-\\uab0e\\uab11-\\uab16\\uab20-\\uab26\\uab28-\\uab2e\\uab30-\\uab5a\\uab5c-\\uab65\\uab70-\\uabe2\\uac00-\\ud7a3\\ud7b0-\\ud7c6\\ud7cb-\\ud7fb\\uf900-\\ufa6d\\ufa70-\\ufad9\\ufb00-\\ufb06\\ufb13-\\ufb17\\ufb1d\\ufb1f-\\ufb28\\ufb2a-\\ufb36\\ufb38-\\ufb3c\\ufb3e\\ufb40-\\ufb41\\ufb43-\\ufb44\\ufb46-\\ufbb1\\ufbd3-\\ufc5d\\ufc64-\\ufd3d\\ufd50-\\ufd8f\\ufd92-\\ufdc7\\ufdf0-\\ufdf9\\ufe71\\ufe73\\ufe77\\ufe79\\ufe7b\\ufe7d\\ufe7f-\\ufefc\\uff21-\\uff3a\\uff41-\\uff5a\\uff66-\\uff9d\\uffa0-\\uffbe\\uffc2-\\uffc7\\uffca-\\uffcf\\uffd2-\\uffd7\\uffda-\\uffdc\\U00010000-\\U0001000b\\U0001000d-\\U00010026\\U00010028-\\U0001003a\\U0001003c-\\U0001003d\\U0001003f-\\U0001004d\\U00010050-\\U0001005d\\U00010080-\\U000100fa\\U00010140-\\U00010174\\U00010280-\\U0001029c\\U000102a0-\\U000102d0\\U00010300-\\U0001031f\\U0001032d-\\U0001034a\\U00010350-\\U00010375\\U00010380-\\U0001039d\\U000103a0-\\U000103c3\\U000103c8-\\U000103cf\\U000103d1-\\U000103d5\\U00010400-\\U0001049d\\U000104b0-\\U000104d3\\U000104d8-\\U000104fb\\U00010500-\\U00010527\\U00010530-\\U00010563\\U00010600-\\U00010736\\U00010740-\\U00010755\\U00010760-\\U00010767\\U00010800-\\U00010805\\U00010808\\U0001080a-\\U00010835\\U00010837-\\U00010838\\U0001083c\\U0001083f-\\U00010855\\U00010860-\\U00010876\\U00010880-\\U0001089e\\U000108e0-\\U000108f2\\U000108f4-\\U000108f5\\U00010900-\\U00010915\\U00010920-\\U00010939\\U00010980-\\U000109b7\\U000109be-\\U000109bf\\U00010a00\\U00010a10-\\U00010a13\\U00010a15-\\U00010a17\\U00010a19-\\U00010a35\\U00010a60-\\U00010a7c\\U00010a80-\\U00010a9c\\U00010ac0-\\U00010ac7\\U00010ac9-\\U00010ae4\\U00010b00-\\U00010b35\\U00010b40-\\U00010b55\\U00010b60-\\U00010b72\\U00010b80-\\U00010b91\\U00010c00-\\U00010c48\\U00010c80-\\U00010cb2\\U00010cc0-\\U00010cf2\\U00010d00-\\U00010d23\\U00010f00-\\U00010f1c\\U00010f27\\U00010f30-\\U00010f45\\U00011003-\\U00011037\\U00011083-\\U000110af\\U000110d0-\\U000110e8\\U00011103-\\U00011126\\U00011144\\U00011150-\\U00011172\\U00011176\\U00011183-\\U000111b2\\U000111c1-\\U000111c4\\U000111da\\U000111dc\\U00011200-\\U00011211\\U00011213-\\U0001122b\\U00011280-\\U00011286\\U00011288\\U0001128a-\\U0001128d\\U0001128f-\\U0001129d\\U0001129f-\\U000112a8\\U000112b0-\\U000112de\\U00011305-\\U0001130c\\U0001130f-\\U00011310\\U00011313-\\U00011328\\U0001132a-\\U00011330\\U00011332-\\U00011333\\U00011335-\\U00011339\\U0001133d\\U00011350\\U0001135d-\\U00011361\\U00011400-\\U00011434\\U00011447-\\U0001144a\\U00011480-\\U000114af\\U000114c4-\\U000114c5\\U000114c7\\U00011580-\\U000115ae\\U000115d8-\\U000115db\\U00011600-\\U0001162f\\U00011644\\U00011680-\\U000116aa\\U00011700-\\U0001171a\\U00011800-\\U0001182b\\U000118a0-\\U000118df\\U000118ff\\U00011a00\\U00011a0b-\\U00011a32\\U00011a3a\\U00011a50\\U00011a5c-\\U00011a83\\U00011a86-\\U00011a89\\U00011a9d\\U00011ac0-\\U00011af8\\U00011c00-\\U00011c08\\U00011c0a-\\U00011c2e\\U00011c40\\U00011c72-\\U00011c8f\\U00011d00-\\U00011d06\\U00011d08-\\U00011d09\\U00011d0b-\\U00011d30\\U00011d46\\U00011d60-\\U00011d65\\U00011d67-\\U00011d68\\U00011d6a-\\U00011d89\\U00011d98\\U00011ee0-\\U00011ef2\\U00012000-\\U00012399\\U00012400-\\U0001246e\\U00012480-\\U00012543\\U00013000-\\U0001342e\\U00014400-\\U00014646\\U00016800-\\U00016a38\\U00016a40-\\U00016a5e\\U00016ad0-\\U00016aed\\U00016b00-\\U00016b2f\\U00016b40-\\U00016b43\\U00016b63-\\U00016b77\\U00016b7d-\\U00016b8f\\U00016e40-\\U00016e7f\\U00016f00-\\U00016f44\\U00016f50\\U00016f93-\\U00016f9f\\U00016fe0-\\U00016fe1\\U00017000-\\U000187f1\\U00018800-\\U00018af2\\U0001b000-\\U0001b11e\\U0001b170-\\U0001b2fb\\U0001bc00-\\U0001bc6a\\U0001bc70-\\U0001bc7c\\U0001bc80-\\U0001bc88\\U0001bc90-\\U0001bc99\\U0001d400-\\U0001d454\\U0001d456-\\U0001d49c\\U0001d49e-\\U0001d49f\\U0001d4a2\\U0001d4a5-\\U0001d4a6\\U0001d4a9-\\U0001d4ac\\U0001d4ae-\\U0001d4b9\\U0001d4bb\\U0001d4bd-\\U0001d4c3\\U0001d4c5-\\U0001d505\\U0001d507-\\U0001d50a\\U0001d50d-\\U0001d514\\U0001d516-\\U0001d51c\\U0001d51e-\\U0001d539\\U0001d53b-\\U0001d53e\\U0001d540-\\U0001d544\\U0001d546\\U0001d54a-\\U0001d550\\U0001d552-\\U0001d6a5\\U0001d6a8-\\U0001d6c0\\U0001d6c2-\\U0001d6da\\U0001d6dc-\\U0001d6fa\\U0001d6fc-\\U0001d714\\U0001d716-\\U0001d734\\U0001d736-\\U0001d74e\\U0001d750-\\U0001d76e\\U0001d770-\\U0001d788\\U0001d78a-\\U0001d7a8\\U0001d7aa-\\U0001d7c2\\U0001d7c4-\\U0001d7cb\\U0001e800-\\U0001e8c4\\U0001e900-\\U0001e943\\U0001ee00-\\U0001ee03\\U0001ee05-\\U0001ee1f\\U0001ee21-\\U0001ee22\\U0001ee24\\U0001ee27\\U0001ee29-\\U0001ee32\\U0001ee34-\\U0001ee37\\U0001ee39\\U0001ee3b\\U0001ee42\\U0001ee47\\U0001ee49\\U0001ee4b\\U0001ee4d-\\U0001ee4f\\U0001ee51-\\U0001ee52\\U0001ee54\\U0001ee57\\U0001ee59\\U0001ee5b\\U0001ee5d\\U0001ee5f\\U0001ee61-\\U0001ee62\\U0001ee64\\U0001ee67-\\U0001ee6a\\U0001ee6c-\\U0001ee72\\U0001ee74-\\U0001ee77\\U0001ee79-\\U0001ee7c\\U0001ee7e\\U0001ee80-\\U0001ee89\\U0001ee8b-\\U0001ee9b\\U0001eea1-\\U0001eea3\\U0001eea5-\\U0001eea9\\U0001eeab-\\U0001eebb\\U00020000-\\U0002a6d6\\U0002a700-\\U0002b734\\U0002b740-\\U0002b81d\\U0002b820-\\U0002cea1\\U0002ceb0-\\U0002ebe0\\U0002f800-\\U0002fa1d'\n\ncats = ['Cc', 'Cf', 'Cn', 'Co', 'Cs', 'Ll', 'Lm', 'Lo', 'Lt', 'Lu', 'Mc', 'Me', 'Mn', 'Nd', 'Nl', 'No', 'Pc', 'Pd', 'Pe', 'Pf', 'Pi', 'Po', 'Ps', 'Sc', 'Sk', 'Sm', 'So', 'Zl', 'Zp', 'Zs']\n\n# Generated from unidata 11.0.0\n\ndef combine(*args):\n return ''.join(globals()[cat] for cat in args)\n\n\ndef allexcept(*args):\n newcats = cats[:]\n for arg in args:\n newcats.remove(arg)\n return ''.join(globals()[cat] for cat in newcats)\n\n\ndef _handle_runs(char_list): # pragma: no cover\n buf = []\n for c in char_list:\n if len(c) == 1:\n if buf and buf[-1][1] == chr(ord(c)-1):\n buf[-1] = (buf[-1][0], c)\n else:\n buf.append((c, c))\n else:\n buf.append((c, c))\n for a, b in buf:\n if a == b:\n yield a\n else:\n yield f'{a}-{b}'\n\n\nif __name__ == '__main__': # pragma: no cover\n import unicodedata\n\n categories = {'xid_start': [], 'xid_continue': []}\n\n with open(__file__, encoding='utf-8') as fp:\n content = fp.read()\n\n header = content[:content.find('Cc =')]\n footer = content[content.find(\"def combine(\"):]\n\n for code in range(0x110000):\n c = chr(code)\n cat = unicodedata.category(c)\n if ord(c) == 0xdc00:\n # Hack to avoid combining this combining with the preceding high\n # surrogate, 0xdbff, when doing a repr.\n c = '\\\\' + c\n elif ord(c) in (0x2d, 0x5b, 0x5c, 0x5d, 0x5e):\n # Escape regex metachars.\n c = '\\\\' + c\n categories.setdefault(cat, []).append(c)\n # XID_START and XID_CONTINUE are special categories used for matching\n # identifiers in Python 3.\n if c.isidentifier():\n categories['xid_start'].append(c)\n if ('a' + c).isidentifier():\n categories['xid_continue'].append(c)\n\n with open(__file__, 'w', encoding='utf-8') as fp:\n fp.write(header)\n\n for cat in sorted(categories):\n val = ''.join(_handle_runs(categories[cat]))\n fp.write(f'{cat} = {val!a}\\n\\n')\n\n cats = sorted(categories)\n cats.remove('xid_start')\n cats.remove('xid_continue')\n fp.write(f'cats = {cats!r}\\n\\n')\n\n fp.write(f'# Generated from unidata {unicodedata.unidata_version}\\n\\n')\n\n fp.write(footer)\n",[],[216,809,810,811,890,891,1469,1471],"08b70238-67fc-11f0-805e-0224a6c84d84","token.py","08b70314-67fc-11f0-805e-0224a6c84d84",314,["D",1753299262386],"\"\"\"\n pygments.token\n ~~~~~~~~~~~~~~\n\n Basic token types and the standard tokens.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\n\nclass _TokenType(tuple):\n parent = None\n\n def split(self):\n buf = []\n node = self\n while node is not None:\n buf.append(node)\n node = node.parent\n buf.reverse()\n return buf\n\n def __init__(self, *args):\n # no need to call super.__init__\n self.subtypes = set()\n\n def __contains__(self, val):\n return self is val or (\n type(val) is self.__class__ and\n val[:len(self)] == self\n )\n\n def __getattr__(self, val):\n if not val or not val[0].isupper():\n return tuple.__getattribute__(self, val)\n new = _TokenType(self + (val,))\n setattr(self, val, new)\n self.subtypes.add(new)\n new.parent = self\n return new\n\n def __repr__(self):\n return 'Token' + (self and '.' or '') + '.'.join(self)\n\n def __copy__(self):\n # These instances are supposed to be singletons\n return self\n\n def __deepcopy__(self, memo):\n # These instances are supposed to be singletons\n return self\n\n\nToken = _TokenType()\n\n# Special token types\nText = Token.Text\nWhitespace = Text.Whitespace\nEscape = Token.Escape\nError = Token.Error\n# Text that doesn't belong to this lexer (e.g. HTML in PHP)\nOther = Token.Other\n\n# Common token types for source code\nKeyword = Token.Keyword\nName = Token.Name\nLiteral = Token.Literal\nString = Literal.String\nNumber = Literal.Number\nPunctuation = Token.Punctuation\nOperator = Token.Operator\nComment = Token.Comment\n\n# Generic types for non-source code\nGeneric = Token.Generic\n\n# String and some others are not direct children of Token.\n# alias them:\nToken.Token = Token\nToken.String = String\nToken.Number = Number\n\n\ndef is_token_subtype(ttype, other):\n \"\"\"\n Return True if ``ttype`` is a subtype of ``other``.\n\n exists for backwards compatibility. use ``ttype in other`` now.\n \"\"\"\n return ttype in other\n\n\ndef string_to_tokentype(s):\n \"\"\"\n Convert a string into a token type::\n\n >>> string_to_token('String.Double')\n Token.Literal.String.Double\n >>> string_to_token('Token.Literal.Number')\n Token.Literal.Number\n >>> string_to_token('')\n Token\n\n Tokens that are already tokens are returned unchanged:\n\n >>> string_to_token(String)\n Token.Literal.String\n \"\"\"\n if isinstance(s, _TokenType):\n return s\n if not s:\n return Token\n node = Token\n for item in s.split('.'):\n node = getattr(node, item)\n return node\n\n\n# Map standard token types to short names, used in CSS class naming.\n# If you add a new item, please be sure to run this file to perform\n# a consistency check for duplicate values.\nSTANDARD_TYPES = {\n Token: '',\n\n Text: '',\n Whitespace: 'w',\n Escape: 'esc',\n Error: 'err',\n Other: 'x',\n\n Keyword: 'k',\n Keyword.Constant: 'kc',\n Keyword.Declaration: 'kd',\n Keyword.Namespace: 'kn',\n Keyword.Pseudo: 'kp',\n Keyword.Reserved: 'kr',\n Keyword.Type: 'kt',\n\n Name: 'n',\n Name.Attribute: 'na',\n Name.Builtin: 'nb',\n Name.Builtin.Pseudo: 'bp',\n Name.Class: 'nc',\n Name.Constant: 'no',\n Name.Decorator: 'nd',\n Name.Entity: 'ni',\n Name.Exception: 'ne',\n Name.Function: 'nf',\n Name.Function.Magic: 'fm',\n Name.Property: 'py',\n Name.Label: 'nl',\n Name.Namespace: 'nn',\n Name.Other: 'nx',\n Name.Tag: 'nt',\n Name.Variable: 'nv',\n Name.Variable.Class: 'vc',\n Name.Variable.Global: 'vg',\n Name.Variable.Instance: 'vi',\n Name.Variable.Magic: 'vm',\n\n Literal: 'l',\n Literal.Date: 'ld',\n\n String: 's',\n String.Affix: 'sa',\n String.Backtick: 'sb',\n String.Char: 'sc',\n String.Delimiter: 'dl',\n String.Doc: 'sd',\n String.Double: 's2',\n String.Escape: 'se',\n String.Heredoc: 'sh',\n String.Interpol: 'si',\n String.Other: 'sx',\n String.Regex: 'sr',\n String.Single: 's1',\n String.Symbol: 'ss',\n\n Number: 'm',\n Number.Bin: 'mb',\n Number.Float: 'mf',\n Number.Hex: 'mh',\n Number.Integer: 'mi',\n Number.Integer.Long: 'il',\n Number.Oct: 'mo',\n\n Operator: 'o',\n Operator.Word: 'ow',\n\n Punctuation: 'p',\n Punctuation.Marker: 'pm',\n\n Comment: 'c',\n Comment.Hashbang: 'ch',\n Comment.Multiline: 'cm',\n Comment.Preproc: 'cp',\n Comment.PreprocFile: 'cpf',\n Comment.Single: 'c1',\n Comment.Special: 'cs',\n\n Generic: 'g',\n Generic.Deleted: 'gd',\n Generic.Emph: 'ge',\n Generic.Error: 'gr',\n Generic.Heading: 'gh',\n Generic.Inserted: 'gi',\n Generic.Output: 'go',\n Generic.Prompt: 'gp',\n Generic.Strong: 'gs',\n Generic.Subheading: 'gu',\n Generic.EmphStrong: 'ges',\n Generic.Traceback: 'gt',\n}\n",[],[216,809,810,811,890,891,1469,1479],"08c32284-67fc-11f0-aedf-0224a6c84d84","08c32324-67fc-11f0-aedf-0224a6c84d84",316,["D",1753299262409],"\"\"\"\n pygments.style\n ~~~~~~~~~~~~~~\n\n Basic style object.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nfrom pip._vendor.pygments.token import Token, STANDARD_TYPES\n\n# Default mapping of ansixxx to RGB colors.\n_ansimap = {\n # dark\n 'ansiblack': '000000',\n 'ansired': '7f0000',\n 'ansigreen': '007f00',\n 'ansiyellow': '7f7fe0',\n 'ansiblue': '00007f',\n 'ansimagenta': '7f007f',\n 'ansicyan': '007f7f',\n 'ansigray': 'e5e5e5',\n # normal\n 'ansibrightblack': '555555',\n 'ansibrightred': 'ff0000',\n 'ansibrightgreen': '00ff00',\n 'ansibrightyellow': 'ffff00',\n 'ansibrightblue': '0000ff',\n 'ansibrightmagenta': 'ff00ff',\n 'ansibrightcyan': '00ffff',\n 'ansiwhite': 'ffffff',\n}\n# mapping of deprecated #ansixxx colors to new color names\n_deprecated_ansicolors = {\n # dark\n '#ansiblack': 'ansiblack',\n '#ansidarkred': 'ansired',\n '#ansidarkgreen': 'ansigreen',\n '#ansibrown': 'ansiyellow',\n '#ansidarkblue': 'ansiblue',\n '#ansipurple': 'ansimagenta',\n '#ansiteal': 'ansicyan',\n '#ansilightgray': 'ansigray',\n # normal\n '#ansidarkgray': 'ansibrightblack',\n '#ansired': 'ansibrightred',\n '#ansigreen': 'ansibrightgreen',\n '#ansiyellow': 'ansibrightyellow',\n '#ansiblue': 'ansibrightblue',\n '#ansifuchsia': 'ansibrightmagenta',\n '#ansiturquoise': 'ansibrightcyan',\n '#ansiwhite': 'ansiwhite',\n}\nansicolors = set(_ansimap)\n\n\nclass StyleMeta(type):\n\n def __new__(mcs, name, bases, dct):\n obj = type.__new__(mcs, name, bases, dct)\n for token in STANDARD_TYPES:\n if token not in obj.styles:\n obj.styles[token] = ''\n\n def colorformat(text):\n if text in ansicolors:\n return text\n if text[0:1] == '#':\n col = text[1:]\n if len(col) == 6:\n return col\n elif len(col) == 3:\n return col[0] * 2 + col[1] * 2 + col[2] * 2\n elif text == '':\n return ''\n elif text.startswith('var') or text.startswith('calc'):\n return text\n assert False, f\"wrong color format {text!r}\"\n\n _styles = obj._styles = {}\n\n for ttype in obj.styles:\n for token in ttype.split():\n if token in _styles:\n continue\n ndef = _styles.get(token.parent, None)\n styledefs = obj.styles.get(token, '').split()\n if not ndef or token is None:\n ndef = ['', 0, 0, 0, '', '', 0, 0, 0]\n elif 'noinherit' in styledefs and token is not Token:\n ndef = _styles[Token][:]\n else:\n ndef = ndef[:]\n _styles[token] = ndef\n for styledef in obj.styles.get(token, '').split():\n if styledef == 'noinherit':\n pass\n elif styledef == 'bold':\n ndef[1] = 1\n elif styledef == 'nobold':\n ndef[1] = 0\n elif styledef == 'italic':\n ndef[2] = 1\n elif styledef == 'noitalic':\n ndef[2] = 0\n elif styledef == 'underline':\n ndef[3] = 1\n elif styledef == 'nounderline':\n ndef[3] = 0\n elif styledef[:3] == 'bg:':\n ndef[4] = colorformat(styledef[3:])\n elif styledef[:7] == 'border:':\n ndef[5] = colorformat(styledef[7:])\n elif styledef == 'roman':\n ndef[6] = 1\n elif styledef == 'sans':\n ndef[7] = 1\n elif styledef == 'mono':\n ndef[8] = 1\n else:\n ndef[0] = colorformat(styledef)\n\n return obj\n\n def style_for_token(cls, token):\n t = cls._styles[token]\n ansicolor = bgansicolor = None\n color = t[0]\n if color in _deprecated_ansicolors:\n color = _deprecated_ansicolors[color]\n if color in ansicolors:\n ansicolor = color\n color = _ansimap[color]\n bgcolor = t[4]\n if bgcolor in _deprecated_ansicolors:\n bgcolor = _deprecated_ansicolors[bgcolor]\n if bgcolor in ansicolors:\n bgansicolor = bgcolor\n bgcolor = _ansimap[bgcolor]\n\n return {\n 'color': color or None,\n 'bold': bool(t[1]),\n 'italic': bool(t[2]),\n 'underline': bool(t[3]),\n 'bgcolor': bgcolor or None,\n 'border': t[5] or None,\n 'roman': bool(t[6]) or None,\n 'sans': bool(t[7]) or None,\n 'mono': bool(t[8]) or None,\n 'ansicolor': ansicolor,\n 'bgansicolor': bgansicolor,\n }\n\n def list_styles(cls):\n return list(cls)\n\n def styles_token(cls, ttype):\n return ttype in cls._styles\n\n def __iter__(cls):\n for token in cls._styles:\n yield token, cls.style_for_token(token)\n\n def __len__(cls):\n return len(cls._styles)\n\n\nclass Style(metaclass=StyleMeta):\n\n #: overall background color (``None`` means transparent)\n background_color = '#ffffff'\n\n #: highlight background color\n highlight_color = '#ffffcc'\n\n #: line number font color\n line_number_color = 'inherit'\n\n #: line number background color\n line_number_background_color = 'transparent'\n\n #: special line number font color\n line_number_special_color = '#000000'\n\n #: special line number background color\n line_number_special_background_color = '#ffffc0'\n\n #: Style definitions for individual token types.\n styles = {}\n\n #: user-friendly style name (used when selecting the style, so this\n # should be all-lowercase, no spaces, hyphens)\n name = 'unnamed'\n\n aliases = []\n\n # Attribute for lexers defined within Pygments. If set\n # to True, the style is not shown in the style gallery\n # on the website. This is intended for language-specific\n # styles.\n web_style_gallery_exclude = False\n",[],[216,809,810,811,890,891,1469,1084],"08d86e32-67fc-11f0-96d6-0224a6c84d84","sphinxext.py","08d86f18-67fc-11f0-96d6-0224a6c84d84",318,["D",1753299262621],"\"\"\"\n pygments.sphinxext\n ~~~~~~~~~~~~~~~~~~\n\n Sphinx extension to generate automatic documentation of lexers,\n formatters and filters.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport sys\n\nfrom docutils import nodes\nfrom docutils.statemachine import ViewList\nfrom docutils.parsers.rst import Directive\nfrom sphinx.util.nodes import nested_parse_with_titles\n\n\nMODULEDOC = '''\n.. module:: %s\n\n%s\n%s\n'''\n\nLEXERDOC = '''\n.. class:: %s\n\n :Short names: %s\n :Filenames: %s\n :MIME types: %s\n\n %s\n\n %s\n\n'''\n\nFMTERDOC = '''\n.. class:: %s\n\n :Short names: %s\n :Filenames: %s\n\n %s\n\n'''\n\nFILTERDOC = '''\n.. class:: %s\n\n :Name: %s\n\n %s\n\n'''\n\n\nclass PygmentsDoc(Directive):\n \"\"\"\n A directive to collect all lexers/formatters/filters and generate\n autoclass directives for them.\n \"\"\"\n has_content = False\n required_arguments = 1\n optional_arguments = 0\n final_argument_whitespace = False\n option_spec = {}\n\n def run(self):\n self.filenames = set()\n if self.arguments[0] == 'lexers':\n out = self.document_lexers()\n elif self.arguments[0] == 'formatters':\n out = self.document_formatters()\n elif self.arguments[0] == 'filters':\n out = self.document_filters()\n elif self.arguments[0] == 'lexers_overview':\n out = self.document_lexers_overview()\n else:\n raise Exception('invalid argument for \"pygmentsdoc\" directive')\n node = nodes.compound()\n vl = ViewList(out.split('\\n'), source='')\n nested_parse_with_titles(self.state, vl, node)\n for fn in self.filenames:\n self.state.document.settings.record_dependencies.add(fn)\n return node.children\n\n def document_lexers_overview(self):\n \"\"\"Generate a tabular overview of all lexers.\n\n The columns are the lexer name, the extensions handled by this lexer\n (or \"None\"), the aliases and a link to the lexer class.\"\"\"\n from pip._vendor.pygments.lexers._mapping import LEXERS\n from pip._vendor.pygments.lexers import find_lexer_class\n out = []\n\n table = []\n\n def format_link(name, url):\n if url:\n return f'`{name} <{url}>`_'\n return name\n\n for classname, data in sorted(LEXERS.items(), key=lambda x: x[1][1].lower()):\n lexer_cls = find_lexer_class(data[1])\n extensions = lexer_cls.filenames + lexer_cls.alias_filenames\n\n table.append({\n 'name': format_link(data[1], lexer_cls.url),\n 'extensions': ', '.join(extensions).replace('*', '\\\\*').replace('_', '\\\\') or 'None',\n 'aliases': ', '.join(data[2]),\n 'class': f'{data[0]}.{classname}'\n })\n\n column_names = ['name', 'extensions', 'aliases', 'class']\n column_lengths = [max([len(row[column]) for row in table if row[column]])\n for column in column_names]\n\n def write_row(*columns):\n \"\"\"Format a table row\"\"\"\n out = []\n for length, col in zip(column_lengths, columns):\n if col:\n out.append(col.ljust(length))\n else:\n out.append(' '*length)\n\n return ' '.join(out)\n\n def write_seperator():\n \"\"\"Write a table separator row\"\"\"\n sep = ['='*c for c in column_lengths]\n return write_row(*sep)\n\n out.append(write_seperator())\n out.append(write_row('Name', 'Extension(s)', 'Short name(s)', 'Lexer class'))\n out.append(write_seperator())\n for row in table:\n out.append(write_row(\n row['name'],\n row['extensions'],\n row['aliases'],\n f':class:`~{row[\"class\"]}`'))\n out.append(write_seperator())\n\n return '\\n'.join(out)\n\n def document_lexers(self):\n from pip._vendor.pygments.lexers._mapping import LEXERS\n from pip._vendor import pygments\n import inspect\n import pathlib\n\n out = []\n modules = {}\n moduledocstrings = {}\n for classname, data in sorted(LEXERS.items(), key=lambda x: x[0]):\n module = data[0]\n mod = __import__(module, None, None, [classname])\n self.filenames.add(mod.__file__)\n cls = getattr(mod, classname)\n if not cls.__doc__:\n print(f\"Warning: {classname} does not have a docstring.\")\n docstring = cls.__doc__\n if isinstance(docstring, bytes):\n docstring = docstring.decode('utf8')\n\n example_file = getattr(cls, '_example', None)\n if example_file:\n p = pathlib.Path(inspect.getabsfile(pygments)).parent.parent /\\\n 'tests' / 'examplefiles' / example_file\n content = p.read_text(encoding='utf-8')\n if not content:\n raise Exception(\n f\"Empty example file '{example_file}' for lexer \"\n f\"{classname}\")\n\n if data[2]:\n lexer_name = data[2][0]\n docstring += '\\n\\n .. admonition:: Example\\n'\n docstring += f'\\n .. code-block:: {lexer_name}\\n\\n'\n for line in content.splitlines():\n docstring += f' {line}\\n'\n\n if cls.version_added:\n version_line = f'.. versionadded:: {cls.version_added}'\n else:\n version_line = ''\n\n modules.setdefault(module, []).append((\n classname,\n ', '.join(data[2]) or 'None',\n ', '.join(data[3]).replace('*', '\\\\*').replace('_', '\\\\') or 'None',\n ', '.join(data[4]) or 'None',\n docstring,\n version_line))\n if module not in moduledocstrings:\n moddoc = mod.__doc__\n if isinstance(moddoc, bytes):\n moddoc = moddoc.decode('utf8')\n moduledocstrings[module] = moddoc\n\n for module, lexers in sorted(modules.items(), key=lambda x: x[0]):\n if moduledocstrings[module] is None:\n raise Exception(f\"Missing docstring for {module}\")\n heading = moduledocstrings[module].splitlines()[4].strip().rstrip('.')\n out.append(MODULEDOC % (module, heading, '-'*len(heading)))\n for data in lexers:\n out.append(LEXERDOC % data)\n\n return ''.join(out)\n\n def document_formatters(self):\n from pip._vendor.pygments.formatters import FORMATTERS\n\n out = []\n for classname, data in sorted(FORMATTERS.items(), key=lambda x: x[0]):\n module = data[0]\n mod = __import__(module, None, None, [classname])\n self.filenames.add(mod.__file__)\n cls = getattr(mod, classname)\n docstring = cls.__doc__\n if isinstance(docstring, bytes):\n docstring = docstring.decode('utf8')\n heading = cls.__name__\n out.append(FMTERDOC % (heading, ', '.join(data[2]) or 'None',\n ', '.join(data[3]).replace('*', '\\\\*') or 'None',\n docstring))\n return ''.join(out)\n\n def document_filters(self):\n from pip._vendor.pygments.filters import FILTERS\n\n out = []\n for name, cls in FILTERS.items():\n self.filenames.add(sys.modules[cls.__module__].__file__)\n docstring = cls.__doc__\n if isinstance(docstring, bytes):\n docstring = docstring.decode('utf8')\n out.append(FILTERDOC % (cls.__name__, name, docstring))\n return ''.join(out)\n\n\ndef setup(app):\n app.add_directive('pygmentsdoc', PygmentsDoc)\n",[],[216,809,810,811,890,891,1469,1494],"08929290-67fc-11f0-bcbe-0224a6c84d84","scanner.py","0892933a-67fc-11f0-bcbe-0224a6c84d84",310,["D",1753299262165],"\"\"\"\n pygments.scanner\n ~~~~~~~~~~~~~~~~\n\n This library implements a regex based scanner. Some languages\n like Pascal are easy to parse but have some keywords that\n depend on the context. Because of this it's impossible to lex\n that just by using a regular expression lexer like the\n `RegexLexer`.\n\n Have a look at the `DelphiLexer` to get an idea of how to use\n this scanner.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\nimport re\n\n\nclass EndOfText(RuntimeError):\n \"\"\"\n Raise if end of text is reached and the user\n tried to call a match function.\n \"\"\"\n\n\nclass Scanner:\n \"\"\"\n Simple scanner\n\n All method patterns are regular expression strings (not\n compiled expressions!)\n \"\"\"\n\n def __init__(self, text, flags=0):\n \"\"\"\n :param text: The text which should be scanned\n :param flags: default regular expression flags\n \"\"\"\n self.data = text\n self.data_length = len(text)\n self.start_pos = 0\n self.pos = 0\n self.flags = flags\n self.last = None\n self.match = None\n self._re_cache = {}\n\n def eos(self):\n \"\"\"`True` if the scanner reached the end of text.\"\"\"\n return self.pos >= self.data_length\n eos = property(eos, eos.__doc__)\n\n def check(self, pattern):\n \"\"\"\n Apply `pattern` on the current position and return\n the match object. (Doesn't touch pos). Use this for\n lookahead.\n \"\"\"\n if self.eos:\n raise EndOfText()\n if pattern not in self._re_cache:\n self._re_cache[pattern] = re.compile(pattern, self.flags)\n return self._re_cache[pattern].match(self.data, self.pos)\n\n def test(self, pattern):\n \"\"\"Apply a pattern on the current position and check\n if it patches. Doesn't touch pos.\n \"\"\"\n return self.check(pattern) is not None\n\n def scan(self, pattern):\n \"\"\"\n Scan the text for the given pattern and update pos/match\n and related fields. The return value is a boolean that\n indicates if the pattern matched. The matched value is\n stored on the instance as ``match``, the last value is\n stored as ``last``. ``start_pos`` is the position of the\n pointer before the pattern was matched, ``pos`` is the\n end position.\n \"\"\"\n if self.eos:\n raise EndOfText()\n if pattern not in self._re_cache:\n self._re_cache[pattern] = re.compile(pattern, self.flags)\n self.last = self.match\n m = self._re_cache[pattern].match(self.data, self.pos)\n if m is None:\n return False\n self.start_pos = m.start()\n self.pos = m.end()\n self.match = m.group()\n return True\n\n def get_char(self):\n \"\"\"Scan exactly one char.\"\"\"\n self.scan('.')\n\n def __repr__(self):\n return '<%s %d/%d>' % (\n self.__class__.__name__,\n self.pos,\n self.data_length\n )\n",[],[216,809,810,811,890,891,1469,1502],"090df034-67fc-11f0-928e-0224a6c84d84","regexopt.py","090df0de-67fc-11f0-928e-0224a6c84d84",325,["D",1753299262973],"\"\"\"\n pygments.regexopt\n ~~~~~~~~~~~~~~~~~\n\n An algorithm that generates optimized regexes for matching long lists of\n literal strings.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\nfrom re import escape\nfrom os.path import commonprefix\nfrom itertools import groupby\nfrom operator import itemgetter\n\nCS_ESCAPE = re.compile(r'[\\[\\^\\\\\\-\\]]')\nFIRST_ELEMENT = itemgetter(0)\n\n\ndef make_charset(letters):\n return '[' + CS_ESCAPE.sub(lambda m: '\\\\' + m.group(), ''.join(letters)) + ']'\n\n\ndef regex_opt_inner(strings, open_paren):\n \"\"\"Return a regex that matches any string in the sorted list of strings.\"\"\"\n close_paren = open_paren and ')' or ''\n # print strings, repr(open_paren)\n if not strings:\n # print '-> nothing left'\n return ''\n first = strings[0]\n if len(strings) == 1:\n # print '-> only 1 string'\n return open_paren + escape(first) + close_paren\n if not first:\n # print '-> first string empty'\n return open_paren + regex_opt_inner(strings[1:], '(?:') \\\n + '?' + close_paren\n if len(first) == 1:\n # multiple one-char strings? make a charset\n oneletter = []\n rest = []\n for s in strings:\n if len(s) == 1:\n oneletter.append(s)\n else:\n rest.append(s)\n if len(oneletter) > 1: # do we have more than one oneletter string?\n if rest:\n # print '-> 1-character + rest'\n return open_paren + regex_opt_inner(rest, '') + '|' \\\n + make_charset(oneletter) + close_paren\n # print '-> only 1-character'\n return open_paren + make_charset(oneletter) + close_paren\n prefix = commonprefix(strings)\n if prefix:\n plen = len(prefix)\n # we have a prefix for all strings\n # print '-> prefix:', prefix\n return open_paren + escape(prefix) \\\n + regex_opt_inner([s[plen:] for s in strings], '(?:') \\\n + close_paren\n # is there a suffix?\n strings_rev = [s[::-1] for s in strings]\n suffix = commonprefix(strings_rev)\n if suffix:\n slen = len(suffix)\n # print '-> suffix:', suffix[::-1]\n return open_paren \\\n + regex_opt_inner(sorted(s[:-slen] for s in strings), '(?:') \\\n + escape(suffix[::-1]) + close_paren\n # recurse on common 1-string prefixes\n # print '-> last resort'\n return open_paren + \\\n '|'.join(regex_opt_inner(list(group[1]), '')\n for group in groupby(strings, lambda s: s[0] == first[0])) \\\n + close_paren\n\n\ndef regex_opt(strings, prefix='', suffix=''):\n \"\"\"Return a compiled regex that matches any string in the given list.\n\n The strings to match must be literal strings, not regexes. They will be\n regex-escaped.\n\n *prefix* and *suffix* are pre- and appended to the final regex.\n \"\"\"\n strings = sorted(strings)\n return prefix + regex_opt_inner(strings, '(') + suffix\n",[],[216,809,810,811,890,891,1469,1510],"091353bc-67fc-11f0-8791-0224a6c84d84","plugin.py","09135470-67fc-11f0-8791-0224a6c84d84",326,["D",1753299263006],"\"\"\"\n pygments.plugin\n ~~~~~~~~~~~~~~~\n\n Pygments plugin interface.\n\n lexer plugins::\n\n [pygments.lexers]\n yourlexer = yourmodule:YourLexer\n\n formatter plugins::\n\n [pygments.formatters]\n yourformatter = yourformatter:YourFormatter\n /.ext = yourformatter:YourFormatter\n\n As you can see, you can define extensions for the formatter\n with a leading slash.\n\n syntax plugins::\n\n [pygments.styles]\n yourstyle = yourstyle:YourStyle\n\n filter plugin::\n\n [pygments.filter]\n yourfilter = yourfilter:YourFilter\n\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\nfrom importlib.metadata import entry_points\n\nLEXER_ENTRY_POINT = 'pygments.lexers'\nFORMATTER_ENTRY_POINT = 'pygments.formatters'\nSTYLE_ENTRY_POINT = 'pygments.styles'\nFILTER_ENTRY_POINT = 'pygments.filters'\n\n\ndef iter_entry_points(group_name):\n groups = entry_points()\n if hasattr(groups, 'select'):\n # New interface in Python 3.10 and newer versions of the\n # importlib_metadata backport.\n return groups.select(group=group_name)\n else:\n # Older interface, deprecated in Python 3.10 and recent\n # importlib_metadata, but we need it in Python 3.8 and 3.9.\n return groups.get(group_name, [])\n\n\ndef find_plugin_lexers():\n for entrypoint in iter_entry_points(LEXER_ENTRY_POINT):\n yield entrypoint.load()\n\n\ndef find_plugin_formatters():\n for entrypoint in iter_entry_points(FORMATTER_ENTRY_POINT):\n yield entrypoint.name, entrypoint.load()\n\n\ndef find_plugin_styles():\n for entrypoint in iter_entry_points(STYLE_ENTRY_POINT):\n yield entrypoint.name, entrypoint.load()\n\n\ndef find_plugin_filters():\n for entrypoint in iter_entry_points(FILTER_ENTRY_POINT):\n yield entrypoint.name, entrypoint.load()\n",[],[216,809,810,811,890,891,1469,1518],"087bda14-67fc-11f0-8cd1-0224a6c84d84","modeline.py","087bdb04-67fc-11f0-8cd1-0224a6c84d84",307,["D",1753299262005],"\"\"\"\n pygments.modeline\n ~~~~~~~~~~~~~~~~~\n\n A simple modeline parser (based on pymodeline).\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\n\n__all__ = ['get_filetype_from_buffer']\n\n\nmodeline_re = re.compile(r'''\n (?: vi | vim | ex ) (?: [<=>]? \\d* )? :\n .* (?: ft | filetype | syn | syntax ) = ( [^:\\s]+ )\n''', re.VERBOSE)\n\n\ndef get_filetype_from_line(l): # noqa: E741\n m = modeline_re.search(l)\n if m:\n return m.group(1)\n\n\ndef get_filetype_from_buffer(buf, max_lines=5):\n \"\"\"\n Scan the buffer for modelines and return filetype if one is found.\n \"\"\"\n lines = buf.splitlines()\n for line in lines[-1:-max_lines-1:-1]:\n ret = get_filetype_from_line(line)\n if ret:\n return ret\n for i in range(max_lines, -1, -1):\n if i < len(lines):\n ret = get_filetype_from_line(lines[i])\n if ret:\n return ret\n\n return None\n",[],[216,809,810,811,890,891,1469,1526],"08fed676-67fc-11f0-85ab-0224a6c84d84","lexer.py","08fed72a-67fc-11f0-85ab-0224a6c84d84",324,["D",1753299262874],"\"\"\"\n pygments.lexer\n ~~~~~~~~~~~~~~\n\n Base lexer classes.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\nimport sys\nimport time\n\nfrom pip._vendor.pygments.filter import apply_filters, Filter\nfrom pip._vendor.pygments.filters import get_filter_by_name\nfrom pip._vendor.pygments.token import Error, Text, Other, Whitespace, _TokenType\nfrom pip._vendor.pygments.util import get_bool_opt, get_int_opt, get_list_opt, \\\n make_analysator, Future, guess_decode\nfrom pip._vendor.pygments.regexopt import regex_opt\n\n__all__ = ['Lexer', 'RegexLexer', 'ExtendedRegexLexer', 'DelegatingLexer',\n 'LexerContext', 'include', 'inherit', 'bygroups', 'using', 'this',\n 'default', 'words', 'line_re']\n\nline_re = re.compile('.*?\\n')\n\n_encoding_map = [(b'\\xef\\xbb\\xbf', 'utf-8'),\n (b'\\xff\\xfe\\0\\0', 'utf-32'),\n (b'\\0\\0\\xfe\\xff', 'utf-32be'),\n (b'\\xff\\xfe', 'utf-16'),\n (b'\\xfe\\xff', 'utf-16be')]\n\n_default_analyse = staticmethod(lambda x: 0.0)\n\n\nclass LexerMeta(type):\n \"\"\"\n This metaclass automagically converts ``analyse_text`` methods into\n static methods which always return float values.\n \"\"\"\n\n def __new__(mcs, name, bases, d):\n if 'analyse_text' in d:\n d['analyse_text'] = make_analysator(d['analyse_text'])\n return type.__new__(mcs, name, bases, d)\n\n\nclass Lexer(metaclass=LexerMeta):\n \"\"\"\n Lexer for a specific language.\n\n See also :doc:`lexerdevelopment`, a high-level guide to writing\n lexers.\n\n Lexer classes have attributes used for choosing the most appropriate\n lexer based on various criteria.\n\n .. autoattribute:: name\n :no-value:\n .. autoattribute:: aliases\n :no-value:\n .. autoattribute:: filenames\n :no-value:\n .. autoattribute:: alias_filenames\n .. autoattribute:: mimetypes\n :no-value:\n .. autoattribute:: priority\n\n Lexers included in Pygments should have two additional attributes:\n\n .. autoattribute:: url\n :no-value:\n .. autoattribute:: version_added\n :no-value:\n\n Lexers included in Pygments may have additional attributes:\n\n .. autoattribute:: _example\n :no-value:\n\n You can pass options to the constructor. The basic options recognized\n by all lexers and processed by the base `Lexer` class are:\n\n ``stripnl``\n Strip leading and trailing newlines from the input (default: True).\n ``stripall``\n Strip all leading and trailing whitespace from the input\n (default: False).\n ``ensurenl``\n Make sure that the input ends with a newline (default: True). This\n is required for some lexers that consume input linewise.\n\n .. versionadded:: 1.3\n\n ``tabsize``\n If given and greater than 0, expand tabs in the input (default: 0).\n ``encoding``\n If given, must be an encoding name. This encoding will be used to\n convert the input string to Unicode, if it is not already a Unicode\n string (default: ``'guess'``, which uses a simple UTF-8 / Locale /\n Latin1 detection. Can also be ``'chardet'`` to use the chardet\n library, if it is installed.\n ``inencoding``\n Overrides the ``encoding`` if given.\n \"\"\"\n\n #: Full name of the lexer, in human-readable form\n name = None\n\n #: A list of short, unique identifiers that can be used to look\n #: up the lexer from a list, e.g., using `get_lexer_by_name()`.\n aliases = []\n\n #: A list of `fnmatch` patterns that match filenames which contain\n #: content for this lexer. The patterns in this list should be unique among\n #: all lexers.\n filenames = []\n\n #: A list of `fnmatch` patterns that match filenames which may or may not\n #: contain content for this lexer. This list is used by the\n #: :func:`.guess_lexer_for_filename()` function, to determine which lexers\n #: are then included in guessing the correct one. That means that\n #: e.g. every lexer for HTML and a template language should include\n #: ``\\*.html`` in this list.\n alias_filenames = []\n\n #: A list of MIME types for content that can be lexed with this lexer.\n mimetypes = []\n\n #: Priority, should multiple lexers match and no content is provided\n priority = 0\n\n #: URL of the language specification/definition. Used in the Pygments\n #: documentation. Set to an empty string to disable.\n url = None\n\n #: Version of Pygments in which the lexer was added.\n version_added = None\n\n #: Example file name. Relative to the ``tests/examplefiles`` directory.\n #: This is used by the documentation generator to show an example.\n _example = None\n\n def __init__(self, **options):\n \"\"\"\n This constructor takes arbitrary options as keyword arguments.\n Every subclass must first process its own options and then call\n the `Lexer` constructor, since it processes the basic\n options like `stripnl`.\n\n An example looks like this:\n\n .. sourcecode:: python\n\n def __init__(self, **options):\n self.compress = options.get('compress', '')\n Lexer.__init__(self, **options)\n\n As these options must all be specifiable as strings (due to the\n command line usage), there are various utility functions\n available to help with that, see `Utilities`_.\n \"\"\"\n self.options = options\n self.stripnl = get_bool_opt(options, 'stripnl', True)\n self.stripall = get_bool_opt(options, 'stripall', False)\n self.ensurenl = get_bool_opt(options, 'ensurenl', True)\n self.tabsize = get_int_opt(options, 'tabsize', 0)\n self.encoding = options.get('encoding', 'guess')\n self.encoding = options.get('inencoding') or self.encoding\n self.filters = []\n for filter_ in get_list_opt(options, 'filters', ()):\n self.add_filter(filter_)\n\n def __repr__(self):\n if self.options:\n return f''\n else:\n return f''\n\n def add_filter(self, filter_, **options):\n \"\"\"\n Add a new stream filter to this lexer.\n \"\"\"\n if not isinstance(filter_, Filter):\n filter_ = get_filter_by_name(filter_, **options)\n self.filters.append(filter_)\n\n def analyse_text(text):\n \"\"\"\n A static method which is called for lexer guessing.\n\n It should analyse the text and return a float in the range\n from ``0.0`` to ``1.0``. If it returns ``0.0``, the lexer\n will not be selected as the most probable one, if it returns\n ``1.0``, it will be selected immediately. This is used by\n `guess_lexer`.\n\n The `LexerMeta` metaclass automatically wraps this function so\n that it works like a static method (no ``self`` or ``cls``\n parameter) and the return value is automatically converted to\n `float`. If the return value is an object that is boolean `False`\n it's the same as if the return values was ``0.0``.\n \"\"\"\n\n def _preprocess_lexer_input(self, text):\n \"\"\"Apply preprocessing such as decoding the input, removing BOM and normalizing newlines.\"\"\"\n\n if not isinstance(text, str):\n if self.encoding == 'guess':\n text, _ = guess_decode(text)\n elif self.encoding == 'chardet':\n try:\n # pip vendoring note: this code is not reachable by pip,\n # removed import of chardet to make it clear.\n raise ImportError('chardet is not vendored by pip')\n except ImportError as e:\n raise ImportError('To enable chardet encoding guessing, '\n 'please install the chardet library '\n 'from http://chardet.feedparser.org/') from e\n # check for BOM first\n decoded = None\n for bom, encoding in _encoding_map:\n if text.startswith(bom):\n decoded = text[len(bom):].decode(encoding, 'replace')\n break\n # no BOM found, so use chardet\n if decoded is None:\n enc = chardet.detect(text[:1024]) # Guess using first 1KB\n decoded = text.decode(enc.get('encoding') or 'utf-8',\n 'replace')\n text = decoded\n else:\n text = text.decode(self.encoding)\n if text.startswith('\\ufeff'):\n text = text[len('\\ufeff'):]\n else:\n if text.startswith('\\ufeff'):\n text = text[len('\\ufeff'):]\n\n # text now *is* a unicode string\n text = text.replace('\\r\\n', '\\n')\n text = text.replace('\\r', '\\n')\n if self.stripall:\n text = text.strip()\n elif self.stripnl:\n text = text.strip('\\n')\n if self.tabsize > 0:\n text = text.expandtabs(self.tabsize)\n if self.ensurenl and not text.endswith('\\n'):\n text += '\\n'\n\n return text\n\n def get_tokens(self, text, unfiltered=False):\n \"\"\"\n This method is the basic interface of a lexer. It is called by\n the `highlight()` function. It must process the text and return an\n iterable of ``(tokentype, value)`` pairs from `text`.\n\n Normally, you don't need to override this method. The default\n implementation processes the options recognized by all lexers\n (`stripnl`, `stripall` and so on), and then yields all tokens\n from `get_tokens_unprocessed()`, with the ``index`` dropped.\n\n If `unfiltered` is set to `True`, the filtering mechanism is\n bypassed even if filters are defined.\n \"\"\"\n text = self._preprocess_lexer_input(text)\n\n def streamer():\n for _, t, v in self.get_tokens_unprocessed(text):\n yield t, v\n stream = streamer()\n if not unfiltered:\n stream = apply_filters(stream, self.filters, self)\n return stream\n\n def get_tokens_unprocessed(self, text):\n \"\"\"\n This method should process the text and return an iterable of\n ``(index, tokentype, value)`` tuples where ``index`` is the starting\n position of the token within the input text.\n\n It must be overridden by subclasses. It is recommended to\n implement it as a generator to maximize effectiveness.\n \"\"\"\n raise NotImplementedError\n\n\nclass DelegatingLexer(Lexer):\n \"\"\"\n This lexer takes two lexer as arguments. A root lexer and\n a language lexer. First everything is scanned using the language\n lexer, afterwards all ``Other`` tokens are lexed using the root\n lexer.\n\n The lexers from the ``template`` lexer package use this base lexer.\n \"\"\"\n\n def __init__(self, _root_lexer, _language_lexer, _needle=Other, **options):\n self.root_lexer = _root_lexer(**options)\n self.language_lexer = _language_lexer(**options)\n self.needle = _needle\n Lexer.__init__(self, **options)\n\n def get_tokens_unprocessed(self, text):\n buffered = ''\n insertions = []\n lng_buffer = []\n for i, t, v in self.language_lexer.get_tokens_unprocessed(text):\n if t is self.needle:\n if lng_buffer:\n insertions.append((len(buffered), lng_buffer))\n lng_buffer = []\n buffered += v\n else:\n lng_buffer.append((i, t, v))\n if lng_buffer:\n insertions.append((len(buffered), lng_buffer))\n return do_insertions(insertions,\n self.root_lexer.get_tokens_unprocessed(buffered))\n\n\n# ------------------------------------------------------------------------------\n# RegexLexer and ExtendedRegexLexer\n#\n\n\nclass include(str): # pylint: disable=invalid-name\n \"\"\"\n Indicates that a state should include rules from another state.\n \"\"\"\n pass\n\n\nclass _inherit:\n \"\"\"\n Indicates the a state should inherit from its superclass.\n \"\"\"\n def __repr__(self):\n return 'inherit'\n\ninherit = _inherit() # pylint: disable=invalid-name\n\n\nclass combined(tuple): # pylint: disable=invalid-name\n \"\"\"\n Indicates a state combined from multiple states.\n \"\"\"\n\n def __new__(cls, *args):\n return tuple.__new__(cls, args)\n\n def __init__(self, *args):\n # tuple.__init__ doesn't do anything\n pass\n\n\nclass _PseudoMatch:\n \"\"\"\n A pseudo match object constructed from a string.\n \"\"\"\n\n def __init__(self, start, text):\n self._text = text\n self._start = start\n\n def start(self, arg=None):\n return self._start\n\n def end(self, arg=None):\n return self._start + len(self._text)\n\n def group(self, arg=None):\n if arg:\n raise IndexError('No such group')\n return self._text\n\n def groups(self):\n return (self._text,)\n\n def groupdict(self):\n return {}\n\n\ndef bygroups(*args):\n \"\"\"\n Callback that yields multiple actions for each group in the match.\n \"\"\"\n def callback(lexer, match, ctx=None):\n for i, action in enumerate(args):\n if action is None:\n continue\n elif type(action) is _TokenType:\n data = match.group(i + 1)\n if data:\n yield match.start(i + 1), action, data\n else:\n data = match.group(i + 1)\n if data is not None:\n if ctx:\n ctx.pos = match.start(i + 1)\n for item in action(lexer,\n _PseudoMatch(match.start(i + 1), data), ctx):\n if item:\n yield item\n if ctx:\n ctx.pos = match.end()\n return callback\n\n\nclass _This:\n \"\"\"\n Special singleton used for indicating the caller class.\n Used by ``using``.\n \"\"\"\n\nthis = _This()\n\n\ndef using(_other, **kwargs):\n \"\"\"\n Callback that processes the match with a different lexer.\n\n The keyword arguments are forwarded to the lexer, except `state` which\n is handled separately.\n\n `state` specifies the state that the new lexer will start in, and can\n be an enumerable such as ('root', 'inline', 'string') or a simple\n string which is assumed to be on top of the root state.\n\n Note: For that to work, `_other` must not be an `ExtendedRegexLexer`.\n \"\"\"\n gt_kwargs = {}\n if 'state' in kwargs:\n s = kwargs.pop('state')\n if isinstance(s, (list, tuple)):\n gt_kwargs['stack'] = s\n else:\n gt_kwargs['stack'] = ('root', s)\n\n if _other is this:\n def callback(lexer, match, ctx=None):\n # if keyword arguments are given the callback\n # function has to create a new lexer instance\n if kwargs:\n # XXX: cache that somehow\n kwargs.update(lexer.options)\n lx = lexer.__class__(**kwargs)\n else:\n lx = lexer\n s = match.start()\n for i, t, v in lx.get_tokens_unprocessed(match.group(), **gt_kwargs):\n yield i + s, t, v\n if ctx:\n ctx.pos = match.end()\n else:\n def callback(lexer, match, ctx=None):\n # XXX: cache that somehow\n kwargs.update(lexer.options)\n lx = _other(**kwargs)\n\n s = match.start()\n for i, t, v in lx.get_tokens_unprocessed(match.group(), **gt_kwargs):\n yield i + s, t, v\n if ctx:\n ctx.pos = match.end()\n return callback\n\n\nclass default:\n \"\"\"\n Indicates a state or state action (e.g. #pop) to apply.\n For example default('#pop') is equivalent to ('', Token, '#pop')\n Note that state tuples may be used as well.\n\n .. versionadded:: 2.0\n \"\"\"\n def __init__(self, state):\n self.state = state\n\n\nclass words(Future):\n \"\"\"\n Indicates a list of literal words that is transformed into an optimized\n regex that matches any of the words.\n\n .. versionadded:: 2.0\n \"\"\"\n def __init__(self, words, prefix='', suffix=''):\n self.words = words\n self.prefix = prefix\n self.suffix = suffix\n\n def get(self):\n return regex_opt(self.words, prefix=self.prefix, suffix=self.suffix)\n\n\nclass RegexLexerMeta(LexerMeta):\n \"\"\"\n Metaclass for RegexLexer, creates the self._tokens attribute from\n self.tokens on the first instantiation.\n \"\"\"\n\n def _process_regex(cls, regex, rflags, state):\n \"\"\"Preprocess the regular expression component of a token definition.\"\"\"\n if isinstance(regex, Future):\n regex = regex.get()\n return re.compile(regex, rflags).match\n\n def _process_token(cls, token):\n \"\"\"Preprocess the token component of a token definition.\"\"\"\n assert type(token) is _TokenType or callable(token), \\\n f'token type must be simple type or callable, not {token!r}'\n return token\n\n def _process_new_state(cls, new_state, unprocessed, processed):\n \"\"\"Preprocess the state transition action of a token definition.\"\"\"\n if isinstance(new_state, str):\n # an existing state\n if new_state == '#pop':\n return -1\n elif new_state in unprocessed:\n return (new_state,)\n elif new_state == '#push':\n return new_state\n elif new_state[:5] == '#pop:':\n return -int(new_state[5:])\n else:\n assert False, f'unknown new state {new_state!r}'\n elif isinstance(new_state, combined):\n # combine a new state from existing ones\n tmp_state = '_tmp_%d' % cls._tmpname\n cls._tmpname += 1\n itokens = []\n for istate in new_state:\n assert istate != new_state, f'circular state ref {istate!r}'\n itokens.extend(cls._process_state(unprocessed,\n processed, istate))\n processed[tmp_state] = itokens\n return (tmp_state,)\n elif isinstance(new_state, tuple):\n # push more than one state\n for istate in new_state:\n assert (istate in unprocessed or\n istate in ('#pop', '#push')), \\\n 'unknown new state ' + istate\n return new_state\n else:\n assert False, f'unknown new state def {new_state!r}'\n\n def _process_state(cls, unprocessed, processed, state):\n \"\"\"Preprocess a single state definition.\"\"\"\n assert isinstance(state, str), f\"wrong state name {state!r}\"\n assert state[0] != '#', f\"invalid state name {state!r}\"\n if state in processed:\n return processed[state]\n tokens = processed[state] = []\n rflags = cls.flags\n for tdef in unprocessed[state]:\n if isinstance(tdef, include):\n # it's a state reference\n assert tdef != state, f\"circular state reference {state!r}\"\n tokens.extend(cls._process_state(unprocessed, processed,\n str(tdef)))\n continue\n if isinstance(tdef, _inherit):\n # should be processed already, but may not in the case of:\n # 1. the state has no counterpart in any parent\n # 2. the state includes more than one 'inherit'\n continue\n if isinstance(tdef, default):\n new_state = cls._process_new_state(tdef.state, unprocessed, processed)\n tokens.append((re.compile('').match, None, new_state))\n continue\n\n assert type(tdef) is tuple, f\"wrong rule def {tdef!r}\"\n\n try:\n rex = cls._process_regex(tdef[0], rflags, state)\n except Exception as err:\n raise ValueError(f\"uncompilable regex {tdef[0]!r} in state {state!r} of {cls!r}: {err}\") from err\n\n token = cls._process_token(tdef[1])\n\n if len(tdef) == 2:\n new_state = None\n else:\n new_state = cls._process_new_state(tdef[2],\n unprocessed, processed)\n\n tokens.append((rex, token, new_state))\n return tokens\n\n def process_tokendef(cls, name, tokendefs=None):\n \"\"\"Preprocess a dictionary of token definitions.\"\"\"\n processed = cls._all_tokens[name] = {}\n tokendefs = tokendefs or cls.tokens[name]\n for state in list(tokendefs):\n cls._process_state(tokendefs, processed, state)\n return processed\n\n def get_tokendefs(cls):\n \"\"\"\n Merge tokens from superclasses in MRO order, returning a single tokendef\n dictionary.\n\n Any state that is not defined by a subclass will be inherited\n automatically. States that *are* defined by subclasses will, by\n default, override that state in the superclass. If a subclass wishes to\n inherit definitions from a superclass, it can use the special value\n \"inherit\", which will cause the superclass' state definition to be\n included at that point in the state.\n \"\"\"\n tokens = {}\n inheritable = {}\n for c in cls.__mro__:\n toks = c.__dict__.get('tokens', {})\n\n for state, items in toks.items():\n curitems = tokens.get(state)\n if curitems is None:\n # N.b. because this is assigned by reference, sufficiently\n # deep hierarchies are processed incrementally (e.g. for\n # A(B), B(C), C(RegexLexer), B will be premodified so X(B)\n # will not see any inherits in B).\n tokens[state] = items\n try:\n inherit_ndx = items.index(inherit)\n except ValueError:\n continue\n inheritable[state] = inherit_ndx\n continue\n\n inherit_ndx = inheritable.pop(state, None)\n if inherit_ndx is None:\n continue\n\n # Replace the \"inherit\" value with the items\n curitems[inherit_ndx:inherit_ndx+1] = items\n try:\n # N.b. this is the index in items (that is, the superclass\n # copy), so offset required when storing below.\n new_inh_ndx = items.index(inherit)\n except ValueError:\n pass\n else:\n inheritable[state] = inherit_ndx + new_inh_ndx\n\n return tokens\n\n def __call__(cls, *args, **kwds):\n \"\"\"Instantiate cls after preprocessing its token definitions.\"\"\"\n if '_tokens' not in cls.__dict__:\n cls._all_tokens = {}\n cls._tmpname = 0\n if hasattr(cls, 'token_variants') and cls.token_variants:\n # don't process yet\n pass\n else:\n cls._tokens = cls.process_tokendef('', cls.get_tokendefs())\n\n return type.__call__(cls, *args, **kwds)\n\n\nclass RegexLexer(Lexer, metaclass=RegexLexerMeta):\n \"\"\"\n Base for simple stateful regular expression-based lexers.\n Simplifies the lexing process so that you need only\n provide a list of states and regular expressions.\n \"\"\"\n\n #: Flags for compiling the regular expressions.\n #: Defaults to MULTILINE.\n flags = re.MULTILINE\n\n #: At all time there is a stack of states. Initially, the stack contains\n #: a single state 'root'. The top of the stack is called \"the current state\".\n #:\n #: Dict of ``{'state': [(regex, tokentype, new_state), ...], ...}``\n #:\n #: ``new_state`` can be omitted to signify no state transition.\n #: If ``new_state`` is a string, it is pushed on the stack. This ensure\n #: the new current state is ``new_state``.\n #: If ``new_state`` is a tuple of strings, all of those strings are pushed\n #: on the stack and the current state will be the last element of the list.\n #: ``new_state`` can also be ``combined('state1', 'state2', ...)``\n #: to signify a new, anonymous state combined from the rules of two\n #: or more existing ones.\n #: Furthermore, it can be '#pop' to signify going back one step in\n #: the state stack, or '#push' to push the current state on the stack\n #: again. Note that if you push while in a combined state, the combined\n #: state itself is pushed, and not only the state in which the rule is\n #: defined.\n #:\n #: The tuple can also be replaced with ``include('state')``, in which\n #: case the rules from the state named by the string are included in the\n #: current one.\n tokens = {}\n\n def get_tokens_unprocessed(self, text, stack=('root',)):\n \"\"\"\n Split ``text`` into (tokentype, text) pairs.\n\n ``stack`` is the initial stack (default: ``['root']``)\n \"\"\"\n pos = 0\n tokendefs = self._tokens\n statestack = list(stack)\n statetokens = tokendefs[statestack[-1]]\n while 1:\n for rexmatch, action, new_state in statetokens:\n m = rexmatch(text, pos)\n if m:\n if action is not None:\n if type(action) is _TokenType:\n yield pos, action, m.group()\n else:\n yield from action(self, m)\n pos = m.end()\n if new_state is not None:\n # state transition\n if isinstance(new_state, tuple):\n for state in new_state:\n if state == '#pop':\n if len(statestack) > 1:\n statestack.pop()\n elif state == '#push':\n statestack.append(statestack[-1])\n else:\n statestack.append(state)\n elif isinstance(new_state, int):\n # pop, but keep at least one state on the stack\n # (random code leading to unexpected pops should\n # not allow exceptions)\n if abs(new_state) >= len(statestack):\n del statestack[1:]\n else:\n del statestack[new_state:]\n elif new_state == '#push':\n statestack.append(statestack[-1])\n else:\n assert False, f\"wrong state def: {new_state!r}\"\n statetokens = tokendefs[statestack[-1]]\n break\n else:\n # We are here only if all state tokens have been considered\n # and there was not a match on any of them.\n try:\n if text[pos] == '\\n':\n # at EOL, reset state to \"root\"\n statestack = ['root']\n statetokens = tokendefs['root']\n yield pos, Whitespace, '\\n'\n pos += 1\n continue\n yield pos, Error, text[pos]\n pos += 1\n except IndexError:\n break\n\n\nclass LexerContext:\n \"\"\"\n A helper object that holds lexer position data.\n \"\"\"\n\n def __init__(self, text, pos, stack=None, end=None):\n self.text = text\n self.pos = pos\n self.end = end or len(text) # end=0 not supported ;-)\n self.stack = stack or ['root']\n\n def __repr__(self):\n return f'LexerContext({self.text!r}, {self.pos!r}, {self.stack!r})'\n\n\nclass ExtendedRegexLexer(RegexLexer):\n \"\"\"\n A RegexLexer that uses a context object to store its state.\n \"\"\"\n\n def get_tokens_unprocessed(self, text=None, context=None):\n \"\"\"\n Split ``text`` into (tokentype, text) pairs.\n If ``context`` is given, use this lexer context instead.\n \"\"\"\n tokendefs = self._tokens\n if not context:\n ctx = LexerContext(text, 0)\n statetokens = tokendefs['root']\n else:\n ctx = context\n statetokens = tokendefs[ctx.stack[-1]]\n text = ctx.text\n while 1:\n for rexmatch, action, new_state in statetokens:\n m = rexmatch(text, ctx.pos, ctx.end)\n if m:\n if action is not None:\n if type(action) is _TokenType:\n yield ctx.pos, action, m.group()\n ctx.pos = m.end()\n else:\n yield from action(self, m, ctx)\n if not new_state:\n # altered the state stack?\n statetokens = tokendefs[ctx.stack[-1]]\n # CAUTION: callback must set ctx.pos!\n if new_state is not None:\n # state transition\n if isinstance(new_state, tuple):\n for state in new_state:\n if state == '#pop':\n if len(ctx.stack) > 1:\n ctx.stack.pop()\n elif state == '#push':\n ctx.stack.append(ctx.stack[-1])\n else:\n ctx.stack.append(state)\n elif isinstance(new_state, int):\n # see RegexLexer for why this check is made\n if abs(new_state) >= len(ctx.stack):\n del ctx.stack[1:]\n else:\n del ctx.stack[new_state:]\n elif new_state == '#push':\n ctx.stack.append(ctx.stack[-1])\n else:\n assert False, f\"wrong state def: {new_state!r}\"\n statetokens = tokendefs[ctx.stack[-1]]\n break\n else:\n try:\n if ctx.pos >= ctx.end:\n break\n if text[ctx.pos] == '\\n':\n # at EOL, reset state to \"root\"\n ctx.stack = ['root']\n statetokens = tokendefs['root']\n yield ctx.pos, Text, '\\n'\n ctx.pos += 1\n continue\n yield ctx.pos, Error, text[ctx.pos]\n ctx.pos += 1\n except IndexError:\n break\n\n\ndef do_insertions(insertions, tokens):\n \"\"\"\n Helper for lexers which must combine the results of several\n sublexers.\n\n ``insertions`` is a list of ``(index, itokens)`` pairs.\n Each ``itokens`` iterable should be inserted at position\n ``index`` into the token stream given by the ``tokens``\n argument.\n\n The result is a combined token stream.\n\n TODO: clean up the code here.\n \"\"\"\n insertions = iter(insertions)\n try:\n index, itokens = next(insertions)\n except StopIteration:\n # no insertions\n yield from tokens\n return\n\n realpos = None\n insleft = True\n\n # iterate over the token stream where we want to insert\n # the tokens from the insertion list.\n for i, t, v in tokens:\n # first iteration. store the position of first item\n if realpos is None:\n realpos = i\n oldi = 0\n while insleft and i + len(v) >= index:\n tmpval = v[oldi:index - i]\n if tmpval:\n yield realpos, t, tmpval\n realpos += len(tmpval)\n for it_index, it_token, it_value in itokens:\n yield realpos, it_token, it_value\n realpos += len(it_value)\n oldi = index - i\n try:\n index, itokens = next(insertions)\n except StopIteration:\n insleft = False\n break # not strictly necessary\n if oldi < len(v):\n yield realpos, t, v[oldi:]\n realpos += len(v) - oldi\n\n # leftover tokens\n while insleft:\n # no normal tokens, set realpos to zero\n realpos = realpos or 0\n for p, t, v in itokens:\n yield realpos, t, v\n realpos += len(v)\n try:\n index, itokens = next(insertions)\n except StopIteration:\n insleft = False\n break # not strictly necessary\n\n\nclass ProfilingRegexLexerMeta(RegexLexerMeta):\n \"\"\"Metaclass for ProfilingRegexLexer, collects regex timing info.\"\"\"\n\n def _process_regex(cls, regex, rflags, state):\n if isinstance(regex, words):\n rex = regex_opt(regex.words, prefix=regex.prefix,\n suffix=regex.suffix)\n else:\n rex = regex\n compiled = re.compile(rex, rflags)\n\n def match_func(text, pos, endpos=sys.maxsize):\n info = cls._prof_data[-1].setdefault((state, rex), [0, 0.0])\n t0 = time.time()\n res = compiled.match(text, pos, endpos)\n t1 = time.time()\n info[0] += 1\n info[1] += t1 - t0\n return res\n return match_func\n\n\nclass ProfilingRegexLexer(RegexLexer, metaclass=ProfilingRegexLexerMeta):\n \"\"\"Drop-in replacement for RegexLexer that does profiling of its regexes.\"\"\"\n\n _prof_data = []\n _prof_sort_index = 4 # defaults to time per call\n\n def get_tokens_unprocessed(self, text, stack=('root',)):\n # this needs to be a stack, since using(this) will produce nested calls\n self.__class__._prof_data.append({})\n yield from RegexLexer.get_tokens_unprocessed(self, text, stack)\n rawdata = self.__class__._prof_data.pop()\n data = sorted(((s, repr(r).strip('u\\'').replace('\\\\\\\\', '\\\\')[:65],\n n, 1000 * t, 1000 * t / n)\n for ((s, r), (n, t)) in rawdata.items()),\n key=lambda x: x[self._prof_sort_index],\n reverse=True)\n sum_total = sum(x[3] for x in data)\n\n print()\n print('Profiling result for %s lexing %d chars in %.3f ms' %\n (self.__class__.__name__, len(text), sum_total))\n print('=' * 110)\n print('%-20s %-64s ncalls tottime percall' % ('state', 'regex'))\n print('-' * 110)\n for d in data:\n print('%-20s %-65s %5d %8.4f %8.4f' % d)\n print('=' * 110)\n",[],[216,809,810,811,890,891,1469,1534],"089810bc-67fc-11f0-8737-0224a6c84d84","formatter.py","0898118e-67fc-11f0-8737-0224a6c84d84",311,["D",1753299262202],"\"\"\"\n pygments.formatter\n ~~~~~~~~~~~~~~~~~~\n\n Base formatter class.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport codecs\n\nfrom pip._vendor.pygments.util import get_bool_opt\nfrom pip._vendor.pygments.styles import get_style_by_name\n\n__all__ = ['Formatter']\n\n\ndef _lookup_style(style):\n if isinstance(style, str):\n return get_style_by_name(style)\n return style\n\n\nclass Formatter:\n \"\"\"\n Converts a token stream to text.\n\n Formatters should have attributes to help selecting them. These\n are similar to the corresponding :class:`~pygments.lexer.Lexer`\n attributes.\n\n .. autoattribute:: name\n :no-value:\n\n .. autoattribute:: aliases\n :no-value:\n\n .. autoattribute:: filenames\n :no-value:\n\n You can pass options as keyword arguments to the constructor.\n All formatters accept these basic options:\n\n ``style``\n The style to use, can be a string or a Style subclass\n (default: \"default\"). Not used by e.g. the\n TerminalFormatter.\n ``full``\n Tells the formatter to output a \"full\" document, i.e.\n a complete self-contained document. This doesn't have\n any effect for some formatters (default: false).\n ``title``\n If ``full`` is true, the title that should be used to\n caption the document (default: '').\n ``encoding``\n If given, must be an encoding name. This will be used to\n convert the Unicode token strings to byte strings in the\n output. If it is \"\" or None, Unicode strings will be written\n to the output file, which most file-like objects do not\n support (default: None).\n ``outencoding``\n Overrides ``encoding`` if given.\n\n \"\"\"\n\n #: Full name for the formatter, in human-readable form.\n name = None\n\n #: A list of short, unique identifiers that can be used to lookup\n #: the formatter from a list, e.g. using :func:`.get_formatter_by_name()`.\n aliases = []\n\n #: A list of fnmatch patterns that match filenames for which this\n #: formatter can produce output. The patterns in this list should be unique\n #: among all formatters.\n filenames = []\n\n #: If True, this formatter outputs Unicode strings when no encoding\n #: option is given.\n unicodeoutput = True\n\n def __init__(self, **options):\n \"\"\"\n As with lexers, this constructor takes arbitrary optional arguments,\n and if you override it, you should first process your own options, then\n call the base class implementation.\n \"\"\"\n self.style = _lookup_style(options.get('style', 'default'))\n self.full = get_bool_opt(options, 'full', False)\n self.title = options.get('title', '')\n self.encoding = options.get('encoding', None) or None\n if self.encoding in ('guess', 'chardet'):\n # can happen for e.g. pygmentize -O encoding=guess\n self.encoding = 'utf-8'\n self.encoding = options.get('outencoding') or self.encoding\n self.options = options\n\n def get_style_defs(self, arg=''):\n \"\"\"\n This method must return statements or declarations suitable to define\n the current style for subsequent highlighted text (e.g. CSS classes\n in the `HTMLFormatter`).\n\n The optional argument `arg` can be used to modify the generation and\n is formatter dependent (it is standardized because it can be given on\n the command line).\n\n This method is called by the ``-S`` :doc:`command-line option `,\n the `arg` is then given by the ``-a`` option.\n \"\"\"\n return ''\n\n def format(self, tokensource, outfile):\n \"\"\"\n This method must format the tokens from the `tokensource` iterable and\n write the formatted version to the file object `outfile`.\n\n Formatter options can control how exactly the tokens are converted.\n \"\"\"\n if self.encoding:\n # wrap the outfile in a StreamWriter\n outfile = codecs.lookup(self.encoding)[3](outfile)\n return self.format_unencoded(tokensource, outfile)\n\n # Allow writing Formatter[str] or Formatter[bytes]. That's equivalent to\n # Formatter. This helps when using third-party type stubs from typeshed.\n def __class_getitem__(cls, name):\n return cls\n",[],[216,809,810,811,890,891,1469,1542],"09181aa0-67fc-11f0-b489-0224a6c84d84","filter.py","09181b40-67fc-11f0-b489-0224a6c84d84",327,["D",1753299263044],"\"\"\"\n pygments.filter\n ~~~~~~~~~~~~~~~\n\n Module that implements the default filter.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\n\ndef apply_filters(stream, filters, lexer=None):\n \"\"\"\n Use this method to apply an iterable of filters to\n a stream. If lexer is given it's forwarded to the\n filter, otherwise the filter receives `None`.\n \"\"\"\n def _apply(filter_, stream):\n yield from filter_.filter(lexer, stream)\n for filter_ in filters:\n stream = _apply(filter_, stream)\n return stream\n\n\ndef simplefilter(f):\n \"\"\"\n Decorator that converts a function into a filter::\n\n @simplefilter\n def lowercase(self, lexer, stream, options):\n for ttype, value in stream:\n yield ttype, value.lower()\n \"\"\"\n return type(f.__name__, (FunctionFilter,), {\n '__module__': getattr(f, '__module__'),\n '__doc__': f.__doc__,\n 'function': f,\n })\n\n\nclass Filter:\n \"\"\"\n Default filter. Subclass this class or use the `simplefilter`\n decorator to create own filters.\n \"\"\"\n\n def __init__(self, **options):\n self.options = options\n\n def filter(self, lexer, stream):\n raise NotImplementedError()\n\n\nclass FunctionFilter(Filter):\n \"\"\"\n Abstract class used by `simplefilter` to create simple\n function filters on the fly. The `simplefilter` decorator\n automatically creates subclasses of this class for\n functions passed to it.\n \"\"\"\n function = None\n\n def __init__(self, **options):\n if not hasattr(self, 'function'):\n raise TypeError(f'{self.__class__.__name__!r} used without bound function')\n Filter.__init__(self, **options)\n\n def filter(self, lexer, stream):\n # pylint: disable=not-callable\n yield from self.function(lexer, stream, self.options)\n",[],[216,809,810,811,890,891,1469,1550],"088bacb4-67fc-11f0-928e-0224a6c84d84","console.py","088bad7c-67fc-11f0-928e-0224a6c84d84",309,["D",1753299262114],"\"\"\"\n pygments.console\n ~~~~~~~~~~~~~~~~\n\n Format colored console output.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nesc = \"\\x1b[\"\n\ncodes = {}\ncodes[\"\"] = \"\"\ncodes[\"reset\"] = esc + \"39;49;00m\"\n\ncodes[\"bold\"] = esc + \"01m\"\ncodes[\"faint\"] = esc + \"02m\"\ncodes[\"standout\"] = esc + \"03m\"\ncodes[\"underline\"] = esc + \"04m\"\ncodes[\"blink\"] = esc + \"05m\"\ncodes[\"overline\"] = esc + \"06m\"\n\ndark_colors = [\"black\", \"red\", \"green\", \"yellow\", \"blue\",\n \"magenta\", \"cyan\", \"gray\"]\nlight_colors = [\"brightblack\", \"brightred\", \"brightgreen\", \"brightyellow\", \"brightblue\",\n \"brightmagenta\", \"brightcyan\", \"white\"]\n\nx = 30\nfor dark, light in zip(dark_colors, light_colors):\n codes[dark] = esc + \"%im\" % x\n codes[light] = esc + \"%im\" % (60 + x)\n x += 1\n\ndel dark, light, x\n\ncodes[\"white\"] = codes[\"bold\"]\n\n\ndef reset_color():\n return codes[\"reset\"]\n\n\ndef colorize(color_key, text):\n return codes[color_key] + text + codes[\"reset\"]\n\n\ndef ansiformat(attr, text):\n \"\"\"\n Format ``text`` with a color and/or some attributes::\n\n color normal color\n *color* bold color\n _color_ underlined color\n +color+ blinking color\n \"\"\"\n result = []\n if attr[:1] == attr[-1:] == '+':\n result.append(codes['blink'])\n attr = attr[1:-1]\n if attr[:1] == attr[-1:] == '*':\n result.append(codes['bold'])\n attr = attr[1:-1]\n if attr[:1] == attr[-1:] == '_':\n result.append(codes['underline'])\n attr = attr[1:-1]\n result.append(codes[attr])\n result.append(text)\n result.append(codes['reset'])\n return ''.join(result)\n",[],[216,809,810,811,890,891,1469,1558],"092bdd60-67fc-11f0-9ad5-0224a6c84d84","__main__.py","092bde14-67fc-11f0-9ad5-0224a6c84d84",329,["D",1753299263170],"\"\"\"\n pygments.__main__\n ~~~~~~~~~~~~~~~~~\n\n Main entry point for ``python -m pygments``.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport sys\nfrom pip._vendor.pygments.cmdline import main\n\ntry:\n sys.exit(main(sys.argv))\nexcept KeyboardInterrupt:\n sys.exit(1)\n",[],[216,809,810,811,890,891,1469,1566],"08dc8d32-67fc-11f0-84bb-0224a6c84d84","08dc8dbe-67fc-11f0-84bb-0224a6c84d84",319,["D",1753299262636],"\"\"\"\n Pygments\n ~~~~~~~~\n\n Pygments is a syntax highlighting package written in Python.\n\n It is a generic syntax highlighter for general use in all kinds of software\n such as forum systems, wikis or other applications that need to prettify\n source code. Highlights are:\n\n * a wide range of common languages and markup formats is supported\n * special attention is paid to details, increasing quality by a fair amount\n * support for new languages and formats are added easily\n * a number of output formats, presently HTML, LaTeX, RTF, SVG, all image\n formats that PIL supports, and ANSI sequences\n * it is usable as a command-line tool and as a library\n * ... and it highlights even Brainfuck!\n\n The `Pygments master branch`_ is installable with ``easy_install Pygments==dev``.\n\n .. _Pygments master branch:\n https://github.com/pygments/pygments/archive/master.zip#egg=Pygments-dev\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\nfrom io import StringIO, BytesIO\n\n__version__ = '2.19.1'\n__docformat__ = 'restructuredtext'\n\n__all__ = ['lex', 'format', 'highlight']\n\n\ndef lex(code, lexer):\n \"\"\"\n Lex `code` with the `lexer` (must be a `Lexer` instance)\n and return an iterable of tokens. Currently, this only calls\n `lexer.get_tokens()`.\n \"\"\"\n try:\n return lexer.get_tokens(code)\n except TypeError:\n # Heuristic to catch a common mistake.\n from pip._vendor.pygments.lexer import RegexLexer\n if isinstance(lexer, type) and issubclass(lexer, RegexLexer):\n raise TypeError('lex() argument must be a lexer instance, '\n 'not a class')\n raise\n\n\ndef format(tokens, formatter, outfile=None): # pylint: disable=redefined-builtin\n \"\"\"\n Format ``tokens`` (an iterable of tokens) with the formatter ``formatter``\n (a `Formatter` instance).\n\n If ``outfile`` is given and a valid file object (an object with a\n ``write`` method), the result will be written to it, otherwise it\n is returned as a string.\n \"\"\"\n try:\n if not outfile:\n realoutfile = getattr(formatter, 'encoding', None) and BytesIO() or StringIO()\n formatter.format(tokens, realoutfile)\n return realoutfile.getvalue()\n else:\n formatter.format(tokens, outfile)\n except TypeError:\n # Heuristic to catch a common mistake.\n from pip._vendor.pygments.formatter import Formatter\n if isinstance(formatter, type) and issubclass(formatter, Formatter):\n raise TypeError('format() argument must be a formatter instance, '\n 'not a class')\n raise\n\n\ndef highlight(code, lexer, formatter, outfile=None):\n \"\"\"\n This is the most high-level highlighting function. It combines `lex` and\n `format` in one function.\n \"\"\"\n return format(lex(code, lexer), formatter, outfile)\n",[],[216,809,810,811,890,891,1469,893],"08f6521c-67fc-11f0-85ab-0224a6c84d84","_mapping.py","08f652b2-67fc-11f0-85ab-0224a6c84d84","001951a8-67fc-11f0-805e-0224a6c84d84",323,["D",1753299262820],"# Automatically generated by scripts/gen_mapfiles.py.\n# DO NOT EDIT BY HAND; run `tox -e mapfiles` instead.\n\nSTYLES = {\n 'AbapStyle': ('pygments.styles.abap', 'abap', ()),\n 'AlgolStyle': ('pygments.styles.algol', 'algol', ()),\n 'Algol_NuStyle': ('pygments.styles.algol_nu', 'algol_nu', ()),\n 'ArduinoStyle': ('pygments.styles.arduino', 'arduino', ()),\n 'AutumnStyle': ('pygments.styles.autumn', 'autumn', ()),\n 'BlackWhiteStyle': ('pygments.styles.bw', 'bw', ()),\n 'BorlandStyle': ('pygments.styles.borland', 'borland', ()),\n 'CoffeeStyle': ('pygments.styles.coffee', 'coffee', ()),\n 'ColorfulStyle': ('pygments.styles.colorful', 'colorful', ()),\n 'DefaultStyle': ('pygments.styles.default', 'default', ()),\n 'DraculaStyle': ('pygments.styles.dracula', 'dracula', ()),\n 'EmacsStyle': ('pygments.styles.emacs', 'emacs', ()),\n 'FriendlyGrayscaleStyle': ('pygments.styles.friendly_grayscale', 'friendly_grayscale', ()),\n 'FriendlyStyle': ('pygments.styles.friendly', 'friendly', ()),\n 'FruityStyle': ('pygments.styles.fruity', 'fruity', ()),\n 'GhDarkStyle': ('pygments.styles.gh_dark', 'github-dark', ()),\n 'GruvboxDarkStyle': ('pygments.styles.gruvbox', 'gruvbox-dark', ()),\n 'GruvboxLightStyle': ('pygments.styles.gruvbox', 'gruvbox-light', ()),\n 'IgorStyle': ('pygments.styles.igor', 'igor', ()),\n 'InkPotStyle': ('pygments.styles.inkpot', 'inkpot', ()),\n 'LightbulbStyle': ('pygments.styles.lightbulb', 'lightbulb', ()),\n 'LilyPondStyle': ('pygments.styles.lilypond', 'lilypond', ()),\n 'LovelaceStyle': ('pygments.styles.lovelace', 'lovelace', ()),\n 'ManniStyle': ('pygments.styles.manni', 'manni', ()),\n 'MaterialStyle': ('pygments.styles.material', 'material', ()),\n 'MonokaiStyle': ('pygments.styles.monokai', 'monokai', ()),\n 'MurphyStyle': ('pygments.styles.murphy', 'murphy', ()),\n 'NativeStyle': ('pygments.styles.native', 'native', ()),\n 'NordDarkerStyle': ('pygments.styles.nord', 'nord-darker', ()),\n 'NordStyle': ('pygments.styles.nord', 'nord', ()),\n 'OneDarkStyle': ('pygments.styles.onedark', 'one-dark', ()),\n 'ParaisoDarkStyle': ('pygments.styles.paraiso_dark', 'paraiso-dark', ()),\n 'ParaisoLightStyle': ('pygments.styles.paraiso_light', 'paraiso-light', ()),\n 'PastieStyle': ('pygments.styles.pastie', 'pastie', ()),\n 'PerldocStyle': ('pygments.styles.perldoc', 'perldoc', ()),\n 'RainbowDashStyle': ('pygments.styles.rainbow_dash', 'rainbow_dash', ()),\n 'RrtStyle': ('pygments.styles.rrt', 'rrt', ()),\n 'SasStyle': ('pygments.styles.sas', 'sas', ()),\n 'SolarizedDarkStyle': ('pygments.styles.solarized', 'solarized-dark', ()),\n 'SolarizedLightStyle': ('pygments.styles.solarized', 'solarized-light', ()),\n 'StarofficeStyle': ('pygments.styles.staroffice', 'staroffice', ()),\n 'StataDarkStyle': ('pygments.styles.stata_dark', 'stata-dark', ()),\n 'StataLightStyle': ('pygments.styles.stata_light', 'stata-light', ()),\n 'TangoStyle': ('pygments.styles.tango', 'tango', ()),\n 'TracStyle': ('pygments.styles.trac', 'trac', ()),\n 'VimStyle': ('pygments.styles.vim', 'vim', ()),\n 'VisualStudioStyle': ('pygments.styles.vs', 'vs', ()),\n 'XcodeStyle': ('pygments.styles.xcode', 'xcode', ()),\n 'ZenburnStyle': ('pygments.styles.zenburn', 'zenburn', ()),\n}\n",[],[216,809,810,811,890,891,1469,1589,1581],"styles","08f2e42e-67fc-11f0-aedf-0224a6c84d84","08f2e528-67fc-11f0-aedf-0224a6c84d84",322,["D",1753299262796],"\"\"\"\n pygments.styles\n ~~~~~~~~~~~~~~~\n\n Contains built-in styles.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nfrom pip._vendor.pygments.plugin import find_plugin_styles\nfrom pip._vendor.pygments.util import ClassNotFound\nfrom pip._vendor.pygments.styles._mapping import STYLES\n\n#: A dictionary of built-in styles, mapping style names to\n#: ``'submodule::classname'`` strings.\n#: This list is deprecated. Use `pygments.styles.STYLES` instead\nSTYLE_MAP = {v[1]: v[0].split('.')[-1] + '::' + k for k, v in STYLES.items()}\n\n#: Internal reverse mapping to make `get_style_by_name` more efficient\n_STYLE_NAME_TO_MODULE_MAP = {v[1]: (v[0], k) for k, v in STYLES.items()}\n\n\ndef get_style_by_name(name):\n \"\"\"\n Return a style class by its short name. The names of the builtin styles\n are listed in :data:`pygments.styles.STYLE_MAP`.\n\n Will raise :exc:`pygments.util.ClassNotFound` if no style of that name is\n found.\n \"\"\"\n if name in _STYLE_NAME_TO_MODULE_MAP:\n mod, cls = _STYLE_NAME_TO_MODULE_MAP[name]\n builtin = \"yes\"\n else:\n for found_name, style in find_plugin_styles():\n if name == found_name:\n return style\n # perhaps it got dropped into our styles package\n builtin = \"\"\n mod = 'pygments.styles.' + name\n cls = name.title() + \"Style\"\n\n try:\n mod = __import__(mod, None, None, [cls])\n except ImportError:\n raise ClassNotFound(f\"Could not find style module {mod!r}\" +\n (builtin and \", though it should be builtin\")\n + \".\")\n try:\n return getattr(mod, cls)\n except AttributeError:\n raise ClassNotFound(f\"Could not find style class {cls!r} in style module.\")\n\n\ndef get_all_styles():\n \"\"\"Return a generator for all styles by name, both builtin and plugin.\"\"\"\n for v in STYLES.values():\n yield v[1]\n for name, _ in find_plugin_styles():\n yield name\n",[],[216,809,810,811,890,891,1469,1589,893],"001950fe-67fc-11f0-805e-0224a6c84d84",98,["D",1753299247949],[523,524],[216,809,810,811,890,891,1469,1589],"08a7b9ae-67fc-11f0-8d4e-0224a6c84d84","python.py","08a7ba58-67fc-11f0-8d4e-0224a6c84d84","ffea26da-67fb-11f0-8863-0224a6c84d84",313,["D",1753299262303],"\"\"\"\n pygments.lexers.python\n ~~~~~~~~~~~~~~~~~~~~~~\n\n Lexers for Python and related languages.\n\n :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport keyword\n\nfrom pip._vendor.pygments.lexer import DelegatingLexer, RegexLexer, include, \\\n bygroups, using, default, words, combined, this\nfrom pip._vendor.pygments.util import get_bool_opt, shebang_matches\nfrom pip._vendor.pygments.token import Text, Comment, Operator, Keyword, Name, String, \\\n Number, Punctuation, Generic, Other, Error, Whitespace\nfrom pip._vendor.pygments import unistring as uni\n\n__all__ = ['PythonLexer', 'PythonConsoleLexer', 'PythonTracebackLexer',\n 'Python2Lexer', 'Python2TracebackLexer',\n 'CythonLexer', 'DgLexer', 'NumPyLexer']\n\n\nclass PythonLexer(RegexLexer):\n \"\"\"\n For Python source code (version 3.x).\n\n .. versionchanged:: 2.5\n This is now the default ``PythonLexer``. It is still available as the\n alias ``Python3Lexer``.\n \"\"\"\n\n name = 'Python'\n url = 'https://www.python.org'\n aliases = ['python', 'py', 'sage', 'python3', 'py3', 'bazel', 'starlark', 'pyi']\n filenames = [\n '*.py',\n '*.pyw',\n # Type stubs\n '*.pyi',\n # Jython\n '*.jy',\n # Sage\n '*.sage',\n # SCons\n '*.sc',\n 'SConstruct',\n 'SConscript',\n # Skylark/Starlark (used by Bazel, Buck, and Pants)\n '*.bzl',\n 'BUCK',\n 'BUILD',\n 'BUILD.bazel',\n 'WORKSPACE',\n # Twisted Application infrastructure\n '*.tac',\n ]\n mimetypes = ['text/x-python', 'application/x-python',\n 'text/x-python3', 'application/x-python3']\n version_added = '0.10'\n\n uni_name = f\"[{uni.xid_start}][{uni.xid_continue}]*\"\n\n def innerstring_rules(ttype):\n return [\n # the old style '%s' % (...) string formatting (still valid in Py3)\n (r'%(\$\\w+\$)?[-#0 +]*([0-9]+|[*])?(\\.([0-9]+|[*]))?'\n '[hlL]?[E-GXc-giorsaux%]', String.Interpol),\n # the new style '{}'.format(...) string formatting\n (r'\\{'\n r'((\\w+)((\\.\\w+)|(\\[[^\\]]+\\]))*)?' # field name\n r'(\\![sra])?' # conversion\n r'(\\:(.?[<>=\\^])?[-+ ]?#?0?(\\d+)?,?(\\.\\d+)?[E-GXb-gnosx%]?)?'\n r'\\}', String.Interpol),\n\n # backslashes, quotes and formatting signs must be parsed one at a time\n (r'[^\\\\\\'\"%{\\n]+', ttype),\n (r'[\\'\"\\\\]', ttype),\n # unhandled string formatting sign\n (r'%|(\\{{1,2})', ttype)\n # newlines are an error (use \"nl\" state)\n ]\n\n def fstring_rules(ttype):\n return [\n # Assuming that a '}' is the closing brace after format specifier.\n # Sadly, this means that we won't detect syntax error. But it's\n # more important to parse correct syntax correctly, than to\n # highlight invalid syntax.\n (r'\\}', String.Interpol),\n (r'\\{', String.Interpol, 'expr-inside-fstring'),\n # backslashes, quotes and formatting signs must be parsed one at a time\n (r'[^\\\\\\'\"{}\\n]+', ttype),\n (r'[\\'\"\\\\]', ttype),\n # newlines are an error (use \"nl\" state)\n ]\n\n tokens = {\n 'root': [\n (r'\\n', Whitespace),\n (r'^(\\s*)([rRuUbB]{,2})(\"\"\"(?:.|\\n)*?\"\"\")',\n bygroups(Whitespace, String.Affix, String.Doc)),\n (r\"^(\\s*)([rRuUbB]{,2})('''(?:.|\\n)*?''')\",\n bygroups(Whitespace, String.Affix, String.Doc)),\n (r'\\A#!.+$', Comment.Hashbang),\n (r'#.*$', Comment.Single),\n (r'\\\\\\n', Text),\n (r'\\\\', Text),\n include('keywords'),\n include('soft-keywords'),\n (r'(def)((?:\\s|\\\\\\s)+)', bygroups(Keyword, Whitespace), 'funcname'),\n (r'(class)((?:\\s|\\\\\\s)+)', bygroups(Keyword, Whitespace), 'classname'),\n (r'(from)((?:\\s|\\\\\\s)+)', bygroups(Keyword.Namespace, Whitespace),\n 'fromimport'),\n (r'(import)((?:\\s|\\\\\\s)+)', bygroups(Keyword.Namespace, Whitespace),\n 'import'),\n include('expr'),\n ],\n 'expr': [\n # raw f-strings\n ('(?i)(rf|fr)(\"\"\")',\n bygroups(String.Affix, String.Double),\n combined('rfstringescape', 'tdqf')),\n (\"(?i)(rf|fr)(''')\",\n bygroups(String.Affix, String.Single),\n combined('rfstringescape', 'tsqf')),\n ('(?i)(rf|fr)(\")',\n bygroups(String.Affix, String.Double),\n combined('rfstringescape', 'dqf')),\n (\"(?i)(rf|fr)(')\",\n bygroups(String.Affix, String.Single),\n combined('rfstringescape', 'sqf')),\n # non-raw f-strings\n ('([fF])(\"\"\")', bygroups(String.Affix, String.Double),\n combined('fstringescape', 'tdqf')),\n (\"([fF])(''')\", bygroups(String.Affix, String.Single),\n combined('fstringescape', 'tsqf')),\n ('([fF])(\")', bygroups(String.Affix, String.Double),\n combined('fstringescape', 'dqf')),\n (\"([fF])(')\", bygroups(String.Affix, String.Single),\n combined('fstringescape', 'sqf')),\n # raw bytes and strings\n ('(?i)(rb|br|r)(\"\"\")',\n bygroups(String.Affix, String.Double), 'tdqs'),\n (\"(?i)(rb|br|r)(''')\",\n bygroups(String.Affix, String.Single), 'tsqs'),\n ('(?i)(rb|br|r)(\")',\n bygroups(String.Affix, String.Double), 'dqs'),\n (\"(?i)(rb|br|r)(')\",\n bygroups(String.Affix, String.Single), 'sqs'),\n # non-raw strings\n ('([uU]?)(\"\"\")', bygroups(String.Affix, String.Double),\n combined('stringescape', 'tdqs')),\n (\"([uU]?)(''')\", bygroups(String.Affix, String.Single),\n combined('stringescape', 'tsqs')),\n ('([uU]?)(\")', bygroups(String.Affix, String.Double),\n combined('stringescape', 'dqs')),\n (\"([uU]?)(')\", bygroups(String.Affix, String.Single),\n combined('stringescape', 'sqs')),\n # non-raw bytes\n ('([bB])(\"\"\")', bygroups(String.Affix, String.Double),\n combined('bytesescape', 'tdqs')),\n (\"([bB])(''')\", bygroups(String.Affix, String.Single),\n combined('bytesescape', 'tsqs')),\n ('([bB])(\")', bygroups(String.Affix, String.Double),\n combined('bytesescape', 'dqs')),\n (\"([bB])(')\", bygroups(String.Affix, String.Single),\n combined('bytesescape', 'sqs')),\n\n (r'[^\\S\\n]+', Text),\n include('numbers'),\n (r'!=|==|<<|>>|:=|[-~+/*%=<>&^|.]', Operator),\n (r'[]{}:(),;[]', Punctuation),\n (r'(in|is|and|or|not)\\b', Operator.Word),\n include('expr-keywords'),\n include('builtins'),\n include('magicfuncs'),\n include('magicvars'),\n include('name'),\n ],\n 'expr-inside-fstring': [\n (r'[{([]', Punctuation, 'expr-inside-fstring-inner'),\n # without format specifier\n (r'(=\\s*)?' # debug (https://bugs.python.org/issue36817)\n r'(\\![sraf])?' # conversion\n r'\\}', String.Interpol, '#pop'),\n # with format specifier\n # we'll catch the remaining '}' in the outer scope\n (r'(=\\s*)?' # debug (https://bugs.python.org/issue36817)\n r'(\\![sraf])?' # conversion\n r':', String.Interpol, '#pop'),\n (r'\\s+', Whitespace), # allow new lines\n include('expr'),\n ],\n 'expr-inside-fstring-inner': [\n (r'[{([]', Punctuation, 'expr-inside-fstring-inner'),\n (r'[])}]', Punctuation, '#pop'),\n (r'\\s+', Whitespace), # allow new lines\n include('expr'),\n ],\n 'expr-keywords': [\n # Based on https://docs.python.org/3/reference/expressions.html\n (words((\n 'async for', 'await', 'else', 'for', 'if', 'lambda',\n 'yield', 'yield from'), suffix=r'\\b'),\n Keyword),\n (words(('True', 'False', 'None'), suffix=r'\\b'), Keyword.Constant),\n ],\n 'keywords': [\n (words((\n 'assert', 'async', 'await', 'break', 'continue', 'del', 'elif',\n 'else', 'except', 'finally', 'for', 'global', 'if', 'lambda',\n 'pass', 'raise', 'nonlocal', 'return', 'try', 'while', 'yield',\n 'yield from', 'as', 'with'), suffix=r'\\b'),\n Keyword),\n (words(('True', 'False', 'None'), suffix=r'\\b'), Keyword.Constant),\n ],\n 'soft-keywords': [\n # `match`, `case` and `_` soft keywords\n (r'(^[ \\t]*)' # at beginning of line + possible indentation\n r'(match|case)\\b' # a possible keyword\n r'(?![ \\t]*(?:' # not followed by...\n r'[:,;=^&|@~)\\]}]|(?:' + # characters and keywords that mean this isn't\n # pattern matching (but None/True/False is ok)\n r'|'.join(k for k in keyword.kwlist if k[0].islower()) + r')\\b))',\n bygroups(Text, Keyword), 'soft-keywords-inner'),\n ],\n 'soft-keywords-inner': [\n # optional `_` keyword\n (r'(\\s+)([^\\n_]*)(_\\b)', bygroups(Whitespace, using(this), Keyword)),\n default('#pop')\n ],\n 'builtins': [\n (words((\n '__import__', 'abs', 'aiter', 'all', 'any', 'bin', 'bool', 'bytearray',\n 'breakpoint', 'bytes', 'callable', 'chr', 'classmethod', 'compile',\n 'complex', 'delattr', 'dict', 'dir', 'divmod', 'enumerate', 'eval',\n 'filter', 'float', 'format', 'frozenset', 'getattr', 'globals',\n 'hasattr', 'hash', 'hex', 'id', 'input', 'int', 'isinstance',\n 'issubclass', 'iter', 'len', 'list', 'locals', 'map', 'max',\n 'memoryview', 'min', 'next', 'object', 'oct', 'open', 'ord', 'pow',\n 'print', 'property', 'range', 'repr', 'reversed', 'round', 'set',\n 'setattr', 'slice', 'sorted', 'staticmethod', 'str', 'sum', 'super',\n 'tuple', 'type', 'vars', 'zip'), prefix=r'(?>|[-~+/*%=<>&^|.]', Operator),\n include('keywords'),\n (r'(def)((?:\\s|\\\\\\s)+)', bygroups(Keyword, Whitespace), 'funcname'),\n (r'(class)((?:\\s|\\\\\\s)+)', bygroups(Keyword, Whitespace), 'classname'),\n (r'(from)((?:\\s|\\\\\\s)+)', bygroups(Keyword.Namespace, Whitespace),\n 'fromimport'),\n (r'(import)((?:\\s|\\\\\\s)+)', bygroups(Keyword.Namespace, Whitespace),\n 'import'),\n include('builtins'),\n include('magicfuncs'),\n include('magicvars'),\n include('backtick'),\n ('([rR]|[uUbB][rR]|[rR][uUbB])(\"\"\")',\n bygroups(String.Affix, String.Double), 'tdqs'),\n (\"([rR]|[uUbB][rR]|[rR][uUbB])(''')\",\n bygroups(String.Affix, String.Single), 'tsqs'),\n ('([rR]|[uUbB][rR]|[rR][uUbB])(\")',\n bygroups(String.Affix, String.Double), 'dqs'),\n (\"([rR]|[uUbB][rR]|[rR][uUbB])(')\",\n bygroups(String.Affix, String.Single), 'sqs'),\n ('([uUbB]?)(\"\"\")', bygroups(String.Affix, String.Double),\n combined('stringescape', 'tdqs')),\n (\"([uUbB]?)(''')\", bygroups(String.Affix, String.Single),\n combined('stringescape', 'tsqs')),\n ('([uUbB]?)(\")', bygroups(String.Affix, String.Double),\n combined('stringescape', 'dqs')),\n (\"([uUbB]?)(')\", bygroups(String.Affix, String.Single),\n combined('stringescape', 'sqs')),\n include('name'),\n include('numbers'),\n ],\n 'keywords': [\n (words((\n 'assert', 'break', 'continue', 'del', 'elif', 'else', 'except',\n 'exec', 'finally', 'for', 'global', 'if', 'lambda', 'pass',\n 'print', 'raise', 'return', 'try', 'while', 'yield',\n 'yield from', 'as', 'with'), suffix=r'\\b'),\n Keyword),\n ],\n 'builtins': [\n (words((\n '__import__', 'abs', 'all', 'any', 'apply', 'basestring', 'bin',\n 'bool', 'buffer', 'bytearray', 'bytes', 'callable', 'chr', 'classmethod',\n 'cmp', 'coerce', 'compile', 'complex', 'delattr', 'dict', 'dir', 'divmod',\n 'enumerate', 'eval', 'execfile', 'exit', 'file', 'filter', 'float',\n 'frozenset', 'getattr', 'globals', 'hasattr', 'hash', 'hex', 'id',\n 'input', 'int', 'intern', 'isinstance', 'issubclass', 'iter', 'len',\n 'list', 'locals', 'long', 'map', 'max', 'min', 'next', 'object',\n 'oct', 'open', 'ord', 'pow', 'property', 'range', 'raw_input', 'reduce',\n 'reload', 'repr', 'reversed', 'round', 'set', 'setattr', 'slice',\n 'sorted', 'staticmethod', 'str', 'sum', 'super', 'tuple', 'type',\n 'unichr', 'unicode', 'vars', 'xrange', 'zip'),\n prefix=r'(?>> )(.*\\n)', bygroups(Generic.Prompt, Other.Code), 'continuations'),\n # This happens, e.g., when tracebacks are embedded in documentation;\n # trailing whitespaces are often stripped in such contexts.\n (r'(>>>)(\\n)', bygroups(Generic.Prompt, Whitespace)),\n (r'(\\^C)?Traceback \$most recent call last\$:\\n', Other.Traceback, 'traceback'),\n # SyntaxError starts with this\n (r' File \"[^\"]+\", line \\d+', Other.Traceback, 'traceback'),\n (r'.*\\n', Generic.Output),\n ],\n 'continuations': [\n (r'(\\.\\.\\. )(.*\\n)', bygroups(Generic.Prompt, Other.Code)),\n # See above.\n (r'(\\.\\.\\.)(\\n)', bygroups(Generic.Prompt, Whitespace)),\n default('#pop'),\n ],\n 'traceback': [\n # As soon as we see a traceback, consume everything until the next\n # >>> prompt.\n (r'(?=>>>( |$))', Text, '#pop'),\n (r'(KeyboardInterrupt)(\\n)', bygroups(Name.Class, Whitespace)),\n (r'.*\\n', Other.Traceback),\n ],\n }\n\n\nclass PythonConsoleLexer(DelegatingLexer):\n \"\"\"\n For Python console output or doctests, such as:\n\n .. sourcecode:: pycon\n\n >>> a = 'foo'\n >>> print(a)\n foo\n >>> 1 / 0\n Traceback (most recent call last):\n File \"\", line 1, in \n ZeroDivisionError: integer division or modulo by zero\n\n Additional options:\n\n `python3`\n Use Python 3 lexer for code. Default is ``True``.\n\n .. versionadded:: 1.0\n .. versionchanged:: 2.5\n Now defaults to ``True``.\n \"\"\"\n\n name = 'Python console session'\n aliases = ['pycon', 'python-console']\n mimetypes = ['text/x-python-doctest']\n url = 'https://python.org'\n version_added = ''\n\n def __init__(self, **options):\n python3 = get_bool_opt(options, 'python3', True)\n if python3:\n pylexer = PythonLexer\n tblexer = PythonTracebackLexer\n else:\n pylexer = Python2Lexer\n tblexer = Python2TracebackLexer\n # We have two auxiliary lexers. Use DelegatingLexer twice with\n # different tokens. TODO: DelegatingLexer should support this\n # directly, by accepting a tuplet of auxiliary lexers and a tuple of\n # distinguishing tokens. Then we wouldn't need this intermediary\n # class.\n class _ReplaceInnerCode(DelegatingLexer):\n def __init__(self, **options):\n super().__init__(pylexer, _PythonConsoleLexerBase, Other.Code, **options)\n super().__init__(tblexer, _ReplaceInnerCode, Other.Traceback, **options)\n\n\nclass PythonTracebackLexer(RegexLexer):\n \"\"\"\n For Python 3.x tracebacks, with support for chained exceptions.\n\n .. versionchanged:: 2.5\n This is now the default ``PythonTracebackLexer``. It is still available\n as the alias ``Python3TracebackLexer``.\n \"\"\"\n\n name = 'Python Traceback'\n aliases = ['pytb', 'py3tb']\n filenames = ['*.pytb', '*.py3tb']\n mimetypes = ['text/x-python-traceback', 'text/x-python3-traceback']\n url = 'https://python.org'\n version_added = '1.0'\n\n tokens = {\n 'root': [\n (r'\\n', Whitespace),\n (r'^(\\^C)?Traceback \$most recent call last\$:\\n', Generic.Traceback, 'intb'),\n (r'^During handling of the above exception, another '\n r'exception occurred:\\n\\n', Generic.Traceback),\n (r'^The above exception was the direct cause of the '\n r'following exception:\\n\\n', Generic.Traceback),\n (r'^(?= File \"[^\"]+\", line \\d+)', Generic.Traceback, 'intb'),\n (r'^.*\\n', Other),\n ],\n 'intb': [\n (r'^( File )(\"[^\"]+\")(, line )(\\d+)(, in )(.+)(\\n)',\n bygroups(Text, Name.Builtin, Text, Number, Text, Name, Whitespace)),\n (r'^( File )(\"[^\"]+\")(, line )(\\d+)(\\n)',\n bygroups(Text, Name.Builtin, Text, Number, Whitespace)),\n (r'^( )(.+)(\\n)',\n bygroups(Whitespace, using(PythonLexer), Whitespace), 'markers'),\n (r'^([ \\t]*)(\\.\\.\\.)(\\n)',\n bygroups(Whitespace, Comment, Whitespace)), # for doctests...\n (r'^([^:]+)(: )(.+)(\\n)',\n bygroups(Generic.Error, Text, Name, Whitespace), '#pop'),\n (r'^([a-zA-Z_][\\w.]*)(:?\\n)',\n bygroups(Generic.Error, Whitespace), '#pop'),\n default('#pop'),\n ],\n 'markers': [\n # Either `PEP 657 `\n # error locations in Python 3.11+, or single-caret markers\n # for syntax errors before that.\n (r'^( {4,})([~^]+)(\\n)',\n bygroups(Whitespace, Punctuation.Marker, Whitespace),\n '#pop'),\n default('#pop'),\n ],\n }\n\n\nPython3TracebackLexer = PythonTracebackLexer\n\n\nclass Python2TracebackLexer(RegexLexer):\n \"\"\"\n For Python tracebacks.\n\n .. versionchanged:: 2.5\n This class has been renamed from ``PythonTracebackLexer``.\n ``PythonTracebackLexer`` now refers to the Python 3 variant.\n \"\"\"\n\n name = 'Python 2.x Traceback'\n aliases = ['py2tb']\n filenames = ['*.py2tb']\n mimetypes = ['text/x-python2-traceback']\n url = 'https://python.org'\n version_added = '0.7'\n\n tokens = {\n 'root': [\n # Cover both (most recent call last) and (innermost last)\n # The optional ^C allows us to catch keyboard interrupt signals.\n (r'^(\\^C)?(Traceback.*\\n)',\n bygroups(Text, Generic.Traceback), 'intb'),\n # SyntaxError starts with this.\n (r'^(?= File \"[^\"]+\", line \\d+)', Generic.Traceback, 'intb'),\n (r'^.*\\n', Other),\n ],\n 'intb': [\n (r'^( File )(\"[^\"]+\")(, line )(\\d+)(, in )(.+)(\\n)',\n bygroups(Text, Name.Builtin, Text, Number, Text, Name, Whitespace)),\n (r'^( File )(\"[^\"]+\")(, line )(\\d+)(\\n)',\n bygroups(Text, Name.Builtin, Text, Number, Whitespace)),\n (r'^( )(.+)(\\n)',\n bygroups(Text, using(Python2Lexer), Whitespace), 'marker'),\n (r'^([ \\t]*)(\\.\\.\\.)(\\n)',\n bygroups(Text, Comment, Whitespace)), # for doctests...\n (r'^([^:]+)(: )(.+)(\\n)',\n bygroups(Generic.Error, Text, Name, Whitespace), '#pop'),\n (r'^([a-zA-Z_]\\w*)(:?\\n)',\n bygroups(Generic.Error, Whitespace), '#pop')\n ],\n 'marker': [\n # For syntax errors.\n (r'( {4,})(\\^)', bygroups(Text, Punctuation.Marker), '#pop'),\n default('#pop'),\n ],\n }\n\n\nclass CythonLexer(RegexLexer):\n \"\"\"\n For Pyrex and Cython source code.\n \"\"\"\n\n name = 'Cython'\n url = 'https://cython.org'\n aliases = ['cython', 'pyx', 'pyrex']\n filenames = ['*.pyx', '*.pxd', '*.pxi']\n mimetypes = ['text/x-cython', 'application/x-cython']\n version_added = '1.1'\n\n tokens = {\n 'root': [\n (r'\\n', Whitespace),\n (r'^(\\s*)(\"\"\"(?:.|\\n)*?\"\"\")', bygroups(Whitespace, String.Doc)),\n (r\"^(\\s*)('''(?:.|\\n)*?''')\", bygroups(Whitespace, String.Doc)),\n (r'[^\\S\\n]+', Text),\n (r'#.*$', Comment),\n (r'[]{}:(),;[]', Punctuation),\n (r'\\\\\\n', Whitespace),\n (r'\\\\', Text),\n (r'(in|is|and|or|not)\\b', Operator.Word),\n (r'(<)([a-zA-Z0-9.?]+)(>)',\n bygroups(Punctuation, Keyword.Type, Punctuation)),\n (r'!=|==|<<|>>|[-~+/*%=<>&^|.?]', Operator),\n (r'(from)(\\d+)(<=)(\\s+)(<)(\\d+)(:)',\n bygroups(Keyword, Number.Integer, Operator, Whitespace, Operator,\n Name, Punctuation)),\n include('keywords'),\n (r'(def|property)(\\s+)', bygroups(Keyword, Whitespace), 'funcname'),\n (r'(cp?def)(\\s+)', bygroups(Keyword, Whitespace), 'cdef'),\n # (should actually start a block with only cdefs)\n (r'(cdef)(:)', bygroups(Keyword, Punctuation)),\n (r'(class|struct)(\\s+)', bygroups(Keyword, Whitespace), 'classname'),\n (r'(from)(\\s+)', bygroups(Keyword, Whitespace), 'fromimport'),\n (r'(c?import)(\\s+)', bygroups(Keyword, Whitespace), 'import'),\n include('builtins'),\n include('backtick'),\n ('(?:[rR]|[uU][rR]|[rR][uU])\"\"\"', String, 'tdqs'),\n (\"(?:[rR]|[uU][rR]|[rR][uU])'''\", String, 'tsqs'),\n ('(?:[rR]|[uU][rR]|[rR][uU])\"', String, 'dqs'),\n (\"(?:[rR]|[uU][rR]|[rR][uU])'\", String, 'sqs'),\n ('[uU]?\"\"\"', String, combined('stringescape', 'tdqs')),\n (\"[uU]?'''\", String, combined('stringescape', 'tsqs')),\n ('[uU]?\"', String, combined('stringescape', 'dqs')),\n (\"[uU]?'\", String, combined('stringescape', 'sqs')),\n include('name'),\n include('numbers'),\n ],\n 'keywords': [\n (words((\n 'assert', 'async', 'await', 'break', 'by', 'continue', 'ctypedef', 'del', 'elif',\n 'else', 'except', 'except?', 'exec', 'finally', 'for', 'fused', 'gil',\n 'global', 'if', 'include', 'lambda', 'nogil', 'pass', 'print',\n 'raise', 'return', 'try', 'while', 'yield', 'as', 'with'), suffix=r'\\b'),\n Keyword),\n (r'(DEF|IF|ELIF|ELSE)\\b', Comment.Preproc),\n ],\n 'builtins': [\n (words((\n '__import__', 'abs', 'all', 'any', 'apply', 'basestring', 'bin', 'bint',\n 'bool', 'buffer', 'bytearray', 'bytes', 'callable', 'chr',\n 'classmethod', 'cmp', 'coerce', 'compile', 'complex', 'delattr',\n 'dict', 'dir', 'divmod', 'enumerate', 'eval', 'execfile', 'exit',\n 'file', 'filter', 'float', 'frozenset', 'getattr', 'globals',\n 'hasattr', 'hash', 'hex', 'id', 'input', 'int', 'intern', 'isinstance',\n 'issubclass', 'iter', 'len', 'list', 'locals', 'long', 'map', 'max',\n 'min', 'next', 'object', 'oct', 'open', 'ord', 'pow', 'property', 'Py_ssize_t',\n 'range', 'raw_input', 'reduce', 'reload', 'repr', 'reversed',\n 'round', 'set', 'setattr', 'slice', 'sorted', 'staticmethod',\n 'str', 'sum', 'super', 'tuple', 'type', 'unichr', 'unicode', 'unsigned',\n 'vars', 'xrange', 'zip'), prefix=r'(? best_lexer[0]:\n best_lexer[:] = (rv, lexer)\n if not best_lexer[0] or best_lexer[1] is None:\n raise ClassNotFound('no lexer matching the text found')\n return best_lexer[1](**options)\n\n\nclass _automodule(types.ModuleType):\n \"\"\"Automatically import lexers.\"\"\"\n\n def __getattr__(self, name):\n info = LEXERS.get(name)\n if info:\n _load_lexers(info[0])\n cls = _lexer_cache[info[1]]\n setattr(self, name, cls)\n return cls\n if name in COMPAT:\n return getattr(self, COMPAT[name])\n raise AttributeError(name)\n\n\noldmod = sys.modules[__name__]\nnewmod = _automodule(__name__)\nnewmod.__dict__.update(oldmod.__dict__)\nsys.modules[__name__] = newmod\ndel newmod.newmod, newmod.oldmod, newmod.sys, newmod.types\n",[],[216,809,810,811,890,891,1469,1611,893],"ffea2612-67fb-11f0-8863-0224a6c84d84",96,["D",1753299247640],[519,520,521],[216,809,810,811,890,891,1469,1611],"08e4af3a-67fc-11f0-b489-0224a6c84d84","08e4afee-67fc-11f0-b489-0224a6c84d84","0001bf8e-67fc-11f0-847e-0224a6c84d84",321,["D",1753299262694],"# Automatically generated by scripts/gen_mapfiles.py.\n# DO NOT EDIT BY HAND; run `tox -e mapfiles` instead.\n\nFORMATTERS = {\n 'BBCodeFormatter': ('pygments.formatters.bbcode', 'BBCode', ('bbcode', 'bb'), (), 'Format tokens with BBcodes. These formatting codes are used by many bulletin boards, so you can highlight your sourcecode with pygments before posting it there.'),\n 'BmpImageFormatter': ('pygments.formatters.img', 'img_bmp', ('bmp', 'bitmap'), ('*.bmp',), 'Create a bitmap image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),\n 'GifImageFormatter': ('pygments.formatters.img', 'img_gif', ('gif',), ('*.gif',), 'Create a GIF image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),\n 'GroffFormatter': ('pygments.formatters.groff', 'groff', ('groff', 'troff', 'roff'), (), 'Format tokens with groff escapes to change their color and font style.'),\n 'HtmlFormatter': ('pygments.formatters.html', 'HTML', ('html',), ('*.html', '*.htm'), \"Format tokens as HTML 4 ```` tags. By default, the content is enclosed in a ``

`` tag, itself wrapped in a ```` tag (but see the `nowrap` option). The ````'s CSS class can be set by the `cssclass` option.\"),\n    'IRCFormatter': ('pygments.formatters.irc', 'IRC', ('irc', 'IRC'), (), 'Format tokens with IRC color sequences'),\n    'ImageFormatter': ('pygments.formatters.img', 'img', ('img', 'IMG', 'png'), ('*.png',), 'Create a PNG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),\n    'JpgImageFormatter': ('pygments.formatters.img', 'img_jpg', ('jpg', 'jpeg'), ('*.jpg',), 'Create a JPEG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),\n    'LatexFormatter': ('pygments.formatters.latex', 'LaTeX', ('latex', 'tex'), ('*.tex',), 'Format tokens as LaTeX code. This needs the `fancyvrb` and `color` standard packages.'),\n    'NullFormatter': ('pygments.formatters.other', 'Text only', ('text', 'null'), ('*.txt',), 'Output the text unchanged without any formatting.'),\n    'PangoMarkupFormatter': ('pygments.formatters.pangomarkup', 'Pango Markup', ('pango', 'pangomarkup'), (), 'Format tokens as Pango Markup code. It can then be rendered to an SVG.'),\n    'RawTokenFormatter': ('pygments.formatters.other', 'Raw tokens', ('raw', 'tokens'), ('*.raw',), 'Format tokens as a raw representation for storing token streams.'),\n    'RtfFormatter': ('pygments.formatters.rtf', 'RTF', ('rtf',), ('*.rtf',), 'Format tokens as RTF markup. This formatter automatically outputs full RTF documents with color information and other useful stuff. Perfect for Copy and Paste into Microsoft(R) Word(R) documents.'),\n    'SvgFormatter': ('pygments.formatters.svg', 'SVG', ('svg',), ('*.svg',), 'Format tokens as an SVG graphics file.  This formatter is still experimental. Each line of code is a ```` element with explicit ``x`` and ``y`` coordinates containing ```` elements with the individual token styles.'),\n    'Terminal256Formatter': ('pygments.formatters.terminal256', 'Terminal256', ('terminal256', 'console256', '256'), (), 'Format tokens with ANSI color sequences, for output in a 256-color terminal or console.  Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'),\n    'TerminalFormatter': ('pygments.formatters.terminal', 'Terminal', ('terminal', 'console'), (), 'Format tokens with ANSI color sequences, for output in a text console. Color sequences are terminated at newlines, so that paging the output works correctly.'),\n    'TerminalTrueColorFormatter': ('pygments.formatters.terminal256', 'TerminalTrueColor', ('terminal16m', 'console16m', '16m'), (), 'Format tokens with ANSI color sequences, for output in a true-color terminal or console.  Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'),\n    'TestcaseFormatter': ('pygments.formatters.other', 'Testcase', ('testcase',), (), 'Format tokens as appropriate for a new testcase.'),\n}\n",[],[216,809,810,811,890,891,1469,1639,1581],"formatters","08e0fb38-67fc-11f0-928e-0224a6c84d84","08e0fbec-67fc-11f0-928e-0224a6c84d84",320,["D",1753299262675],"\"\"\"\n    pygments.formatters\n    ~~~~~~~~~~~~~~~~~~~\n\n    Pygments formatters.\n\n    :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n    :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\nimport sys\nimport types\nimport fnmatch\nfrom os.path import basename\n\nfrom pip._vendor.pygments.formatters._mapping import FORMATTERS\nfrom pip._vendor.pygments.plugin import find_plugin_formatters\nfrom pip._vendor.pygments.util import ClassNotFound\n\n__all__ = ['get_formatter_by_name', 'get_formatter_for_filename',\n           'get_all_formatters', 'load_formatter_from_file'] + list(FORMATTERS)\n\n_formatter_cache = {}  # classes by name\n_pattern_cache = {}\n\n\ndef _fn_matches(fn, glob):\n    \"\"\"Return whether the supplied file name fn matches pattern filename.\"\"\"\n    if glob not in _pattern_cache:\n        pattern = _pattern_cache[glob] = re.compile(fnmatch.translate(glob))\n        return pattern.match(fn)\n    return _pattern_cache[glob].match(fn)\n\n\ndef _load_formatters(module_name):\n    \"\"\"Load a formatter (and all others in the module too).\"\"\"\n    mod = __import__(module_name, None, None, ['__all__'])\n    for formatter_name in mod.__all__:\n        cls = getattr(mod, formatter_name)\n        _formatter_cache[cls.name] = cls\n\n\ndef get_all_formatters():\n    \"\"\"Return a generator for all formatter classes.\"\"\"\n    # NB: this returns formatter classes, not info like get_all_lexers().\n    for info in FORMATTERS.values():\n        if info[1] not in _formatter_cache:\n            _load_formatters(info[0])\n        yield _formatter_cache[info[1]]\n    for _, formatter in find_plugin_formatters():\n        yield formatter\n\n\ndef find_formatter_class(alias):\n    \"\"\"Lookup a formatter by alias.\n\n    Returns None if not found.\n    \"\"\"\n    for module_name, name, aliases, _, _ in FORMATTERS.values():\n        if alias in aliases:\n            if name not in _formatter_cache:\n                _load_formatters(module_name)\n            return _formatter_cache[name]\n    for _, cls in find_plugin_formatters():\n        if alias in cls.aliases:\n            return cls\n\n\ndef get_formatter_by_name(_alias, **options):\n    \"\"\"\n    Return an instance of a :class:`.Formatter` subclass that has `alias` in its\n    aliases list. The formatter is given the `options` at its instantiation.\n\n    Will raise :exc:`pygments.util.ClassNotFound` if no formatter with that\n    alias is found.\n    \"\"\"\n    cls = find_formatter_class(_alias)\n    if cls is None:\n        raise ClassNotFound(f\"no formatter found for name {_alias!r}\")\n    return cls(**options)\n\n\ndef load_formatter_from_file(filename, formattername=\"CustomFormatter\", **options):\n    \"\"\"\n    Return a `Formatter` subclass instance loaded from the provided file, relative\n    to the current directory.\n\n    The file is expected to contain a Formatter class named ``formattername``\n    (by default, CustomFormatter). Users should be very careful with the input, because\n    this method is equivalent to running ``eval()`` on the input file. The formatter is\n    given the `options` at its instantiation.\n\n    :exc:`pygments.util.ClassNotFound` is raised if there are any errors loading\n    the formatter.\n\n    .. versionadded:: 2.2\n    \"\"\"\n    try:\n        # This empty dict will contain the namespace for the exec'd file\n        custom_namespace = {}\n        with open(filename, 'rb') as f:\n            exec(f.read(), custom_namespace)\n        # Retrieve the class `formattername` from that namespace\n        if formattername not in custom_namespace:\n            raise ClassNotFound(f'no valid {formattername} class found in {filename}')\n        formatter_class = custom_namespace[formattername]\n        # And finally instantiate it with the options\n        return formatter_class(**options)\n    except OSError as err:\n        raise ClassNotFound(f'cannot read {filename}: {err}')\n    except ClassNotFound:\n        raise\n    except Exception as err:\n        raise ClassNotFound(f'error when loading custom formatter: {err}')\n\n\ndef get_formatter_for_filename(fn, **options):\n    \"\"\"\n    Return a :class:`.Formatter` subclass instance that has a filename pattern\n    matching `fn`. The formatter is given the `options` at its instantiation.\n\n    Will raise :exc:`pygments.util.ClassNotFound` if no formatter for that filename\n    is found.\n    \"\"\"\n    fn = basename(fn)\n    for modname, name, _, filenames, _ in FORMATTERS.values():\n        for filename in filenames:\n            if _fn_matches(fn, filename):\n                if name not in _formatter_cache:\n                    _load_formatters(modname)\n                return _formatter_cache[name](**options)\n    for _name, cls in find_plugin_formatters():\n        for filename in cls.filenames:\n            if _fn_matches(fn, filename):\n                return cls(**options)\n    raise ClassNotFound(f\"no formatter found for file name {fn!r}\")\n\n\nclass _automodule(types.ModuleType):\n    \"\"\"Automatically import formatters.\"\"\"\n\n    def __getattr__(self, name):\n        info = FORMATTERS.get(name)\n        if info:\n            _load_formatters(info[0])\n            cls = _formatter_cache[info[1]]\n            setattr(self, name, cls)\n            return cls\n        raise AttributeError(name)\n\n\noldmod = sys.modules[__name__]\nnewmod = _automodule(__name__)\nnewmod.__dict__.update(oldmod.__dict__)\nsys.modules[__name__] = newmod\ndel newmod.newmod, newmod.oldmod, newmod.sys, newmod.types\n",[],[216,809,810,811,890,891,1469,1639,893],"0001be6c-67fc-11f0-847e-0224a6c84d84",97,["D",1753299247795],[516,517],[216,809,810,811,890,891,1469,1639],"093b075e-67fc-11f0-95df-0224a6c84d84","093b0830-67fc-11f0-95df-0224a6c84d84","ffd22a3a-67fb-11f0-84bb-0224a6c84d84",332,["D",1753299261985],"\"\"\"\n    pygments.filters\n    ~~~~~~~~~~~~~~~~\n\n    Module containing filter lookup functions and default\n    filters.\n\n    :copyright: Copyright 2006-2025 by the Pygments team, see AUTHORS.\n    :license: BSD, see LICENSE for details.\n\"\"\"\n\nimport re\n\nfrom pip._vendor.pygments.token import String, Comment, Keyword, Name, Error, Whitespace, \\\n    string_to_tokentype\nfrom pip._vendor.pygments.filter import Filter\nfrom pip._vendor.pygments.util import get_list_opt, get_int_opt, get_bool_opt, \\\n    get_choice_opt, ClassNotFound, OptionError\nfrom pip._vendor.pygments.plugin import find_plugin_filters\n\n\ndef find_filter_class(filtername):\n    \"\"\"Lookup a filter by name. Return None if not found.\"\"\"\n    if filtername in FILTERS:\n        return FILTERS[filtername]\n    for name, cls in find_plugin_filters():\n        if name == filtername:\n            return cls\n    return None\n\n\ndef get_filter_by_name(filtername, **options):\n    \"\"\"Return an instantiated filter.\n\n    Options are passed to the filter initializer if wanted.\n    Raise a ClassNotFound if not found.\n    \"\"\"\n    cls = find_filter_class(filtername)\n    if cls:\n        return cls(**options)\n    else:\n        raise ClassNotFound(f'filter {filtername!r} not found')\n\n\ndef get_all_filters():\n    \"\"\"Return a generator of all filter names.\"\"\"\n    yield from FILTERS\n    for name, _ in find_plugin_filters():\n        yield name\n\n\ndef _replace_special(ttype, value, regex, specialttype,\n                     replacefunc=lambda x: x):\n    last = 0\n    for match in regex.finditer(value):\n        start, end = match.start(), match.end()\n        if start != last:\n            yield ttype, value[last:start]\n        yield specialttype, replacefunc(value[start:end])\n        last = end\n    if last != len(value):\n        yield ttype, value[last:]\n\n\nclass CodeTagFilter(Filter):\n    \"\"\"Highlight special code tags in comments and docstrings.\n\n    Options accepted:\n\n    `codetags` : list of strings\n       A list of strings that are flagged as code tags.  The default is to\n       highlight ``XXX``, ``TODO``, ``FIXME``, ``BUG`` and ``NOTE``.\n\n    .. versionchanged:: 2.13\n       Now recognizes ``FIXME`` by default.\n    \"\"\"\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        tags = get_list_opt(options, 'codetags',\n                            ['XXX', 'TODO', 'FIXME', 'BUG', 'NOTE'])\n        self.tag_re = re.compile(r'\\b({})\\b'.format('|'.join([\n            re.escape(tag) for tag in tags if tag\n        ])))\n\n    def filter(self, lexer, stream):\n        regex = self.tag_re\n        for ttype, value in stream:\n            if ttype in String.Doc or \\\n               ttype in Comment and \\\n               ttype not in Comment.Preproc:\n                yield from _replace_special(ttype, value, regex, Comment.Special)\n            else:\n                yield ttype, value\n\n\nclass SymbolFilter(Filter):\n    \"\"\"Convert mathematical symbols such as \\\\ in Isabelle\n    or \\\\longrightarrow in LaTeX into Unicode characters.\n\n    This is mostly useful for HTML or console output when you want to\n    approximate the source rendering you'd see in an IDE.\n\n    Options accepted:\n\n    `lang` : string\n       The symbol language. Must be one of ``'isabelle'`` or\n       ``'latex'``.  The default is ``'isabelle'``.\n    \"\"\"\n\n    latex_symbols = {\n        '\\\\alpha'                : '\\U000003b1',\n        '\\\\beta'                 : '\\U000003b2',\n        '\\\\gamma'                : '\\U000003b3',\n        '\\\\delta'                : '\\U000003b4',\n        '\\\\varepsilon'           : '\\U000003b5',\n        '\\\\zeta'                 : '\\U000003b6',\n        '\\\\eta'                  : '\\U000003b7',\n        '\\\\vartheta'             : '\\U000003b8',\n        '\\\\iota'                 : '\\U000003b9',\n        '\\\\kappa'                : '\\U000003ba',\n        '\\\\lambda'               : '\\U000003bb',\n        '\\\\mu'                   : '\\U000003bc',\n        '\\\\nu'                   : '\\U000003bd',\n        '\\\\xi'                   : '\\U000003be',\n        '\\\\pi'                   : '\\U000003c0',\n        '\\\\varrho'               : '\\U000003c1',\n        '\\\\sigma'                : '\\U000003c3',\n        '\\\\tau'                  : '\\U000003c4',\n        '\\\\upsilon'              : '\\U000003c5',\n        '\\\\varphi'               : '\\U000003c6',\n        '\\\\chi'                  : '\\U000003c7',\n        '\\\\psi'                  : '\\U000003c8',\n        '\\\\omega'                : '\\U000003c9',\n        '\\\\Gamma'                : '\\U00000393',\n        '\\\\Delta'                : '\\U00000394',\n        '\\\\Theta'                : '\\U00000398',\n        '\\\\Lambda'               : '\\U0000039b',\n        '\\\\Xi'                   : '\\U0000039e',\n        '\\\\Pi'                   : '\\U000003a0',\n        '\\\\Sigma'                : '\\U000003a3',\n        '\\\\Upsilon'              : '\\U000003a5',\n        '\\\\Phi'                  : '\\U000003a6',\n        '\\\\Psi'                  : '\\U000003a8',\n        '\\\\Omega'                : '\\U000003a9',\n        '\\\\leftarrow'            : '\\U00002190',\n        '\\\\longleftarrow'        : '\\U000027f5',\n        '\\\\rightarrow'           : '\\U00002192',\n        '\\\\longrightarrow'       : '\\U000027f6',\n        '\\\\Leftarrow'            : '\\U000021d0',\n        '\\\\Longleftarrow'        : '\\U000027f8',\n        '\\\\Rightarrow'           : '\\U000021d2',\n        '\\\\Longrightarrow'       : '\\U000027f9',\n        '\\\\leftrightarrow'       : '\\U00002194',\n        '\\\\longleftrightarrow'   : '\\U000027f7',\n        '\\\\Leftrightarrow'       : '\\U000021d4',\n        '\\\\Longleftrightarrow'   : '\\U000027fa',\n        '\\\\mapsto'               : '\\U000021a6',\n        '\\\\longmapsto'           : '\\U000027fc',\n        '\\\\relbar'               : '\\U00002500',\n        '\\\\Relbar'               : '\\U00002550',\n        '\\\\hookleftarrow'        : '\\U000021a9',\n        '\\\\hookrightarrow'       : '\\U000021aa',\n        '\\\\leftharpoondown'      : '\\U000021bd',\n        '\\\\rightharpoondown'     : '\\U000021c1',\n        '\\\\leftharpoonup'        : '\\U000021bc',\n        '\\\\rightharpoonup'       : '\\U000021c0',\n        '\\\\rightleftharpoons'    : '\\U000021cc',\n        '\\\\leadsto'              : '\\U0000219d',\n        '\\\\downharpoonleft'      : '\\U000021c3',\n        '\\\\downharpoonright'     : '\\U000021c2',\n        '\\\\upharpoonleft'        : '\\U000021bf',\n        '\\\\upharpoonright'       : '\\U000021be',\n        '\\\\restriction'          : '\\U000021be',\n        '\\\\uparrow'              : '\\U00002191',\n        '\\\\Uparrow'              : '\\U000021d1',\n        '\\\\downarrow'            : '\\U00002193',\n        '\\\\Downarrow'            : '\\U000021d3',\n        '\\\\updownarrow'          : '\\U00002195',\n        '\\\\Updownarrow'          : '\\U000021d5',\n        '\\\\langle'               : '\\U000027e8',\n        '\\\\rangle'               : '\\U000027e9',\n        '\\\\lceil'                : '\\U00002308',\n        '\\\\rceil'                : '\\U00002309',\n        '\\\\lfloor'               : '\\U0000230a',\n        '\\\\rfloor'               : '\\U0000230b',\n        '\\\\flqq'                 : '\\U000000ab',\n        '\\\\frqq'                 : '\\U000000bb',\n        '\\\\bot'                  : '\\U000022a5',\n        '\\\\top'                  : '\\U000022a4',\n        '\\\\wedge'                : '\\U00002227',\n        '\\\\bigwedge'             : '\\U000022c0',\n        '\\\\vee'                  : '\\U00002228',\n        '\\\\bigvee'               : '\\U000022c1',\n        '\\\\forall'               : '\\U00002200',\n        '\\\\exists'               : '\\U00002203',\n        '\\\\nexists'              : '\\U00002204',\n        '\\\\neg'                  : '\\U000000ac',\n        '\\\\Box'                  : '\\U000025a1',\n        '\\\\Diamond'              : '\\U000025c7',\n        '\\\\vdash'                : '\\U000022a2',\n        '\\\\models'               : '\\U000022a8',\n        '\\\\dashv'                : '\\U000022a3',\n        '\\\\surd'                 : '\\U0000221a',\n        '\\\\le'                   : '\\U00002264',\n        '\\\\ge'                   : '\\U00002265',\n        '\\\\ll'                   : '\\U0000226a',\n        '\\\\gg'                   : '\\U0000226b',\n        '\\\\lesssim'              : '\\U00002272',\n        '\\\\gtrsim'               : '\\U00002273',\n        '\\\\lessapprox'           : '\\U00002a85',\n        '\\\\gtrapprox'            : '\\U00002a86',\n        '\\\\in'                   : '\\U00002208',\n        '\\\\notin'                : '\\U00002209',\n        '\\\\subset'               : '\\U00002282',\n        '\\\\supset'               : '\\U00002283',\n        '\\\\subseteq'             : '\\U00002286',\n        '\\\\supseteq'             : '\\U00002287',\n        '\\\\sqsubset'             : '\\U0000228f',\n        '\\\\sqsupset'             : '\\U00002290',\n        '\\\\sqsubseteq'           : '\\U00002291',\n        '\\\\sqsupseteq'           : '\\U00002292',\n        '\\\\cap'                  : '\\U00002229',\n        '\\\\bigcap'               : '\\U000022c2',\n        '\\\\cup'                  : '\\U0000222a',\n        '\\\\bigcup'               : '\\U000022c3',\n        '\\\\sqcup'                : '\\U00002294',\n        '\\\\bigsqcup'             : '\\U00002a06',\n        '\\\\sqcap'                : '\\U00002293',\n        '\\\\Bigsqcap'             : '\\U00002a05',\n        '\\\\setminus'             : '\\U00002216',\n        '\\\\propto'               : '\\U0000221d',\n        '\\\\uplus'                : '\\U0000228e',\n        '\\\\bigplus'              : '\\U00002a04',\n        '\\\\sim'                  : '\\U0000223c',\n        '\\\\doteq'                : '\\U00002250',\n        '\\\\simeq'                : '\\U00002243',\n        '\\\\approx'               : '\\U00002248',\n        '\\\\asymp'                : '\\U0000224d',\n        '\\\\cong'                 : '\\U00002245',\n        '\\\\equiv'                : '\\U00002261',\n        '\\\\Join'                 : '\\U000022c8',\n        '\\\\bowtie'               : '\\U00002a1d',\n        '\\\\prec'                 : '\\U0000227a',\n        '\\\\succ'                 : '\\U0000227b',\n        '\\\\preceq'               : '\\U0000227c',\n        '\\\\succeq'               : '\\U0000227d',\n        '\\\\parallel'             : '\\U00002225',\n        '\\\\mid'                  : '\\U000000a6',\n        '\\\\pm'                   : '\\U000000b1',\n        '\\\\mp'                   : '\\U00002213',\n        '\\\\times'                : '\\U000000d7',\n        '\\\\div'                  : '\\U000000f7',\n        '\\\\cdot'                 : '\\U000022c5',\n        '\\\\star'                 : '\\U000022c6',\n        '\\\\circ'                 : '\\U00002218',\n        '\\\\dagger'               : '\\U00002020',\n        '\\\\ddagger'              : '\\U00002021',\n        '\\\\lhd'                  : '\\U000022b2',\n        '\\\\rhd'                  : '\\U000022b3',\n        '\\\\unlhd'                : '\\U000022b4',\n        '\\\\unrhd'                : '\\U000022b5',\n        '\\\\triangleleft'         : '\\U000025c3',\n        '\\\\triangleright'        : '\\U000025b9',\n        '\\\\triangle'             : '\\U000025b3',\n        '\\\\triangleq'            : '\\U0000225c',\n        '\\\\oplus'                : '\\U00002295',\n        '\\\\bigoplus'             : '\\U00002a01',\n        '\\\\otimes'               : '\\U00002297',\n        '\\\\bigotimes'            : '\\U00002a02',\n        '\\\\odot'                 : '\\U00002299',\n        '\\\\bigodot'              : '\\U00002a00',\n        '\\\\ominus'               : '\\U00002296',\n        '\\\\oslash'               : '\\U00002298',\n        '\\\\dots'                 : '\\U00002026',\n        '\\\\cdots'                : '\\U000022ef',\n        '\\\\sum'                  : '\\U00002211',\n        '\\\\prod'                 : '\\U0000220f',\n        '\\\\coprod'               : '\\U00002210',\n        '\\\\infty'                : '\\U0000221e',\n        '\\\\int'                  : '\\U0000222b',\n        '\\\\oint'                 : '\\U0000222e',\n        '\\\\clubsuit'             : '\\U00002663',\n        '\\\\diamondsuit'          : '\\U00002662',\n        '\\\\heartsuit'            : '\\U00002661',\n        '\\\\spadesuit'            : '\\U00002660',\n        '\\\\aleph'                : '\\U00002135',\n        '\\\\emptyset'             : '\\U00002205',\n        '\\\\nabla'                : '\\U00002207',\n        '\\\\partial'              : '\\U00002202',\n        '\\\\flat'                 : '\\U0000266d',\n        '\\\\natural'              : '\\U0000266e',\n        '\\\\sharp'                : '\\U0000266f',\n        '\\\\angle'                : '\\U00002220',\n        '\\\\copyright'            : '\\U000000a9',\n        '\\\\textregistered'       : '\\U000000ae',\n        '\\\\textonequarter'       : '\\U000000bc',\n        '\\\\textonehalf'          : '\\U000000bd',\n        '\\\\textthreequarters'    : '\\U000000be',\n        '\\\\textordfeminine'      : '\\U000000aa',\n        '\\\\textordmasculine'     : '\\U000000ba',\n        '\\\\euro'                 : '\\U000020ac',\n        '\\\\pounds'               : '\\U000000a3',\n        '\\\\yen'                  : '\\U000000a5',\n        '\\\\textcent'             : '\\U000000a2',\n        '\\\\textcurrency'         : '\\U000000a4',\n        '\\\\textdegree'           : '\\U000000b0',\n    }\n\n    isabelle_symbols = {\n        '\\\\'                 : '\\U0001d7ec',\n        '\\\\'                  : '\\U0001d7ed',\n        '\\\\'                  : '\\U0001d7ee',\n        '\\\\'                : '\\U0001d7ef',\n        '\\\\'                 : '\\U0001d7f0',\n        '\\\\'                 : '\\U0001d7f1',\n        '\\\\'                  : '\\U0001d7f2',\n        '\\\\'                : '\\U0001d7f3',\n        '\\\\'                : '\\U0001d7f4',\n        '\\\\'                 : '\\U0001d7f5',\n        '\\\\'                    : '\\U0001d49c',\n        '\\\\'                    : '\\U0000212c',\n        '\\\\'                    : '\\U0001d49e',\n        '\\\\'                    : '\\U0001d49f',\n        '\\\\'                    : '\\U00002130',\n        '\\\\'                    : '\\U00002131',\n        '\\\\'                    : '\\U0001d4a2',\n        '\\\\'                    : '\\U0000210b',\n        '\\\\'                    : '\\U00002110',\n        '\\\\'                    : '\\U0001d4a5',\n        '\\\\'                    : '\\U0001d4a6',\n        '\\\\'                    : '\\U00002112',\n        '\\\\'                    : '\\U00002133',\n        '\\\\'                    : '\\U0001d4a9',\n        '\\\\'                    : '\\U0001d4aa',\n        '\\\\'                    : '\\U0001d4ab',\n        '\\\\'                    : '\\U0001d4ac',\n        '\\\\'                    : '\\U0000211b',\n        '\\\\'                    : '\\U0001d4ae',\n        '\\\\'                    : '\\U0001d4af',\n        '\\\\'                    : '\\U0001d4b0',\n        '\\\\'                    : '\\U0001d4b1',\n        '\\\\'                    : '\\U0001d4b2',\n        '\\\\'                    : '\\U0001d4b3',\n        '\\\\'                    : '\\U0001d4b4',\n        '\\\\'                    : '\\U0001d4b5',\n        '\\\\'                    : '\\U0001d5ba',\n        '\\\\'                    : '\\U0001d5bb',\n        '\\\\'                    : '\\U0001d5bc',\n        '\\\\'                    : '\\U0001d5bd',\n        '\\\\'                    : '\\U0001d5be',\n        '\\\\'                    : '\\U0001d5bf',\n        '\\\\'                    : '\\U0001d5c0',\n        '\\\\'                    : '\\U0001d5c1',\n        '\\\\'                    : '\\U0001d5c2',\n        '\\\\'                    : '\\U0001d5c3',\n        '\\\\'                    : '\\U0001d5c4',\n        '\\\\'                    : '\\U0001d5c5',\n        '\\\\'                    : '\\U0001d5c6',\n        '\\\\'                    : '\\U0001d5c7',\n        '\\\\'                    : '\\U0001d5c8',\n        '\\\\
'                    : '\\U0001d5c9',\n        '\\\\'                    : '\\U0001d5ca',\n        '\\\\'                    : '\\U0001d5cb',\n        '\\\\'                    : '\\U0001d5cc',\n        '\\\\'                    : '\\U0001d5cd',\n        '\\\\'                    : '\\U0001d5ce',\n        '\\\\'                    : '\\U0001d5cf',\n        '\\\\'                    : '\\U0001d5d0',\n        '\\\\'                    : '\\U0001d5d1',\n        '\\\\'                    : '\\U0001d5d2',\n        '\\\\'                    : '\\U0001d5d3',\n        '\\\\'                   : '\\U0001d504',\n        '\\\\'                   : '\\U0001d505',\n        '\\\\'                   : '\\U0000212d',\n        '\\\\
'                   : '\\U0001d507',\n        '\\\\'                   : '\\U0001d508',\n        '\\\\'                   : '\\U0001d509',\n        '\\\\'                   : '\\U0001d50a',\n        '\\\\'                   : '\\U0000210c',\n        '\\\\'                   : '\\U00002111',\n        '\\\\'                   : '\\U0001d50d',\n        '\\\\'                   : '\\U0001d50e',\n        '\\\\'                   : '\\U0001d50f',\n        '\\\\'                   : '\\U0001d510',\n        '\\\\'                   : '\\U0001d511',\n        '\\\\'                   : '\\U0001d512',\n        '\\\\'                   : '\\U0001d513',\n        '\\\\'                   : '\\U0001d514',\n        '\\\\'                   : '\\U0000211c',\n        '\\\\'                   : '\\U0001d516',\n        '\\\\'                   : '\\U0001d517',\n        '\\\\'                   : '\\U0001d518',\n        '\\\\'                   : '\\U0001d519',\n        '\\\\'                   : '\\U0001d51a',\n        '\\\\'                   : '\\U0001d51b',\n        '\\\\'                   : '\\U0001d51c',\n        '\\\\'                   : '\\U00002128',\n        '\\\\'                   : '\\U0001d51e',\n        '\\\\'                   : '\\U0001d51f',\n        '\\\\'                   : '\\U0001d520',\n        '\\\\
'                   : '\\U0001d521',\n        '\\\\'                   : '\\U0001d522',\n        '\\\\'                   : '\\U0001d523',\n        '\\\\'                   : '\\U0001d524',\n        '\\\\'                   : '\\U0001d525',\n        '\\\\'                   : '\\U0001d526',\n        '\\\\'                   : '\\U0001d527',\n        '\\\\'                   : '\\U0001d528',\n        '\\\\'                   : '\\U0001d529',\n        '\\\\'                   : '\\U0001d52a',\n        '\\\\'                   : '\\U0001d52b',\n        '\\\\'                   : '\\U0001d52c',\n        '\\\\'                   : '\\U0001d52d',\n        '\\\\'                   : '\\U0001d52e',\n        '\\\\'                   : '\\U0001d52f',\n        '\\\\'                   : '\\U0001d530',\n        '\\\\'                   : '\\U0001d531',\n        '\\\\'                   : '\\U0001d532',\n        '\\\\'                   : '\\U0001d533',\n        '\\\\'                   : '\\U0001d534',\n        '\\\\'                   : '\\U0001d535',\n        '\\\\'                   : '\\U0001d536',\n        '\\\\'                   : '\\U0001d537',\n        '\\\\'                : '\\U000003b1',\n        '\\\\'                 : '\\U000003b2',\n        '\\\\'                : '\\U000003b3',\n        '\\\\'                : '\\U000003b4',\n        '\\\\'              : '\\U000003b5',\n        '\\\\'                 : '\\U000003b6',\n        '\\\\'                  : '\\U000003b7',\n        '\\\\'                : '\\U000003b8',\n        '\\\\'                 : '\\U000003b9',\n        '\\\\'                : '\\U000003ba',\n        '\\\\'               : '\\U000003bb',\n        '\\\\'                   : '\\U000003bc',\n        '\\\\'                   : '\\U000003bd',\n        '\\\\'                   : '\\U000003be',\n        '\\\\'                   : '\\U000003c0',\n        '\\\\'                  : '\\U000003c1',\n        '\\\\'                : '\\U000003c3',\n        '\\\\'                  : '\\U000003c4',\n        '\\\\'              : '\\U000003c5',\n        '\\\\'                  : '\\U000003c6',\n        '\\\\'                  : '\\U000003c7',\n        '\\\\'                  : '\\U000003c8',\n        '\\\\'                : '\\U000003c9',\n        '\\\\'                : '\\U00000393',\n        '\\\\'                : '\\U00000394',\n        '\\\\'                : '\\U00000398',\n        '\\\\'               : '\\U0000039b',\n        '\\\\'                   : '\\U0000039e',\n        '\\\\'                   : '\\U000003a0',\n        '\\\\'                : '\\U000003a3',\n        '\\\\'              : '\\U000003a5',\n        '\\\\'                  : '\\U000003a6',\n        '\\\\'                  : '\\U000003a8',\n        '\\\\'                : '\\U000003a9',\n        '\\\\'                 : '\\U0001d539',\n        '\\\\'              : '\\U00002102',\n        '\\\\'                  : '\\U00002115',\n        '\\\\'                  : '\\U0000211a',\n        '\\\\'                 : '\\U0000211d',\n        '\\\\'                  : '\\U00002124',\n        '\\\\'            : '\\U00002190',\n        '\\\\'        : '\\U000027f5',\n        '\\\\'           : '\\U00002192',\n        '\\\\'       : '\\U000027f6',\n        '\\\\'            : '\\U000021d0',\n        '\\\\'        : '\\U000027f8',\n        '\\\\'           : '\\U000021d2',\n        '\\\\'       : '\\U000027f9',\n        '\\\\'       : '\\U00002194',\n        '\\\\'   : '\\U000027f7',\n        '\\\\'       : '\\U000021d4',\n        '\\\\'   : '\\U000027fa',\n        '\\\\'               : '\\U000021a6',\n        '\\\\'           : '\\U000027fc',\n        '\\\\'             : '\\U00002500',\n        '\\\\'             : '\\U00002550',\n        '\\\\'        : '\\U000021a9',\n        '\\\\'       : '\\U000021aa',\n        '\\\\'      : '\\U000021bd',\n        '\\\\'     : '\\U000021c1',\n        '\\\\'        : '\\U000021bc',\n        '\\\\'       : '\\U000021c0',\n        '\\\\'    : '\\U000021cc',\n        '\\\\'              : '\\U0000219d',\n        '\\\\'      : '\\U000021c3',\n        '\\\\'     : '\\U000021c2',\n        '\\\\'        : '\\U000021bf',\n        '\\\\'       : '\\U000021be',\n        '\\\\'          : '\\U000021be',\n        '\\\\'                : '\\U00002237',\n        '\\\\'                   : '\\U00002191',\n        '\\\\'                   : '\\U000021d1',\n        '\\\\'                 : '\\U00002193',\n        '\\\\'                 : '\\U000021d3',\n        '\\\\'               : '\\U00002195',\n        '\\\\'               : '\\U000021d5',\n        '\\\\'               : '\\U000027e8',\n        '\\\\'               : '\\U000027e9',\n        '\\\\'                : '\\U00002308',\n        '\\\\'                : '\\U00002309',\n        '\\\\'               : '\\U0000230a',\n        '\\\\'               : '\\U0000230b',\n        '\\\\'                : '\\U00002987',\n        '\\\\'                : '\\U00002988',\n        '\\\\'               : '\\U000027e6',\n        '\\\\'               : '\\U000027e7',\n        '\\\\'               : '\\U00002983',\n        '\\\\'               : '\\U00002984',\n        '\\\\'        : '\\U000000ab',\n        '\\\\'       : '\\U000000bb',\n        '\\\\'               : '\\U000022a5',\n        '\\\\'                  : '\\U000022a4',\n        '\\\\'                  : '\\U00002227',\n        '\\\\'                  : '\\U000022c0',\n        '\\\\'                   : '\\U00002228',\n        '\\\\'                   : '\\U000022c1',\n        '\\\\'               : '\\U00002200',\n        '\\\\'               : '\\U00002203',\n        '\\\\'              : '\\U00002204',\n        '\\\\'                  : '\\U000000ac',\n        '\\\\'                  : '\\U000025a1',\n        '\\\\'              : '\\U000025c7',\n        '\\\\'            : '\\U000022a2',\n        '\\\\'            : '\\U000022a8',\n        '\\\\'           : '\\U000022a9',\n        '\\\\'           : '\\U000022ab',\n        '\\\\'            : '\\U000022a3',\n        '\\\\'                 : '\\U0000221a',\n        '\\\\'                   : '\\U00002264',\n        '\\\\'                   : '\\U00002265',\n        '\\\\'                : '\\U0000226a',\n        '\\\\'             : '\\U0000226b',\n        '\\\\'              : '\\U00002272',\n        '\\\\'           : '\\U00002273',\n        '\\\\'           : '\\U00002a85',\n        '\\\\'        : '\\U00002a86',\n        '\\\\'                   : '\\U00002208',\n        '\\\\'                : '\\U00002209',\n        '\\\\'               : '\\U00002282',\n        '\\\\'               : '\\U00002283',\n        '\\\\'             : '\\U00002286',\n        '\\\\'             : '\\U00002287',\n        '\\\\'             : '\\U0000228f',\n        '\\\\'             : '\\U00002290',\n        '\\\\'           : '\\U00002291',\n        '\\\\'           : '\\U00002292',\n        '\\\\'                : '\\U00002229',\n        '\\\\'                : '\\U000022c2',\n        '\\\\'                : '\\U0000222a',\n        '\\\\'                : '\\U000022c3',\n        '\\\\'              : '\\U00002294',\n        '\\\\'              : '\\U00002a06',\n        '\\\\'              : '\\U00002293',\n        '\\\\'              : '\\U00002a05',\n        '\\\\'             : '\\U00002216',\n        '\\\\'               : '\\U0000221d',\n        '\\\\'                : '\\U0000228e',\n        '\\\\'                : '\\U00002a04',\n        '\\\\'                : '\\U00002260',\n        '\\\\'                  : '\\U0000223c',\n        '\\\\'                : '\\U00002250',\n        '\\\\'                : '\\U00002243',\n        '\\\\'               : '\\U00002248',\n        '\\\\'                : '\\U0000224d',\n        '\\\\'                 : '\\U00002245',\n        '\\\\'                : '\\U00002323',\n        '\\\\'                : '\\U00002261',\n        '\\\\'                : '\\U00002322',\n        '\\\\'                 : '\\U000022c8',\n        '\\\\'               : '\\U00002a1d',\n        '\\\\'                 : '\\U0000227a',\n        '\\\\'                 : '\\U0000227b',\n        '\\\\'               : '\\U0000227c',\n        '\\\\'               : '\\U0000227d',\n        '\\\\'             : '\\U00002225',\n        '\\\\'                  : '\\U000000a6',\n        '\\\\'            : '\\U000000b1',\n        '\\\\'            : '\\U00002213',\n        '\\\\'                : '\\U000000d7',\n        '\\\\'                  : '\\U000000f7',\n        '\\\\'                 : '\\U000022c5',\n        '\\\\'                 : '\\U000022c6',\n        '\\\\'               : '\\U00002219',\n        '\\\\'                 : '\\U00002218',\n        '\\\\'               : '\\U00002020',\n        '\\\\'              : '\\U00002021',\n        '\\\\'                  : '\\U000022b2',\n        '\\\\'                  : '\\U000022b3',\n        '\\\\'                : '\\U000022b4',\n        '\\\\'                : '\\U000022b5',\n        '\\\\'         : '\\U000025c3',\n        '\\\\'        : '\\U000025b9',\n        '\\\\'             : '\\U000025b3',\n        '\\\\'            : '\\U0000225c',\n        '\\\\'                : '\\U00002295',\n        '\\\\'                : '\\U00002a01',\n        '\\\\'               : '\\U00002297',\n        '\\\\'               : '\\U00002a02',\n        '\\\\'                 : '\\U00002299',\n        '\\\\'                 : '\\U00002a00',\n        '\\\\'               : '\\U00002296',\n        '\\\\'               : '\\U00002298',\n        '\\\\'                 : '\\U00002026',\n        '\\\\'                : '\\U000022ef',\n        '\\\\'                  : '\\U00002211',\n        '\\\\'                 : '\\U0000220f',\n        '\\\\'               : '\\U00002210',\n        '\\\\'             : '\\U0000221e',\n        '\\\\'             : '\\U0000222b',\n        '\\\\'            : '\\U0000222e',\n        '\\\\'             : '\\U00002663',\n        '\\\\'          : '\\U00002662',\n        '\\\\'            : '\\U00002661',\n        '\\\\'            : '\\U00002660',\n        '\\\\'                : '\\U00002135',\n        '\\\\'             : '\\U00002205',\n        '\\\\'                : '\\U00002207',\n        '\\\\'              : '\\U00002202',\n        '\\\\'                 : '\\U0000266d',\n        '\\\\'              : '\\U0000266e',\n        '\\\\'                : '\\U0000266f',\n        '\\\\'                : '\\U00002220',\n        '\\\\'            : '\\U000000a9',\n        '\\\\'           : '\\U000000ae',\n        '\\\\'               : '\\U000000ad',\n        '\\\\'              : '\\U000000af',\n        '\\\\'           : '\\U000000bc',\n        '\\\\'              : '\\U000000bd',\n        '\\\\'        : '\\U000000be',\n        '\\\\'          : '\\U000000aa',\n        '\\\\'         : '\\U000000ba',\n        '\\\\'              : '\\U000000a7',\n        '\\\\'            : '\\U000000b6',\n        '\\\\'           : '\\U000000a1',\n        '\\\\'         : '\\U000000bf',\n        '\\\\'                 : '\\U000020ac',\n        '\\\\'               : '\\U000000a3',\n        '\\\\'                  : '\\U000000a5',\n        '\\\\'                 : '\\U000000a2',\n        '\\\\'             : '\\U000000a4',\n        '\\\\'               : '\\U000000b0',\n        '\\\\'                : '\\U00002a3f',\n        '\\\\'                  : '\\U00002127',\n        '\\\\'              : '\\U000025ca',\n        '\\\\'                   : '\\U00002118',\n        '\\\\'                : '\\U00002240',\n        '\\\\'               : '\\U000022c4',\n        '\\\\'                : '\\U000000b4',\n        '\\\\'                : '\\U00000131',\n        '\\\\'             : '\\U000000a8',\n        '\\\\'              : '\\U000000b8',\n        '\\\\'         : '\\U000002dd',\n        '\\\\'                 : '\\U000003f5',\n        '\\\\'              : '\\U000023ce',\n        '\\\\'                 : '\\U00002039',\n        '\\\\'                : '\\U0000203a',\n        '\\\\'                 : '\\U00002302',\n        '\\\\<^sub>'                 : '\\U000021e9',\n        '\\\\<^sup>'                 : '\\U000021e7',\n        '\\\\<^bold>'                : '\\U00002759',\n        '\\\\<^bsub>'                : '\\U000021d8',\n        '\\\\<^esub>'                : '\\U000021d9',\n        '\\\\<^bsup>'                : '\\U000021d7',\n        '\\\\<^esup>'                : '\\U000021d6',\n    }\n\n    lang_map = {'isabelle' : isabelle_symbols, 'latex' : latex_symbols}\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        lang = get_choice_opt(options, 'lang',\n                              ['isabelle', 'latex'], 'isabelle')\n        self.symbols = self.lang_map[lang]\n\n    def filter(self, lexer, stream):\n        for ttype, value in stream:\n            if value in self.symbols:\n                yield ttype, self.symbols[value]\n            else:\n                yield ttype, value\n\n\nclass KeywordCaseFilter(Filter):\n    \"\"\"Convert keywords to lowercase or uppercase or capitalize them, which\n    means first letter uppercase, rest lowercase.\n\n    This can be useful e.g. if you highlight Pascal code and want to adapt the\n    code to your styleguide.\n\n    Options accepted:\n\n    `case` : string\n       The casing to convert keywords to. Must be one of ``'lower'``,\n       ``'upper'`` or ``'capitalize'``.  The default is ``'lower'``.\n    \"\"\"\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        case = get_choice_opt(options, 'case',\n                              ['lower', 'upper', 'capitalize'], 'lower')\n        self.convert = getattr(str, case)\n\n    def filter(self, lexer, stream):\n        for ttype, value in stream:\n            if ttype in Keyword:\n                yield ttype, self.convert(value)\n            else:\n                yield ttype, value\n\n\nclass NameHighlightFilter(Filter):\n    \"\"\"Highlight a normal Name (and Name.*) token with a different token type.\n\n    Example::\n\n        filter = NameHighlightFilter(\n            names=['foo', 'bar', 'baz'],\n            tokentype=Name.Function,\n        )\n\n    This would highlight the names \"foo\", \"bar\" and \"baz\"\n    as functions. `Name.Function` is the default token type.\n\n    Options accepted:\n\n    `names` : list of strings\n      A list of names that should be given the different token type.\n      There is no default.\n    `tokentype` : TokenType or string\n      A token type or a string containing a token type name that is\n      used for highlighting the strings in `names`.  The default is\n      `Name.Function`.\n    \"\"\"\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        self.names = set(get_list_opt(options, 'names', []))\n        tokentype = options.get('tokentype')\n        if tokentype:\n            self.tokentype = string_to_tokentype(tokentype)\n        else:\n            self.tokentype = Name.Function\n\n    def filter(self, lexer, stream):\n        for ttype, value in stream:\n            if ttype in Name and value in self.names:\n                yield self.tokentype, value\n            else:\n                yield ttype, value\n\n\nclass ErrorToken(Exception):\n    pass\n\n\nclass RaiseOnErrorTokenFilter(Filter):\n    \"\"\"Raise an exception when the lexer generates an error token.\n\n    Options accepted:\n\n    `excclass` : Exception class\n      The exception class to raise.\n      The default is `pygments.filters.ErrorToken`.\n\n    .. versionadded:: 0.8\n    \"\"\"\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        self.exception = options.get('excclass', ErrorToken)\n        try:\n            # issubclass() will raise TypeError if first argument is not a class\n            if not issubclass(self.exception, Exception):\n                raise TypeError\n        except TypeError:\n            raise OptionError('excclass option is not an exception class')\n\n    def filter(self, lexer, stream):\n        for ttype, value in stream:\n            if ttype is Error:\n                raise self.exception(value)\n            yield ttype, value\n\n\nclass VisibleWhitespaceFilter(Filter):\n    \"\"\"Convert tabs, newlines and/or spaces to visible characters.\n\n    Options accepted:\n\n    `spaces` : string or bool\n      If this is a one-character string, spaces will be replaces by this string.\n      If it is another true value, spaces will be replaced by ``·`` (unicode\n      MIDDLE DOT).  If it is a false value, spaces will not be replaced.  The\n      default is ``False``.\n    `tabs` : string or bool\n      The same as for `spaces`, but the default replacement character is ``»``\n      (unicode RIGHT-POINTING DOUBLE ANGLE QUOTATION MARK).  The default value\n      is ``False``.  Note: this will not work if the `tabsize` option for the\n      lexer is nonzero, as tabs will already have been expanded then.\n    `tabsize` : int\n      If tabs are to be replaced by this filter (see the `tabs` option), this\n      is the total number of characters that a tab should be expanded to.\n      The default is ``8``.\n    `newlines` : string or bool\n      The same as for `spaces`, but the default replacement character is ``¶``\n      (unicode PILCROW SIGN).  The default value is ``False``.\n    `wstokentype` : bool\n      If true, give whitespace the special `Whitespace` token type.  This allows\n      styling the visible whitespace differently (e.g. greyed out), but it can\n      disrupt background colors.  The default is ``True``.\n\n    .. versionadded:: 0.8\n    \"\"\"\n\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        for name, default in [('spaces',   '·'),\n                              ('tabs',     '»'),\n                              ('newlines', '¶')]:\n            opt = options.get(name, False)\n            if isinstance(opt, str) and len(opt) == 1:\n                setattr(self, name, opt)\n            else:\n                setattr(self, name, (opt and default or ''))\n        tabsize = get_int_opt(options, 'tabsize', 8)\n        if self.tabs:\n            self.tabs += ' ' * (tabsize - 1)\n        if self.newlines:\n            self.newlines += '\\n'\n        self.wstt = get_bool_opt(options, 'wstokentype', True)\n\n    def filter(self, lexer, stream):\n        if self.wstt:\n            spaces = self.spaces or ' '\n            tabs = self.tabs or '\\t'\n            newlines = self.newlines or '\\n'\n            regex = re.compile(r'\\s')\n\n            def replacefunc(wschar):\n                if wschar == ' ':\n                    return spaces\n                elif wschar == '\\t':\n                    return tabs\n                elif wschar == '\\n':\n                    return newlines\n                return wschar\n\n            for ttype, value in stream:\n                yield from _replace_special(ttype, value, regex, Whitespace,\n                                            replacefunc)\n        else:\n            spaces, tabs, newlines = self.spaces, self.tabs, self.newlines\n            # simpler processing\n            for ttype, value in stream:\n                if spaces:\n                    value = value.replace(' ', spaces)\n                if tabs:\n                    value = value.replace('\\t', tabs)\n                if newlines:\n                    value = value.replace('\\n', newlines)\n                yield ttype, value\n\n\nclass GobbleFilter(Filter):\n    \"\"\"Gobbles source code lines (eats initial characters).\n\n    This filter drops the first ``n`` characters off every line of code.  This\n    may be useful when the source code fed to the lexer is indented by a fixed\n    amount of space that isn't desired in the output.\n\n    Options accepted:\n\n    `n` : int\n       The number of characters to gobble.\n\n    .. versionadded:: 1.2\n    \"\"\"\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n        self.n = get_int_opt(options, 'n', 0)\n\n    def gobble(self, value, left):\n        if left < len(value):\n            return value[left:], 0\n        else:\n            return '', left - len(value)\n\n    def filter(self, lexer, stream):\n        n = self.n\n        left = n  # How many characters left to gobble.\n        for ttype, value in stream:\n            # Remove ``left`` tokens from first line, ``n`` from all others.\n            parts = value.split('\\n')\n            (parts[0], left) = self.gobble(parts[0], left)\n            for i in range(1, len(parts)):\n                (parts[i], left) = self.gobble(parts[i], n)\n            value = '\\n'.join(parts)\n\n            if value != '':\n                yield ttype, value\n\n\nclass TokenMergeFilter(Filter):\n    \"\"\"Merges consecutive tokens with the same token type in the output\n    stream of a lexer.\n\n    .. versionadded:: 1.2\n    \"\"\"\n    def __init__(self, **options):\n        Filter.__init__(self, **options)\n\n    def filter(self, lexer, stream):\n        current_type = None\n        current_value = None\n        for ttype, value in stream:\n            if ttype is current_type:\n                current_value += value\n            else:\n                if current_type is not None:\n                    yield current_type, current_value\n                current_type = ttype\n                current_value = value\n        if current_type is not None:\n            yield current_type, current_value\n\n\nFILTERS = {\n    'codetagify':     CodeTagFilter,\n    'keywordcase':    KeywordCaseFilter,\n    'highlight':      NameHighlightFilter,\n    'raiseonerror':   RaiseOnErrorTokenFilter,\n    'whitespace':     VisibleWhitespaceFilter,\n    'gobble':         GobbleFilter,\n    'tokenmerge':     TokenMergeFilter,\n    'symbols':        SymbolFilter,\n}\n",[],[216,809,810,811,890,891,1469,1660,893],"filters","ffd2297c-67fb-11f0-84bb-0224a6c84d84",95,["D",1753299247483],[514],[216,809,810,811,890,891,1469,1660],"fdca9380-67fb-11f0-847e-0224a6c84d84",74,["D",1753299244078],[513,515,518,522,525,526,527,528,529,530,531,532,533,534,535,536,537,538,539],[216,809,810,811,890,891,1469],"ff298a74-67fb-11f0-b5f5-0224a6c84d84","platformdirs","ff298b46-67fb-11f0-b5f5-0224a6c84d84",88,["D",1753299246378],[],[216,809,810,811,890,891,1672],"fef9c00a-67fb-11f0-84bb-0224a6c84d84","pkg_resources","fef9c0be-67fb-11f0-84bb-0224a6c84d84",86,["D",1753299246065],[],[216,809,810,811,890,891,1679],"07c1b30a-67fc-11f0-8863-0224a6c84d84","version.py","07c1b4d6-67fc-11f0-8863-0224a6c84d84","fd686d18-67fb-11f0-bf1a-0224a6c84d84",278,["D",1753299260796],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\"\"\"\n.. testsetup::\n\n    from pip._vendor.packaging.version import parse, Version\n\"\"\"\n\nfrom __future__ import annotations\n\nimport itertools\nimport re\nfrom typing import Any, Callable, NamedTuple, SupportsInt, Tuple, Union\n\nfrom ._structures import Infinity, InfinityType, NegativeInfinity, NegativeInfinityType\n\n__all__ = [\"VERSION_PATTERN\", \"InvalidVersion\", \"Version\", \"parse\"]\n\nLocalType = Tuple[Union[int, str], ...]\n\nCmpPrePostDevType = Union[InfinityType, NegativeInfinityType, Tuple[str, int]]\nCmpLocalType = Union[\n    NegativeInfinityType,\n    Tuple[Union[Tuple[int, str], Tuple[NegativeInfinityType, Union[int, str]]], ...],\n]\nCmpKey = Tuple[\n    int,\n    Tuple[int, ...],\n    CmpPrePostDevType,\n    CmpPrePostDevType,\n    CmpPrePostDevType,\n    CmpLocalType,\n]\nVersionComparisonMethod = Callable[[CmpKey, CmpKey], bool]\n\n\nclass _Version(NamedTuple):\n    epoch: int\n    release: tuple[int, ...]\n    dev: tuple[str, int] | None\n    pre: tuple[str, int] | None\n    post: tuple[str, int] | None\n    local: LocalType | None\n\n\ndef parse(version: str) -> Version:\n    \"\"\"Parse the given version string.\n\n    >>> parse('1.0.dev1')\n    \n\n    :param version: The version string to parse.\n    :raises InvalidVersion: When the version string is not a valid version.\n    \"\"\"\n    return Version(version)\n\n\nclass InvalidVersion(ValueError):\n    \"\"\"Raised when a version string is not a valid version.\n\n    >>> Version(\"invalid\")\n    Traceback (most recent call last):\n        ...\n    packaging.version.InvalidVersion: Invalid version: 'invalid'\n    \"\"\"\n\n\nclass _BaseVersion:\n    _key: tuple[Any, ...]\n\n    def __hash__(self) -> int:\n        return hash(self._key)\n\n    # Please keep the duplicated `isinstance` check\n    # in the six comparisons hereunder\n    # unless you find a way to avoid adding overhead function calls.\n    def __lt__(self, other: _BaseVersion) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key < other._key\n\n    def __le__(self, other: _BaseVersion) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key <= other._key\n\n    def __eq__(self, other: object) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key == other._key\n\n    def __ge__(self, other: _BaseVersion) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key >= other._key\n\n    def __gt__(self, other: _BaseVersion) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key > other._key\n\n    def __ne__(self, other: object) -> bool:\n        if not isinstance(other, _BaseVersion):\n            return NotImplemented\n\n        return self._key != other._key\n\n\n# Deliberately not anchored to the start and end of the string, to make it\n# easier for 3rd party code to reuse\n_VERSION_PATTERN = r\"\"\"\n    v?\n    (?:\n        (?:(?P[0-9]+)!)?                           # epoch\n        (?P[0-9]+(?:\\.[0-9]+)*)                  # release segment\n        (?P                                          # pre-release\n            [-_\\.]?\n            (?Palpha|a|beta|b|preview|pre|c|rc)\n            [-_\\.]?\n            (?P[0-9]+)?\n        )?\n        (?P                                         # post release\n            (?:-(?P[0-9]+))\n            |\n            (?:\n                [-_\\.]?\n                (?Ppost|rev|r)\n                [-_\\.]?\n                (?P[0-9]+)?\n            )\n        )?\n        (?P                                          # dev release\n            [-_\\.]?\n            (?Pdev)\n            [-_\\.]?\n            (?P[0-9]+)?\n        )?\n    )\n    (?:\\+(?P[a-z0-9]+(?:[-_\\.][a-z0-9]+)*))?       # local version\n\"\"\"\n\nVERSION_PATTERN = _VERSION_PATTERN\n\"\"\"\nA string containing the regular expression used to match a valid version.\n\nThe pattern is not anchored at either end, and is intended for embedding in larger\nexpressions (for example, matching a version number as part of a file name). The\nregular expression should be compiled with the ``re.VERBOSE`` and ``re.IGNORECASE``\nflags set.\n\n:meta hide-value:\n\"\"\"\n\n\nclass Version(_BaseVersion):\n    \"\"\"This class abstracts handling of a project's versions.\n\n    A :class:`Version` instance is comparison aware and can be compared and\n    sorted using the standard Python interfaces.\n\n    >>> v1 = Version(\"1.0a5\")\n    >>> v2 = Version(\"1.0\")\n    >>> v1\n    \n    >>> v2\n    \n    >>> v1 < v2\n    True\n    >>> v1 == v2\n    False\n    >>> v1 > v2\n    False\n    >>> v1 >= v2\n    False\n    >>> v1 <= v2\n    True\n    \"\"\"\n\n    _regex = re.compile(r\"^\\s*\" + VERSION_PATTERN + r\"\\s*$\", re.VERBOSE | re.IGNORECASE)\n    _key: CmpKey\n\n    def __init__(self, version: str) -> None:\n        \"\"\"Initialize a Version object.\n\n        :param version:\n            The string representation of a version which will be parsed and normalized\n            before use.\n        :raises InvalidVersion:\n            If the ``version`` does not conform to PEP 440 in any way then this\n            exception will be raised.\n        \"\"\"\n\n        # Validate the version and parse it into pieces\n        match = self._regex.search(version)\n        if not match:\n            raise InvalidVersion(f\"Invalid version: {version!r}\")\n\n        # Store the parsed out pieces of the version\n        self._version = _Version(\n            epoch=int(match.group(\"epoch\")) if match.group(\"epoch\") else 0,\n            release=tuple(int(i) for i in match.group(\"release\").split(\".\")),\n            pre=_parse_letter_version(match.group(\"pre_l\"), match.group(\"pre_n\")),\n            post=_parse_letter_version(\n                match.group(\"post_l\"), match.group(\"post_n1\") or match.group(\"post_n2\")\n            ),\n            dev=_parse_letter_version(match.group(\"dev_l\"), match.group(\"dev_n\")),\n            local=_parse_local_version(match.group(\"local\")),\n        )\n\n        # Generate a key which will be used for sorting\n        self._key = _cmpkey(\n            self._version.epoch,\n            self._version.release,\n            self._version.pre,\n            self._version.post,\n            self._version.dev,\n            self._version.local,\n        )\n\n    def __repr__(self) -> str:\n        \"\"\"A representation of the Version that shows all internal state.\n\n        >>> Version('1.0.0')\n        \n        \"\"\"\n        return f\"\"\n\n    def __str__(self) -> str:\n        \"\"\"A string representation of the version that can be round-tripped.\n\n        >>> str(Version(\"1.0a5\"))\n        '1.0a5'\n        \"\"\"\n        parts = []\n\n        # Epoch\n        if self.epoch != 0:\n            parts.append(f\"{self.epoch}!\")\n\n        # Release segment\n        parts.append(\".\".join(str(x) for x in self.release))\n\n        # Pre-release\n        if self.pre is not None:\n            parts.append(\"\".join(str(x) for x in self.pre))\n\n        # Post-release\n        if self.post is not None:\n            parts.append(f\".post{self.post}\")\n\n        # Development release\n        if self.dev is not None:\n            parts.append(f\".dev{self.dev}\")\n\n        # Local version segment\n        if self.local is not None:\n            parts.append(f\"+{self.local}\")\n\n        return \"\".join(parts)\n\n    @property\n    def epoch(self) -> int:\n        \"\"\"The epoch of the version.\n\n        >>> Version(\"2.0.0\").epoch\n        0\n        >>> Version(\"1!2.0.0\").epoch\n        1\n        \"\"\"\n        return self._version.epoch\n\n    @property\n    def release(self) -> tuple[int, ...]:\n        \"\"\"The components of the \"release\" segment of the version.\n\n        >>> Version(\"1.2.3\").release\n        (1, 2, 3)\n        >>> Version(\"2.0.0\").release\n        (2, 0, 0)\n        >>> Version(\"1!2.0.0.post0\").release\n        (2, 0, 0)\n\n        Includes trailing zeroes but not the epoch or any pre-release / development /\n        post-release suffixes.\n        \"\"\"\n        return self._version.release\n\n    @property\n    def pre(self) -> tuple[str, int] | None:\n        \"\"\"The pre-release segment of the version.\n\n        >>> print(Version(\"1.2.3\").pre)\n        None\n        >>> Version(\"1.2.3a1\").pre\n        ('a', 1)\n        >>> Version(\"1.2.3b1\").pre\n        ('b', 1)\n        >>> Version(\"1.2.3rc1\").pre\n        ('rc', 1)\n        \"\"\"\n        return self._version.pre\n\n    @property\n    def post(self) -> int | None:\n        \"\"\"The post-release number of the version.\n\n        >>> print(Version(\"1.2.3\").post)\n        None\n        >>> Version(\"1.2.3.post1\").post\n        1\n        \"\"\"\n        return self._version.post[1] if self._version.post else None\n\n    @property\n    def dev(self) -> int | None:\n        \"\"\"The development number of the version.\n\n        >>> print(Version(\"1.2.3\").dev)\n        None\n        >>> Version(\"1.2.3.dev1\").dev\n        1\n        \"\"\"\n        return self._version.dev[1] if self._version.dev else None\n\n    @property\n    def local(self) -> str | None:\n        \"\"\"The local version segment of the version.\n\n        >>> print(Version(\"1.2.3\").local)\n        None\n        >>> Version(\"1.2.3+abc\").local\n        'abc'\n        \"\"\"\n        if self._version.local:\n            return \".\".join(str(x) for x in self._version.local)\n        else:\n            return None\n\n    @property\n    def public(self) -> str:\n        \"\"\"The public portion of the version.\n\n        >>> Version(\"1.2.3\").public\n        '1.2.3'\n        >>> Version(\"1.2.3+abc\").public\n        '1.2.3'\n        >>> Version(\"1!1.2.3dev1+abc\").public\n        '1!1.2.3.dev1'\n        \"\"\"\n        return str(self).split(\"+\", 1)[0]\n\n    @property\n    def base_version(self) -> str:\n        \"\"\"The \"base version\" of the version.\n\n        >>> Version(\"1.2.3\").base_version\n        '1.2.3'\n        >>> Version(\"1.2.3+abc\").base_version\n        '1.2.3'\n        >>> Version(\"1!1.2.3dev1+abc\").base_version\n        '1!1.2.3'\n\n        The \"base version\" is the public version of the project without any pre or post\n        release markers.\n        \"\"\"\n        parts = []\n\n        # Epoch\n        if self.epoch != 0:\n            parts.append(f\"{self.epoch}!\")\n\n        # Release segment\n        parts.append(\".\".join(str(x) for x in self.release))\n\n        return \"\".join(parts)\n\n    @property\n    def is_prerelease(self) -> bool:\n        \"\"\"Whether this version is a pre-release.\n\n        >>> Version(\"1.2.3\").is_prerelease\n        False\n        >>> Version(\"1.2.3a1\").is_prerelease\n        True\n        >>> Version(\"1.2.3b1\").is_prerelease\n        True\n        >>> Version(\"1.2.3rc1\").is_prerelease\n        True\n        >>> Version(\"1.2.3dev1\").is_prerelease\n        True\n        \"\"\"\n        return self.dev is not None or self.pre is not None\n\n    @property\n    def is_postrelease(self) -> bool:\n        \"\"\"Whether this version is a post-release.\n\n        >>> Version(\"1.2.3\").is_postrelease\n        False\n        >>> Version(\"1.2.3.post1\").is_postrelease\n        True\n        \"\"\"\n        return self.post is not None\n\n    @property\n    def is_devrelease(self) -> bool:\n        \"\"\"Whether this version is a development release.\n\n        >>> Version(\"1.2.3\").is_devrelease\n        False\n        >>> Version(\"1.2.3.dev1\").is_devrelease\n        True\n        \"\"\"\n        return self.dev is not None\n\n    @property\n    def major(self) -> int:\n        \"\"\"The first item of :attr:`release` or ``0`` if unavailable.\n\n        >>> Version(\"1.2.3\").major\n        1\n        \"\"\"\n        return self.release[0] if len(self.release) >= 1 else 0\n\n    @property\n    def minor(self) -> int:\n        \"\"\"The second item of :attr:`release` or ``0`` if unavailable.\n\n        >>> Version(\"1.2.3\").minor\n        2\n        >>> Version(\"1\").minor\n        0\n        \"\"\"\n        return self.release[1] if len(self.release) >= 2 else 0\n\n    @property\n    def micro(self) -> int:\n        \"\"\"The third item of :attr:`release` or ``0`` if unavailable.\n\n        >>> Version(\"1.2.3\").micro\n        3\n        >>> Version(\"1\").micro\n        0\n        \"\"\"\n        return self.release[2] if len(self.release) >= 3 else 0\n\n\nclass _TrimmedRelease(Version):\n    @property\n    def release(self) -> tuple[int, ...]:\n        \"\"\"\n        Release segment without any trailing zeros.\n\n        >>> _TrimmedRelease('1.0.0').release\n        (1,)\n        >>> _TrimmedRelease('0.0').release\n        (0,)\n        \"\"\"\n        rel = super().release\n        nonzeros = (index for index, val in enumerate(rel) if val)\n        last_nonzero = max(nonzeros, default=0)\n        return rel[: last_nonzero + 1]\n\n\ndef _parse_letter_version(\n    letter: str | None, number: str | bytes | SupportsInt | None\n) -> tuple[str, int] | None:\n    if letter:\n        # We consider there to be an implicit 0 in a pre-release if there is\n        # not a numeral associated with it.\n        if number is None:\n            number = 0\n\n        # We normalize any letters to their lower case form\n        letter = letter.lower()\n\n        # We consider some words to be alternate spellings of other words and\n        # in those cases we want to normalize the spellings to our preferred\n        # spelling.\n        if letter == \"alpha\":\n            letter = \"a\"\n        elif letter == \"beta\":\n            letter = \"b\"\n        elif letter in [\"c\", \"pre\", \"preview\"]:\n            letter = \"rc\"\n        elif letter in [\"rev\", \"r\"]:\n            letter = \"post\"\n\n        return letter, int(number)\n\n    assert not letter\n    if number:\n        # We assume if we are given a number, but we are not given a letter\n        # then this is using the implicit post release syntax (e.g. 1.0-1)\n        letter = \"post\"\n\n        return letter, int(number)\n\n    return None\n\n\n_local_version_separators = re.compile(r\"[\\._-]\")\n\n\ndef _parse_local_version(local: str | None) -> LocalType | None:\n    \"\"\"\n    Takes a string like abc.1.twelve and turns it into (\"abc\", 1, \"twelve\").\n    \"\"\"\n    if local is not None:\n        return tuple(\n            part.lower() if not part.isdigit() else int(part)\n            for part in _local_version_separators.split(local)\n        )\n    return None\n\n\ndef _cmpkey(\n    epoch: int,\n    release: tuple[int, ...],\n    pre: tuple[str, int] | None,\n    post: tuple[str, int] | None,\n    dev: tuple[str, int] | None,\n    local: LocalType | None,\n) -> CmpKey:\n    # When we compare a release version, we want to compare it with all of the\n    # trailing zeros removed. So we'll use a reverse the list, drop all the now\n    # leading zeros until we come to something non zero, then take the rest\n    # re-reverse it back into the correct order and make it a tuple and use\n    # that for our sorting key.\n    _release = tuple(\n        reversed(list(itertools.dropwhile(lambda x: x == 0, reversed(release))))\n    )\n\n    # We need to \"trick\" the sorting algorithm to put 1.0.dev0 before 1.0a0.\n    # We'll do this by abusing the pre segment, but we _only_ want to do this\n    # if there is not a pre or a post segment. If we have one of those then\n    # the normal sorting rules will handle this case correctly.\n    if pre is None and post is None and dev is not None:\n        _pre: CmpPrePostDevType = NegativeInfinity\n    # Versions without a pre-release (except as noted above) should sort after\n    # those with one.\n    elif pre is None:\n        _pre = Infinity\n    else:\n        _pre = pre\n\n    # Versions without a post segment should sort before those with one.\n    if post is None:\n        _post: CmpPrePostDevType = NegativeInfinity\n\n    else:\n        _post = post\n\n    # Versions without a development segment should sort after those with one.\n    if dev is None:\n        _dev: CmpPrePostDevType = Infinity\n\n    else:\n        _dev = dev\n\n    if local is None:\n        # Versions without a local segment should sort before those with one.\n        _local: CmpLocalType = NegativeInfinity\n    else:\n        # Versions with a local segment need that segment parsed to implement\n        # the sorting rules in PEP440.\n        # - Alpha numeric segments sort before numeric segments\n        # - Alpha numeric segments sort lexicographically\n        # - Numeric segments sort numerically\n        # - Shorter versions sort before longer versions when the prefixes\n        #   match exactly\n        _local = tuple(\n            (i, \"\") if isinstance(i, int) else (NegativeInfinity, i) for i in local\n        )\n\n    return epoch, _release, _pre, _post, _dev, _local\n",[],[216,809,810,811,890,891,1694,1686],"packaging","07dd5ca4-67fc-11f0-85ab-0224a6c84d84","07dd5d58-67fc-11f0-85ab-0224a6c84d84",283,["D",1753299260975],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\nfrom __future__ import annotations\n\nimport functools\nimport re\nfrom typing import NewType, Tuple, Union, cast\n\nfrom .tags import Tag, parse_tag\nfrom .version import InvalidVersion, Version, _TrimmedRelease\n\nBuildTag = Union[Tuple[()], Tuple[int, str]]\nNormalizedName = NewType(\"NormalizedName\", str)\n\n\nclass InvalidName(ValueError):\n    \"\"\"\n    An invalid distribution name; users should refer to the packaging user guide.\n    \"\"\"\n\n\nclass InvalidWheelFilename(ValueError):\n    \"\"\"\n    An invalid wheel filename was found, users should refer to PEP 427.\n    \"\"\"\n\n\nclass InvalidSdistFilename(ValueError):\n    \"\"\"\n    An invalid sdist filename was found, users should refer to the packaging user guide.\n    \"\"\"\n\n\n# Core metadata spec for `Name`\n_validate_regex = re.compile(\n    r\"^([A-Z0-9]|[A-Z0-9][A-Z0-9._-]*[A-Z0-9])$\", re.IGNORECASE\n)\n_canonicalize_regex = re.compile(r\"[-_.]+\")\n_normalized_regex = re.compile(r\"^([a-z0-9]|[a-z0-9]([a-z0-9-](?!--))*[a-z0-9])$\")\n# PEP 427: The build number must start with a digit.\n_build_tag_regex = re.compile(r\"(\\d+)(.*)\")\n\n\ndef canonicalize_name(name: str, *, validate: bool = False) -> NormalizedName:\n    if validate and not _validate_regex.match(name):\n        raise InvalidName(f\"name is invalid: {name!r}\")\n    # This is taken from PEP 503.\n    value = _canonicalize_regex.sub(\"-\", name).lower()\n    return cast(NormalizedName, value)\n\n\ndef is_normalized_name(name: str) -> bool:\n    return _normalized_regex.match(name) is not None\n\n\n@functools.singledispatch\ndef canonicalize_version(\n    version: Version | str, *, strip_trailing_zero: bool = True\n) -> str:\n    \"\"\"\n    Return a canonical form of a version as a string.\n\n    >>> canonicalize_version('1.0.1')\n    '1.0.1'\n\n    Per PEP 625, versions may have multiple canonical forms, differing\n    only by trailing zeros.\n\n    >>> canonicalize_version('1.0.0')\n    '1'\n    >>> canonicalize_version('1.0.0', strip_trailing_zero=False)\n    '1.0.0'\n\n    Invalid versions are returned unaltered.\n\n    >>> canonicalize_version('foo bar baz')\n    'foo bar baz'\n    \"\"\"\n    return str(_TrimmedRelease(str(version)) if strip_trailing_zero else version)\n\n\n@canonicalize_version.register\ndef _(version: str, *, strip_trailing_zero: bool = True) -> str:\n    try:\n        parsed = Version(version)\n    except InvalidVersion:\n        # Legacy versions cannot be normalized\n        return version\n    return canonicalize_version(parsed, strip_trailing_zero=strip_trailing_zero)\n\n\ndef parse_wheel_filename(\n    filename: str,\n) -> tuple[NormalizedName, Version, BuildTag, frozenset[Tag]]:\n    if not filename.endswith(\".whl\"):\n        raise InvalidWheelFilename(\n            f\"Invalid wheel filename (extension must be '.whl'): {filename!r}\"\n        )\n\n    filename = filename[:-4]\n    dashes = filename.count(\"-\")\n    if dashes not in (4, 5):\n        raise InvalidWheelFilename(\n            f\"Invalid wheel filename (wrong number of parts): {filename!r}\"\n        )\n\n    parts = filename.split(\"-\", dashes - 2)\n    name_part = parts[0]\n    # See PEP 427 for the rules on escaping the project name.\n    if \"__\" in name_part or re.match(r\"^[\\w\\d._]*$\", name_part, re.UNICODE) is None:\n        raise InvalidWheelFilename(f\"Invalid project name: {filename!r}\")\n    name = canonicalize_name(name_part)\n\n    try:\n        version = Version(parts[1])\n    except InvalidVersion as e:\n        raise InvalidWheelFilename(\n            f\"Invalid wheel filename (invalid version): {filename!r}\"\n        ) from e\n\n    if dashes == 5:\n        build_part = parts[2]\n        build_match = _build_tag_regex.match(build_part)\n        if build_match is None:\n            raise InvalidWheelFilename(\n                f\"Invalid build number: {build_part} in {filename!r}\"\n            )\n        build = cast(BuildTag, (int(build_match.group(1)), build_match.group(2)))\n    else:\n        build = ()\n    tags = parse_tag(parts[-1])\n    return (name, version, build, tags)\n\n\ndef parse_sdist_filename(filename: str) -> tuple[NormalizedName, Version]:\n    if filename.endswith(\".tar.gz\"):\n        file_stem = filename[: -len(\".tar.gz\")]\n    elif filename.endswith(\".zip\"):\n        file_stem = filename[: -len(\".zip\")]\n    else:\n        raise InvalidSdistFilename(\n            f\"Invalid sdist filename (extension must be '.tar.gz' or '.zip'):\"\n            f\" {filename!r}\"\n        )\n\n    # We are requiring a PEP 440 version, which cannot contain dashes,\n    # so we split on the last dash.\n    name_part, sep, version_part = file_stem.rpartition(\"-\")\n    if not sep:\n        raise InvalidSdistFilename(f\"Invalid sdist filename: {filename!r}\")\n\n    name = canonicalize_name(name_part)\n\n    try:\n        version = Version(version_part)\n    except InvalidVersion as e:\n        raise InvalidSdistFilename(\n            f\"Invalid sdist filename (invalid version): {filename!r}\"\n        ) from e\n\n    return (name, version)\n",[],[216,809,810,811,890,891,1694,1267],"07ad4384-67fc-11f0-95df-0224a6c84d84","tags.py","07ad441a-67fc-11f0-95df-0224a6c84d84",275,["D",1753299260664],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\nfrom __future__ import annotations\n\nimport logging\nimport platform\nimport re\nimport struct\nimport subprocess\nimport sys\nimport sysconfig\nfrom importlib.machinery import EXTENSION_SUFFIXES\nfrom typing import (\n    Iterable,\n    Iterator,\n    Sequence,\n    Tuple,\n    cast,\n)\n\nfrom . import _manylinux, _musllinux\n\nlogger = logging.getLogger(__name__)\n\nPythonVersion = Sequence[int]\nAppleVersion = Tuple[int, int]\n\nINTERPRETER_SHORT_NAMES: dict[str, str] = {\n    \"python\": \"py\",  # Generic.\n    \"cpython\": \"cp\",\n    \"pypy\": \"pp\",\n    \"ironpython\": \"ip\",\n    \"jython\": \"jy\",\n}\n\n\n_32_BIT_INTERPRETER = struct.calcsize(\"P\") == 4\n\n\nclass Tag:\n    \"\"\"\n    A representation of the tag triple for a wheel.\n\n    Instances are considered immutable and thus are hashable. Equality checking\n    is also supported.\n    \"\"\"\n\n    __slots__ = [\"_abi\", \"_hash\", \"_interpreter\", \"_platform\"]\n\n    def __init__(self, interpreter: str, abi: str, platform: str) -> None:\n        self._interpreter = interpreter.lower()\n        self._abi = abi.lower()\n        self._platform = platform.lower()\n        # The __hash__ of every single element in a Set[Tag] will be evaluated each time\n        # that a set calls its `.disjoint()` method, which may be called hundreds of\n        # times when scanning a page of links for packages with tags matching that\n        # Set[Tag]. Pre-computing the value here produces significant speedups for\n        # downstream consumers.\n        self._hash = hash((self._interpreter, self._abi, self._platform))\n\n    @property\n    def interpreter(self) -> str:\n        return self._interpreter\n\n    @property\n    def abi(self) -> str:\n        return self._abi\n\n    @property\n    def platform(self) -> str:\n        return self._platform\n\n    def __eq__(self, other: object) -> bool:\n        if not isinstance(other, Tag):\n            return NotImplemented\n\n        return (\n            (self._hash == other._hash)  # Short-circuit ASAP for perf reasons.\n            and (self._platform == other._platform)\n            and (self._abi == other._abi)\n            and (self._interpreter == other._interpreter)\n        )\n\n    def __hash__(self) -> int:\n        return self._hash\n\n    def __str__(self) -> str:\n        return f\"{self._interpreter}-{self._abi}-{self._platform}\"\n\n    def __repr__(self) -> str:\n        return f\"<{self} @ {id(self)}>\"\n\n\ndef parse_tag(tag: str) -> frozenset[Tag]:\n    \"\"\"\n    Parses the provided tag (e.g. `py3-none-any`) into a frozenset of Tag instances.\n\n    Returning a set is required due to the possibility that the tag is a\n    compressed tag set.\n    \"\"\"\n    tags = set()\n    interpreters, abis, platforms = tag.split(\"-\")\n    for interpreter in interpreters.split(\".\"):\n        for abi in abis.split(\".\"):\n            for platform_ in platforms.split(\".\"):\n                tags.add(Tag(interpreter, abi, platform_))\n    return frozenset(tags)\n\n\ndef _get_config_var(name: str, warn: bool = False) -> int | str | None:\n    value: int | str | None = sysconfig.get_config_var(name)\n    if value is None and warn:\n        logger.debug(\n            \"Config variable '%s' is unset, Python ABI tag may be incorrect\", name\n        )\n    return value\n\n\ndef _normalize_string(string: str) -> str:\n    return string.replace(\".\", \"_\").replace(\"-\", \"_\").replace(\" \", \"_\")\n\n\ndef _is_threaded_cpython(abis: list[str]) -> bool:\n    \"\"\"\n    Determine if the ABI corresponds to a threaded (`--disable-gil`) build.\n\n    The threaded builds are indicated by a \"t\" in the abiflags.\n    \"\"\"\n    if len(abis) == 0:\n        return False\n    # expect e.g., cp313\n    m = re.match(r\"cp\\d+(.*)\", abis[0])\n    if not m:\n        return False\n    abiflags = m.group(1)\n    return \"t\" in abiflags\n\n\ndef _abi3_applies(python_version: PythonVersion, threading: bool) -> bool:\n    \"\"\"\n    Determine if the Python version supports abi3.\n\n    PEP 384 was first implemented in Python 3.2. The threaded (`--disable-gil`)\n    builds do not support abi3.\n    \"\"\"\n    return len(python_version) > 1 and tuple(python_version) >= (3, 2) and not threading\n\n\ndef _cpython_abis(py_version: PythonVersion, warn: bool = False) -> list[str]:\n    py_version = tuple(py_version)  # To allow for version comparison.\n    abis = []\n    version = _version_nodot(py_version[:2])\n    threading = debug = pymalloc = ucs4 = \"\"\n    with_debug = _get_config_var(\"Py_DEBUG\", warn)\n    has_refcount = hasattr(sys, \"gettotalrefcount\")\n    # Windows doesn't set Py_DEBUG, so checking for support of debug-compiled\n    # extension modules is the best option.\n    # https://github.com/pypa/pip/issues/3383#issuecomment-173267692\n    has_ext = \"_d.pyd\" in EXTENSION_SUFFIXES\n    if with_debug or (with_debug is None and (has_refcount or has_ext)):\n        debug = \"d\"\n    if py_version >= (3, 13) and _get_config_var(\"Py_GIL_DISABLED\", warn):\n        threading = \"t\"\n    if py_version < (3, 8):\n        with_pymalloc = _get_config_var(\"WITH_PYMALLOC\", warn)\n        if with_pymalloc or with_pymalloc is None:\n            pymalloc = \"m\"\n        if py_version < (3, 3):\n            unicode_size = _get_config_var(\"Py_UNICODE_SIZE\", warn)\n            if unicode_size == 4 or (\n                unicode_size is None and sys.maxunicode == 0x10FFFF\n            ):\n                ucs4 = \"u\"\n    elif debug:\n        # Debug builds can also load \"normal\" extension modules.\n        # We can also assume no UCS-4 or pymalloc requirement.\n        abis.append(f\"cp{version}{threading}\")\n    abis.insert(0, f\"cp{version}{threading}{debug}{pymalloc}{ucs4}\")\n    return abis\n\n\ndef cpython_tags(\n    python_version: PythonVersion | None = None,\n    abis: Iterable[str] | None = None,\n    platforms: Iterable[str] | None = None,\n    *,\n    warn: bool = False,\n) -> Iterator[Tag]:\n    \"\"\"\n    Yields the tags for a CPython interpreter.\n\n    The tags consist of:\n    - cp--\n    - cp-abi3-\n    - cp-none-\n    - cp-abi3-  # Older Python versions down to 3.2.\n\n    If python_version only specifies a major version then user-provided ABIs and\n    the 'none' ABItag will be used.\n\n    If 'abi3' or 'none' are specified in 'abis' then they will be yielded at\n    their normal position and not at the beginning.\n    \"\"\"\n    if not python_version:\n        python_version = sys.version_info[:2]\n\n    interpreter = f\"cp{_version_nodot(python_version[:2])}\"\n\n    if abis is None:\n        if len(python_version) > 1:\n            abis = _cpython_abis(python_version, warn)\n        else:\n            abis = []\n    abis = list(abis)\n    # 'abi3' and 'none' are explicitly handled later.\n    for explicit_abi in (\"abi3\", \"none\"):\n        try:\n            abis.remove(explicit_abi)\n        except ValueError:\n            pass\n\n    platforms = list(platforms or platform_tags())\n    for abi in abis:\n        for platform_ in platforms:\n            yield Tag(interpreter, abi, platform_)\n\n    threading = _is_threaded_cpython(abis)\n    use_abi3 = _abi3_applies(python_version, threading)\n    if use_abi3:\n        yield from (Tag(interpreter, \"abi3\", platform_) for platform_ in platforms)\n    yield from (Tag(interpreter, \"none\", platform_) for platform_ in platforms)\n\n    if use_abi3:\n        for minor_version in range(python_version[1] - 1, 1, -1):\n            for platform_ in platforms:\n                version = _version_nodot((python_version[0], minor_version))\n                interpreter = f\"cp{version}\"\n                yield Tag(interpreter, \"abi3\", platform_)\n\n\ndef _generic_abi() -> list[str]:\n    \"\"\"\n    Return the ABI tag based on EXT_SUFFIX.\n    \"\"\"\n    # The following are examples of `EXT_SUFFIX`.\n    # We want to keep the parts which are related to the ABI and remove the\n    # parts which are related to the platform:\n    # - linux:   '.cpython-310-x86_64-linux-gnu.so' => cp310\n    # - mac:     '.cpython-310-darwin.so'           => cp310\n    # - win:     '.cp310-win_amd64.pyd'             => cp310\n    # - win:     '.pyd'                             => cp37 (uses _cpython_abis())\n    # - pypy:    '.pypy38-pp73-x86_64-linux-gnu.so' => pypy38_pp73\n    # - graalpy: '.graalpy-38-native-x86_64-darwin.dylib'\n    #                                               => graalpy_38_native\n\n    ext_suffix = _get_config_var(\"EXT_SUFFIX\", warn=True)\n    if not isinstance(ext_suffix, str) or ext_suffix[0] != \".\":\n        raise SystemError(\"invalid sysconfig.get_config_var('EXT_SUFFIX')\")\n    parts = ext_suffix.split(\".\")\n    if len(parts) < 3:\n        # CPython3.7 and earlier uses \".pyd\" on Windows.\n        return _cpython_abis(sys.version_info[:2])\n    soabi = parts[1]\n    if soabi.startswith(\"cpython\"):\n        # non-windows\n        abi = \"cp\" + soabi.split(\"-\")[1]\n    elif soabi.startswith(\"cp\"):\n        # windows\n        abi = soabi.split(\"-\")[0]\n    elif soabi.startswith(\"pypy\"):\n        abi = \"-\".join(soabi.split(\"-\")[:2])\n    elif soabi.startswith(\"graalpy\"):\n        abi = \"-\".join(soabi.split(\"-\")[:3])\n    elif soabi:\n        # pyston, ironpython, others?\n        abi = soabi\n    else:\n        return []\n    return [_normalize_string(abi)]\n\n\ndef generic_tags(\n    interpreter: str | None = None,\n    abis: Iterable[str] | None = None,\n    platforms: Iterable[str] | None = None,\n    *,\n    warn: bool = False,\n) -> Iterator[Tag]:\n    \"\"\"\n    Yields the tags for a generic interpreter.\n\n    The tags consist of:\n    - --\n\n    The \"none\" ABI will be added if it was not explicitly provided.\n    \"\"\"\n    if not interpreter:\n        interp_name = interpreter_name()\n        interp_version = interpreter_version(warn=warn)\n        interpreter = \"\".join([interp_name, interp_version])\n    if abis is None:\n        abis = _generic_abi()\n    else:\n        abis = list(abis)\n    platforms = list(platforms or platform_tags())\n    if \"none\" not in abis:\n        abis.append(\"none\")\n    for abi in abis:\n        for platform_ in platforms:\n            yield Tag(interpreter, abi, platform_)\n\n\ndef _py_interpreter_range(py_version: PythonVersion) -> Iterator[str]:\n    \"\"\"\n    Yields Python versions in descending order.\n\n    After the latest version, the major-only version will be yielded, and then\n    all previous versions of that major version.\n    \"\"\"\n    if len(py_version) > 1:\n        yield f\"py{_version_nodot(py_version[:2])}\"\n    yield f\"py{py_version[0]}\"\n    if len(py_version) > 1:\n        for minor in range(py_version[1] - 1, -1, -1):\n            yield f\"py{_version_nodot((py_version[0], minor))}\"\n\n\ndef compatible_tags(\n    python_version: PythonVersion | None = None,\n    interpreter: str | None = None,\n    platforms: Iterable[str] | None = None,\n) -> Iterator[Tag]:\n    \"\"\"\n    Yields the sequence of tags that are compatible with a specific version of Python.\n\n    The tags consist of:\n    - py*-none-\n    - -none-any  # ... if `interpreter` is provided.\n    - py*-none-any\n    \"\"\"\n    if not python_version:\n        python_version = sys.version_info[:2]\n    platforms = list(platforms or platform_tags())\n    for version in _py_interpreter_range(python_version):\n        for platform_ in platforms:\n            yield Tag(version, \"none\", platform_)\n    if interpreter:\n        yield Tag(interpreter, \"none\", \"any\")\n    for version in _py_interpreter_range(python_version):\n        yield Tag(version, \"none\", \"any\")\n\n\ndef _mac_arch(arch: str, is_32bit: bool = _32_BIT_INTERPRETER) -> str:\n    if not is_32bit:\n        return arch\n\n    if arch.startswith(\"ppc\"):\n        return \"ppc\"\n\n    return \"i386\"\n\n\ndef _mac_binary_formats(version: AppleVersion, cpu_arch: str) -> list[str]:\n    formats = [cpu_arch]\n    if cpu_arch == \"x86_64\":\n        if version < (10, 4):\n            return []\n        formats.extend([\"intel\", \"fat64\", \"fat32\"])\n\n    elif cpu_arch == \"i386\":\n        if version < (10, 4):\n            return []\n        formats.extend([\"intel\", \"fat32\", \"fat\"])\n\n    elif cpu_arch == \"ppc64\":\n        # TODO: Need to care about 32-bit PPC for ppc64 through 10.2?\n        if version > (10, 5) or version < (10, 4):\n            return []\n        formats.append(\"fat64\")\n\n    elif cpu_arch == \"ppc\":\n        if version > (10, 6):\n            return []\n        formats.extend([\"fat32\", \"fat\"])\n\n    if cpu_arch in {\"arm64\", \"x86_64\"}:\n        formats.append(\"universal2\")\n\n    if cpu_arch in {\"x86_64\", \"i386\", \"ppc64\", \"ppc\", \"intel\"}:\n        formats.append(\"universal\")\n\n    return formats\n\n\ndef mac_platforms(\n    version: AppleVersion | None = None, arch: str | None = None\n) -> Iterator[str]:\n    \"\"\"\n    Yields the platform tags for a macOS system.\n\n    The `version` parameter is a two-item tuple specifying the macOS version to\n    generate platform tags for. The `arch` parameter is the CPU architecture to\n    generate platform tags for. Both parameters default to the appropriate value\n    for the current system.\n    \"\"\"\n    version_str, _, cpu_arch = platform.mac_ver()\n    if version is None:\n        version = cast(\"AppleVersion\", tuple(map(int, version_str.split(\".\")[:2])))\n        if version == (10, 16):\n            # When built against an older macOS SDK, Python will report macOS 10.16\n            # instead of the real version.\n            version_str = subprocess.run(\n                [\n                    sys.executable,\n                    \"-sS\",\n                    \"-c\",\n                    \"import platform; print(platform.mac_ver()[0])\",\n                ],\n                check=True,\n                env={\"SYSTEM_VERSION_COMPAT\": \"0\"},\n                stdout=subprocess.PIPE,\n                text=True,\n            ).stdout\n            version = cast(\"AppleVersion\", tuple(map(int, version_str.split(\".\")[:2])))\n    else:\n        version = version\n    if arch is None:\n        arch = _mac_arch(cpu_arch)\n    else:\n        arch = arch\n\n    if (10, 0) <= version and version < (11, 0):\n        # Prior to Mac OS 11, each yearly release of Mac OS bumped the\n        # \"minor\" version number.  The major version was always 10.\n        major_version = 10\n        for minor_version in range(version[1], -1, -1):\n            compat_version = major_version, minor_version\n            binary_formats = _mac_binary_formats(compat_version, arch)\n            for binary_format in binary_formats:\n                yield f\"macosx_{major_version}_{minor_version}_{binary_format}\"\n\n    if version >= (11, 0):\n        # Starting with Mac OS 11, each yearly release bumps the major version\n        # number.   The minor versions are now the midyear updates.\n        minor_version = 0\n        for major_version in range(version[0], 10, -1):\n            compat_version = major_version, minor_version\n            binary_formats = _mac_binary_formats(compat_version, arch)\n            for binary_format in binary_formats:\n                yield f\"macosx_{major_version}_{minor_version}_{binary_format}\"\n\n    if version >= (11, 0):\n        # Mac OS 11 on x86_64 is compatible with binaries from previous releases.\n        # Arm64 support was introduced in 11.0, so no Arm binaries from previous\n        # releases exist.\n        #\n        # However, the \"universal2\" binary format can have a\n        # macOS version earlier than 11.0 when the x86_64 part of the binary supports\n        # that version of macOS.\n        major_version = 10\n        if arch == \"x86_64\":\n            for minor_version in range(16, 3, -1):\n                compat_version = major_version, minor_version\n                binary_formats = _mac_binary_formats(compat_version, arch)\n                for binary_format in binary_formats:\n                    yield f\"macosx_{major_version}_{minor_version}_{binary_format}\"\n        else:\n            for minor_version in range(16, 3, -1):\n                compat_version = major_version, minor_version\n                binary_format = \"universal2\"\n                yield f\"macosx_{major_version}_{minor_version}_{binary_format}\"\n\n\ndef ios_platforms(\n    version: AppleVersion | None = None, multiarch: str | None = None\n) -> Iterator[str]:\n    \"\"\"\n    Yields the platform tags for an iOS system.\n\n    :param version: A two-item tuple specifying the iOS version to generate\n        platform tags for. Defaults to the current iOS version.\n    :param multiarch: The CPU architecture+ABI to generate platform tags for -\n        (the value used by `sys.implementation._multiarch` e.g.,\n        `arm64_iphoneos` or `x84_64_iphonesimulator`). Defaults to the current\n        multiarch value.\n    \"\"\"\n    if version is None:\n        # if iOS is the current platform, ios_ver *must* be defined. However,\n        # it won't exist for CPython versions before 3.13, which causes a mypy\n        # error.\n        _, release, _, _ = platform.ios_ver()  # type: ignore[attr-defined, unused-ignore]\n        version = cast(\"AppleVersion\", tuple(map(int, release.split(\".\")[:2])))\n\n    if multiarch is None:\n        multiarch = sys.implementation._multiarch\n    multiarch = multiarch.replace(\"-\", \"_\")\n\n    ios_platform_template = \"ios_{major}_{minor}_{multiarch}\"\n\n    # Consider any iOS major.minor version from the version requested, down to\n    # 12.0. 12.0 is the first iOS version that is known to have enough features\n    # to support CPython. Consider every possible minor release up to X.9. There\n    # highest the minor has ever gone is 8 (14.8 and 15.8) but having some extra\n    # candidates that won't ever match doesn't really hurt, and it saves us from\n    # having to keep an explicit list of known iOS versions in the code. Return\n    # the results descending order of version number.\n\n    # If the requested major version is less than 12, there won't be any matches.\n    if version[0] < 12:\n        return\n\n    # Consider the actual X.Y version that was requested.\n    yield ios_platform_template.format(\n        major=version[0], minor=version[1], multiarch=multiarch\n    )\n\n    # Consider every minor version from X.0 to the minor version prior to the\n    # version requested by the platform.\n    for minor in range(version[1] - 1, -1, -1):\n        yield ios_platform_template.format(\n            major=version[0], minor=minor, multiarch=multiarch\n        )\n\n    for major in range(version[0] - 1, 11, -1):\n        for minor in range(9, -1, -1):\n            yield ios_platform_template.format(\n                major=major, minor=minor, multiarch=multiarch\n            )\n\n\ndef android_platforms(\n    api_level: int | None = None, abi: str | None = None\n) -> Iterator[str]:\n    \"\"\"\n    Yields the :attr:`~Tag.platform` tags for Android. If this function is invoked on\n    non-Android platforms, the ``api_level`` and ``abi`` arguments are required.\n\n    :param int api_level: The maximum `API level\n        `__ to return. Defaults\n        to the current system's version, as returned by ``platform.android_ver``.\n    :param str abi: The `Android ABI `__,\n        e.g. ``arm64_v8a``. Defaults to the current system's ABI , as returned by\n        ``sysconfig.get_platform``. Hyphens and periods will be replaced with\n        underscores.\n    \"\"\"\n    if platform.system() != \"Android\" and (api_level is None or abi is None):\n        raise TypeError(\n            \"on non-Android platforms, the api_level and abi arguments are required\"\n        )\n\n    if api_level is None:\n        # Python 3.13 was the first version to return platform.system() == \"Android\",\n        # and also the first version to define platform.android_ver().\n        api_level = platform.android_ver().api_level  # type: ignore[attr-defined]\n\n    if abi is None:\n        abi = sysconfig.get_platform().split(\"-\")[-1]\n    abi = _normalize_string(abi)\n\n    # 16 is the minimum API level known to have enough features to support CPython\n    # without major patching. Yield every API level from the maximum down to the\n    # minimum, inclusive.\n    min_api_level = 16\n    for ver in range(api_level, min_api_level - 1, -1):\n        yield f\"android_{ver}_{abi}\"\n\n\ndef _linux_platforms(is_32bit: bool = _32_BIT_INTERPRETER) -> Iterator[str]:\n    linux = _normalize_string(sysconfig.get_platform())\n    if not linux.startswith(\"linux_\"):\n        # we should never be here, just yield the sysconfig one and return\n        yield linux\n        return\n    if is_32bit:\n        if linux == \"linux_x86_64\":\n            linux = \"linux_i686\"\n        elif linux == \"linux_aarch64\":\n            linux = \"linux_armv8l\"\n    _, arch = linux.split(\"_\", 1)\n    archs = {\"armv8l\": [\"armv8l\", \"armv7l\"]}.get(arch, [arch])\n    yield from _manylinux.platform_tags(archs)\n    yield from _musllinux.platform_tags(archs)\n    for arch in archs:\n        yield f\"linux_{arch}\"\n\n\ndef _generic_platforms() -> Iterator[str]:\n    yield _normalize_string(sysconfig.get_platform())\n\n\ndef platform_tags() -> Iterator[str]:\n    \"\"\"\n    Provides the platform tags for this installation.\n    \"\"\"\n    if platform.system() == \"Darwin\":\n        return mac_platforms()\n    elif platform.system() == \"iOS\":\n        return ios_platforms()\n    elif platform.system() == \"Android\":\n        return android_platforms()\n    elif platform.system() == \"Linux\":\n        return _linux_platforms()\n    else:\n        return _generic_platforms()\n\n\ndef interpreter_name() -> str:\n    \"\"\"\n    Returns the name of the running interpreter.\n\n    Some implementations have a reserved, two-letter abbreviation which will\n    be returned when appropriate.\n    \"\"\"\n    name = sys.implementation.name\n    return INTERPRETER_SHORT_NAMES.get(name) or name\n\n\ndef interpreter_version(*, warn: bool = False) -> str:\n    \"\"\"\n    Returns the version of the running interpreter.\n    \"\"\"\n    version = _get_config_var(\"py_version_nodot\", warn=warn)\n    if version:\n        version = str(version)\n    else:\n        version = _version_nodot(sys.version_info[:2])\n    return version\n\n\ndef _version_nodot(version: PythonVersion) -> str:\n    return \"\".join(map(str, version))\n\n\ndef sys_tags(*, warn: bool = False) -> Iterator[Tag]:\n    \"\"\"\n    Returns the sequence of tag triples for the running interpreter.\n\n    The order of the sequence corresponds to priority order for the\n    interpreter, from most to least important.\n    \"\"\"\n\n    interp_name = interpreter_name()\n    if interp_name == \"cp\":\n        yield from cpython_tags(warn=warn)\n    else:\n        yield from generic_tags()\n\n    if interp_name == \"pp\":\n        interp = \"pp3\"\n    elif interp_name == \"cp\":\n        interp = \"cp\" + interpreter_version(warn=warn)\n    else:\n        interp = None\n    yield from compatible_tags(interpreter=interp)\n",[],[216,809,810,811,890,891,1694,1703],"07fe21c8-67fc-11f0-928e-0224a6c84d84","specifiers.py","07fe2268-67fc-11f0-928e-0224a6c84d84",289,["D",1753299261191],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\"\"\"\n.. testsetup::\n\n    from pip._vendor.packaging.specifiers import Specifier, SpecifierSet, InvalidSpecifier\n    from pip._vendor.packaging.version import Version\n\"\"\"\n\nfrom __future__ import annotations\n\nimport abc\nimport itertools\nimport re\nfrom typing import Callable, Iterable, Iterator, TypeVar, Union\n\nfrom .utils import canonicalize_version\nfrom .version import Version\n\nUnparsedVersion = Union[Version, str]\nUnparsedVersionVar = TypeVar(\"UnparsedVersionVar\", bound=UnparsedVersion)\nCallableOperator = Callable[[Version, str], bool]\n\n\ndef _coerce_version(version: UnparsedVersion) -> Version:\n    if not isinstance(version, Version):\n        version = Version(version)\n    return version\n\n\nclass InvalidSpecifier(ValueError):\n    \"\"\"\n    Raised when attempting to create a :class:`Specifier` with a specifier\n    string that is invalid.\n\n    >>> Specifier(\"lolwat\")\n    Traceback (most recent call last):\n        ...\n    packaging.specifiers.InvalidSpecifier: Invalid specifier: 'lolwat'\n    \"\"\"\n\n\nclass BaseSpecifier(metaclass=abc.ABCMeta):\n    @abc.abstractmethod\n    def __str__(self) -> str:\n        \"\"\"\n        Returns the str representation of this Specifier-like object. This\n        should be representative of the Specifier itself.\n        \"\"\"\n\n    @abc.abstractmethod\n    def __hash__(self) -> int:\n        \"\"\"\n        Returns a hash value for this Specifier-like object.\n        \"\"\"\n\n    @abc.abstractmethod\n    def __eq__(self, other: object) -> bool:\n        \"\"\"\n        Returns a boolean representing whether or not the two Specifier-like\n        objects are equal.\n\n        :param other: The other object to check against.\n        \"\"\"\n\n    @property\n    @abc.abstractmethod\n    def prereleases(self) -> bool | None:\n        \"\"\"Whether or not pre-releases as a whole are allowed.\n\n        This can be set to either ``True`` or ``False`` to explicitly enable or disable\n        prereleases or it can be set to ``None`` (the default) to use default semantics.\n        \"\"\"\n\n    @prereleases.setter\n    def prereleases(self, value: bool) -> None:\n        \"\"\"Setter for :attr:`prereleases`.\n\n        :param value: The value to set.\n        \"\"\"\n\n    @abc.abstractmethod\n    def contains(self, item: str, prereleases: bool | None = None) -> bool:\n        \"\"\"\n        Determines if the given item is contained within this specifier.\n        \"\"\"\n\n    @abc.abstractmethod\n    def filter(\n        self, iterable: Iterable[UnparsedVersionVar], prereleases: bool | None = None\n    ) -> Iterator[UnparsedVersionVar]:\n        \"\"\"\n        Takes an iterable of items and filters them so that only items which\n        are contained within this specifier are allowed in it.\n        \"\"\"\n\n\nclass Specifier(BaseSpecifier):\n    \"\"\"This class abstracts handling of version specifiers.\n\n    .. tip::\n\n        It is generally not required to instantiate this manually. You should instead\n        prefer to work with :class:`SpecifierSet` instead, which can parse\n        comma-separated version specifiers (which is what package metadata contains).\n    \"\"\"\n\n    _operator_regex_str = r\"\"\"\n        (?P(~=|==|!=|<=|>=|<|>|===))\n        \"\"\"\n    _version_regex_str = r\"\"\"\n        (?P\n            (?:\n                # The identity operators allow for an escape hatch that will\n                # do an exact string match of the version you wish to install.\n                # This will not be parsed by PEP 440 and we cannot determine\n                # any semantic meaning from it. This operator is discouraged\n                # but included entirely as an escape hatch.\n                (?<====)  # Only match for the identity operator\n                \\s*\n                [^\\s;)]*  # The arbitrary version can be just about anything,\n                          # we match everything except for whitespace, a\n                          # semi-colon for marker support, and a closing paren\n                          # since versions can be enclosed in them.\n            )\n            |\n            (?:\n                # The (non)equality operators allow for wild card and local\n                # versions to be specified so we have to define these two\n                # operators separately to enable that.\n                (?<===|!=)            # Only match for equals and not equals\n\n                \\s*\n                v?\n                (?:[0-9]+!)?          # epoch\n                [0-9]+(?:\\.[0-9]+)*   # release\n\n                # You cannot use a wild card and a pre-release, post-release, a dev or\n                # local version together so group them with a | and make them optional.\n                (?:\n                    \\.\\*  # Wild card syntax of .*\n                    |\n                    (?:                                  # pre release\n                        [-_\\.]?\n                        (alpha|beta|preview|pre|a|b|c|rc)\n                        [-_\\.]?\n                        [0-9]*\n                    )?\n                    (?:                                  # post release\n                        (?:-[0-9]+)|(?:[-_\\.]?(post|rev|r)[-_\\.]?[0-9]*)\n                    )?\n                    (?:[-_\\.]?dev[-_\\.]?[0-9]*)?         # dev release\n                    (?:\\+[a-z0-9]+(?:[-_\\.][a-z0-9]+)*)? # local\n                )?\n            )\n            |\n            (?:\n                # The compatible operator requires at least two digits in the\n                # release segment.\n                (?<=~=)               # Only match for the compatible operator\n\n                \\s*\n                v?\n                (?:[0-9]+!)?          # epoch\n                [0-9]+(?:\\.[0-9]+)+   # release  (We have a + instead of a *)\n                (?:                   # pre release\n                    [-_\\.]?\n                    (alpha|beta|preview|pre|a|b|c|rc)\n                    [-_\\.]?\n                    [0-9]*\n                )?\n                (?:                                   # post release\n                    (?:-[0-9]+)|(?:[-_\\.]?(post|rev|r)[-_\\.]?[0-9]*)\n                )?\n                (?:[-_\\.]?dev[-_\\.]?[0-9]*)?          # dev release\n            )\n            |\n            (?:\n                # All other operators only allow a sub set of what the\n                # (non)equality operators do. Specifically they do not allow\n                # local versions to be specified nor do they allow the prefix\n                # matching wild cards.\n                (?=\": \"greater_than_equal\",\n        \"<\": \"less_than\",\n        \">\": \"greater_than\",\n        \"===\": \"arbitrary\",\n    }\n\n    def __init__(self, spec: str = \"\", prereleases: bool | None = None) -> None:\n        \"\"\"Initialize a Specifier instance.\n\n        :param spec:\n            The string representation of a specifier which will be parsed and\n            normalized before use.\n        :param prereleases:\n            This tells the specifier if it should accept prerelease versions if\n            applicable or not. The default of ``None`` will autodetect it from the\n            given specifiers.\n        :raises InvalidSpecifier:\n            If the given specifier is invalid (i.e. bad syntax).\n        \"\"\"\n        match = self._regex.search(spec)\n        if not match:\n            raise InvalidSpecifier(f\"Invalid specifier: {spec!r}\")\n\n        self._spec: tuple[str, str] = (\n            match.group(\"operator\").strip(),\n            match.group(\"version\").strip(),\n        )\n\n        # Store whether or not this Specifier should accept prereleases\n        self._prereleases = prereleases\n\n    # https://github.com/python/mypy/pull/13475#pullrequestreview-1079784515\n    @property  # type: ignore[override]\n    def prereleases(self) -> bool:\n        # If there is an explicit prereleases set for this, then we'll just\n        # blindly use that.\n        if self._prereleases is not None:\n            return self._prereleases\n\n        # Look at all of our specifiers and determine if they are inclusive\n        # operators, and if they are if they are including an explicit\n        # prerelease.\n        operator, version = self._spec\n        if operator in [\"==\", \">=\", \"<=\", \"~=\", \"===\", \">\", \"<\"]:\n            # The == specifier can include a trailing .*, if it does we\n            # want to remove before parsing.\n            if operator == \"==\" and version.endswith(\".*\"):\n                version = version[:-2]\n\n            # Parse the version, and if it is a pre-release than this\n            # specifier allows pre-releases.\n            if Version(version).is_prerelease:\n                return True\n\n        return False\n\n    @prereleases.setter\n    def prereleases(self, value: bool) -> None:\n        self._prereleases = value\n\n    @property\n    def operator(self) -> str:\n        \"\"\"The operator of this specifier.\n\n        >>> Specifier(\"==1.2.3\").operator\n        '=='\n        \"\"\"\n        return self._spec[0]\n\n    @property\n    def version(self) -> str:\n        \"\"\"The version of this specifier.\n\n        >>> Specifier(\"==1.2.3\").version\n        '1.2.3'\n        \"\"\"\n        return self._spec[1]\n\n    def __repr__(self) -> str:\n        \"\"\"A representation of the Specifier that shows all internal state.\n\n        >>> Specifier('>=1.0.0')\n        =1.0.0')>\n        >>> Specifier('>=1.0.0', prereleases=False)\n        =1.0.0', prereleases=False)>\n        >>> Specifier('>=1.0.0', prereleases=True)\n        =1.0.0', prereleases=True)>\n        \"\"\"\n        pre = (\n            f\", prereleases={self.prereleases!r}\"\n            if self._prereleases is not None\n            else \"\"\n        )\n\n        return f\"<{self.__class__.__name__}({str(self)!r}{pre})>\"\n\n    def __str__(self) -> str:\n        \"\"\"A string representation of the Specifier that can be round-tripped.\n\n        >>> str(Specifier('>=1.0.0'))\n        '>=1.0.0'\n        >>> str(Specifier('>=1.0.0', prereleases=False))\n        '>=1.0.0'\n        \"\"\"\n        return \"{}{}\".format(*self._spec)\n\n    @property\n    def _canonical_spec(self) -> tuple[str, str]:\n        canonical_version = canonicalize_version(\n            self._spec[1],\n            strip_trailing_zero=(self._spec[0] != \"~=\"),\n        )\n        return self._spec[0], canonical_version\n\n    def __hash__(self) -> int:\n        return hash(self._canonical_spec)\n\n    def __eq__(self, other: object) -> bool:\n        \"\"\"Whether or not the two Specifier-like objects are equal.\n\n        :param other: The other object to check against.\n\n        The value of :attr:`prereleases` is ignored.\n\n        >>> Specifier(\"==1.2.3\") == Specifier(\"== 1.2.3.0\")\n        True\n        >>> (Specifier(\"==1.2.3\", prereleases=False) ==\n        ...  Specifier(\"==1.2.3\", prereleases=True))\n        True\n        >>> Specifier(\"==1.2.3\") == \"==1.2.3\"\n        True\n        >>> Specifier(\"==1.2.3\") == Specifier(\"==1.2.4\")\n        False\n        >>> Specifier(\"==1.2.3\") == Specifier(\"~=1.2.3\")\n        False\n        \"\"\"\n        if isinstance(other, str):\n            try:\n                other = self.__class__(str(other))\n            except InvalidSpecifier:\n                return NotImplemented\n        elif not isinstance(other, self.__class__):\n            return NotImplemented\n\n        return self._canonical_spec == other._canonical_spec\n\n    def _get_operator(self, op: str) -> CallableOperator:\n        operator_callable: CallableOperator = getattr(\n            self, f\"_compare_{self._operators[op]}\"\n        )\n        return operator_callable\n\n    def _compare_compatible(self, prospective: Version, spec: str) -> bool:\n        # Compatible releases have an equivalent combination of >= and ==. That\n        # is that ~=2.2 is equivalent to >=2.2,==2.*. This allows us to\n        # implement this in terms of the other specifiers instead of\n        # implementing it ourselves. The only thing we need to do is construct\n        # the other specifiers.\n\n        # We want everything but the last item in the version, but we want to\n        # ignore suffix segments.\n        prefix = _version_join(\n            list(itertools.takewhile(_is_not_suffix, _version_split(spec)))[:-1]\n        )\n\n        # Add the prefix notation to the end of our string\n        prefix += \".*\"\n\n        return self._get_operator(\">=\")(prospective, spec) and self._get_operator(\"==\")(\n            prospective, prefix\n        )\n\n    def _compare_equal(self, prospective: Version, spec: str) -> bool:\n        # We need special logic to handle prefix matching\n        if spec.endswith(\".*\"):\n            # In the case of prefix matching we want to ignore local segment.\n            normalized_prospective = canonicalize_version(\n                prospective.public, strip_trailing_zero=False\n            )\n            # Get the normalized version string ignoring the trailing .*\n            normalized_spec = canonicalize_version(spec[:-2], strip_trailing_zero=False)\n            # Split the spec out by bangs and dots, and pretend that there is\n            # an implicit dot in between a release segment and a pre-release segment.\n            split_spec = _version_split(normalized_spec)\n\n            # Split the prospective version out by bangs and dots, and pretend\n            # that there is an implicit dot in between a release segment and\n            # a pre-release segment.\n            split_prospective = _version_split(normalized_prospective)\n\n            # 0-pad the prospective version before shortening it to get the correct\n            # shortened version.\n            padded_prospective, _ = _pad_version(split_prospective, split_spec)\n\n            # Shorten the prospective version to be the same length as the spec\n            # so that we can determine if the specifier is a prefix of the\n            # prospective version or not.\n            shortened_prospective = padded_prospective[: len(split_spec)]\n\n            return shortened_prospective == split_spec\n        else:\n            # Convert our spec string into a Version\n            spec_version = Version(spec)\n\n            # If the specifier does not have a local segment, then we want to\n            # act as if the prospective version also does not have a local\n            # segment.\n            if not spec_version.local:\n                prospective = Version(prospective.public)\n\n            return prospective == spec_version\n\n    def _compare_not_equal(self, prospective: Version, spec: str) -> bool:\n        return not self._compare_equal(prospective, spec)\n\n    def _compare_less_than_equal(self, prospective: Version, spec: str) -> bool:\n        # NB: Local version identifiers are NOT permitted in the version\n        # specifier, so local version labels can be universally removed from\n        # the prospective version.\n        return Version(prospective.public) <= Version(spec)\n\n    def _compare_greater_than_equal(self, prospective: Version, spec: str) -> bool:\n        # NB: Local version identifiers are NOT permitted in the version\n        # specifier, so local version labels can be universally removed from\n        # the prospective version.\n        return Version(prospective.public) >= Version(spec)\n\n    def _compare_less_than(self, prospective: Version, spec_str: str) -> bool:\n        # Convert our spec to a Version instance, since we'll want to work with\n        # it as a version.\n        spec = Version(spec_str)\n\n        # Check to see if the prospective version is less than the spec\n        # version. If it's not we can short circuit and just return False now\n        # instead of doing extra unneeded work.\n        if not prospective < spec:\n            return False\n\n        # This special case is here so that, unless the specifier itself\n        # includes is a pre-release version, that we do not accept pre-release\n        # versions for the version mentioned in the specifier (e.g. <3.1 should\n        # not match 3.1.dev0, but should match 3.0.dev0).\n        if not spec.is_prerelease and prospective.is_prerelease:\n            if Version(prospective.base_version) == Version(spec.base_version):\n                return False\n\n        # If we've gotten to here, it means that prospective version is both\n        # less than the spec version *and* it's not a pre-release of the same\n        # version in the spec.\n        return True\n\n    def _compare_greater_than(self, prospective: Version, spec_str: str) -> bool:\n        # Convert our spec to a Version instance, since we'll want to work with\n        # it as a version.\n        spec = Version(spec_str)\n\n        # Check to see if the prospective version is greater than the spec\n        # version. If it's not we can short circuit and just return False now\n        # instead of doing extra unneeded work.\n        if not prospective > spec:\n            return False\n\n        # This special case is here so that, unless the specifier itself\n        # includes is a post-release version, that we do not accept\n        # post-release versions for the version mentioned in the specifier\n        # (e.g. >3.1 should not match 3.0.post0, but should match 3.2.post0).\n        if not spec.is_postrelease and prospective.is_postrelease:\n            if Version(prospective.base_version) == Version(spec.base_version):\n                return False\n\n        # Ensure that we do not allow a local version of the version mentioned\n        # in the specifier, which is technically greater than, to match.\n        if prospective.local is not None:\n            if Version(prospective.base_version) == Version(spec.base_version):\n                return False\n\n        # If we've gotten to here, it means that prospective version is both\n        # greater than the spec version *and* it's not a pre-release of the\n        # same version in the spec.\n        return True\n\n    def _compare_arbitrary(self, prospective: Version, spec: str) -> bool:\n        return str(prospective).lower() == str(spec).lower()\n\n    def __contains__(self, item: str | Version) -> bool:\n        \"\"\"Return whether or not the item is contained in this specifier.\n\n        :param item: The item to check for.\n\n        This is used for the ``in`` operator and behaves the same as\n        :meth:`contains` with no ``prereleases`` argument passed.\n\n        >>> \"1.2.3\" in Specifier(\">=1.2.3\")\n        True\n        >>> Version(\"1.2.3\") in Specifier(\">=1.2.3\")\n        True\n        >>> \"1.0.0\" in Specifier(\">=1.2.3\")\n        False\n        >>> \"1.3.0a1\" in Specifier(\">=1.2.3\")\n        False\n        >>> \"1.3.0a1\" in Specifier(\">=1.2.3\", prereleases=True)\n        True\n        \"\"\"\n        return self.contains(item)\n\n    def contains(self, item: UnparsedVersion, prereleases: bool | None = None) -> bool:\n        \"\"\"Return whether or not the item is contained in this specifier.\n\n        :param item:\n            The item to check for, which can be a version string or a\n            :class:`Version` instance.\n        :param prereleases:\n            Whether or not to match prereleases with this Specifier. If set to\n            ``None`` (the default), it uses :attr:`prereleases` to determine\n            whether or not prereleases are allowed.\n\n        >>> Specifier(\">=1.2.3\").contains(\"1.2.3\")\n        True\n        >>> Specifier(\">=1.2.3\").contains(Version(\"1.2.3\"))\n        True\n        >>> Specifier(\">=1.2.3\").contains(\"1.0.0\")\n        False\n        >>> Specifier(\">=1.2.3\").contains(\"1.3.0a1\")\n        False\n        >>> Specifier(\">=1.2.3\", prereleases=True).contains(\"1.3.0a1\")\n        True\n        >>> Specifier(\">=1.2.3\").contains(\"1.3.0a1\", prereleases=True)\n        True\n        \"\"\"\n\n        # Determine if prereleases are to be allowed or not.\n        if prereleases is None:\n            prereleases = self.prereleases\n\n        # Normalize item to a Version, this allows us to have a shortcut for\n        # \"2.0\" in Specifier(\">=2\")\n        normalized_item = _coerce_version(item)\n\n        # Determine if we should be supporting prereleases in this specifier\n        # or not, if we do not support prereleases than we can short circuit\n        # logic if this version is a prereleases.\n        if normalized_item.is_prerelease and not prereleases:\n            return False\n\n        # Actually do the comparison to determine if this item is contained\n        # within this Specifier or not.\n        operator_callable: CallableOperator = self._get_operator(self.operator)\n        return operator_callable(normalized_item, self.version)\n\n    def filter(\n        self, iterable: Iterable[UnparsedVersionVar], prereleases: bool | None = None\n    ) -> Iterator[UnparsedVersionVar]:\n        \"\"\"Filter items in the given iterable, that match the specifier.\n\n        :param iterable:\n            An iterable that can contain version strings and :class:`Version` instances.\n            The items in the iterable will be filtered according to the specifier.\n        :param prereleases:\n            Whether or not to allow prereleases in the returned iterator. If set to\n            ``None`` (the default), it will be intelligently decide whether to allow\n            prereleases or not (based on the :attr:`prereleases` attribute, and\n            whether the only versions matching are prereleases).\n\n        This method is smarter than just ``filter(Specifier().contains, [...])``\n        because it implements the rule from :pep:`440` that a prerelease item\n        SHOULD be accepted if no other versions match the given specifier.\n\n        >>> list(Specifier(\">=1.2.3\").filter([\"1.2\", \"1.3\", \"1.5a1\"]))\n        ['1.3']\n        >>> list(Specifier(\">=1.2.3\").filter([\"1.2\", \"1.2.3\", \"1.3\", Version(\"1.4\")]))\n        ['1.2.3', '1.3', ]\n        >>> list(Specifier(\">=1.2.3\").filter([\"1.2\", \"1.5a1\"]))\n        ['1.5a1']\n        >>> list(Specifier(\">=1.2.3\").filter([\"1.3\", \"1.5a1\"], prereleases=True))\n        ['1.3', '1.5a1']\n        >>> list(Specifier(\">=1.2.3\", prereleases=True).filter([\"1.3\", \"1.5a1\"]))\n        ['1.3', '1.5a1']\n        \"\"\"\n\n        yielded = False\n        found_prereleases = []\n\n        kw = {\"prereleases\": prereleases if prereleases is not None else True}\n\n        # Attempt to iterate over all the values in the iterable and if any of\n        # them match, yield them.\n        for version in iterable:\n            parsed_version = _coerce_version(version)\n\n            if self.contains(parsed_version, **kw):\n                # If our version is a prerelease, and we were not set to allow\n                # prereleases, then we'll store it for later in case nothing\n                # else matches this specifier.\n                if parsed_version.is_prerelease and not (\n                    prereleases or self.prereleases\n                ):\n                    found_prereleases.append(version)\n                # Either this is not a prerelease, or we should have been\n                # accepting prereleases from the beginning.\n                else:\n                    yielded = True\n                    yield version\n\n        # Now that we've iterated over everything, determine if we've yielded\n        # any values, and if we have not and we have any prereleases stored up\n        # then we will go ahead and yield the prereleases.\n        if not yielded and found_prereleases:\n            for version in found_prereleases:\n                yield version\n\n\n_prefix_regex = re.compile(r\"^([0-9]+)((?:a|b|c|rc)[0-9]+)$\")\n\n\ndef _version_split(version: str) -> list[str]:\n    \"\"\"Split version into components.\n\n    The split components are intended for version comparison. The logic does\n    not attempt to retain the original version string, so joining the\n    components back with :func:`_version_join` may not produce the original\n    version string.\n    \"\"\"\n    result: list[str] = []\n\n    epoch, _, rest = version.rpartition(\"!\")\n    result.append(epoch or \"0\")\n\n    for item in rest.split(\".\"):\n        match = _prefix_regex.search(item)\n        if match:\n            result.extend(match.groups())\n        else:\n            result.append(item)\n    return result\n\n\ndef _version_join(components: list[str]) -> str:\n    \"\"\"Join split version components into a version string.\n\n    This function assumes the input came from :func:`_version_split`, where the\n    first component must be the epoch (either empty or numeric), and all other\n    components numeric.\n    \"\"\"\n    epoch, *rest = components\n    return f\"{epoch}!{'.'.join(rest)}\"\n\n\ndef _is_not_suffix(segment: str) -> bool:\n    return not any(\n        segment.startswith(prefix) for prefix in (\"dev\", \"a\", \"b\", \"rc\", \"post\")\n    )\n\n\ndef _pad_version(left: list[str], right: list[str]) -> tuple[list[str], list[str]]:\n    left_split, right_split = [], []\n\n    # Get the release segment of our versions\n    left_split.append(list(itertools.takewhile(lambda x: x.isdigit(), left)))\n    right_split.append(list(itertools.takewhile(lambda x: x.isdigit(), right)))\n\n    # Get the rest of our versions\n    left_split.append(left[len(left_split[0]) :])\n    right_split.append(right[len(right_split[0]) :])\n\n    # Insert our padding\n    left_split.insert(1, [\"0\"] * max(0, len(right_split[0]) - len(left_split[0])))\n    right_split.insert(1, [\"0\"] * max(0, len(left_split[0]) - len(right_split[0])))\n\n    return (\n        list(itertools.chain.from_iterable(left_split)),\n        list(itertools.chain.from_iterable(right_split)),\n    )\n\n\nclass SpecifierSet(BaseSpecifier):\n    \"\"\"This class abstracts handling of a set of version specifiers.\n\n    It can be passed a single specifier (``>=3.0``), a comma-separated list of\n    specifiers (``>=3.0,!=3.1``), or no specifier at all.\n    \"\"\"\n\n    def __init__(\n        self,\n        specifiers: str | Iterable[Specifier] = \"\",\n        prereleases: bool | None = None,\n    ) -> None:\n        \"\"\"Initialize a SpecifierSet instance.\n\n        :param specifiers:\n            The string representation of a specifier or a comma-separated list of\n            specifiers which will be parsed and normalized before use.\n            May also be an iterable of ``Specifier`` instances, which will be used\n            as is.\n        :param prereleases:\n            This tells the SpecifierSet if it should accept prerelease versions if\n            applicable or not. The default of ``None`` will autodetect it from the\n            given specifiers.\n\n        :raises InvalidSpecifier:\n            If the given ``specifiers`` are not parseable than this exception will be\n            raised.\n        \"\"\"\n\n        if isinstance(specifiers, str):\n            # Split on `,` to break each individual specifier into its own item, and\n            # strip each item to remove leading/trailing whitespace.\n            split_specifiers = [s.strip() for s in specifiers.split(\",\") if s.strip()]\n\n            # Make each individual specifier a Specifier and save in a frozen set\n            # for later.\n            self._specs = frozenset(map(Specifier, split_specifiers))\n        else:\n            # Save the supplied specifiers in a frozen set.\n            self._specs = frozenset(specifiers)\n\n        # Store our prereleases value so we can use it later to determine if\n        # we accept prereleases or not.\n        self._prereleases = prereleases\n\n    @property\n    def prereleases(self) -> bool | None:\n        # If we have been given an explicit prerelease modifier, then we'll\n        # pass that through here.\n        if self._prereleases is not None:\n            return self._prereleases\n\n        # If we don't have any specifiers, and we don't have a forced value,\n        # then we'll just return None since we don't know if this should have\n        # pre-releases or not.\n        if not self._specs:\n            return None\n\n        # Otherwise we'll see if any of the given specifiers accept\n        # prereleases, if any of them do we'll return True, otherwise False.\n        return any(s.prereleases for s in self._specs)\n\n    @prereleases.setter\n    def prereleases(self, value: bool) -> None:\n        self._prereleases = value\n\n    def __repr__(self) -> str:\n        \"\"\"A representation of the specifier set that shows all internal state.\n\n        Note that the ordering of the individual specifiers within the set may not\n        match the input string.\n\n        >>> SpecifierSet('>=1.0.0,!=2.0.0')\n        =1.0.0')>\n        >>> SpecifierSet('>=1.0.0,!=2.0.0', prereleases=False)\n        =1.0.0', prereleases=False)>\n        >>> SpecifierSet('>=1.0.0,!=2.0.0', prereleases=True)\n        =1.0.0', prereleases=True)>\n        \"\"\"\n        pre = (\n            f\", prereleases={self.prereleases!r}\"\n            if self._prereleases is not None\n            else \"\"\n        )\n\n        return f\"\"\n\n    def __str__(self) -> str:\n        \"\"\"A string representation of the specifier set that can be round-tripped.\n\n        Note that the ordering of the individual specifiers within the set may not\n        match the input string.\n\n        >>> str(SpecifierSet(\">=1.0.0,!=1.0.1\"))\n        '!=1.0.1,>=1.0.0'\n        >>> str(SpecifierSet(\">=1.0.0,!=1.0.1\", prereleases=False))\n        '!=1.0.1,>=1.0.0'\n        \"\"\"\n        return \",\".join(sorted(str(s) for s in self._specs))\n\n    def __hash__(self) -> int:\n        return hash(self._specs)\n\n    def __and__(self, other: SpecifierSet | str) -> SpecifierSet:\n        \"\"\"Return a SpecifierSet which is a combination of the two sets.\n\n        :param other: The other object to combine with.\n\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") & '<=2.0.0,!=2.0.1'\n        =1.0.0')>\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") & SpecifierSet('<=2.0.0,!=2.0.1')\n        =1.0.0')>\n        \"\"\"\n        if isinstance(other, str):\n            other = SpecifierSet(other)\n        elif not isinstance(other, SpecifierSet):\n            return NotImplemented\n\n        specifier = SpecifierSet()\n        specifier._specs = frozenset(self._specs | other._specs)\n\n        if self._prereleases is None and other._prereleases is not None:\n            specifier._prereleases = other._prereleases\n        elif self._prereleases is not None and other._prereleases is None:\n            specifier._prereleases = self._prereleases\n        elif self._prereleases == other._prereleases:\n            specifier._prereleases = self._prereleases\n        else:\n            raise ValueError(\n                \"Cannot combine SpecifierSets with True and False prerelease overrides.\"\n            )\n\n        return specifier\n\n    def __eq__(self, other: object) -> bool:\n        \"\"\"Whether or not the two SpecifierSet-like objects are equal.\n\n        :param other: The other object to check against.\n\n        The value of :attr:`prereleases` is ignored.\n\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") == SpecifierSet(\">=1.0.0,!=1.0.1\")\n        True\n        >>> (SpecifierSet(\">=1.0.0,!=1.0.1\", prereleases=False) ==\n        ...  SpecifierSet(\">=1.0.0,!=1.0.1\", prereleases=True))\n        True\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") == \">=1.0.0,!=1.0.1\"\n        True\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") == SpecifierSet(\">=1.0.0\")\n        False\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\") == SpecifierSet(\">=1.0.0,!=1.0.2\")\n        False\n        \"\"\"\n        if isinstance(other, (str, Specifier)):\n            other = SpecifierSet(str(other))\n        elif not isinstance(other, SpecifierSet):\n            return NotImplemented\n\n        return self._specs == other._specs\n\n    def __len__(self) -> int:\n        \"\"\"Returns the number of specifiers in this specifier set.\"\"\"\n        return len(self._specs)\n\n    def __iter__(self) -> Iterator[Specifier]:\n        \"\"\"\n        Returns an iterator over all the underlying :class:`Specifier` instances\n        in this specifier set.\n\n        >>> sorted(SpecifierSet(\">=1.0.0,!=1.0.1\"), key=str)\n        [, =1.0.0')>]\n        \"\"\"\n        return iter(self._specs)\n\n    def __contains__(self, item: UnparsedVersion) -> bool:\n        \"\"\"Return whether or not the item is contained in this specifier.\n\n        :param item: The item to check for.\n\n        This is used for the ``in`` operator and behaves the same as\n        :meth:`contains` with no ``prereleases`` argument passed.\n\n        >>> \"1.2.3\" in SpecifierSet(\">=1.0.0,!=1.0.1\")\n        True\n        >>> Version(\"1.2.3\") in SpecifierSet(\">=1.0.0,!=1.0.1\")\n        True\n        >>> \"1.0.1\" in SpecifierSet(\">=1.0.0,!=1.0.1\")\n        False\n        >>> \"1.3.0a1\" in SpecifierSet(\">=1.0.0,!=1.0.1\")\n        False\n        >>> \"1.3.0a1\" in SpecifierSet(\">=1.0.0,!=1.0.1\", prereleases=True)\n        True\n        \"\"\"\n        return self.contains(item)\n\n    def contains(\n        self,\n        item: UnparsedVersion,\n        prereleases: bool | None = None,\n        installed: bool | None = None,\n    ) -> bool:\n        \"\"\"Return whether or not the item is contained in this SpecifierSet.\n\n        :param item:\n            The item to check for, which can be a version string or a\n            :class:`Version` instance.\n        :param prereleases:\n            Whether or not to match prereleases with this SpecifierSet. If set to\n            ``None`` (the default), it uses :attr:`prereleases` to determine\n            whether or not prereleases are allowed.\n\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\").contains(\"1.2.3\")\n        True\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\").contains(Version(\"1.2.3\"))\n        True\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\").contains(\"1.0.1\")\n        False\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\").contains(\"1.3.0a1\")\n        False\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\", prereleases=True).contains(\"1.3.0a1\")\n        True\n        >>> SpecifierSet(\">=1.0.0,!=1.0.1\").contains(\"1.3.0a1\", prereleases=True)\n        True\n        \"\"\"\n        # Ensure that our item is a Version instance.\n        if not isinstance(item, Version):\n            item = Version(item)\n\n        # Determine if we're forcing a prerelease or not, if we're not forcing\n        # one for this particular filter call, then we'll use whatever the\n        # SpecifierSet thinks for whether or not we should support prereleases.\n        if prereleases is None:\n            prereleases = self.prereleases\n\n        # We can determine if we're going to allow pre-releases by looking to\n        # see if any of the underlying items supports them. If none of them do\n        # and this item is a pre-release then we do not allow it and we can\n        # short circuit that here.\n        # Note: This means that 1.0.dev1 would not be contained in something\n        #       like >=1.0.devabc however it would be in >=1.0.debabc,>0.0.dev0\n        if not prereleases and item.is_prerelease:\n            return False\n\n        if installed and item.is_prerelease:\n            item = Version(item.base_version)\n\n        # We simply dispatch to the underlying specs here to make sure that the\n        # given version is contained within all of them.\n        # Note: This use of all() here means that an empty set of specifiers\n        #       will always return True, this is an explicit design decision.\n        return all(s.contains(item, prereleases=prereleases) for s in self._specs)\n\n    def filter(\n        self, iterable: Iterable[UnparsedVersionVar], prereleases: bool | None = None\n    ) -> Iterator[UnparsedVersionVar]:\n        \"\"\"Filter items in the given iterable, that match the specifiers in this set.\n\n        :param iterable:\n            An iterable that can contain version strings and :class:`Version` instances.\n            The items in the iterable will be filtered according to the specifier.\n        :param prereleases:\n            Whether or not to allow prereleases in the returned iterator. If set to\n            ``None`` (the default), it will be intelligently decide whether to allow\n            prereleases or not (based on the :attr:`prereleases` attribute, and\n            whether the only versions matching are prereleases).\n\n        This method is smarter than just ``filter(SpecifierSet(...).contains, [...])``\n        because it implements the rule from :pep:`440` that a prerelease item\n        SHOULD be accepted if no other versions match the given specifier.\n\n        >>> list(SpecifierSet(\">=1.2.3\").filter([\"1.2\", \"1.3\", \"1.5a1\"]))\n        ['1.3']\n        >>> list(SpecifierSet(\">=1.2.3\").filter([\"1.2\", \"1.3\", Version(\"1.4\")]))\n        ['1.3', ]\n        >>> list(SpecifierSet(\">=1.2.3\").filter([\"1.2\", \"1.5a1\"]))\n        []\n        >>> list(SpecifierSet(\">=1.2.3\").filter([\"1.3\", \"1.5a1\"], prereleases=True))\n        ['1.3', '1.5a1']\n        >>> list(SpecifierSet(\">=1.2.3\", prereleases=True).filter([\"1.3\", \"1.5a1\"]))\n        ['1.3', '1.5a1']\n\n        An \"empty\" SpecifierSet will filter items based on the presence of prerelease\n        versions in the set.\n\n        >>> list(SpecifierSet(\"\").filter([\"1.3\", \"1.5a1\"]))\n        ['1.3']\n        >>> list(SpecifierSet(\"\").filter([\"1.5a1\"]))\n        ['1.5a1']\n        >>> list(SpecifierSet(\"\", prereleases=True).filter([\"1.3\", \"1.5a1\"]))\n        ['1.3', '1.5a1']\n        >>> list(SpecifierSet(\"\").filter([\"1.3\", \"1.5a1\"], prereleases=True))\n        ['1.3', '1.5a1']\n        \"\"\"\n        # Determine if we're forcing a prerelease or not, if we're not forcing\n        # one for this particular filter call, then we'll use whatever the\n        # SpecifierSet thinks for whether or not we should support prereleases.\n        if prereleases is None:\n            prereleases = self.prereleases\n\n        # If we have any specifiers, then we want to wrap our iterable in the\n        # filter method for each one, this will act as a logical AND amongst\n        # each specifier.\n        if self._specs:\n            for spec in self._specs:\n                iterable = spec.filter(iterable, prereleases=bool(prereleases))\n            return iter(iterable)\n        # If we do not have any specifiers, then we need to have a rough filter\n        # which will filter out any pre-releases, unless there are no final\n        # releases.\n        else:\n            filtered: list[UnparsedVersionVar] = []\n            found_prereleases: list[UnparsedVersionVar] = []\n\n            for item in iterable:\n                parsed_version = _coerce_version(item)\n\n                # Store any item which is a pre-release for later unless we've\n                # already found a final version or we are accepting prereleases\n                if parsed_version.is_prerelease and not prereleases:\n                    if not filtered:\n                        found_prereleases.append(item)\n                else:\n                    filtered.append(item)\n\n            # If we've found no items except for pre-releases, then we'll go\n            # ahead and use the pre-releases\n            if not filtered and found_prereleases and prereleases is None:\n                return iter(found_prereleases)\n\n            return iter(filtered)\n",[],[216,809,810,811,890,891,1694,1711],"07e1a886-67fc-11f0-9cad-0224a6c84d84","requirements.py","07e1a94e-67fc-11f0-9cad-0224a6c84d84",284,["D",1753299260990],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\nfrom __future__ import annotations\n\nfrom typing import Any, Iterator\n\nfrom ._parser import parse_requirement as _parse_requirement\nfrom ._tokenizer import ParserSyntaxError\nfrom .markers import Marker, _normalize_extra_values\nfrom .specifiers import SpecifierSet\nfrom .utils import canonicalize_name\n\n\nclass InvalidRequirement(ValueError):\n    \"\"\"\n    An invalid requirement was found, users should refer to PEP 508.\n    \"\"\"\n\n\nclass Requirement:\n    \"\"\"Parse a requirement.\n\n    Parse a given requirement string into its parts, such as name, specifier,\n    URL, and extras. Raises InvalidRequirement on a badly-formed requirement\n    string.\n    \"\"\"\n\n    # TODO: Can we test whether something is contained within a requirement?\n    #       If so how do we do that? Do we need to test against the _name_ of\n    #       the thing as well as the version? What about the markers?\n    # TODO: Can we normalize the name and extra name?\n\n    def __init__(self, requirement_string: str) -> None:\n        try:\n            parsed = _parse_requirement(requirement_string)\n        except ParserSyntaxError as e:\n            raise InvalidRequirement(str(e)) from e\n\n        self.name: str = parsed.name\n        self.url: str | None = parsed.url or None\n        self.extras: set[str] = set(parsed.extras or [])\n        self.specifier: SpecifierSet = SpecifierSet(parsed.specifier)\n        self.marker: Marker | None = None\n        if parsed.marker is not None:\n            self.marker = Marker.__new__(Marker)\n            self.marker._markers = _normalize_extra_values(parsed.marker)\n\n    def _iter_parts(self, name: str) -> Iterator[str]:\n        yield name\n\n        if self.extras:\n            formatted_extras = \",\".join(sorted(self.extras))\n            yield f\"[{formatted_extras}]\"\n\n        if self.specifier:\n            yield str(self.specifier)\n\n        if self.url:\n            yield f\"@ {self.url}\"\n            if self.marker:\n                yield \" \"\n\n        if self.marker:\n            yield f\"; {self.marker}\"\n\n    def __str__(self) -> str:\n        return \"\".join(self._iter_parts(self.name))\n\n    def __repr__(self) -> str:\n        return f\"\"\n\n    def __hash__(self) -> int:\n        return hash(\n            (\n                self.__class__.__name__,\n                *self._iter_parts(canonicalize_name(self.name)),\n            )\n        )\n\n    def __eq__(self, other: Any) -> bool:\n        if not isinstance(other, Requirement):\n            return NotImplemented\n\n        return (\n            canonicalize_name(self.name) == canonicalize_name(other.name)\n            and self.extras == other.extras\n            and self.specifier == other.specifier\n            and self.url == other.url\n            and self.marker == other.marker\n        )\n",[],[216,809,810,811,890,891,1694,1719],"07bc2a3e-67fc-11f0-9ab6-0224a6c84d84","metadata.py","07bc2b10-67fc-11f0-9ab6-0224a6c84d84",277,["D",1753299260763],"from __future__ import annotations\n\nimport email.feedparser\nimport email.header\nimport email.message\nimport email.parser\nimport email.policy\nimport pathlib\nimport sys\nimport typing\nfrom typing import (\n    Any,\n    Callable,\n    Generic,\n    Literal,\n    TypedDict,\n    cast,\n)\n\nfrom . import licenses, requirements, specifiers, utils\nfrom . import version as version_module\nfrom .licenses import NormalizedLicenseExpression\n\nT = typing.TypeVar(\"T\")\n\n\nif sys.version_info >= (3, 11):  # pragma: no cover\n    ExceptionGroup = ExceptionGroup\nelse:  # pragma: no cover\n\n    class ExceptionGroup(Exception):\n        \"\"\"A minimal implementation of :external:exc:`ExceptionGroup` from Python 3.11.\n\n        If :external:exc:`ExceptionGroup` is already defined by Python itself,\n        that version is used instead.\n        \"\"\"\n\n        message: str\n        exceptions: list[Exception]\n\n        def __init__(self, message: str, exceptions: list[Exception]) -> None:\n            self.message = message\n            self.exceptions = exceptions\n\n        def __repr__(self) -> str:\n            return f\"{self.__class__.__name__}({self.message!r}, {self.exceptions!r})\"\n\n\nclass InvalidMetadata(ValueError):\n    \"\"\"A metadata field contains invalid data.\"\"\"\n\n    field: str\n    \"\"\"The name of the field that contains invalid data.\"\"\"\n\n    def __init__(self, field: str, message: str) -> None:\n        self.field = field\n        super().__init__(message)\n\n\n# The RawMetadata class attempts to make as few assumptions about the underlying\n# serialization formats as possible. The idea is that as long as a serialization\n# formats offer some very basic primitives in *some* way then we can support\n# serializing to and from that format.\nclass RawMetadata(TypedDict, total=False):\n    \"\"\"A dictionary of raw core metadata.\n\n    Each field in core metadata maps to a key of this dictionary (when data is\n    provided). The key is lower-case and underscores are used instead of dashes\n    compared to the equivalent core metadata field. Any core metadata field that\n    can be specified multiple times or can hold multiple values in a single\n    field have a key with a plural name. See :class:`Metadata` whose attributes\n    match the keys of this dictionary.\n\n    Core metadata fields that can be specified multiple times are stored as a\n    list or dict depending on which is appropriate for the field. Any fields\n    which hold multiple values in a single field are stored as a list.\n\n    \"\"\"\n\n    # Metadata 1.0 - PEP 241\n    metadata_version: str\n    name: str\n    version: str\n    platforms: list[str]\n    summary: str\n    description: str\n    keywords: list[str]\n    home_page: str\n    author: str\n    author_email: str\n    license: str\n\n    # Metadata 1.1 - PEP 314\n    supported_platforms: list[str]\n    download_url: str\n    classifiers: list[str]\n    requires: list[str]\n    provides: list[str]\n    obsoletes: list[str]\n\n    # Metadata 1.2 - PEP 345\n    maintainer: str\n    maintainer_email: str\n    requires_dist: list[str]\n    provides_dist: list[str]\n    obsoletes_dist: list[str]\n    requires_python: str\n    requires_external: list[str]\n    project_urls: dict[str, str]\n\n    # Metadata 2.0\n    # PEP 426 attempted to completely revamp the metadata format\n    # but got stuck without ever being able to build consensus on\n    # it and ultimately ended up withdrawn.\n    #\n    # However, a number of tools had started emitting METADATA with\n    # `2.0` Metadata-Version, so for historical reasons, this version\n    # was skipped.\n\n    # Metadata 2.1 - PEP 566\n    description_content_type: str\n    provides_extra: list[str]\n\n    # Metadata 2.2 - PEP 643\n    dynamic: list[str]\n\n    # Metadata 2.3 - PEP 685\n    # No new fields were added in PEP 685, just some edge case were\n    # tightened up to provide better interoptability.\n\n    # Metadata 2.4 - PEP 639\n    license_expression: str\n    license_files: list[str]\n\n\n_STRING_FIELDS = {\n    \"author\",\n    \"author_email\",\n    \"description\",\n    \"description_content_type\",\n    \"download_url\",\n    \"home_page\",\n    \"license\",\n    \"license_expression\",\n    \"maintainer\",\n    \"maintainer_email\",\n    \"metadata_version\",\n    \"name\",\n    \"requires_python\",\n    \"summary\",\n    \"version\",\n}\n\n_LIST_FIELDS = {\n    \"classifiers\",\n    \"dynamic\",\n    \"license_files\",\n    \"obsoletes\",\n    \"obsoletes_dist\",\n    \"platforms\",\n    \"provides\",\n    \"provides_dist\",\n    \"provides_extra\",\n    \"requires\",\n    \"requires_dist\",\n    \"requires_external\",\n    \"supported_platforms\",\n}\n\n_DICT_FIELDS = {\n    \"project_urls\",\n}\n\n\ndef _parse_keywords(data: str) -> list[str]:\n    \"\"\"Split a string of comma-separated keywords into a list of keywords.\"\"\"\n    return [k.strip() for k in data.split(\",\")]\n\n\ndef _parse_project_urls(data: list[str]) -> dict[str, str]:\n    \"\"\"Parse a list of label/URL string pairings separated by a comma.\"\"\"\n    urls = {}\n    for pair in data:\n        # Our logic is slightly tricky here as we want to try and do\n        # *something* reasonable with malformed data.\n        #\n        # The main thing that we have to worry about, is data that does\n        # not have a ',' at all to split the label from the Value. There\n        # isn't a singular right answer here, and we will fail validation\n        # later on (if the caller is validating) so it doesn't *really*\n        # matter, but since the missing value has to be an empty str\n        # and our return value is dict[str, str], if we let the key\n        # be the missing value, then they'd have multiple '' values that\n        # overwrite each other in a accumulating dict.\n        #\n        # The other potentional issue is that it's possible to have the\n        # same label multiple times in the metadata, with no solid \"right\"\n        # answer with what to do in that case. As such, we'll do the only\n        # thing we can, which is treat the field as unparseable and add it\n        # to our list of unparsed fields.\n        parts = [p.strip() for p in pair.split(\",\", 1)]\n        parts.extend([\"\"] * (max(0, 2 - len(parts))))  # Ensure 2 items\n\n        # TODO: The spec doesn't say anything about if the keys should be\n        #       considered case sensitive or not... logically they should\n        #       be case-preserving and case-insensitive, but doing that\n        #       would open up more cases where we might have duplicate\n        #       entries.\n        label, url = parts\n        if label in urls:\n            # The label already exists in our set of urls, so this field\n            # is unparseable, and we can just add the whole thing to our\n            # unparseable data and stop processing it.\n            raise KeyError(\"duplicate labels in project urls\")\n        urls[label] = url\n\n    return urls\n\n\ndef _get_payload(msg: email.message.Message, source: bytes | str) -> str:\n    \"\"\"Get the body of the message.\"\"\"\n    # If our source is a str, then our caller has managed encodings for us,\n    # and we don't need to deal with it.\n    if isinstance(source, str):\n        payload = msg.get_payload()\n        assert isinstance(payload, str)\n        return payload\n    # If our source is a bytes, then we're managing the encoding and we need\n    # to deal with it.\n    else:\n        bpayload = msg.get_payload(decode=True)\n        assert isinstance(bpayload, bytes)\n        try:\n            return bpayload.decode(\"utf8\", \"strict\")\n        except UnicodeDecodeError as exc:\n            raise ValueError(\"payload in an invalid encoding\") from exc\n\n\n# The various parse_FORMAT functions here are intended to be as lenient as\n# possible in their parsing, while still returning a correctly typed\n# RawMetadata.\n#\n# To aid in this, we also generally want to do as little touching of the\n# data as possible, except where there are possibly some historic holdovers\n# that make valid data awkward to work with.\n#\n# While this is a lower level, intermediate format than our ``Metadata``\n# class, some light touch ups can make a massive difference in usability.\n\n# Map METADATA fields to RawMetadata.\n_EMAIL_TO_RAW_MAPPING = {\n    \"author\": \"author\",\n    \"author-email\": \"author_email\",\n    \"classifier\": \"classifiers\",\n    \"description\": \"description\",\n    \"description-content-type\": \"description_content_type\",\n    \"download-url\": \"download_url\",\n    \"dynamic\": \"dynamic\",\n    \"home-page\": \"home_page\",\n    \"keywords\": \"keywords\",\n    \"license\": \"license\",\n    \"license-expression\": \"license_expression\",\n    \"license-file\": \"license_files\",\n    \"maintainer\": \"maintainer\",\n    \"maintainer-email\": \"maintainer_email\",\n    \"metadata-version\": \"metadata_version\",\n    \"name\": \"name\",\n    \"obsoletes\": \"obsoletes\",\n    \"obsoletes-dist\": \"obsoletes_dist\",\n    \"platform\": \"platforms\",\n    \"project-url\": \"project_urls\",\n    \"provides\": \"provides\",\n    \"provides-dist\": \"provides_dist\",\n    \"provides-extra\": \"provides_extra\",\n    \"requires\": \"requires\",\n    \"requires-dist\": \"requires_dist\",\n    \"requires-external\": \"requires_external\",\n    \"requires-python\": \"requires_python\",\n    \"summary\": \"summary\",\n    \"supported-platform\": \"supported_platforms\",\n    \"version\": \"version\",\n}\n_RAW_TO_EMAIL_MAPPING = {raw: email for email, raw in _EMAIL_TO_RAW_MAPPING.items()}\n\n\ndef parse_email(data: bytes | str) -> tuple[RawMetadata, dict[str, list[str]]]:\n    \"\"\"Parse a distribution's metadata stored as email headers (e.g. from ``METADATA``).\n\n    This function returns a two-item tuple of dicts. The first dict is of\n    recognized fields from the core metadata specification. Fields that can be\n    parsed and translated into Python's built-in types are converted\n    appropriately. All other fields are left as-is. Fields that are allowed to\n    appear multiple times are stored as lists.\n\n    The second dict contains all other fields from the metadata. This includes\n    any unrecognized fields. It also includes any fields which are expected to\n    be parsed into a built-in type but were not formatted appropriately. Finally,\n    any fields that are expected to appear only once but are repeated are\n    included in this dict.\n\n    \"\"\"\n    raw: dict[str, str | list[str] | dict[str, str]] = {}\n    unparsed: dict[str, list[str]] = {}\n\n    if isinstance(data, str):\n        parsed = email.parser.Parser(policy=email.policy.compat32).parsestr(data)\n    else:\n        parsed = email.parser.BytesParser(policy=email.policy.compat32).parsebytes(data)\n\n    # We have to wrap parsed.keys() in a set, because in the case of multiple\n    # values for a key (a list), the key will appear multiple times in the\n    # list of keys, but we're avoiding that by using get_all().\n    for name in frozenset(parsed.keys()):\n        # Header names in RFC are case insensitive, so we'll normalize to all\n        # lower case to make comparisons easier.\n        name = name.lower()\n\n        # We use get_all() here, even for fields that aren't multiple use,\n        # because otherwise someone could have e.g. two Name fields, and we\n        # would just silently ignore it rather than doing something about it.\n        headers = parsed.get_all(name) or []\n\n        # The way the email module works when parsing bytes is that it\n        # unconditionally decodes the bytes as ascii using the surrogateescape\n        # handler. When you pull that data back out (such as with get_all() ),\n        # it looks to see if the str has any surrogate escapes, and if it does\n        # it wraps it in a Header object instead of returning the string.\n        #\n        # As such, we'll look for those Header objects, and fix up the encoding.\n        value = []\n        # Flag if we have run into any issues processing the headers, thus\n        # signalling that the data belongs in 'unparsed'.\n        valid_encoding = True\n        for h in headers:\n            # It's unclear if this can return more types than just a Header or\n            # a str, so we'll just assert here to make sure.\n            assert isinstance(h, (email.header.Header, str))\n\n            # If it's a header object, we need to do our little dance to get\n            # the real data out of it. In cases where there is invalid data\n            # we're going to end up with mojibake, but there's no obvious, good\n            # way around that without reimplementing parts of the Header object\n            # ourselves.\n            #\n            # That should be fine since, if mojibacked happens, this key is\n            # going into the unparsed dict anyways.\n            if isinstance(h, email.header.Header):\n                # The Header object stores it's data as chunks, and each chunk\n                # can be independently encoded, so we'll need to check each\n                # of them.\n                chunks: list[tuple[bytes, str | None]] = []\n                for bin, encoding in email.header.decode_header(h):\n                    try:\n                        bin.decode(\"utf8\", \"strict\")\n                    except UnicodeDecodeError:\n                        # Enable mojibake.\n                        encoding = \"latin1\"\n                        valid_encoding = False\n                    else:\n                        encoding = \"utf8\"\n                    chunks.append((bin, encoding))\n\n                # Turn our chunks back into a Header object, then let that\n                # Header object do the right thing to turn them into a\n                # string for us.\n                value.append(str(email.header.make_header(chunks)))\n            # This is already a string, so just add it.\n            else:\n                value.append(h)\n\n        # We've processed all of our values to get them into a list of str,\n        # but we may have mojibake data, in which case this is an unparsed\n        # field.\n        if not valid_encoding:\n            unparsed[name] = value\n            continue\n\n        raw_name = _EMAIL_TO_RAW_MAPPING.get(name)\n        if raw_name is None:\n            # This is a bit of a weird situation, we've encountered a key that\n            # we don't know what it means, so we don't know whether it's meant\n            # to be a list or not.\n            #\n            # Since we can't really tell one way or another, we'll just leave it\n            # as a list, even though it may be a single item list, because that's\n            # what makes the most sense for email headers.\n            unparsed[name] = value\n            continue\n\n        # If this is one of our string fields, then we'll check to see if our\n        # value is a list of a single item. If it is then we'll assume that\n        # it was emitted as a single string, and unwrap the str from inside\n        # the list.\n        #\n        # If it's any other kind of data, then we haven't the faintest clue\n        # what we should parse it as, and we have to just add it to our list\n        # of unparsed stuff.\n        if raw_name in _STRING_FIELDS and len(value) == 1:\n            raw[raw_name] = value[0]\n        # If this is one of our list of string fields, then we can just assign\n        # the value, since email *only* has strings, and our get_all() call\n        # above ensures that this is a list.\n        elif raw_name in _LIST_FIELDS:\n            raw[raw_name] = value\n        # Special Case: Keywords\n        # The keywords field is implemented in the metadata spec as a str,\n        # but it conceptually is a list of strings, and is serialized using\n        # \", \".join(keywords), so we'll do some light data massaging to turn\n        # this into what it logically is.\n        elif raw_name == \"keywords\" and len(value) == 1:\n            raw[raw_name] = _parse_keywords(value[0])\n        # Special Case: Project-URL\n        # The project urls is implemented in the metadata spec as a list of\n        # specially-formatted strings that represent a key and a value, which\n        # is fundamentally a mapping, however the email format doesn't support\n        # mappings in a sane way, so it was crammed into a list of strings\n        # instead.\n        #\n        # We will do a little light data massaging to turn this into a map as\n        # it logically should be.\n        elif raw_name == \"project_urls\":\n            try:\n                raw[raw_name] = _parse_project_urls(value)\n            except KeyError:\n                unparsed[name] = value\n        # Nothing that we've done has managed to parse this, so it'll just\n        # throw it in our unparseable data and move on.\n        else:\n            unparsed[name] = value\n\n    # We need to support getting the Description from the message payload in\n    # addition to getting it from the the headers. This does mean, though, there\n    # is the possibility of it being set both ways, in which case we put both\n    # in 'unparsed' since we don't know which is right.\n    try:\n        payload = _get_payload(parsed, data)\n    except ValueError:\n        unparsed.setdefault(\"description\", []).append(\n            parsed.get_payload(decode=isinstance(data, bytes))  # type: ignore[call-overload]\n        )\n    else:\n        if payload:\n            # Check to see if we've already got a description, if so then both\n            # it, and this body move to unparseable.\n            if \"description\" in raw:\n                description_header = cast(str, raw.pop(\"description\"))\n                unparsed.setdefault(\"description\", []).extend(\n                    [description_header, payload]\n                )\n            elif \"description\" in unparsed:\n                unparsed[\"description\"].append(payload)\n            else:\n                raw[\"description\"] = payload\n\n    # We need to cast our `raw` to a metadata, because a TypedDict only support\n    # literal key names, but we're computing our key names on purpose, but the\n    # way this function is implemented, our `TypedDict` can only have valid key\n    # names.\n    return cast(RawMetadata, raw), unparsed\n\n\n_NOT_FOUND = object()\n\n\n# Keep the two values in sync.\n_VALID_METADATA_VERSIONS = [\"1.0\", \"1.1\", \"1.2\", \"2.1\", \"2.2\", \"2.3\", \"2.4\"]\n_MetadataVersion = Literal[\"1.0\", \"1.1\", \"1.2\", \"2.1\", \"2.2\", \"2.3\", \"2.4\"]\n\n_REQUIRED_ATTRS = frozenset([\"metadata_version\", \"name\", \"version\"])\n\n\nclass _Validator(Generic[T]):\n    \"\"\"Validate a metadata field.\n\n    All _process_*() methods correspond to a core metadata field. The method is\n    called with the field's raw value. If the raw value is valid it is returned\n    in its \"enriched\" form (e.g. ``version.Version`` for the ``Version`` field).\n    If the raw value is invalid, :exc:`InvalidMetadata` is raised (with a cause\n    as appropriate).\n    \"\"\"\n\n    name: str\n    raw_name: str\n    added: _MetadataVersion\n\n    def __init__(\n        self,\n        *,\n        added: _MetadataVersion = \"1.0\",\n    ) -> None:\n        self.added = added\n\n    def __set_name__(self, _owner: Metadata, name: str) -> None:\n        self.name = name\n        self.raw_name = _RAW_TO_EMAIL_MAPPING[name]\n\n    def __get__(self, instance: Metadata, _owner: type[Metadata]) -> T:\n        # With Python 3.8, the caching can be replaced with functools.cached_property().\n        # No need to check the cache as attribute lookup will resolve into the\n        # instance's __dict__ before __get__ is called.\n        cache = instance.__dict__\n        value = instance._raw.get(self.name)\n\n        # To make the _process_* methods easier, we'll check if the value is None\n        # and if this field is NOT a required attribute, and if both of those\n        # things are true, we'll skip the the converter. This will mean that the\n        # converters never have to deal with the None union.\n        if self.name in _REQUIRED_ATTRS or value is not None:\n            try:\n                converter: Callable[[Any], T] = getattr(self, f\"_process_{self.name}\")\n            except AttributeError:\n                pass\n            else:\n                value = converter(value)\n\n        cache[self.name] = value\n        try:\n            del instance._raw[self.name]  # type: ignore[misc]\n        except KeyError:\n            pass\n\n        return cast(T, value)\n\n    def _invalid_metadata(\n        self, msg: str, cause: Exception | None = None\n    ) -> InvalidMetadata:\n        exc = InvalidMetadata(\n            self.raw_name, msg.format_map({\"field\": repr(self.raw_name)})\n        )\n        exc.__cause__ = cause\n        return exc\n\n    def _process_metadata_version(self, value: str) -> _MetadataVersion:\n        # Implicitly makes Metadata-Version required.\n        if value not in _VALID_METADATA_VERSIONS:\n            raise self._invalid_metadata(f\"{value!r} is not a valid metadata version\")\n        return cast(_MetadataVersion, value)\n\n    def _process_name(self, value: str) -> str:\n        if not value:\n            raise self._invalid_metadata(\"{field} is a required field\")\n        # Validate the name as a side-effect.\n        try:\n            utils.canonicalize_name(value, validate=True)\n        except utils.InvalidName as exc:\n            raise self._invalid_metadata(\n                f\"{value!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n        else:\n            return value\n\n    def _process_version(self, value: str) -> version_module.Version:\n        if not value:\n            raise self._invalid_metadata(\"{field} is a required field\")\n        try:\n            return version_module.parse(value)\n        except version_module.InvalidVersion as exc:\n            raise self._invalid_metadata(\n                f\"{value!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n\n    def _process_summary(self, value: str) -> str:\n        \"\"\"Check the field contains no newlines.\"\"\"\n        if \"\\n\" in value:\n            raise self._invalid_metadata(\"{field} must be a single line\")\n        return value\n\n    def _process_description_content_type(self, value: str) -> str:\n        content_types = {\"text/plain\", \"text/x-rst\", \"text/markdown\"}\n        message = email.message.EmailMessage()\n        message[\"content-type\"] = value\n\n        content_type, parameters = (\n            # Defaults to `text/plain` if parsing failed.\n            message.get_content_type().lower(),\n            message[\"content-type\"].params,\n        )\n        # Check if content-type is valid or defaulted to `text/plain` and thus was\n        # not parseable.\n        if content_type not in content_types or content_type not in value.lower():\n            raise self._invalid_metadata(\n                f\"{{field}} must be one of {list(content_types)}, not {value!r}\"\n            )\n\n        charset = parameters.get(\"charset\", \"UTF-8\")\n        if charset != \"UTF-8\":\n            raise self._invalid_metadata(\n                f\"{{field}} can only specify the UTF-8 charset, not {list(charset)}\"\n            )\n\n        markdown_variants = {\"GFM\", \"CommonMark\"}\n        variant = parameters.get(\"variant\", \"GFM\")  # Use an acceptable default.\n        if content_type == \"text/markdown\" and variant not in markdown_variants:\n            raise self._invalid_metadata(\n                f\"valid Markdown variants for {{field}} are {list(markdown_variants)}, \"\n                f\"not {variant!r}\",\n            )\n        return value\n\n    def _process_dynamic(self, value: list[str]) -> list[str]:\n        for dynamic_field in map(str.lower, value):\n            if dynamic_field in {\"name\", \"version\", \"metadata-version\"}:\n                raise self._invalid_metadata(\n                    f\"{dynamic_field!r} is not allowed as a dynamic field\"\n                )\n            elif dynamic_field not in _EMAIL_TO_RAW_MAPPING:\n                raise self._invalid_metadata(\n                    f\"{dynamic_field!r} is not a valid dynamic field\"\n                )\n        return list(map(str.lower, value))\n\n    def _process_provides_extra(\n        self,\n        value: list[str],\n    ) -> list[utils.NormalizedName]:\n        normalized_names = []\n        try:\n            for name in value:\n                normalized_names.append(utils.canonicalize_name(name, validate=True))\n        except utils.InvalidName as exc:\n            raise self._invalid_metadata(\n                f\"{name!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n        else:\n            return normalized_names\n\n    def _process_requires_python(self, value: str) -> specifiers.SpecifierSet:\n        try:\n            return specifiers.SpecifierSet(value)\n        except specifiers.InvalidSpecifier as exc:\n            raise self._invalid_metadata(\n                f\"{value!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n\n    def _process_requires_dist(\n        self,\n        value: list[str],\n    ) -> list[requirements.Requirement]:\n        reqs = []\n        try:\n            for req in value:\n                reqs.append(requirements.Requirement(req))\n        except requirements.InvalidRequirement as exc:\n            raise self._invalid_metadata(\n                f\"{req!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n        else:\n            return reqs\n\n    def _process_license_expression(\n        self, value: str\n    ) -> NormalizedLicenseExpression | None:\n        try:\n            return licenses.canonicalize_license_expression(value)\n        except ValueError as exc:\n            raise self._invalid_metadata(\n                f\"{value!r} is invalid for {{field}}\", cause=exc\n            ) from exc\n\n    def _process_license_files(self, value: list[str]) -> list[str]:\n        paths = []\n        for path in value:\n            if \"..\" in path:\n                raise self._invalid_metadata(\n                    f\"{path!r} is invalid for {{field}}, \"\n                    \"parent directory indicators are not allowed\"\n                )\n            if \"*\" in path:\n                raise self._invalid_metadata(\n                    f\"{path!r} is invalid for {{field}}, paths must be resolved\"\n                )\n            if (\n                pathlib.PurePosixPath(path).is_absolute()\n                or pathlib.PureWindowsPath(path).is_absolute()\n            ):\n                raise self._invalid_metadata(\n                    f\"{path!r} is invalid for {{field}}, paths must be relative\"\n                )\n            if pathlib.PureWindowsPath(path).as_posix() != path:\n                raise self._invalid_metadata(\n                    f\"{path!r} is invalid for {{field}}, paths must use '/' delimiter\"\n                )\n            paths.append(path)\n        return paths\n\n\nclass Metadata:\n    \"\"\"Representation of distribution metadata.\n\n    Compared to :class:`RawMetadata`, this class provides objects representing\n    metadata fields instead of only using built-in types. Any invalid metadata\n    will cause :exc:`InvalidMetadata` to be raised (with a\n    :py:attr:`~BaseException.__cause__` attribute as appropriate).\n    \"\"\"\n\n    _raw: RawMetadata\n\n    @classmethod\n    def from_raw(cls, data: RawMetadata, *, validate: bool = True) -> Metadata:\n        \"\"\"Create an instance from :class:`RawMetadata`.\n\n        If *validate* is true, all metadata will be validated. All exceptions\n        related to validation will be gathered and raised as an :class:`ExceptionGroup`.\n        \"\"\"\n        ins = cls()\n        ins._raw = data.copy()  # Mutations occur due to caching enriched values.\n\n        if validate:\n            exceptions: list[Exception] = []\n            try:\n                metadata_version = ins.metadata_version\n                metadata_age = _VALID_METADATA_VERSIONS.index(metadata_version)\n            except InvalidMetadata as metadata_version_exc:\n                exceptions.append(metadata_version_exc)\n                metadata_version = None\n\n            # Make sure to check for the fields that are present, the required\n            # fields (so their absence can be reported).\n            fields_to_check = frozenset(ins._raw) | _REQUIRED_ATTRS\n            # Remove fields that have already been checked.\n            fields_to_check -= {\"metadata_version\"}\n\n            for key in fields_to_check:\n                try:\n                    if metadata_version:\n                        # Can't use getattr() as that triggers descriptor protocol which\n                        # will fail due to no value for the instance argument.\n                        try:\n                            field_metadata_version = cls.__dict__[key].added\n                        except KeyError:\n                            exc = InvalidMetadata(key, f\"unrecognized field: {key!r}\")\n                            exceptions.append(exc)\n                            continue\n                        field_age = _VALID_METADATA_VERSIONS.index(\n                            field_metadata_version\n                        )\n                        if field_age > metadata_age:\n                            field = _RAW_TO_EMAIL_MAPPING[key]\n                            exc = InvalidMetadata(\n                                field,\n                                f\"{field} introduced in metadata version \"\n                                f\"{field_metadata_version}, not {metadata_version}\",\n                            )\n                            exceptions.append(exc)\n                            continue\n                    getattr(ins, key)\n                except InvalidMetadata as exc:\n                    exceptions.append(exc)\n\n            if exceptions:\n                raise ExceptionGroup(\"invalid metadata\", exceptions)\n\n        return ins\n\n    @classmethod\n    def from_email(cls, data: bytes | str, *, validate: bool = True) -> Metadata:\n        \"\"\"Parse metadata from email headers.\n\n        If *validate* is true, the metadata will be validated. All exceptions\n        related to validation will be gathered and raised as an :class:`ExceptionGroup`.\n        \"\"\"\n        raw, unparsed = parse_email(data)\n\n        if validate:\n            exceptions: list[Exception] = []\n            for unparsed_key in unparsed:\n                if unparsed_key in _EMAIL_TO_RAW_MAPPING:\n                    message = f\"{unparsed_key!r} has invalid data\"\n                else:\n                    message = f\"unrecognized field: {unparsed_key!r}\"\n                exceptions.append(InvalidMetadata(unparsed_key, message))\n\n            if exceptions:\n                raise ExceptionGroup(\"unparsed\", exceptions)\n\n        try:\n            return cls.from_raw(raw, validate=validate)\n        except ExceptionGroup as exc_group:\n            raise ExceptionGroup(\n                \"invalid or unparsed metadata\", exc_group.exceptions\n            ) from None\n\n    metadata_version: _Validator[_MetadataVersion] = _Validator()\n    \"\"\":external:ref:`core-metadata-metadata-version`\n    (required; validated to be a valid metadata version)\"\"\"\n    # `name` is not normalized/typed to NormalizedName so as to provide access to\n    # the original/raw name.\n    name: _Validator[str] = _Validator()\n    \"\"\":external:ref:`core-metadata-name`\n    (required; validated using :func:`~packaging.utils.canonicalize_name` and its\n    *validate* parameter)\"\"\"\n    version: _Validator[version_module.Version] = _Validator()\n    \"\"\":external:ref:`core-metadata-version` (required)\"\"\"\n    dynamic: _Validator[list[str] | None] = _Validator(\n        added=\"2.2\",\n    )\n    \"\"\":external:ref:`core-metadata-dynamic`\n    (validated against core metadata field names and lowercased)\"\"\"\n    platforms: _Validator[list[str] | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-platform`\"\"\"\n    supported_platforms: _Validator[list[str] | None] = _Validator(added=\"1.1\")\n    \"\"\":external:ref:`core-metadata-supported-platform`\"\"\"\n    summary: _Validator[str | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-summary` (validated to contain no newlines)\"\"\"\n    description: _Validator[str | None] = _Validator()  # TODO 2.1: can be in body\n    \"\"\":external:ref:`core-metadata-description`\"\"\"\n    description_content_type: _Validator[str | None] = _Validator(added=\"2.1\")\n    \"\"\":external:ref:`core-metadata-description-content-type` (validated)\"\"\"\n    keywords: _Validator[list[str] | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-keywords`\"\"\"\n    home_page: _Validator[str | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-home-page`\"\"\"\n    download_url: _Validator[str | None] = _Validator(added=\"1.1\")\n    \"\"\":external:ref:`core-metadata-download-url`\"\"\"\n    author: _Validator[str | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-author`\"\"\"\n    author_email: _Validator[str | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-author-email`\"\"\"\n    maintainer: _Validator[str | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-maintainer`\"\"\"\n    maintainer_email: _Validator[str | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-maintainer-email`\"\"\"\n    license: _Validator[str | None] = _Validator()\n    \"\"\":external:ref:`core-metadata-license`\"\"\"\n    license_expression: _Validator[NormalizedLicenseExpression | None] = _Validator(\n        added=\"2.4\"\n    )\n    \"\"\":external:ref:`core-metadata-license-expression`\"\"\"\n    license_files: _Validator[list[str] | None] = _Validator(added=\"2.4\")\n    \"\"\":external:ref:`core-metadata-license-file`\"\"\"\n    classifiers: _Validator[list[str] | None] = _Validator(added=\"1.1\")\n    \"\"\":external:ref:`core-metadata-classifier`\"\"\"\n    requires_dist: _Validator[list[requirements.Requirement] | None] = _Validator(\n        added=\"1.2\"\n    )\n    \"\"\":external:ref:`core-metadata-requires-dist`\"\"\"\n    requires_python: _Validator[specifiers.SpecifierSet | None] = _Validator(\n        added=\"1.2\"\n    )\n    \"\"\":external:ref:`core-metadata-requires-python`\"\"\"\n    # Because `Requires-External` allows for non-PEP 440 version specifiers, we\n    # don't do any processing on the values.\n    requires_external: _Validator[list[str] | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-requires-external`\"\"\"\n    project_urls: _Validator[dict[str, str] | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-project-url`\"\"\"\n    # PEP 685 lets us raise an error if an extra doesn't pass `Name` validation\n    # regardless of metadata version.\n    provides_extra: _Validator[list[utils.NormalizedName] | None] = _Validator(\n        added=\"2.1\",\n    )\n    \"\"\":external:ref:`core-metadata-provides-extra`\"\"\"\n    provides_dist: _Validator[list[str] | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-provides-dist`\"\"\"\n    obsoletes_dist: _Validator[list[str] | None] = _Validator(added=\"1.2\")\n    \"\"\":external:ref:`core-metadata-obsoletes-dist`\"\"\"\n    requires: _Validator[list[str] | None] = _Validator(added=\"1.1\")\n    \"\"\"``Requires`` (deprecated)\"\"\"\n    provides: _Validator[list[str] | None] = _Validator(added=\"1.1\")\n    \"\"\"``Provides`` (deprecated)\"\"\"\n    obsoletes: _Validator[list[str] | None] = _Validator(added=\"1.1\")\n    \"\"\"``Obsoletes`` (deprecated)\"\"\"\n",[],[216,809,810,811,890,891,1694,1727],"07e65e80-67fc-11f0-85ab-0224a6c84d84","markers.py","07e65f20-67fc-11f0-85ab-0224a6c84d84",285,["D",1753299261038],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\nfrom __future__ import annotations\n\nimport operator\nimport os\nimport platform\nimport sys\nfrom typing import AbstractSet, Any, Callable, Literal, TypedDict, Union, cast\n\nfrom ._parser import MarkerAtom, MarkerList, Op, Value, Variable\nfrom ._parser import parse_marker as _parse_marker\nfrom ._tokenizer import ParserSyntaxError\nfrom .specifiers import InvalidSpecifier, Specifier\nfrom .utils import canonicalize_name\n\n__all__ = [\n    \"EvaluateContext\",\n    \"InvalidMarker\",\n    \"Marker\",\n    \"UndefinedComparison\",\n    \"UndefinedEnvironmentName\",\n    \"default_environment\",\n]\n\nOperator = Callable[[str, Union[str, AbstractSet[str]]], bool]\nEvaluateContext = Literal[\"metadata\", \"lock_file\", \"requirement\"]\nMARKERS_ALLOWING_SET = {\"extras\", \"dependency_groups\"}\n\n\nclass InvalidMarker(ValueError):\n    \"\"\"\n    An invalid marker was found, users should refer to PEP 508.\n    \"\"\"\n\n\nclass UndefinedComparison(ValueError):\n    \"\"\"\n    An invalid operation was attempted on a value that doesn't support it.\n    \"\"\"\n\n\nclass UndefinedEnvironmentName(ValueError):\n    \"\"\"\n    A name was attempted to be used that does not exist inside of the\n    environment.\n    \"\"\"\n\n\nclass Environment(TypedDict):\n    implementation_name: str\n    \"\"\"The implementation's identifier, e.g. ``'cpython'``.\"\"\"\n\n    implementation_version: str\n    \"\"\"\n    The implementation's version, e.g. ``'3.13.0a2'`` for CPython 3.13.0a2, or\n    ``'7.3.13'`` for PyPy3.10 v7.3.13.\n    \"\"\"\n\n    os_name: str\n    \"\"\"\n    The value of :py:data:`os.name`. The name of the operating system dependent module\n    imported, e.g. ``'posix'``.\n    \"\"\"\n\n    platform_machine: str\n    \"\"\"\n    Returns the machine type, e.g. ``'i386'``.\n\n    An empty string if the value cannot be determined.\n    \"\"\"\n\n    platform_release: str\n    \"\"\"\n    The system's release, e.g. ``'2.2.0'`` or ``'NT'``.\n\n    An empty string if the value cannot be determined.\n    \"\"\"\n\n    platform_system: str\n    \"\"\"\n    The system/OS name, e.g. ``'Linux'``, ``'Windows'`` or ``'Java'``.\n\n    An empty string if the value cannot be determined.\n    \"\"\"\n\n    platform_version: str\n    \"\"\"\n    The system's release version, e.g. ``'#3 on degas'``.\n\n    An empty string if the value cannot be determined.\n    \"\"\"\n\n    python_full_version: str\n    \"\"\"\n    The Python version as string ``'major.minor.patchlevel'``.\n\n    Note that unlike the Python :py:data:`sys.version`, this value will always include\n    the patchlevel (it defaults to 0).\n    \"\"\"\n\n    platform_python_implementation: str\n    \"\"\"\n    A string identifying the Python implementation, e.g. ``'CPython'``.\n    \"\"\"\n\n    python_version: str\n    \"\"\"The Python version as string ``'major.minor'``.\"\"\"\n\n    sys_platform: str\n    \"\"\"\n    This string contains a platform identifier that can be used to append\n    platform-specific components to :py:data:`sys.path`, for instance.\n\n    For Unix systems, except on Linux and AIX, this is the lowercased OS name as\n    returned by ``uname -s`` with the first part of the version as returned by\n    ``uname -r`` appended, e.g. ``'sunos5'`` or ``'freebsd8'``, at the time when Python\n    was built.\n    \"\"\"\n\n\ndef _normalize_extra_values(results: Any) -> Any:\n    \"\"\"\n    Normalize extra values.\n    \"\"\"\n    if isinstance(results[0], tuple):\n        lhs, op, rhs = results[0]\n        if isinstance(lhs, Variable) and lhs.value == \"extra\":\n            normalized_extra = canonicalize_name(rhs.value)\n            rhs = Value(normalized_extra)\n        elif isinstance(rhs, Variable) and rhs.value == \"extra\":\n            normalized_extra = canonicalize_name(lhs.value)\n            lhs = Value(normalized_extra)\n        results[0] = lhs, op, rhs\n    return results\n\n\ndef _format_marker(\n    marker: list[str] | MarkerAtom | str, first: bool | None = True\n) -> str:\n    assert isinstance(marker, (list, tuple, str))\n\n    # Sometimes we have a structure like [[...]] which is a single item list\n    # where the single item is itself it's own list. In that case we want skip\n    # the rest of this function so that we don't get extraneous () on the\n    # outside.\n    if (\n        isinstance(marker, list)\n        and len(marker) == 1\n        and isinstance(marker[0], (list, tuple))\n    ):\n        return _format_marker(marker[0])\n\n    if isinstance(marker, list):\n        inner = (_format_marker(m, first=False) for m in marker)\n        if first:\n            return \" \".join(inner)\n        else:\n            return \"(\" + \" \".join(inner) + \")\"\n    elif isinstance(marker, tuple):\n        return \" \".join([m.serialize() for m in marker])\n    else:\n        return marker\n\n\n_operators: dict[str, Operator] = {\n    \"in\": lambda lhs, rhs: lhs in rhs,\n    \"not in\": lambda lhs, rhs: lhs not in rhs,\n    \"<\": operator.lt,\n    \"<=\": operator.le,\n    \"==\": operator.eq,\n    \"!=\": operator.ne,\n    \">=\": operator.ge,\n    \">\": operator.gt,\n}\n\n\ndef _eval_op(lhs: str, op: Op, rhs: str | AbstractSet[str]) -> bool:\n    if isinstance(rhs, str):\n        try:\n            spec = Specifier(\"\".join([op.serialize(), rhs]))\n        except InvalidSpecifier:\n            pass\n        else:\n            return spec.contains(lhs, prereleases=True)\n\n    oper: Operator | None = _operators.get(op.serialize())\n    if oper is None:\n        raise UndefinedComparison(f\"Undefined {op!r} on {lhs!r} and {rhs!r}.\")\n\n    return oper(lhs, rhs)\n\n\ndef _normalize(\n    lhs: str, rhs: str | AbstractSet[str], key: str\n) -> tuple[str, str | AbstractSet[str]]:\n    # PEP 685 – Comparison of extra names for optional distribution dependencies\n    # https://peps.python.org/pep-0685/\n    # > When comparing extra names, tools MUST normalize the names being\n    # > compared using the semantics outlined in PEP 503 for names\n    if key == \"extra\":\n        assert isinstance(rhs, str), \"extra value must be a string\"\n        return (canonicalize_name(lhs), canonicalize_name(rhs))\n    if key in MARKERS_ALLOWING_SET:\n        if isinstance(rhs, str):  # pragma: no cover\n            return (canonicalize_name(lhs), canonicalize_name(rhs))\n        else:\n            return (canonicalize_name(lhs), {canonicalize_name(v) for v in rhs})\n\n    # other environment markers don't have such standards\n    return lhs, rhs\n\n\ndef _evaluate_markers(\n    markers: MarkerList, environment: dict[str, str | AbstractSet[str]]\n) -> bool:\n    groups: list[list[bool]] = [[]]\n\n    for marker in markers:\n        assert isinstance(marker, (list, tuple, str))\n\n        if isinstance(marker, list):\n            groups[-1].append(_evaluate_markers(marker, environment))\n        elif isinstance(marker, tuple):\n            lhs, op, rhs = marker\n\n            if isinstance(lhs, Variable):\n                environment_key = lhs.value\n                lhs_value = environment[environment_key]\n                rhs_value = rhs.value\n            else:\n                lhs_value = lhs.value\n                environment_key = rhs.value\n                rhs_value = environment[environment_key]\n            assert isinstance(lhs_value, str), \"lhs must be a string\"\n            lhs_value, rhs_value = _normalize(lhs_value, rhs_value, key=environment_key)\n            groups[-1].append(_eval_op(lhs_value, op, rhs_value))\n        else:\n            assert marker in [\"and\", \"or\"]\n            if marker == \"or\":\n                groups.append([])\n\n    return any(all(item) for item in groups)\n\n\ndef format_full_version(info: sys._version_info) -> str:\n    version = f\"{info.major}.{info.minor}.{info.micro}\"\n    kind = info.releaselevel\n    if kind != \"final\":\n        version += kind[0] + str(info.serial)\n    return version\n\n\ndef default_environment() -> Environment:\n    iver = format_full_version(sys.implementation.version)\n    implementation_name = sys.implementation.name\n    return {\n        \"implementation_name\": implementation_name,\n        \"implementation_version\": iver,\n        \"os_name\": os.name,\n        \"platform_machine\": platform.machine(),\n        \"platform_release\": platform.release(),\n        \"platform_system\": platform.system(),\n        \"platform_version\": platform.version(),\n        \"python_full_version\": platform.python_version(),\n        \"platform_python_implementation\": platform.python_implementation(),\n        \"python_version\": \".\".join(platform.python_version_tuple()[:2]),\n        \"sys_platform\": sys.platform,\n    }\n\n\nclass Marker:\n    def __init__(self, marker: str) -> None:\n        # Note: We create a Marker object without calling this constructor in\n        #       packaging.requirements.Requirement. If any additional logic is\n        #       added here, make sure to mirror/adapt Requirement.\n        try:\n            self._markers = _normalize_extra_values(_parse_marker(marker))\n            # The attribute `_markers` can be described in terms of a recursive type:\n            # MarkerList = List[Union[Tuple[Node, ...], str, MarkerList]]\n            #\n            # For example, the following expression:\n            # python_version > \"3.6\" or (python_version == \"3.6\" and os_name == \"unix\")\n            #\n            # is parsed into:\n            # [\n            #     (, ')>, ),\n            #     'and',\n            #     [\n            #         (, , ),\n            #         'or',\n            #         (, , )\n            #     ]\n            # ]\n        except ParserSyntaxError as e:\n            raise InvalidMarker(str(e)) from e\n\n    def __str__(self) -> str:\n        return _format_marker(self._markers)\n\n    def __repr__(self) -> str:\n        return f\"\"\n\n    def __hash__(self) -> int:\n        return hash((self.__class__.__name__, str(self)))\n\n    def __eq__(self, other: Any) -> bool:\n        if not isinstance(other, Marker):\n            return NotImplemented\n\n        return str(self) == str(other)\n\n    def evaluate(\n        self,\n        environment: dict[str, str] | None = None,\n        context: EvaluateContext = \"metadata\",\n    ) -> bool:\n        \"\"\"Evaluate a marker.\n\n        Return the boolean from evaluating the given marker against the\n        environment. environment is an optional argument to override all or\n        part of the determined environment. The *context* parameter specifies what\n        context the markers are being evaluated for, which influences what markers\n        are considered valid. Acceptable values are \"metadata\" (for core metadata;\n        default), \"lock_file\", and \"requirement\" (i.e. all other situations).\n\n        The environment is determined from the current Python process.\n        \"\"\"\n        current_environment = cast(\n            \"dict[str, str | AbstractSet[str]]\", default_environment()\n        )\n        if context == \"lock_file\":\n            current_environment.update(\n                extras=frozenset(), dependency_groups=frozenset()\n            )\n        elif context == \"metadata\":\n            current_environment[\"extra\"] = \"\"\n        if environment is not None:\n            current_environment.update(environment)\n            # The API used to allow setting extra to None. We need to handle this\n            # case for backwards compatibility.\n            if \"extra\" in current_environment and current_environment[\"extra\"] is None:\n                current_environment[\"extra\"] = \"\"\n\n        return _evaluate_markers(\n            self._markers, _repair_python_full_version(current_environment)\n        )\n\n\ndef _repair_python_full_version(\n    env: dict[str, str | AbstractSet[str]],\n) -> dict[str, str | AbstractSet[str]]:\n    \"\"\"\n    Work around platform.python_version() returning something that is not PEP 440\n    compliant for non-tagged Python builds.\n    \"\"\"\n    python_full_version = cast(str, env[\"python_full_version\"])\n    if python_full_version.endswith(\"+\"):\n        env[\"python_full_version\"] = f\"{python_full_version}local\"\n    return env\n",[],[216,809,810,811,890,891,1694,1735],"07fabe7a-67fc-11f0-befa-0224a6c84d84","_tokenizer.py","07fabf74-67fc-11f0-befa-0224a6c84d84",288,["D",1753299261164],"from __future__ import annotations\n\nimport contextlib\nimport re\nfrom dataclasses import dataclass\nfrom typing import Iterator, NoReturn\n\nfrom .specifiers import Specifier\n\n\n@dataclass\nclass Token:\n    name: str\n    text: str\n    position: int\n\n\nclass ParserSyntaxError(Exception):\n    \"\"\"The provided source text could not be parsed correctly.\"\"\"\n\n    def __init__(\n        self,\n        message: str,\n        *,\n        source: str,\n        span: tuple[int, int],\n    ) -> None:\n        self.span = span\n        self.message = message\n        self.source = source\n\n        super().__init__()\n\n    def __str__(self) -> str:\n        marker = \" \" * self.span[0] + \"~\" * (self.span[1] - self.span[0]) + \"^\"\n        return \"\\n    \".join([self.message, self.source, marker])\n\n\nDEFAULT_RULES: dict[str, str | re.Pattern[str]] = {\n    \"LEFT_PARENTHESIS\": r\"\\(\",\n    \"RIGHT_PARENTHESIS\": r\"\\)\",\n    \"LEFT_BRACKET\": r\"\\[\",\n    \"RIGHT_BRACKET\": r\"\\]\",\n    \"SEMICOLON\": r\";\",\n    \"COMMA\": r\",\",\n    \"QUOTED_STRING\": re.compile(\n        r\"\"\"\n            (\n                ('[^']*')\n                |\n                (\"[^\"]*\")\n            )\n        \"\"\",\n        re.VERBOSE,\n    ),\n    \"OP\": r\"(===|==|~=|!=|<=|>=|<|>)\",\n    \"BOOLOP\": r\"\\b(or|and)\\b\",\n    \"IN\": r\"\\bin\\b\",\n    \"NOT\": r\"\\bnot\\b\",\n    \"VARIABLE\": re.compile(\n        r\"\"\"\n            \\b(\n                python_version\n                |python_full_version\n                |os[._]name\n                |sys[._]platform\n                |platform_(release|system)\n                |platform[._](version|machine|python_implementation)\n                |python_implementation\n                |implementation_(name|version)\n                |extras?\n                |dependency_groups\n            )\\b\n        \"\"\",\n        re.VERBOSE,\n    ),\n    \"SPECIFIER\": re.compile(\n        Specifier._operator_regex_str + Specifier._version_regex_str,\n        re.VERBOSE | re.IGNORECASE,\n    ),\n    \"AT\": r\"\\@\",\n    \"URL\": r\"[^ \\t]+\",\n    \"IDENTIFIER\": r\"\\b[a-zA-Z0-9][a-zA-Z0-9._-]*\\b\",\n    \"VERSION_PREFIX_TRAIL\": r\"\\.\\*\",\n    \"VERSION_LOCAL_LABEL_TRAIL\": r\"\\+[a-z0-9]+(?:[-_\\.][a-z0-9]+)*\",\n    \"WS\": r\"[ \\t]+\",\n    \"END\": r\"$\",\n}\n\n\nclass Tokenizer:\n    \"\"\"Context-sensitive token parsing.\n\n    Provides methods to examine the input stream to check whether the next token\n    matches.\n    \"\"\"\n\n    def __init__(\n        self,\n        source: str,\n        *,\n        rules: dict[str, str | re.Pattern[str]],\n    ) -> None:\n        self.source = source\n        self.rules: dict[str, re.Pattern[str]] = {\n            name: re.compile(pattern) for name, pattern in rules.items()\n        }\n        self.next_token: Token | None = None\n        self.position = 0\n\n    def consume(self, name: str) -> None:\n        \"\"\"Move beyond provided token name, if at current position.\"\"\"\n        if self.check(name):\n            self.read()\n\n    def check(self, name: str, *, peek: bool = False) -> bool:\n        \"\"\"Check whether the next token has the provided name.\n\n        By default, if the check succeeds, the token *must* be read before\n        another check. If `peek` is set to `True`, the token is not loaded and\n        would need to be checked again.\n        \"\"\"\n        assert self.next_token is None, (\n            f\"Cannot check for {name!r}, already have {self.next_token!r}\"\n        )\n        assert name in self.rules, f\"Unknown token name: {name!r}\"\n\n        expression = self.rules[name]\n\n        match = expression.match(self.source, self.position)\n        if match is None:\n            return False\n        if not peek:\n            self.next_token = Token(name, match[0], self.position)\n        return True\n\n    def expect(self, name: str, *, expected: str) -> Token:\n        \"\"\"Expect a certain token name next, failing with a syntax error otherwise.\n\n        The token is *not* read.\n        \"\"\"\n        if not self.check(name):\n            raise self.raise_syntax_error(f\"Expected {expected}\")\n        return self.read()\n\n    def read(self) -> Token:\n        \"\"\"Consume the next token and return it.\"\"\"\n        token = self.next_token\n        assert token is not None\n\n        self.position += len(token.text)\n        self.next_token = None\n\n        return token\n\n    def raise_syntax_error(\n        self,\n        message: str,\n        *,\n        span_start: int | None = None,\n        span_end: int | None = None,\n    ) -> NoReturn:\n        \"\"\"Raise ParserSyntaxError at the given position.\"\"\"\n        span = (\n            self.position if span_start is None else span_start,\n            self.position if span_end is None else span_end,\n        )\n        raise ParserSyntaxError(\n            message,\n            source=self.source,\n            span=span,\n        )\n\n    @contextlib.contextmanager\n    def enclosing_tokens(\n        self, open_token: str, close_token: str, *, around: str\n    ) -> Iterator[None]:\n        if self.check(open_token):\n            open_position = self.position\n            self.read()\n        else:\n            open_position = None\n\n        yield\n\n        if open_position is None:\n            return\n\n        if not self.check(close_token):\n            self.raise_syntax_error(\n                f\"Expected matching {close_token} for {open_token}, after {around}\",\n                span_start=open_position,\n            )\n\n        self.read()\n",[],[216,809,810,811,890,891,1694,1743],"07ed4f42-67fc-11f0-b489-0224a6c84d84","_structures.py","07ed5050-67fc-11f0-b489-0224a6c84d84",286,["D",1753299261011],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\n\nclass InfinityType:\n    def __repr__(self) -> str:\n        return \"Infinity\"\n\n    def __hash__(self) -> int:\n        return hash(repr(self))\n\n    def __lt__(self, other: object) -> bool:\n        return False\n\n    def __le__(self, other: object) -> bool:\n        return False\n\n    def __eq__(self, other: object) -> bool:\n        return isinstance(other, self.__class__)\n\n    def __gt__(self, other: object) -> bool:\n        return True\n\n    def __ge__(self, other: object) -> bool:\n        return True\n\n    def __neg__(self: object) -> \"NegativeInfinityType\":\n        return NegativeInfinity\n\n\nInfinity = InfinityType()\n\n\nclass NegativeInfinityType:\n    def __repr__(self) -> str:\n        return \"-Infinity\"\n\n    def __hash__(self) -> int:\n        return hash(repr(self))\n\n    def __lt__(self, other: object) -> bool:\n        return True\n\n    def __le__(self, other: object) -> bool:\n        return True\n\n    def __eq__(self, other: object) -> bool:\n        return isinstance(other, self.__class__)\n\n    def __gt__(self, other: object) -> bool:\n        return False\n\n    def __ge__(self, other: object) -> bool:\n        return False\n\n    def __neg__(self: object) -> InfinityType:\n        return Infinity\n\n\nNegativeInfinity = NegativeInfinityType()\n",[],[216,809,810,811,890,891,1694,1751],"07d581fa-67fc-11f0-b654-0224a6c84d84","07d5829a-67fc-11f0-b654-0224a6c84d84",282,["D",1753299260927],"\"\"\"Handwritten parser of dependency specifiers.\n\nThe docstring for each __parse_* function contains EBNF-inspired grammar representing\nthe implementation.\n\"\"\"\n\nfrom __future__ import annotations\n\nimport ast\nfrom typing import NamedTuple, Sequence, Tuple, Union\n\nfrom ._tokenizer import DEFAULT_RULES, Tokenizer\n\n\nclass Node:\n    def __init__(self, value: str) -> None:\n        self.value = value\n\n    def __str__(self) -> str:\n        return self.value\n\n    def __repr__(self) -> str:\n        return f\"<{self.__class__.__name__}('{self}')>\"\n\n    def serialize(self) -> str:\n        raise NotImplementedError\n\n\nclass Variable(Node):\n    def serialize(self) -> str:\n        return str(self)\n\n\nclass Value(Node):\n    def serialize(self) -> str:\n        return f'\"{self}\"'\n\n\nclass Op(Node):\n    def serialize(self) -> str:\n        return str(self)\n\n\nMarkerVar = Union[Variable, Value]\nMarkerItem = Tuple[MarkerVar, Op, MarkerVar]\nMarkerAtom = Union[MarkerItem, Sequence[\"MarkerAtom\"]]\nMarkerList = Sequence[Union[\"MarkerList\", MarkerAtom, str]]\n\n\nclass ParsedRequirement(NamedTuple):\n    name: str\n    url: str\n    extras: list[str]\n    specifier: str\n    marker: MarkerList | None\n\n\n# --------------------------------------------------------------------------------------\n# Recursive descent parser for dependency specifier\n# --------------------------------------------------------------------------------------\ndef parse_requirement(source: str) -> ParsedRequirement:\n    return _parse_requirement(Tokenizer(source, rules=DEFAULT_RULES))\n\n\ndef _parse_requirement(tokenizer: Tokenizer) -> ParsedRequirement:\n    \"\"\"\n    requirement = WS? IDENTIFIER WS? extras WS? requirement_details\n    \"\"\"\n    tokenizer.consume(\"WS\")\n\n    name_token = tokenizer.expect(\n        \"IDENTIFIER\", expected=\"package name at the start of dependency specifier\"\n    )\n    name = name_token.text\n    tokenizer.consume(\"WS\")\n\n    extras = _parse_extras(tokenizer)\n    tokenizer.consume(\"WS\")\n\n    url, specifier, marker = _parse_requirement_details(tokenizer)\n    tokenizer.expect(\"END\", expected=\"end of dependency specifier\")\n\n    return ParsedRequirement(name, url, extras, specifier, marker)\n\n\ndef _parse_requirement_details(\n    tokenizer: Tokenizer,\n) -> tuple[str, str, MarkerList | None]:\n    \"\"\"\n    requirement_details = AT URL (WS requirement_marker?)?\n                        | specifier WS? (requirement_marker)?\n    \"\"\"\n\n    specifier = \"\"\n    url = \"\"\n    marker = None\n\n    if tokenizer.check(\"AT\"):\n        tokenizer.read()\n        tokenizer.consume(\"WS\")\n\n        url_start = tokenizer.position\n        url = tokenizer.expect(\"URL\", expected=\"URL after @\").text\n        if tokenizer.check(\"END\", peek=True):\n            return (url, specifier, marker)\n\n        tokenizer.expect(\"WS\", expected=\"whitespace after URL\")\n\n        # The input might end after whitespace.\n        if tokenizer.check(\"END\", peek=True):\n            return (url, specifier, marker)\n\n        marker = _parse_requirement_marker(\n            tokenizer, span_start=url_start, after=\"URL and whitespace\"\n        )\n    else:\n        specifier_start = tokenizer.position\n        specifier = _parse_specifier(tokenizer)\n        tokenizer.consume(\"WS\")\n\n        if tokenizer.check(\"END\", peek=True):\n            return (url, specifier, marker)\n\n        marker = _parse_requirement_marker(\n            tokenizer,\n            span_start=specifier_start,\n            after=(\n                \"version specifier\"\n                if specifier\n                else \"name and no valid version specifier\"\n            ),\n        )\n\n    return (url, specifier, marker)\n\n\ndef _parse_requirement_marker(\n    tokenizer: Tokenizer, *, span_start: int, after: str\n) -> MarkerList:\n    \"\"\"\n    requirement_marker = SEMICOLON marker WS?\n    \"\"\"\n\n    if not tokenizer.check(\"SEMICOLON\"):\n        tokenizer.raise_syntax_error(\n            f\"Expected end or semicolon (after {after})\",\n            span_start=span_start,\n        )\n    tokenizer.read()\n\n    marker = _parse_marker(tokenizer)\n    tokenizer.consume(\"WS\")\n\n    return marker\n\n\ndef _parse_extras(tokenizer: Tokenizer) -> list[str]:\n    \"\"\"\n    extras = (LEFT_BRACKET wsp* extras_list? wsp* RIGHT_BRACKET)?\n    \"\"\"\n    if not tokenizer.check(\"LEFT_BRACKET\", peek=True):\n        return []\n\n    with tokenizer.enclosing_tokens(\n        \"LEFT_BRACKET\",\n        \"RIGHT_BRACKET\",\n        around=\"extras\",\n    ):\n        tokenizer.consume(\"WS\")\n        extras = _parse_extras_list(tokenizer)\n        tokenizer.consume(\"WS\")\n\n    return extras\n\n\ndef _parse_extras_list(tokenizer: Tokenizer) -> list[str]:\n    \"\"\"\n    extras_list = identifier (wsp* ',' wsp* identifier)*\n    \"\"\"\n    extras: list[str] = []\n\n    if not tokenizer.check(\"IDENTIFIER\"):\n        return extras\n\n    extras.append(tokenizer.read().text)\n\n    while True:\n        tokenizer.consume(\"WS\")\n        if tokenizer.check(\"IDENTIFIER\", peek=True):\n            tokenizer.raise_syntax_error(\"Expected comma between extra names\")\n        elif not tokenizer.check(\"COMMA\"):\n            break\n\n        tokenizer.read()\n        tokenizer.consume(\"WS\")\n\n        extra_token = tokenizer.expect(\"IDENTIFIER\", expected=\"extra name after comma\")\n        extras.append(extra_token.text)\n\n    return extras\n\n\ndef _parse_specifier(tokenizer: Tokenizer) -> str:\n    \"\"\"\n    specifier = LEFT_PARENTHESIS WS? version_many WS? RIGHT_PARENTHESIS\n              | WS? version_many WS?\n    \"\"\"\n    with tokenizer.enclosing_tokens(\n        \"LEFT_PARENTHESIS\",\n        \"RIGHT_PARENTHESIS\",\n        around=\"version specifier\",\n    ):\n        tokenizer.consume(\"WS\")\n        parsed_specifiers = _parse_version_many(tokenizer)\n        tokenizer.consume(\"WS\")\n\n    return parsed_specifiers\n\n\ndef _parse_version_many(tokenizer: Tokenizer) -> str:\n    \"\"\"\n    version_many = (SPECIFIER (WS? COMMA WS? SPECIFIER)*)?\n    \"\"\"\n    parsed_specifiers = \"\"\n    while tokenizer.check(\"SPECIFIER\"):\n        span_start = tokenizer.position\n        parsed_specifiers += tokenizer.read().text\n        if tokenizer.check(\"VERSION_PREFIX_TRAIL\", peek=True):\n            tokenizer.raise_syntax_error(\n                \".* suffix can only be used with `==` or `!=` operators\",\n                span_start=span_start,\n                span_end=tokenizer.position + 1,\n            )\n        if tokenizer.check(\"VERSION_LOCAL_LABEL_TRAIL\", peek=True):\n            tokenizer.raise_syntax_error(\n                \"Local version label can only be used with `==` or `!=` operators\",\n                span_start=span_start,\n                span_end=tokenizer.position,\n            )\n        tokenizer.consume(\"WS\")\n        if not tokenizer.check(\"COMMA\"):\n            break\n        parsed_specifiers += tokenizer.read().text\n        tokenizer.consume(\"WS\")\n\n    return parsed_specifiers\n\n\n# --------------------------------------------------------------------------------------\n# Recursive descent parser for marker expression\n# --------------------------------------------------------------------------------------\ndef parse_marker(source: str) -> MarkerList:\n    return _parse_full_marker(Tokenizer(source, rules=DEFAULT_RULES))\n\n\ndef _parse_full_marker(tokenizer: Tokenizer) -> MarkerList:\n    retval = _parse_marker(tokenizer)\n    tokenizer.expect(\"END\", expected=\"end of marker expression\")\n    return retval\n\n\ndef _parse_marker(tokenizer: Tokenizer) -> MarkerList:\n    \"\"\"\n    marker = marker_atom (BOOLOP marker_atom)+\n    \"\"\"\n    expression = [_parse_marker_atom(tokenizer)]\n    while tokenizer.check(\"BOOLOP\"):\n        token = tokenizer.read()\n        expr_right = _parse_marker_atom(tokenizer)\n        expression.extend((token.text, expr_right))\n    return expression\n\n\ndef _parse_marker_atom(tokenizer: Tokenizer) -> MarkerAtom:\n    \"\"\"\n    marker_atom = WS? LEFT_PARENTHESIS WS? marker WS? RIGHT_PARENTHESIS WS?\n                | WS? marker_item WS?\n    \"\"\"\n\n    tokenizer.consume(\"WS\")\n    if tokenizer.check(\"LEFT_PARENTHESIS\", peek=True):\n        with tokenizer.enclosing_tokens(\n            \"LEFT_PARENTHESIS\",\n            \"RIGHT_PARENTHESIS\",\n            around=\"marker expression\",\n        ):\n            tokenizer.consume(\"WS\")\n            marker: MarkerAtom = _parse_marker(tokenizer)\n            tokenizer.consume(\"WS\")\n    else:\n        marker = _parse_marker_item(tokenizer)\n    tokenizer.consume(\"WS\")\n    return marker\n\n\ndef _parse_marker_item(tokenizer: Tokenizer) -> MarkerItem:\n    \"\"\"\n    marker_item = WS? marker_var WS? marker_op WS? marker_var WS?\n    \"\"\"\n    tokenizer.consume(\"WS\")\n    marker_var_left = _parse_marker_var(tokenizer)\n    tokenizer.consume(\"WS\")\n    marker_op = _parse_marker_op(tokenizer)\n    tokenizer.consume(\"WS\")\n    marker_var_right = _parse_marker_var(tokenizer)\n    tokenizer.consume(\"WS\")\n    return (marker_var_left, marker_op, marker_var_right)\n\n\ndef _parse_marker_var(tokenizer: Tokenizer) -> MarkerVar:\n    \"\"\"\n    marker_var = VARIABLE | QUOTED_STRING\n    \"\"\"\n    if tokenizer.check(\"VARIABLE\"):\n        return process_env_var(tokenizer.read().text.replace(\".\", \"_\"))\n    elif tokenizer.check(\"QUOTED_STRING\"):\n        return process_python_str(tokenizer.read().text)\n    else:\n        tokenizer.raise_syntax_error(\n            message=\"Expected a marker variable or quoted string\"\n        )\n\n\ndef process_env_var(env_var: str) -> Variable:\n    if env_var in (\"platform_python_implementation\", \"python_implementation\"):\n        return Variable(\"platform_python_implementation\")\n    else:\n        return Variable(env_var)\n\n\ndef process_python_str(python_str: str) -> Value:\n    value = ast.literal_eval(python_str)\n    return Value(str(value))\n\n\ndef _parse_marker_op(tokenizer: Tokenizer) -> Op:\n    \"\"\"\n    marker_op = IN | NOT IN | OP\n    \"\"\"\n    if tokenizer.check(\"IN\"):\n        tokenizer.read()\n        return Op(\"in\")\n    elif tokenizer.check(\"NOT\"):\n        tokenizer.read()\n        tokenizer.expect(\"WS\", expected=\"whitespace after 'not'\")\n        tokenizer.expect(\"IN\", expected=\"'in' after 'not'\")\n        return Op(\"not in\")\n    elif tokenizer.check(\"OP\"):\n        return Op(tokenizer.read().text)\n    else:\n        return tokenizer.raise_syntax_error(\n            \"Expected marker operator, one of <=, <, !=, ==, >=, >, ~=, ===, in, not in\"\n        )\n",[],[216,809,810,811,890,891,1694,1030],"07b2723c-67fc-11f0-9ab6-0224a6c84d84","_musllinux.py","07b272e6-67fc-11f0-9ab6-0224a6c84d84",276,["D",1753299260698],"\"\"\"PEP 656 support.\n\nThis module implements logic to detect if the currently running Python is\nlinked against musl, and what musl version is used.\n\"\"\"\n\nfrom __future__ import annotations\n\nimport functools\nimport re\nimport subprocess\nimport sys\nfrom typing import Iterator, NamedTuple, Sequence\n\nfrom ._elffile import ELFFile\n\n\nclass _MuslVersion(NamedTuple):\n    major: int\n    minor: int\n\n\ndef _parse_musl_version(output: str) -> _MuslVersion | None:\n    lines = [n for n in (n.strip() for n in output.splitlines()) if n]\n    if len(lines) < 2 or lines[0][:4] != \"musl\":\n        return None\n    m = re.match(r\"Version (\\d+)\\.(\\d+)\", lines[1])\n    if not m:\n        return None\n    return _MuslVersion(major=int(m.group(1)), minor=int(m.group(2)))\n\n\n@functools.lru_cache\ndef _get_musl_version(executable: str) -> _MuslVersion | None:\n    \"\"\"Detect currently-running musl runtime version.\n\n    This is done by checking the specified executable's dynamic linking\n    information, and invoking the loader to parse its output for a version\n    string. If the loader is musl, the output would be something like::\n\n        musl libc (x86_64)\n        Version 1.2.2\n        Dynamic Program Loader\n    \"\"\"\n    try:\n        with open(executable, \"rb\") as f:\n            ld = ELFFile(f).interpreter\n    except (OSError, TypeError, ValueError):\n        return None\n    if ld is None or \"musl\" not in ld:\n        return None\n    proc = subprocess.run([ld], stderr=subprocess.PIPE, text=True)\n    return _parse_musl_version(proc.stderr)\n\n\ndef platform_tags(archs: Sequence[str]) -> Iterator[str]:\n    \"\"\"Generate musllinux tags compatible to the current platform.\n\n    :param archs: Sequence of compatible architectures.\n        The first one shall be the closest to the actual architecture and be the part of\n        platform tag after the ``linux_`` prefix, e.g. ``x86_64``.\n        The ``linux_`` prefix is assumed as a prerequisite for the current platform to\n        be musllinux-compatible.\n\n    :returns: An iterator of compatible musllinux tags.\n    \"\"\"\n    sys_musl = _get_musl_version(sys.executable)\n    if sys_musl is None:  # Python not dynamically linked against musl.\n        return\n    for arch in archs:\n        for minor in range(sys_musl.minor, -1, -1):\n            yield f\"musllinux_{sys_musl.major}_{minor}_{arch}\"\n\n\nif __name__ == \"__main__\":  # pragma: no cover\n    import sysconfig\n\n    plat = sysconfig.get_platform()\n    assert plat.startswith(\"linux-\"), \"not linux\"\n\n    print(\"plat:\", plat)\n    print(\"musl:\", _get_musl_version(sys.executable))\n    print(\"tags:\", end=\" \")\n    for t in platform_tags(re.sub(r\"[.-]\", \"_\", plat.split(\"-\", 1)[-1])):\n        print(t, end=\"\\n      \")\n",[],[216,809,810,811,890,891,1694,1766],"07f00110-67fc-11f0-84bb-0224a6c84d84","_manylinux.py","07f001ec-67fc-11f0-84bb-0224a6c84d84",287,["D",1753299261099],"from __future__ import annotations\n\nimport collections\nimport contextlib\nimport functools\nimport os\nimport re\nimport sys\nimport warnings\nfrom typing import Generator, Iterator, NamedTuple, Sequence\n\nfrom ._elffile import EIClass, EIData, ELFFile, EMachine\n\nEF_ARM_ABIMASK = 0xFF000000\nEF_ARM_ABI_VER5 = 0x05000000\nEF_ARM_ABI_FLOAT_HARD = 0x00000400\n\n\n# `os.PathLike` not a generic type until Python 3.9, so sticking with `str`\n# as the type for `path` until then.\n@contextlib.contextmanager\ndef _parse_elf(path: str) -> Generator[ELFFile | None, None, None]:\n    try:\n        with open(path, \"rb\") as f:\n            yield ELFFile(f)\n    except (OSError, TypeError, ValueError):\n        yield None\n\n\ndef _is_linux_armhf(executable: str) -> bool:\n    # hard-float ABI can be detected from the ELF header of the running\n    # process\n    # https://static.docs.arm.com/ihi0044/g/aaelf32.pdf\n    with _parse_elf(executable) as f:\n        return (\n            f is not None\n            and f.capacity == EIClass.C32\n            and f.encoding == EIData.Lsb\n            and f.machine == EMachine.Arm\n            and f.flags & EF_ARM_ABIMASK == EF_ARM_ABI_VER5\n            and f.flags & EF_ARM_ABI_FLOAT_HARD == EF_ARM_ABI_FLOAT_HARD\n        )\n\n\ndef _is_linux_i686(executable: str) -> bool:\n    with _parse_elf(executable) as f:\n        return (\n            f is not None\n            and f.capacity == EIClass.C32\n            and f.encoding == EIData.Lsb\n            and f.machine == EMachine.I386\n        )\n\n\ndef _have_compatible_abi(executable: str, archs: Sequence[str]) -> bool:\n    if \"armv7l\" in archs:\n        return _is_linux_armhf(executable)\n    if \"i686\" in archs:\n        return _is_linux_i686(executable)\n    allowed_archs = {\n        \"x86_64\",\n        \"aarch64\",\n        \"ppc64\",\n        \"ppc64le\",\n        \"s390x\",\n        \"loongarch64\",\n        \"riscv64\",\n    }\n    return any(arch in allowed_archs for arch in archs)\n\n\n# If glibc ever changes its major version, we need to know what the last\n# minor version was, so we can build the complete list of all versions.\n# For now, guess what the highest minor version might be, assume it will\n# be 50 for testing. Once this actually happens, update the dictionary\n# with the actual value.\n_LAST_GLIBC_MINOR: dict[int, int] = collections.defaultdict(lambda: 50)\n\n\nclass _GLibCVersion(NamedTuple):\n    major: int\n    minor: int\n\n\ndef _glibc_version_string_confstr() -> str | None:\n    \"\"\"\n    Primary implementation of glibc_version_string using os.confstr.\n    \"\"\"\n    # os.confstr is quite a bit faster than ctypes.DLL. It's also less likely\n    # to be broken or missing. This strategy is used in the standard library\n    # platform module.\n    # https://github.com/python/cpython/blob/fcf1d003bf4f0100c/Lib/platform.py#L175-L183\n    try:\n        # Should be a string like \"glibc 2.17\".\n        version_string: str | None = os.confstr(\"CS_GNU_LIBC_VERSION\")\n        assert version_string is not None\n        _, version = version_string.rsplit()\n    except (AssertionError, AttributeError, OSError, ValueError):\n        # os.confstr() or CS_GNU_LIBC_VERSION not available (or a bad value)...\n        return None\n    return version\n\n\ndef _glibc_version_string_ctypes() -> str | None:\n    \"\"\"\n    Fallback implementation of glibc_version_string using ctypes.\n    \"\"\"\n    try:\n        import ctypes\n    except ImportError:\n        return None\n\n    # ctypes.CDLL(None) internally calls dlopen(NULL), and as the dlopen\n    # manpage says, \"If filename is NULL, then the returned handle is for the\n    # main program\". This way we can let the linker do the work to figure out\n    # which libc our process is actually using.\n    #\n    # We must also handle the special case where the executable is not a\n    # dynamically linked executable. This can occur when using musl libc,\n    # for example. In this situation, dlopen() will error, leading to an\n    # OSError. Interestingly, at least in the case of musl, there is no\n    # errno set on the OSError. The single string argument used to construct\n    # OSError comes from libc itself and is therefore not portable to\n    # hard code here. In any case, failure to call dlopen() means we\n    # can proceed, so we bail on our attempt.\n    try:\n        process_namespace = ctypes.CDLL(None)\n    except OSError:\n        return None\n\n    try:\n        gnu_get_libc_version = process_namespace.gnu_get_libc_version\n    except AttributeError:\n        # Symbol doesn't exist -> therefore, we are not linked to\n        # glibc.\n        return None\n\n    # Call gnu_get_libc_version, which returns a string like \"2.5\"\n    gnu_get_libc_version.restype = ctypes.c_char_p\n    version_str: str = gnu_get_libc_version()\n    # py2 / py3 compatibility:\n    if not isinstance(version_str, str):\n        version_str = version_str.decode(\"ascii\")\n\n    return version_str\n\n\ndef _glibc_version_string() -> str | None:\n    \"\"\"Returns glibc version string, or None if not using glibc.\"\"\"\n    return _glibc_version_string_confstr() or _glibc_version_string_ctypes()\n\n\ndef _parse_glibc_version(version_str: str) -> tuple[int, int]:\n    \"\"\"Parse glibc version.\n\n    We use a regexp instead of str.split because we want to discard any\n    random junk that might come after the minor version -- this might happen\n    in patched/forked versions of glibc (e.g. Linaro's version of glibc\n    uses version strings like \"2.20-2014.11\"). See gh-3588.\n    \"\"\"\n    m = re.match(r\"(?P[0-9]+)\\.(?P[0-9]+)\", version_str)\n    if not m:\n        warnings.warn(\n            f\"Expected glibc version with 2 components major.minor, got: {version_str}\",\n            RuntimeWarning,\n            stacklevel=2,\n        )\n        return -1, -1\n    return int(m.group(\"major\")), int(m.group(\"minor\"))\n\n\n@functools.lru_cache\ndef _get_glibc_version() -> tuple[int, int]:\n    version_str = _glibc_version_string()\n    if version_str is None:\n        return (-1, -1)\n    return _parse_glibc_version(version_str)\n\n\n# From PEP 513, PEP 600\ndef _is_compatible(arch: str, version: _GLibCVersion) -> bool:\n    sys_glibc = _get_glibc_version()\n    if sys_glibc < version:\n        return False\n    # Check for presence of _manylinux module.\n    try:\n        import _manylinux\n    except ImportError:\n        return True\n    if hasattr(_manylinux, \"manylinux_compatible\"):\n        result = _manylinux.manylinux_compatible(version[0], version[1], arch)\n        if result is not None:\n            return bool(result)\n        return True\n    if version == _GLibCVersion(2, 5):\n        if hasattr(_manylinux, \"manylinux1_compatible\"):\n            return bool(_manylinux.manylinux1_compatible)\n    if version == _GLibCVersion(2, 12):\n        if hasattr(_manylinux, \"manylinux2010_compatible\"):\n            return bool(_manylinux.manylinux2010_compatible)\n    if version == _GLibCVersion(2, 17):\n        if hasattr(_manylinux, \"manylinux2014_compatible\"):\n            return bool(_manylinux.manylinux2014_compatible)\n    return True\n\n\n_LEGACY_MANYLINUX_MAP = {\n    # CentOS 7 w/ glibc 2.17 (PEP 599)\n    (2, 17): \"manylinux2014\",\n    # CentOS 6 w/ glibc 2.12 (PEP 571)\n    (2, 12): \"manylinux2010\",\n    # CentOS 5 w/ glibc 2.5 (PEP 513)\n    (2, 5): \"manylinux1\",\n}\n\n\ndef platform_tags(archs: Sequence[str]) -> Iterator[str]:\n    \"\"\"Generate manylinux tags compatible to the current platform.\n\n    :param archs: Sequence of compatible architectures.\n        The first one shall be the closest to the actual architecture and be the part of\n        platform tag after the ``linux_`` prefix, e.g. ``x86_64``.\n        The ``linux_`` prefix is assumed as a prerequisite for the current platform to\n        be manylinux-compatible.\n\n    :returns: An iterator of compatible manylinux tags.\n    \"\"\"\n    if not _have_compatible_abi(sys.executable, archs):\n        return\n    # Oldest glibc to be supported regardless of architecture is (2, 17).\n    too_old_glibc2 = _GLibCVersion(2, 16)\n    if set(archs) & {\"x86_64\", \"i686\"}:\n        # On x86/i686 also oldest glibc to be supported is (2, 5).\n        too_old_glibc2 = _GLibCVersion(2, 4)\n    current_glibc = _GLibCVersion(*_get_glibc_version())\n    glibc_max_list = [current_glibc]\n    # We can assume compatibility across glibc major versions.\n    # https://sourceware.org/bugzilla/show_bug.cgi?id=24636\n    #\n    # Build a list of maximum glibc versions so that we can\n    # output the canonical list of all glibc from current_glibc\n    # down to too_old_glibc2, including all intermediary versions.\n    for glibc_major in range(current_glibc.major - 1, 1, -1):\n        glibc_minor = _LAST_GLIBC_MINOR[glibc_major]\n        glibc_max_list.append(_GLibCVersion(glibc_major, glibc_minor))\n    for arch in archs:\n        for glibc_max in glibc_max_list:\n            if glibc_max.major == too_old_glibc2.major:\n                min_minor = too_old_glibc2.minor\n            else:\n                # For other glibc major versions oldest supported is (x, 0).\n                min_minor = -1\n            for glibc_minor in range(glibc_max.minor, min_minor, -1):\n                glibc_version = _GLibCVersion(glibc_max.major, glibc_minor)\n                tag = \"manylinux_{}_{}\".format(*glibc_version)\n                if _is_compatible(arch, glibc_version):\n                    yield f\"{tag}_{arch}\"\n                # Handle the legacy manylinux1, manylinux2010, manylinux2014 tags.\n                if glibc_version in _LEGACY_MANYLINUX_MAP:\n                    legacy_tag = _LEGACY_MANYLINUX_MAP[glibc_version]\n                    if _is_compatible(arch, glibc_version):\n                        yield f\"{legacy_tag}_{arch}\"\n",[],[216,809,810,811,890,891,1694,1774],"0801e182-67fc-11f0-8d4e-0224a6c84d84","_elffile.py","0801e25e-67fc-11f0-8d4e-0224a6c84d84",290,["D",1753299261206],"\"\"\"\nELF file parser.\n\nThis provides a class ``ELFFile`` that parses an ELF executable in a similar\ninterface to ``ZipFile``. Only the read interface is implemented.\n\nBased on: https://gist.github.com/lyssdod/f51579ae8d93c8657a5564aefc2ffbca\nELF header: https://refspecs.linuxfoundation.org/elf/gabi4+/ch4.eheader.html\n\"\"\"\n\nfrom __future__ import annotations\n\nimport enum\nimport os\nimport struct\nfrom typing import IO\n\n\nclass ELFInvalid(ValueError):\n    pass\n\n\nclass EIClass(enum.IntEnum):\n    C32 = 1\n    C64 = 2\n\n\nclass EIData(enum.IntEnum):\n    Lsb = 1\n    Msb = 2\n\n\nclass EMachine(enum.IntEnum):\n    I386 = 3\n    S390 = 22\n    Arm = 40\n    X8664 = 62\n    AArc64 = 183\n\n\nclass ELFFile:\n    \"\"\"\n    Representation of an ELF executable.\n    \"\"\"\n\n    def __init__(self, f: IO[bytes]) -> None:\n        self._f = f\n\n        try:\n            ident = self._read(\"16B\")\n        except struct.error as e:\n            raise ELFInvalid(\"unable to parse identification\") from e\n        magic = bytes(ident[:4])\n        if magic != b\"\\x7fELF\":\n            raise ELFInvalid(f\"invalid magic: {magic!r}\")\n\n        self.capacity = ident[4]  # Format for program header (bitness).\n        self.encoding = ident[5]  # Data structure encoding (endianness).\n\n        try:\n            # e_fmt: Format for program header.\n            # p_fmt: Format for section header.\n            # p_idx: Indexes to find p_type, p_offset, and p_filesz.\n            e_fmt, self._p_fmt, self._p_idx = {\n                (1, 1): (\"HHIIIIIHHH\", \">IIIIIIII\", (0, 1, 4)),  # 32-bit MSB.\n                (2, 1): (\"HHIQQQIHHH\", \">IIQQQQQQ\", (0, 2, 5)),  # 64-bit MSB.\n            }[(self.capacity, self.encoding)]\n        except KeyError as e:\n            raise ELFInvalid(\n                f\"unrecognized capacity ({self.capacity}) or encoding ({self.encoding})\"\n            ) from e\n\n        try:\n            (\n                _,\n                self.machine,  # Architecture type.\n                _,\n                _,\n                self._e_phoff,  # Offset of program header.\n                _,\n                self.flags,  # Processor-specific flags.\n                _,\n                self._e_phentsize,  # Size of section.\n                self._e_phnum,  # Number of sections.\n            ) = self._read(e_fmt)\n        except struct.error as e:\n            raise ELFInvalid(\"unable to parse machine and section information\") from e\n\n    def _read(self, fmt: str) -> tuple[int, ...]:\n        return struct.unpack(fmt, self._f.read(struct.calcsize(fmt)))\n\n    @property\n    def interpreter(self) -> str | None:\n        \"\"\"\n        The path recorded in the ``PT_INTERP`` section header.\n        \"\"\"\n        for index in range(self._e_phnum):\n            self._f.seek(self._e_phoff + self._e_phentsize * index)\n            try:\n                data = self._read(self._p_fmt)\n            except struct.error:\n                continue\n            if data[self._p_idx[0]] != 3:  # Not PT_INTERP.\n                continue\n            self._f.seek(data[self._p_idx[1]])\n            return os.fsdecode(self._f.read(data[self._p_idx[2]])).strip(\"\\0\")\n        return None\n",[],[216,809,810,811,890,891,1694,1782],"07cd3d88-67fc-11f0-8863-0224a6c84d84","07cd3e6e-67fc-11f0-8863-0224a6c84d84",281,["D",1753299260872],"# This file is dual licensed under the terms of the Apache License, Version\n# 2.0, and the BSD License. See the LICENSE file in the root of this repository\n# for complete details.\n\n__title__ = \"packaging\"\n__summary__ = \"Core utilities for Python packages\"\n__uri__ = \"https://github.com/pypa/packaging\"\n\n__version__ = \"25.0\"\n\n__author__ = \"Donald Stufft and individual contributors\"\n__email__ = \"donald@stufft.io\"\n\n__license__ = \"BSD-2-Clause or Apache-2.0\"\n__copyright__ = f\"2014 {__author__}\"\n",[],[216,809,810,811,890,891,1694,893],"07c94386-67fc-11f0-aad3-0224a6c84d84","_spdx.py","07c94458-67fc-11f0-aad3-0224a6c84d84","ffbb10f2-67fb-11f0-9f6f-0224a6c84d84",280,["D",1753299260835],"\nfrom __future__ import annotations\n\nfrom typing import TypedDict\n\nclass SPDXLicense(TypedDict):\n    id: str\n    deprecated: bool\n\nclass SPDXException(TypedDict):\n    id: str\n    deprecated: bool\n\n\nVERSION = '3.25.0'\n\nLICENSES: dict[str, SPDXLicense] = {\n    '0bsd': {'id': '0BSD', 'deprecated': False},\n    '3d-slicer-1.0': {'id': '3D-Slicer-1.0', 'deprecated': False},\n    'aal': {'id': 'AAL', 'deprecated': False},\n    'abstyles': {'id': 'Abstyles', 'deprecated': False},\n    'adacore-doc': {'id': 'AdaCore-doc', 'deprecated': False},\n    'adobe-2006': {'id': 'Adobe-2006', 'deprecated': False},\n    'adobe-display-postscript': {'id': 'Adobe-Display-PostScript', 'deprecated': False},\n    'adobe-glyph': {'id': 'Adobe-Glyph', 'deprecated': False},\n    'adobe-utopia': {'id': 'Adobe-Utopia', 'deprecated': False},\n    'adsl': {'id': 'ADSL', 'deprecated': False},\n    'afl-1.1': {'id': 'AFL-1.1', 'deprecated': False},\n    'afl-1.2': {'id': 'AFL-1.2', 'deprecated': False},\n    'afl-2.0': {'id': 'AFL-2.0', 'deprecated': False},\n    'afl-2.1': {'id': 'AFL-2.1', 'deprecated': False},\n    'afl-3.0': {'id': 'AFL-3.0', 'deprecated': False},\n    'afmparse': {'id': 'Afmparse', 'deprecated': False},\n    'agpl-1.0': {'id': 'AGPL-1.0', 'deprecated': True},\n    'agpl-1.0-only': {'id': 'AGPL-1.0-only', 'deprecated': False},\n    'agpl-1.0-or-later': {'id': 'AGPL-1.0-or-later', 'deprecated': False},\n    'agpl-3.0': {'id': 'AGPL-3.0', 'deprecated': True},\n    'agpl-3.0-only': {'id': 'AGPL-3.0-only', 'deprecated': False},\n    'agpl-3.0-or-later': {'id': 'AGPL-3.0-or-later', 'deprecated': False},\n    'aladdin': {'id': 'Aladdin', 'deprecated': False},\n    'amd-newlib': {'id': 'AMD-newlib', 'deprecated': False},\n    'amdplpa': {'id': 'AMDPLPA', 'deprecated': False},\n    'aml': {'id': 'AML', 'deprecated': False},\n    'aml-glslang': {'id': 'AML-glslang', 'deprecated': False},\n    'ampas': {'id': 'AMPAS', 'deprecated': False},\n    'antlr-pd': {'id': 'ANTLR-PD', 'deprecated': False},\n    'antlr-pd-fallback': {'id': 'ANTLR-PD-fallback', 'deprecated': False},\n    'any-osi': {'id': 'any-OSI', 'deprecated': False},\n    'apache-1.0': {'id': 'Apache-1.0', 'deprecated': False},\n    'apache-1.1': {'id': 'Apache-1.1', 'deprecated': False},\n    'apache-2.0': {'id': 'Apache-2.0', 'deprecated': False},\n    'apafml': {'id': 'APAFML', 'deprecated': False},\n    'apl-1.0': {'id': 'APL-1.0', 'deprecated': False},\n    'app-s2p': {'id': 'App-s2p', 'deprecated': False},\n    'apsl-1.0': {'id': 'APSL-1.0', 'deprecated': False},\n    'apsl-1.1': {'id': 'APSL-1.1', 'deprecated': False},\n    'apsl-1.2': {'id': 'APSL-1.2', 'deprecated': False},\n    'apsl-2.0': {'id': 'APSL-2.0', 'deprecated': False},\n    'arphic-1999': {'id': 'Arphic-1999', 'deprecated': False},\n    'artistic-1.0': {'id': 'Artistic-1.0', 'deprecated': False},\n    'artistic-1.0-cl8': {'id': 'Artistic-1.0-cl8', 'deprecated': False},\n    'artistic-1.0-perl': {'id': 'Artistic-1.0-Perl', 'deprecated': False},\n    'artistic-2.0': {'id': 'Artistic-2.0', 'deprecated': False},\n    'aswf-digital-assets-1.0': {'id': 'ASWF-Digital-Assets-1.0', 'deprecated': False},\n    'aswf-digital-assets-1.1': {'id': 'ASWF-Digital-Assets-1.1', 'deprecated': False},\n    'baekmuk': {'id': 'Baekmuk', 'deprecated': False},\n    'bahyph': {'id': 'Bahyph', 'deprecated': False},\n    'barr': {'id': 'Barr', 'deprecated': False},\n    'bcrypt-solar-designer': {'id': 'bcrypt-Solar-Designer', 'deprecated': False},\n    'beerware': {'id': 'Beerware', 'deprecated': False},\n    'bitstream-charter': {'id': 'Bitstream-Charter', 'deprecated': False},\n    'bitstream-vera': {'id': 'Bitstream-Vera', 'deprecated': False},\n    'bittorrent-1.0': {'id': 'BitTorrent-1.0', 'deprecated': False},\n    'bittorrent-1.1': {'id': 'BitTorrent-1.1', 'deprecated': False},\n    'blessing': {'id': 'blessing', 'deprecated': False},\n    'blueoak-1.0.0': {'id': 'BlueOak-1.0.0', 'deprecated': False},\n    'boehm-gc': {'id': 'Boehm-GC', 'deprecated': False},\n    'borceux': {'id': 'Borceux', 'deprecated': False},\n    'brian-gladman-2-clause': {'id': 'Brian-Gladman-2-Clause', 'deprecated': False},\n    'brian-gladman-3-clause': {'id': 'Brian-Gladman-3-Clause', 'deprecated': False},\n    'bsd-1-clause': {'id': 'BSD-1-Clause', 'deprecated': False},\n    'bsd-2-clause': {'id': 'BSD-2-Clause', 'deprecated': False},\n    'bsd-2-clause-darwin': {'id': 'BSD-2-Clause-Darwin', 'deprecated': False},\n    'bsd-2-clause-first-lines': {'id': 'BSD-2-Clause-first-lines', 'deprecated': False},\n    'bsd-2-clause-freebsd': {'id': 'BSD-2-Clause-FreeBSD', 'deprecated': True},\n    'bsd-2-clause-netbsd': {'id': 'BSD-2-Clause-NetBSD', 'deprecated': True},\n    'bsd-2-clause-patent': {'id': 'BSD-2-Clause-Patent', 'deprecated': False},\n    'bsd-2-clause-views': {'id': 'BSD-2-Clause-Views', 'deprecated': False},\n    'bsd-3-clause': {'id': 'BSD-3-Clause', 'deprecated': False},\n    'bsd-3-clause-acpica': {'id': 'BSD-3-Clause-acpica', 'deprecated': False},\n    'bsd-3-clause-attribution': {'id': 'BSD-3-Clause-Attribution', 'deprecated': False},\n    'bsd-3-clause-clear': {'id': 'BSD-3-Clause-Clear', 'deprecated': False},\n    'bsd-3-clause-flex': {'id': 'BSD-3-Clause-flex', 'deprecated': False},\n    'bsd-3-clause-hp': {'id': 'BSD-3-Clause-HP', 'deprecated': False},\n    'bsd-3-clause-lbnl': {'id': 'BSD-3-Clause-LBNL', 'deprecated': False},\n    'bsd-3-clause-modification': {'id': 'BSD-3-Clause-Modification', 'deprecated': False},\n    'bsd-3-clause-no-military-license': {'id': 'BSD-3-Clause-No-Military-License', 'deprecated': False},\n    'bsd-3-clause-no-nuclear-license': {'id': 'BSD-3-Clause-No-Nuclear-License', 'deprecated': False},\n    'bsd-3-clause-no-nuclear-license-2014': {'id': 'BSD-3-Clause-No-Nuclear-License-2014', 'deprecated': False},\n    'bsd-3-clause-no-nuclear-warranty': {'id': 'BSD-3-Clause-No-Nuclear-Warranty', 'deprecated': False},\n    'bsd-3-clause-open-mpi': {'id': 'BSD-3-Clause-Open-MPI', 'deprecated': False},\n    'bsd-3-clause-sun': {'id': 'BSD-3-Clause-Sun', 'deprecated': False},\n    'bsd-4-clause': {'id': 'BSD-4-Clause', 'deprecated': False},\n    'bsd-4-clause-shortened': {'id': 'BSD-4-Clause-Shortened', 'deprecated': False},\n    'bsd-4-clause-uc': {'id': 'BSD-4-Clause-UC', 'deprecated': False},\n    'bsd-4.3reno': {'id': 'BSD-4.3RENO', 'deprecated': False},\n    'bsd-4.3tahoe': {'id': 'BSD-4.3TAHOE', 'deprecated': False},\n    'bsd-advertising-acknowledgement': {'id': 'BSD-Advertising-Acknowledgement', 'deprecated': False},\n    'bsd-attribution-hpnd-disclaimer': {'id': 'BSD-Attribution-HPND-disclaimer', 'deprecated': False},\n    'bsd-inferno-nettverk': {'id': 'BSD-Inferno-Nettverk', 'deprecated': False},\n    'bsd-protection': {'id': 'BSD-Protection', 'deprecated': False},\n    'bsd-source-beginning-file': {'id': 'BSD-Source-beginning-file', 'deprecated': False},\n    'bsd-source-code': {'id': 'BSD-Source-Code', 'deprecated': False},\n    'bsd-systemics': {'id': 'BSD-Systemics', 'deprecated': False},\n    'bsd-systemics-w3works': {'id': 'BSD-Systemics-W3Works', 'deprecated': False},\n    'bsl-1.0': {'id': 'BSL-1.0', 'deprecated': False},\n    'busl-1.1': {'id': 'BUSL-1.1', 'deprecated': False},\n    'bzip2-1.0.5': {'id': 'bzip2-1.0.5', 'deprecated': True},\n    'bzip2-1.0.6': {'id': 'bzip2-1.0.6', 'deprecated': False},\n    'c-uda-1.0': {'id': 'C-UDA-1.0', 'deprecated': False},\n    'cal-1.0': {'id': 'CAL-1.0', 'deprecated': False},\n    'cal-1.0-combined-work-exception': {'id': 'CAL-1.0-Combined-Work-Exception', 'deprecated': False},\n    'caldera': {'id': 'Caldera', 'deprecated': False},\n    'caldera-no-preamble': {'id': 'Caldera-no-preamble', 'deprecated': False},\n    'catharon': {'id': 'Catharon', 'deprecated': False},\n    'catosl-1.1': {'id': 'CATOSL-1.1', 'deprecated': False},\n    'cc-by-1.0': {'id': 'CC-BY-1.0', 'deprecated': False},\n    'cc-by-2.0': {'id': 'CC-BY-2.0', 'deprecated': False},\n    'cc-by-2.5': {'id': 'CC-BY-2.5', 'deprecated': False},\n    'cc-by-2.5-au': {'id': 'CC-BY-2.5-AU', 'deprecated': False},\n    'cc-by-3.0': {'id': 'CC-BY-3.0', 'deprecated': False},\n    'cc-by-3.0-at': {'id': 'CC-BY-3.0-AT', 'deprecated': False},\n    'cc-by-3.0-au': {'id': 'CC-BY-3.0-AU', 'deprecated': False},\n    'cc-by-3.0-de': {'id': 'CC-BY-3.0-DE', 'deprecated': False},\n    'cc-by-3.0-igo': {'id': 'CC-BY-3.0-IGO', 'deprecated': False},\n    'cc-by-3.0-nl': {'id': 'CC-BY-3.0-NL', 'deprecated': False},\n    'cc-by-3.0-us': {'id': 'CC-BY-3.0-US', 'deprecated': False},\n    'cc-by-4.0': {'id': 'CC-BY-4.0', 'deprecated': False},\n    'cc-by-nc-1.0': {'id': 'CC-BY-NC-1.0', 'deprecated': False},\n    'cc-by-nc-2.0': {'id': 'CC-BY-NC-2.0', 'deprecated': False},\n    'cc-by-nc-2.5': {'id': 'CC-BY-NC-2.5', 'deprecated': False},\n    'cc-by-nc-3.0': {'id': 'CC-BY-NC-3.0', 'deprecated': False},\n    'cc-by-nc-3.0-de': {'id': 'CC-BY-NC-3.0-DE', 'deprecated': False},\n    'cc-by-nc-4.0': {'id': 'CC-BY-NC-4.0', 'deprecated': False},\n    'cc-by-nc-nd-1.0': {'id': 'CC-BY-NC-ND-1.0', 'deprecated': False},\n    'cc-by-nc-nd-2.0': {'id': 'CC-BY-NC-ND-2.0', 'deprecated': False},\n    'cc-by-nc-nd-2.5': {'id': 'CC-BY-NC-ND-2.5', 'deprecated': False},\n    'cc-by-nc-nd-3.0': {'id': 'CC-BY-NC-ND-3.0', 'deprecated': False},\n    'cc-by-nc-nd-3.0-de': {'id': 'CC-BY-NC-ND-3.0-DE', 'deprecated': False},\n    'cc-by-nc-nd-3.0-igo': {'id': 'CC-BY-NC-ND-3.0-IGO', 'deprecated': False},\n    'cc-by-nc-nd-4.0': {'id': 'CC-BY-NC-ND-4.0', 'deprecated': False},\n    'cc-by-nc-sa-1.0': {'id': 'CC-BY-NC-SA-1.0', 'deprecated': False},\n    'cc-by-nc-sa-2.0': {'id': 'CC-BY-NC-SA-2.0', 'deprecated': False},\n    'cc-by-nc-sa-2.0-de': {'id': 'CC-BY-NC-SA-2.0-DE', 'deprecated': False},\n    'cc-by-nc-sa-2.0-fr': {'id': 'CC-BY-NC-SA-2.0-FR', 'deprecated': False},\n    'cc-by-nc-sa-2.0-uk': {'id': 'CC-BY-NC-SA-2.0-UK', 'deprecated': False},\n    'cc-by-nc-sa-2.5': {'id': 'CC-BY-NC-SA-2.5', 'deprecated': False},\n    'cc-by-nc-sa-3.0': {'id': 'CC-BY-NC-SA-3.0', 'deprecated': False},\n    'cc-by-nc-sa-3.0-de': {'id': 'CC-BY-NC-SA-3.0-DE', 'deprecated': False},\n    'cc-by-nc-sa-3.0-igo': {'id': 'CC-BY-NC-SA-3.0-IGO', 'deprecated': False},\n    'cc-by-nc-sa-4.0': {'id': 'CC-BY-NC-SA-4.0', 'deprecated': False},\n    'cc-by-nd-1.0': {'id': 'CC-BY-ND-1.0', 'deprecated': False},\n    'cc-by-nd-2.0': {'id': 'CC-BY-ND-2.0', 'deprecated': False},\n    'cc-by-nd-2.5': {'id': 'CC-BY-ND-2.5', 'deprecated': False},\n    'cc-by-nd-3.0': {'id': 'CC-BY-ND-3.0', 'deprecated': False},\n    'cc-by-nd-3.0-de': {'id': 'CC-BY-ND-3.0-DE', 'deprecated': False},\n    'cc-by-nd-4.0': {'id': 'CC-BY-ND-4.0', 'deprecated': False},\n    'cc-by-sa-1.0': {'id': 'CC-BY-SA-1.0', 'deprecated': False},\n    'cc-by-sa-2.0': {'id': 'CC-BY-SA-2.0', 'deprecated': False},\n    'cc-by-sa-2.0-uk': {'id': 'CC-BY-SA-2.0-UK', 'deprecated': False},\n    'cc-by-sa-2.1-jp': {'id': 'CC-BY-SA-2.1-JP', 'deprecated': False},\n    'cc-by-sa-2.5': {'id': 'CC-BY-SA-2.5', 'deprecated': False},\n    'cc-by-sa-3.0': {'id': 'CC-BY-SA-3.0', 'deprecated': False},\n    'cc-by-sa-3.0-at': {'id': 'CC-BY-SA-3.0-AT', 'deprecated': False},\n    'cc-by-sa-3.0-de': {'id': 'CC-BY-SA-3.0-DE', 'deprecated': False},\n    'cc-by-sa-3.0-igo': {'id': 'CC-BY-SA-3.0-IGO', 'deprecated': False},\n    'cc-by-sa-4.0': {'id': 'CC-BY-SA-4.0', 'deprecated': False},\n    'cc-pddc': {'id': 'CC-PDDC', 'deprecated': False},\n    'cc0-1.0': {'id': 'CC0-1.0', 'deprecated': False},\n    'cddl-1.0': {'id': 'CDDL-1.0', 'deprecated': False},\n    'cddl-1.1': {'id': 'CDDL-1.1', 'deprecated': False},\n    'cdl-1.0': {'id': 'CDL-1.0', 'deprecated': False},\n    'cdla-permissive-1.0': {'id': 'CDLA-Permissive-1.0', 'deprecated': False},\n    'cdla-permissive-2.0': {'id': 'CDLA-Permissive-2.0', 'deprecated': False},\n    'cdla-sharing-1.0': {'id': 'CDLA-Sharing-1.0', 'deprecated': False},\n    'cecill-1.0': {'id': 'CECILL-1.0', 'deprecated': False},\n    'cecill-1.1': {'id': 'CECILL-1.1', 'deprecated': False},\n    'cecill-2.0': {'id': 'CECILL-2.0', 'deprecated': False},\n    'cecill-2.1': {'id': 'CECILL-2.1', 'deprecated': False},\n    'cecill-b': {'id': 'CECILL-B', 'deprecated': False},\n    'cecill-c': {'id': 'CECILL-C', 'deprecated': False},\n    'cern-ohl-1.1': {'id': 'CERN-OHL-1.1', 'deprecated': False},\n    'cern-ohl-1.2': {'id': 'CERN-OHL-1.2', 'deprecated': False},\n    'cern-ohl-p-2.0': {'id': 'CERN-OHL-P-2.0', 'deprecated': False},\n    'cern-ohl-s-2.0': {'id': 'CERN-OHL-S-2.0', 'deprecated': False},\n    'cern-ohl-w-2.0': {'id': 'CERN-OHL-W-2.0', 'deprecated': False},\n    'cfitsio': {'id': 'CFITSIO', 'deprecated': False},\n    'check-cvs': {'id': 'check-cvs', 'deprecated': False},\n    'checkmk': {'id': 'checkmk', 'deprecated': False},\n    'clartistic': {'id': 'ClArtistic', 'deprecated': False},\n    'clips': {'id': 'Clips', 'deprecated': False},\n    'cmu-mach': {'id': 'CMU-Mach', 'deprecated': False},\n    'cmu-mach-nodoc': {'id': 'CMU-Mach-nodoc', 'deprecated': False},\n    'cnri-jython': {'id': 'CNRI-Jython', 'deprecated': False},\n    'cnri-python': {'id': 'CNRI-Python', 'deprecated': False},\n    'cnri-python-gpl-compatible': {'id': 'CNRI-Python-GPL-Compatible', 'deprecated': False},\n    'coil-1.0': {'id': 'COIL-1.0', 'deprecated': False},\n    'community-spec-1.0': {'id': 'Community-Spec-1.0', 'deprecated': False},\n    'condor-1.1': {'id': 'Condor-1.1', 'deprecated': False},\n    'copyleft-next-0.3.0': {'id': 'copyleft-next-0.3.0', 'deprecated': False},\n    'copyleft-next-0.3.1': {'id': 'copyleft-next-0.3.1', 'deprecated': False},\n    'cornell-lossless-jpeg': {'id': 'Cornell-Lossless-JPEG', 'deprecated': False},\n    'cpal-1.0': {'id': 'CPAL-1.0', 'deprecated': False},\n    'cpl-1.0': {'id': 'CPL-1.0', 'deprecated': False},\n    'cpol-1.02': {'id': 'CPOL-1.02', 'deprecated': False},\n    'cronyx': {'id': 'Cronyx', 'deprecated': False},\n    'crossword': {'id': 'Crossword', 'deprecated': False},\n    'crystalstacker': {'id': 'CrystalStacker', 'deprecated': False},\n    'cua-opl-1.0': {'id': 'CUA-OPL-1.0', 'deprecated': False},\n    'cube': {'id': 'Cube', 'deprecated': False},\n    'curl': {'id': 'curl', 'deprecated': False},\n    'cve-tou': {'id': 'cve-tou', 'deprecated': False},\n    'd-fsl-1.0': {'id': 'D-FSL-1.0', 'deprecated': False},\n    'dec-3-clause': {'id': 'DEC-3-Clause', 'deprecated': False},\n    'diffmark': {'id': 'diffmark', 'deprecated': False},\n    'dl-de-by-2.0': {'id': 'DL-DE-BY-2.0', 'deprecated': False},\n    'dl-de-zero-2.0': {'id': 'DL-DE-ZERO-2.0', 'deprecated': False},\n    'doc': {'id': 'DOC', 'deprecated': False},\n    'docbook-schema': {'id': 'DocBook-Schema', 'deprecated': False},\n    'docbook-xml': {'id': 'DocBook-XML', 'deprecated': False},\n    'dotseqn': {'id': 'Dotseqn', 'deprecated': False},\n    'drl-1.0': {'id': 'DRL-1.0', 'deprecated': False},\n    'drl-1.1': {'id': 'DRL-1.1', 'deprecated': False},\n    'dsdp': {'id': 'DSDP', 'deprecated': False},\n    'dtoa': {'id': 'dtoa', 'deprecated': False},\n    'dvipdfm': {'id': 'dvipdfm', 'deprecated': False},\n    'ecl-1.0': {'id': 'ECL-1.0', 'deprecated': False},\n    'ecl-2.0': {'id': 'ECL-2.0', 'deprecated': False},\n    'ecos-2.0': {'id': 'eCos-2.0', 'deprecated': True},\n    'efl-1.0': {'id': 'EFL-1.0', 'deprecated': False},\n    'efl-2.0': {'id': 'EFL-2.0', 'deprecated': False},\n    'egenix': {'id': 'eGenix', 'deprecated': False},\n    'elastic-2.0': {'id': 'Elastic-2.0', 'deprecated': False},\n    'entessa': {'id': 'Entessa', 'deprecated': False},\n    'epics': {'id': 'EPICS', 'deprecated': False},\n    'epl-1.0': {'id': 'EPL-1.0', 'deprecated': False},\n    'epl-2.0': {'id': 'EPL-2.0', 'deprecated': False},\n    'erlpl-1.1': {'id': 'ErlPL-1.1', 'deprecated': False},\n    'etalab-2.0': {'id': 'etalab-2.0', 'deprecated': False},\n    'eudatagrid': {'id': 'EUDatagrid', 'deprecated': False},\n    'eupl-1.0': {'id': 'EUPL-1.0', 'deprecated': False},\n    'eupl-1.1': {'id': 'EUPL-1.1', 'deprecated': False},\n    'eupl-1.2': {'id': 'EUPL-1.2', 'deprecated': False},\n    'eurosym': {'id': 'Eurosym', 'deprecated': False},\n    'fair': {'id': 'Fair', 'deprecated': False},\n    'fbm': {'id': 'FBM', 'deprecated': False},\n    'fdk-aac': {'id': 'FDK-AAC', 'deprecated': False},\n    'ferguson-twofish': {'id': 'Ferguson-Twofish', 'deprecated': False},\n    'frameworx-1.0': {'id': 'Frameworx-1.0', 'deprecated': False},\n    'freebsd-doc': {'id': 'FreeBSD-DOC', 'deprecated': False},\n    'freeimage': {'id': 'FreeImage', 'deprecated': False},\n    'fsfap': {'id': 'FSFAP', 'deprecated': False},\n    'fsfap-no-warranty-disclaimer': {'id': 'FSFAP-no-warranty-disclaimer', 'deprecated': False},\n    'fsful': {'id': 'FSFUL', 'deprecated': False},\n    'fsfullr': {'id': 'FSFULLR', 'deprecated': False},\n    'fsfullrwd': {'id': 'FSFULLRWD', 'deprecated': False},\n    'ftl': {'id': 'FTL', 'deprecated': False},\n    'furuseth': {'id': 'Furuseth', 'deprecated': False},\n    'fwlw': {'id': 'fwlw', 'deprecated': False},\n    'gcr-docs': {'id': 'GCR-docs', 'deprecated': False},\n    'gd': {'id': 'GD', 'deprecated': False},\n    'gfdl-1.1': {'id': 'GFDL-1.1', 'deprecated': True},\n    'gfdl-1.1-invariants-only': {'id': 'GFDL-1.1-invariants-only', 'deprecated': False},\n    'gfdl-1.1-invariants-or-later': {'id': 'GFDL-1.1-invariants-or-later', 'deprecated': False},\n    'gfdl-1.1-no-invariants-only': {'id': 'GFDL-1.1-no-invariants-only', 'deprecated': False},\n    'gfdl-1.1-no-invariants-or-later': {'id': 'GFDL-1.1-no-invariants-or-later', 'deprecated': False},\n    'gfdl-1.1-only': {'id': 'GFDL-1.1-only', 'deprecated': False},\n    'gfdl-1.1-or-later': {'id': 'GFDL-1.1-or-later', 'deprecated': False},\n    'gfdl-1.2': {'id': 'GFDL-1.2', 'deprecated': True},\n    'gfdl-1.2-invariants-only': {'id': 'GFDL-1.2-invariants-only', 'deprecated': False},\n    'gfdl-1.2-invariants-or-later': {'id': 'GFDL-1.2-invariants-or-later', 'deprecated': False},\n    'gfdl-1.2-no-invariants-only': {'id': 'GFDL-1.2-no-invariants-only', 'deprecated': False},\n    'gfdl-1.2-no-invariants-or-later': {'id': 'GFDL-1.2-no-invariants-or-later', 'deprecated': False},\n    'gfdl-1.2-only': {'id': 'GFDL-1.2-only', 'deprecated': False},\n    'gfdl-1.2-or-later': {'id': 'GFDL-1.2-or-later', 'deprecated': False},\n    'gfdl-1.3': {'id': 'GFDL-1.3', 'deprecated': True},\n    'gfdl-1.3-invariants-only': {'id': 'GFDL-1.3-invariants-only', 'deprecated': False},\n    'gfdl-1.3-invariants-or-later': {'id': 'GFDL-1.3-invariants-or-later', 'deprecated': False},\n    'gfdl-1.3-no-invariants-only': {'id': 'GFDL-1.3-no-invariants-only', 'deprecated': False},\n    'gfdl-1.3-no-invariants-or-later': {'id': 'GFDL-1.3-no-invariants-or-later', 'deprecated': False},\n    'gfdl-1.3-only': {'id': 'GFDL-1.3-only', 'deprecated': False},\n    'gfdl-1.3-or-later': {'id': 'GFDL-1.3-or-later', 'deprecated': False},\n    'giftware': {'id': 'Giftware', 'deprecated': False},\n    'gl2ps': {'id': 'GL2PS', 'deprecated': False},\n    'glide': {'id': 'Glide', 'deprecated': False},\n    'glulxe': {'id': 'Glulxe', 'deprecated': False},\n    'glwtpl': {'id': 'GLWTPL', 'deprecated': False},\n    'gnuplot': {'id': 'gnuplot', 'deprecated': False},\n    'gpl-1.0': {'id': 'GPL-1.0', 'deprecated': True},\n    'gpl-1.0+': {'id': 'GPL-1.0+', 'deprecated': True},\n    'gpl-1.0-only': {'id': 'GPL-1.0-only', 'deprecated': False},\n    'gpl-1.0-or-later': {'id': 'GPL-1.0-or-later', 'deprecated': False},\n    'gpl-2.0': {'id': 'GPL-2.0', 'deprecated': True},\n    'gpl-2.0+': {'id': 'GPL-2.0+', 'deprecated': True},\n    'gpl-2.0-only': {'id': 'GPL-2.0-only', 'deprecated': False},\n    'gpl-2.0-or-later': {'id': 'GPL-2.0-or-later', 'deprecated': False},\n    'gpl-2.0-with-autoconf-exception': {'id': 'GPL-2.0-with-autoconf-exception', 'deprecated': True},\n    'gpl-2.0-with-bison-exception': {'id': 'GPL-2.0-with-bison-exception', 'deprecated': True},\n    'gpl-2.0-with-classpath-exception': {'id': 'GPL-2.0-with-classpath-exception', 'deprecated': True},\n    'gpl-2.0-with-font-exception': {'id': 'GPL-2.0-with-font-exception', 'deprecated': True},\n    'gpl-2.0-with-gcc-exception': {'id': 'GPL-2.0-with-GCC-exception', 'deprecated': True},\n    'gpl-3.0': {'id': 'GPL-3.0', 'deprecated': True},\n    'gpl-3.0+': {'id': 'GPL-3.0+', 'deprecated': True},\n    'gpl-3.0-only': {'id': 'GPL-3.0-only', 'deprecated': False},\n    'gpl-3.0-or-later': {'id': 'GPL-3.0-or-later', 'deprecated': False},\n    'gpl-3.0-with-autoconf-exception': {'id': 'GPL-3.0-with-autoconf-exception', 'deprecated': True},\n    'gpl-3.0-with-gcc-exception': {'id': 'GPL-3.0-with-GCC-exception', 'deprecated': True},\n    'graphics-gems': {'id': 'Graphics-Gems', 'deprecated': False},\n    'gsoap-1.3b': {'id': 'gSOAP-1.3b', 'deprecated': False},\n    'gtkbook': {'id': 'gtkbook', 'deprecated': False},\n    'gutmann': {'id': 'Gutmann', 'deprecated': False},\n    'haskellreport': {'id': 'HaskellReport', 'deprecated': False},\n    'hdparm': {'id': 'hdparm', 'deprecated': False},\n    'hidapi': {'id': 'HIDAPI', 'deprecated': False},\n    'hippocratic-2.1': {'id': 'Hippocratic-2.1', 'deprecated': False},\n    'hp-1986': {'id': 'HP-1986', 'deprecated': False},\n    'hp-1989': {'id': 'HP-1989', 'deprecated': False},\n    'hpnd': {'id': 'HPND', 'deprecated': False},\n    'hpnd-dec': {'id': 'HPND-DEC', 'deprecated': False},\n    'hpnd-doc': {'id': 'HPND-doc', 'deprecated': False},\n    'hpnd-doc-sell': {'id': 'HPND-doc-sell', 'deprecated': False},\n    'hpnd-export-us': {'id': 'HPND-export-US', 'deprecated': False},\n    'hpnd-export-us-acknowledgement': {'id': 'HPND-export-US-acknowledgement', 'deprecated': False},\n    'hpnd-export-us-modify': {'id': 'HPND-export-US-modify', 'deprecated': False},\n    'hpnd-export2-us': {'id': 'HPND-export2-US', 'deprecated': False},\n    'hpnd-fenneberg-livingston': {'id': 'HPND-Fenneberg-Livingston', 'deprecated': False},\n    'hpnd-inria-imag': {'id': 'HPND-INRIA-IMAG', 'deprecated': False},\n    'hpnd-intel': {'id': 'HPND-Intel', 'deprecated': False},\n    'hpnd-kevlin-henney': {'id': 'HPND-Kevlin-Henney', 'deprecated': False},\n    'hpnd-markus-kuhn': {'id': 'HPND-Markus-Kuhn', 'deprecated': False},\n    'hpnd-merchantability-variant': {'id': 'HPND-merchantability-variant', 'deprecated': False},\n    'hpnd-mit-disclaimer': {'id': 'HPND-MIT-disclaimer', 'deprecated': False},\n    'hpnd-netrek': {'id': 'HPND-Netrek', 'deprecated': False},\n    'hpnd-pbmplus': {'id': 'HPND-Pbmplus', 'deprecated': False},\n    'hpnd-sell-mit-disclaimer-xserver': {'id': 'HPND-sell-MIT-disclaimer-xserver', 'deprecated': False},\n    'hpnd-sell-regexpr': {'id': 'HPND-sell-regexpr', 'deprecated': False},\n    'hpnd-sell-variant': {'id': 'HPND-sell-variant', 'deprecated': False},\n    'hpnd-sell-variant-mit-disclaimer': {'id': 'HPND-sell-variant-MIT-disclaimer', 'deprecated': False},\n    'hpnd-sell-variant-mit-disclaimer-rev': {'id': 'HPND-sell-variant-MIT-disclaimer-rev', 'deprecated': False},\n    'hpnd-uc': {'id': 'HPND-UC', 'deprecated': False},\n    'hpnd-uc-export-us': {'id': 'HPND-UC-export-US', 'deprecated': False},\n    'htmltidy': {'id': 'HTMLTIDY', 'deprecated': False},\n    'ibm-pibs': {'id': 'IBM-pibs', 'deprecated': False},\n    'icu': {'id': 'ICU', 'deprecated': False},\n    'iec-code-components-eula': {'id': 'IEC-Code-Components-EULA', 'deprecated': False},\n    'ijg': {'id': 'IJG', 'deprecated': False},\n    'ijg-short': {'id': 'IJG-short', 'deprecated': False},\n    'imagemagick': {'id': 'ImageMagick', 'deprecated': False},\n    'imatix': {'id': 'iMatix', 'deprecated': False},\n    'imlib2': {'id': 'Imlib2', 'deprecated': False},\n    'info-zip': {'id': 'Info-ZIP', 'deprecated': False},\n    'inner-net-2.0': {'id': 'Inner-Net-2.0', 'deprecated': False},\n    'intel': {'id': 'Intel', 'deprecated': False},\n    'intel-acpi': {'id': 'Intel-ACPI', 'deprecated': False},\n    'interbase-1.0': {'id': 'Interbase-1.0', 'deprecated': False},\n    'ipa': {'id': 'IPA', 'deprecated': False},\n    'ipl-1.0': {'id': 'IPL-1.0', 'deprecated': False},\n    'isc': {'id': 'ISC', 'deprecated': False},\n    'isc-veillard': {'id': 'ISC-Veillard', 'deprecated': False},\n    'jam': {'id': 'Jam', 'deprecated': False},\n    'jasper-2.0': {'id': 'JasPer-2.0', 'deprecated': False},\n    'jpl-image': {'id': 'JPL-image', 'deprecated': False},\n    'jpnic': {'id': 'JPNIC', 'deprecated': False},\n    'json': {'id': 'JSON', 'deprecated': False},\n    'kastrup': {'id': 'Kastrup', 'deprecated': False},\n    'kazlib': {'id': 'Kazlib', 'deprecated': False},\n    'knuth-ctan': {'id': 'Knuth-CTAN', 'deprecated': False},\n    'lal-1.2': {'id': 'LAL-1.2', 'deprecated': False},\n    'lal-1.3': {'id': 'LAL-1.3', 'deprecated': False},\n    'latex2e': {'id': 'Latex2e', 'deprecated': False},\n    'latex2e-translated-notice': {'id': 'Latex2e-translated-notice', 'deprecated': False},\n    'leptonica': {'id': 'Leptonica', 'deprecated': False},\n    'lgpl-2.0': {'id': 'LGPL-2.0', 'deprecated': True},\n    'lgpl-2.0+': {'id': 'LGPL-2.0+', 'deprecated': True},\n    'lgpl-2.0-only': {'id': 'LGPL-2.0-only', 'deprecated': False},\n    'lgpl-2.0-or-later': {'id': 'LGPL-2.0-or-later', 'deprecated': False},\n    'lgpl-2.1': {'id': 'LGPL-2.1', 'deprecated': True},\n    'lgpl-2.1+': {'id': 'LGPL-2.1+', 'deprecated': True},\n    'lgpl-2.1-only': {'id': 'LGPL-2.1-only', 'deprecated': False},\n    'lgpl-2.1-or-later': {'id': 'LGPL-2.1-or-later', 'deprecated': False},\n    'lgpl-3.0': {'id': 'LGPL-3.0', 'deprecated': True},\n    'lgpl-3.0+': {'id': 'LGPL-3.0+', 'deprecated': True},\n    'lgpl-3.0-only': {'id': 'LGPL-3.0-only', 'deprecated': False},\n    'lgpl-3.0-or-later': {'id': 'LGPL-3.0-or-later', 'deprecated': False},\n    'lgpllr': {'id': 'LGPLLR', 'deprecated': False},\n    'libpng': {'id': 'Libpng', 'deprecated': False},\n    'libpng-2.0': {'id': 'libpng-2.0', 'deprecated': False},\n    'libselinux-1.0': {'id': 'libselinux-1.0', 'deprecated': False},\n    'libtiff': {'id': 'libtiff', 'deprecated': False},\n    'libutil-david-nugent': {'id': 'libutil-David-Nugent', 'deprecated': False},\n    'liliq-p-1.1': {'id': 'LiLiQ-P-1.1', 'deprecated': False},\n    'liliq-r-1.1': {'id': 'LiLiQ-R-1.1', 'deprecated': False},\n    'liliq-rplus-1.1': {'id': 'LiLiQ-Rplus-1.1', 'deprecated': False},\n    'linux-man-pages-1-para': {'id': 'Linux-man-pages-1-para', 'deprecated': False},\n    'linux-man-pages-copyleft': {'id': 'Linux-man-pages-copyleft', 'deprecated': False},\n    'linux-man-pages-copyleft-2-para': {'id': 'Linux-man-pages-copyleft-2-para', 'deprecated': False},\n    'linux-man-pages-copyleft-var': {'id': 'Linux-man-pages-copyleft-var', 'deprecated': False},\n    'linux-openib': {'id': 'Linux-OpenIB', 'deprecated': False},\n    'loop': {'id': 'LOOP', 'deprecated': False},\n    'lpd-document': {'id': 'LPD-document', 'deprecated': False},\n    'lpl-1.0': {'id': 'LPL-1.0', 'deprecated': False},\n    'lpl-1.02': {'id': 'LPL-1.02', 'deprecated': False},\n    'lppl-1.0': {'id': 'LPPL-1.0', 'deprecated': False},\n    'lppl-1.1': {'id': 'LPPL-1.1', 'deprecated': False},\n    'lppl-1.2': {'id': 'LPPL-1.2', 'deprecated': False},\n    'lppl-1.3a': {'id': 'LPPL-1.3a', 'deprecated': False},\n    'lppl-1.3c': {'id': 'LPPL-1.3c', 'deprecated': False},\n    'lsof': {'id': 'lsof', 'deprecated': False},\n    'lucida-bitmap-fonts': {'id': 'Lucida-Bitmap-Fonts', 'deprecated': False},\n    'lzma-sdk-9.11-to-9.20': {'id': 'LZMA-SDK-9.11-to-9.20', 'deprecated': False},\n    'lzma-sdk-9.22': {'id': 'LZMA-SDK-9.22', 'deprecated': False},\n    'mackerras-3-clause': {'id': 'Mackerras-3-Clause', 'deprecated': False},\n    'mackerras-3-clause-acknowledgment': {'id': 'Mackerras-3-Clause-acknowledgment', 'deprecated': False},\n    'magaz': {'id': 'magaz', 'deprecated': False},\n    'mailprio': {'id': 'mailprio', 'deprecated': False},\n    'makeindex': {'id': 'MakeIndex', 'deprecated': False},\n    'martin-birgmeier': {'id': 'Martin-Birgmeier', 'deprecated': False},\n    'mcphee-slideshow': {'id': 'McPhee-slideshow', 'deprecated': False},\n    'metamail': {'id': 'metamail', 'deprecated': False},\n    'minpack': {'id': 'Minpack', 'deprecated': False},\n    'miros': {'id': 'MirOS', 'deprecated': False},\n    'mit': {'id': 'MIT', 'deprecated': False},\n    'mit-0': {'id': 'MIT-0', 'deprecated': False},\n    'mit-advertising': {'id': 'MIT-advertising', 'deprecated': False},\n    'mit-cmu': {'id': 'MIT-CMU', 'deprecated': False},\n    'mit-enna': {'id': 'MIT-enna', 'deprecated': False},\n    'mit-feh': {'id': 'MIT-feh', 'deprecated': False},\n    'mit-festival': {'id': 'MIT-Festival', 'deprecated': False},\n    'mit-khronos-old': {'id': 'MIT-Khronos-old', 'deprecated': False},\n    'mit-modern-variant': {'id': 'MIT-Modern-Variant', 'deprecated': False},\n    'mit-open-group': {'id': 'MIT-open-group', 'deprecated': False},\n    'mit-testregex': {'id': 'MIT-testregex', 'deprecated': False},\n    'mit-wu': {'id': 'MIT-Wu', 'deprecated': False},\n    'mitnfa': {'id': 'MITNFA', 'deprecated': False},\n    'mmixware': {'id': 'MMIXware', 'deprecated': False},\n    'motosoto': {'id': 'Motosoto', 'deprecated': False},\n    'mpeg-ssg': {'id': 'MPEG-SSG', 'deprecated': False},\n    'mpi-permissive': {'id': 'mpi-permissive', 'deprecated': False},\n    'mpich2': {'id': 'mpich2', 'deprecated': False},\n    'mpl-1.0': {'id': 'MPL-1.0', 'deprecated': False},\n    'mpl-1.1': {'id': 'MPL-1.1', 'deprecated': False},\n    'mpl-2.0': {'id': 'MPL-2.0', 'deprecated': False},\n    'mpl-2.0-no-copyleft-exception': {'id': 'MPL-2.0-no-copyleft-exception', 'deprecated': False},\n    'mplus': {'id': 'mplus', 'deprecated': False},\n    'ms-lpl': {'id': 'MS-LPL', 'deprecated': False},\n    'ms-pl': {'id': 'MS-PL', 'deprecated': False},\n    'ms-rl': {'id': 'MS-RL', 'deprecated': False},\n    'mtll': {'id': 'MTLL', 'deprecated': False},\n    'mulanpsl-1.0': {'id': 'MulanPSL-1.0', 'deprecated': False},\n    'mulanpsl-2.0': {'id': 'MulanPSL-2.0', 'deprecated': False},\n    'multics': {'id': 'Multics', 'deprecated': False},\n    'mup': {'id': 'Mup', 'deprecated': False},\n    'naist-2003': {'id': 'NAIST-2003', 'deprecated': False},\n    'nasa-1.3': {'id': 'NASA-1.3', 'deprecated': False},\n    'naumen': {'id': 'Naumen', 'deprecated': False},\n    'nbpl-1.0': {'id': 'NBPL-1.0', 'deprecated': False},\n    'ncbi-pd': {'id': 'NCBI-PD', 'deprecated': False},\n    'ncgl-uk-2.0': {'id': 'NCGL-UK-2.0', 'deprecated': False},\n    'ncl': {'id': 'NCL', 'deprecated': False},\n    'ncsa': {'id': 'NCSA', 'deprecated': False},\n    'net-snmp': {'id': 'Net-SNMP', 'deprecated': True},\n    'netcdf': {'id': 'NetCDF', 'deprecated': False},\n    'newsletr': {'id': 'Newsletr', 'deprecated': False},\n    'ngpl': {'id': 'NGPL', 'deprecated': False},\n    'nicta-1.0': {'id': 'NICTA-1.0', 'deprecated': False},\n    'nist-pd': {'id': 'NIST-PD', 'deprecated': False},\n    'nist-pd-fallback': {'id': 'NIST-PD-fallback', 'deprecated': False},\n    'nist-software': {'id': 'NIST-Software', 'deprecated': False},\n    'nlod-1.0': {'id': 'NLOD-1.0', 'deprecated': False},\n    'nlod-2.0': {'id': 'NLOD-2.0', 'deprecated': False},\n    'nlpl': {'id': 'NLPL', 'deprecated': False},\n    'nokia': {'id': 'Nokia', 'deprecated': False},\n    'nosl': {'id': 'NOSL', 'deprecated': False},\n    'noweb': {'id': 'Noweb', 'deprecated': False},\n    'npl-1.0': {'id': 'NPL-1.0', 'deprecated': False},\n    'npl-1.1': {'id': 'NPL-1.1', 'deprecated': False},\n    'nposl-3.0': {'id': 'NPOSL-3.0', 'deprecated': False},\n    'nrl': {'id': 'NRL', 'deprecated': False},\n    'ntp': {'id': 'NTP', 'deprecated': False},\n    'ntp-0': {'id': 'NTP-0', 'deprecated': False},\n    'nunit': {'id': 'Nunit', 'deprecated': True},\n    'o-uda-1.0': {'id': 'O-UDA-1.0', 'deprecated': False},\n    'oar': {'id': 'OAR', 'deprecated': False},\n    'occt-pl': {'id': 'OCCT-PL', 'deprecated': False},\n    'oclc-2.0': {'id': 'OCLC-2.0', 'deprecated': False},\n    'odbl-1.0': {'id': 'ODbL-1.0', 'deprecated': False},\n    'odc-by-1.0': {'id': 'ODC-By-1.0', 'deprecated': False},\n    'offis': {'id': 'OFFIS', 'deprecated': False},\n    'ofl-1.0': {'id': 'OFL-1.0', 'deprecated': False},\n    'ofl-1.0-no-rfn': {'id': 'OFL-1.0-no-RFN', 'deprecated': False},\n    'ofl-1.0-rfn': {'id': 'OFL-1.0-RFN', 'deprecated': False},\n    'ofl-1.1': {'id': 'OFL-1.1', 'deprecated': False},\n    'ofl-1.1-no-rfn': {'id': 'OFL-1.1-no-RFN', 'deprecated': False},\n    'ofl-1.1-rfn': {'id': 'OFL-1.1-RFN', 'deprecated': False},\n    'ogc-1.0': {'id': 'OGC-1.0', 'deprecated': False},\n    'ogdl-taiwan-1.0': {'id': 'OGDL-Taiwan-1.0', 'deprecated': False},\n    'ogl-canada-2.0': {'id': 'OGL-Canada-2.0', 'deprecated': False},\n    'ogl-uk-1.0': {'id': 'OGL-UK-1.0', 'deprecated': False},\n    'ogl-uk-2.0': {'id': 'OGL-UK-2.0', 'deprecated': False},\n    'ogl-uk-3.0': {'id': 'OGL-UK-3.0', 'deprecated': False},\n    'ogtsl': {'id': 'OGTSL', 'deprecated': False},\n    'oldap-1.1': {'id': 'OLDAP-1.1', 'deprecated': False},\n    'oldap-1.2': {'id': 'OLDAP-1.2', 'deprecated': False},\n    'oldap-1.3': {'id': 'OLDAP-1.3', 'deprecated': False},\n    'oldap-1.4': {'id': 'OLDAP-1.4', 'deprecated': False},\n    'oldap-2.0': {'id': 'OLDAP-2.0', 'deprecated': False},\n    'oldap-2.0.1': {'id': 'OLDAP-2.0.1', 'deprecated': False},\n    'oldap-2.1': {'id': 'OLDAP-2.1', 'deprecated': False},\n    'oldap-2.2': {'id': 'OLDAP-2.2', 'deprecated': False},\n    'oldap-2.2.1': {'id': 'OLDAP-2.2.1', 'deprecated': False},\n    'oldap-2.2.2': {'id': 'OLDAP-2.2.2', 'deprecated': False},\n    'oldap-2.3': {'id': 'OLDAP-2.3', 'deprecated': False},\n    'oldap-2.4': {'id': 'OLDAP-2.4', 'deprecated': False},\n    'oldap-2.5': {'id': 'OLDAP-2.5', 'deprecated': False},\n    'oldap-2.6': {'id': 'OLDAP-2.6', 'deprecated': False},\n    'oldap-2.7': {'id': 'OLDAP-2.7', 'deprecated': False},\n    'oldap-2.8': {'id': 'OLDAP-2.8', 'deprecated': False},\n    'olfl-1.3': {'id': 'OLFL-1.3', 'deprecated': False},\n    'oml': {'id': 'OML', 'deprecated': False},\n    'openpbs-2.3': {'id': 'OpenPBS-2.3', 'deprecated': False},\n    'openssl': {'id': 'OpenSSL', 'deprecated': False},\n    'openssl-standalone': {'id': 'OpenSSL-standalone', 'deprecated': False},\n    'openvision': {'id': 'OpenVision', 'deprecated': False},\n    'opl-1.0': {'id': 'OPL-1.0', 'deprecated': False},\n    'opl-uk-3.0': {'id': 'OPL-UK-3.0', 'deprecated': False},\n    'opubl-1.0': {'id': 'OPUBL-1.0', 'deprecated': False},\n    'oset-pl-2.1': {'id': 'OSET-PL-2.1', 'deprecated': False},\n    'osl-1.0': {'id': 'OSL-1.0', 'deprecated': False},\n    'osl-1.1': {'id': 'OSL-1.1', 'deprecated': False},\n    'osl-2.0': {'id': 'OSL-2.0', 'deprecated': False},\n    'osl-2.1': {'id': 'OSL-2.1', 'deprecated': False},\n    'osl-3.0': {'id': 'OSL-3.0', 'deprecated': False},\n    'padl': {'id': 'PADL', 'deprecated': False},\n    'parity-6.0.0': {'id': 'Parity-6.0.0', 'deprecated': False},\n    'parity-7.0.0': {'id': 'Parity-7.0.0', 'deprecated': False},\n    'pddl-1.0': {'id': 'PDDL-1.0', 'deprecated': False},\n    'php-3.0': {'id': 'PHP-3.0', 'deprecated': False},\n    'php-3.01': {'id': 'PHP-3.01', 'deprecated': False},\n    'pixar': {'id': 'Pixar', 'deprecated': False},\n    'pkgconf': {'id': 'pkgconf', 'deprecated': False},\n    'plexus': {'id': 'Plexus', 'deprecated': False},\n    'pnmstitch': {'id': 'pnmstitch', 'deprecated': False},\n    'polyform-noncommercial-1.0.0': {'id': 'PolyForm-Noncommercial-1.0.0', 'deprecated': False},\n    'polyform-small-business-1.0.0': {'id': 'PolyForm-Small-Business-1.0.0', 'deprecated': False},\n    'postgresql': {'id': 'PostgreSQL', 'deprecated': False},\n    'ppl': {'id': 'PPL', 'deprecated': False},\n    'psf-2.0': {'id': 'PSF-2.0', 'deprecated': False},\n    'psfrag': {'id': 'psfrag', 'deprecated': False},\n    'psutils': {'id': 'psutils', 'deprecated': False},\n    'python-2.0': {'id': 'Python-2.0', 'deprecated': False},\n    'python-2.0.1': {'id': 'Python-2.0.1', 'deprecated': False},\n    'python-ldap': {'id': 'python-ldap', 'deprecated': False},\n    'qhull': {'id': 'Qhull', 'deprecated': False},\n    'qpl-1.0': {'id': 'QPL-1.0', 'deprecated': False},\n    'qpl-1.0-inria-2004': {'id': 'QPL-1.0-INRIA-2004', 'deprecated': False},\n    'radvd': {'id': 'radvd', 'deprecated': False},\n    'rdisc': {'id': 'Rdisc', 'deprecated': False},\n    'rhecos-1.1': {'id': 'RHeCos-1.1', 'deprecated': False},\n    'rpl-1.1': {'id': 'RPL-1.1', 'deprecated': False},\n    'rpl-1.5': {'id': 'RPL-1.5', 'deprecated': False},\n    'rpsl-1.0': {'id': 'RPSL-1.0', 'deprecated': False},\n    'rsa-md': {'id': 'RSA-MD', 'deprecated': False},\n    'rscpl': {'id': 'RSCPL', 'deprecated': False},\n    'ruby': {'id': 'Ruby', 'deprecated': False},\n    'ruby-pty': {'id': 'Ruby-pty', 'deprecated': False},\n    'sax-pd': {'id': 'SAX-PD', 'deprecated': False},\n    'sax-pd-2.0': {'id': 'SAX-PD-2.0', 'deprecated': False},\n    'saxpath': {'id': 'Saxpath', 'deprecated': False},\n    'scea': {'id': 'SCEA', 'deprecated': False},\n    'schemereport': {'id': 'SchemeReport', 'deprecated': False},\n    'sendmail': {'id': 'Sendmail', 'deprecated': False},\n    'sendmail-8.23': {'id': 'Sendmail-8.23', 'deprecated': False},\n    'sgi-b-1.0': {'id': 'SGI-B-1.0', 'deprecated': False},\n    'sgi-b-1.1': {'id': 'SGI-B-1.1', 'deprecated': False},\n    'sgi-b-2.0': {'id': 'SGI-B-2.0', 'deprecated': False},\n    'sgi-opengl': {'id': 'SGI-OpenGL', 'deprecated': False},\n    'sgp4': {'id': 'SGP4', 'deprecated': False},\n    'shl-0.5': {'id': 'SHL-0.5', 'deprecated': False},\n    'shl-0.51': {'id': 'SHL-0.51', 'deprecated': False},\n    'simpl-2.0': {'id': 'SimPL-2.0', 'deprecated': False},\n    'sissl': {'id': 'SISSL', 'deprecated': False},\n    'sissl-1.2': {'id': 'SISSL-1.2', 'deprecated': False},\n    'sl': {'id': 'SL', 'deprecated': False},\n    'sleepycat': {'id': 'Sleepycat', 'deprecated': False},\n    'smlnj': {'id': 'SMLNJ', 'deprecated': False},\n    'smppl': {'id': 'SMPPL', 'deprecated': False},\n    'snia': {'id': 'SNIA', 'deprecated': False},\n    'snprintf': {'id': 'snprintf', 'deprecated': False},\n    'softsurfer': {'id': 'softSurfer', 'deprecated': False},\n    'soundex': {'id': 'Soundex', 'deprecated': False},\n    'spencer-86': {'id': 'Spencer-86', 'deprecated': False},\n    'spencer-94': {'id': 'Spencer-94', 'deprecated': False},\n    'spencer-99': {'id': 'Spencer-99', 'deprecated': False},\n    'spl-1.0': {'id': 'SPL-1.0', 'deprecated': False},\n    'ssh-keyscan': {'id': 'ssh-keyscan', 'deprecated': False},\n    'ssh-openssh': {'id': 'SSH-OpenSSH', 'deprecated': False},\n    'ssh-short': {'id': 'SSH-short', 'deprecated': False},\n    'ssleay-standalone': {'id': 'SSLeay-standalone', 'deprecated': False},\n    'sspl-1.0': {'id': 'SSPL-1.0', 'deprecated': False},\n    'standardml-nj': {'id': 'StandardML-NJ', 'deprecated': True},\n    'sugarcrm-1.1.3': {'id': 'SugarCRM-1.1.3', 'deprecated': False},\n    'sun-ppp': {'id': 'Sun-PPP', 'deprecated': False},\n    'sun-ppp-2000': {'id': 'Sun-PPP-2000', 'deprecated': False},\n    'sunpro': {'id': 'SunPro', 'deprecated': False},\n    'swl': {'id': 'SWL', 'deprecated': False},\n    'swrule': {'id': 'swrule', 'deprecated': False},\n    'symlinks': {'id': 'Symlinks', 'deprecated': False},\n    'tapr-ohl-1.0': {'id': 'TAPR-OHL-1.0', 'deprecated': False},\n    'tcl': {'id': 'TCL', 'deprecated': False},\n    'tcp-wrappers': {'id': 'TCP-wrappers', 'deprecated': False},\n    'termreadkey': {'id': 'TermReadKey', 'deprecated': False},\n    'tgppl-1.0': {'id': 'TGPPL-1.0', 'deprecated': False},\n    'threeparttable': {'id': 'threeparttable', 'deprecated': False},\n    'tmate': {'id': 'TMate', 'deprecated': False},\n    'torque-1.1': {'id': 'TORQUE-1.1', 'deprecated': False},\n    'tosl': {'id': 'TOSL', 'deprecated': False},\n    'tpdl': {'id': 'TPDL', 'deprecated': False},\n    'tpl-1.0': {'id': 'TPL-1.0', 'deprecated': False},\n    'ttwl': {'id': 'TTWL', 'deprecated': False},\n    'ttyp0': {'id': 'TTYP0', 'deprecated': False},\n    'tu-berlin-1.0': {'id': 'TU-Berlin-1.0', 'deprecated': False},\n    'tu-berlin-2.0': {'id': 'TU-Berlin-2.0', 'deprecated': False},\n    'ubuntu-font-1.0': {'id': 'Ubuntu-font-1.0', 'deprecated': False},\n    'ucar': {'id': 'UCAR', 'deprecated': False},\n    'ucl-1.0': {'id': 'UCL-1.0', 'deprecated': False},\n    'ulem': {'id': 'ulem', 'deprecated': False},\n    'umich-merit': {'id': 'UMich-Merit', 'deprecated': False},\n    'unicode-3.0': {'id': 'Unicode-3.0', 'deprecated': False},\n    'unicode-dfs-2015': {'id': 'Unicode-DFS-2015', 'deprecated': False},\n    'unicode-dfs-2016': {'id': 'Unicode-DFS-2016', 'deprecated': False},\n    'unicode-tou': {'id': 'Unicode-TOU', 'deprecated': False},\n    'unixcrypt': {'id': 'UnixCrypt', 'deprecated': False},\n    'unlicense': {'id': 'Unlicense', 'deprecated': False},\n    'upl-1.0': {'id': 'UPL-1.0', 'deprecated': False},\n    'urt-rle': {'id': 'URT-RLE', 'deprecated': False},\n    'vim': {'id': 'Vim', 'deprecated': False},\n    'vostrom': {'id': 'VOSTROM', 'deprecated': False},\n    'vsl-1.0': {'id': 'VSL-1.0', 'deprecated': False},\n    'w3c': {'id': 'W3C', 'deprecated': False},\n    'w3c-19980720': {'id': 'W3C-19980720', 'deprecated': False},\n    'w3c-20150513': {'id': 'W3C-20150513', 'deprecated': False},\n    'w3m': {'id': 'w3m', 'deprecated': False},\n    'watcom-1.0': {'id': 'Watcom-1.0', 'deprecated': False},\n    'widget-workshop': {'id': 'Widget-Workshop', 'deprecated': False},\n    'wsuipa': {'id': 'Wsuipa', 'deprecated': False},\n    'wtfpl': {'id': 'WTFPL', 'deprecated': False},\n    'wxwindows': {'id': 'wxWindows', 'deprecated': True},\n    'x11': {'id': 'X11', 'deprecated': False},\n    'x11-distribute-modifications-variant': {'id': 'X11-distribute-modifications-variant', 'deprecated': False},\n    'x11-swapped': {'id': 'X11-swapped', 'deprecated': False},\n    'xdebug-1.03': {'id': 'Xdebug-1.03', 'deprecated': False},\n    'xerox': {'id': 'Xerox', 'deprecated': False},\n    'xfig': {'id': 'Xfig', 'deprecated': False},\n    'xfree86-1.1': {'id': 'XFree86-1.1', 'deprecated': False},\n    'xinetd': {'id': 'xinetd', 'deprecated': False},\n    'xkeyboard-config-zinoviev': {'id': 'xkeyboard-config-Zinoviev', 'deprecated': False},\n    'xlock': {'id': 'xlock', 'deprecated': False},\n    'xnet': {'id': 'Xnet', 'deprecated': False},\n    'xpp': {'id': 'xpp', 'deprecated': False},\n    'xskat': {'id': 'XSkat', 'deprecated': False},\n    'xzoom': {'id': 'xzoom', 'deprecated': False},\n    'ypl-1.0': {'id': 'YPL-1.0', 'deprecated': False},\n    'ypl-1.1': {'id': 'YPL-1.1', 'deprecated': False},\n    'zed': {'id': 'Zed', 'deprecated': False},\n    'zeeff': {'id': 'Zeeff', 'deprecated': False},\n    'zend-2.0': {'id': 'Zend-2.0', 'deprecated': False},\n    'zimbra-1.3': {'id': 'Zimbra-1.3', 'deprecated': False},\n    'zimbra-1.4': {'id': 'Zimbra-1.4', 'deprecated': False},\n    'zlib': {'id': 'Zlib', 'deprecated': False},\n    'zlib-acknowledgement': {'id': 'zlib-acknowledgement', 'deprecated': False},\n    'zpl-1.1': {'id': 'ZPL-1.1', 'deprecated': False},\n    'zpl-2.0': {'id': 'ZPL-2.0', 'deprecated': False},\n    'zpl-2.1': {'id': 'ZPL-2.1', 'deprecated': False},\n}\n\nEXCEPTIONS: dict[str, SPDXException] = {\n    '389-exception': {'id': '389-exception', 'deprecated': False},\n    'asterisk-exception': {'id': 'Asterisk-exception', 'deprecated': False},\n    'asterisk-linking-protocols-exception': {'id': 'Asterisk-linking-protocols-exception', 'deprecated': False},\n    'autoconf-exception-2.0': {'id': 'Autoconf-exception-2.0', 'deprecated': False},\n    'autoconf-exception-3.0': {'id': 'Autoconf-exception-3.0', 'deprecated': False},\n    'autoconf-exception-generic': {'id': 'Autoconf-exception-generic', 'deprecated': False},\n    'autoconf-exception-generic-3.0': {'id': 'Autoconf-exception-generic-3.0', 'deprecated': False},\n    'autoconf-exception-macro': {'id': 'Autoconf-exception-macro', 'deprecated': False},\n    'bison-exception-1.24': {'id': 'Bison-exception-1.24', 'deprecated': False},\n    'bison-exception-2.2': {'id': 'Bison-exception-2.2', 'deprecated': False},\n    'bootloader-exception': {'id': 'Bootloader-exception', 'deprecated': False},\n    'classpath-exception-2.0': {'id': 'Classpath-exception-2.0', 'deprecated': False},\n    'clisp-exception-2.0': {'id': 'CLISP-exception-2.0', 'deprecated': False},\n    'cryptsetup-openssl-exception': {'id': 'cryptsetup-OpenSSL-exception', 'deprecated': False},\n    'digirule-foss-exception': {'id': 'DigiRule-FOSS-exception', 'deprecated': False},\n    'ecos-exception-2.0': {'id': 'eCos-exception-2.0', 'deprecated': False},\n    'erlang-otp-linking-exception': {'id': 'erlang-otp-linking-exception', 'deprecated': False},\n    'fawkes-runtime-exception': {'id': 'Fawkes-Runtime-exception', 'deprecated': False},\n    'fltk-exception': {'id': 'FLTK-exception', 'deprecated': False},\n    'fmt-exception': {'id': 'fmt-exception', 'deprecated': False},\n    'font-exception-2.0': {'id': 'Font-exception-2.0', 'deprecated': False},\n    'freertos-exception-2.0': {'id': 'freertos-exception-2.0', 'deprecated': False},\n    'gcc-exception-2.0': {'id': 'GCC-exception-2.0', 'deprecated': False},\n    'gcc-exception-2.0-note': {'id': 'GCC-exception-2.0-note', 'deprecated': False},\n    'gcc-exception-3.1': {'id': 'GCC-exception-3.1', 'deprecated': False},\n    'gmsh-exception': {'id': 'Gmsh-exception', 'deprecated': False},\n    'gnat-exception': {'id': 'GNAT-exception', 'deprecated': False},\n    'gnome-examples-exception': {'id': 'GNOME-examples-exception', 'deprecated': False},\n    'gnu-compiler-exception': {'id': 'GNU-compiler-exception', 'deprecated': False},\n    'gnu-javamail-exception': {'id': 'gnu-javamail-exception', 'deprecated': False},\n    'gpl-3.0-interface-exception': {'id': 'GPL-3.0-interface-exception', 'deprecated': False},\n    'gpl-3.0-linking-exception': {'id': 'GPL-3.0-linking-exception', 'deprecated': False},\n    'gpl-3.0-linking-source-exception': {'id': 'GPL-3.0-linking-source-exception', 'deprecated': False},\n    'gpl-cc-1.0': {'id': 'GPL-CC-1.0', 'deprecated': False},\n    'gstreamer-exception-2005': {'id': 'GStreamer-exception-2005', 'deprecated': False},\n    'gstreamer-exception-2008': {'id': 'GStreamer-exception-2008', 'deprecated': False},\n    'i2p-gpl-java-exception': {'id': 'i2p-gpl-java-exception', 'deprecated': False},\n    'kicad-libraries-exception': {'id': 'KiCad-libraries-exception', 'deprecated': False},\n    'lgpl-3.0-linking-exception': {'id': 'LGPL-3.0-linking-exception', 'deprecated': False},\n    'libpri-openh323-exception': {'id': 'libpri-OpenH323-exception', 'deprecated': False},\n    'libtool-exception': {'id': 'Libtool-exception', 'deprecated': False},\n    'linux-syscall-note': {'id': 'Linux-syscall-note', 'deprecated': False},\n    'llgpl': {'id': 'LLGPL', 'deprecated': False},\n    'llvm-exception': {'id': 'LLVM-exception', 'deprecated': False},\n    'lzma-exception': {'id': 'LZMA-exception', 'deprecated': False},\n    'mif-exception': {'id': 'mif-exception', 'deprecated': False},\n    'nokia-qt-exception-1.1': {'id': 'Nokia-Qt-exception-1.1', 'deprecated': True},\n    'ocaml-lgpl-linking-exception': {'id': 'OCaml-LGPL-linking-exception', 'deprecated': False},\n    'occt-exception-1.0': {'id': 'OCCT-exception-1.0', 'deprecated': False},\n    'openjdk-assembly-exception-1.0': {'id': 'OpenJDK-assembly-exception-1.0', 'deprecated': False},\n    'openvpn-openssl-exception': {'id': 'openvpn-openssl-exception', 'deprecated': False},\n    'pcre2-exception': {'id': 'PCRE2-exception', 'deprecated': False},\n    'ps-or-pdf-font-exception-20170817': {'id': 'PS-or-PDF-font-exception-20170817', 'deprecated': False},\n    'qpl-1.0-inria-2004-exception': {'id': 'QPL-1.0-INRIA-2004-exception', 'deprecated': False},\n    'qt-gpl-exception-1.0': {'id': 'Qt-GPL-exception-1.0', 'deprecated': False},\n    'qt-lgpl-exception-1.1': {'id': 'Qt-LGPL-exception-1.1', 'deprecated': False},\n    'qwt-exception-1.0': {'id': 'Qwt-exception-1.0', 'deprecated': False},\n    'romic-exception': {'id': 'romic-exception', 'deprecated': False},\n    'rrdtool-floss-exception-2.0': {'id': 'RRDtool-FLOSS-exception-2.0', 'deprecated': False},\n    'sane-exception': {'id': 'SANE-exception', 'deprecated': False},\n    'shl-2.0': {'id': 'SHL-2.0', 'deprecated': False},\n    'shl-2.1': {'id': 'SHL-2.1', 'deprecated': False},\n    'stunnel-exception': {'id': 'stunnel-exception', 'deprecated': False},\n    'swi-exception': {'id': 'SWI-exception', 'deprecated': False},\n    'swift-exception': {'id': 'Swift-exception', 'deprecated': False},\n    'texinfo-exception': {'id': 'Texinfo-exception', 'deprecated': False},\n    'u-boot-exception-2.0': {'id': 'u-boot-exception-2.0', 'deprecated': False},\n    'ubdl-exception': {'id': 'UBDL-exception', 'deprecated': False},\n    'universal-foss-exception-1.0': {'id': 'Universal-FOSS-exception-1.0', 'deprecated': False},\n    'vsftpd-openssl-exception': {'id': 'vsftpd-openssl-exception', 'deprecated': False},\n    'wxwindows-exception-3.1': {'id': 'WxWindows-exception-3.1', 'deprecated': False},\n    'x11vnc-openssl-exception': {'id': 'x11vnc-openssl-exception', 'deprecated': False},\n}\n",[],[216,809,810,811,890,891,1694,861,1797],"07c527ec-67fc-11f0-9b65-0224a6c84d84","07c528a0-67fc-11f0-9b65-0224a6c84d84",279,["D",1753299260820],"#######################################################################################\n#\n# Adapted from:\n#  https://github.com/pypa/hatch/blob/5352e44/backend/src/hatchling/licenses/parse.py\n#\n# MIT License\n#\n# Copyright (c) 2017-present Ofek Lev \n#\n# Permission is hereby granted, free of charge, to any person obtaining a copy of this\n# software and associated documentation files (the \"Software\"), to deal in the Software\n# without restriction, including without limitation the rights to use, copy, modify,\n# merge, publish, distribute, sublicense, and/or sell copies of the Software, and to\n# permit persons to whom the Software is furnished to do so, subject to the following\n# conditions:\n#\n# The above copyright notice and this permission notice shall be included in all copies\n# or substantial portions of the Software.\n#\n# THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,\n# INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A\n# PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT\n# HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF\n# CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE\n# OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n#\n#\n# With additional allowance of arbitrary `LicenseRef-` identifiers, not just\n# `LicenseRef-Public-Domain` and `LicenseRef-Proprietary`.\n#\n#######################################################################################\nfrom __future__ import annotations\n\nimport re\nfrom typing import NewType, cast\n\nfrom pip._vendor.packaging.licenses._spdx import EXCEPTIONS, LICENSES\n\n__all__ = [\n    \"InvalidLicenseExpression\",\n    \"NormalizedLicenseExpression\",\n    \"canonicalize_license_expression\",\n]\n\nlicense_ref_allowed = re.compile(\"^[A-Za-z0-9.-]*$\")\n\nNormalizedLicenseExpression = NewType(\"NormalizedLicenseExpression\", str)\n\n\nclass InvalidLicenseExpression(ValueError):\n    \"\"\"Raised when a license-expression string is invalid\n\n    >>> canonicalize_license_expression(\"invalid\")\n    Traceback (most recent call last):\n        ...\n    packaging.licenses.InvalidLicenseExpression: Invalid license expression: 'invalid'\n    \"\"\"\n\n\ndef canonicalize_license_expression(\n    raw_license_expression: str,\n) -> NormalizedLicenseExpression:\n    if not raw_license_expression:\n        message = f\"Invalid license expression: {raw_license_expression!r}\"\n        raise InvalidLicenseExpression(message)\n\n    # Pad any parentheses so tokenization can be achieved by merely splitting on\n    # whitespace.\n    license_expression = raw_license_expression.replace(\"(\", \" ( \").replace(\")\", \" ) \")\n    licenseref_prefix = \"LicenseRef-\"\n    license_refs = {\n        ref.lower(): \"LicenseRef-\" + ref[len(licenseref_prefix) :]\n        for ref in license_expression.split()\n        if ref.lower().startswith(licenseref_prefix.lower())\n    }\n\n    # Normalize to lower case so we can look up licenses/exceptions\n    # and so boolean operators are Python-compatible.\n    license_expression = license_expression.lower()\n\n    tokens = license_expression.split()\n\n    # Rather than implementing boolean logic, we create an expression that Python can\n    # parse. Everything that is not involved with the grammar itself is treated as\n    # `False` and the expression should evaluate as such.\n    python_tokens = []\n    for token in tokens:\n        if token not in {\"or\", \"and\", \"with\", \"(\", \")\"}:\n            python_tokens.append(\"False\")\n        elif token == \"with\":\n            python_tokens.append(\"or\")\n        elif token == \"(\" and python_tokens and python_tokens[-1] not in {\"or\", \"and\"}:\n            message = f\"Invalid license expression: {raw_license_expression!r}\"\n            raise InvalidLicenseExpression(message)\n        else:\n            python_tokens.append(token)\n\n    python_expression = \" \".join(python_tokens)\n    try:\n        invalid = eval(python_expression, globals(), locals())\n    except Exception:\n        invalid = True\n\n    if invalid is not False:\n        message = f\"Invalid license expression: {raw_license_expression!r}\"\n        raise InvalidLicenseExpression(message) from None\n\n    # Take a final pass to check for unknown licenses/exceptions.\n    normalized_tokens = []\n    for token in tokens:\n        if token in {\"or\", \"and\", \"with\", \"(\", \")\"}:\n            normalized_tokens.append(token.upper())\n            continue\n\n        if normalized_tokens and normalized_tokens[-1] == \"WITH\":\n            if token not in EXCEPTIONS:\n                message = f\"Unknown license exception: {token!r}\"\n                raise InvalidLicenseExpression(message)\n\n            normalized_tokens.append(EXCEPTIONS[token][\"id\"])\n        else:\n            if token.endswith(\"+\"):\n                final_token = token[:-1]\n                suffix = \"+\"\n            else:\n                final_token = token\n                suffix = \"\"\n\n            if final_token.startswith(\"licenseref-\"):\n                if not license_ref_allowed.match(final_token):\n                    message = f\"Invalid licenseref: {final_token!r}\"\n                    raise InvalidLicenseExpression(message)\n                normalized_tokens.append(license_refs[final_token] + suffix)\n            else:\n                if final_token not in LICENSES:\n                    message = f\"Unknown license: {final_token!r}\"\n                    raise InvalidLicenseExpression(message)\n                normalized_tokens.append(LICENSES[final_token][\"id\"] + suffix)\n\n    normalized_expression = \" \".join(normalized_tokens)\n\n    return cast(\n        NormalizedLicenseExpression,\n        normalized_expression.replace(\"( \", \"(\").replace(\" )\", \")\"),\n    )\n",[],[216,809,810,811,890,891,1694,861,893],"ffbb102a-67fb-11f0-9f6f-0224a6c84d84",94,["D",1753299247332],[494,495],[216,809,810,811,890,891,1694,861],"fd686c46-67fb-11f0-bf1a-0224a6c84d84",70,["D",1753299243434],[493,496,497,498,499,500,501,502,503,504,505,506,507,508,509],[216,809,810,811,890,891,1694],"083dbd24-67fc-11f0-9ab6-0224a6c84d84","fallback.py","083dbdec-67fc-11f0-9ab6-0224a6c84d84","fd98684c-67fb-11f0-928e-0224a6c84d84",300,["D",1753299261610],"\"\"\"Fallback pure Python implementation of msgpack\"\"\"\n\nimport struct\nimport sys\nfrom datetime import datetime as _DateTime\n\nif hasattr(sys, \"pypy_version_info\"):\n    from __pypy__ import newlist_hint\n    from __pypy__.builders import BytesBuilder\n\n    _USING_STRINGBUILDER = True\n\n    class BytesIO:\n        def __init__(self, s=b\"\"):\n            if s:\n                self.builder = BytesBuilder(len(s))\n                self.builder.append(s)\n            else:\n                self.builder = BytesBuilder()\n\n        def write(self, s):\n            if isinstance(s, memoryview):\n                s = s.tobytes()\n            elif isinstance(s, bytearray):\n                s = bytes(s)\n            self.builder.append(s)\n\n        def getvalue(self):\n            return self.builder.build()\n\nelse:\n    from io import BytesIO\n\n    _USING_STRINGBUILDER = False\n\n    def newlist_hint(size):\n        return []\n\n\nfrom .exceptions import BufferFull, ExtraData, FormatError, OutOfData, StackError\nfrom .ext import ExtType, Timestamp\n\nEX_SKIP = 0\nEX_CONSTRUCT = 1\nEX_READ_ARRAY_HEADER = 2\nEX_READ_MAP_HEADER = 3\n\nTYPE_IMMEDIATE = 0\nTYPE_ARRAY = 1\nTYPE_MAP = 2\nTYPE_RAW = 3\nTYPE_BIN = 4\nTYPE_EXT = 5\n\nDEFAULT_RECURSE_LIMIT = 511\n\n\ndef _check_type_strict(obj, t, type=type, tuple=tuple):\n    if type(t) is tuple:\n        return type(obj) in t\n    else:\n        return type(obj) is t\n\n\ndef _get_data_from_buffer(obj):\n    view = memoryview(obj)\n    if view.itemsize != 1:\n        raise ValueError(\"cannot unpack from multi-byte object\")\n    return view\n\n\ndef unpackb(packed, **kwargs):\n    \"\"\"\n    Unpack an object from `packed`.\n\n    Raises ``ExtraData`` when *packed* contains extra bytes.\n    Raises ``ValueError`` when *packed* is incomplete.\n    Raises ``FormatError`` when *packed* is not valid msgpack.\n    Raises ``StackError`` when *packed* contains too nested.\n    Other exceptions can be raised during unpacking.\n\n    See :class:`Unpacker` for options.\n    \"\"\"\n    unpacker = Unpacker(None, max_buffer_size=len(packed), **kwargs)\n    unpacker.feed(packed)\n    try:\n        ret = unpacker._unpack()\n    except OutOfData:\n        raise ValueError(\"Unpack failed: incomplete input\")\n    except RecursionError:\n        raise StackError\n    if unpacker._got_extradata():\n        raise ExtraData(ret, unpacker._get_extradata())\n    return ret\n\n\n_NO_FORMAT_USED = \"\"\n_MSGPACK_HEADERS = {\n    0xC4: (1, _NO_FORMAT_USED, TYPE_BIN),\n    0xC5: (2, \">H\", TYPE_BIN),\n    0xC6: (4, \">I\", TYPE_BIN),\n    0xC7: (2, \"Bb\", TYPE_EXT),\n    0xC8: (3, \">Hb\", TYPE_EXT),\n    0xC9: (5, \">Ib\", TYPE_EXT),\n    0xCA: (4, \">f\"),\n    0xCB: (8, \">d\"),\n    0xCC: (1, _NO_FORMAT_USED),\n    0xCD: (2, \">H\"),\n    0xCE: (4, \">I\"),\n    0xCF: (8, \">Q\"),\n    0xD0: (1, \"b\"),\n    0xD1: (2, \">h\"),\n    0xD2: (4, \">i\"),\n    0xD3: (8, \">q\"),\n    0xD4: (1, \"b1s\", TYPE_EXT),\n    0xD5: (2, \"b2s\", TYPE_EXT),\n    0xD6: (4, \"b4s\", TYPE_EXT),\n    0xD7: (8, \"b8s\", TYPE_EXT),\n    0xD8: (16, \"b16s\", TYPE_EXT),\n    0xD9: (1, _NO_FORMAT_USED, TYPE_RAW),\n    0xDA: (2, \">H\", TYPE_RAW),\n    0xDB: (4, \">I\", TYPE_RAW),\n    0xDC: (2, \">H\", TYPE_ARRAY),\n    0xDD: (4, \">I\", TYPE_ARRAY),\n    0xDE: (2, \">H\", TYPE_MAP),\n    0xDF: (4, \">I\", TYPE_MAP),\n}\n\n\nclass Unpacker:\n    \"\"\"Streaming unpacker.\n\n    Arguments:\n\n    :param file_like:\n        File-like object having `.read(n)` method.\n        If specified, unpacker reads serialized data from it and `.feed()` is not usable.\n\n    :param int read_size:\n        Used as `file_like.read(read_size)`. (default: `min(16*1024, max_buffer_size)`)\n\n    :param bool use_list:\n        If true, unpack msgpack array to Python list.\n        Otherwise, unpack to Python tuple. (default: True)\n\n    :param bool raw:\n        If true, unpack msgpack raw to Python bytes.\n        Otherwise, unpack to Python str by decoding with UTF-8 encoding (default).\n\n    :param int timestamp:\n        Control how timestamp type is unpacked:\n\n            0 - Timestamp\n            1 - float  (Seconds from the EPOCH)\n            2 - int  (Nanoseconds from the EPOCH)\n            3 - datetime.datetime  (UTC).\n\n    :param bool strict_map_key:\n        If true (default), only str or bytes are accepted for map (dict) keys.\n\n    :param object_hook:\n        When specified, it should be callable.\n        Unpacker calls it with a dict argument after unpacking msgpack map.\n        (See also simplejson)\n\n    :param object_pairs_hook:\n        When specified, it should be callable.\n        Unpacker calls it with a list of key-value pairs after unpacking msgpack map.\n        (See also simplejson)\n\n    :param str unicode_errors:\n        The error handler for decoding unicode. (default: 'strict')\n        This option should be used only when you have msgpack data which\n        contains invalid UTF-8 string.\n\n    :param int max_buffer_size:\n        Limits size of data waiting unpacked.  0 means 2**32-1.\n        The default value is 100*1024*1024 (100MiB).\n        Raises `BufferFull` exception when it is insufficient.\n        You should set this parameter when unpacking data from untrusted source.\n\n    :param int max_str_len:\n        Deprecated, use *max_buffer_size* instead.\n        Limits max length of str. (default: max_buffer_size)\n\n    :param int max_bin_len:\n        Deprecated, use *max_buffer_size* instead.\n        Limits max length of bin. (default: max_buffer_size)\n\n    :param int max_array_len:\n        Limits max length of array.\n        (default: max_buffer_size)\n\n    :param int max_map_len:\n        Limits max length of map.\n        (default: max_buffer_size//2)\n\n    :param int max_ext_len:\n        Deprecated, use *max_buffer_size* instead.\n        Limits max size of ext type.  (default: max_buffer_size)\n\n    Example of streaming deserialize from file-like object::\n\n        unpacker = Unpacker(file_like)\n        for o in unpacker:\n            process(o)\n\n    Example of streaming deserialize from socket::\n\n        unpacker = Unpacker()\n        while True:\n            buf = sock.recv(1024**2)\n            if not buf:\n                break\n            unpacker.feed(buf)\n            for o in unpacker:\n                process(o)\n\n    Raises ``ExtraData`` when *packed* contains extra bytes.\n    Raises ``OutOfData`` when *packed* is incomplete.\n    Raises ``FormatError`` when *packed* is not valid msgpack.\n    Raises ``StackError`` when *packed* contains too nested.\n    Other exceptions can be raised during unpacking.\n    \"\"\"\n\n    def __init__(\n        self,\n        file_like=None,\n        *,\n        read_size=0,\n        use_list=True,\n        raw=False,\n        timestamp=0,\n        strict_map_key=True,\n        object_hook=None,\n        object_pairs_hook=None,\n        list_hook=None,\n        unicode_errors=None,\n        max_buffer_size=100 * 1024 * 1024,\n        ext_hook=ExtType,\n        max_str_len=-1,\n        max_bin_len=-1,\n        max_array_len=-1,\n        max_map_len=-1,\n        max_ext_len=-1,\n    ):\n        if unicode_errors is None:\n            unicode_errors = \"strict\"\n\n        if file_like is None:\n            self._feeding = True\n        else:\n            if not callable(file_like.read):\n                raise TypeError(\"`file_like.read` must be callable\")\n            self.file_like = file_like\n            self._feeding = False\n\n        #: array of bytes fed.\n        self._buffer = bytearray()\n        #: Which position we currently reads\n        self._buff_i = 0\n\n        # When Unpacker is used as an iterable, between the calls to next(),\n        # the buffer is not \"consumed\" completely, for efficiency sake.\n        # Instead, it is done sloppily.  To make sure we raise BufferFull at\n        # the correct moments, we have to keep track of how sloppy we were.\n        # Furthermore, when the buffer is incomplete (that is: in the case\n        # we raise an OutOfData) we need to rollback the buffer to the correct\n        # state, which _buf_checkpoint records.\n        self._buf_checkpoint = 0\n\n        if not max_buffer_size:\n            max_buffer_size = 2**31 - 1\n        if max_str_len == -1:\n            max_str_len = max_buffer_size\n        if max_bin_len == -1:\n            max_bin_len = max_buffer_size\n        if max_array_len == -1:\n            max_array_len = max_buffer_size\n        if max_map_len == -1:\n            max_map_len = max_buffer_size // 2\n        if max_ext_len == -1:\n            max_ext_len = max_buffer_size\n\n        self._max_buffer_size = max_buffer_size\n        if read_size > self._max_buffer_size:\n            raise ValueError(\"read_size must be smaller than max_buffer_size\")\n        self._read_size = read_size or min(self._max_buffer_size, 16 * 1024)\n        self._raw = bool(raw)\n        self._strict_map_key = bool(strict_map_key)\n        self._unicode_errors = unicode_errors\n        self._use_list = use_list\n        if not (0 <= timestamp <= 3):\n            raise ValueError(\"timestamp must be 0..3\")\n        self._timestamp = timestamp\n        self._list_hook = list_hook\n        self._object_hook = object_hook\n        self._object_pairs_hook = object_pairs_hook\n        self._ext_hook = ext_hook\n        self._max_str_len = max_str_len\n        self._max_bin_len = max_bin_len\n        self._max_array_len = max_array_len\n        self._max_map_len = max_map_len\n        self._max_ext_len = max_ext_len\n        self._stream_offset = 0\n\n        if list_hook is not None and not callable(list_hook):\n            raise TypeError(\"`list_hook` is not callable\")\n        if object_hook is not None and not callable(object_hook):\n            raise TypeError(\"`object_hook` is not callable\")\n        if object_pairs_hook is not None and not callable(object_pairs_hook):\n            raise TypeError(\"`object_pairs_hook` is not callable\")\n        if object_hook is not None and object_pairs_hook is not None:\n            raise TypeError(\"object_pairs_hook and object_hook are mutually exclusive\")\n        if not callable(ext_hook):\n            raise TypeError(\"`ext_hook` is not callable\")\n\n    def feed(self, next_bytes):\n        assert self._feeding\n        view = _get_data_from_buffer(next_bytes)\n        if len(self._buffer) - self._buff_i + len(view) > self._max_buffer_size:\n            raise BufferFull\n\n        # Strip buffer before checkpoint before reading file.\n        if self._buf_checkpoint > 0:\n            del self._buffer[: self._buf_checkpoint]\n            self._buff_i -= self._buf_checkpoint\n            self._buf_checkpoint = 0\n\n        # Use extend here: INPLACE_ADD += doesn't reliably typecast memoryview in jython\n        self._buffer.extend(view)\n        view.release()\n\n    def _consume(self):\n        \"\"\"Gets rid of the used parts of the buffer.\"\"\"\n        self._stream_offset += self._buff_i - self._buf_checkpoint\n        self._buf_checkpoint = self._buff_i\n\n    def _got_extradata(self):\n        return self._buff_i < len(self._buffer)\n\n    def _get_extradata(self):\n        return self._buffer[self._buff_i :]\n\n    def read_bytes(self, n):\n        ret = self._read(n, raise_outofdata=False)\n        self._consume()\n        return ret\n\n    def _read(self, n, raise_outofdata=True):\n        # (int) -> bytearray\n        self._reserve(n, raise_outofdata=raise_outofdata)\n        i = self._buff_i\n        ret = self._buffer[i : i + n]\n        self._buff_i = i + len(ret)\n        return ret\n\n    def _reserve(self, n, raise_outofdata=True):\n        remain_bytes = len(self._buffer) - self._buff_i - n\n\n        # Fast path: buffer has n bytes already\n        if remain_bytes >= 0:\n            return\n\n        if self._feeding:\n            self._buff_i = self._buf_checkpoint\n            raise OutOfData\n\n        # Strip buffer before checkpoint before reading file.\n        if self._buf_checkpoint > 0:\n            del self._buffer[: self._buf_checkpoint]\n            self._buff_i -= self._buf_checkpoint\n            self._buf_checkpoint = 0\n\n        # Read from file\n        remain_bytes = -remain_bytes\n        if remain_bytes + len(self._buffer) > self._max_buffer_size:\n            raise BufferFull\n        while remain_bytes > 0:\n            to_read_bytes = max(self._read_size, remain_bytes)\n            read_data = self.file_like.read(to_read_bytes)\n            if not read_data:\n                break\n            assert isinstance(read_data, bytes)\n            self._buffer += read_data\n            remain_bytes -= len(read_data)\n\n        if len(self._buffer) < n + self._buff_i and raise_outofdata:\n            self._buff_i = 0  # rollback\n            raise OutOfData\n\n    def _read_header(self):\n        typ = TYPE_IMMEDIATE\n        n = 0\n        obj = None\n        self._reserve(1)\n        b = self._buffer[self._buff_i]\n        self._buff_i += 1\n        if b & 0b10000000 == 0:\n            obj = b\n        elif b & 0b11100000 == 0b11100000:\n            obj = -1 - (b ^ 0xFF)\n        elif b & 0b11100000 == 0b10100000:\n            n = b & 0b00011111\n            typ = TYPE_RAW\n            if n > self._max_str_len:\n                raise ValueError(f\"{n} exceeds max_str_len({self._max_str_len})\")\n            obj = self._read(n)\n        elif b & 0b11110000 == 0b10010000:\n            n = b & 0b00001111\n            typ = TYPE_ARRAY\n            if n > self._max_array_len:\n                raise ValueError(f\"{n} exceeds max_array_len({self._max_array_len})\")\n        elif b & 0b11110000 == 0b10000000:\n            n = b & 0b00001111\n            typ = TYPE_MAP\n            if n > self._max_map_len:\n                raise ValueError(f\"{n} exceeds max_map_len({self._max_map_len})\")\n        elif b == 0xC0:\n            obj = None\n        elif b == 0xC2:\n            obj = False\n        elif b == 0xC3:\n            obj = True\n        elif 0xC4 <= b <= 0xC6:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            if len(fmt) > 0:\n                n = struct.unpack_from(fmt, self._buffer, self._buff_i)[0]\n            else:\n                n = self._buffer[self._buff_i]\n            self._buff_i += size\n            if n > self._max_bin_len:\n                raise ValueError(f\"{n} exceeds max_bin_len({self._max_bin_len})\")\n            obj = self._read(n)\n        elif 0xC7 <= b <= 0xC9:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            L, n = struct.unpack_from(fmt, self._buffer, self._buff_i)\n            self._buff_i += size\n            if L > self._max_ext_len:\n                raise ValueError(f\"{L} exceeds max_ext_len({self._max_ext_len})\")\n            obj = self._read(L)\n        elif 0xCA <= b <= 0xD3:\n            size, fmt = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            if len(fmt) > 0:\n                obj = struct.unpack_from(fmt, self._buffer, self._buff_i)[0]\n            else:\n                obj = self._buffer[self._buff_i]\n            self._buff_i += size\n        elif 0xD4 <= b <= 0xD8:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            if self._max_ext_len < size:\n                raise ValueError(f\"{size} exceeds max_ext_len({self._max_ext_len})\")\n            self._reserve(size + 1)\n            n, obj = struct.unpack_from(fmt, self._buffer, self._buff_i)\n            self._buff_i += size + 1\n        elif 0xD9 <= b <= 0xDB:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            if len(fmt) > 0:\n                (n,) = struct.unpack_from(fmt, self._buffer, self._buff_i)\n            else:\n                n = self._buffer[self._buff_i]\n            self._buff_i += size\n            if n > self._max_str_len:\n                raise ValueError(f\"{n} exceeds max_str_len({self._max_str_len})\")\n            obj = self._read(n)\n        elif 0xDC <= b <= 0xDD:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            (n,) = struct.unpack_from(fmt, self._buffer, self._buff_i)\n            self._buff_i += size\n            if n > self._max_array_len:\n                raise ValueError(f\"{n} exceeds max_array_len({self._max_array_len})\")\n        elif 0xDE <= b <= 0xDF:\n            size, fmt, typ = _MSGPACK_HEADERS[b]\n            self._reserve(size)\n            (n,) = struct.unpack_from(fmt, self._buffer, self._buff_i)\n            self._buff_i += size\n            if n > self._max_map_len:\n                raise ValueError(f\"{n} exceeds max_map_len({self._max_map_len})\")\n        else:\n            raise FormatError(\"Unknown header: 0x%x\" % b)\n        return typ, n, obj\n\n    def _unpack(self, execute=EX_CONSTRUCT):\n        typ, n, obj = self._read_header()\n\n        if execute == EX_READ_ARRAY_HEADER:\n            if typ != TYPE_ARRAY:\n                raise ValueError(\"Expected array\")\n            return n\n        if execute == EX_READ_MAP_HEADER:\n            if typ != TYPE_MAP:\n                raise ValueError(\"Expected map\")\n            return n\n        # TODO should we eliminate the recursion?\n        if typ == TYPE_ARRAY:\n            if execute == EX_SKIP:\n                for i in range(n):\n                    # TODO check whether we need to call `list_hook`\n                    self._unpack(EX_SKIP)\n                return\n            ret = newlist_hint(n)\n            for i in range(n):\n                ret.append(self._unpack(EX_CONSTRUCT))\n            if self._list_hook is not None:\n                ret = self._list_hook(ret)\n            # TODO is the interaction between `list_hook` and `use_list` ok?\n            return ret if self._use_list else tuple(ret)\n        if typ == TYPE_MAP:\n            if execute == EX_SKIP:\n                for i in range(n):\n                    # TODO check whether we need to call hooks\n                    self._unpack(EX_SKIP)\n                    self._unpack(EX_SKIP)\n                return\n            if self._object_pairs_hook is not None:\n                ret = self._object_pairs_hook(\n                    (self._unpack(EX_CONSTRUCT), self._unpack(EX_CONSTRUCT)) for _ in range(n)\n                )\n            else:\n                ret = {}\n                for _ in range(n):\n                    key = self._unpack(EX_CONSTRUCT)\n                    if self._strict_map_key and type(key) not in (str, bytes):\n                        raise ValueError(\"%s is not allowed for map key\" % str(type(key)))\n                    if isinstance(key, str):\n                        key = sys.intern(key)\n                    ret[key] = self._unpack(EX_CONSTRUCT)\n                if self._object_hook is not None:\n                    ret = self._object_hook(ret)\n            return ret\n        if execute == EX_SKIP:\n            return\n        if typ == TYPE_RAW:\n            if self._raw:\n                obj = bytes(obj)\n            else:\n                obj = obj.decode(\"utf_8\", self._unicode_errors)\n            return obj\n        if typ == TYPE_BIN:\n            return bytes(obj)\n        if typ == TYPE_EXT:\n            if n == -1:  # timestamp\n                ts = Timestamp.from_bytes(bytes(obj))\n                if self._timestamp == 1:\n                    return ts.to_unix()\n                elif self._timestamp == 2:\n                    return ts.to_unix_nano()\n                elif self._timestamp == 3:\n                    return ts.to_datetime()\n                else:\n                    return ts\n            else:\n                return self._ext_hook(n, bytes(obj))\n        assert typ == TYPE_IMMEDIATE\n        return obj\n\n    def __iter__(self):\n        return self\n\n    def __next__(self):\n        try:\n            ret = self._unpack(EX_CONSTRUCT)\n            self._consume()\n            return ret\n        except OutOfData:\n            self._consume()\n            raise StopIteration\n        except RecursionError:\n            raise StackError\n\n    next = __next__\n\n    def skip(self):\n        self._unpack(EX_SKIP)\n        self._consume()\n\n    def unpack(self):\n        try:\n            ret = self._unpack(EX_CONSTRUCT)\n        except RecursionError:\n            raise StackError\n        self._consume()\n        return ret\n\n    def read_array_header(self):\n        ret = self._unpack(EX_READ_ARRAY_HEADER)\n        self._consume()\n        return ret\n\n    def read_map_header(self):\n        ret = self._unpack(EX_READ_MAP_HEADER)\n        self._consume()\n        return ret\n\n    def tell(self):\n        return self._stream_offset\n\n\nclass Packer:\n    \"\"\"\n    MessagePack Packer\n\n    Usage::\n\n        packer = Packer()\n        astream.write(packer.pack(a))\n        astream.write(packer.pack(b))\n\n    Packer's constructor has some keyword arguments:\n\n    :param default:\n        When specified, it should be callable.\n        Convert user type to builtin type that Packer supports.\n        See also simplejson's document.\n\n    :param bool use_single_float:\n        Use single precision float type for float. (default: False)\n\n    :param bool autoreset:\n        Reset buffer after each pack and return its content as `bytes`. (default: True).\n        If set this to false, use `bytes()` to get content and `.reset()` to clear buffer.\n\n    :param bool use_bin_type:\n        Use bin type introduced in msgpack spec 2.0 for bytes.\n        It also enables str8 type for unicode. (default: True)\n\n    :param bool strict_types:\n        If set to true, types will be checked to be exact. Derived classes\n        from serializable types will not be serialized and will be\n        treated as unsupported type and forwarded to default.\n        Additionally tuples will not be serialized as lists.\n        This is useful when trying to implement accurate serialization\n        for python types.\n\n    :param bool datetime:\n        If set to true, datetime with tzinfo is packed into Timestamp type.\n        Note that the tzinfo is stripped in the timestamp.\n        You can get UTC datetime with `timestamp=3` option of the Unpacker.\n\n    :param str unicode_errors:\n        The error handler for encoding unicode. (default: 'strict')\n        DO NOT USE THIS!!  This option is kept for very specific usage.\n\n    :param int buf_size:\n        Internal buffer size. This option is used only for C implementation.\n    \"\"\"\n\n    def __init__(\n        self,\n        *,\n        default=None,\n        use_single_float=False,\n        autoreset=True,\n        use_bin_type=True,\n        strict_types=False,\n        datetime=False,\n        unicode_errors=None,\n        buf_size=None,\n    ):\n        self._strict_types = strict_types\n        self._use_float = use_single_float\n        self._autoreset = autoreset\n        self._use_bin_type = use_bin_type\n        self._buffer = BytesIO()\n        self._datetime = bool(datetime)\n        self._unicode_errors = unicode_errors or \"strict\"\n        if default is not None and not callable(default):\n            raise TypeError(\"default must be callable\")\n        self._default = default\n\n    def _pack(\n        self,\n        obj,\n        nest_limit=DEFAULT_RECURSE_LIMIT,\n        check=isinstance,\n        check_type_strict=_check_type_strict,\n    ):\n        default_used = False\n        if self._strict_types:\n            check = check_type_strict\n            list_types = list\n        else:\n            list_types = (list, tuple)\n        while True:\n            if nest_limit < 0:\n                raise ValueError(\"recursion limit exceeded\")\n            if obj is None:\n                return self._buffer.write(b\"\\xc0\")\n            if check(obj, bool):\n                if obj:\n                    return self._buffer.write(b\"\\xc3\")\n                return self._buffer.write(b\"\\xc2\")\n            if check(obj, int):\n                if 0 <= obj < 0x80:\n                    return self._buffer.write(struct.pack(\"B\", obj))\n                if -0x20 <= obj < 0:\n                    return self._buffer.write(struct.pack(\"b\", obj))\n                if 0x80 <= obj <= 0xFF:\n                    return self._buffer.write(struct.pack(\"BB\", 0xCC, obj))\n                if -0x80 <= obj < 0:\n                    return self._buffer.write(struct.pack(\">Bb\", 0xD0, obj))\n                if 0xFF < obj <= 0xFFFF:\n                    return self._buffer.write(struct.pack(\">BH\", 0xCD, obj))\n                if -0x8000 <= obj < -0x80:\n                    return self._buffer.write(struct.pack(\">Bh\", 0xD1, obj))\n                if 0xFFFF < obj <= 0xFFFFFFFF:\n                    return self._buffer.write(struct.pack(\">BI\", 0xCE, obj))\n                if -0x80000000 <= obj < -0x8000:\n                    return self._buffer.write(struct.pack(\">Bi\", 0xD2, obj))\n                if 0xFFFFFFFF < obj <= 0xFFFFFFFFFFFFFFFF:\n                    return self._buffer.write(struct.pack(\">BQ\", 0xCF, obj))\n                if -0x8000000000000000 <= obj < -0x80000000:\n                    return self._buffer.write(struct.pack(\">Bq\", 0xD3, obj))\n                if not default_used and self._default is not None:\n                    obj = self._default(obj)\n                    default_used = True\n                    continue\n                raise OverflowError(\"Integer value out of range\")\n            if check(obj, (bytes, bytearray)):\n                n = len(obj)\n                if n >= 2**32:\n                    raise ValueError(\"%s is too large\" % type(obj).__name__)\n                self._pack_bin_header(n)\n                return self._buffer.write(obj)\n            if check(obj, str):\n                obj = obj.encode(\"utf-8\", self._unicode_errors)\n                n = len(obj)\n                if n >= 2**32:\n                    raise ValueError(\"String is too large\")\n                self._pack_raw_header(n)\n                return self._buffer.write(obj)\n            if check(obj, memoryview):\n                n = obj.nbytes\n                if n >= 2**32:\n                    raise ValueError(\"Memoryview is too large\")\n                self._pack_bin_header(n)\n                return self._buffer.write(obj)\n            if check(obj, float):\n                if self._use_float:\n                    return self._buffer.write(struct.pack(\">Bf\", 0xCA, obj))\n                return self._buffer.write(struct.pack(\">Bd\", 0xCB, obj))\n            if check(obj, (ExtType, Timestamp)):\n                if check(obj, Timestamp):\n                    code = -1\n                    data = obj.to_bytes()\n                else:\n                    code = obj.code\n                    data = obj.data\n                assert isinstance(code, int)\n                assert isinstance(data, bytes)\n                L = len(data)\n                if L == 1:\n                    self._buffer.write(b\"\\xd4\")\n                elif L == 2:\n                    self._buffer.write(b\"\\xd5\")\n                elif L == 4:\n                    self._buffer.write(b\"\\xd6\")\n                elif L == 8:\n                    self._buffer.write(b\"\\xd7\")\n                elif L == 16:\n                    self._buffer.write(b\"\\xd8\")\n                elif L <= 0xFF:\n                    self._buffer.write(struct.pack(\">BB\", 0xC7, L))\n                elif L <= 0xFFFF:\n                    self._buffer.write(struct.pack(\">BH\", 0xC8, L))\n                else:\n                    self._buffer.write(struct.pack(\">BI\", 0xC9, L))\n                self._buffer.write(struct.pack(\"b\", code))\n                self._buffer.write(data)\n                return\n            if check(obj, list_types):\n                n = len(obj)\n                self._pack_array_header(n)\n                for i in range(n):\n                    self._pack(obj[i], nest_limit - 1)\n                return\n            if check(obj, dict):\n                return self._pack_map_pairs(len(obj), obj.items(), nest_limit - 1)\n\n            if self._datetime and check(obj, _DateTime) and obj.tzinfo is not None:\n                obj = Timestamp.from_datetime(obj)\n                default_used = 1\n                continue\n\n            if not default_used and self._default is not None:\n                obj = self._default(obj)\n                default_used = 1\n                continue\n\n            if self._datetime and check(obj, _DateTime):\n                raise ValueError(f\"Cannot serialize {obj!r} where tzinfo=None\")\n\n            raise TypeError(f\"Cannot serialize {obj!r}\")\n\n    def pack(self, obj):\n        try:\n            self._pack(obj)\n        except:\n            self._buffer = BytesIO()  # force reset\n            raise\n        if self._autoreset:\n            ret = self._buffer.getvalue()\n            self._buffer = BytesIO()\n            return ret\n\n    def pack_map_pairs(self, pairs):\n        self._pack_map_pairs(len(pairs), pairs)\n        if self._autoreset:\n            ret = self._buffer.getvalue()\n            self._buffer = BytesIO()\n            return ret\n\n    def pack_array_header(self, n):\n        if n >= 2**32:\n            raise ValueError\n        self._pack_array_header(n)\n        if self._autoreset:\n            ret = self._buffer.getvalue()\n            self._buffer = BytesIO()\n            return ret\n\n    def pack_map_header(self, n):\n        if n >= 2**32:\n            raise ValueError\n        self._pack_map_header(n)\n        if self._autoreset:\n            ret = self._buffer.getvalue()\n            self._buffer = BytesIO()\n            return ret\n\n    def pack_ext_type(self, typecode, data):\n        if not isinstance(typecode, int):\n            raise TypeError(\"typecode must have int type.\")\n        if not 0 <= typecode <= 127:\n            raise ValueError(\"typecode should be 0-127\")\n        if not isinstance(data, bytes):\n            raise TypeError(\"data must have bytes type\")\n        L = len(data)\n        if L > 0xFFFFFFFF:\n            raise ValueError(\"Too large data\")\n        if L == 1:\n            self._buffer.write(b\"\\xd4\")\n        elif L == 2:\n            self._buffer.write(b\"\\xd5\")\n        elif L == 4:\n            self._buffer.write(b\"\\xd6\")\n        elif L == 8:\n            self._buffer.write(b\"\\xd7\")\n        elif L == 16:\n            self._buffer.write(b\"\\xd8\")\n        elif L <= 0xFF:\n            self._buffer.write(b\"\\xc7\" + struct.pack(\"B\", L))\n        elif L <= 0xFFFF:\n            self._buffer.write(b\"\\xc8\" + struct.pack(\">H\", L))\n        else:\n            self._buffer.write(b\"\\xc9\" + struct.pack(\">I\", L))\n        self._buffer.write(struct.pack(\"B\", typecode))\n        self._buffer.write(data)\n\n    def _pack_array_header(self, n):\n        if n <= 0x0F:\n            return self._buffer.write(struct.pack(\"B\", 0x90 + n))\n        if n <= 0xFFFF:\n            return self._buffer.write(struct.pack(\">BH\", 0xDC, n))\n        if n <= 0xFFFFFFFF:\n            return self._buffer.write(struct.pack(\">BI\", 0xDD, n))\n        raise ValueError(\"Array is too large\")\n\n    def _pack_map_header(self, n):\n        if n <= 0x0F:\n            return self._buffer.write(struct.pack(\"B\", 0x80 + n))\n        if n <= 0xFFFF:\n            return self._buffer.write(struct.pack(\">BH\", 0xDE, n))\n        if n <= 0xFFFFFFFF:\n            return self._buffer.write(struct.pack(\">BI\", 0xDF, n))\n        raise ValueError(\"Dict is too large\")\n\n    def _pack_map_pairs(self, n, pairs, nest_limit=DEFAULT_RECURSE_LIMIT):\n        self._pack_map_header(n)\n        for k, v in pairs:\n            self._pack(k, nest_limit - 1)\n            self._pack(v, nest_limit - 1)\n\n    def _pack_raw_header(self, n):\n        if n <= 0x1F:\n            self._buffer.write(struct.pack(\"B\", 0xA0 + n))\n        elif self._use_bin_type and n <= 0xFF:\n            self._buffer.write(struct.pack(\">BB\", 0xD9, n))\n        elif n <= 0xFFFF:\n            self._buffer.write(struct.pack(\">BH\", 0xDA, n))\n        elif n <= 0xFFFFFFFF:\n            self._buffer.write(struct.pack(\">BI\", 0xDB, n))\n        else:\n            raise ValueError(\"Raw is too large\")\n\n    def _pack_bin_header(self, n):\n        if not self._use_bin_type:\n            return self._pack_raw_header(n)\n        elif n <= 0xFF:\n            return self._buffer.write(struct.pack(\">BB\", 0xC4, n))\n        elif n <= 0xFFFF:\n            return self._buffer.write(struct.pack(\">BH\", 0xC5, n))\n        elif n <= 0xFFFFFFFF:\n            return self._buffer.write(struct.pack(\">BI\", 0xC6, n))\n        else:\n            raise ValueError(\"Bin is too large\")\n\n    def bytes(self):\n        \"\"\"Return internal buffer contents as bytes object\"\"\"\n        return self._buffer.getvalue()\n\n    def reset(self):\n        \"\"\"Reset internal buffer.\n\n        This method is useful only when autoreset=False.\n        \"\"\"\n        self._buffer = BytesIO()\n\n    def getbuffer(self):\n        \"\"\"Return view of internal buffer.\"\"\"\n        if _USING_STRINGBUILDER:\n            return memoryview(self.bytes())\n        else:\n            return self._buffer.getbuffer()\n",[],[216,809,810,811,890,891,1831,1823],"msgpack","084379b2-67fc-11f0-9b65-0224a6c84d84","ext.py","08437aa2-67fc-11f0-9b65-0224a6c84d84",301,["D",1753299261646],"import datetime\nimport struct\nfrom collections import namedtuple\n\n\nclass ExtType(namedtuple(\"ExtType\", \"code data\")):\n    \"\"\"ExtType represents ext type in msgpack.\"\"\"\n\n    def __new__(cls, code, data):\n        if not isinstance(code, int):\n            raise TypeError(\"code must be int\")\n        if not isinstance(data, bytes):\n            raise TypeError(\"data must be bytes\")\n        if not 0 <= code <= 127:\n            raise ValueError(\"code must be 0~127\")\n        return super().__new__(cls, code, data)\n\n\nclass Timestamp:\n    \"\"\"Timestamp represents the Timestamp extension type in msgpack.\n\n    When built with Cython, msgpack uses C methods to pack and unpack `Timestamp`.\n    When using pure-Python msgpack, :func:`to_bytes` and :func:`from_bytes` are used to pack and\n    unpack `Timestamp`.\n\n    This class is immutable: Do not override seconds and nanoseconds.\n    \"\"\"\n\n    __slots__ = [\"seconds\", \"nanoseconds\"]\n\n    def __init__(self, seconds, nanoseconds=0):\n        \"\"\"Initialize a Timestamp object.\n\n        :param int seconds:\n            Number of seconds since the UNIX epoch (00:00:00 UTC Jan 1 1970, minus leap seconds).\n            May be negative.\n\n        :param int nanoseconds:\n            Number of nanoseconds to add to `seconds` to get fractional time.\n            Maximum is 999_999_999.  Default is 0.\n\n        Note: Negative times (before the UNIX epoch) are represented as neg. seconds + pos. ns.\n        \"\"\"\n        if not isinstance(seconds, int):\n            raise TypeError(\"seconds must be an integer\")\n        if not isinstance(nanoseconds, int):\n            raise TypeError(\"nanoseconds must be an integer\")\n        if not (0 <= nanoseconds < 10**9):\n            raise ValueError(\"nanoseconds must be a non-negative integer less than 999999999.\")\n        self.seconds = seconds\n        self.nanoseconds = nanoseconds\n\n    def __repr__(self):\n        \"\"\"String representation of Timestamp.\"\"\"\n        return f\"Timestamp(seconds={self.seconds}, nanoseconds={self.nanoseconds})\"\n\n    def __eq__(self, other):\n        \"\"\"Check for equality with another Timestamp object\"\"\"\n        if type(other) is self.__class__:\n            return self.seconds == other.seconds and self.nanoseconds == other.nanoseconds\n        return False\n\n    def __ne__(self, other):\n        \"\"\"not-equals method (see :func:`__eq__()`)\"\"\"\n        return not self.__eq__(other)\n\n    def __hash__(self):\n        return hash((self.seconds, self.nanoseconds))\n\n    @staticmethod\n    def from_bytes(b):\n        \"\"\"Unpack bytes into a `Timestamp` object.\n\n        Used for pure-Python msgpack unpacking.\n\n        :param b: Payload from msgpack ext message with code -1\n        :type b: bytes\n\n        :returns: Timestamp object unpacked from msgpack ext payload\n        :rtype: Timestamp\n        \"\"\"\n        if len(b) == 4:\n            seconds = struct.unpack(\"!L\", b)[0]\n            nanoseconds = 0\n        elif len(b) == 8:\n            data64 = struct.unpack(\"!Q\", b)[0]\n            seconds = data64 & 0x00000003FFFFFFFF\n            nanoseconds = data64 >> 34\n        elif len(b) == 12:\n            nanoseconds, seconds = struct.unpack(\"!Iq\", b)\n        else:\n            raise ValueError(\n                \"Timestamp type can only be created from 32, 64, or 96-bit byte objects\"\n            )\n        return Timestamp(seconds, nanoseconds)\n\n    def to_bytes(self):\n        \"\"\"Pack this Timestamp object into bytes.\n\n        Used for pure-Python msgpack packing.\n\n        :returns data: Payload for EXT message with code -1 (timestamp type)\n        :rtype: bytes\n        \"\"\"\n        if (self.seconds >> 34) == 0:  # seconds is non-negative and fits in 34 bits\n            data64 = self.nanoseconds << 34 | self.seconds\n            if data64 & 0xFFFFFFFF00000000 == 0:\n                # nanoseconds is zero and seconds < 2**32, so timestamp 32\n                data = struct.pack(\"!L\", data64)\n            else:\n                # timestamp 64\n                data = struct.pack(\"!Q\", data64)\n        else:\n            # timestamp 96\n            data = struct.pack(\"!Iq\", self.nanoseconds, self.seconds)\n        return data\n\n    @staticmethod\n    def from_unix(unix_sec):\n        \"\"\"Create a Timestamp from posix timestamp in seconds.\n\n        :param unix_float: Posix timestamp in seconds.\n        :type unix_float: int or float\n        \"\"\"\n        seconds = int(unix_sec // 1)\n        nanoseconds = int((unix_sec % 1) * 10**9)\n        return Timestamp(seconds, nanoseconds)\n\n    def to_unix(self):\n        \"\"\"Get the timestamp as a floating-point value.\n\n        :returns: posix timestamp\n        :rtype: float\n        \"\"\"\n        return self.seconds + self.nanoseconds / 1e9\n\n    @staticmethod\n    def from_unix_nano(unix_ns):\n        \"\"\"Create a Timestamp from posix timestamp in nanoseconds.\n\n        :param int unix_ns: Posix timestamp in nanoseconds.\n        :rtype: Timestamp\n        \"\"\"\n        return Timestamp(*divmod(unix_ns, 10**9))\n\n    def to_unix_nano(self):\n        \"\"\"Get the timestamp as a unixtime in nanoseconds.\n\n        :returns: posix timestamp in nanoseconds\n        :rtype: int\n        \"\"\"\n        return self.seconds * 10**9 + self.nanoseconds\n\n    def to_datetime(self):\n        \"\"\"Get the timestamp as a UTC datetime.\n\n        :rtype: `datetime.datetime`\n        \"\"\"\n        utc = datetime.timezone.utc\n        return datetime.datetime.fromtimestamp(0, utc) + datetime.timedelta(\n            seconds=self.seconds, microseconds=self.nanoseconds // 1000\n        )\n\n    @staticmethod\n    def from_datetime(dt):\n        \"\"\"Create a Timestamp from datetime with tzinfo.\n\n        :rtype: Timestamp\n        \"\"\"\n        return Timestamp(seconds=int(dt.timestamp()), nanoseconds=dt.microsecond * 1000)\n",[],[216,809,810,811,890,891,1831,1833],"08378300-67fc-11f0-928e-0224a6c84d84","083783b4-67fc-11f0-928e-0224a6c84d84",299,["D",1753299261565],"class UnpackException(Exception):\n    \"\"\"Base class for some exceptions raised while unpacking.\n\n    NOTE: unpack may raise exception other than subclass of\n    UnpackException.  If you want to catch all error, catch\n    Exception instead.\n    \"\"\"\n\n\nclass BufferFull(UnpackException):\n    pass\n\n\nclass OutOfData(UnpackException):\n    pass\n\n\nclass FormatError(ValueError, UnpackException):\n    \"\"\"Invalid msgpack format\"\"\"\n\n\nclass StackError(ValueError, UnpackException):\n    \"\"\"Too nested\"\"\"\n\n\n# Deprecated.  Use ValueError instead\nUnpackValueError = ValueError\n\n\nclass ExtraData(UnpackValueError):\n    \"\"\"ExtraData is raised when there is trailing data.\n\n    This exception is raised while only one-shot (not streaming)\n    unpack.\n    \"\"\"\n\n    def __init__(self, unpacked, extra):\n        self.unpacked = unpacked\n        self.extra = extra\n\n    def __str__(self):\n        return \"unpack(b) received extra data.\"\n\n\n# Deprecated.  Use Exception instead to catch all exception during packing.\nPackException = Exception\nPackValueError = ValueError\nPackOverflowError = OverflowError\n",[],[216,809,810,811,890,891,1831,1333],"0832a8ee-67fc-11f0-96d6-0224a6c84d84","0832a998-67fc-11f0-96d6-0224a6c84d84",298,["D",1753299261535],"# ruff: noqa: F401\nimport os\n\nfrom .exceptions import *  # noqa: F403\nfrom .ext import ExtType, Timestamp\n\nversion = (1, 1, 0)\n__version__ = \"1.1.0\"\n\n\nif os.environ.get(\"MSGPACK_PUREPYTHON\"):\n    from .fallback import Packer, Unpacker, unpackb\nelse:\n    try:\n        from ._cmsgpack import Packer, Unpacker, unpackb\n    except ImportError:\n        from .fallback import Packer, Unpacker, unpackb\n\n\ndef pack(o, stream, **kwargs):\n    \"\"\"\n    Pack object `o` and write it to `stream`\n\n    See :class:`Packer` for options.\n    \"\"\"\n    packer = Packer(**kwargs)\n    stream.write(packer.pack(o))\n\n\ndef packb(o, **kwargs):\n    \"\"\"\n    Pack object `o` and return packed bytes\n\n    See :class:`Packer` for options.\n    \"\"\"\n    return Packer(**kwargs).pack(o)\n\n\ndef unpack(stream, **kwargs):\n    \"\"\"\n    Unpack an object from `stream`.\n\n    Raises `ExtraData` when `stream` contains extra bytes.\n    See :class:`Unpacker` for options.\n    \"\"\"\n    data = stream.read()\n    return unpackb(data, **kwargs)\n\n\n# alias for compatibility to simplejson/marshal/pickle.\nload = unpack\nloads = unpackb\n\ndump = pack\ndumps = packb\n",[],[216,809,810,811,890,891,1831,893],"fd98677a-67fb-11f0-928e-0224a6c84d84",72,["D",1753299243744],[488,489,490,491],[216,809,810,811,890,891,1831],"09effdb2-67fc-11f0-8791-0224a6c84d84","package_data.py","09effe5c-67fc-11f0-8791-0224a6c84d84","fe33b022-67fb-11f0-8b06-0224a6c84d84",360,["D",1753299264455],"__version__ = \"3.10\"\n",[],[216,809,810,811,890,891,1868,1860],"idna","09e67e04-67fc-11f0-a99a-0224a6c84d84","intranges.py","09e67ec2-67fc-11f0-a99a-0224a6c84d84",359,["D",1753299264394],"\"\"\"\nGiven a list of integers, made up of (hopefully) a small number of long runs\nof consecutive integers, compute a representation of the form\n((start1, end1), (start2, end2) ...). Then answer the question \"was x present\nin the original list?\" in time O(log(# runs)).\n\"\"\"\n\nimport bisect\nfrom typing import List, Tuple\n\n\ndef intranges_from_list(list_: List[int]) -> Tuple[int, ...]:\n    \"\"\"Represent a list of integers as a sequence of ranges:\n    ((start_0, end_0), (start_1, end_1), ...), such that the original\n    integers are exactly those x such that start_i <= x < end_i for some i.\n\n    Ranges are encoded as single integers (start << 32 | end), not as tuples.\n    \"\"\"\n\n    sorted_list = sorted(list_)\n    ranges = []\n    last_write = -1\n    for i in range(len(sorted_list)):\n        if i + 1 < len(sorted_list):\n            if sorted_list[i] == sorted_list[i + 1] - 1:\n                continue\n        current_range = sorted_list[last_write + 1 : i + 1]\n        ranges.append(_encode_range(current_range[0], current_range[-1] + 1))\n        last_write = i\n\n    return tuple(ranges)\n\n\ndef _encode_range(start: int, end: int) -> int:\n    return (start << 32) | end\n\n\ndef _decode_range(r: int) -> Tuple[int, int]:\n    return (r >> 32), (r & ((1 << 32) - 1))\n\n\ndef intranges_contain(int_: int, ranges: Tuple[int, ...]) -> bool:\n    \"\"\"Determine if `int_` falls into one of the ranges in `ranges`.\"\"\"\n    tuple_ = _encode_range(int_, 0)\n    pos = bisect.bisect_left(ranges, tuple_)\n    # we could be immediately ahead of a tuple (start, end)\n    # with start < int_ <= end\n    if pos > 0:\n        left, right = _decode_range(ranges[pos - 1])\n        if left <= int_ < right:\n            return True\n    # or we could be immediately behind a tuple (int_, end)\n    if pos < len(ranges):\n        left, _ = _decode_range(ranges[pos])\n        if left == int_:\n            return True\n    return False\n",[],[216,809,810,811,890,891,1868,1870],"0a0b2b64-67fc-11f0-a319-0224a6c84d84","idnadata.py","0a0b2c2c-67fc-11f0-a319-0224a6c84d84",364,["D",1753299264631],"# This file is automatically generated by tools/idna-data\n\n__version__ = \"15.1.0\"\nscripts = {\n    \"Greek\": (\n        0x37000000374,\n        0x37500000378,\n        0x37A0000037E,\n        0x37F00000380,\n        0x38400000385,\n        0x38600000387,\n        0x3880000038B,\n        0x38C0000038D,\n        0x38E000003A2,\n        0x3A3000003E2,\n        0x3F000000400,\n        0x1D2600001D2B,\n        0x1D5D00001D62,\n        0x1D6600001D6B,\n        0x1DBF00001DC0,\n        0x1F0000001F16,\n        0x1F1800001F1E,\n        0x1F2000001F46,\n        0x1F4800001F4E,\n        0x1F5000001F58,\n        0x1F5900001F5A,\n        0x1F5B00001F5C,\n        0x1F5D00001F5E,\n        0x1F5F00001F7E,\n        0x1F8000001FB5,\n        0x1FB600001FC5,\n        0x1FC600001FD4,\n        0x1FD600001FDC,\n        0x1FDD00001FF0,\n        0x1FF200001FF5,\n        0x1FF600001FFF,\n        0x212600002127,\n        0xAB650000AB66,\n        0x101400001018F,\n        0x101A0000101A1,\n        0x1D2000001D246,\n    ),\n    \"Han\": (\n        0x2E8000002E9A,\n        0x2E9B00002EF4,\n        0x2F0000002FD6,\n        0x300500003006,\n        0x300700003008,\n        0x30210000302A,\n        0x30380000303C,\n        0x340000004DC0,\n        0x4E000000A000,\n        0xF9000000FA6E,\n        0xFA700000FADA,\n        0x16FE200016FE4,\n        0x16FF000016FF2,\n        0x200000002A6E0,\n        0x2A7000002B73A,\n        0x2B7400002B81E,\n        0x2B8200002CEA2,\n        0x2CEB00002EBE1,\n        0x2EBF00002EE5E,\n        0x2F8000002FA1E,\n        0x300000003134B,\n        0x31350000323B0,\n    ),\n    \"Hebrew\": (\n        0x591000005C8,\n        0x5D0000005EB,\n        0x5EF000005F5,\n        0xFB1D0000FB37,\n        0xFB380000FB3D,\n        0xFB3E0000FB3F,\n        0xFB400000FB42,\n        0xFB430000FB45,\n        0xFB460000FB50,\n    ),\n    \"Hiragana\": (\n        0x304100003097,\n        0x309D000030A0,\n        0x1B0010001B120,\n        0x1B1320001B133,\n        0x1B1500001B153,\n        0x1F2000001F201,\n    ),\n    \"Katakana\": (\n        0x30A1000030FB,\n        0x30FD00003100,\n        0x31F000003200,\n        0x32D0000032FF,\n        0x330000003358,\n        0xFF660000FF70,\n        0xFF710000FF9E,\n        0x1AFF00001AFF4,\n        0x1AFF50001AFFC,\n        0x1AFFD0001AFFF,\n        0x1B0000001B001,\n        0x1B1200001B123,\n        0x1B1550001B156,\n        0x1B1640001B168,\n    ),\n}\njoining_types = {\n    0xAD: 84,\n    0x300: 84,\n    0x301: 84,\n    0x302: 84,\n    0x303: 84,\n    0x304: 84,\n    0x305: 84,\n    0x306: 84,\n    0x307: 84,\n    0x308: 84,\n    0x309: 84,\n    0x30A: 84,\n    0x30B: 84,\n    0x30C: 84,\n    0x30D: 84,\n    0x30E: 84,\n    0x30F: 84,\n    0x310: 84,\n    0x311: 84,\n    0x312: 84,\n    0x313: 84,\n    0x314: 84,\n    0x315: 84,\n    0x316: 84,\n    0x317: 84,\n    0x318: 84,\n    0x319: 84,\n    0x31A: 84,\n    0x31B: 84,\n    0x31C: 84,\n    0x31D: 84,\n    0x31E: 84,\n    0x31F: 84,\n    0x320: 84,\n    0x321: 84,\n    0x322: 84,\n    0x323: 84,\n    0x324: 84,\n    0x325: 84,\n    0x326: 84,\n    0x327: 84,\n    0x328: 84,\n    0x329: 84,\n    0x32A: 84,\n    0x32B: 84,\n    0x32C: 84,\n    0x32D: 84,\n    0x32E: 84,\n    0x32F: 84,\n    0x330: 84,\n    0x331: 84,\n    0x332: 84,\n    0x333: 84,\n    0x334: 84,\n    0x335: 84,\n    0x336: 84,\n    0x337: 84,\n    0x338: 84,\n    0x339: 84,\n    0x33A: 84,\n    0x33B: 84,\n    0x33C: 84,\n    0x33D: 84,\n    0x33E: 84,\n    0x33F: 84,\n    0x340: 84,\n    0x341: 84,\n    0x342: 84,\n    0x343: 84,\n    0x344: 84,\n    0x345: 84,\n    0x346: 84,\n    0x347: 84,\n    0x348: 84,\n    0x349: 84,\n    0x34A: 84,\n    0x34B: 84,\n    0x34C: 84,\n    0x34D: 84,\n    0x34E: 84,\n    0x34F: 84,\n    0x350: 84,\n    0x351: 84,\n    0x352: 84,\n    0x353: 84,\n    0x354: 84,\n    0x355: 84,\n    0x356: 84,\n    0x357: 84,\n    0x358: 84,\n    0x359: 84,\n    0x35A: 84,\n    0x35B: 84,\n    0x35C: 84,\n    0x35D: 84,\n    0x35E: 84,\n    0x35F: 84,\n    0x360: 84,\n    0x361: 84,\n    0x362: 84,\n    0x363: 84,\n    0x364: 84,\n    0x365: 84,\n    0x366: 84,\n    0x367: 84,\n    0x368: 84,\n    0x369: 84,\n    0x36A: 84,\n    0x36B: 84,\n    0x36C: 84,\n    0x36D: 84,\n    0x36E: 84,\n    0x36F: 84,\n    0x483: 84,\n    0x484: 84,\n    0x485: 84,\n    0x486: 84,\n    0x487: 84,\n    0x488: 84,\n    0x489: 84,\n    0x591: 84,\n    0x592: 84,\n    0x593: 84,\n    0x594: 84,\n    0x595: 84,\n    0x596: 84,\n    0x597: 84,\n    0x598: 84,\n    0x599: 84,\n    0x59A: 84,\n    0x59B: 84,\n    0x59C: 84,\n    0x59D: 84,\n    0x59E: 84,\n    0x59F: 84,\n    0x5A0: 84,\n    0x5A1: 84,\n    0x5A2: 84,\n    0x5A3: 84,\n    0x5A4: 84,\n    0x5A5: 84,\n    0x5A6: 84,\n    0x5A7: 84,\n    0x5A8: 84,\n    0x5A9: 84,\n    0x5AA: 84,\n    0x5AB: 84,\n    0x5AC: 84,\n    0x5AD: 84,\n    0x5AE: 84,\n    0x5AF: 84,\n    0x5B0: 84,\n    0x5B1: 84,\n    0x5B2: 84,\n    0x5B3: 84,\n    0x5B4: 84,\n    0x5B5: 84,\n    0x5B6: 84,\n    0x5B7: 84,\n    0x5B8: 84,\n    0x5B9: 84,\n    0x5BA: 84,\n    0x5BB: 84,\n    0x5BC: 84,\n    0x5BD: 84,\n    0x5BF: 84,\n    0x5C1: 84,\n    0x5C2: 84,\n    0x5C4: 84,\n    0x5C5: 84,\n    0x5C7: 84,\n    0x610: 84,\n    0x611: 84,\n    0x612: 84,\n    0x613: 84,\n    0x614: 84,\n    0x615: 84,\n    0x616: 84,\n    0x617: 84,\n    0x618: 84,\n    0x619: 84,\n    0x61A: 84,\n    0x61C: 84,\n    0x620: 68,\n    0x622: 82,\n    0x623: 82,\n    0x624: 82,\n    0x625: 82,\n    0x626: 68,\n    0x627: 82,\n    0x628: 68,\n    0x629: 82,\n    0x62A: 68,\n    0x62B: 68,\n    0x62C: 68,\n    0x62D: 68,\n    0x62E: 68,\n    0x62F: 82,\n    0x630: 82,\n    0x631: 82,\n    0x632: 82,\n    0x633: 68,\n    0x634: 68,\n    0x635: 68,\n    0x636: 68,\n    0x637: 68,\n    0x638: 68,\n    0x639: 68,\n    0x63A: 68,\n    0x63B: 68,\n    0x63C: 68,\n    0x63D: 68,\n    0x63E: 68,\n    0x63F: 68,\n    0x640: 67,\n    0x641: 68,\n    0x642: 68,\n    0x643: 68,\n    0x644: 68,\n    0x645: 68,\n    0x646: 68,\n    0x647: 68,\n    0x648: 82,\n    0x649: 68,\n    0x64A: 68,\n    0x64B: 84,\n    0x64C: 84,\n    0x64D: 84,\n    0x64E: 84,\n    0x64F: 84,\n    0x650: 84,\n    0x651: 84,\n    0x652: 84,\n    0x653: 84,\n    0x654: 84,\n    0x655: 84,\n    0x656: 84,\n    0x657: 84,\n    0x658: 84,\n    0x659: 84,\n    0x65A: 84,\n    0x65B: 84,\n    0x65C: 84,\n    0x65D: 84,\n    0x65E: 84,\n    0x65F: 84,\n    0x66E: 68,\n    0x66F: 68,\n    0x670: 84,\n    0x671: 82,\n    0x672: 82,\n    0x673: 82,\n    0x675: 82,\n    0x676: 82,\n    0x677: 82,\n    0x678: 68,\n    0x679: 68,\n    0x67A: 68,\n    0x67B: 68,\n    0x67C: 68,\n    0x67D: 68,\n    0x67E: 68,\n    0x67F: 68,\n    0x680: 68,\n    0x681: 68,\n    0x682: 68,\n    0x683: 68,\n    0x684: 68,\n    0x685: 68,\n    0x686: 68,\n    0x687: 68,\n    0x688: 82,\n    0x689: 82,\n    0x68A: 82,\n    0x68B: 82,\n    0x68C: 82,\n    0x68D: 82,\n    0x68E: 82,\n    0x68F: 82,\n    0x690: 82,\n    0x691: 82,\n    0x692: 82,\n    0x693: 82,\n    0x694: 82,\n    0x695: 82,\n    0x696: 82,\n    0x697: 82,\n    0x698: 82,\n    0x699: 82,\n    0x69A: 68,\n    0x69B: 68,\n    0x69C: 68,\n    0x69D: 68,\n    0x69E: 68,\n    0x69F: 68,\n    0x6A0: 68,\n    0x6A1: 68,\n    0x6A2: 68,\n    0x6A3: 68,\n    0x6A4: 68,\n    0x6A5: 68,\n    0x6A6: 68,\n    0x6A7: 68,\n    0x6A8: 68,\n    0x6A9: 68,\n    0x6AA: 68,\n    0x6AB: 68,\n    0x6AC: 68,\n    0x6AD: 68,\n    0x6AE: 68,\n    0x6AF: 68,\n    0x6B0: 68,\n    0x6B1: 68,\n    0x6B2: 68,\n    0x6B3: 68,\n    0x6B4: 68,\n    0x6B5: 68,\n    0x6B6: 68,\n    0x6B7: 68,\n    0x6B8: 68,\n    0x6B9: 68,\n    0x6BA: 68,\n    0x6BB: 68,\n    0x6BC: 68,\n    0x6BD: 68,\n    0x6BE: 68,\n    0x6BF: 68,\n    0x6C0: 82,\n    0x6C1: 68,\n    0x6C2: 68,\n    0x6C3: 82,\n    0x6C4: 82,\n    0x6C5: 82,\n    0x6C6: 82,\n    0x6C7: 82,\n    0x6C8: 82,\n    0x6C9: 82,\n    0x6CA: 82,\n    0x6CB: 82,\n    0x6CC: 68,\n    0x6CD: 82,\n    0x6CE: 68,\n    0x6CF: 82,\n    0x6D0: 68,\n    0x6D1: 68,\n    0x6D2: 82,\n    0x6D3: 82,\n    0x6D5: 82,\n    0x6D6: 84,\n    0x6D7: 84,\n    0x6D8: 84,\n    0x6D9: 84,\n    0x6DA: 84,\n    0x6DB: 84,\n    0x6DC: 84,\n    0x6DF: 84,\n    0x6E0: 84,\n    0x6E1: 84,\n    0x6E2: 84,\n    0x6E3: 84,\n    0x6E4: 84,\n    0x6E7: 84,\n    0x6E8: 84,\n    0x6EA: 84,\n    0x6EB: 84,\n    0x6EC: 84,\n    0x6ED: 84,\n    0x6EE: 82,\n    0x6EF: 82,\n    0x6FA: 68,\n    0x6FB: 68,\n    0x6FC: 68,\n    0x6FF: 68,\n    0x70F: 84,\n    0x710: 82,\n    0x711: 84,\n    0x712: 68,\n    0x713: 68,\n    0x714: 68,\n    0x715: 82,\n    0x716: 82,\n    0x717: 82,\n    0x718: 82,\n    0x719: 82,\n    0x71A: 68,\n    0x71B: 68,\n    0x71C: 68,\n    0x71D: 68,\n    0x71E: 82,\n    0x71F: 68,\n    0x720: 68,\n    0x721: 68,\n    0x722: 68,\n    0x723: 68,\n    0x724: 68,\n    0x725: 68,\n    0x726: 68,\n    0x727: 68,\n    0x728: 82,\n    0x729: 68,\n    0x72A: 82,\n    0x72B: 68,\n    0x72C: 82,\n    0x72D: 68,\n    0x72E: 68,\n    0x72F: 82,\n    0x730: 84,\n    0x731: 84,\n    0x732: 84,\n    0x733: 84,\n    0x734: 84,\n    0x735: 84,\n    0x736: 84,\n    0x737: 84,\n    0x738: 84,\n    0x739: 84,\n    0x73A: 84,\n    0x73B: 84,\n    0x73C: 84,\n    0x73D: 84,\n    0x73E: 84,\n    0x73F: 84,\n    0x740: 84,\n    0x741: 84,\n    0x742: 84,\n    0x743: 84,\n    0x744: 84,\n    0x745: 84,\n    0x746: 84,\n    0x747: 84,\n    0x748: 84,\n    0x749: 84,\n    0x74A: 84,\n    0x74D: 82,\n    0x74E: 68,\n    0x74F: 68,\n    0x750: 68,\n    0x751: 68,\n    0x752: 68,\n    0x753: 68,\n    0x754: 68,\n    0x755: 68,\n    0x756: 68,\n    0x757: 68,\n    0x758: 68,\n    0x759: 82,\n    0x75A: 82,\n    0x75B: 82,\n    0x75C: 68,\n    0x75D: 68,\n    0x75E: 68,\n    0x75F: 68,\n    0x760: 68,\n    0x761: 68,\n    0x762: 68,\n    0x763: 68,\n    0x764: 68,\n    0x765: 68,\n    0x766: 68,\n    0x767: 68,\n    0x768: 68,\n    0x769: 68,\n    0x76A: 68,\n    0x76B: 82,\n    0x76C: 82,\n    0x76D: 68,\n    0x76E: 68,\n    0x76F: 68,\n    0x770: 68,\n    0x771: 82,\n    0x772: 68,\n    0x773: 82,\n    0x774: 82,\n    0x775: 68,\n    0x776: 68,\n    0x777: 68,\n    0x778: 82,\n    0x779: 82,\n    0x77A: 68,\n    0x77B: 68,\n    0x77C: 68,\n    0x77D: 68,\n    0x77E: 68,\n    0x77F: 68,\n    0x7A6: 84,\n    0x7A7: 84,\n    0x7A8: 84,\n    0x7A9: 84,\n    0x7AA: 84,\n    0x7AB: 84,\n    0x7AC: 84,\n    0x7AD: 84,\n    0x7AE: 84,\n    0x7AF: 84,\n    0x7B0: 84,\n    0x7CA: 68,\n    0x7CB: 68,\n    0x7CC: 68,\n    0x7CD: 68,\n    0x7CE: 68,\n    0x7CF: 68,\n    0x7D0: 68,\n    0x7D1: 68,\n    0x7D2: 68,\n    0x7D3: 68,\n    0x7D4: 68,\n    0x7D5: 68,\n    0x7D6: 68,\n    0x7D7: 68,\n    0x7D8: 68,\n    0x7D9: 68,\n    0x7DA: 68,\n    0x7DB: 68,\n    0x7DC: 68,\n    0x7DD: 68,\n    0x7DE: 68,\n    0x7DF: 68,\n    0x7E0: 68,\n    0x7E1: 68,\n    0x7E2: 68,\n    0x7E3: 68,\n    0x7E4: 68,\n    0x7E5: 68,\n    0x7E6: 68,\n    0x7E7: 68,\n    0x7E8: 68,\n    0x7E9: 68,\n    0x7EA: 68,\n    0x7EB: 84,\n    0x7EC: 84,\n    0x7ED: 84,\n    0x7EE: 84,\n    0x7EF: 84,\n    0x7F0: 84,\n    0x7F1: 84,\n    0x7F2: 84,\n    0x7F3: 84,\n    0x7FA: 67,\n    0x7FD: 84,\n    0x816: 84,\n    0x817: 84,\n    0x818: 84,\n    0x819: 84,\n    0x81B: 84,\n    0x81C: 84,\n    0x81D: 84,\n    0x81E: 84,\n    0x81F: 84,\n    0x820: 84,\n    0x821: 84,\n    0x822: 84,\n    0x823: 84,\n    0x825: 84,\n    0x826: 84,\n    0x827: 84,\n    0x829: 84,\n    0x82A: 84,\n    0x82B: 84,\n    0x82C: 84,\n    0x82D: 84,\n    0x840: 82,\n    0x841: 68,\n    0x842: 68,\n    0x843: 68,\n    0x844: 68,\n    0x845: 68,\n    0x846: 82,\n    0x847: 82,\n    0x848: 68,\n    0x849: 82,\n    0x84A: 68,\n    0x84B: 68,\n    0x84C: 68,\n    0x84D: 68,\n    0x84E: 68,\n    0x84F: 68,\n    0x850: 68,\n    0x851: 68,\n    0x852: 68,\n    0x853: 68,\n    0x854: 82,\n    0x855: 68,\n    0x856: 82,\n    0x857: 82,\n    0x858: 82,\n    0x859: 84,\n    0x85A: 84,\n    0x85B: 84,\n    0x860: 68,\n    0x862: 68,\n    0x863: 68,\n    0x864: 68,\n    0x865: 68,\n    0x867: 82,\n    0x868: 68,\n    0x869: 82,\n    0x86A: 82,\n    0x870: 82,\n    0x871: 82,\n    0x872: 82,\n    0x873: 82,\n    0x874: 82,\n    0x875: 82,\n    0x876: 82,\n    0x877: 82,\n    0x878: 82,\n    0x879: 82,\n    0x87A: 82,\n    0x87B: 82,\n    0x87C: 82,\n    0x87D: 82,\n    0x87E: 82,\n    0x87F: 82,\n    0x880: 82,\n    0x881: 82,\n    0x882: 82,\n    0x883: 67,\n    0x884: 67,\n    0x885: 67,\n    0x886: 68,\n    0x889: 68,\n    0x88A: 68,\n    0x88B: 68,\n    0x88C: 68,\n    0x88D: 68,\n    0x88E: 82,\n    0x898: 84,\n    0x899: 84,\n    0x89A: 84,\n    0x89B: 84,\n    0x89C: 84,\n    0x89D: 84,\n    0x89E: 84,\n    0x89F: 84,\n    0x8A0: 68,\n    0x8A1: 68,\n    0x8A2: 68,\n    0x8A3: 68,\n    0x8A4: 68,\n    0x8A5: 68,\n    0x8A6: 68,\n    0x8A7: 68,\n    0x8A8: 68,\n    0x8A9: 68,\n    0x8AA: 82,\n    0x8AB: 82,\n    0x8AC: 82,\n    0x8AE: 82,\n    0x8AF: 68,\n    0x8B0: 68,\n    0x8B1: 82,\n    0x8B2: 82,\n    0x8B3: 68,\n    0x8B4: 68,\n    0x8B5: 68,\n    0x8B6: 68,\n    0x8B7: 68,\n    0x8B8: 68,\n    0x8B9: 82,\n    0x8BA: 68,\n    0x8BB: 68,\n    0x8BC: 68,\n    0x8BD: 68,\n    0x8BE: 68,\n    0x8BF: 68,\n    0x8C0: 68,\n    0x8C1: 68,\n    0x8C2: 68,\n    0x8C3: 68,\n    0x8C4: 68,\n    0x8C5: 68,\n    0x8C6: 68,\n    0x8C7: 68,\n    0x8C8: 68,\n    0x8CA: 84,\n    0x8CB: 84,\n    0x8CC: 84,\n    0x8CD: 84,\n    0x8CE: 84,\n    0x8CF: 84,\n    0x8D0: 84,\n    0x8D1: 84,\n    0x8D2: 84,\n    0x8D3: 84,\n    0x8D4: 84,\n    0x8D5: 84,\n    0x8D6: 84,\n    0x8D7: 84,\n    0x8D8: 84,\n    0x8D9: 84,\n    0x8DA: 84,\n    0x8DB: 84,\n    0x8DC: 84,\n    0x8DD: 84,\n    0x8DE: 84,\n    0x8DF: 84,\n    0x8E0: 84,\n    0x8E1: 84,\n    0x8E3: 84,\n    0x8E4: 84,\n    0x8E5: 84,\n    0x8E6: 84,\n    0x8E7: 84,\n    0x8E8: 84,\n    0x8E9: 84,\n    0x8EA: 84,\n    0x8EB: 84,\n    0x8EC: 84,\n    0x8ED: 84,\n    0x8EE: 84,\n    0x8EF: 84,\n    0x8F0: 84,\n    0x8F1: 84,\n    0x8F2: 84,\n    0x8F3: 84,\n    0x8F4: 84,\n    0x8F5: 84,\n    0x8F6: 84,\n    0x8F7: 84,\n    0x8F8: 84,\n    0x8F9: 84,\n    0x8FA: 84,\n    0x8FB: 84,\n    0x8FC: 84,\n    0x8FD: 84,\n    0x8FE: 84,\n    0x8FF: 84,\n    0x900: 84,\n    0x901: 84,\n    0x902: 84,\n    0x93A: 84,\n    0x93C: 84,\n    0x941: 84,\n    0x942: 84,\n    0x943: 84,\n    0x944: 84,\n    0x945: 84,\n    0x946: 84,\n    0x947: 84,\n    0x948: 84,\n    0x94D: 84,\n    0x951: 84,\n    0x952: 84,\n    0x953: 84,\n    0x954: 84,\n    0x955: 84,\n    0x956: 84,\n    0x957: 84,\n    0x962: 84,\n    0x963: 84,\n    0x981: 84,\n    0x9BC: 84,\n    0x9C1: 84,\n    0x9C2: 84,\n    0x9C3: 84,\n    0x9C4: 84,\n    0x9CD: 84,\n    0x9E2: 84,\n    0x9E3: 84,\n    0x9FE: 84,\n    0xA01: 84,\n    0xA02: 84,\n    0xA3C: 84,\n    0xA41: 84,\n    0xA42: 84,\n    0xA47: 84,\n    0xA48: 84,\n    0xA4B: 84,\n    0xA4C: 84,\n    0xA4D: 84,\n    0xA51: 84,\n    0xA70: 84,\n    0xA71: 84,\n    0xA75: 84,\n    0xA81: 84,\n    0xA82: 84,\n    0xABC: 84,\n    0xAC1: 84,\n    0xAC2: 84,\n    0xAC3: 84,\n    0xAC4: 84,\n    0xAC5: 84,\n    0xAC7: 84,\n    0xAC8: 84,\n    0xACD: 84,\n    0xAE2: 84,\n    0xAE3: 84,\n    0xAFA: 84,\n    0xAFB: 84,\n    0xAFC: 84,\n    0xAFD: 84,\n    0xAFE: 84,\n    0xAFF: 84,\n    0xB01: 84,\n    0xB3C: 84,\n    0xB3F: 84,\n    0xB41: 84,\n    0xB42: 84,\n    0xB43: 84,\n    0xB44: 84,\n    0xB4D: 84,\n    0xB55: 84,\n    0xB56: 84,\n    0xB62: 84,\n    0xB63: 84,\n    0xB82: 84,\n    0xBC0: 84,\n    0xBCD: 84,\n    0xC00: 84,\n    0xC04: 84,\n    0xC3C: 84,\n    0xC3E: 84,\n    0xC3F: 84,\n    0xC40: 84,\n    0xC46: 84,\n    0xC47: 84,\n    0xC48: 84,\n    0xC4A: 84,\n    0xC4B: 84,\n    0xC4C: 84,\n    0xC4D: 84,\n    0xC55: 84,\n    0xC56: 84,\n    0xC62: 84,\n    0xC63: 84,\n    0xC81: 84,\n    0xCBC: 84,\n    0xCBF: 84,\n    0xCC6: 84,\n    0xCCC: 84,\n    0xCCD: 84,\n    0xCE2: 84,\n    0xCE3: 84,\n    0xD00: 84,\n    0xD01: 84,\n    0xD3B: 84,\n    0xD3C: 84,\n    0xD41: 84,\n    0xD42: 84,\n    0xD43: 84,\n    0xD44: 84,\n    0xD4D: 84,\n    0xD62: 84,\n    0xD63: 84,\n    0xD81: 84,\n    0xDCA: 84,\n    0xDD2: 84,\n    0xDD3: 84,\n    0xDD4: 84,\n    0xDD6: 84,\n    0xE31: 84,\n    0xE34: 84,\n    0xE35: 84,\n    0xE36: 84,\n    0xE37: 84,\n    0xE38: 84,\n    0xE39: 84,\n    0xE3A: 84,\n    0xE47: 84,\n    0xE48: 84,\n    0xE49: 84,\n    0xE4A: 84,\n    0xE4B: 84,\n    0xE4C: 84,\n    0xE4D: 84,\n    0xE4E: 84,\n    0xEB1: 84,\n    0xEB4: 84,\n    0xEB5: 84,\n    0xEB6: 84,\n    0xEB7: 84,\n    0xEB8: 84,\n    0xEB9: 84,\n    0xEBA: 84,\n    0xEBB: 84,\n    0xEBC: 84,\n    0xEC8: 84,\n    0xEC9: 84,\n    0xECA: 84,\n    0xECB: 84,\n    0xECC: 84,\n    0xECD: 84,\n    0xECE: 84,\n    0xF18: 84,\n    0xF19: 84,\n    0xF35: 84,\n    0xF37: 84,\n    0xF39: 84,\n    0xF71: 84,\n    0xF72: 84,\n    0xF73: 84,\n    0xF74: 84,\n    0xF75: 84,\n    0xF76: 84,\n    0xF77: 84,\n    0xF78: 84,\n    0xF79: 84,\n    0xF7A: 84,\n    0xF7B: 84,\n    0xF7C: 84,\n    0xF7D: 84,\n    0xF7E: 84,\n    0xF80: 84,\n    0xF81: 84,\n    0xF82: 84,\n    0xF83: 84,\n    0xF84: 84,\n    0xF86: 84,\n    0xF87: 84,\n    0xF8D: 84,\n    0xF8E: 84,\n    0xF8F: 84,\n    0xF90: 84,\n    0xF91: 84,\n    0xF92: 84,\n    0xF93: 84,\n    0xF94: 84,\n    0xF95: 84,\n    0xF96: 84,\n    0xF97: 84,\n    0xF99: 84,\n    0xF9A: 84,\n    0xF9B: 84,\n    0xF9C: 84,\n    0xF9D: 84,\n    0xF9E: 84,\n    0xF9F: 84,\n    0xFA0: 84,\n    0xFA1: 84,\n    0xFA2: 84,\n    0xFA3: 84,\n    0xFA4: 84,\n    0xFA5: 84,\n    0xFA6: 84,\n    0xFA7: 84,\n    0xFA8: 84,\n    0xFA9: 84,\n    0xFAA: 84,\n    0xFAB: 84,\n    0xFAC: 84,\n    0xFAD: 84,\n    0xFAE: 84,\n    0xFAF: 84,\n    0xFB0: 84,\n    0xFB1: 84,\n    0xFB2: 84,\n    0xFB3: 84,\n    0xFB4: 84,\n    0xFB5: 84,\n    0xFB6: 84,\n    0xFB7: 84,\n    0xFB8: 84,\n    0xFB9: 84,\n    0xFBA: 84,\n    0xFBB: 84,\n    0xFBC: 84,\n    0xFC6: 84,\n    0x102D: 84,\n    0x102E: 84,\n    0x102F: 84,\n    0x1030: 84,\n    0x1032: 84,\n    0x1033: 84,\n    0x1034: 84,\n    0x1035: 84,\n    0x1036: 84,\n    0x1037: 84,\n    0x1039: 84,\n    0x103A: 84,\n    0x103D: 84,\n    0x103E: 84,\n    0x1058: 84,\n    0x1059: 84,\n    0x105E: 84,\n    0x105F: 84,\n    0x1060: 84,\n    0x1071: 84,\n    0x1072: 84,\n    0x1073: 84,\n    0x1074: 84,\n    0x1082: 84,\n    0x1085: 84,\n    0x1086: 84,\n    0x108D: 84,\n    0x109D: 84,\n    0x135D: 84,\n    0x135E: 84,\n    0x135F: 84,\n    0x1712: 84,\n    0x1713: 84,\n    0x1714: 84,\n    0x1732: 84,\n    0x1733: 84,\n    0x1752: 84,\n    0x1753: 84,\n    0x1772: 84,\n    0x1773: 84,\n    0x17B4: 84,\n    0x17B5: 84,\n    0x17B7: 84,\n    0x17B8: 84,\n    0x17B9: 84,\n    0x17BA: 84,\n    0x17BB: 84,\n    0x17BC: 84,\n    0x17BD: 84,\n    0x17C6: 84,\n    0x17C9: 84,\n    0x17CA: 84,\n    0x17CB: 84,\n    0x17CC: 84,\n    0x17CD: 84,\n    0x17CE: 84,\n    0x17CF: 84,\n    0x17D0: 84,\n    0x17D1: 84,\n    0x17D2: 84,\n    0x17D3: 84,\n    0x17DD: 84,\n    0x1807: 68,\n    0x180A: 67,\n    0x180B: 84,\n    0x180C: 84,\n    0x180D: 84,\n    0x180F: 84,\n    0x1820: 68,\n    0x1821: 68,\n    0x1822: 68,\n    0x1823: 68,\n    0x1824: 68,\n    0x1825: 68,\n    0x1826: 68,\n    0x1827: 68,\n    0x1828: 68,\n    0x1829: 68,\n    0x182A: 68,\n    0x182B: 68,\n    0x182C: 68,\n    0x182D: 68,\n    0x182E: 68,\n    0x182F: 68,\n    0x1830: 68,\n    0x1831: 68,\n    0x1832: 68,\n    0x1833: 68,\n    0x1834: 68,\n    0x1835: 68,\n    0x1836: 68,\n    0x1837: 68,\n    0x1838: 68,\n    0x1839: 68,\n    0x183A: 68,\n    0x183B: 68,\n    0x183C: 68,\n    0x183D: 68,\n    0x183E: 68,\n    0x183F: 68,\n    0x1840: 68,\n    0x1841: 68,\n    0x1842: 68,\n    0x1843: 68,\n    0x1844: 68,\n    0x1845: 68,\n    0x1846: 68,\n    0x1847: 68,\n    0x1848: 68,\n    0x1849: 68,\n    0x184A: 68,\n    0x184B: 68,\n    0x184C: 68,\n    0x184D: 68,\n    0x184E: 68,\n    0x184F: 68,\n    0x1850: 68,\n    0x1851: 68,\n    0x1852: 68,\n    0x1853: 68,\n    0x1854: 68,\n    0x1855: 68,\n    0x1856: 68,\n    0x1857: 68,\n    0x1858: 68,\n    0x1859: 68,\n    0x185A: 68,\n    0x185B: 68,\n    0x185C: 68,\n    0x185D: 68,\n    0x185E: 68,\n    0x185F: 68,\n    0x1860: 68,\n    0x1861: 68,\n    0x1862: 68,\n    0x1863: 68,\n    0x1864: 68,\n    0x1865: 68,\n    0x1866: 68,\n    0x1867: 68,\n    0x1868: 68,\n    0x1869: 68,\n    0x186A: 68,\n    0x186B: 68,\n    0x186C: 68,\n    0x186D: 68,\n    0x186E: 68,\n    0x186F: 68,\n    0x1870: 68,\n    0x1871: 68,\n    0x1872: 68,\n    0x1873: 68,\n    0x1874: 68,\n    0x1875: 68,\n    0x1876: 68,\n    0x1877: 68,\n    0x1878: 68,\n    0x1885: 84,\n    0x1886: 84,\n    0x1887: 68,\n    0x1888: 68,\n    0x1889: 68,\n    0x188A: 68,\n    0x188B: 68,\n    0x188C: 68,\n    0x188D: 68,\n    0x188E: 68,\n    0x188F: 68,\n    0x1890: 68,\n    0x1891: 68,\n    0x1892: 68,\n    0x1893: 68,\n    0x1894: 68,\n    0x1895: 68,\n    0x1896: 68,\n    0x1897: 68,\n    0x1898: 68,\n    0x1899: 68,\n    0x189A: 68,\n    0x189B: 68,\n    0x189C: 68,\n    0x189D: 68,\n    0x189E: 68,\n    0x189F: 68,\n    0x18A0: 68,\n    0x18A1: 68,\n    0x18A2: 68,\n    0x18A3: 68,\n    0x18A4: 68,\n    0x18A5: 68,\n    0x18A6: 68,\n    0x18A7: 68,\n    0x18A8: 68,\n    0x18A9: 84,\n    0x18AA: 68,\n    0x1920: 84,\n    0x1921: 84,\n    0x1922: 84,\n    0x1927: 84,\n    0x1928: 84,\n    0x1932: 84,\n    0x1939: 84,\n    0x193A: 84,\n    0x193B: 84,\n    0x1A17: 84,\n    0x1A18: 84,\n    0x1A1B: 84,\n    0x1A56: 84,\n    0x1A58: 84,\n    0x1A59: 84,\n    0x1A5A: 84,\n    0x1A5B: 84,\n    0x1A5C: 84,\n    0x1A5D: 84,\n    0x1A5E: 84,\n    0x1A60: 84,\n    0x1A62: 84,\n    0x1A65: 84,\n    0x1A66: 84,\n    0x1A67: 84,\n    0x1A68: 84,\n    0x1A69: 84,\n    0x1A6A: 84,\n    0x1A6B: 84,\n    0x1A6C: 84,\n    0x1A73: 84,\n    0x1A74: 84,\n    0x1A75: 84,\n    0x1A76: 84,\n    0x1A77: 84,\n    0x1A78: 84,\n    0x1A79: 84,\n    0x1A7A: 84,\n    0x1A7B: 84,\n    0x1A7C: 84,\n    0x1A7F: 84,\n    0x1AB0: 84,\n    0x1AB1: 84,\n    0x1AB2: 84,\n    0x1AB3: 84,\n    0x1AB4: 84,\n    0x1AB5: 84,\n    0x1AB6: 84,\n    0x1AB7: 84,\n    0x1AB8: 84,\n    0x1AB9: 84,\n    0x1ABA: 84,\n    0x1ABB: 84,\n    0x1ABC: 84,\n    0x1ABD: 84,\n    0x1ABE: 84,\n    0x1ABF: 84,\n    0x1AC0: 84,\n    0x1AC1: 84,\n    0x1AC2: 84,\n    0x1AC3: 84,\n    0x1AC4: 84,\n    0x1AC5: 84,\n    0x1AC6: 84,\n    0x1AC7: 84,\n    0x1AC8: 84,\n    0x1AC9: 84,\n    0x1ACA: 84,\n    0x1ACB: 84,\n    0x1ACC: 84,\n    0x1ACD: 84,\n    0x1ACE: 84,\n    0x1B00: 84,\n    0x1B01: 84,\n    0x1B02: 84,\n    0x1B03: 84,\n    0x1B34: 84,\n    0x1B36: 84,\n    0x1B37: 84,\n    0x1B38: 84,\n    0x1B39: 84,\n    0x1B3A: 84,\n    0x1B3C: 84,\n    0x1B42: 84,\n    0x1B6B: 84,\n    0x1B6C: 84,\n    0x1B6D: 84,\n    0x1B6E: 84,\n    0x1B6F: 84,\n    0x1B70: 84,\n    0x1B71: 84,\n    0x1B72: 84,\n    0x1B73: 84,\n    0x1B80: 84,\n    0x1B81: 84,\n    0x1BA2: 84,\n    0x1BA3: 84,\n    0x1BA4: 84,\n    0x1BA5: 84,\n    0x1BA8: 84,\n    0x1BA9: 84,\n    0x1BAB: 84,\n    0x1BAC: 84,\n    0x1BAD: 84,\n    0x1BE6: 84,\n    0x1BE8: 84,\n    0x1BE9: 84,\n    0x1BED: 84,\n    0x1BEF: 84,\n    0x1BF0: 84,\n    0x1BF1: 84,\n    0x1C2C: 84,\n    0x1C2D: 84,\n    0x1C2E: 84,\n    0x1C2F: 84,\n    0x1C30: 84,\n    0x1C31: 84,\n    0x1C32: 84,\n    0x1C33: 84,\n    0x1C36: 84,\n    0x1C37: 84,\n    0x1CD0: 84,\n    0x1CD1: 84,\n    0x1CD2: 84,\n    0x1CD4: 84,\n    0x1CD5: 84,\n    0x1CD6: 84,\n    0x1CD7: 84,\n    0x1CD8: 84,\n    0x1CD9: 84,\n    0x1CDA: 84,\n    0x1CDB: 84,\n    0x1CDC: 84,\n    0x1CDD: 84,\n    0x1CDE: 84,\n    0x1CDF: 84,\n    0x1CE0: 84,\n    0x1CE2: 84,\n    0x1CE3: 84,\n    0x1CE4: 84,\n    0x1CE5: 84,\n    0x1CE6: 84,\n    0x1CE7: 84,\n    0x1CE8: 84,\n    0x1CED: 84,\n    0x1CF4: 84,\n    0x1CF8: 84,\n    0x1CF9: 84,\n    0x1DC0: 84,\n    0x1DC1: 84,\n    0x1DC2: 84,\n    0x1DC3: 84,\n    0x1DC4: 84,\n    0x1DC5: 84,\n    0x1DC6: 84,\n    0x1DC7: 84,\n    0x1DC8: 84,\n    0x1DC9: 84,\n    0x1DCA: 84,\n    0x1DCB: 84,\n    0x1DCC: 84,\n    0x1DCD: 84,\n    0x1DCE: 84,\n    0x1DCF: 84,\n    0x1DD0: 84,\n    0x1DD1: 84,\n    0x1DD2: 84,\n    0x1DD3: 84,\n    0x1DD4: 84,\n    0x1DD5: 84,\n    0x1DD6: 84,\n    0x1DD7: 84,\n    0x1DD8: 84,\n    0x1DD9: 84,\n    0x1DDA: 84,\n    0x1DDB: 84,\n    0x1DDC: 84,\n    0x1DDD: 84,\n    0x1DDE: 84,\n    0x1DDF: 84,\n    0x1DE0: 84,\n    0x1DE1: 84,\n    0x1DE2: 84,\n    0x1DE3: 84,\n    0x1DE4: 84,\n    0x1DE5: 84,\n    0x1DE6: 84,\n    0x1DE7: 84,\n    0x1DE8: 84,\n    0x1DE9: 84,\n    0x1DEA: 84,\n    0x1DEB: 84,\n    0x1DEC: 84,\n    0x1DED: 84,\n    0x1DEE: 84,\n    0x1DEF: 84,\n    0x1DF0: 84,\n    0x1DF1: 84,\n    0x1DF2: 84,\n    0x1DF3: 84,\n    0x1DF4: 84,\n    0x1DF5: 84,\n    0x1DF6: 84,\n    0x1DF7: 84,\n    0x1DF8: 84,\n    0x1DF9: 84,\n    0x1DFA: 84,\n    0x1DFB: 84,\n    0x1DFC: 84,\n    0x1DFD: 84,\n    0x1DFE: 84,\n    0x1DFF: 84,\n    0x200B: 84,\n    0x200D: 67,\n    0x200E: 84,\n    0x200F: 84,\n    0x202A: 84,\n    0x202B: 84,\n    0x202C: 84,\n    0x202D: 84,\n    0x202E: 84,\n    0x2060: 84,\n    0x2061: 84,\n    0x2062: 84,\n    0x2063: 84,\n    0x2064: 84,\n    0x206A: 84,\n    0x206B: 84,\n    0x206C: 84,\n    0x206D: 84,\n    0x206E: 84,\n    0x206F: 84,\n    0x20D0: 84,\n    0x20D1: 84,\n    0x20D2: 84,\n    0x20D3: 84,\n    0x20D4: 84,\n    0x20D5: 84,\n    0x20D6: 84,\n    0x20D7: 84,\n    0x20D8: 84,\n    0x20D9: 84,\n    0x20DA: 84,\n    0x20DB: 84,\n    0x20DC: 84,\n    0x20DD: 84,\n    0x20DE: 84,\n    0x20DF: 84,\n    0x20E0: 84,\n    0x20E1: 84,\n    0x20E2: 84,\n    0x20E3: 84,\n    0x20E4: 84,\n    0x20E5: 84,\n    0x20E6: 84,\n    0x20E7: 84,\n    0x20E8: 84,\n    0x20E9: 84,\n    0x20EA: 84,\n    0x20EB: 84,\n    0x20EC: 84,\n    0x20ED: 84,\n    0x20EE: 84,\n    0x20EF: 84,\n    0x20F0: 84,\n    0x2CEF: 84,\n    0x2CF0: 84,\n    0x2CF1: 84,\n    0x2D7F: 84,\n    0x2DE0: 84,\n    0x2DE1: 84,\n    0x2DE2: 84,\n    0x2DE3: 84,\n    0x2DE4: 84,\n    0x2DE5: 84,\n    0x2DE6: 84,\n    0x2DE7: 84,\n    0x2DE8: 84,\n    0x2DE9: 84,\n    0x2DEA: 84,\n    0x2DEB: 84,\n    0x2DEC: 84,\n    0x2DED: 84,\n    0x2DEE: 84,\n    0x2DEF: 84,\n    0x2DF0: 84,\n    0x2DF1: 84,\n    0x2DF2: 84,\n    0x2DF3: 84,\n    0x2DF4: 84,\n    0x2DF5: 84,\n    0x2DF6: 84,\n    0x2DF7: 84,\n    0x2DF8: 84,\n    0x2DF9: 84,\n    0x2DFA: 84,\n    0x2DFB: 84,\n    0x2DFC: 84,\n    0x2DFD: 84,\n    0x2DFE: 84,\n    0x2DFF: 84,\n    0x302A: 84,\n    0x302B: 84,\n    0x302C: 84,\n    0x302D: 84,\n    0x3099: 84,\n    0x309A: 84,\n    0xA66F: 84,\n    0xA670: 84,\n    0xA671: 84,\n    0xA672: 84,\n    0xA674: 84,\n    0xA675: 84,\n    0xA676: 84,\n    0xA677: 84,\n    0xA678: 84,\n    0xA679: 84,\n    0xA67A: 84,\n    0xA67B: 84,\n    0xA67C: 84,\n    0xA67D: 84,\n    0xA69E: 84,\n    0xA69F: 84,\n    0xA6F0: 84,\n    0xA6F1: 84,\n    0xA802: 84,\n    0xA806: 84,\n    0xA80B: 84,\n    0xA825: 84,\n    0xA826: 84,\n    0xA82C: 84,\n    0xA840: 68,\n    0xA841: 68,\n    0xA842: 68,\n    0xA843: 68,\n    0xA844: 68,\n    0xA845: 68,\n    0xA846: 68,\n    0xA847: 68,\n    0xA848: 68,\n    0xA849: 68,\n    0xA84A: 68,\n    0xA84B: 68,\n    0xA84C: 68,\n    0xA84D: 68,\n    0xA84E: 68,\n    0xA84F: 68,\n    0xA850: 68,\n    0xA851: 68,\n    0xA852: 68,\n    0xA853: 68,\n    0xA854: 68,\n    0xA855: 68,\n    0xA856: 68,\n    0xA857: 68,\n    0xA858: 68,\n    0xA859: 68,\n    0xA85A: 68,\n    0xA85B: 68,\n    0xA85C: 68,\n    0xA85D: 68,\n    0xA85E: 68,\n    0xA85F: 68,\n    0xA860: 68,\n    0xA861: 68,\n    0xA862: 68,\n    0xA863: 68,\n    0xA864: 68,\n    0xA865: 68,\n    0xA866: 68,\n    0xA867: 68,\n    0xA868: 68,\n    0xA869: 68,\n    0xA86A: 68,\n    0xA86B: 68,\n    0xA86C: 68,\n    0xA86D: 68,\n    0xA86E: 68,\n    0xA86F: 68,\n    0xA870: 68,\n    0xA871: 68,\n    0xA872: 76,\n    0xA8C4: 84,\n    0xA8C5: 84,\n    0xA8E0: 84,\n    0xA8E1: 84,\n    0xA8E2: 84,\n    0xA8E3: 84,\n    0xA8E4: 84,\n    0xA8E5: 84,\n    0xA8E6: 84,\n    0xA8E7: 84,\n    0xA8E8: 84,\n    0xA8E9: 84,\n    0xA8EA: 84,\n    0xA8EB: 84,\n    0xA8EC: 84,\n    0xA8ED: 84,\n    0xA8EE: 84,\n    0xA8EF: 84,\n    0xA8F0: 84,\n    0xA8F1: 84,\n    0xA8FF: 84,\n    0xA926: 84,\n    0xA927: 84,\n    0xA928: 84,\n    0xA929: 84,\n    0xA92A: 84,\n    0xA92B: 84,\n    0xA92C: 84,\n    0xA92D: 84,\n    0xA947: 84,\n    0xA948: 84,\n    0xA949: 84,\n    0xA94A: 84,\n    0xA94B: 84,\n    0xA94C: 84,\n    0xA94D: 84,\n    0xA94E: 84,\n    0xA94F: 84,\n    0xA950: 84,\n    0xA951: 84,\n    0xA980: 84,\n    0xA981: 84,\n    0xA982: 84,\n    0xA9B3: 84,\n    0xA9B6: 84,\n    0xA9B7: 84,\n    0xA9B8: 84,\n    0xA9B9: 84,\n    0xA9BC: 84,\n    0xA9BD: 84,\n    0xA9E5: 84,\n    0xAA29: 84,\n    0xAA2A: 84,\n    0xAA2B: 84,\n    0xAA2C: 84,\n    0xAA2D: 84,\n    0xAA2E: 84,\n    0xAA31: 84,\n    0xAA32: 84,\n    0xAA35: 84,\n    0xAA36: 84,\n    0xAA43: 84,\n    0xAA4C: 84,\n    0xAA7C: 84,\n    0xAAB0: 84,\n    0xAAB2: 84,\n    0xAAB3: 84,\n    0xAAB4: 84,\n    0xAAB7: 84,\n    0xAAB8: 84,\n    0xAABE: 84,\n    0xAABF: 84,\n    0xAAC1: 84,\n    0xAAEC: 84,\n    0xAAED: 84,\n    0xAAF6: 84,\n    0xABE5: 84,\n    0xABE8: 84,\n    0xABED: 84,\n    0xFB1E: 84,\n    0xFE00: 84,\n    0xFE01: 84,\n    0xFE02: 84,\n    0xFE03: 84,\n    0xFE04: 84,\n    0xFE05: 84,\n    0xFE06: 84,\n    0xFE07: 84,\n    0xFE08: 84,\n    0xFE09: 84,\n    0xFE0A: 84,\n    0xFE0B: 84,\n    0xFE0C: 84,\n    0xFE0D: 84,\n    0xFE0E: 84,\n    0xFE0F: 84,\n    0xFE20: 84,\n    0xFE21: 84,\n    0xFE22: 84,\n    0xFE23: 84,\n    0xFE24: 84,\n    0xFE25: 84,\n    0xFE26: 84,\n    0xFE27: 84,\n    0xFE28: 84,\n    0xFE29: 84,\n    0xFE2A: 84,\n    0xFE2B: 84,\n    0xFE2C: 84,\n    0xFE2D: 84,\n    0xFE2E: 84,\n    0xFE2F: 84,\n    0xFEFF: 84,\n    0xFFF9: 84,\n    0xFFFA: 84,\n    0xFFFB: 84,\n    0x101FD: 84,\n    0x102E0: 84,\n    0x10376: 84,\n    0x10377: 84,\n    0x10378: 84,\n    0x10379: 84,\n    0x1037A: 84,\n    0x10A01: 84,\n    0x10A02: 84,\n    0x10A03: 84,\n    0x10A05: 84,\n    0x10A06: 84,\n    0x10A0C: 84,\n    0x10A0D: 84,\n    0x10A0E: 84,\n    0x10A0F: 84,\n    0x10A38: 84,\n    0x10A39: 84,\n    0x10A3A: 84,\n    0x10A3F: 84,\n    0x10AC0: 68,\n    0x10AC1: 68,\n    0x10AC2: 68,\n    0x10AC3: 68,\n    0x10AC4: 68,\n    0x10AC5: 82,\n    0x10AC7: 82,\n    0x10AC9: 82,\n    0x10ACA: 82,\n    0x10ACD: 76,\n    0x10ACE: 82,\n    0x10ACF: 82,\n    0x10AD0: 82,\n    0x10AD1: 82,\n    0x10AD2: 82,\n    0x10AD3: 68,\n    0x10AD4: 68,\n    0x10AD5: 68,\n    0x10AD6: 68,\n    0x10AD7: 76,\n    0x10AD8: 68,\n    0x10AD9: 68,\n    0x10ADA: 68,\n    0x10ADB: 68,\n    0x10ADC: 68,\n    0x10ADD: 82,\n    0x10ADE: 68,\n    0x10ADF: 68,\n    0x10AE0: 68,\n    0x10AE1: 82,\n    0x10AE4: 82,\n    0x10AE5: 84,\n    0x10AE6: 84,\n    0x10AEB: 68,\n    0x10AEC: 68,\n    0x10AED: 68,\n    0x10AEE: 68,\n    0x10AEF: 82,\n    0x10B80: 68,\n    0x10B81: 82,\n    0x10B82: 68,\n    0x10B83: 82,\n    0x10B84: 82,\n    0x10B85: 82,\n    0x10B86: 68,\n    0x10B87: 68,\n    0x10B88: 68,\n    0x10B89: 82,\n    0x10B8A: 68,\n    0x10B8B: 68,\n    0x10B8C: 82,\n    0x10B8D: 68,\n    0x10B8E: 82,\n    0x10B8F: 82,\n    0x10B90: 68,\n    0x10B91: 82,\n    0x10BA9: 82,\n    0x10BAA: 82,\n    0x10BAB: 82,\n    0x10BAC: 82,\n    0x10BAD: 68,\n    0x10BAE: 68,\n    0x10D00: 76,\n    0x10D01: 68,\n    0x10D02: 68,\n    0x10D03: 68,\n    0x10D04: 68,\n    0x10D05: 68,\n    0x10D06: 68,\n    0x10D07: 68,\n    0x10D08: 68,\n    0x10D09: 68,\n    0x10D0A: 68,\n    0x10D0B: 68,\n    0x10D0C: 68,\n    0x10D0D: 68,\n    0x10D0E: 68,\n    0x10D0F: 68,\n    0x10D10: 68,\n    0x10D11: 68,\n    0x10D12: 68,\n    0x10D13: 68,\n    0x10D14: 68,\n    0x10D15: 68,\n    0x10D16: 68,\n    0x10D17: 68,\n    0x10D18: 68,\n    0x10D19: 68,\n    0x10D1A: 68,\n    0x10D1B: 68,\n    0x10D1C: 68,\n    0x10D1D: 68,\n    0x10D1E: 68,\n    0x10D1F: 68,\n    0x10D20: 68,\n    0x10D21: 68,\n    0x10D22: 82,\n    0x10D23: 68,\n    0x10D24: 84,\n    0x10D25: 84,\n    0x10D26: 84,\n    0x10D27: 84,\n    0x10EAB: 84,\n    0x10EAC: 84,\n    0x10EFD: 84,\n    0x10EFE: 84,\n    0x10EFF: 84,\n    0x10F30: 68,\n    0x10F31: 68,\n    0x10F32: 68,\n    0x10F33: 82,\n    0x10F34: 68,\n    0x10F35: 68,\n    0x10F36: 68,\n    0x10F37: 68,\n    0x10F38: 68,\n    0x10F39: 68,\n    0x10F3A: 68,\n    0x10F3B: 68,\n    0x10F3C: 68,\n    0x10F3D: 68,\n    0x10F3E: 68,\n    0x10F3F: 68,\n    0x10F40: 68,\n    0x10F41: 68,\n    0x10F42: 68,\n    0x10F43: 68,\n    0x10F44: 68,\n    0x10F46: 84,\n    0x10F47: 84,\n    0x10F48: 84,\n    0x10F49: 84,\n    0x10F4A: 84,\n    0x10F4B: 84,\n    0x10F4C: 84,\n    0x10F4D: 84,\n    0x10F4E: 84,\n    0x10F4F: 84,\n    0x10F50: 84,\n    0x10F51: 68,\n    0x10F52: 68,\n    0x10F53: 68,\n    0x10F54: 82,\n    0x10F70: 68,\n    0x10F71: 68,\n    0x10F72: 68,\n    0x10F73: 68,\n    0x10F74: 82,\n    0x10F75: 82,\n    0x10F76: 68,\n    0x10F77: 68,\n    0x10F78: 68,\n    0x10F79: 68,\n    0x10F7A: 68,\n    0x10F7B: 68,\n    0x10F7C: 68,\n    0x10F7D: 68,\n    0x10F7E: 68,\n    0x10F7F: 68,\n    0x10F80: 68,\n    0x10F81: 68,\n    0x10F82: 84,\n    0x10F83: 84,\n    0x10F84: 84,\n    0x10F85: 84,\n    0x10FB0: 68,\n    0x10FB2: 68,\n    0x10FB3: 68,\n    0x10FB4: 82,\n    0x10FB5: 82,\n    0x10FB6: 82,\n    0x10FB8: 68,\n    0x10FB9: 82,\n    0x10FBA: 82,\n    0x10FBB: 68,\n    0x10FBC: 68,\n    0x10FBD: 82,\n    0x10FBE: 68,\n    0x10FBF: 68,\n    0x10FC1: 68,\n    0x10FC2: 82,\n    0x10FC3: 82,\n    0x10FC4: 68,\n    0x10FC9: 82,\n    0x10FCA: 68,\n    0x10FCB: 76,\n    0x11001: 84,\n    0x11038: 84,\n    0x11039: 84,\n    0x1103A: 84,\n    0x1103B: 84,\n    0x1103C: 84,\n    0x1103D: 84,\n    0x1103E: 84,\n    0x1103F: 84,\n    0x11040: 84,\n    0x11041: 84,\n    0x11042: 84,\n    0x11043: 84,\n    0x11044: 84,\n    0x11045: 84,\n    0x11046: 84,\n    0x11070: 84,\n    0x11073: 84,\n    0x11074: 84,\n    0x1107F: 84,\n    0x11080: 84,\n    0x11081: 84,\n    0x110B3: 84,\n    0x110B4: 84,\n    0x110B5: 84,\n    0x110B6: 84,\n    0x110B9: 84,\n    0x110BA: 84,\n    0x110C2: 84,\n    0x11100: 84,\n    0x11101: 84,\n    0x11102: 84,\n    0x11127: 84,\n    0x11128: 84,\n    0x11129: 84,\n    0x1112A: 84,\n    0x1112B: 84,\n    0x1112D: 84,\n    0x1112E: 84,\n    0x1112F: 84,\n    0x11130: 84,\n    0x11131: 84,\n    0x11132: 84,\n    0x11133: 84,\n    0x11134: 84,\n    0x11173: 84,\n    0x11180: 84,\n    0x11181: 84,\n    0x111B6: 84,\n    0x111B7: 84,\n    0x111B8: 84,\n    0x111B9: 84,\n    0x111BA: 84,\n    0x111BB: 84,\n    0x111BC: 84,\n    0x111BD: 84,\n    0x111BE: 84,\n    0x111C9: 84,\n    0x111CA: 84,\n    0x111CB: 84,\n    0x111CC: 84,\n    0x111CF: 84,\n    0x1122F: 84,\n    0x11230: 84,\n    0x11231: 84,\n    0x11234: 84,\n    0x11236: 84,\n    0x11237: 84,\n    0x1123E: 84,\n    0x11241: 84,\n    0x112DF: 84,\n    0x112E3: 84,\n    0x112E4: 84,\n    0x112E5: 84,\n    0x112E6: 84,\n    0x112E7: 84,\n    0x112E8: 84,\n    0x112E9: 84,\n    0x112EA: 84,\n    0x11300: 84,\n    0x11301: 84,\n    0x1133B: 84,\n    0x1133C: 84,\n    0x11340: 84,\n    0x11366: 84,\n    0x11367: 84,\n    0x11368: 84,\n    0x11369: 84,\n    0x1136A: 84,\n    0x1136B: 84,\n    0x1136C: 84,\n    0x11370: 84,\n    0x11371: 84,\n    0x11372: 84,\n    0x11373: 84,\n    0x11374: 84,\n    0x11438: 84,\n    0x11439: 84,\n    0x1143A: 84,\n    0x1143B: 84,\n    0x1143C: 84,\n    0x1143D: 84,\n    0x1143E: 84,\n    0x1143F: 84,\n    0x11442: 84,\n    0x11443: 84,\n    0x11444: 84,\n    0x11446: 84,\n    0x1145E: 84,\n    0x114B3: 84,\n    0x114B4: 84,\n    0x114B5: 84,\n    0x114B6: 84,\n    0x114B7: 84,\n    0x114B8: 84,\n    0x114BA: 84,\n    0x114BF: 84,\n    0x114C0: 84,\n    0x114C2: 84,\n    0x114C3: 84,\n    0x115B2: 84,\n    0x115B3: 84,\n    0x115B4: 84,\n    0x115B5: 84,\n    0x115BC: 84,\n    0x115BD: 84,\n    0x115BF: 84,\n    0x115C0: 84,\n    0x115DC: 84,\n    0x115DD: 84,\n    0x11633: 84,\n    0x11634: 84,\n    0x11635: 84,\n    0x11636: 84,\n    0x11637: 84,\n    0x11638: 84,\n    0x11639: 84,\n    0x1163A: 84,\n    0x1163D: 84,\n    0x1163F: 84,\n    0x11640: 84,\n    0x116AB: 84,\n    0x116AD: 84,\n    0x116B0: 84,\n    0x116B1: 84,\n    0x116B2: 84,\n    0x116B3: 84,\n    0x116B4: 84,\n    0x116B5: 84,\n    0x116B7: 84,\n    0x1171D: 84,\n    0x1171E: 84,\n    0x1171F: 84,\n    0x11722: 84,\n    0x11723: 84,\n    0x11724: 84,\n    0x11725: 84,\n    0x11727: 84,\n    0x11728: 84,\n    0x11729: 84,\n    0x1172A: 84,\n    0x1172B: 84,\n    0x1182F: 84,\n    0x11830: 84,\n    0x11831: 84,\n    0x11832: 84,\n    0x11833: 84,\n    0x11834: 84,\n    0x11835: 84,\n    0x11836: 84,\n    0x11837: 84,\n    0x11839: 84,\n    0x1183A: 84,\n    0x1193B: 84,\n    0x1193C: 84,\n    0x1193E: 84,\n    0x11943: 84,\n    0x119D4: 84,\n    0x119D5: 84,\n    0x119D6: 84,\n    0x119D7: 84,\n    0x119DA: 84,\n    0x119DB: 84,\n    0x119E0: 84,\n    0x11A01: 84,\n    0x11A02: 84,\n    0x11A03: 84,\n    0x11A04: 84,\n    0x11A05: 84,\n    0x11A06: 84,\n    0x11A07: 84,\n    0x11A08: 84,\n    0x11A09: 84,\n    0x11A0A: 84,\n    0x11A33: 84,\n    0x11A34: 84,\n    0x11A35: 84,\n    0x11A36: 84,\n    0x11A37: 84,\n    0x11A38: 84,\n    0x11A3B: 84,\n    0x11A3C: 84,\n    0x11A3D: 84,\n    0x11A3E: 84,\n    0x11A47: 84,\n    0x11A51: 84,\n    0x11A52: 84,\n    0x11A53: 84,\n    0x11A54: 84,\n    0x11A55: 84,\n    0x11A56: 84,\n    0x11A59: 84,\n    0x11A5A: 84,\n    0x11A5B: 84,\n    0x11A8A: 84,\n    0x11A8B: 84,\n    0x11A8C: 84,\n    0x11A8D: 84,\n    0x11A8E: 84,\n    0x11A8F: 84,\n    0x11A90: 84,\n    0x11A91: 84,\n    0x11A92: 84,\n    0x11A93: 84,\n    0x11A94: 84,\n    0x11A95: 84,\n    0x11A96: 84,\n    0x11A98: 84,\n    0x11A99: 84,\n    0x11C30: 84,\n    0x11C31: 84,\n    0x11C32: 84,\n    0x11C33: 84,\n    0x11C34: 84,\n    0x11C35: 84,\n    0x11C36: 84,\n    0x11C38: 84,\n    0x11C39: 84,\n    0x11C3A: 84,\n    0x11C3B: 84,\n    0x11C3C: 84,\n    0x11C3D: 84,\n    0x11C3F: 84,\n    0x11C92: 84,\n    0x11C93: 84,\n    0x11C94: 84,\n    0x11C95: 84,\n    0x11C96: 84,\n    0x11C97: 84,\n    0x11C98: 84,\n    0x11C99: 84,\n    0x11C9A: 84,\n    0x11C9B: 84,\n    0x11C9C: 84,\n    0x11C9D: 84,\n    0x11C9E: 84,\n    0x11C9F: 84,\n    0x11CA0: 84,\n    0x11CA1: 84,\n    0x11CA2: 84,\n    0x11CA3: 84,\n    0x11CA4: 84,\n    0x11CA5: 84,\n    0x11CA6: 84,\n    0x11CA7: 84,\n    0x11CAA: 84,\n    0x11CAB: 84,\n    0x11CAC: 84,\n    0x11CAD: 84,\n    0x11CAE: 84,\n    0x11CAF: 84,\n    0x11CB0: 84,\n    0x11CB2: 84,\n    0x11CB3: 84,\n    0x11CB5: 84,\n    0x11CB6: 84,\n    0x11D31: 84,\n    0x11D32: 84,\n    0x11D33: 84,\n    0x11D34: 84,\n    0x11D35: 84,\n    0x11D36: 84,\n    0x11D3A: 84,\n    0x11D3C: 84,\n    0x11D3D: 84,\n    0x11D3F: 84,\n    0x11D40: 84,\n    0x11D41: 84,\n    0x11D42: 84,\n    0x11D43: 84,\n    0x11D44: 84,\n    0x11D45: 84,\n    0x11D47: 84,\n    0x11D90: 84,\n    0x11D91: 84,\n    0x11D95: 84,\n    0x11D97: 84,\n    0x11EF3: 84,\n    0x11EF4: 84,\n    0x11F00: 84,\n    0x11F01: 84,\n    0x11F36: 84,\n    0x11F37: 84,\n    0x11F38: 84,\n    0x11F39: 84,\n    0x11F3A: 84,\n    0x11F40: 84,\n    0x11F42: 84,\n    0x13430: 84,\n    0x13431: 84,\n    0x13432: 84,\n    0x13433: 84,\n    0x13434: 84,\n    0x13435: 84,\n    0x13436: 84,\n    0x13437: 84,\n    0x13438: 84,\n    0x13439: 84,\n    0x1343A: 84,\n    0x1343B: 84,\n    0x1343C: 84,\n    0x1343D: 84,\n    0x1343E: 84,\n    0x1343F: 84,\n    0x13440: 84,\n    0x13447: 84,\n    0x13448: 84,\n    0x13449: 84,\n    0x1344A: 84,\n    0x1344B: 84,\n    0x1344C: 84,\n    0x1344D: 84,\n    0x1344E: 84,\n    0x1344F: 84,\n    0x13450: 84,\n    0x13451: 84,\n    0x13452: 84,\n    0x13453: 84,\n    0x13454: 84,\n    0x13455: 84,\n    0x16AF0: 84,\n    0x16AF1: 84,\n    0x16AF2: 84,\n    0x16AF3: 84,\n    0x16AF4: 84,\n    0x16B30: 84,\n    0x16B31: 84,\n    0x16B32: 84,\n    0x16B33: 84,\n    0x16B34: 84,\n    0x16B35: 84,\n    0x16B36: 84,\n    0x16F4F: 84,\n    0x16F8F: 84,\n    0x16F90: 84,\n    0x16F91: 84,\n    0x16F92: 84,\n    0x16FE4: 84,\n    0x1BC9D: 84,\n    0x1BC9E: 84,\n    0x1BCA0: 84,\n    0x1BCA1: 84,\n    0x1BCA2: 84,\n    0x1BCA3: 84,\n    0x1CF00: 84,\n    0x1CF01: 84,\n    0x1CF02: 84,\n    0x1CF03: 84,\n    0x1CF04: 84,\n    0x1CF05: 84,\n    0x1CF06: 84,\n    0x1CF07: 84,\n    0x1CF08: 84,\n    0x1CF09: 84,\n    0x1CF0A: 84,\n    0x1CF0B: 84,\n    0x1CF0C: 84,\n    0x1CF0D: 84,\n    0x1CF0E: 84,\n    0x1CF0F: 84,\n    0x1CF10: 84,\n    0x1CF11: 84,\n    0x1CF12: 84,\n    0x1CF13: 84,\n    0x1CF14: 84,\n    0x1CF15: 84,\n    0x1CF16: 84,\n    0x1CF17: 84,\n    0x1CF18: 84,\n    0x1CF19: 84,\n    0x1CF1A: 84,\n    0x1CF1B: 84,\n    0x1CF1C: 84,\n    0x1CF1D: 84,\n    0x1CF1E: 84,\n    0x1CF1F: 84,\n    0x1CF20: 84,\n    0x1CF21: 84,\n    0x1CF22: 84,\n    0x1CF23: 84,\n    0x1CF24: 84,\n    0x1CF25: 84,\n    0x1CF26: 84,\n    0x1CF27: 84,\n    0x1CF28: 84,\n    0x1CF29: 84,\n    0x1CF2A: 84,\n    0x1CF2B: 84,\n    0x1CF2C: 84,\n    0x1CF2D: 84,\n    0x1CF30: 84,\n    0x1CF31: 84,\n    0x1CF32: 84,\n    0x1CF33: 84,\n    0x1CF34: 84,\n    0x1CF35: 84,\n    0x1CF36: 84,\n    0x1CF37: 84,\n    0x1CF38: 84,\n    0x1CF39: 84,\n    0x1CF3A: 84,\n    0x1CF3B: 84,\n    0x1CF3C: 84,\n    0x1CF3D: 84,\n    0x1CF3E: 84,\n    0x1CF3F: 84,\n    0x1CF40: 84,\n    0x1CF41: 84,\n    0x1CF42: 84,\n    0x1CF43: 84,\n    0x1CF44: 84,\n    0x1CF45: 84,\n    0x1CF46: 84,\n    0x1D167: 84,\n    0x1D168: 84,\n    0x1D169: 84,\n    0x1D173: 84,\n    0x1D174: 84,\n    0x1D175: 84,\n    0x1D176: 84,\n    0x1D177: 84,\n    0x1D178: 84,\n    0x1D179: 84,\n    0x1D17A: 84,\n    0x1D17B: 84,\n    0x1D17C: 84,\n    0x1D17D: 84,\n    0x1D17E: 84,\n    0x1D17F: 84,\n    0x1D180: 84,\n    0x1D181: 84,\n    0x1D182: 84,\n    0x1D185: 84,\n    0x1D186: 84,\n    0x1D187: 84,\n    0x1D188: 84,\n    0x1D189: 84,\n    0x1D18A: 84,\n    0x1D18B: 84,\n    0x1D1AA: 84,\n    0x1D1AB: 84,\n    0x1D1AC: 84,\n    0x1D1AD: 84,\n    0x1D242: 84,\n    0x1D243: 84,\n    0x1D244: 84,\n    0x1DA00: 84,\n    0x1DA01: 84,\n    0x1DA02: 84,\n    0x1DA03: 84,\n    0x1DA04: 84,\n    0x1DA05: 84,\n    0x1DA06: 84,\n    0x1DA07: 84,\n    0x1DA08: 84,\n    0x1DA09: 84,\n    0x1DA0A: 84,\n    0x1DA0B: 84,\n    0x1DA0C: 84,\n    0x1DA0D: 84,\n    0x1DA0E: 84,\n    0x1DA0F: 84,\n    0x1DA10: 84,\n    0x1DA11: 84,\n    0x1DA12: 84,\n    0x1DA13: 84,\n    0x1DA14: 84,\n    0x1DA15: 84,\n    0x1DA16: 84,\n    0x1DA17: 84,\n    0x1DA18: 84,\n    0x1DA19: 84,\n    0x1DA1A: 84,\n    0x1DA1B: 84,\n    0x1DA1C: 84,\n    0x1DA1D: 84,\n    0x1DA1E: 84,\n    0x1DA1F: 84,\n    0x1DA20: 84,\n    0x1DA21: 84,\n    0x1DA22: 84,\n    0x1DA23: 84,\n    0x1DA24: 84,\n    0x1DA25: 84,\n    0x1DA26: 84,\n    0x1DA27: 84,\n    0x1DA28: 84,\n    0x1DA29: 84,\n    0x1DA2A: 84,\n    0x1DA2B: 84,\n    0x1DA2C: 84,\n    0x1DA2D: 84,\n    0x1DA2E: 84,\n    0x1DA2F: 84,\n    0x1DA30: 84,\n    0x1DA31: 84,\n    0x1DA32: 84,\n    0x1DA33: 84,\n    0x1DA34: 84,\n    0x1DA35: 84,\n    0x1DA36: 84,\n    0x1DA3B: 84,\n    0x1DA3C: 84,\n    0x1DA3D: 84,\n    0x1DA3E: 84,\n    0x1DA3F: 84,\n    0x1DA40: 84,\n    0x1DA41: 84,\n    0x1DA42: 84,\n    0x1DA43: 84,\n    0x1DA44: 84,\n    0x1DA45: 84,\n    0x1DA46: 84,\n    0x1DA47: 84,\n    0x1DA48: 84,\n    0x1DA49: 84,\n    0x1DA4A: 84,\n    0x1DA4B: 84,\n    0x1DA4C: 84,\n    0x1DA4D: 84,\n    0x1DA4E: 84,\n    0x1DA4F: 84,\n    0x1DA50: 84,\n    0x1DA51: 84,\n    0x1DA52: 84,\n    0x1DA53: 84,\n    0x1DA54: 84,\n    0x1DA55: 84,\n    0x1DA56: 84,\n    0x1DA57: 84,\n    0x1DA58: 84,\n    0x1DA59: 84,\n    0x1DA5A: 84,\n    0x1DA5B: 84,\n    0x1DA5C: 84,\n    0x1DA5D: 84,\n    0x1DA5E: 84,\n    0x1DA5F: 84,\n    0x1DA60: 84,\n    0x1DA61: 84,\n    0x1DA62: 84,\n    0x1DA63: 84,\n    0x1DA64: 84,\n    0x1DA65: 84,\n    0x1DA66: 84,\n    0x1DA67: 84,\n    0x1DA68: 84,\n    0x1DA69: 84,\n    0x1DA6A: 84,\n    0x1DA6B: 84,\n    0x1DA6C: 84,\n    0x1DA75: 84,\n    0x1DA84: 84,\n    0x1DA9B: 84,\n    0x1DA9C: 84,\n    0x1DA9D: 84,\n    0x1DA9E: 84,\n    0x1DA9F: 84,\n    0x1DAA1: 84,\n    0x1DAA2: 84,\n    0x1DAA3: 84,\n    0x1DAA4: 84,\n    0x1DAA5: 84,\n    0x1DAA6: 84,\n    0x1DAA7: 84,\n    0x1DAA8: 84,\n    0x1DAA9: 84,\n    0x1DAAA: 84,\n    0x1DAAB: 84,\n    0x1DAAC: 84,\n    0x1DAAD: 84,\n    0x1DAAE: 84,\n    0x1DAAF: 84,\n    0x1E000: 84,\n    0x1E001: 84,\n    0x1E002: 84,\n    0x1E003: 84,\n    0x1E004: 84,\n    0x1E005: 84,\n    0x1E006: 84,\n    0x1E008: 84,\n    0x1E009: 84,\n    0x1E00A: 84,\n    0x1E00B: 84,\n    0x1E00C: 84,\n    0x1E00D: 84,\n    0x1E00E: 84,\n    0x1E00F: 84,\n    0x1E010: 84,\n    0x1E011: 84,\n    0x1E012: 84,\n    0x1E013: 84,\n    0x1E014: 84,\n    0x1E015: 84,\n    0x1E016: 84,\n    0x1E017: 84,\n    0x1E018: 84,\n    0x1E01B: 84,\n    0x1E01C: 84,\n    0x1E01D: 84,\n    0x1E01E: 84,\n    0x1E01F: 84,\n    0x1E020: 84,\n    0x1E021: 84,\n    0x1E023: 84,\n    0x1E024: 84,\n    0x1E026: 84,\n    0x1E027: 84,\n    0x1E028: 84,\n    0x1E029: 84,\n    0x1E02A: 84,\n    0x1E08F: 84,\n    0x1E130: 84,\n    0x1E131: 84,\n    0x1E132: 84,\n    0x1E133: 84,\n    0x1E134: 84,\n    0x1E135: 84,\n    0x1E136: 84,\n    0x1E2AE: 84,\n    0x1E2EC: 84,\n    0x1E2ED: 84,\n    0x1E2EE: 84,\n    0x1E2EF: 84,\n    0x1E4EC: 84,\n    0x1E4ED: 84,\n    0x1E4EE: 84,\n    0x1E4EF: 84,\n    0x1E8D0: 84,\n    0x1E8D1: 84,\n    0x1E8D2: 84,\n    0x1E8D3: 84,\n    0x1E8D4: 84,\n    0x1E8D5: 84,\n    0x1E8D6: 84,\n    0x1E900: 68,\n    0x1E901: 68,\n    0x1E902: 68,\n    0x1E903: 68,\n    0x1E904: 68,\n    0x1E905: 68,\n    0x1E906: 68,\n    0x1E907: 68,\n    0x1E908: 68,\n    0x1E909: 68,\n    0x1E90A: 68,\n    0x1E90B: 68,\n    0x1E90C: 68,\n    0x1E90D: 68,\n    0x1E90E: 68,\n    0x1E90F: 68,\n    0x1E910: 68,\n    0x1E911: 68,\n    0x1E912: 68,\n    0x1E913: 68,\n    0x1E914: 68,\n    0x1E915: 68,\n    0x1E916: 68,\n    0x1E917: 68,\n    0x1E918: 68,\n    0x1E919: 68,\n    0x1E91A: 68,\n    0x1E91B: 68,\n    0x1E91C: 68,\n    0x1E91D: 68,\n    0x1E91E: 68,\n    0x1E91F: 68,\n    0x1E920: 68,\n    0x1E921: 68,\n    0x1E922: 68,\n    0x1E923: 68,\n    0x1E924: 68,\n    0x1E925: 68,\n    0x1E926: 68,\n    0x1E927: 68,\n    0x1E928: 68,\n    0x1E929: 68,\n    0x1E92A: 68,\n    0x1E92B: 68,\n    0x1E92C: 68,\n    0x1E92D: 68,\n    0x1E92E: 68,\n    0x1E92F: 68,\n    0x1E930: 68,\n    0x1E931: 68,\n    0x1E932: 68,\n    0x1E933: 68,\n    0x1E934: 68,\n    0x1E935: 68,\n    0x1E936: 68,\n    0x1E937: 68,\n    0x1E938: 68,\n    0x1E939: 68,\n    0x1E93A: 68,\n    0x1E93B: 68,\n    0x1E93C: 68,\n    0x1E93D: 68,\n    0x1E93E: 68,\n    0x1E93F: 68,\n    0x1E940: 68,\n    0x1E941: 68,\n    0x1E942: 68,\n    0x1E943: 68,\n    0x1E944: 84,\n    0x1E945: 84,\n    0x1E946: 84,\n    0x1E947: 84,\n    0x1E948: 84,\n    0x1E949: 84,\n    0x1E94A: 84,\n    0x1E94B: 84,\n    0xE0001: 84,\n    0xE0020: 84,\n    0xE0021: 84,\n    0xE0022: 84,\n    0xE0023: 84,\n    0xE0024: 84,\n    0xE0025: 84,\n    0xE0026: 84,\n    0xE0027: 84,\n    0xE0028: 84,\n    0xE0029: 84,\n    0xE002A: 84,\n    0xE002B: 84,\n    0xE002C: 84,\n    0xE002D: 84,\n    0xE002E: 84,\n    0xE002F: 84,\n    0xE0030: 84,\n    0xE0031: 84,\n    0xE0032: 84,\n    0xE0033: 84,\n    0xE0034: 84,\n    0xE0035: 84,\n    0xE0036: 84,\n    0xE0037: 84,\n    0xE0038: 84,\n    0xE0039: 84,\n    0xE003A: 84,\n    0xE003B: 84,\n    0xE003C: 84,\n    0xE003D: 84,\n    0xE003E: 84,\n    0xE003F: 84,\n    0xE0040: 84,\n    0xE0041: 84,\n    0xE0042: 84,\n    0xE0043: 84,\n    0xE0044: 84,\n    0xE0045: 84,\n    0xE0046: 84,\n    0xE0047: 84,\n    0xE0048: 84,\n    0xE0049: 84,\n    0xE004A: 84,\n    0xE004B: 84,\n    0xE004C: 84,\n    0xE004D: 84,\n    0xE004E: 84,\n    0xE004F: 84,\n    0xE0050: 84,\n    0xE0051: 84,\n    0xE0052: 84,\n    0xE0053: 84,\n    0xE0054: 84,\n    0xE0055: 84,\n    0xE0056: 84,\n    0xE0057: 84,\n    0xE0058: 84,\n    0xE0059: 84,\n    0xE005A: 84,\n    0xE005B: 84,\n    0xE005C: 84,\n    0xE005D: 84,\n    0xE005E: 84,\n    0xE005F: 84,\n    0xE0060: 84,\n    0xE0061: 84,\n    0xE0062: 84,\n    0xE0063: 84,\n    0xE0064: 84,\n    0xE0065: 84,\n    0xE0066: 84,\n    0xE0067: 84,\n    0xE0068: 84,\n    0xE0069: 84,\n    0xE006A: 84,\n    0xE006B: 84,\n    0xE006C: 84,\n    0xE006D: 84,\n    0xE006E: 84,\n    0xE006F: 84,\n    0xE0070: 84,\n    0xE0071: 84,\n    0xE0072: 84,\n    0xE0073: 84,\n    0xE0074: 84,\n    0xE0075: 84,\n    0xE0076: 84,\n    0xE0077: 84,\n    0xE0078: 84,\n    0xE0079: 84,\n    0xE007A: 84,\n    0xE007B: 84,\n    0xE007C: 84,\n    0xE007D: 84,\n    0xE007E: 84,\n    0xE007F: 84,\n    0xE0100: 84,\n    0xE0101: 84,\n    0xE0102: 84,\n    0xE0103: 84,\n    0xE0104: 84,\n    0xE0105: 84,\n    0xE0106: 84,\n    0xE0107: 84,\n    0xE0108: 84,\n    0xE0109: 84,\n    0xE010A: 84,\n    0xE010B: 84,\n    0xE010C: 84,\n    0xE010D: 84,\n    0xE010E: 84,\n    0xE010F: 84,\n    0xE0110: 84,\n    0xE0111: 84,\n    0xE0112: 84,\n    0xE0113: 84,\n    0xE0114: 84,\n    0xE0115: 84,\n    0xE0116: 84,\n    0xE0117: 84,\n    0xE0118: 84,\n    0xE0119: 84,\n    0xE011A: 84,\n    0xE011B: 84,\n    0xE011C: 84,\n    0xE011D: 84,\n    0xE011E: 84,\n    0xE011F: 84,\n    0xE0120: 84,\n    0xE0121: 84,\n    0xE0122: 84,\n    0xE0123: 84,\n    0xE0124: 84,\n    0xE0125: 84,\n    0xE0126: 84,\n    0xE0127: 84,\n    0xE0128: 84,\n    0xE0129: 84,\n    0xE012A: 84,\n    0xE012B: 84,\n    0xE012C: 84,\n    0xE012D: 84,\n    0xE012E: 84,\n    0xE012F: 84,\n    0xE0130: 84,\n    0xE0131: 84,\n    0xE0132: 84,\n    0xE0133: 84,\n    0xE0134: 84,\n    0xE0135: 84,\n    0xE0136: 84,\n    0xE0137: 84,\n    0xE0138: 84,\n    0xE0139: 84,\n    0xE013A: 84,\n    0xE013B: 84,\n    0xE013C: 84,\n    0xE013D: 84,\n    0xE013E: 84,\n    0xE013F: 84,\n    0xE0140: 84,\n    0xE0141: 84,\n    0xE0142: 84,\n    0xE0143: 84,\n    0xE0144: 84,\n    0xE0145: 84,\n    0xE0146: 84,\n    0xE0147: 84,\n    0xE0148: 84,\n    0xE0149: 84,\n    0xE014A: 84,\n    0xE014B: 84,\n    0xE014C: 84,\n    0xE014D: 84,\n    0xE014E: 84,\n    0xE014F: 84,\n    0xE0150: 84,\n    0xE0151: 84,\n    0xE0152: 84,\n    0xE0153: 84,\n    0xE0154: 84,\n    0xE0155: 84,\n    0xE0156: 84,\n    0xE0157: 84,\n    0xE0158: 84,\n    0xE0159: 84,\n    0xE015A: 84,\n    0xE015B: 84,\n    0xE015C: 84,\n    0xE015D: 84,\n    0xE015E: 84,\n    0xE015F: 84,\n    0xE0160: 84,\n    0xE0161: 84,\n    0xE0162: 84,\n    0xE0163: 84,\n    0xE0164: 84,\n    0xE0165: 84,\n    0xE0166: 84,\n    0xE0167: 84,\n    0xE0168: 84,\n    0xE0169: 84,\n    0xE016A: 84,\n    0xE016B: 84,\n    0xE016C: 84,\n    0xE016D: 84,\n    0xE016E: 84,\n    0xE016F: 84,\n    0xE0170: 84,\n    0xE0171: 84,\n    0xE0172: 84,\n    0xE0173: 84,\n    0xE0174: 84,\n    0xE0175: 84,\n    0xE0176: 84,\n    0xE0177: 84,\n    0xE0178: 84,\n    0xE0179: 84,\n    0xE017A: 84,\n    0xE017B: 84,\n    0xE017C: 84,\n    0xE017D: 84,\n    0xE017E: 84,\n    0xE017F: 84,\n    0xE0180: 84,\n    0xE0181: 84,\n    0xE0182: 84,\n    0xE0183: 84,\n    0xE0184: 84,\n    0xE0185: 84,\n    0xE0186: 84,\n    0xE0187: 84,\n    0xE0188: 84,\n    0xE0189: 84,\n    0xE018A: 84,\n    0xE018B: 84,\n    0xE018C: 84,\n    0xE018D: 84,\n    0xE018E: 84,\n    0xE018F: 84,\n    0xE0190: 84,\n    0xE0191: 84,\n    0xE0192: 84,\n    0xE0193: 84,\n    0xE0194: 84,\n    0xE0195: 84,\n    0xE0196: 84,\n    0xE0197: 84,\n    0xE0198: 84,\n    0xE0199: 84,\n    0xE019A: 84,\n    0xE019B: 84,\n    0xE019C: 84,\n    0xE019D: 84,\n    0xE019E: 84,\n    0xE019F: 84,\n    0xE01A0: 84,\n    0xE01A1: 84,\n    0xE01A2: 84,\n    0xE01A3: 84,\n    0xE01A4: 84,\n    0xE01A5: 84,\n    0xE01A6: 84,\n    0xE01A7: 84,\n    0xE01A8: 84,\n    0xE01A9: 84,\n    0xE01AA: 84,\n    0xE01AB: 84,\n    0xE01AC: 84,\n    0xE01AD: 84,\n    0xE01AE: 84,\n    0xE01AF: 84,\n    0xE01B0: 84,\n    0xE01B1: 84,\n    0xE01B2: 84,\n    0xE01B3: 84,\n    0xE01B4: 84,\n    0xE01B5: 84,\n    0xE01B6: 84,\n    0xE01B7: 84,\n    0xE01B8: 84,\n    0xE01B9: 84,\n    0xE01BA: 84,\n    0xE01BB: 84,\n    0xE01BC: 84,\n    0xE01BD: 84,\n    0xE01BE: 84,\n    0xE01BF: 84,\n    0xE01C0: 84,\n    0xE01C1: 84,\n    0xE01C2: 84,\n    0xE01C3: 84,\n    0xE01C4: 84,\n    0xE01C5: 84,\n    0xE01C6: 84,\n    0xE01C7: 84,\n    0xE01C8: 84,\n    0xE01C9: 84,\n    0xE01CA: 84,\n    0xE01CB: 84,\n    0xE01CC: 84,\n    0xE01CD: 84,\n    0xE01CE: 84,\n    0xE01CF: 84,\n    0xE01D0: 84,\n    0xE01D1: 84,\n    0xE01D2: 84,\n    0xE01D3: 84,\n    0xE01D4: 84,\n    0xE01D5: 84,\n    0xE01D6: 84,\n    0xE01D7: 84,\n    0xE01D8: 84,\n    0xE01D9: 84,\n    0xE01DA: 84,\n    0xE01DB: 84,\n    0xE01DC: 84,\n    0xE01DD: 84,\n    0xE01DE: 84,\n    0xE01DF: 84,\n    0xE01E0: 84,\n    0xE01E1: 84,\n    0xE01E2: 84,\n    0xE01E3: 84,\n    0xE01E4: 84,\n    0xE01E5: 84,\n    0xE01E6: 84,\n    0xE01E7: 84,\n    0xE01E8: 84,\n    0xE01E9: 84,\n    0xE01EA: 84,\n    0xE01EB: 84,\n    0xE01EC: 84,\n    0xE01ED: 84,\n    0xE01EE: 84,\n    0xE01EF: 84,\n}\ncodepoint_classes = {\n    \"PVALID\": (\n        0x2D0000002E,\n        0x300000003A,\n        0x610000007B,\n        0xDF000000F7,\n        0xF800000100,\n        0x10100000102,\n        0x10300000104,\n        0x10500000106,\n        0x10700000108,\n        0x1090000010A,\n        0x10B0000010C,\n        0x10D0000010E,\n        0x10F00000110,\n        0x11100000112,\n        0x11300000114,\n        0x11500000116,\n        0x11700000118,\n        0x1190000011A,\n        0x11B0000011C,\n        0x11D0000011E,\n        0x11F00000120,\n        0x12100000122,\n        0x12300000124,\n        0x12500000126,\n        0x12700000128,\n        0x1290000012A,\n        0x12B0000012C,\n        0x12D0000012E,\n        0x12F00000130,\n        0x13100000132,\n        0x13500000136,\n        0x13700000139,\n        0x13A0000013B,\n        0x13C0000013D,\n        0x13E0000013F,\n        0x14200000143,\n        0x14400000145,\n        0x14600000147,\n        0x14800000149,\n        0x14B0000014C,\n        0x14D0000014E,\n        0x14F00000150,\n        0x15100000152,\n        0x15300000154,\n        0x15500000156,\n        0x15700000158,\n        0x1590000015A,\n        0x15B0000015C,\n        0x15D0000015E,\n        0x15F00000160,\n        0x16100000162,\n        0x16300000164,\n        0x16500000166,\n        0x16700000168,\n        0x1690000016A,\n        0x16B0000016C,\n        0x16D0000016E,\n        0x16F00000170,\n        0x17100000172,\n        0x17300000174,\n        0x17500000176,\n        0x17700000178,\n        0x17A0000017B,\n        0x17C0000017D,\n        0x17E0000017F,\n        0x18000000181,\n        0x18300000184,\n        0x18500000186,\n        0x18800000189,\n        0x18C0000018E,\n        0x19200000193,\n        0x19500000196,\n        0x1990000019C,\n        0x19E0000019F,\n        0x1A1000001A2,\n        0x1A3000001A4,\n        0x1A5000001A6,\n        0x1A8000001A9,\n        0x1AA000001AC,\n        0x1AD000001AE,\n        0x1B0000001B1,\n        0x1B4000001B5,\n        0x1B6000001B7,\n        0x1B9000001BC,\n        0x1BD000001C4,\n        0x1CE000001CF,\n        0x1D0000001D1,\n        0x1D2000001D3,\n        0x1D4000001D5,\n        0x1D6000001D7,\n        0x1D8000001D9,\n        0x1DA000001DB,\n        0x1DC000001DE,\n        0x1DF000001E0,\n        0x1E1000001E2,\n        0x1E3000001E4,\n        0x1E5000001E6,\n        0x1E7000001E8,\n        0x1E9000001EA,\n        0x1EB000001EC,\n        0x1ED000001EE,\n        0x1EF000001F1,\n        0x1F5000001F6,\n        0x1F9000001FA,\n        0x1FB000001FC,\n        0x1FD000001FE,\n        0x1FF00000200,\n        0x20100000202,\n        0x20300000204,\n        0x20500000206,\n        0x20700000208,\n        0x2090000020A,\n        0x20B0000020C,\n        0x20D0000020E,\n        0x20F00000210,\n        0x21100000212,\n        0x21300000214,\n        0x21500000216,\n        0x21700000218,\n        0x2190000021A,\n        0x21B0000021C,\n        0x21D0000021E,\n        0x21F00000220,\n        0x22100000222,\n        0x22300000224,\n        0x22500000226,\n        0x22700000228,\n        0x2290000022A,\n        0x22B0000022C,\n        0x22D0000022E,\n        0x22F00000230,\n        0x23100000232,\n        0x2330000023A,\n        0x23C0000023D,\n        0x23F00000241,\n        0x24200000243,\n        0x24700000248,\n        0x2490000024A,\n        0x24B0000024C,\n        0x24D0000024E,\n        0x24F000002B0,\n        0x2B9000002C2,\n        0x2C6000002D2,\n        0x2EC000002ED,\n        0x2EE000002EF,\n        0x30000000340,\n        0x34200000343,\n        0x3460000034F,\n        0x35000000370,\n        0x37100000372,\n        0x37300000374,\n        0x37700000378,\n        0x37B0000037E,\n        0x39000000391,\n        0x3AC000003CF,\n        0x3D7000003D8,\n        0x3D9000003DA,\n        0x3DB000003DC,\n        0x3DD000003DE,\n        0x3DF000003E0,\n        0x3E1000003E2,\n        0x3E3000003E4,\n        0x3E5000003E6,\n        0x3E7000003E8,\n        0x3E9000003EA,\n        0x3EB000003EC,\n        0x3ED000003EE,\n        0x3EF000003F0,\n        0x3F3000003F4,\n        0x3F8000003F9,\n        0x3FB000003FD,\n        0x43000000460,\n        0x46100000462,\n        0x46300000464,\n        0x46500000466,\n        0x46700000468,\n        0x4690000046A,\n        0x46B0000046C,\n        0x46D0000046E,\n        0x46F00000470,\n        0x47100000472,\n        0x47300000474,\n        0x47500000476,\n        0x47700000478,\n        0x4790000047A,\n        0x47B0000047C,\n        0x47D0000047E,\n        0x47F00000480,\n        0x48100000482,\n        0x48300000488,\n        0x48B0000048C,\n        0x48D0000048E,\n        0x48F00000490,\n        0x49100000492,\n        0x49300000494,\n        0x49500000496,\n        0x49700000498,\n        0x4990000049A,\n        0x49B0000049C,\n        0x49D0000049E,\n        0x49F000004A0,\n        0x4A1000004A2,\n        0x4A3000004A4,\n        0x4A5000004A6,\n        0x4A7000004A8,\n        0x4A9000004AA,\n        0x4AB000004AC,\n        0x4AD000004AE,\n        0x4AF000004B0,\n        0x4B1000004B2,\n        0x4B3000004B4,\n        0x4B5000004B6,\n        0x4B7000004B8,\n        0x4B9000004BA,\n        0x4BB000004BC,\n        0x4BD000004BE,\n        0x4BF000004C0,\n        0x4C2000004C3,\n        0x4C4000004C5,\n        0x4C6000004C7,\n        0x4C8000004C9,\n        0x4CA000004CB,\n        0x4CC000004CD,\n        0x4CE000004D0,\n        0x4D1000004D2,\n        0x4D3000004D4,\n        0x4D5000004D6,\n        0x4D7000004D8,\n        0x4D9000004DA,\n        0x4DB000004DC,\n        0x4DD000004DE,\n        0x4DF000004E0,\n        0x4E1000004E2,\n        0x4E3000004E4,\n        0x4E5000004E6,\n        0x4E7000004E8,\n        0x4E9000004EA,\n        0x4EB000004EC,\n        0x4ED000004EE,\n        0x4EF000004F0,\n        0x4F1000004F2,\n        0x4F3000004F4,\n        0x4F5000004F6,\n        0x4F7000004F8,\n        0x4F9000004FA,\n        0x4FB000004FC,\n        0x4FD000004FE,\n        0x4FF00000500,\n        0x50100000502,\n        0x50300000504,\n        0x50500000506,\n        0x50700000508,\n        0x5090000050A,\n        0x50B0000050C,\n        0x50D0000050E,\n        0x50F00000510,\n        0x51100000512,\n        0x51300000514,\n        0x51500000516,\n        0x51700000518,\n        0x5190000051A,\n        0x51B0000051C,\n        0x51D0000051E,\n        0x51F00000520,\n        0x52100000522,\n        0x52300000524,\n        0x52500000526,\n        0x52700000528,\n        0x5290000052A,\n        0x52B0000052C,\n        0x52D0000052E,\n        0x52F00000530,\n        0x5590000055A,\n        0x56000000587,\n        0x58800000589,\n        0x591000005BE,\n        0x5BF000005C0,\n        0x5C1000005C3,\n        0x5C4000005C6,\n        0x5C7000005C8,\n        0x5D0000005EB,\n        0x5EF000005F3,\n        0x6100000061B,\n        0x62000000640,\n        0x64100000660,\n        0x66E00000675,\n        0x679000006D4,\n        0x6D5000006DD,\n        0x6DF000006E9,\n        0x6EA000006F0,\n        0x6FA00000700,\n        0x7100000074B,\n        0x74D000007B2,\n        0x7C0000007F6,\n        0x7FD000007FE,\n        0x8000000082E,\n        0x8400000085C,\n        0x8600000086B,\n        0x87000000888,\n        0x8890000088F,\n        0x898000008E2,\n        0x8E300000958,\n        0x96000000964,\n        0x96600000970,\n        0x97100000984,\n        0x9850000098D,\n        0x98F00000991,\n        0x993000009A9,\n        0x9AA000009B1,\n        0x9B2000009B3,\n        0x9B6000009BA,\n        0x9BC000009C5,\n        0x9C7000009C9,\n        0x9CB000009CF,\n        0x9D7000009D8,\n        0x9E0000009E4,\n        0x9E6000009F2,\n        0x9FC000009FD,\n        0x9FE000009FF,\n        0xA0100000A04,\n        0xA0500000A0B,\n        0xA0F00000A11,\n        0xA1300000A29,\n        0xA2A00000A31,\n        0xA3200000A33,\n        0xA3500000A36,\n        0xA3800000A3A,\n        0xA3C00000A3D,\n        0xA3E00000A43,\n        0xA4700000A49,\n        0xA4B00000A4E,\n        0xA5100000A52,\n        0xA5C00000A5D,\n        0xA6600000A76,\n        0xA8100000A84,\n        0xA8500000A8E,\n        0xA8F00000A92,\n        0xA9300000AA9,\n        0xAAA00000AB1,\n        0xAB200000AB4,\n        0xAB500000ABA,\n        0xABC00000AC6,\n        0xAC700000ACA,\n        0xACB00000ACE,\n        0xAD000000AD1,\n        0xAE000000AE4,\n        0xAE600000AF0,\n        0xAF900000B00,\n        0xB0100000B04,\n        0xB0500000B0D,\n        0xB0F00000B11,\n        0xB1300000B29,\n        0xB2A00000B31,\n        0xB3200000B34,\n        0xB3500000B3A,\n        0xB3C00000B45,\n        0xB4700000B49,\n        0xB4B00000B4E,\n        0xB5500000B58,\n        0xB5F00000B64,\n        0xB6600000B70,\n        0xB7100000B72,\n        0xB8200000B84,\n        0xB8500000B8B,\n        0xB8E00000B91,\n        0xB9200000B96,\n        0xB9900000B9B,\n        0xB9C00000B9D,\n        0xB9E00000BA0,\n        0xBA300000BA5,\n        0xBA800000BAB,\n        0xBAE00000BBA,\n        0xBBE00000BC3,\n        0xBC600000BC9,\n        0xBCA00000BCE,\n        0xBD000000BD1,\n        0xBD700000BD8,\n        0xBE600000BF0,\n        0xC0000000C0D,\n        0xC0E00000C11,\n        0xC1200000C29,\n        0xC2A00000C3A,\n        0xC3C00000C45,\n        0xC4600000C49,\n        0xC4A00000C4E,\n        0xC5500000C57,\n        0xC5800000C5B,\n        0xC5D00000C5E,\n        0xC6000000C64,\n        0xC6600000C70,\n        0xC8000000C84,\n        0xC8500000C8D,\n        0xC8E00000C91,\n        0xC9200000CA9,\n        0xCAA00000CB4,\n        0xCB500000CBA,\n        0xCBC00000CC5,\n        0xCC600000CC9,\n        0xCCA00000CCE,\n        0xCD500000CD7,\n        0xCDD00000CDF,\n        0xCE000000CE4,\n        0xCE600000CF0,\n        0xCF100000CF4,\n        0xD0000000D0D,\n        0xD0E00000D11,\n        0xD1200000D45,\n        0xD4600000D49,\n        0xD4A00000D4F,\n        0xD5400000D58,\n        0xD5F00000D64,\n        0xD6600000D70,\n        0xD7A00000D80,\n        0xD8100000D84,\n        0xD8500000D97,\n        0xD9A00000DB2,\n        0xDB300000DBC,\n        0xDBD00000DBE,\n        0xDC000000DC7,\n        0xDCA00000DCB,\n        0xDCF00000DD5,\n        0xDD600000DD7,\n        0xDD800000DE0,\n        0xDE600000DF0,\n        0xDF200000DF4,\n        0xE0100000E33,\n        0xE3400000E3B,\n        0xE4000000E4F,\n        0xE5000000E5A,\n        0xE8100000E83,\n        0xE8400000E85,\n        0xE8600000E8B,\n        0xE8C00000EA4,\n        0xEA500000EA6,\n        0xEA700000EB3,\n        0xEB400000EBE,\n        0xEC000000EC5,\n        0xEC600000EC7,\n        0xEC800000ECF,\n        0xED000000EDA,\n        0xEDE00000EE0,\n        0xF0000000F01,\n        0xF0B00000F0C,\n        0xF1800000F1A,\n        0xF2000000F2A,\n        0xF3500000F36,\n        0xF3700000F38,\n        0xF3900000F3A,\n        0xF3E00000F43,\n        0xF4400000F48,\n        0xF4900000F4D,\n        0xF4E00000F52,\n        0xF5300000F57,\n        0xF5800000F5C,\n        0xF5D00000F69,\n        0xF6A00000F6D,\n        0xF7100000F73,\n        0xF7400000F75,\n        0xF7A00000F81,\n        0xF8200000F85,\n        0xF8600000F93,\n        0xF9400000F98,\n        0xF9900000F9D,\n        0xF9E00000FA2,\n        0xFA300000FA7,\n        0xFA800000FAC,\n        0xFAD00000FB9,\n        0xFBA00000FBD,\n        0xFC600000FC7,\n        0x10000000104A,\n        0x10500000109E,\n        0x10D0000010FB,\n        0x10FD00001100,\n        0x120000001249,\n        0x124A0000124E,\n        0x125000001257,\n        0x125800001259,\n        0x125A0000125E,\n        0x126000001289,\n        0x128A0000128E,\n        0x1290000012B1,\n        0x12B2000012B6,\n        0x12B8000012BF,\n        0x12C0000012C1,\n        0x12C2000012C6,\n        0x12C8000012D7,\n        0x12D800001311,\n        0x131200001316,\n        0x13180000135B,\n        0x135D00001360,\n        0x138000001390,\n        0x13A0000013F6,\n        0x14010000166D,\n        0x166F00001680,\n        0x16810000169B,\n        0x16A0000016EB,\n        0x16F1000016F9,\n        0x170000001716,\n        0x171F00001735,\n        0x174000001754,\n        0x17600000176D,\n        0x176E00001771,\n        0x177200001774,\n        0x1780000017B4,\n        0x17B6000017D4,\n        0x17D7000017D8,\n        0x17DC000017DE,\n        0x17E0000017EA,\n        0x18100000181A,\n        0x182000001879,\n        0x1880000018AB,\n        0x18B0000018F6,\n        0x19000000191F,\n        0x19200000192C,\n        0x19300000193C,\n        0x19460000196E,\n        0x197000001975,\n        0x1980000019AC,\n        0x19B0000019CA,\n        0x19D0000019DA,\n        0x1A0000001A1C,\n        0x1A2000001A5F,\n        0x1A6000001A7D,\n        0x1A7F00001A8A,\n        0x1A9000001A9A,\n        0x1AA700001AA8,\n        0x1AB000001ABE,\n        0x1ABF00001ACF,\n        0x1B0000001B4D,\n        0x1B5000001B5A,\n        0x1B6B00001B74,\n        0x1B8000001BF4,\n        0x1C0000001C38,\n        0x1C4000001C4A,\n        0x1C4D00001C7E,\n        0x1CD000001CD3,\n        0x1CD400001CFB,\n        0x1D0000001D2C,\n        0x1D2F00001D30,\n        0x1D3B00001D3C,\n        0x1D4E00001D4F,\n        0x1D6B00001D78,\n        0x1D7900001D9B,\n        0x1DC000001E00,\n        0x1E0100001E02,\n        0x1E0300001E04,\n        0x1E0500001E06,\n        0x1E0700001E08,\n        0x1E0900001E0A,\n        0x1E0B00001E0C,\n        0x1E0D00001E0E,\n        0x1E0F00001E10,\n        0x1E1100001E12,\n        0x1E1300001E14,\n        0x1E1500001E16,\n        0x1E1700001E18,\n        0x1E1900001E1A,\n        0x1E1B00001E1C,\n        0x1E1D00001E1E,\n        0x1E1F00001E20,\n        0x1E2100001E22,\n        0x1E2300001E24,\n        0x1E2500001E26,\n        0x1E2700001E28,\n        0x1E2900001E2A,\n        0x1E2B00001E2C,\n        0x1E2D00001E2E,\n        0x1E2F00001E30,\n        0x1E3100001E32,\n        0x1E3300001E34,\n        0x1E3500001E36,\n        0x1E3700001E38,\n        0x1E3900001E3A,\n        0x1E3B00001E3C,\n        0x1E3D00001E3E,\n        0x1E3F00001E40,\n        0x1E4100001E42,\n        0x1E4300001E44,\n        0x1E4500001E46,\n        0x1E4700001E48,\n        0x1E4900001E4A,\n        0x1E4B00001E4C,\n        0x1E4D00001E4E,\n        0x1E4F00001E50,\n        0x1E5100001E52,\n        0x1E5300001E54,\n        0x1E5500001E56,\n        0x1E5700001E58,\n        0x1E5900001E5A,\n        0x1E5B00001E5C,\n        0x1E5D00001E5E,\n        0x1E5F00001E60,\n        0x1E6100001E62,\n        0x1E6300001E64,\n        0x1E6500001E66,\n        0x1E6700001E68,\n        0x1E6900001E6A,\n        0x1E6B00001E6C,\n        0x1E6D00001E6E,\n        0x1E6F00001E70,\n        0x1E7100001E72,\n        0x1E7300001E74,\n        0x1E7500001E76,\n        0x1E7700001E78,\n        0x1E7900001E7A,\n        0x1E7B00001E7C,\n        0x1E7D00001E7E,\n        0x1E7F00001E80,\n        0x1E8100001E82,\n        0x1E8300001E84,\n        0x1E8500001E86,\n        0x1E8700001E88,\n        0x1E8900001E8A,\n        0x1E8B00001E8C,\n        0x1E8D00001E8E,\n        0x1E8F00001E90,\n        0x1E9100001E92,\n        0x1E9300001E94,\n        0x1E9500001E9A,\n        0x1E9C00001E9E,\n        0x1E9F00001EA0,\n        0x1EA100001EA2,\n        0x1EA300001EA4,\n        0x1EA500001EA6,\n        0x1EA700001EA8,\n        0x1EA900001EAA,\n        0x1EAB00001EAC,\n        0x1EAD00001EAE,\n        0x1EAF00001EB0,\n        0x1EB100001EB2,\n        0x1EB300001EB4,\n        0x1EB500001EB6,\n        0x1EB700001EB8,\n        0x1EB900001EBA,\n        0x1EBB00001EBC,\n        0x1EBD00001EBE,\n        0x1EBF00001EC0,\n        0x1EC100001EC2,\n        0x1EC300001EC4,\n        0x1EC500001EC6,\n        0x1EC700001EC8,\n        0x1EC900001ECA,\n        0x1ECB00001ECC,\n        0x1ECD00001ECE,\n        0x1ECF00001ED0,\n        0x1ED100001ED2,\n        0x1ED300001ED4,\n        0x1ED500001ED6,\n        0x1ED700001ED8,\n        0x1ED900001EDA,\n        0x1EDB00001EDC,\n        0x1EDD00001EDE,\n        0x1EDF00001EE0,\n        0x1EE100001EE2,\n        0x1EE300001EE4,\n        0x1EE500001EE6,\n        0x1EE700001EE8,\n        0x1EE900001EEA,\n        0x1EEB00001EEC,\n        0x1EED00001EEE,\n        0x1EEF00001EF0,\n        0x1EF100001EF2,\n        0x1EF300001EF4,\n        0x1EF500001EF6,\n        0x1EF700001EF8,\n        0x1EF900001EFA,\n        0x1EFB00001EFC,\n        0x1EFD00001EFE,\n        0x1EFF00001F08,\n        0x1F1000001F16,\n        0x1F2000001F28,\n        0x1F3000001F38,\n        0x1F4000001F46,\n        0x1F5000001F58,\n        0x1F6000001F68,\n        0x1F7000001F71,\n        0x1F7200001F73,\n        0x1F7400001F75,\n        0x1F7600001F77,\n        0x1F7800001F79,\n        0x1F7A00001F7B,\n        0x1F7C00001F7D,\n        0x1FB000001FB2,\n        0x1FB600001FB7,\n        0x1FC600001FC7,\n        0x1FD000001FD3,\n        0x1FD600001FD8,\n        0x1FE000001FE3,\n        0x1FE400001FE8,\n        0x1FF600001FF7,\n        0x214E0000214F,\n        0x218400002185,\n        0x2C3000002C60,\n        0x2C6100002C62,\n        0x2C6500002C67,\n        0x2C6800002C69,\n        0x2C6A00002C6B,\n        0x2C6C00002C6D,\n        0x2C7100002C72,\n        0x2C7300002C75,\n        0x2C7600002C7C,\n        0x2C8100002C82,\n        0x2C8300002C84,\n        0x2C8500002C86,\n        0x2C8700002C88,\n        0x2C8900002C8A,\n        0x2C8B00002C8C,\n        0x2C8D00002C8E,\n        0x2C8F00002C90,\n        0x2C9100002C92,\n        0x2C9300002C94,\n        0x2C9500002C96,\n        0x2C9700002C98,\n        0x2C9900002C9A,\n        0x2C9B00002C9C,\n        0x2C9D00002C9E,\n        0x2C9F00002CA0,\n        0x2CA100002CA2,\n        0x2CA300002CA4,\n        0x2CA500002CA6,\n        0x2CA700002CA8,\n        0x2CA900002CAA,\n        0x2CAB00002CAC,\n        0x2CAD00002CAE,\n        0x2CAF00002CB0,\n        0x2CB100002CB2,\n        0x2CB300002CB4,\n        0x2CB500002CB6,\n        0x2CB700002CB8,\n        0x2CB900002CBA,\n        0x2CBB00002CBC,\n        0x2CBD00002CBE,\n        0x2CBF00002CC0,\n        0x2CC100002CC2,\n        0x2CC300002CC4,\n        0x2CC500002CC6,\n        0x2CC700002CC8,\n        0x2CC900002CCA,\n        0x2CCB00002CCC,\n        0x2CCD00002CCE,\n        0x2CCF00002CD0,\n        0x2CD100002CD2,\n        0x2CD300002CD4,\n        0x2CD500002CD6,\n        0x2CD700002CD8,\n        0x2CD900002CDA,\n        0x2CDB00002CDC,\n        0x2CDD00002CDE,\n        0x2CDF00002CE0,\n        0x2CE100002CE2,\n        0x2CE300002CE5,\n        0x2CEC00002CED,\n        0x2CEE00002CF2,\n        0x2CF300002CF4,\n        0x2D0000002D26,\n        0x2D2700002D28,\n        0x2D2D00002D2E,\n        0x2D3000002D68,\n        0x2D7F00002D97,\n        0x2DA000002DA7,\n        0x2DA800002DAF,\n        0x2DB000002DB7,\n        0x2DB800002DBF,\n        0x2DC000002DC7,\n        0x2DC800002DCF,\n        0x2DD000002DD7,\n        0x2DD800002DDF,\n        0x2DE000002E00,\n        0x2E2F00002E30,\n        0x300500003008,\n        0x302A0000302E,\n        0x303C0000303D,\n        0x304100003097,\n        0x30990000309B,\n        0x309D0000309F,\n        0x30A1000030FB,\n        0x30FC000030FF,\n        0x310500003130,\n        0x31A0000031C0,\n        0x31F000003200,\n        0x340000004DC0,\n        0x4E000000A48D,\n        0xA4D00000A4FE,\n        0xA5000000A60D,\n        0xA6100000A62C,\n        0xA6410000A642,\n        0xA6430000A644,\n        0xA6450000A646,\n        0xA6470000A648,\n        0xA6490000A64A,\n        0xA64B0000A64C,\n        0xA64D0000A64E,\n        0xA64F0000A650,\n        0xA6510000A652,\n        0xA6530000A654,\n        0xA6550000A656,\n        0xA6570000A658,\n        0xA6590000A65A,\n        0xA65B0000A65C,\n        0xA65D0000A65E,\n        0xA65F0000A660,\n        0xA6610000A662,\n        0xA6630000A664,\n        0xA6650000A666,\n        0xA6670000A668,\n        0xA6690000A66A,\n        0xA66B0000A66C,\n        0xA66D0000A670,\n        0xA6740000A67E,\n        0xA67F0000A680,\n        0xA6810000A682,\n        0xA6830000A684,\n        0xA6850000A686,\n        0xA6870000A688,\n        0xA6890000A68A,\n        0xA68B0000A68C,\n        0xA68D0000A68E,\n        0xA68F0000A690,\n        0xA6910000A692,\n        0xA6930000A694,\n        0xA6950000A696,\n        0xA6970000A698,\n        0xA6990000A69A,\n        0xA69B0000A69C,\n        0xA69E0000A6E6,\n        0xA6F00000A6F2,\n        0xA7170000A720,\n        0xA7230000A724,\n        0xA7250000A726,\n        0xA7270000A728,\n        0xA7290000A72A,\n        0xA72B0000A72C,\n        0xA72D0000A72E,\n        0xA72F0000A732,\n        0xA7330000A734,\n        0xA7350000A736,\n        0xA7370000A738,\n        0xA7390000A73A,\n        0xA73B0000A73C,\n        0xA73D0000A73E,\n        0xA73F0000A740,\n        0xA7410000A742,\n        0xA7430000A744,\n        0xA7450000A746,\n        0xA7470000A748,\n        0xA7490000A74A,\n        0xA74B0000A74C,\n        0xA74D0000A74E,\n        0xA74F0000A750,\n        0xA7510000A752,\n        0xA7530000A754,\n        0xA7550000A756,\n        0xA7570000A758,\n        0xA7590000A75A,\n        0xA75B0000A75C,\n        0xA75D0000A75E,\n        0xA75F0000A760,\n        0xA7610000A762,\n        0xA7630000A764,\n        0xA7650000A766,\n        0xA7670000A768,\n        0xA7690000A76A,\n        0xA76B0000A76C,\n        0xA76D0000A76E,\n        0xA76F0000A770,\n        0xA7710000A779,\n        0xA77A0000A77B,\n        0xA77C0000A77D,\n        0xA77F0000A780,\n        0xA7810000A782,\n        0xA7830000A784,\n        0xA7850000A786,\n        0xA7870000A789,\n        0xA78C0000A78D,\n        0xA78E0000A790,\n        0xA7910000A792,\n        0xA7930000A796,\n        0xA7970000A798,\n        0xA7990000A79A,\n        0xA79B0000A79C,\n        0xA79D0000A79E,\n        0xA79F0000A7A0,\n        0xA7A10000A7A2,\n        0xA7A30000A7A4,\n        0xA7A50000A7A6,\n        0xA7A70000A7A8,\n        0xA7A90000A7AA,\n        0xA7AF0000A7B0,\n        0xA7B50000A7B6,\n        0xA7B70000A7B8,\n        0xA7B90000A7BA,\n        0xA7BB0000A7BC,\n        0xA7BD0000A7BE,\n        0xA7BF0000A7C0,\n        0xA7C10000A7C2,\n        0xA7C30000A7C4,\n        0xA7C80000A7C9,\n        0xA7CA0000A7CB,\n        0xA7D10000A7D2,\n        0xA7D30000A7D4,\n        0xA7D50000A7D6,\n        0xA7D70000A7D8,\n        0xA7D90000A7DA,\n        0xA7F60000A7F8,\n        0xA7FA0000A828,\n        0xA82C0000A82D,\n        0xA8400000A874,\n        0xA8800000A8C6,\n        0xA8D00000A8DA,\n        0xA8E00000A8F8,\n        0xA8FB0000A8FC,\n        0xA8FD0000A92E,\n        0xA9300000A954,\n        0xA9800000A9C1,\n        0xA9CF0000A9DA,\n        0xA9E00000A9FF,\n        0xAA000000AA37,\n        0xAA400000AA4E,\n        0xAA500000AA5A,\n        0xAA600000AA77,\n        0xAA7A0000AAC3,\n        0xAADB0000AADE,\n        0xAAE00000AAF0,\n        0xAAF20000AAF7,\n        0xAB010000AB07,\n        0xAB090000AB0F,\n        0xAB110000AB17,\n        0xAB200000AB27,\n        0xAB280000AB2F,\n        0xAB300000AB5B,\n        0xAB600000AB69,\n        0xABC00000ABEB,\n        0xABEC0000ABEE,\n        0xABF00000ABFA,\n        0xAC000000D7A4,\n        0xFA0E0000FA10,\n        0xFA110000FA12,\n        0xFA130000FA15,\n        0xFA1F0000FA20,\n        0xFA210000FA22,\n        0xFA230000FA25,\n        0xFA270000FA2A,\n        0xFB1E0000FB1F,\n        0xFE200000FE30,\n        0xFE730000FE74,\n        0x100000001000C,\n        0x1000D00010027,\n        0x100280001003B,\n        0x1003C0001003E,\n        0x1003F0001004E,\n        0x100500001005E,\n        0x10080000100FB,\n        0x101FD000101FE,\n        0x102800001029D,\n        0x102A0000102D1,\n        0x102E0000102E1,\n        0x1030000010320,\n        0x1032D00010341,\n        0x103420001034A,\n        0x103500001037B,\n        0x103800001039E,\n        0x103A0000103C4,\n        0x103C8000103D0,\n        0x104280001049E,\n        0x104A0000104AA,\n        0x104D8000104FC,\n        0x1050000010528,\n        0x1053000010564,\n        0x10597000105A2,\n        0x105A3000105B2,\n        0x105B3000105BA,\n        0x105BB000105BD,\n        0x1060000010737,\n        0x1074000010756,\n        0x1076000010768,\n        0x1078000010781,\n        0x1080000010806,\n        0x1080800010809,\n        0x1080A00010836,\n        0x1083700010839,\n        0x1083C0001083D,\n        0x1083F00010856,\n        0x1086000010877,\n        0x108800001089F,\n        0x108E0000108F3,\n        0x108F4000108F6,\n        0x1090000010916,\n        0x109200001093A,\n        0x10980000109B8,\n        0x109BE000109C0,\n        0x10A0000010A04,\n        0x10A0500010A07,\n        0x10A0C00010A14,\n        0x10A1500010A18,\n        0x10A1900010A36,\n        0x10A3800010A3B,\n        0x10A3F00010A40,\n        0x10A6000010A7D,\n        0x10A8000010A9D,\n        0x10AC000010AC8,\n        0x10AC900010AE7,\n        0x10B0000010B36,\n        0x10B4000010B56,\n        0x10B6000010B73,\n        0x10B8000010B92,\n        0x10C0000010C49,\n        0x10CC000010CF3,\n        0x10D0000010D28,\n        0x10D3000010D3A,\n        0x10E8000010EAA,\n        0x10EAB00010EAD,\n        0x10EB000010EB2,\n        0x10EFD00010F1D,\n        0x10F2700010F28,\n        0x10F3000010F51,\n        0x10F7000010F86,\n        0x10FB000010FC5,\n        0x10FE000010FF7,\n        0x1100000011047,\n        0x1106600011076,\n        0x1107F000110BB,\n        0x110C2000110C3,\n        0x110D0000110E9,\n        0x110F0000110FA,\n        0x1110000011135,\n        0x1113600011140,\n        0x1114400011148,\n        0x1115000011174,\n        0x1117600011177,\n        0x11180000111C5,\n        0x111C9000111CD,\n        0x111CE000111DB,\n        0x111DC000111DD,\n        0x1120000011212,\n        0x1121300011238,\n        0x1123E00011242,\n        0x1128000011287,\n        0x1128800011289,\n        0x1128A0001128E,\n        0x1128F0001129E,\n        0x1129F000112A9,\n        0x112B0000112EB,\n        0x112F0000112FA,\n        0x1130000011304,\n        0x113050001130D,\n        0x1130F00011311,\n        0x1131300011329,\n        0x1132A00011331,\n        0x1133200011334,\n        0x113350001133A,\n        0x1133B00011345,\n        0x1134700011349,\n        0x1134B0001134E,\n        0x1135000011351,\n        0x1135700011358,\n        0x1135D00011364,\n        0x113660001136D,\n        0x1137000011375,\n        0x114000001144B,\n        0x114500001145A,\n        0x1145E00011462,\n        0x11480000114C6,\n        0x114C7000114C8,\n        0x114D0000114DA,\n        0x11580000115B6,\n        0x115B8000115C1,\n        0x115D8000115DE,\n        0x1160000011641,\n        0x1164400011645,\n        0x116500001165A,\n        0x11680000116B9,\n        0x116C0000116CA,\n        0x117000001171B,\n        0x1171D0001172C,\n        0x117300001173A,\n        0x1174000011747,\n        0x118000001183B,\n        0x118C0000118EA,\n        0x118FF00011907,\n        0x119090001190A,\n        0x1190C00011914,\n        0x1191500011917,\n        0x1191800011936,\n        0x1193700011939,\n        0x1193B00011944,\n        0x119500001195A,\n        0x119A0000119A8,\n        0x119AA000119D8,\n        0x119DA000119E2,\n        0x119E3000119E5,\n        0x11A0000011A3F,\n        0x11A4700011A48,\n        0x11A5000011A9A,\n        0x11A9D00011A9E,\n        0x11AB000011AF9,\n        0x11C0000011C09,\n        0x11C0A00011C37,\n        0x11C3800011C41,\n        0x11C5000011C5A,\n        0x11C7200011C90,\n        0x11C9200011CA8,\n        0x11CA900011CB7,\n        0x11D0000011D07,\n        0x11D0800011D0A,\n        0x11D0B00011D37,\n        0x11D3A00011D3B,\n        0x11D3C00011D3E,\n        0x11D3F00011D48,\n        0x11D5000011D5A,\n        0x11D6000011D66,\n        0x11D6700011D69,\n        0x11D6A00011D8F,\n        0x11D9000011D92,\n        0x11D9300011D99,\n        0x11DA000011DAA,\n        0x11EE000011EF7,\n        0x11F0000011F11,\n        0x11F1200011F3B,\n        0x11F3E00011F43,\n        0x11F5000011F5A,\n        0x11FB000011FB1,\n        0x120000001239A,\n        0x1248000012544,\n        0x12F9000012FF1,\n        0x1300000013430,\n        0x1344000013456,\n        0x1440000014647,\n        0x1680000016A39,\n        0x16A4000016A5F,\n        0x16A6000016A6A,\n        0x16A7000016ABF,\n        0x16AC000016ACA,\n        0x16AD000016AEE,\n        0x16AF000016AF5,\n        0x16B0000016B37,\n        0x16B4000016B44,\n        0x16B5000016B5A,\n        0x16B6300016B78,\n        0x16B7D00016B90,\n        0x16E6000016E80,\n        0x16F0000016F4B,\n        0x16F4F00016F88,\n        0x16F8F00016FA0,\n        0x16FE000016FE2,\n        0x16FE300016FE5,\n        0x16FF000016FF2,\n        0x17000000187F8,\n        0x1880000018CD6,\n        0x18D0000018D09,\n        0x1AFF00001AFF4,\n        0x1AFF50001AFFC,\n        0x1AFFD0001AFFF,\n        0x1B0000001B123,\n        0x1B1320001B133,\n        0x1B1500001B153,\n        0x1B1550001B156,\n        0x1B1640001B168,\n        0x1B1700001B2FC,\n        0x1BC000001BC6B,\n        0x1BC700001BC7D,\n        0x1BC800001BC89,\n        0x1BC900001BC9A,\n        0x1BC9D0001BC9F,\n        0x1CF000001CF2E,\n        0x1CF300001CF47,\n        0x1DA000001DA37,\n        0x1DA3B0001DA6D,\n        0x1DA750001DA76,\n        0x1DA840001DA85,\n        0x1DA9B0001DAA0,\n        0x1DAA10001DAB0,\n        0x1DF000001DF1F,\n        0x1DF250001DF2B,\n        0x1E0000001E007,\n        0x1E0080001E019,\n        0x1E01B0001E022,\n        0x1E0230001E025,\n        0x1E0260001E02B,\n        0x1E08F0001E090,\n        0x1E1000001E12D,\n        0x1E1300001E13E,\n        0x1E1400001E14A,\n        0x1E14E0001E14F,\n        0x1E2900001E2AF,\n        0x1E2C00001E2FA,\n        0x1E4D00001E4FA,\n        0x1E7E00001E7E7,\n        0x1E7E80001E7EC,\n        0x1E7ED0001E7EF,\n        0x1E7F00001E7FF,\n        0x1E8000001E8C5,\n        0x1E8D00001E8D7,\n        0x1E9220001E94C,\n        0x1E9500001E95A,\n        0x200000002A6E0,\n        0x2A7000002B73A,\n        0x2B7400002B81E,\n        0x2B8200002CEA2,\n        0x2CEB00002EBE1,\n        0x2EBF00002EE5E,\n        0x300000003134B,\n        0x31350000323B0,\n    ),\n    \"CONTEXTJ\": (0x200C0000200E,),\n    \"CONTEXTO\": (\n        0xB7000000B8,\n        0x37500000376,\n        0x5F3000005F5,\n        0x6600000066A,\n        0x6F0000006FA,\n        0x30FB000030FC,\n    ),\n}\n",[],[216,809,810,811,890,891,1868,1878],"0a03a6a0-67fc-11f0-9b65-0224a6c84d84","core.py","0a03a736-67fc-11f0-9b65-0224a6c84d84",363,["D",1753299264574],"import bisect\nimport re\nimport unicodedata\nfrom typing import Optional, Union\n\nfrom . import idnadata\nfrom .intranges import intranges_contain\n\n_virama_combining_class = 9\n_alabel_prefix = b\"xn--\"\n_unicode_dots_re = re.compile(\"[\\u002e\\u3002\\uff0e\\uff61]\")\n\n\nclass IDNAError(UnicodeError):\n    \"\"\"Base exception for all IDNA-encoding related problems\"\"\"\n\n    pass\n\n\nclass IDNABidiError(IDNAError):\n    \"\"\"Exception when bidirectional requirements are not satisfied\"\"\"\n\n    pass\n\n\nclass InvalidCodepoint(IDNAError):\n    \"\"\"Exception when a disallowed or unallocated codepoint is used\"\"\"\n\n    pass\n\n\nclass InvalidCodepointContext(IDNAError):\n    \"\"\"Exception when the codepoint is not valid in the context it is used\"\"\"\n\n    pass\n\n\ndef _combining_class(cp: int) -> int:\n    v = unicodedata.combining(chr(cp))\n    if v == 0:\n        if not unicodedata.name(chr(cp)):\n            raise ValueError(\"Unknown character in unicodedata\")\n    return v\n\n\ndef _is_script(cp: str, script: str) -> bool:\n    return intranges_contain(ord(cp), idnadata.scripts[script])\n\n\ndef _punycode(s: str) -> bytes:\n    return s.encode(\"punycode\")\n\n\ndef _unot(s: int) -> str:\n    return \"U+{:04X}\".format(s)\n\n\ndef valid_label_length(label: Union[bytes, str]) -> bool:\n    if len(label) > 63:\n        return False\n    return True\n\n\ndef valid_string_length(label: Union[bytes, str], trailing_dot: bool) -> bool:\n    if len(label) > (254 if trailing_dot else 253):\n        return False\n    return True\n\n\ndef check_bidi(label: str, check_ltr: bool = False) -> bool:\n    # Bidi rules should only be applied if string contains RTL characters\n    bidi_label = False\n    for idx, cp in enumerate(label, 1):\n        direction = unicodedata.bidirectional(cp)\n        if direction == \"\":\n            # String likely comes from a newer version of Unicode\n            raise IDNABidiError(\"Unknown directionality in label {} at position {}\".format(repr(label), idx))\n        if direction in [\"R\", \"AL\", \"AN\"]:\n            bidi_label = True\n    if not bidi_label and not check_ltr:\n        return True\n\n    # Bidi rule 1\n    direction = unicodedata.bidirectional(label[0])\n    if direction in [\"R\", \"AL\"]:\n        rtl = True\n    elif direction == \"L\":\n        rtl = False\n    else:\n        raise IDNABidiError(\"First codepoint in label {} must be directionality L, R or AL\".format(repr(label)))\n\n    valid_ending = False\n    number_type: Optional[str] = None\n    for idx, cp in enumerate(label, 1):\n        direction = unicodedata.bidirectional(cp)\n\n        if rtl:\n            # Bidi rule 2\n            if direction not in [\n                \"R\",\n                \"AL\",\n                \"AN\",\n                \"EN\",\n                \"ES\",\n                \"CS\",\n                \"ET\",\n                \"ON\",\n                \"BN\",\n                \"NSM\",\n            ]:\n                raise IDNABidiError(\"Invalid direction for codepoint at position {} in a right-to-left label\".format(idx))\n            # Bidi rule 3\n            if direction in [\"R\", \"AL\", \"EN\", \"AN\"]:\n                valid_ending = True\n            elif direction != \"NSM\":\n                valid_ending = False\n            # Bidi rule 4\n            if direction in [\"AN\", \"EN\"]:\n                if not number_type:\n                    number_type = direction\n                else:\n                    if number_type != direction:\n                        raise IDNABidiError(\"Can not mix numeral types in a right-to-left label\")\n        else:\n            # Bidi rule 5\n            if direction not in [\"L\", \"EN\", \"ES\", \"CS\", \"ET\", \"ON\", \"BN\", \"NSM\"]:\n                raise IDNABidiError(\"Invalid direction for codepoint at position {} in a left-to-right label\".format(idx))\n            # Bidi rule 6\n            if direction in [\"L\", \"EN\"]:\n                valid_ending = True\n            elif direction != \"NSM\":\n                valid_ending = False\n\n    if not valid_ending:\n        raise IDNABidiError(\"Label ends with illegal codepoint directionality\")\n\n    return True\n\n\ndef check_initial_combiner(label: str) -> bool:\n    if unicodedata.category(label[0])[0] == \"M\":\n        raise IDNAError(\"Label begins with an illegal combining character\")\n    return True\n\n\ndef check_hyphen_ok(label: str) -> bool:\n    if label[2:4] == \"--\":\n        raise IDNAError(\"Label has disallowed hyphens in 3rd and 4th position\")\n    if label[0] == \"-\" or label[-1] == \"-\":\n        raise IDNAError(\"Label must not start or end with a hyphen\")\n    return True\n\n\ndef check_nfc(label: str) -> None:\n    if unicodedata.normalize(\"NFC\", label) != label:\n        raise IDNAError(\"Label must be in Normalization Form C\")\n\n\ndef valid_contextj(label: str, pos: int) -> bool:\n    cp_value = ord(label[pos])\n\n    if cp_value == 0x200C:\n        if pos > 0:\n            if _combining_class(ord(label[pos - 1])) == _virama_combining_class:\n                return True\n\n        ok = False\n        for i in range(pos - 1, -1, -1):\n            joining_type = idnadata.joining_types.get(ord(label[i]))\n            if joining_type == ord(\"T\"):\n                continue\n            elif joining_type in [ord(\"L\"), ord(\"D\")]:\n                ok = True\n                break\n            else:\n                break\n\n        if not ok:\n            return False\n\n        ok = False\n        for i in range(pos + 1, len(label)):\n            joining_type = idnadata.joining_types.get(ord(label[i]))\n            if joining_type == ord(\"T\"):\n                continue\n            elif joining_type in [ord(\"R\"), ord(\"D\")]:\n                ok = True\n                break\n            else:\n                break\n        return ok\n\n    if cp_value == 0x200D:\n        if pos > 0:\n            if _combining_class(ord(label[pos - 1])) == _virama_combining_class:\n                return True\n        return False\n\n    else:\n        return False\n\n\ndef valid_contexto(label: str, pos: int, exception: bool = False) -> bool:\n    cp_value = ord(label[pos])\n\n    if cp_value == 0x00B7:\n        if 0 < pos < len(label) - 1:\n            if ord(label[pos - 1]) == 0x006C and ord(label[pos + 1]) == 0x006C:\n                return True\n        return False\n\n    elif cp_value == 0x0375:\n        if pos < len(label) - 1 and len(label) > 1:\n            return _is_script(label[pos + 1], \"Greek\")\n        return False\n\n    elif cp_value == 0x05F3 or cp_value == 0x05F4:\n        if pos > 0:\n            return _is_script(label[pos - 1], \"Hebrew\")\n        return False\n\n    elif cp_value == 0x30FB:\n        for cp in label:\n            if cp == \"\\u30fb\":\n                continue\n            if _is_script(cp, \"Hiragana\") or _is_script(cp, \"Katakana\") or _is_script(cp, \"Han\"):\n                return True\n        return False\n\n    elif 0x660 <= cp_value <= 0x669:\n        for cp in label:\n            if 0x6F0 <= ord(cp) <= 0x06F9:\n                return False\n        return True\n\n    elif 0x6F0 <= cp_value <= 0x6F9:\n        for cp in label:\n            if 0x660 <= ord(cp) <= 0x0669:\n                return False\n        return True\n\n    return False\n\n\ndef check_label(label: Union[str, bytes, bytearray]) -> None:\n    if isinstance(label, (bytes, bytearray)):\n        label = label.decode(\"utf-8\")\n    if len(label) == 0:\n        raise IDNAError(\"Empty Label\")\n\n    check_nfc(label)\n    check_hyphen_ok(label)\n    check_initial_combiner(label)\n\n    for pos, cp in enumerate(label):\n        cp_value = ord(cp)\n        if intranges_contain(cp_value, idnadata.codepoint_classes[\"PVALID\"]):\n            continue\n        elif intranges_contain(cp_value, idnadata.codepoint_classes[\"CONTEXTJ\"]):\n            try:\n                if not valid_contextj(label, pos):\n                    raise InvalidCodepointContext(\n                        \"Joiner {} not allowed at position {} in {}\".format(_unot(cp_value), pos + 1, repr(label))\n                    )\n            except ValueError:\n                raise IDNAError(\n                    \"Unknown codepoint adjacent to joiner {} at position {} in {}\".format(\n                        _unot(cp_value), pos + 1, repr(label)\n                    )\n                )\n        elif intranges_contain(cp_value, idnadata.codepoint_classes[\"CONTEXTO\"]):\n            if not valid_contexto(label, pos):\n                raise InvalidCodepointContext(\n                    \"Codepoint {} not allowed at position {} in {}\".format(_unot(cp_value), pos + 1, repr(label))\n                )\n        else:\n            raise InvalidCodepoint(\n                \"Codepoint {} at position {} of {} not allowed\".format(_unot(cp_value), pos + 1, repr(label))\n            )\n\n    check_bidi(label)\n\n\ndef alabel(label: str) -> bytes:\n    try:\n        label_bytes = label.encode(\"ascii\")\n        ulabel(label_bytes)\n        if not valid_label_length(label_bytes):\n            raise IDNAError(\"Label too long\")\n        return label_bytes\n    except UnicodeEncodeError:\n        pass\n\n    check_label(label)\n    label_bytes = _alabel_prefix + _punycode(label)\n\n    if not valid_label_length(label_bytes):\n        raise IDNAError(\"Label too long\")\n\n    return label_bytes\n\n\ndef ulabel(label: Union[str, bytes, bytearray]) -> str:\n    if not isinstance(label, (bytes, bytearray)):\n        try:\n            label_bytes = label.encode(\"ascii\")\n        except UnicodeEncodeError:\n            check_label(label)\n            return label\n    else:\n        label_bytes = label\n\n    label_bytes = label_bytes.lower()\n    if label_bytes.startswith(_alabel_prefix):\n        label_bytes = label_bytes[len(_alabel_prefix) :]\n        if not label_bytes:\n            raise IDNAError(\"Malformed A-label, no Punycode eligible content found\")\n        if label_bytes.decode(\"ascii\")[-1] == \"-\":\n            raise IDNAError(\"A-label must not end with a hyphen\")\n    else:\n        check_label(label_bytes)\n        return label_bytes.decode(\"ascii\")\n\n    try:\n        label = label_bytes.decode(\"punycode\")\n    except UnicodeError:\n        raise IDNAError(\"Invalid A-label\")\n    check_label(label)\n    return label\n\n\ndef uts46_remap(domain: str, std3_rules: bool = True, transitional: bool = False) -> str:\n    \"\"\"Re-map the characters in the string according to UTS46 processing.\"\"\"\n    from .uts46data import uts46data\n\n    output = \"\"\n\n    for pos, char in enumerate(domain):\n        code_point = ord(char)\n        try:\n            uts46row = uts46data[code_point if code_point < 256 else bisect.bisect_left(uts46data, (code_point, \"Z\")) - 1]\n            status = uts46row[1]\n            replacement: Optional[str] = None\n            if len(uts46row) == 3:\n                replacement = uts46row[2]\n            if (\n                status == \"V\"\n                or (status == \"D\" and not transitional)\n                or (status == \"3\" and not std3_rules and replacement is None)\n            ):\n                output += char\n            elif replacement is not None and (\n                status == \"M\" or (status == \"3\" and not std3_rules) or (status == \"D\" and transitional)\n            ):\n                output += replacement\n            elif status != \"I\":\n                raise IndexError()\n        except IndexError:\n            raise InvalidCodepoint(\n                \"Codepoint {} not allowed at position {} in {}\".format(_unot(code_point), pos + 1, repr(domain))\n            )\n\n    return unicodedata.normalize(\"NFC\", output)\n\n\ndef encode(\n    s: Union[str, bytes, bytearray],\n    strict: bool = False,\n    uts46: bool = False,\n    std3_rules: bool = False,\n    transitional: bool = False,\n) -> bytes:\n    if not isinstance(s, str):\n        try:\n            s = str(s, \"ascii\")\n        except UnicodeDecodeError:\n            raise IDNAError(\"should pass a unicode string to the function rather than a byte string.\")\n    if uts46:\n        s = uts46_remap(s, std3_rules, transitional)\n    trailing_dot = False\n    result = []\n    if strict:\n        labels = s.split(\".\")\n    else:\n        labels = _unicode_dots_re.split(s)\n    if not labels or labels == [\"\"]:\n        raise IDNAError(\"Empty domain\")\n    if labels[-1] == \"\":\n        del labels[-1]\n        trailing_dot = True\n    for label in labels:\n        s = alabel(label)\n        if s:\n            result.append(s)\n        else:\n            raise IDNAError(\"Empty label\")\n    if trailing_dot:\n        result.append(b\"\")\n    s = b\".\".join(result)\n    if not valid_string_length(s, trailing_dot):\n        raise IDNAError(\"Domain too long\")\n    return s\n\n\ndef decode(\n    s: Union[str, bytes, bytearray],\n    strict: bool = False,\n    uts46: bool = False,\n    std3_rules: bool = False,\n) -> str:\n    try:\n        if not isinstance(s, str):\n            s = str(s, \"ascii\")\n    except UnicodeDecodeError:\n        raise IDNAError(\"Invalid ASCII in A-label\")\n    if uts46:\n        s = uts46_remap(s, std3_rules, False)\n    trailing_dot = False\n    result = []\n    if not strict:\n        labels = _unicode_dots_re.split(s)\n    else:\n        labels = s.split(\".\")\n    if not labels or labels == [\"\"]:\n        raise IDNAError(\"Empty domain\")\n    if not labels[-1]:\n        del labels[-1]\n        trailing_dot = True\n    for label in labels:\n        s = ulabel(label)\n        if s:\n            result.append(s)\n        else:\n            raise IDNAError(\"Empty label\")\n    if trailing_dot:\n        result.append(\"\")\n    return \".\".join(result)\n",[],[216,809,810,811,890,891,1868,1886],"09f763ea-67fc-11f0-bcbe-0224a6c84d84","09f7649e-67fc-11f0-bcbe-0224a6c84d84",361,["D",1753299264504],"from typing import Any, Union\n\nfrom .core import decode, encode\n\n\ndef ToASCII(label: str) -> bytes:\n    return encode(label)\n\n\ndef ToUnicode(label: Union[bytes, bytearray]) -> str:\n    return decode(label)\n\n\ndef nameprep(s: Any) -> None:\n    raise NotImplementedError(\"IDNA 2008 does not utilise nameprep protocol\")\n",[],[216,809,810,811,890,891,1868,1349],"0a112e9c-67fc-11f0-9b65-0224a6c84d84","codec.py","0a112f64-67fc-11f0-9b65-0224a6c84d84",365,["D",1753299264632],"import codecs\nimport re\nfrom typing import Any, Optional, Tuple\n\nfrom .core import IDNAError, alabel, decode, encode, ulabel\n\n_unicode_dots_re = re.compile(\"[\\u002e\\u3002\\uff0e\\uff61]\")\n\n\nclass Codec(codecs.Codec):\n    def encode(self, data: str, errors: str = \"strict\") -> Tuple[bytes, int]:\n        if errors != \"strict\":\n            raise IDNAError('Unsupported error handling \"{}\"'.format(errors))\n\n        if not data:\n            return b\"\", 0\n\n        return encode(data), len(data)\n\n    def decode(self, data: bytes, errors: str = \"strict\") -> Tuple[str, int]:\n        if errors != \"strict\":\n            raise IDNAError('Unsupported error handling \"{}\"'.format(errors))\n\n        if not data:\n            return \"\", 0\n\n        return decode(data), len(data)\n\n\nclass IncrementalEncoder(codecs.BufferedIncrementalEncoder):\n    def _buffer_encode(self, data: str, errors: str, final: bool) -> Tuple[bytes, int]:\n        if errors != \"strict\":\n            raise IDNAError('Unsupported error handling \"{}\"'.format(errors))\n\n        if not data:\n            return b\"\", 0\n\n        labels = _unicode_dots_re.split(data)\n        trailing_dot = b\"\"\n        if labels:\n            if not labels[-1]:\n                trailing_dot = b\".\"\n                del labels[-1]\n            elif not final:\n                # Keep potentially unfinished label until the next call\n                del labels[-1]\n                if labels:\n                    trailing_dot = b\".\"\n\n        result = []\n        size = 0\n        for label in labels:\n            result.append(alabel(label))\n            if size:\n                size += 1\n            size += len(label)\n\n        # Join with U+002E\n        result_bytes = b\".\".join(result) + trailing_dot\n        size += len(trailing_dot)\n        return result_bytes, size\n\n\nclass IncrementalDecoder(codecs.BufferedIncrementalDecoder):\n    def _buffer_decode(self, data: Any, errors: str, final: bool) -> Tuple[str, int]:\n        if errors != \"strict\":\n            raise IDNAError('Unsupported error handling \"{}\"'.format(errors))\n\n        if not data:\n            return (\"\", 0)\n\n        if not isinstance(data, str):\n            data = str(data, \"ascii\")\n\n        labels = _unicode_dots_re.split(data)\n        trailing_dot = \"\"\n        if labels:\n            if not labels[-1]:\n                trailing_dot = \".\"\n                del labels[-1]\n            elif not final:\n                # Keep potentially unfinished label until the next call\n                del labels[-1]\n                if labels:\n                    trailing_dot = \".\"\n\n        result = []\n        size = 0\n        for label in labels:\n            result.append(ulabel(label))\n            if size:\n                size += 1\n            size += len(label)\n\n        result_str = \".\".join(result) + trailing_dot\n        size += len(trailing_dot)\n        return (result_str, size)\n\n\nclass StreamWriter(Codec, codecs.StreamWriter):\n    pass\n\n\nclass StreamReader(Codec, codecs.StreamReader):\n    pass\n\n\ndef search_function(name: str) -> Optional[codecs.CodecInfo]:\n    if name != \"idna2008\":\n        return None\n    return codecs.CodecInfo(\n        name=name,\n        encode=Codec().encode,\n        decode=Codec().decode,\n        incrementalencoder=IncrementalEncoder,\n        incrementaldecoder=IncrementalDecoder,\n        streamwriter=StreamWriter,\n        streamreader=StreamReader,\n    )\n\n\ncodecs.register(search_function)\n",[],[216,809,810,811,890,891,1868,1901],"09ffb2ac-67fc-11f0-8d4e-0224a6c84d84","09ffb374-67fc-11f0-8d4e-0224a6c84d84",362,["D",1753299264558],"from .core import (\n    IDNABidiError,\n    IDNAError,\n    InvalidCodepoint,\n    InvalidCodepointContext,\n    alabel,\n    check_bidi,\n    check_hyphen_ok,\n    check_initial_combiner,\n    check_label,\n    check_nfc,\n    decode,\n    encode,\n    ulabel,\n    uts46_remap,\n    valid_contextj,\n    valid_contexto,\n    valid_label_length,\n    valid_string_length,\n)\nfrom .intranges import intranges_contain\nfrom .package_data import __version__\n\n__all__ = [\n    \"__version__\",\n    \"IDNABidiError\",\n    \"IDNAError\",\n    \"InvalidCodepoint\",\n    \"InvalidCodepointContext\",\n    \"alabel\",\n    \"check_bidi\",\n    \"check_hyphen_ok\",\n    \"check_initial_combiner\",\n    \"check_label\",\n    \"check_nfc\",\n    \"decode\",\n    \"encode\",\n    \"intranges_contain\",\n    \"ulabel\",\n    \"uts46_remap\",\n    \"valid_contextj\",\n    \"valid_contexto\",\n    \"valid_label_length\",\n    \"valid_string_length\",\n]\n",[],[216,809,810,811,890,891,1868,893],"fe33af6e-67fb-11f0-8b06-0224a6c84d84",78,["D",1753299244769],[480,481,482,483,484,485,486],[216,809,810,811,890,891,1868],"0997046e-67fc-11f0-aedf-0224a6c84d84","distro.py","09970536-67fc-11f0-aedf-0224a6c84d84","fe047bcc-67fb-11f0-a7d9-0224a6c84d84",345,["D",1753299263872],"#!/usr/bin/env python\n# Copyright 2015-2021 Nir Cohen\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\n\"\"\"\nThe ``distro`` package (``distro`` stands for Linux Distribution) provides\ninformation about the Linux distribution it runs on, such as a reliable\nmachine-readable distro ID, or version information.\n\nIt is the recommended replacement for Python's original\n:py:func:`platform.linux_distribution` function, but it provides much more\nfunctionality. An alternative implementation became necessary because Python\n3.5 deprecated this function, and Python 3.8 removed it altogether. Its\npredecessor function :py:func:`platform.dist` was already deprecated since\nPython 2.6 and removed in Python 3.8. Still, there are many cases in which\naccess to OS distribution information is needed. See `Python issue 1322\n`_ for more information.\n\"\"\"\n\nimport argparse\nimport json\nimport logging\nimport os\nimport re\nimport shlex\nimport subprocess\nimport sys\nimport warnings\nfrom typing import (\n    Any,\n    Callable,\n    Dict,\n    Iterable,\n    Optional,\n    Sequence,\n    TextIO,\n    Tuple,\n    Type,\n)\n\ntry:\n    from typing import TypedDict\nexcept ImportError:\n    # Python 3.7\n    TypedDict = dict\n\n__version__ = \"1.9.0\"\n\n\nclass VersionDict(TypedDict):\n    major: str\n    minor: str\n    build_number: str\n\n\nclass InfoDict(TypedDict):\n    id: str\n    version: str\n    version_parts: VersionDict\n    like: str\n    codename: str\n\n\n_UNIXCONFDIR = os.environ.get(\"UNIXCONFDIR\", \"/etc\")\n_UNIXUSRLIBDIR = os.environ.get(\"UNIXUSRLIBDIR\", \"/usr/lib\")\n_OS_RELEASE_BASENAME = \"os-release\"\n\n#: Translation table for normalizing the \"ID\" attribute defined in os-release\n#: files, for use by the :func:`distro.id` method.\n#:\n#: * Key: Value as defined in the os-release file, translated to lower case,\n#:   with blanks translated to underscores.\n#:\n#: * Value: Normalized value.\nNORMALIZED_OS_ID = {\n    \"ol\": \"oracle\",  # Oracle Linux\n    \"opensuse-leap\": \"opensuse\",  # Newer versions of OpenSuSE report as opensuse-leap\n}\n\n#: Translation table for normalizing the \"Distributor ID\" attribute returned by\n#: the lsb_release command, for use by the :func:`distro.id` method.\n#:\n#: * Key: Value as returned by the lsb_release command, translated to lower\n#:   case, with blanks translated to underscores.\n#:\n#: * Value: Normalized value.\nNORMALIZED_LSB_ID = {\n    \"enterpriseenterpriseas\": \"oracle\",  # Oracle Enterprise Linux 4\n    \"enterpriseenterpriseserver\": \"oracle\",  # Oracle Linux 5\n    \"redhatenterpriseworkstation\": \"rhel\",  # RHEL 6, 7 Workstation\n    \"redhatenterpriseserver\": \"rhel\",  # RHEL 6, 7 Server\n    \"redhatenterprisecomputenode\": \"rhel\",  # RHEL 6 ComputeNode\n}\n\n#: Translation table for normalizing the distro ID derived from the file name\n#: of distro release files, for use by the :func:`distro.id` method.\n#:\n#: * Key: Value as derived from the file name of a distro release file,\n#:   translated to lower case, with blanks translated to underscores.\n#:\n#: * Value: Normalized value.\nNORMALIZED_DISTRO_ID = {\n    \"redhat\": \"rhel\",  # RHEL 6.x, 7.x\n}\n\n# Pattern for content of distro release file (reversed)\n_DISTRO_RELEASE_CONTENT_REVERSED_PATTERN = re.compile(\n    r\"(?:[^)]*\\)(.*)\\()? *(?:STL )?([\\d.+\\-a-z]*\\d) *(?:esaeler *)?(.+)\"\n)\n\n# Pattern for base file name of distro release file\n_DISTRO_RELEASE_BASENAME_PATTERN = re.compile(r\"(\\w+)[-_](release|version)$\")\n\n# Base file names to be looked up for if _UNIXCONFDIR is not readable.\n_DISTRO_RELEASE_BASENAMES = [\n    \"SuSE-release\",\n    \"altlinux-release\",\n    \"arch-release\",\n    \"base-release\",\n    \"centos-release\",\n    \"fedora-release\",\n    \"gentoo-release\",\n    \"mageia-release\",\n    \"mandrake-release\",\n    \"mandriva-release\",\n    \"mandrivalinux-release\",\n    \"manjaro-release\",\n    \"oracle-release\",\n    \"redhat-release\",\n    \"rocky-release\",\n    \"sl-release\",\n    \"slackware-version\",\n]\n\n# Base file names to be ignored when searching for distro release file\n_DISTRO_RELEASE_IGNORE_BASENAMES = (\n    \"debian_version\",\n    \"lsb-release\",\n    \"oem-release\",\n    _OS_RELEASE_BASENAME,\n    \"system-release\",\n    \"plesk-release\",\n    \"iredmail-release\",\n    \"board-release\",\n    \"ec2_version\",\n)\n\n\ndef linux_distribution(full_distribution_name: bool = True) -> Tuple[str, str, str]:\n    \"\"\"\n    .. deprecated:: 1.6.0\n\n        :func:`distro.linux_distribution()` is deprecated. It should only be\n        used as a compatibility shim with Python's\n        :py:func:`platform.linux_distribution()`. Please use :func:`distro.id`,\n        :func:`distro.version` and :func:`distro.name` instead.\n\n    Return information about the current OS distribution as a tuple\n    ``(id_name, version, codename)`` with items as follows:\n\n    * ``id_name``:  If *full_distribution_name* is false, the result of\n      :func:`distro.id`. Otherwise, the result of :func:`distro.name`.\n\n    * ``version``:  The result of :func:`distro.version`.\n\n    * ``codename``:  The extra item (usually in parentheses) after the\n      os-release version number, or the result of :func:`distro.codename`.\n\n    The interface of this function is compatible with the original\n    :py:func:`platform.linux_distribution` function, supporting a subset of\n    its parameters.\n\n    The data it returns may not exactly be the same, because it uses more data\n    sources than the original function, and that may lead to different data if\n    the OS distribution is not consistent across multiple data sources it\n    provides (there are indeed such distributions ...).\n\n    Another reason for differences is the fact that the :func:`distro.id`\n    method normalizes the distro ID string to a reliable machine-readable value\n    for a number of popular OS distributions.\n    \"\"\"\n    warnings.warn(\n        \"distro.linux_distribution() is deprecated. It should only be used as a \"\n        \"compatibility shim with Python's platform.linux_distribution(). Please use \"\n        \"distro.id(), distro.version() and distro.name() instead.\",\n        DeprecationWarning,\n        stacklevel=2,\n    )\n    return _distro.linux_distribution(full_distribution_name)\n\n\ndef id() -> str:\n    \"\"\"\n    Return the distro ID of the current distribution, as a\n    machine-readable string.\n\n    For a number of OS distributions, the returned distro ID value is\n    *reliable*, in the sense that it is documented and that it does not change\n    across releases of the distribution.\n\n    This package maintains the following reliable distro ID values:\n\n    ==============  =========================================\n    Distro ID       Distribution\n    ==============  =========================================\n    \"ubuntu\"        Ubuntu\n    \"debian\"        Debian\n    \"rhel\"          RedHat Enterprise Linux\n    \"centos\"        CentOS\n    \"fedora\"        Fedora\n    \"sles\"          SUSE Linux Enterprise Server\n    \"opensuse\"      openSUSE\n    \"amzn\"          Amazon Linux\n    \"arch\"          Arch Linux\n    \"buildroot\"     Buildroot\n    \"cloudlinux\"    CloudLinux OS\n    \"exherbo\"       Exherbo Linux\n    \"gentoo\"        GenToo Linux\n    \"ibm_powerkvm\"  IBM PowerKVM\n    \"kvmibm\"        KVM for IBM z Systems\n    \"linuxmint\"     Linux Mint\n    \"mageia\"        Mageia\n    \"mandriva\"      Mandriva Linux\n    \"parallels\"     Parallels\n    \"pidora\"        Pidora\n    \"raspbian\"      Raspbian\n    \"oracle\"        Oracle Linux (and Oracle Enterprise Linux)\n    \"scientific\"    Scientific Linux\n    \"slackware\"     Slackware\n    \"xenserver\"     XenServer\n    \"openbsd\"       OpenBSD\n    \"netbsd\"        NetBSD\n    \"freebsd\"       FreeBSD\n    \"midnightbsd\"   MidnightBSD\n    \"rocky\"         Rocky Linux\n    \"aix\"           AIX\n    \"guix\"          Guix System\n    \"altlinux\"      ALT Linux\n    ==============  =========================================\n\n    If you have a need to get distros for reliable IDs added into this set,\n    or if you find that the :func:`distro.id` function returns a different\n    distro ID for one of the listed distros, please create an issue in the\n    `distro issue tracker`_.\n\n    **Lookup hierarchy and transformations:**\n\n    First, the ID is obtained from the following sources, in the specified\n    order. The first available and non-empty value is used:\n\n    * the value of the \"ID\" attribute of the os-release file,\n\n    * the value of the \"Distributor ID\" attribute returned by the lsb_release\n      command,\n\n    * the first part of the file name of the distro release file,\n\n    The so determined ID value then passes the following transformations,\n    before it is returned by this method:\n\n    * it is translated to lower case,\n\n    * blanks (which should not be there anyway) are translated to underscores,\n\n    * a normalization of the ID is performed, based upon\n      `normalization tables`_. The purpose of this normalization is to ensure\n      that the ID is as reliable as possible, even across incompatible changes\n      in the OS distributions. A common reason for an incompatible change is\n      the addition of an os-release file, or the addition of the lsb_release\n      command, with ID values that differ from what was previously determined\n      from the distro release file name.\n    \"\"\"\n    return _distro.id()\n\n\ndef name(pretty: bool = False) -> str:\n    \"\"\"\n    Return the name of the current OS distribution, as a human-readable\n    string.\n\n    If *pretty* is false, the name is returned without version or codename.\n    (e.g. \"CentOS Linux\")\n\n    If *pretty* is true, the version and codename are appended.\n    (e.g. \"CentOS Linux 7.1.1503 (Core)\")\n\n    **Lookup hierarchy:**\n\n    The name is obtained from the following sources, in the specified order.\n    The first available and non-empty value is used:\n\n    * If *pretty* is false:\n\n      - the value of the \"NAME\" attribute of the os-release file,\n\n      - the value of the \"Distributor ID\" attribute returned by the lsb_release\n        command,\n\n      - the value of the \"\" field of the distro release file.\n\n    * If *pretty* is true:\n\n      - the value of the \"PRETTY_NAME\" attribute of the os-release file,\n\n      - the value of the \"Description\" attribute returned by the lsb_release\n        command,\n\n      - the value of the \"\" field of the distro release file, appended\n        with the value of the pretty version (\"\" and \"\"\n        fields) of the distro release file, if available.\n    \"\"\"\n    return _distro.name(pretty)\n\n\ndef version(pretty: bool = False, best: bool = False) -> str:\n    \"\"\"\n    Return the version of the current OS distribution, as a human-readable\n    string.\n\n    If *pretty* is false, the version is returned without codename (e.g.\n    \"7.0\").\n\n    If *pretty* is true, the codename in parenthesis is appended, if the\n    codename is non-empty (e.g. \"7.0 (Maipo)\").\n\n    Some distributions provide version numbers with different precisions in\n    the different sources of distribution information. Examining the different\n    sources in a fixed priority order does not always yield the most precise\n    version (e.g. for Debian 8.2, or CentOS 7.1).\n\n    Some other distributions may not provide this kind of information. In these\n    cases, an empty string would be returned. This behavior can be observed\n    with rolling releases distributions (e.g. Arch Linux).\n\n    The *best* parameter can be used to control the approach for the returned\n    version:\n\n    If *best* is false, the first non-empty version number in priority order of\n    the examined sources is returned.\n\n    If *best* is true, the most precise version number out of all examined\n    sources is returned.\n\n    **Lookup hierarchy:**\n\n    In all cases, the version number is obtained from the following sources.\n    If *best* is false, this order represents the priority order:\n\n    * the value of the \"VERSION_ID\" attribute of the os-release file,\n    * the value of the \"Release\" attribute returned by the lsb_release\n      command,\n    * the version number parsed from the \"\" field of the first line\n      of the distro release file,\n    * the version number parsed from the \"PRETTY_NAME\" attribute of the\n      os-release file, if it follows the format of the distro release files.\n    * the version number parsed from the \"Description\" attribute returned by\n      the lsb_release command, if it follows the format of the distro release\n      files.\n    \"\"\"\n    return _distro.version(pretty, best)\n\n\ndef version_parts(best: bool = False) -> Tuple[str, str, str]:\n    \"\"\"\n    Return the version of the current OS distribution as a tuple\n    ``(major, minor, build_number)`` with items as follows:\n\n    * ``major``:  The result of :func:`distro.major_version`.\n\n    * ``minor``:  The result of :func:`distro.minor_version`.\n\n    * ``build_number``:  The result of :func:`distro.build_number`.\n\n    For a description of the *best* parameter, see the :func:`distro.version`\n    method.\n    \"\"\"\n    return _distro.version_parts(best)\n\n\ndef major_version(best: bool = False) -> str:\n    \"\"\"\n    Return the major version of the current OS distribution, as a string,\n    if provided.\n    Otherwise, the empty string is returned. The major version is the first\n    part of the dot-separated version string.\n\n    For a description of the *best* parameter, see the :func:`distro.version`\n    method.\n    \"\"\"\n    return _distro.major_version(best)\n\n\ndef minor_version(best: bool = False) -> str:\n    \"\"\"\n    Return the minor version of the current OS distribution, as a string,\n    if provided.\n    Otherwise, the empty string is returned. The minor version is the second\n    part of the dot-separated version string.\n\n    For a description of the *best* parameter, see the :func:`distro.version`\n    method.\n    \"\"\"\n    return _distro.minor_version(best)\n\n\ndef build_number(best: bool = False) -> str:\n    \"\"\"\n    Return the build number of the current OS distribution, as a string,\n    if provided.\n    Otherwise, the empty string is returned. The build number is the third part\n    of the dot-separated version string.\n\n    For a description of the *best* parameter, see the :func:`distro.version`\n    method.\n    \"\"\"\n    return _distro.build_number(best)\n\n\ndef like() -> str:\n    \"\"\"\n    Return a space-separated list of distro IDs of distributions that are\n    closely related to the current OS distribution in regards to packaging\n    and programming interfaces, for example distributions the current\n    distribution is a derivative from.\n\n    **Lookup hierarchy:**\n\n    This information item is only provided by the os-release file.\n    For details, see the description of the \"ID_LIKE\" attribute in the\n    `os-release man page\n    `_.\n    \"\"\"\n    return _distro.like()\n\n\ndef codename() -> str:\n    \"\"\"\n    Return the codename for the release of the current OS distribution,\n    as a string.\n\n    If the distribution does not have a codename, an empty string is returned.\n\n    Note that the returned codename is not always really a codename. For\n    example, openSUSE returns \"x86_64\". This function does not handle such\n    cases in any special way and just returns the string it finds, if any.\n\n    **Lookup hierarchy:**\n\n    * the codename within the \"VERSION\" attribute of the os-release file, if\n      provided,\n\n    * the value of the \"Codename\" attribute returned by the lsb_release\n      command,\n\n    * the value of the \"\" field of the distro release file.\n    \"\"\"\n    return _distro.codename()\n\n\ndef info(pretty: bool = False, best: bool = False) -> InfoDict:\n    \"\"\"\n    Return certain machine-readable information items about the current OS\n    distribution in a dictionary, as shown in the following example:\n\n    .. sourcecode:: python\n\n        {\n            'id': 'rhel',\n            'version': '7.0',\n            'version_parts': {\n                'major': '7',\n                'minor': '0',\n                'build_number': ''\n            },\n            'like': 'fedora',\n            'codename': 'Maipo'\n        }\n\n    The dictionary structure and keys are always the same, regardless of which\n    information items are available in the underlying data sources. The values\n    for the various keys are as follows:\n\n    * ``id``:  The result of :func:`distro.id`.\n\n    * ``version``:  The result of :func:`distro.version`.\n\n    * ``version_parts -> major``:  The result of :func:`distro.major_version`.\n\n    * ``version_parts -> minor``:  The result of :func:`distro.minor_version`.\n\n    * ``version_parts -> build_number``:  The result of\n      :func:`distro.build_number`.\n\n    * ``like``:  The result of :func:`distro.like`.\n\n    * ``codename``:  The result of :func:`distro.codename`.\n\n    For a description of the *pretty* and *best* parameters, see the\n    :func:`distro.version` method.\n    \"\"\"\n    return _distro.info(pretty, best)\n\n\ndef os_release_info() -> Dict[str, str]:\n    \"\"\"\n    Return a dictionary containing key-value pairs for the information items\n    from the os-release file data source of the current OS distribution.\n\n    See `os-release file`_ for details about these information items.\n    \"\"\"\n    return _distro.os_release_info()\n\n\ndef lsb_release_info() -> Dict[str, str]:\n    \"\"\"\n    Return a dictionary containing key-value pairs for the information items\n    from the lsb_release command data source of the current OS distribution.\n\n    See `lsb_release command output`_ for details about these information\n    items.\n    \"\"\"\n    return _distro.lsb_release_info()\n\n\ndef distro_release_info() -> Dict[str, str]:\n    \"\"\"\n    Return a dictionary containing key-value pairs for the information items\n    from the distro release file data source of the current OS distribution.\n\n    See `distro release file`_ for details about these information items.\n    \"\"\"\n    return _distro.distro_release_info()\n\n\ndef uname_info() -> Dict[str, str]:\n    \"\"\"\n    Return a dictionary containing key-value pairs for the information items\n    from the distro release file data source of the current OS distribution.\n    \"\"\"\n    return _distro.uname_info()\n\n\ndef os_release_attr(attribute: str) -> str:\n    \"\"\"\n    Return a single named information item from the os-release file data source\n    of the current OS distribution.\n\n    Parameters:\n\n    * ``attribute`` (string): Key of the information item.\n\n    Returns:\n\n    * (string): Value of the information item, if the item exists.\n      The empty string, if the item does not exist.\n\n    See `os-release file`_ for details about these information items.\n    \"\"\"\n    return _distro.os_release_attr(attribute)\n\n\ndef lsb_release_attr(attribute: str) -> str:\n    \"\"\"\n    Return a single named information item from the lsb_release command output\n    data source of the current OS distribution.\n\n    Parameters:\n\n    * ``attribute`` (string): Key of the information item.\n\n    Returns:\n\n    * (string): Value of the information item, if the item exists.\n      The empty string, if the item does not exist.\n\n    See `lsb_release command output`_ for details about these information\n    items.\n    \"\"\"\n    return _distro.lsb_release_attr(attribute)\n\n\ndef distro_release_attr(attribute: str) -> str:\n    \"\"\"\n    Return a single named information item from the distro release file\n    data source of the current OS distribution.\n\n    Parameters:\n\n    * ``attribute`` (string): Key of the information item.\n\n    Returns:\n\n    * (string): Value of the information item, if the item exists.\n      The empty string, if the item does not exist.\n\n    See `distro release file`_ for details about these information items.\n    \"\"\"\n    return _distro.distro_release_attr(attribute)\n\n\ndef uname_attr(attribute: str) -> str:\n    \"\"\"\n    Return a single named information item from the distro release file\n    data source of the current OS distribution.\n\n    Parameters:\n\n    * ``attribute`` (string): Key of the information item.\n\n    Returns:\n\n    * (string): Value of the information item, if the item exists.\n                The empty string, if the item does not exist.\n    \"\"\"\n    return _distro.uname_attr(attribute)\n\n\ntry:\n    from functools import cached_property\nexcept ImportError:\n    # Python < 3.8\n    class cached_property:  # type: ignore\n        \"\"\"A version of @property which caches the value.  On access, it calls the\n        underlying function and sets the value in `__dict__` so future accesses\n        will not re-call the property.\n        \"\"\"\n\n        def __init__(self, f: Callable[[Any], Any]) -> None:\n            self._fname = f.__name__\n            self._f = f\n\n        def __get__(self, obj: Any, owner: Type[Any]) -> Any:\n            assert obj is not None, f\"call {self._fname} on an instance\"\n            ret = obj.__dict__[self._fname] = self._f(obj)\n            return ret\n\n\nclass LinuxDistribution:\n    \"\"\"\n    Provides information about a OS distribution.\n\n    This package creates a private module-global instance of this class with\n    default initialization arguments, that is used by the\n    `consolidated accessor functions`_ and `single source accessor functions`_.\n    By using default initialization arguments, that module-global instance\n    returns data about the current OS distribution (i.e. the distro this\n    package runs on).\n\n    Normally, it is not necessary to create additional instances of this class.\n    However, in situations where control is needed over the exact data sources\n    that are used, instances of this class can be created with a specific\n    distro release file, or a specific os-release file, or without invoking the\n    lsb_release command.\n    \"\"\"\n\n    def __init__(\n        self,\n        include_lsb: Optional[bool] = None,\n        os_release_file: str = \"\",\n        distro_release_file: str = \"\",\n        include_uname: Optional[bool] = None,\n        root_dir: Optional[str] = None,\n        include_oslevel: Optional[bool] = None,\n    ) -> None:\n        \"\"\"\n        The initialization method of this class gathers information from the\n        available data sources, and stores that in private instance attributes.\n        Subsequent access to the information items uses these private instance\n        attributes, so that the data sources are read only once.\n\n        Parameters:\n\n        * ``include_lsb`` (bool): Controls whether the\n          `lsb_release command output`_ is included as a data source.\n\n          If the lsb_release command is not available in the program execution\n          path, the data source for the lsb_release command will be empty.\n\n        * ``os_release_file`` (string): The path name of the\n          `os-release file`_ that is to be used as a data source.\n\n          An empty string (the default) will cause the default path name to\n          be used (see `os-release file`_ for details).\n\n          If the specified or defaulted os-release file does not exist, the\n          data source for the os-release file will be empty.\n\n        * ``distro_release_file`` (string): The path name of the\n          `distro release file`_ that is to be used as a data source.\n\n          An empty string (the default) will cause a default search algorithm\n          to be used (see `distro release file`_ for details).\n\n          If the specified distro release file does not exist, or if no default\n          distro release file can be found, the data source for the distro\n          release file will be empty.\n\n        * ``include_uname`` (bool): Controls whether uname command output is\n          included as a data source. If the uname command is not available in\n          the program execution path the data source for the uname command will\n          be empty.\n\n        * ``root_dir`` (string): The absolute path to the root directory to use\n          to find distro-related information files. Note that ``include_*``\n          parameters must not be enabled in combination with ``root_dir``.\n\n        * ``include_oslevel`` (bool): Controls whether (AIX) oslevel command\n          output is included as a data source. If the oslevel command is not\n          available in the program execution path the data source will be\n          empty.\n\n        Public instance attributes:\n\n        * ``os_release_file`` (string): The path name of the\n          `os-release file`_ that is actually used as a data source. The\n          empty string if no distro release file is used as a data source.\n\n        * ``distro_release_file`` (string): The path name of the\n          `distro release file`_ that is actually used as a data source. The\n          empty string if no distro release file is used as a data source.\n\n        * ``include_lsb`` (bool): The result of the ``include_lsb`` parameter.\n          This controls whether the lsb information will be loaded.\n\n        * ``include_uname`` (bool): The result of the ``include_uname``\n          parameter. This controls whether the uname information will\n          be loaded.\n\n        * ``include_oslevel`` (bool): The result of the ``include_oslevel``\n          parameter. This controls whether (AIX) oslevel information will be\n          loaded.\n\n        * ``root_dir`` (string): The result of the ``root_dir`` parameter.\n          The absolute path to the root directory to use to find distro-related\n          information files.\n\n        Raises:\n\n        * :py:exc:`ValueError`: Initialization parameters combination is not\n           supported.\n\n        * :py:exc:`OSError`: Some I/O issue with an os-release file or distro\n          release file.\n\n        * :py:exc:`UnicodeError`: A data source has unexpected characters or\n          uses an unexpected encoding.\n        \"\"\"\n        self.root_dir = root_dir\n        self.etc_dir = os.path.join(root_dir, \"etc\") if root_dir else _UNIXCONFDIR\n        self.usr_lib_dir = (\n            os.path.join(root_dir, \"usr/lib\") if root_dir else _UNIXUSRLIBDIR\n        )\n\n        if os_release_file:\n            self.os_release_file = os_release_file\n        else:\n            etc_dir_os_release_file = os.path.join(self.etc_dir, _OS_RELEASE_BASENAME)\n            usr_lib_os_release_file = os.path.join(\n                self.usr_lib_dir, _OS_RELEASE_BASENAME\n            )\n\n            # NOTE: The idea is to respect order **and** have it set\n            #       at all times for API backwards compatibility.\n            if os.path.isfile(etc_dir_os_release_file) or not os.path.isfile(\n                usr_lib_os_release_file\n            ):\n                self.os_release_file = etc_dir_os_release_file\n            else:\n                self.os_release_file = usr_lib_os_release_file\n\n        self.distro_release_file = distro_release_file or \"\"  # updated later\n\n        is_root_dir_defined = root_dir is not None\n        if is_root_dir_defined and (include_lsb or include_uname or include_oslevel):\n            raise ValueError(\n                \"Including subprocess data sources from specific root_dir is disallowed\"\n                \" to prevent false information\"\n            )\n        self.include_lsb = (\n            include_lsb if include_lsb is not None else not is_root_dir_defined\n        )\n        self.include_uname = (\n            include_uname if include_uname is not None else not is_root_dir_defined\n        )\n        self.include_oslevel = (\n            include_oslevel if include_oslevel is not None else not is_root_dir_defined\n        )\n\n    def __repr__(self) -> str:\n        \"\"\"Return repr of all info\"\"\"\n        return (\n            \"LinuxDistribution(\"\n            \"os_release_file={self.os_release_file!r}, \"\n            \"distro_release_file={self.distro_release_file!r}, \"\n            \"include_lsb={self.include_lsb!r}, \"\n            \"include_uname={self.include_uname!r}, \"\n            \"include_oslevel={self.include_oslevel!r}, \"\n            \"root_dir={self.root_dir!r}, \"\n            \"_os_release_info={self._os_release_info!r}, \"\n            \"_lsb_release_info={self._lsb_release_info!r}, \"\n            \"_distro_release_info={self._distro_release_info!r}, \"\n            \"_uname_info={self._uname_info!r}, \"\n            \"_oslevel_info={self._oslevel_info!r})\".format(self=self)\n        )\n\n    def linux_distribution(\n        self, full_distribution_name: bool = True\n    ) -> Tuple[str, str, str]:\n        \"\"\"\n        Return information about the OS distribution that is compatible\n        with Python's :func:`platform.linux_distribution`, supporting a subset\n        of its parameters.\n\n        For details, see :func:`distro.linux_distribution`.\n        \"\"\"\n        return (\n            self.name() if full_distribution_name else self.id(),\n            self.version(),\n            self._os_release_info.get(\"release_codename\") or self.codename(),\n        )\n\n    def id(self) -> str:\n        \"\"\"Return the distro ID of the OS distribution, as a string.\n\n        For details, see :func:`distro.id`.\n        \"\"\"\n\n        def normalize(distro_id: str, table: Dict[str, str]) -> str:\n            distro_id = distro_id.lower().replace(\" \", \"_\")\n            return table.get(distro_id, distro_id)\n\n        distro_id = self.os_release_attr(\"id\")\n        if distro_id:\n            return normalize(distro_id, NORMALIZED_OS_ID)\n\n        distro_id = self.lsb_release_attr(\"distributor_id\")\n        if distro_id:\n            return normalize(distro_id, NORMALIZED_LSB_ID)\n\n        distro_id = self.distro_release_attr(\"id\")\n        if distro_id:\n            return normalize(distro_id, NORMALIZED_DISTRO_ID)\n\n        distro_id = self.uname_attr(\"id\")\n        if distro_id:\n            return normalize(distro_id, NORMALIZED_DISTRO_ID)\n\n        return \"\"\n\n    def name(self, pretty: bool = False) -> str:\n        \"\"\"\n        Return the name of the OS distribution, as a string.\n\n        For details, see :func:`distro.name`.\n        \"\"\"\n        name = (\n            self.os_release_attr(\"name\")\n            or self.lsb_release_attr(\"distributor_id\")\n            or self.distro_release_attr(\"name\")\n            or self.uname_attr(\"name\")\n        )\n        if pretty:\n            name = self.os_release_attr(\"pretty_name\") or self.lsb_release_attr(\n                \"description\"\n            )\n            if not name:\n                name = self.distro_release_attr(\"name\") or self.uname_attr(\"name\")\n                version = self.version(pretty=True)\n                if version:\n                    name = f\"{name} {version}\"\n        return name or \"\"\n\n    def version(self, pretty: bool = False, best: bool = False) -> str:\n        \"\"\"\n        Return the version of the OS distribution, as a string.\n\n        For details, see :func:`distro.version`.\n        \"\"\"\n        versions = [\n            self.os_release_attr(\"version_id\"),\n            self.lsb_release_attr(\"release\"),\n            self.distro_release_attr(\"version_id\"),\n            self._parse_distro_release_content(self.os_release_attr(\"pretty_name\")).get(\n                \"version_id\", \"\"\n            ),\n            self._parse_distro_release_content(\n                self.lsb_release_attr(\"description\")\n            ).get(\"version_id\", \"\"),\n            self.uname_attr(\"release\"),\n        ]\n        if self.uname_attr(\"id\").startswith(\"aix\"):\n            # On AIX platforms, prefer oslevel command output.\n            versions.insert(0, self.oslevel_info())\n        elif self.id() == \"debian\" or \"debian\" in self.like().split():\n            # On Debian-like, add debian_version file content to candidates list.\n            versions.append(self._debian_version)\n        version = \"\"\n        if best:\n            # This algorithm uses the last version in priority order that has\n            # the best precision. If the versions are not in conflict, that\n            # does not matter; otherwise, using the last one instead of the\n            # first one might be considered a surprise.\n            for v in versions:\n                if v.count(\".\") > version.count(\".\") or version == \"\":\n                    version = v\n        else:\n            for v in versions:\n                if v != \"\":\n                    version = v\n                    break\n        if pretty and version and self.codename():\n            version = f\"{version} ({self.codename()})\"\n        return version\n\n    def version_parts(self, best: bool = False) -> Tuple[str, str, str]:\n        \"\"\"\n        Return the version of the OS distribution, as a tuple of version\n        numbers.\n\n        For details, see :func:`distro.version_parts`.\n        \"\"\"\n        version_str = self.version(best=best)\n        if version_str:\n            version_regex = re.compile(r\"(\\d+)\\.?(\\d+)?\\.?(\\d+)?\")\n            matches = version_regex.match(version_str)\n            if matches:\n                major, minor, build_number = matches.groups()\n                return major, minor or \"\", build_number or \"\"\n        return \"\", \"\", \"\"\n\n    def major_version(self, best: bool = False) -> str:\n        \"\"\"\n        Return the major version number of the current distribution.\n\n        For details, see :func:`distro.major_version`.\n        \"\"\"\n        return self.version_parts(best)[0]\n\n    def minor_version(self, best: bool = False) -> str:\n        \"\"\"\n        Return the minor version number of the current distribution.\n\n        For details, see :func:`distro.minor_version`.\n        \"\"\"\n        return self.version_parts(best)[1]\n\n    def build_number(self, best: bool = False) -> str:\n        \"\"\"\n        Return the build number of the current distribution.\n\n        For details, see :func:`distro.build_number`.\n        \"\"\"\n        return self.version_parts(best)[2]\n\n    def like(self) -> str:\n        \"\"\"\n        Return the IDs of distributions that are like the OS distribution.\n\n        For details, see :func:`distro.like`.\n        \"\"\"\n        return self.os_release_attr(\"id_like\") or \"\"\n\n    def codename(self) -> str:\n        \"\"\"\n        Return the codename of the OS distribution.\n\n        For details, see :func:`distro.codename`.\n        \"\"\"\n        try:\n            # Handle os_release specially since distros might purposefully set\n            # this to empty string to have no codename\n            return self._os_release_info[\"codename\"]\n        except KeyError:\n            return (\n                self.lsb_release_attr(\"codename\")\n                or self.distro_release_attr(\"codename\")\n                or \"\"\n            )\n\n    def info(self, pretty: bool = False, best: bool = False) -> InfoDict:\n        \"\"\"\n        Return certain machine-readable information about the OS\n        distribution.\n\n        For details, see :func:`distro.info`.\n        \"\"\"\n        return InfoDict(\n            id=self.id(),\n            version=self.version(pretty, best),\n            version_parts=VersionDict(\n                major=self.major_version(best),\n                minor=self.minor_version(best),\n                build_number=self.build_number(best),\n            ),\n            like=self.like(),\n            codename=self.codename(),\n        )\n\n    def os_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Return a dictionary containing key-value pairs for the information\n        items from the os-release file data source of the OS distribution.\n\n        For details, see :func:`distro.os_release_info`.\n        \"\"\"\n        return self._os_release_info\n\n    def lsb_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Return a dictionary containing key-value pairs for the information\n        items from the lsb_release command data source of the OS\n        distribution.\n\n        For details, see :func:`distro.lsb_release_info`.\n        \"\"\"\n        return self._lsb_release_info\n\n    def distro_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Return a dictionary containing key-value pairs for the information\n        items from the distro release file data source of the OS\n        distribution.\n\n        For details, see :func:`distro.distro_release_info`.\n        \"\"\"\n        return self._distro_release_info\n\n    def uname_info(self) -> Dict[str, str]:\n        \"\"\"\n        Return a dictionary containing key-value pairs for the information\n        items from the uname command data source of the OS distribution.\n\n        For details, see :func:`distro.uname_info`.\n        \"\"\"\n        return self._uname_info\n\n    def oslevel_info(self) -> str:\n        \"\"\"\n        Return AIX' oslevel command output.\n        \"\"\"\n        return self._oslevel_info\n\n    def os_release_attr(self, attribute: str) -> str:\n        \"\"\"\n        Return a single named information item from the os-release file data\n        source of the OS distribution.\n\n        For details, see :func:`distro.os_release_attr`.\n        \"\"\"\n        return self._os_release_info.get(attribute, \"\")\n\n    def lsb_release_attr(self, attribute: str) -> str:\n        \"\"\"\n        Return a single named information item from the lsb_release command\n        output data source of the OS distribution.\n\n        For details, see :func:`distro.lsb_release_attr`.\n        \"\"\"\n        return self._lsb_release_info.get(attribute, \"\")\n\n    def distro_release_attr(self, attribute: str) -> str:\n        \"\"\"\n        Return a single named information item from the distro release file\n        data source of the OS distribution.\n\n        For details, see :func:`distro.distro_release_attr`.\n        \"\"\"\n        return self._distro_release_info.get(attribute, \"\")\n\n    def uname_attr(self, attribute: str) -> str:\n        \"\"\"\n        Return a single named information item from the uname command\n        output data source of the OS distribution.\n\n        For details, see :func:`distro.uname_attr`.\n        \"\"\"\n        return self._uname_info.get(attribute, \"\")\n\n    @cached_property\n    def _os_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Get the information items from the specified os-release file.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        if os.path.isfile(self.os_release_file):\n            with open(self.os_release_file, encoding=\"utf-8\") as release_file:\n                return self._parse_os_release_content(release_file)\n        return {}\n\n    @staticmethod\n    def _parse_os_release_content(lines: TextIO) -> Dict[str, str]:\n        \"\"\"\n        Parse the lines of an os-release file.\n\n        Parameters:\n\n        * lines: Iterable through the lines in the os-release file.\n                 Each line must be a unicode string or a UTF-8 encoded byte\n                 string.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        props = {}\n        lexer = shlex.shlex(lines, posix=True)\n        lexer.whitespace_split = True\n\n        tokens = list(lexer)\n        for token in tokens:\n            # At this point, all shell-like parsing has been done (i.e.\n            # comments processed, quotes and backslash escape sequences\n            # processed, multi-line values assembled, trailing newlines\n            # stripped, etc.), so the tokens are now either:\n            # * variable assignments: var=value\n            # * commands or their arguments (not allowed in os-release)\n            # Ignore any tokens that are not variable assignments\n            if \"=\" in token:\n                k, v = token.split(\"=\", 1)\n                props[k.lower()] = v\n\n        if \"version\" in props:\n            # extract release codename (if any) from version attribute\n            match = re.search(r\"\\((\\D+)\\)|,\\s*(\\D+)\", props[\"version\"])\n            if match:\n                release_codename = match.group(1) or match.group(2)\n                props[\"codename\"] = props[\"release_codename\"] = release_codename\n\n        if \"version_codename\" in props:\n            # os-release added a version_codename field.  Use that in\n            # preference to anything else Note that some distros purposefully\n            # do not have code names.  They should be setting\n            # version_codename=\"\"\n            props[\"codename\"] = props[\"version_codename\"]\n        elif \"ubuntu_codename\" in props:\n            # Same as above but a non-standard field name used on older Ubuntus\n            props[\"codename\"] = props[\"ubuntu_codename\"]\n\n        return props\n\n    @cached_property\n    def _lsb_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Get the information items from the lsb_release command output.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        if not self.include_lsb:\n            return {}\n        try:\n            cmd = (\"lsb_release\", \"-a\")\n            stdout = subprocess.check_output(cmd, stderr=subprocess.DEVNULL)\n        # Command not found or lsb_release returned error\n        except (OSError, subprocess.CalledProcessError):\n            return {}\n        content = self._to_str(stdout).splitlines()\n        return self._parse_lsb_release_content(content)\n\n    @staticmethod\n    def _parse_lsb_release_content(lines: Iterable[str]) -> Dict[str, str]:\n        \"\"\"\n        Parse the output of the lsb_release command.\n\n        Parameters:\n\n        * lines: Iterable through the lines of the lsb_release output.\n                 Each line must be a unicode string or a UTF-8 encoded byte\n                 string.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        props = {}\n        for line in lines:\n            kv = line.strip(\"\\n\").split(\":\", 1)\n            if len(kv) != 2:\n                # Ignore lines without colon.\n                continue\n            k, v = kv\n            props.update({k.replace(\" \", \"_\").lower(): v.strip()})\n        return props\n\n    @cached_property\n    def _uname_info(self) -> Dict[str, str]:\n        if not self.include_uname:\n            return {}\n        try:\n            cmd = (\"uname\", \"-rs\")\n            stdout = subprocess.check_output(cmd, stderr=subprocess.DEVNULL)\n        except OSError:\n            return {}\n        content = self._to_str(stdout).splitlines()\n        return self._parse_uname_content(content)\n\n    @cached_property\n    def _oslevel_info(self) -> str:\n        if not self.include_oslevel:\n            return \"\"\n        try:\n            stdout = subprocess.check_output(\"oslevel\", stderr=subprocess.DEVNULL)\n        except (OSError, subprocess.CalledProcessError):\n            return \"\"\n        return self._to_str(stdout).strip()\n\n    @cached_property\n    def _debian_version(self) -> str:\n        try:\n            with open(\n                os.path.join(self.etc_dir, \"debian_version\"), encoding=\"ascii\"\n            ) as fp:\n                return fp.readline().rstrip()\n        except FileNotFoundError:\n            return \"\"\n\n    @staticmethod\n    def _parse_uname_content(lines: Sequence[str]) -> Dict[str, str]:\n        if not lines:\n            return {}\n        props = {}\n        match = re.search(r\"^([^\\s]+)\\s+([\\d\\.]+)\", lines[0].strip())\n        if match:\n            name, version = match.groups()\n\n            # This is to prevent the Linux kernel version from\n            # appearing as the 'best' version on otherwise\n            # identifiable distributions.\n            if name == \"Linux\":\n                return {}\n            props[\"id\"] = name.lower()\n            props[\"name\"] = name\n            props[\"release\"] = version\n        return props\n\n    @staticmethod\n    def _to_str(bytestring: bytes) -> str:\n        encoding = sys.getfilesystemencoding()\n        return bytestring.decode(encoding)\n\n    @cached_property\n    def _distro_release_info(self) -> Dict[str, str]:\n        \"\"\"\n        Get the information items from the specified distro release file.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        if self.distro_release_file:\n            # If it was specified, we use it and parse what we can, even if\n            # its file name or content does not match the expected pattern.\n            distro_info = self._parse_distro_release_file(self.distro_release_file)\n            basename = os.path.basename(self.distro_release_file)\n            # The file name pattern for user-specified distro release files\n            # is somewhat more tolerant (compared to when searching for the\n            # file), because we want to use what was specified as best as\n            # possible.\n            match = _DISTRO_RELEASE_BASENAME_PATTERN.match(basename)\n        else:\n            try:\n                basenames = [\n                    basename\n                    for basename in os.listdir(self.etc_dir)\n                    if basename not in _DISTRO_RELEASE_IGNORE_BASENAMES\n                    and os.path.isfile(os.path.join(self.etc_dir, basename))\n                ]\n                # We sort for repeatability in cases where there are multiple\n                # distro specific files; e.g. CentOS, Oracle, Enterprise all\n                # containing `redhat-release` on top of their own.\n                basenames.sort()\n            except OSError:\n                # This may occur when /etc is not readable but we can't be\n                # sure about the *-release files. Check common entries of\n                # /etc for information. If they turn out to not be there the\n                # error is handled in `_parse_distro_release_file()`.\n                basenames = _DISTRO_RELEASE_BASENAMES\n            for basename in basenames:\n                match = _DISTRO_RELEASE_BASENAME_PATTERN.match(basename)\n                if match is None:\n                    continue\n                filepath = os.path.join(self.etc_dir, basename)\n                distro_info = self._parse_distro_release_file(filepath)\n                # The name is always present if the pattern matches.\n                if \"name\" not in distro_info:\n                    continue\n                self.distro_release_file = filepath\n                break\n            else:  # the loop didn't \"break\": no candidate.\n                return {}\n\n        if match is not None:\n            distro_info[\"id\"] = match.group(1)\n\n        # CloudLinux < 7: manually enrich info with proper id.\n        if \"cloudlinux\" in distro_info.get(\"name\", \"\").lower():\n            distro_info[\"id\"] = \"cloudlinux\"\n\n        return distro_info\n\n    def _parse_distro_release_file(self, filepath: str) -> Dict[str, str]:\n        \"\"\"\n        Parse a distro release file.\n\n        Parameters:\n\n        * filepath: Path name of the distro release file.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        try:\n            with open(filepath, encoding=\"utf-8\") as fp:\n                # Only parse the first line. For instance, on SLES there\n                # are multiple lines. We don't want them...\n                return self._parse_distro_release_content(fp.readline())\n        except OSError:\n            # Ignore not being able to read a specific, seemingly version\n            # related file.\n            # See https://github.com/python-distro/distro/issues/162\n            return {}\n\n    @staticmethod\n    def _parse_distro_release_content(line: str) -> Dict[str, str]:\n        \"\"\"\n        Parse a line from a distro release file.\n\n        Parameters:\n        * line: Line from the distro release file. Must be a unicode string\n                or a UTF-8 encoded byte string.\n\n        Returns:\n            A dictionary containing all information items.\n        \"\"\"\n        matches = _DISTRO_RELEASE_CONTENT_REVERSED_PATTERN.match(line.strip()[::-1])\n        distro_info = {}\n        if matches:\n            # regexp ensures non-None\n            distro_info[\"name\"] = matches.group(3)[::-1]\n            if matches.group(2):\n                distro_info[\"version_id\"] = matches.group(2)[::-1]\n            if matches.group(1):\n                distro_info[\"codename\"] = matches.group(1)[::-1]\n        elif line:\n            distro_info[\"name\"] = line.strip()\n        return distro_info\n\n\n_distro = LinuxDistribution()\n\n\ndef main() -> None:\n    logger = logging.getLogger(__name__)\n    logger.setLevel(logging.DEBUG)\n    logger.addHandler(logging.StreamHandler(sys.stdout))\n\n    parser = argparse.ArgumentParser(description=\"OS distro info tool\")\n    parser.add_argument(\n        \"--json\", \"-j\", help=\"Output in machine readable format\", action=\"store_true\"\n    )\n\n    parser.add_argument(\n        \"--root-dir\",\n        \"-r\",\n        type=str,\n        dest=\"root_dir\",\n        help=\"Path to the root filesystem directory (defaults to /)\",\n    )\n\n    args = parser.parse_args()\n\n    if args.root_dir:\n        dist = LinuxDistribution(\n            include_lsb=False,\n            include_uname=False,\n            include_oslevel=False,\n            root_dir=args.root_dir,\n        )\n    else:\n        dist = _distro\n\n    if args.json:\n        logger.info(json.dumps(dist.info(), indent=4, sort_keys=True))\n    else:\n        logger.info(\"Name: %s\", dist.name(pretty=True))\n        distribution_version = dist.version(pretty=True)\n        logger.info(\"Version: %s\", distribution_version)\n        distribution_codename = dist.codename()\n        logger.info(\"Codename: %s\", distribution_codename)\n\n\nif __name__ == \"__main__\":\n    main()\n",[],[216,809,810,811,890,891,1929,1921],"distro","099bdad4-67fc-11f0-bcbe-0224a6c84d84","099bdb88-67fc-11f0-bcbe-0224a6c84d84",346,["D",1753299263903],"from .distro import main\n\nif __name__ == \"__main__\":\n    main()\n",[],[216,809,810,811,890,891,1929,1566],"09910f00-67fc-11f0-a082-0224a6c84d84","09910fdc-67fc-11f0-a082-0224a6c84d84",344,["D",1753299263833],"from .distro import (\n    NORMALIZED_DISTRO_ID,\n    NORMALIZED_LSB_ID,\n    NORMALIZED_OS_ID,\n    LinuxDistribution,\n    __version__,\n    build_number,\n    codename,\n    distro_release_attr,\n    distro_release_info,\n    id,\n    info,\n    like,\n    linux_distribution,\n    lsb_release_attr,\n    lsb_release_info,\n    major_version,\n    minor_version,\n    name,\n    os_release_attr,\n    os_release_info,\n    uname_attr,\n    uname_info,\n    version,\n    version_parts,\n)\n\n__all__ = [\n    \"NORMALIZED_DISTRO_ID\",\n    \"NORMALIZED_LSB_ID\",\n    \"NORMALIZED_OS_ID\",\n    \"LinuxDistribution\",\n    \"build_number\",\n    \"codename\",\n    \"distro_release_attr\",\n    \"distro_release_info\",\n    \"id\",\n    \"info\",\n    \"like\",\n    \"linux_distribution\",\n    \"lsb_release_attr\",\n    \"lsb_release_info\",\n    \"major_version\",\n    \"minor_version\",\n    \"name\",\n    \"os_release_attr\",\n    \"os_release_info\",\n    \"uname_attr\",\n    \"uname_info\",\n    \"version\",\n    \"version_parts\",\n]\n\n__version__ = __version__\n",[],[216,809,810,811,890,891,1929,893],"fe04799c-67fb-11f0-a7d9-0224a6c84d84",76,["D",1753299244456],[476,477,478],[216,809,810,811,890,891,1929],"0988f5a4-67fc-11f0-a319-0224a6c84d84","wheel.py","0988f658-67fc-11f0-a319-0224a6c84d84","fde616aa-67fb-11f0-88b0-0224a6c84d84",343,["D",1753299263779],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom __future__ import unicode_literals\n\nimport base64\nimport codecs\nimport datetime\nfrom email import message_from_file\nimport hashlib\nimport json\nimport logging\nimport os\nimport posixpath\nimport re\nimport shutil\nimport sys\nimport tempfile\nimport zipfile\n\nfrom . import __version__, DistlibException\nfrom .compat import sysconfig, ZipFile, fsdecode, text_type, filter\nfrom .database import InstalledDistribution\nfrom .metadata import Metadata, WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME\nfrom .util import (FileOperator, convert_path, CSVReader, CSVWriter, Cache, cached_property, get_cache_base,\n                   read_exports, tempdir, get_platform)\nfrom .version import NormalizedVersion, UnsupportedVersionError\n\nlogger = logging.getLogger(__name__)\n\ncache = None  # created when needed\n\nif hasattr(sys, 'pypy_version_info'):  # pragma: no cover\n    IMP_PREFIX = 'pp'\nelif sys.platform.startswith('java'):  # pragma: no cover\n    IMP_PREFIX = 'jy'\nelif sys.platform == 'cli':  # pragma: no cover\n    IMP_PREFIX = 'ip'\nelse:\n    IMP_PREFIX = 'cp'\n\nVER_SUFFIX = sysconfig.get_config_var('py_version_nodot')\nif not VER_SUFFIX:  # pragma: no cover\n    VER_SUFFIX = '%s%s' % sys.version_info[:2]\nPYVER = 'py' + VER_SUFFIX\nIMPVER = IMP_PREFIX + VER_SUFFIX\n\nARCH = get_platform().replace('-', '_').replace('.', '_')\n\nABI = sysconfig.get_config_var('SOABI')\nif ABI and ABI.startswith('cpython-'):\n    ABI = ABI.replace('cpython-', 'cp').split('-')[0]\nelse:\n\n    def _derive_abi():\n        parts = ['cp', VER_SUFFIX]\n        if sysconfig.get_config_var('Py_DEBUG'):\n            parts.append('d')\n        if IMP_PREFIX == 'cp':\n            vi = sys.version_info[:2]\n            if vi < (3, 8):\n                wpm = sysconfig.get_config_var('WITH_PYMALLOC')\n                if wpm is None:\n                    wpm = True\n                if wpm:\n                    parts.append('m')\n                if vi < (3, 3):\n                    us = sysconfig.get_config_var('Py_UNICODE_SIZE')\n                    if us == 4 or (us is None and sys.maxunicode == 0x10FFFF):\n                        parts.append('u')\n        return ''.join(parts)\n\n    ABI = _derive_abi()\n    del _derive_abi\n\nFILENAME_RE = re.compile(\n    r'''\n(?P[^-]+)\n-(?P\\d+[^-]*)\n(-(?P\\d+[^-]*))?\n-(?P\\w+\\d+(\\.\\w+\\d+)*)\n-(?P\\w+)\n-(?P\\w+(\\.\\w+)*)\n\\.whl$\n''', re.IGNORECASE | re.VERBOSE)\n\nNAME_VERSION_RE = re.compile(r'''\n(?P[^-]+)\n-(?P\\d+[^-]*)\n(-(?P\\d+[^-]*))?$\n''', re.IGNORECASE | re.VERBOSE)\n\nSHEBANG_RE = re.compile(br'\\s*#![^\\r\\n]*')\nSHEBANG_DETAIL_RE = re.compile(br'^(\\s*#!(\"[^\"]+\"|\\S+))\\s+(.*)$')\nSHEBANG_PYTHON = b'#!python'\nSHEBANG_PYTHONW = b'#!pythonw'\n\nif os.sep == '/':\n    to_posix = lambda o: o\nelse:\n    to_posix = lambda o: o.replace(os.sep, '/')\n\nif sys.version_info[0] < 3:\n    import imp\nelse:\n    imp = None\n    import importlib.machinery\n    import importlib.util\n\n\ndef _get_suffixes():\n    if imp:\n        return [s[0] for s in imp.get_suffixes()]\n    else:\n        return importlib.machinery.EXTENSION_SUFFIXES\n\n\ndef _load_dynamic(name, path):\n    # https://docs.python.org/3/library/importlib.html#importing-a-source-file-directly\n    if imp:\n        return imp.load_dynamic(name, path)\n    else:\n        spec = importlib.util.spec_from_file_location(name, path)\n        module = importlib.util.module_from_spec(spec)\n        sys.modules[name] = module\n        spec.loader.exec_module(module)\n        return module\n\n\nclass Mounter(object):\n\n    def __init__(self):\n        self.impure_wheels = {}\n        self.libs = {}\n\n    def add(self, pathname, extensions):\n        self.impure_wheels[pathname] = extensions\n        self.libs.update(extensions)\n\n    def remove(self, pathname):\n        extensions = self.impure_wheels.pop(pathname)\n        for k, v in extensions:\n            if k in self.libs:\n                del self.libs[k]\n\n    def find_module(self, fullname, path=None):\n        if fullname in self.libs:\n            result = self\n        else:\n            result = None\n        return result\n\n    def load_module(self, fullname):\n        if fullname in sys.modules:\n            result = sys.modules[fullname]\n        else:\n            if fullname not in self.libs:\n                raise ImportError('unable to find extension for %s' % fullname)\n            result = _load_dynamic(fullname, self.libs[fullname])\n            result.__loader__ = self\n            parts = fullname.rsplit('.', 1)\n            if len(parts) > 1:\n                result.__package__ = parts[0]\n        return result\n\n\n_hook = Mounter()\n\n\nclass Wheel(object):\n    \"\"\"\n    Class to build and install from Wheel files (PEP 427).\n    \"\"\"\n\n    wheel_version = (1, 1)\n    hash_kind = 'sha256'\n\n    def __init__(self, filename=None, sign=False, verify=False):\n        \"\"\"\n        Initialise an instance using a (valid) filename.\n        \"\"\"\n        self.sign = sign\n        self.should_verify = verify\n        self.buildver = ''\n        self.pyver = [PYVER]\n        self.abi = ['none']\n        self.arch = ['any']\n        self.dirname = os.getcwd()\n        if filename is None:\n            self.name = 'dummy'\n            self.version = '0.1'\n            self._filename = self.filename\n        else:\n            m = NAME_VERSION_RE.match(filename)\n            if m:\n                info = m.groupdict('')\n                self.name = info['nm']\n                # Reinstate the local version separator\n                self.version = info['vn'].replace('_', '-')\n                self.buildver = info['bn']\n                self._filename = self.filename\n            else:\n                dirname, filename = os.path.split(filename)\n                m = FILENAME_RE.match(filename)\n                if not m:\n                    raise DistlibException('Invalid name or '\n                                           'filename: %r' % filename)\n                if dirname:\n                    self.dirname = os.path.abspath(dirname)\n                self._filename = filename\n                info = m.groupdict('')\n                self.name = info['nm']\n                self.version = info['vn']\n                self.buildver = info['bn']\n                self.pyver = info['py'].split('.')\n                self.abi = info['bi'].split('.')\n                self.arch = info['ar'].split('.')\n\n    @property\n    def filename(self):\n        \"\"\"\n        Build and return a filename from the various components.\n        \"\"\"\n        if self.buildver:\n            buildver = '-' + self.buildver\n        else:\n            buildver = ''\n        pyver = '.'.join(self.pyver)\n        abi = '.'.join(self.abi)\n        arch = '.'.join(self.arch)\n        # replace - with _ as a local version separator\n        version = self.version.replace('-', '_')\n        return '%s-%s%s-%s-%s-%s.whl' % (self.name, version, buildver, pyver, abi, arch)\n\n    @property\n    def exists(self):\n        path = os.path.join(self.dirname, self.filename)\n        return os.path.isfile(path)\n\n    @property\n    def tags(self):\n        for pyver in self.pyver:\n            for abi in self.abi:\n                for arch in self.arch:\n                    yield pyver, abi, arch\n\n    @cached_property\n    def metadata(self):\n        pathname = os.path.join(self.dirname, self.filename)\n        name_ver = '%s-%s' % (self.name, self.version)\n        info_dir = '%s.dist-info' % name_ver\n        wrapper = codecs.getreader('utf-8')\n        with ZipFile(pathname, 'r') as zf:\n            self.get_wheel_metadata(zf)\n            # wv = wheel_metadata['Wheel-Version'].split('.', 1)\n            # file_version = tuple([int(i) for i in wv])\n            # if file_version < (1, 1):\n            # fns = [WHEEL_METADATA_FILENAME, METADATA_FILENAME,\n            # LEGACY_METADATA_FILENAME]\n            # else:\n            # fns = [WHEEL_METADATA_FILENAME, METADATA_FILENAME]\n            fns = [WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME]\n            result = None\n            for fn in fns:\n                try:\n                    metadata_filename = posixpath.join(info_dir, fn)\n                    with zf.open(metadata_filename) as bf:\n                        wf = wrapper(bf)\n                        result = Metadata(fileobj=wf)\n                        if result:\n                            break\n                except KeyError:\n                    pass\n            if not result:\n                raise ValueError('Invalid wheel, because metadata is '\n                                 'missing: looked in %s' % ', '.join(fns))\n        return result\n\n    def get_wheel_metadata(self, zf):\n        name_ver = '%s-%s' % (self.name, self.version)\n        info_dir = '%s.dist-info' % name_ver\n        metadata_filename = posixpath.join(info_dir, 'WHEEL')\n        with zf.open(metadata_filename) as bf:\n            wf = codecs.getreader('utf-8')(bf)\n            message = message_from_file(wf)\n        return dict(message)\n\n    @cached_property\n    def info(self):\n        pathname = os.path.join(self.dirname, self.filename)\n        with ZipFile(pathname, 'r') as zf:\n            result = self.get_wheel_metadata(zf)\n        return result\n\n    def process_shebang(self, data):\n        m = SHEBANG_RE.match(data)\n        if m:\n            end = m.end()\n            shebang, data_after_shebang = data[:end], data[end:]\n            # Preserve any arguments after the interpreter\n            if b'pythonw' in shebang.lower():\n                shebang_python = SHEBANG_PYTHONW\n            else:\n                shebang_python = SHEBANG_PYTHON\n            m = SHEBANG_DETAIL_RE.match(shebang)\n            if m:\n                args = b' ' + m.groups()[-1]\n            else:\n                args = b''\n            shebang = shebang_python + args\n            data = shebang + data_after_shebang\n        else:\n            cr = data.find(b'\\r')\n            lf = data.find(b'\\n')\n            if cr < 0 or cr > lf:\n                term = b'\\n'\n            else:\n                if data[cr:cr + 2] == b'\\r\\n':\n                    term = b'\\r\\n'\n                else:\n                    term = b'\\r'\n            data = SHEBANG_PYTHON + term + data\n        return data\n\n    def get_hash(self, data, hash_kind=None):\n        if hash_kind is None:\n            hash_kind = self.hash_kind\n        try:\n            hasher = getattr(hashlib, hash_kind)\n        except AttributeError:\n            raise DistlibException('Unsupported hash algorithm: %r' % hash_kind)\n        result = hasher(data).digest()\n        result = base64.urlsafe_b64encode(result).rstrip(b'=').decode('ascii')\n        return hash_kind, result\n\n    def write_record(self, records, record_path, archive_record_path):\n        records = list(records)  # make a copy, as mutated\n        records.append((archive_record_path, '', ''))\n        with CSVWriter(record_path) as writer:\n            for row in records:\n                writer.writerow(row)\n\n    def write_records(self, info, libdir, archive_paths):\n        records = []\n        distinfo, info_dir = info\n        # hasher = getattr(hashlib, self.hash_kind)\n        for ap, p in archive_paths:\n            with open(p, 'rb') as f:\n                data = f.read()\n            digest = '%s=%s' % self.get_hash(data)\n            size = os.path.getsize(p)\n            records.append((ap, digest, size))\n\n        p = os.path.join(distinfo, 'RECORD')\n        ap = to_posix(os.path.join(info_dir, 'RECORD'))\n        self.write_record(records, p, ap)\n        archive_paths.append((ap, p))\n\n    def build_zip(self, pathname, archive_paths):\n        with ZipFile(pathname, 'w', zipfile.ZIP_DEFLATED) as zf:\n            for ap, p in archive_paths:\n                logger.debug('Wrote %s to %s in wheel', p, ap)\n                zf.write(p, ap)\n\n    def build(self, paths, tags=None, wheel_version=None):\n        \"\"\"\n        Build a wheel from files in specified paths, and use any specified tags\n        when determining the name of the wheel.\n        \"\"\"\n        if tags is None:\n            tags = {}\n\n        libkey = list(filter(lambda o: o in paths, ('purelib', 'platlib')))[0]\n        if libkey == 'platlib':\n            is_pure = 'false'\n            default_pyver = [IMPVER]\n            default_abi = [ABI]\n            default_arch = [ARCH]\n        else:\n            is_pure = 'true'\n            default_pyver = [PYVER]\n            default_abi = ['none']\n            default_arch = ['any']\n\n        self.pyver = tags.get('pyver', default_pyver)\n        self.abi = tags.get('abi', default_abi)\n        self.arch = tags.get('arch', default_arch)\n\n        libdir = paths[libkey]\n\n        name_ver = '%s-%s' % (self.name, self.version)\n        data_dir = '%s.data' % name_ver\n        info_dir = '%s.dist-info' % name_ver\n\n        archive_paths = []\n\n        # First, stuff which is not in site-packages\n        for key in ('data', 'headers', 'scripts'):\n            if key not in paths:\n                continue\n            path = paths[key]\n            if os.path.isdir(path):\n                for root, dirs, files in os.walk(path):\n                    for fn in files:\n                        p = fsdecode(os.path.join(root, fn))\n                        rp = os.path.relpath(p, path)\n                        ap = to_posix(os.path.join(data_dir, key, rp))\n                        archive_paths.append((ap, p))\n                        if key == 'scripts' and not p.endswith('.exe'):\n                            with open(p, 'rb') as f:\n                                data = f.read()\n                            data = self.process_shebang(data)\n                            with open(p, 'wb') as f:\n                                f.write(data)\n\n        # Now, stuff which is in site-packages, other than the\n        # distinfo stuff.\n        path = libdir\n        distinfo = None\n        for root, dirs, files in os.walk(path):\n            if root == path:\n                # At the top level only, save distinfo for later\n                # and skip it for now\n                for i, dn in enumerate(dirs):\n                    dn = fsdecode(dn)\n                    if dn.endswith('.dist-info'):\n                        distinfo = os.path.join(root, dn)\n                        del dirs[i]\n                        break\n                assert distinfo, '.dist-info directory expected, not found'\n\n            for fn in files:\n                # comment out next suite to leave .pyc files in\n                if fsdecode(fn).endswith(('.pyc', '.pyo')):\n                    continue\n                p = os.path.join(root, fn)\n                rp = to_posix(os.path.relpath(p, path))\n                archive_paths.append((rp, p))\n\n        # Now distinfo. Assumed to be flat, i.e. os.listdir is enough.\n        files = os.listdir(distinfo)\n        for fn in files:\n            if fn not in ('RECORD', 'INSTALLER', 'SHARED', 'WHEEL'):\n                p = fsdecode(os.path.join(distinfo, fn))\n                ap = to_posix(os.path.join(info_dir, fn))\n                archive_paths.append((ap, p))\n\n        wheel_metadata = [\n            'Wheel-Version: %d.%d' % (wheel_version or self.wheel_version),\n            'Generator: distlib %s' % __version__,\n            'Root-Is-Purelib: %s' % is_pure,\n        ]\n        for pyver, abi, arch in self.tags:\n            wheel_metadata.append('Tag: %s-%s-%s' % (pyver, abi, arch))\n        p = os.path.join(distinfo, 'WHEEL')\n        with open(p, 'w') as f:\n            f.write('\\n'.join(wheel_metadata))\n        ap = to_posix(os.path.join(info_dir, 'WHEEL'))\n        archive_paths.append((ap, p))\n\n        # sort the entries by archive path. Not needed by any spec, but it\n        # keeps the archive listing and RECORD tidier than they would otherwise\n        # be. Use the number of path segments to keep directory entries together,\n        # and keep the dist-info stuff at the end.\n        def sorter(t):\n            ap = t[0]\n            n = ap.count('/')\n            if '.dist-info' in ap:\n                n += 10000\n            return (n, ap)\n\n        archive_paths = sorted(archive_paths, key=sorter)\n\n        # Now, at last, RECORD.\n        # Paths in here are archive paths - nothing else makes sense.\n        self.write_records((distinfo, info_dir), libdir, archive_paths)\n        # Now, ready to build the zip file\n        pathname = os.path.join(self.dirname, self.filename)\n        self.build_zip(pathname, archive_paths)\n        return pathname\n\n    def skip_entry(self, arcname):\n        \"\"\"\n        Determine whether an archive entry should be skipped when verifying\n        or installing.\n        \"\"\"\n        # The signature file won't be in RECORD,\n        # and we  don't currently don't do anything with it\n        # We also skip directories, as they won't be in RECORD\n        # either. See:\n        #\n        # https://github.com/pypa/wheel/issues/294\n        # https://github.com/pypa/wheel/issues/287\n        # https://github.com/pypa/wheel/pull/289\n        #\n        return arcname.endswith(('/', '/RECORD.jws'))\n\n    def install(self, paths, maker, **kwargs):\n        \"\"\"\n        Install a wheel to the specified paths. If kwarg ``warner`` is\n        specified, it should be a callable, which will be called with two\n        tuples indicating the wheel version of this software and the wheel\n        version in the file, if there is a discrepancy in the versions.\n        This can be used to issue any warnings to raise any exceptions.\n        If kwarg ``lib_only`` is True, only the purelib/platlib files are\n        installed, and the headers, scripts, data and dist-info metadata are\n        not written. If kwarg ``bytecode_hashed_invalidation`` is True, written\n        bytecode will try to use file-hash based invalidation (PEP-552) on\n        supported interpreter versions (CPython 3.7+).\n\n        The return value is a :class:`InstalledDistribution` instance unless\n        ``options.lib_only`` is True, in which case the return value is ``None``.\n        \"\"\"\n\n        dry_run = maker.dry_run\n        warner = kwargs.get('warner')\n        lib_only = kwargs.get('lib_only', False)\n        bc_hashed_invalidation = kwargs.get('bytecode_hashed_invalidation', False)\n\n        pathname = os.path.join(self.dirname, self.filename)\n        name_ver = '%s-%s' % (self.name, self.version)\n        data_dir = '%s.data' % name_ver\n        info_dir = '%s.dist-info' % name_ver\n\n        metadata_name = posixpath.join(info_dir, LEGACY_METADATA_FILENAME)\n        wheel_metadata_name = posixpath.join(info_dir, 'WHEEL')\n        record_name = posixpath.join(info_dir, 'RECORD')\n\n        wrapper = codecs.getreader('utf-8')\n\n        with ZipFile(pathname, 'r') as zf:\n            with zf.open(wheel_metadata_name) as bwf:\n                wf = wrapper(bwf)\n                message = message_from_file(wf)\n            wv = message['Wheel-Version'].split('.', 1)\n            file_version = tuple([int(i) for i in wv])\n            if (file_version != self.wheel_version) and warner:\n                warner(self.wheel_version, file_version)\n\n            if message['Root-Is-Purelib'] == 'true':\n                libdir = paths['purelib']\n            else:\n                libdir = paths['platlib']\n\n            records = {}\n            with zf.open(record_name) as bf:\n                with CSVReader(stream=bf) as reader:\n                    for row in reader:\n                        p = row[0]\n                        records[p] = row\n\n            data_pfx = posixpath.join(data_dir, '')\n            info_pfx = posixpath.join(info_dir, '')\n            script_pfx = posixpath.join(data_dir, 'scripts', '')\n\n            # make a new instance rather than a copy of maker's,\n            # as we mutate it\n            fileop = FileOperator(dry_run=dry_run)\n            fileop.record = True  # so we can rollback if needed\n\n            bc = not sys.dont_write_bytecode  # Double negatives. Lovely!\n\n            outfiles = []  # for RECORD writing\n\n            # for script copying/shebang processing\n            workdir = tempfile.mkdtemp()\n            # set target dir later\n            # we default add_launchers to False, as the\n            # Python Launcher should be used instead\n            maker.source_dir = workdir\n            maker.target_dir = None\n            try:\n                for zinfo in zf.infolist():\n                    arcname = zinfo.filename\n                    if isinstance(arcname, text_type):\n                        u_arcname = arcname\n                    else:\n                        u_arcname = arcname.decode('utf-8')\n                    if self.skip_entry(u_arcname):\n                        continue\n                    row = records[u_arcname]\n                    if row[2] and str(zinfo.file_size) != row[2]:\n                        raise DistlibException('size mismatch for '\n                                               '%s' % u_arcname)\n                    if row[1]:\n                        kind, value = row[1].split('=', 1)\n                        with zf.open(arcname) as bf:\n                            data = bf.read()\n                        _, digest = self.get_hash(data, kind)\n                        if digest != value:\n                            raise DistlibException('digest mismatch for '\n                                                   '%s' % arcname)\n\n                    if lib_only and u_arcname.startswith((info_pfx, data_pfx)):\n                        logger.debug('lib_only: skipping %s', u_arcname)\n                        continue\n                    is_script = (u_arcname.startswith(script_pfx) and not u_arcname.endswith('.exe'))\n\n                    if u_arcname.startswith(data_pfx):\n                        _, where, rp = u_arcname.split('/', 2)\n                        outfile = os.path.join(paths[where], convert_path(rp))\n                    else:\n                        # meant for site-packages.\n                        if u_arcname in (wheel_metadata_name, record_name):\n                            continue\n                        outfile = os.path.join(libdir, convert_path(u_arcname))\n                    if not is_script:\n                        with zf.open(arcname) as bf:\n                            fileop.copy_stream(bf, outfile)\n                        # Issue #147: permission bits aren't preserved. Using\n                        # zf.extract(zinfo, libdir) should have worked, but didn't,\n                        # see https://www.thetopsites.net/article/53834422.shtml\n                        # So ... manually preserve permission bits as given in zinfo\n                        if os.name == 'posix':\n                            # just set the normal permission bits\n                            os.chmod(outfile, (zinfo.external_attr >> 16) & 0x1FF)\n                        outfiles.append(outfile)\n                        # Double check the digest of the written file\n                        if not dry_run and row[1]:\n                            with open(outfile, 'rb') as bf:\n                                data = bf.read()\n                                _, newdigest = self.get_hash(data, kind)\n                                if newdigest != digest:\n                                    raise DistlibException('digest mismatch '\n                                                           'on write for '\n                                                           '%s' % outfile)\n                        if bc and outfile.endswith('.py'):\n                            try:\n                                pyc = fileop.byte_compile(outfile, hashed_invalidation=bc_hashed_invalidation)\n                                outfiles.append(pyc)\n                            except Exception:\n                                # Don't give up if byte-compilation fails,\n                                # but log it and perhaps warn the user\n                                logger.warning('Byte-compilation failed', exc_info=True)\n                    else:\n                        fn = os.path.basename(convert_path(arcname))\n                        workname = os.path.join(workdir, fn)\n                        with zf.open(arcname) as bf:\n                            fileop.copy_stream(bf, workname)\n\n                        dn, fn = os.path.split(outfile)\n                        maker.target_dir = dn\n                        filenames = maker.make(fn)\n                        fileop.set_executable_mode(filenames)\n                        outfiles.extend(filenames)\n\n                if lib_only:\n                    logger.debug('lib_only: returning None')\n                    dist = None\n                else:\n                    # Generate scripts\n\n                    # Try to get pydist.json so we can see if there are\n                    # any commands to generate. If this fails (e.g. because\n                    # of a legacy wheel), log a warning but don't give up.\n                    commands = None\n                    file_version = self.info['Wheel-Version']\n                    if file_version == '1.0':\n                        # Use legacy info\n                        ep = posixpath.join(info_dir, 'entry_points.txt')\n                        try:\n                            with zf.open(ep) as bwf:\n                                epdata = read_exports(bwf)\n                            commands = {}\n                            for key in ('console', 'gui'):\n                                k = '%s_scripts' % key\n                                if k in epdata:\n                                    commands['wrap_%s' % key] = d = {}\n                                    for v in epdata[k].values():\n                                        s = '%s:%s' % (v.prefix, v.suffix)\n                                        if v.flags:\n                                            s += ' [%s]' % ','.join(v.flags)\n                                        d[v.name] = s\n                        except Exception:\n                            logger.warning('Unable to read legacy script '\n                                           'metadata, so cannot generate '\n                                           'scripts')\n                    else:\n                        try:\n                            with zf.open(metadata_name) as bwf:\n                                wf = wrapper(bwf)\n                                commands = json.load(wf).get('extensions')\n                                if commands:\n                                    commands = commands.get('python.commands')\n                        except Exception:\n                            logger.warning('Unable to read JSON metadata, so '\n                                           'cannot generate scripts')\n                    if commands:\n                        console_scripts = commands.get('wrap_console', {})\n                        gui_scripts = commands.get('wrap_gui', {})\n                        if console_scripts or gui_scripts:\n                            script_dir = paths.get('scripts', '')\n                            if not os.path.isdir(script_dir):\n                                raise ValueError('Valid script path not '\n                                                 'specified')\n                            maker.target_dir = script_dir\n                            for k, v in console_scripts.items():\n                                script = '%s = %s' % (k, v)\n                                filenames = maker.make(script)\n                                fileop.set_executable_mode(filenames)\n\n                            if gui_scripts:\n                                options = {'gui': True}\n                                for k, v in gui_scripts.items():\n                                    script = '%s = %s' % (k, v)\n                                    filenames = maker.make(script, options)\n                                    fileop.set_executable_mode(filenames)\n\n                    p = os.path.join(libdir, info_dir)\n                    dist = InstalledDistribution(p)\n\n                    # Write SHARED\n                    paths = dict(paths)  # don't change passed in dict\n                    del paths['purelib']\n                    del paths['platlib']\n                    paths['lib'] = libdir\n                    p = dist.write_shared_locations(paths, dry_run)\n                    if p:\n                        outfiles.append(p)\n\n                    # Write RECORD\n                    dist.write_installed_files(outfiles, paths['prefix'], dry_run)\n                return dist\n            except Exception:  # pragma: no cover\n                logger.exception('installation failed.')\n                fileop.rollback()\n                raise\n            finally:\n                shutil.rmtree(workdir)\n\n    def _get_dylib_cache(self):\n        global cache\n        if cache is None:\n            # Use native string to avoid issues on 2.x: see Python #20140.\n            base = os.path.join(get_cache_base(), str('dylib-cache'), '%s.%s' % sys.version_info[:2])\n            cache = Cache(base)\n        return cache\n\n    def _get_extensions(self):\n        pathname = os.path.join(self.dirname, self.filename)\n        name_ver = '%s-%s' % (self.name, self.version)\n        info_dir = '%s.dist-info' % name_ver\n        arcname = posixpath.join(info_dir, 'EXTENSIONS')\n        wrapper = codecs.getreader('utf-8')\n        result = []\n        with ZipFile(pathname, 'r') as zf:\n            try:\n                with zf.open(arcname) as bf:\n                    wf = wrapper(bf)\n                    extensions = json.load(wf)\n                    cache = self._get_dylib_cache()\n                    prefix = cache.prefix_to_dir(self.filename, use_abspath=False)\n                    cache_base = os.path.join(cache.base, prefix)\n                    if not os.path.isdir(cache_base):\n                        os.makedirs(cache_base)\n                    for name, relpath in extensions.items():\n                        dest = os.path.join(cache_base, convert_path(relpath))\n                        if not os.path.exists(dest):\n                            extract = True\n                        else:\n                            file_time = os.stat(dest).st_mtime\n                            file_time = datetime.datetime.fromtimestamp(file_time)\n                            info = zf.getinfo(relpath)\n                            wheel_time = datetime.datetime(*info.date_time)\n                            extract = wheel_time > file_time\n                        if extract:\n                            zf.extract(relpath, cache_base)\n                        result.append((name, dest))\n            except KeyError:\n                pass\n        return result\n\n    def is_compatible(self):\n        \"\"\"\n        Determine if a wheel is compatible with the running system.\n        \"\"\"\n        return is_compatible(self)\n\n    def is_mountable(self):\n        \"\"\"\n        Determine if a wheel is asserted as mountable by its metadata.\n        \"\"\"\n        return True  # for now - metadata details TBD\n\n    def mount(self, append=False):\n        pathname = os.path.abspath(os.path.join(self.dirname, self.filename))\n        if not self.is_compatible():\n            msg = 'Wheel %s not compatible with this Python.' % pathname\n            raise DistlibException(msg)\n        if not self.is_mountable():\n            msg = 'Wheel %s is marked as not mountable.' % pathname\n            raise DistlibException(msg)\n        if pathname in sys.path:\n            logger.debug('%s already in path', pathname)\n        else:\n            if append:\n                sys.path.append(pathname)\n            else:\n                sys.path.insert(0, pathname)\n            extensions = self._get_extensions()\n            if extensions:\n                if _hook not in sys.meta_path:\n                    sys.meta_path.append(_hook)\n                _hook.add(pathname, extensions)\n\n    def unmount(self):\n        pathname = os.path.abspath(os.path.join(self.dirname, self.filename))\n        if pathname not in sys.path:\n            logger.debug('%s not in path', pathname)\n        else:\n            sys.path.remove(pathname)\n            if pathname in _hook.impure_wheels:\n                _hook.remove(pathname)\n            if not _hook.impure_wheels:\n                if _hook in sys.meta_path:\n                    sys.meta_path.remove(_hook)\n\n    def verify(self):\n        pathname = os.path.join(self.dirname, self.filename)\n        name_ver = '%s-%s' % (self.name, self.version)\n        # data_dir = '%s.data' % name_ver\n        info_dir = '%s.dist-info' % name_ver\n\n        # metadata_name = posixpath.join(info_dir, LEGACY_METADATA_FILENAME)\n        wheel_metadata_name = posixpath.join(info_dir, 'WHEEL')\n        record_name = posixpath.join(info_dir, 'RECORD')\n\n        wrapper = codecs.getreader('utf-8')\n\n        with ZipFile(pathname, 'r') as zf:\n            with zf.open(wheel_metadata_name) as bwf:\n                wf = wrapper(bwf)\n                message_from_file(wf)\n            # wv = message['Wheel-Version'].split('.', 1)\n            # file_version = tuple([int(i) for i in wv])\n            # TODO version verification\n\n            records = {}\n            with zf.open(record_name) as bf:\n                with CSVReader(stream=bf) as reader:\n                    for row in reader:\n                        p = row[0]\n                        records[p] = row\n\n            for zinfo in zf.infolist():\n                arcname = zinfo.filename\n                if isinstance(arcname, text_type):\n                    u_arcname = arcname\n                else:\n                    u_arcname = arcname.decode('utf-8')\n                # See issue #115: some wheels have .. in their entries, but\n                # in the filename ... e.g. __main__..py ! So the check is\n                # updated to look for .. in the directory portions\n                p = u_arcname.split('/')\n                if '..' in p:\n                    raise DistlibException('invalid entry in '\n                                           'wheel: %r' % u_arcname)\n\n                if self.skip_entry(u_arcname):\n                    continue\n                row = records[u_arcname]\n                if row[2] and str(zinfo.file_size) != row[2]:\n                    raise DistlibException('size mismatch for '\n                                           '%s' % u_arcname)\n                if row[1]:\n                    kind, value = row[1].split('=', 1)\n                    with zf.open(arcname) as bf:\n                        data = bf.read()\n                    _, digest = self.get_hash(data, kind)\n                    if digest != value:\n                        raise DistlibException('digest mismatch for '\n                                               '%s' % arcname)\n\n    def update(self, modifier, dest_dir=None, **kwargs):\n        \"\"\"\n        Update the contents of a wheel in a generic way. The modifier should\n        be a callable which expects a dictionary argument: its keys are\n        archive-entry paths, and its values are absolute filesystem paths\n        where the contents the corresponding archive entries can be found. The\n        modifier is free to change the contents of the files pointed to, add\n        new entries and remove entries, before returning. This method will\n        extract the entire contents of the wheel to a temporary location, call\n        the modifier, and then use the passed (and possibly updated)\n        dictionary to write a new wheel. If ``dest_dir`` is specified, the new\n        wheel is written there -- otherwise, the original wheel is overwritten.\n\n        The modifier should return True if it updated the wheel, else False.\n        This method returns the same value the modifier returns.\n        \"\"\"\n\n        def get_version(path_map, info_dir):\n            version = path = None\n            key = '%s/%s' % (info_dir, LEGACY_METADATA_FILENAME)\n            if key not in path_map:\n                key = '%s/PKG-INFO' % info_dir\n            if key in path_map:\n                path = path_map[key]\n                version = Metadata(path=path).version\n            return version, path\n\n        def update_version(version, path):\n            updated = None\n            try:\n                NormalizedVersion(version)\n                i = version.find('-')\n                if i < 0:\n                    updated = '%s+1' % version\n                else:\n                    parts = [int(s) for s in version[i + 1:].split('.')]\n                    parts[-1] += 1\n                    updated = '%s+%s' % (version[:i], '.'.join(str(i) for i in parts))\n            except UnsupportedVersionError:\n                logger.debug('Cannot update non-compliant (PEP-440) '\n                             'version %r', version)\n            if updated:\n                md = Metadata(path=path)\n                md.version = updated\n                legacy = path.endswith(LEGACY_METADATA_FILENAME)\n                md.write(path=path, legacy=legacy)\n                logger.debug('Version updated from %r to %r', version, updated)\n\n        pathname = os.path.join(self.dirname, self.filename)\n        name_ver = '%s-%s' % (self.name, self.version)\n        info_dir = '%s.dist-info' % name_ver\n        record_name = posixpath.join(info_dir, 'RECORD')\n        with tempdir() as workdir:\n            with ZipFile(pathname, 'r') as zf:\n                path_map = {}\n                for zinfo in zf.infolist():\n                    arcname = zinfo.filename\n                    if isinstance(arcname, text_type):\n                        u_arcname = arcname\n                    else:\n                        u_arcname = arcname.decode('utf-8')\n                    if u_arcname == record_name:\n                        continue\n                    if '..' in u_arcname:\n                        raise DistlibException('invalid entry in '\n                                               'wheel: %r' % u_arcname)\n                    zf.extract(zinfo, workdir)\n                    path = os.path.join(workdir, convert_path(u_arcname))\n                    path_map[u_arcname] = path\n\n            # Remember the version.\n            original_version, _ = get_version(path_map, info_dir)\n            # Files extracted. Call the modifier.\n            modified = modifier(path_map, **kwargs)\n            if modified:\n                # Something changed - need to build a new wheel.\n                current_version, path = get_version(path_map, info_dir)\n                if current_version and (current_version == original_version):\n                    # Add or update local version to signify changes.\n                    update_version(current_version, path)\n                # Decide where the new wheel goes.\n                if dest_dir is None:\n                    fd, newpath = tempfile.mkstemp(suffix='.whl', prefix='wheel-update-', dir=workdir)\n                    os.close(fd)\n                else:\n                    if not os.path.isdir(dest_dir):\n                        raise DistlibException('Not a directory: %r' % dest_dir)\n                    newpath = os.path.join(dest_dir, self.filename)\n                archive_paths = list(path_map.items())\n                distinfo = os.path.join(workdir, info_dir)\n                info = distinfo, info_dir\n                self.write_records(info, workdir, archive_paths)\n                self.build_zip(newpath, archive_paths)\n                if dest_dir is None:\n                    shutil.copyfile(newpath, pathname)\n        return modified\n\n\ndef _get_glibc_version():\n    import platform\n    ver = platform.libc_ver()\n    result = []\n    if ver[0] == 'glibc':\n        for s in ver[1].split('.'):\n            result.append(int(s) if s.isdigit() else 0)\n        result = tuple(result)\n    return result\n\n\ndef compatible_tags():\n    \"\"\"\n    Return (pyver, abi, arch) tuples compatible with this Python.\n    \"\"\"\n    class _Version:\n        def __init__(self, major, minor):\n            self.major = major\n            self.major_minor = (major, minor)\n            self.string = ''.join((str(major), str(minor)))\n\n        def __str__(self):\n            return self.string\n\n\n    versions = [\n        _Version(sys.version_info.major, minor_version)\n        for minor_version in range(sys.version_info.minor, -1, -1)\n    ]\n    abis = []\n    for suffix in _get_suffixes():\n        if suffix.startswith('.abi'):\n            abis.append(suffix.split('.', 2)[1])\n    abis.sort()\n    if ABI != 'none':\n        abis.insert(0, ABI)\n    abis.append('none')\n    result = []\n\n    arches = [ARCH]\n    if sys.platform == 'darwin':\n        m = re.match(r'(\\w+)_(\\d+)_(\\d+)_(\\w+)$', ARCH)\n        if m:\n            name, major, minor, arch = m.groups()\n            minor = int(minor)\n            matches = [arch]\n            if arch in ('i386', 'ppc'):\n                matches.append('fat')\n            if arch in ('i386', 'ppc', 'x86_64'):\n                matches.append('fat3')\n            if arch in ('ppc64', 'x86_64'):\n                matches.append('fat64')\n            if arch in ('i386', 'x86_64'):\n                matches.append('intel')\n            if arch in ('i386', 'x86_64', 'intel', 'ppc', 'ppc64'):\n                matches.append('universal')\n            while minor >= 0:\n                for match in matches:\n                    s = '%s_%s_%s_%s' % (name, major, minor, match)\n                    if s != ARCH:  # already there\n                        arches.append(s)\n                minor -= 1\n\n    # Most specific - our Python version, ABI and arch\n    for i, version_object in enumerate(versions):\n        version = str(version_object)\n        add_abis = []\n\n        if i == 0:\n            add_abis = abis\n\n        if IMP_PREFIX == 'cp' and version_object.major_minor >= (3, 2):\n            limited_api_abi = 'abi' + str(version_object.major)\n            if limited_api_abi not in add_abis:\n                add_abis.append(limited_api_abi)\n\n        for abi in add_abis:\n            for arch in arches:\n                result.append((''.join((IMP_PREFIX, version)), abi, arch))\n                # manylinux\n                if abi != 'none' and sys.platform.startswith('linux'):\n                    arch = arch.replace('linux_', '')\n                    parts = _get_glibc_version()\n                    if len(parts) == 2:\n                        if parts >= (2, 5):\n                            result.append((''.join((IMP_PREFIX, version)), abi, 'manylinux1_%s' % arch))\n                        if parts >= (2, 12):\n                            result.append((''.join((IMP_PREFIX, version)), abi, 'manylinux2010_%s' % arch))\n                        if parts >= (2, 17):\n                            result.append((''.join((IMP_PREFIX, version)), abi, 'manylinux2014_%s' % arch))\n                        result.append((''.join(\n                            (IMP_PREFIX, version)), abi, 'manylinux_%s_%s_%s' % (parts[0], parts[1], arch)))\n\n    # where no ABI / arch dependency, but IMP_PREFIX dependency\n    for i, version_object in enumerate(versions):\n        version = str(version_object)\n        result.append((''.join((IMP_PREFIX, version)), 'none', 'any'))\n        if i == 0:\n            result.append((''.join((IMP_PREFIX, version[0])), 'none', 'any'))\n\n    # no IMP_PREFIX, ABI or arch dependency\n    for i, version_object in enumerate(versions):\n        version = str(version_object)\n        result.append((''.join(('py', version)), 'none', 'any'))\n        if i == 0:\n            result.append((''.join(('py', version[0])), 'none', 'any'))\n\n    return set(result)\n\n\nCOMPATIBLE_TAGS = compatible_tags()\n\ndel compatible_tags\n\n\ndef is_compatible(wheel, tags=None):\n    if not isinstance(wheel, Wheel):\n        wheel = Wheel(wheel)  # assume it's a filename\n    result = False\n    if tags is None:\n        tags = COMPATIBLE_TAGS\n    for ver, abi, arch in tags:\n        if ver in wheel.pyver and abi in wheel.abi and arch in wheel.arch:\n            result = True\n            break\n    return result\n",[],[216,809,810,811,890,891,1958,1950],"distlib","09353fc2-67fc-11f0-9ab6-0224a6c84d84","09354080-67fc-11f0-9ab6-0224a6c84d84",331,["D",1753299263232],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"\nImplementation of a flexible versioning scheme providing support for PEP-440,\nsetuptools-compatible and semantic versioning.\n\"\"\"\n\nimport logging\nimport re\n\nfrom .compat import string_types\nfrom .util import parse_requirement\n\n__all__ = ['NormalizedVersion', 'NormalizedMatcher',\n           'LegacyVersion', 'LegacyMatcher',\n           'SemanticVersion', 'SemanticMatcher',\n           'UnsupportedVersionError', 'get_scheme']\n\nlogger = logging.getLogger(__name__)\n\n\nclass UnsupportedVersionError(ValueError):\n    \"\"\"This is an unsupported version.\"\"\"\n    pass\n\n\nclass Version(object):\n    def __init__(self, s):\n        self._string = s = s.strip()\n        self._parts = parts = self.parse(s)\n        assert isinstance(parts, tuple)\n        assert len(parts) > 0\n\n    def parse(self, s):\n        raise NotImplementedError('please implement in a subclass')\n\n    def _check_compatible(self, other):\n        if type(self) != type(other):\n            raise TypeError('cannot compare %r and %r' % (self, other))\n\n    def __eq__(self, other):\n        self._check_compatible(other)\n        return self._parts == other._parts\n\n    def __ne__(self, other):\n        return not self.__eq__(other)\n\n    def __lt__(self, other):\n        self._check_compatible(other)\n        return self._parts < other._parts\n\n    def __gt__(self, other):\n        return not (self.__lt__(other) or self.__eq__(other))\n\n    def __le__(self, other):\n        return self.__lt__(other) or self.__eq__(other)\n\n    def __ge__(self, other):\n        return self.__gt__(other) or self.__eq__(other)\n\n    # See http://docs.python.org/reference/datamodel#object.__hash__\n    def __hash__(self):\n        return hash(self._parts)\n\n    def __repr__(self):\n        return \"%s('%s')\" % (self.__class__.__name__, self._string)\n\n    def __str__(self):\n        return self._string\n\n    @property\n    def is_prerelease(self):\n        raise NotImplementedError('Please implement in subclasses.')\n\n\nclass Matcher(object):\n    version_class = None\n\n    # value is either a callable or the name of a method\n    _operators = {\n        '<': lambda v, c, p: v < c,\n        '>': lambda v, c, p: v > c,\n        '<=': lambda v, c, p: v == c or v < c,\n        '>=': lambda v, c, p: v == c or v > c,\n        '==': lambda v, c, p: v == c,\n        '===': lambda v, c, p: v == c,\n        # by default, compatible => >=.\n        '~=': lambda v, c, p: v == c or v > c,\n        '!=': lambda v, c, p: v != c,\n    }\n\n    # this is a method only to support alternative implementations\n    # via overriding\n    def parse_requirement(self, s):\n        return parse_requirement(s)\n\n    def __init__(self, s):\n        if self.version_class is None:\n            raise ValueError('Please specify a version class')\n        self._string = s = s.strip()\n        r = self.parse_requirement(s)\n        if not r:\n            raise ValueError('Not valid: %r' % s)\n        self.name = r.name\n        self.key = self.name.lower()    # for case-insensitive comparisons\n        clist = []\n        if r.constraints:\n            # import pdb; pdb.set_trace()\n            for op, s in r.constraints:\n                if s.endswith('.*'):\n                    if op not in ('==', '!='):\n                        raise ValueError('\\'.*\\' not allowed for '\n                                         '%r constraints' % op)\n                    # Could be a partial version (e.g. for '2.*') which\n                    # won't parse as a version, so keep it as a string\n                    vn, prefix = s[:-2], True\n                    # Just to check that vn is a valid version\n                    self.version_class(vn)\n                else:\n                    # Should parse as a version, so we can create an\n                    # instance for the comparison\n                    vn, prefix = self.version_class(s), False\n                clist.append((op, vn, prefix))\n        self._parts = tuple(clist)\n\n    def match(self, version):\n        \"\"\"\n        Check if the provided version matches the constraints.\n\n        :param version: The version to match against this instance.\n        :type version: String or :class:`Version` instance.\n        \"\"\"\n        if isinstance(version, string_types):\n            version = self.version_class(version)\n        for operator, constraint, prefix in self._parts:\n            f = self._operators.get(operator)\n            if isinstance(f, string_types):\n                f = getattr(self, f)\n            if not f:\n                msg = ('%r not implemented '\n                       'for %s' % (operator, self.__class__.__name__))\n                raise NotImplementedError(msg)\n            if not f(version, constraint, prefix):\n                return False\n        return True\n\n    @property\n    def exact_version(self):\n        result = None\n        if len(self._parts) == 1 and self._parts[0][0] in ('==', '==='):\n            result = self._parts[0][1]\n        return result\n\n    def _check_compatible(self, other):\n        if type(self) != type(other) or self.name != other.name:\n            raise TypeError('cannot compare %s and %s' % (self, other))\n\n    def __eq__(self, other):\n        self._check_compatible(other)\n        return self.key == other.key and self._parts == other._parts\n\n    def __ne__(self, other):\n        return not self.__eq__(other)\n\n    # See http://docs.python.org/reference/datamodel#object.__hash__\n    def __hash__(self):\n        return hash(self.key) + hash(self._parts)\n\n    def __repr__(self):\n        return \"%s(%r)\" % (self.__class__.__name__, self._string)\n\n    def __str__(self):\n        return self._string\n\n\nPEP440_VERSION_RE = re.compile(r'^v?(\\d+!)?(\\d+(\\.\\d+)*)((a|alpha|b|beta|c|rc|pre|preview)(\\d+)?)?'\n                               r'(\\.(post|r|rev)(\\d+)?)?([._-]?(dev)(\\d+)?)?'\n                               r'(\\+([a-zA-Z\\d]+(\\.[a-zA-Z\\d]+)?))?$', re.I)\n\n\ndef _pep_440_key(s):\n    s = s.strip()\n    m = PEP440_VERSION_RE.match(s)\n    if not m:\n        raise UnsupportedVersionError('Not a valid version: %s' % s)\n    groups = m.groups()\n    nums = tuple(int(v) for v in groups[1].split('.'))\n    while len(nums) > 1 and nums[-1] == 0:\n        nums = nums[:-1]\n\n    if not groups[0]:\n        epoch = 0\n    else:\n        epoch = int(groups[0][:-1])\n    pre = groups[4:6]\n    post = groups[7:9]\n    dev = groups[10:12]\n    local = groups[13]\n    if pre == (None, None):\n        pre = ()\n    else:\n        if pre[1] is None:\n            pre = pre[0], 0\n        else:\n            pre = pre[0], int(pre[1])\n    if post == (None, None):\n        post = ()\n    else:\n        if post[1] is None:\n            post = post[0], 0\n        else:\n            post = post[0], int(post[1])\n    if dev == (None, None):\n        dev = ()\n    else:\n        if dev[1] is None:\n            dev = dev[0], 0\n        else:\n            dev = dev[0], int(dev[1])\n    if local is None:\n        local = ()\n    else:\n        parts = []\n        for part in local.split('.'):\n            # to ensure that numeric compares as > lexicographic, avoid\n            # comparing them directly, but encode a tuple which ensures\n            # correct sorting\n            if part.isdigit():\n                part = (1, int(part))\n            else:\n                part = (0, part)\n            parts.append(part)\n        local = tuple(parts)\n    if not pre:\n        # either before pre-release, or final release and after\n        if not post and dev:\n            # before pre-release\n            pre = ('a', -1)     # to sort before a0\n        else:\n            pre = ('z',)        # to sort after all pre-releases\n    # now look at the state of post and dev.\n    if not post:\n        post = ('_',)   # sort before 'a'\n    if not dev:\n        dev = ('final',)\n\n    return epoch, nums, pre, post, dev, local\n\n\n_normalized_key = _pep_440_key\n\n\nclass NormalizedVersion(Version):\n    \"\"\"A rational version.\n\n    Good:\n        1.2         # equivalent to \"1.2.0\"\n        1.2.0\n        1.2a1\n        1.2.3a2\n        1.2.3b1\n        1.2.3c1\n        1.2.3.4\n        TODO: fill this out\n\n    Bad:\n        1           # minimum two numbers\n        1.2a        # release level must have a release serial\n        1.2.3b\n    \"\"\"\n    def parse(self, s):\n        result = _normalized_key(s)\n        # _normalized_key loses trailing zeroes in the release\n        # clause, since that's needed to ensure that X.Y == X.Y.0 == X.Y.0.0\n        # However, PEP 440 prefix matching needs it: for example,\n        # (~= 1.4.5.0) matches differently to (~= 1.4.5.0.0).\n        m = PEP440_VERSION_RE.match(s)      # must succeed\n        groups = m.groups()\n        self._release_clause = tuple(int(v) for v in groups[1].split('.'))\n        return result\n\n    PREREL_TAGS = set(['a', 'b', 'c', 'rc', 'dev'])\n\n    @property\n    def is_prerelease(self):\n        return any(t[0] in self.PREREL_TAGS for t in self._parts if t)\n\n\ndef _match_prefix(x, y):\n    x = str(x)\n    y = str(y)\n    if x == y:\n        return True\n    if not x.startswith(y):\n        return False\n    n = len(y)\n    return x[n] == '.'\n\n\nclass NormalizedMatcher(Matcher):\n    version_class = NormalizedVersion\n\n    # value is either a callable or the name of a method\n    _operators = {\n        '~=': '_match_compatible',\n        '<': '_match_lt',\n        '>': '_match_gt',\n        '<=': '_match_le',\n        '>=': '_match_ge',\n        '==': '_match_eq',\n        '===': '_match_arbitrary',\n        '!=': '_match_ne',\n    }\n\n    def _adjust_local(self, version, constraint, prefix):\n        if prefix:\n            strip_local = '+' not in constraint and version._parts[-1]\n        else:\n            # both constraint and version are\n            # NormalizedVersion instances.\n            # If constraint does not have a local component,\n            # ensure the version doesn't, either.\n            strip_local = not constraint._parts[-1] and version._parts[-1]\n        if strip_local:\n            s = version._string.split('+', 1)[0]\n            version = self.version_class(s)\n        return version, constraint\n\n    def _match_lt(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        if version >= constraint:\n            return False\n        release_clause = constraint._release_clause\n        pfx = '.'.join([str(i) for i in release_clause])\n        return not _match_prefix(version, pfx)\n\n    def _match_gt(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        if version <= constraint:\n            return False\n        release_clause = constraint._release_clause\n        pfx = '.'.join([str(i) for i in release_clause])\n        return not _match_prefix(version, pfx)\n\n    def _match_le(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        return version <= constraint\n\n    def _match_ge(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        return version >= constraint\n\n    def _match_eq(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        if not prefix:\n            result = (version == constraint)\n        else:\n            result = _match_prefix(version, constraint)\n        return result\n\n    def _match_arbitrary(self, version, constraint, prefix):\n        return str(version) == str(constraint)\n\n    def _match_ne(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        if not prefix:\n            result = (version != constraint)\n        else:\n            result = not _match_prefix(version, constraint)\n        return result\n\n    def _match_compatible(self, version, constraint, prefix):\n        version, constraint = self._adjust_local(version, constraint, prefix)\n        if version == constraint:\n            return True\n        if version < constraint:\n            return False\n#        if not prefix:\n#            return True\n        release_clause = constraint._release_clause\n        if len(release_clause) > 1:\n            release_clause = release_clause[:-1]\n        pfx = '.'.join([str(i) for i in release_clause])\n        return _match_prefix(version, pfx)\n\n\n_REPLACEMENTS = (\n    (re.compile('[.+-]$'), ''),                     # remove trailing puncts\n    (re.compile(r'^[.](\\d)'), r'0.\\1'),             # .N -> 0.N at start\n    (re.compile('^[.-]'), ''),                      # remove leading puncts\n    (re.compile(r'^\\((.*)\\)$'), r'\\1'),             # remove parentheses\n    (re.compile(r'^v(ersion)?\\s*(\\d+)'), r'\\2'),    # remove leading v(ersion)\n    (re.compile(r'^r(ev)?\\s*(\\d+)'), r'\\2'),        # remove leading v(ersion)\n    (re.compile('[.]{2,}'), '.'),                   # multiple runs of '.'\n    (re.compile(r'\\b(alfa|apha)\\b'), 'alpha'),      # misspelt alpha\n    (re.compile(r'\\b(pre-alpha|prealpha)\\b'),\n        'pre.alpha'),                               # standardise\n    (re.compile(r'\\(beta\\)$'), 'beta'),             # remove parentheses\n)\n\n_SUFFIX_REPLACEMENTS = (\n    (re.compile('^[:~._+-]+'), ''),                   # remove leading puncts\n    (re.compile('[,*\")([\\\\]]'), ''),                  # remove unwanted chars\n    (re.compile('[~:+_ -]'), '.'),                    # replace illegal chars\n    (re.compile('[.]{2,}'), '.'),                   # multiple runs of '.'\n    (re.compile(r'\\.$'), ''),                       # trailing '.'\n)\n\n_NUMERIC_PREFIX = re.compile(r'(\\d+(\\.\\d+)*)')\n\n\ndef _suggest_semantic_version(s):\n    \"\"\"\n    Try to suggest a semantic form for a version for which\n    _suggest_normalized_version couldn't come up with anything.\n    \"\"\"\n    result = s.strip().lower()\n    for pat, repl in _REPLACEMENTS:\n        result = pat.sub(repl, result)\n    if not result:\n        result = '0.0.0'\n\n    # Now look for numeric prefix, and separate it out from\n    # the rest.\n    # import pdb; pdb.set_trace()\n    m = _NUMERIC_PREFIX.match(result)\n    if not m:\n        prefix = '0.0.0'\n        suffix = result\n    else:\n        prefix = m.groups()[0].split('.')\n        prefix = [int(i) for i in prefix]\n        while len(prefix) < 3:\n            prefix.append(0)\n        if len(prefix) == 3:\n            suffix = result[m.end():]\n        else:\n            suffix = '.'.join([str(i) for i in prefix[3:]]) + result[m.end():]\n            prefix = prefix[:3]\n        prefix = '.'.join([str(i) for i in prefix])\n        suffix = suffix.strip()\n    if suffix:\n        # import pdb; pdb.set_trace()\n        # massage the suffix.\n        for pat, repl in _SUFFIX_REPLACEMENTS:\n            suffix = pat.sub(repl, suffix)\n\n    if not suffix:\n        result = prefix\n    else:\n        sep = '-' if 'dev' in suffix else '+'\n        result = prefix + sep + suffix\n    if not is_semver(result):\n        result = None\n    return result\n\n\ndef _suggest_normalized_version(s):\n    \"\"\"Suggest a normalized version close to the given version string.\n\n    If you have a version string that isn't rational (i.e. NormalizedVersion\n    doesn't like it) then you might be able to get an equivalent (or close)\n    rational version from this function.\n\n    This does a number of simple normalizations to the given string, based\n    on observation of versions currently in use on PyPI. Given a dump of\n    those version during PyCon 2009, 4287 of them:\n    - 2312 (53.93%) match NormalizedVersion without change\n      with the automatic suggestion\n    - 3474 (81.04%) match when using this suggestion method\n\n    @param s {str} An irrational version string.\n    @returns A rational version string, or None, if couldn't determine one.\n    \"\"\"\n    try:\n        _normalized_key(s)\n        return s   # already rational\n    except UnsupportedVersionError:\n        pass\n\n    rs = s.lower()\n\n    # part of this could use maketrans\n    for orig, repl in (('-alpha', 'a'), ('-beta', 'b'), ('alpha', 'a'),\n                       ('beta', 'b'), ('rc', 'c'), ('-final', ''),\n                       ('-pre', 'c'),\n                       ('-release', ''), ('.release', ''), ('-stable', ''),\n                       ('+', '.'), ('_', '.'), (' ', ''), ('.final', ''),\n                       ('final', '')):\n        rs = rs.replace(orig, repl)\n\n    # if something ends with dev or pre, we add a 0\n    rs = re.sub(r\"pre$\", r\"pre0\", rs)\n    rs = re.sub(r\"dev$\", r\"dev0\", rs)\n\n    # if we have something like \"b-2\" or \"a.2\" at the end of the\n    # version, that is probably beta, alpha, etc\n    # let's remove the dash or dot\n    rs = re.sub(r\"([abc]|rc)[\\-\\.](\\d+)$\", r\"\\1\\2\", rs)\n\n    # 1.0-dev-r371 -> 1.0.dev371\n    # 0.1-dev-r79 -> 0.1.dev79\n    rs = re.sub(r\"[\\-\\.](dev)[\\-\\.]?r?(\\d+)$\", r\".\\1\\2\", rs)\n\n    # Clean: 2.0.a.3, 2.0.b1, 0.9.0~c1\n    rs = re.sub(r\"[.~]?([abc])\\.?\", r\"\\1\", rs)\n\n    # Clean: v0.3, v1.0\n    if rs.startswith('v'):\n        rs = rs[1:]\n\n    # Clean leading '0's on numbers.\n    # TODO: unintended side-effect on, e.g., \"2003.05.09\"\n    # PyPI stats: 77 (~2%) better\n    rs = re.sub(r\"\\b0+(\\d+)(?!\\d)\", r\"\\1\", rs)\n\n    # Clean a/b/c with no version. E.g. \"1.0a\" -> \"1.0a0\". Setuptools infers\n    # zero.\n    # PyPI stats: 245 (7.56%) better\n    rs = re.sub(r\"(\\d+[abc])$\", r\"\\g<1>0\", rs)\n\n    # the 'dev-rNNN' tag is a dev tag\n    rs = re.sub(r\"\\.?(dev-r|dev\\.r)\\.?(\\d+)$\", r\".dev\\2\", rs)\n\n    # clean the - when used as a pre delimiter\n    rs = re.sub(r\"-(a|b|c)(\\d+)$\", r\"\\1\\2\", rs)\n\n    # a terminal \"dev\" or \"devel\" can be changed into \".dev0\"\n    rs = re.sub(r\"[\\.\\-](dev|devel)$\", r\".dev0\", rs)\n\n    # a terminal \"dev\" can be changed into \".dev0\"\n    rs = re.sub(r\"(?![\\.\\-])dev$\", r\".dev0\", rs)\n\n    # a terminal \"final\" or \"stable\" can be removed\n    rs = re.sub(r\"(final|stable)$\", \"\", rs)\n\n    # The 'r' and the '-' tags are post release tags\n    #   0.4a1.r10       ->  0.4a1.post10\n    #   0.9.33-17222    ->  0.9.33.post17222\n    #   0.9.33-r17222   ->  0.9.33.post17222\n    rs = re.sub(r\"\\.?(r|-|-r)\\.?(\\d+)$\", r\".post\\2\", rs)\n\n    # Clean 'r' instead of 'dev' usage:\n    #   0.9.33+r17222   ->  0.9.33.dev17222\n    #   1.0dev123       ->  1.0.dev123\n    #   1.0.git123      ->  1.0.dev123\n    #   1.0.bzr123      ->  1.0.dev123\n    #   0.1a0dev.123    ->  0.1a0.dev123\n    # PyPI stats:  ~150 (~4%) better\n    rs = re.sub(r\"\\.?(dev|git|bzr)\\.?(\\d+)$\", r\".dev\\2\", rs)\n\n    # Clean '.pre' (normalized from '-pre' above) instead of 'c' usage:\n    #   0.2.pre1        ->  0.2c1\n    #   0.2-c1         ->  0.2c1\n    #   1.0preview123   ->  1.0c123\n    # PyPI stats: ~21 (0.62%) better\n    rs = re.sub(r\"\\.?(pre|preview|-c)(\\d+)$\", r\"c\\g<2>\", rs)\n\n    # Tcl/Tk uses \"px\" for their post release markers\n    rs = re.sub(r\"p(\\d+)$\", r\".post\\1\", rs)\n\n    try:\n        _normalized_key(rs)\n    except UnsupportedVersionError:\n        rs = None\n    return rs\n\n#\n#   Legacy version processing (distribute-compatible)\n#\n\n\n_VERSION_PART = re.compile(r'([a-z]+|\\d+|[\\.-])', re.I)\n_VERSION_REPLACE = {\n    'pre': 'c',\n    'preview': 'c',\n    '-': 'final-',\n    'rc': 'c',\n    'dev': '@',\n    '': None,\n    '.': None,\n}\n\n\ndef _legacy_key(s):\n    def get_parts(s):\n        result = []\n        for p in _VERSION_PART.split(s.lower()):\n            p = _VERSION_REPLACE.get(p, p)\n            if p:\n                if '0' <= p[:1] <= '9':\n                    p = p.zfill(8)\n                else:\n                    p = '*' + p\n                result.append(p)\n        result.append('*final')\n        return result\n\n    result = []\n    for p in get_parts(s):\n        if p.startswith('*'):\n            if p < '*final':\n                while result and result[-1] == '*final-':\n                    result.pop()\n            while result and result[-1] == '00000000':\n                result.pop()\n        result.append(p)\n    return tuple(result)\n\n\nclass LegacyVersion(Version):\n    def parse(self, s):\n        return _legacy_key(s)\n\n    @property\n    def is_prerelease(self):\n        result = False\n        for x in self._parts:\n            if (isinstance(x, string_types) and x.startswith('*') and x < '*final'):\n                result = True\n                break\n        return result\n\n\nclass LegacyMatcher(Matcher):\n    version_class = LegacyVersion\n\n    _operators = dict(Matcher._operators)\n    _operators['~='] = '_match_compatible'\n\n    numeric_re = re.compile(r'^(\\d+(\\.\\d+)*)')\n\n    def _match_compatible(self, version, constraint, prefix):\n        if version < constraint:\n            return False\n        m = self.numeric_re.match(str(constraint))\n        if not m:\n            logger.warning('Cannot compute compatible match for version %s '\n                           ' and constraint %s', version, constraint)\n            return True\n        s = m.groups()[0]\n        if '.' in s:\n            s = s.rsplit('.', 1)[0]\n        return _match_prefix(version, s)\n\n#\n#   Semantic versioning\n#\n\n\n_SEMVER_RE = re.compile(r'^(\\d+)\\.(\\d+)\\.(\\d+)'\n                        r'(-[a-z0-9]+(\\.[a-z0-9-]+)*)?'\n                        r'(\\+[a-z0-9]+(\\.[a-z0-9-]+)*)?$', re.I)\n\n\ndef is_semver(s):\n    return _SEMVER_RE.match(s)\n\n\ndef _semantic_key(s):\n    def make_tuple(s, absent):\n        if s is None:\n            result = (absent,)\n        else:\n            parts = s[1:].split('.')\n            # We can't compare ints and strings on Python 3, so fudge it\n            # by zero-filling numeric values so simulate a numeric comparison\n            result = tuple([p.zfill(8) if p.isdigit() else p for p in parts])\n        return result\n\n    m = is_semver(s)\n    if not m:\n        raise UnsupportedVersionError(s)\n    groups = m.groups()\n    major, minor, patch = [int(i) for i in groups[:3]]\n    # choose the '|' and '*' so that versions sort correctly\n    pre, build = make_tuple(groups[3], '|'), make_tuple(groups[5], '*')\n    return (major, minor, patch), pre, build\n\n\nclass SemanticVersion(Version):\n    def parse(self, s):\n        return _semantic_key(s)\n\n    @property\n    def is_prerelease(self):\n        return self._parts[1][0] != '|'\n\n\nclass SemanticMatcher(Matcher):\n    version_class = SemanticVersion\n\n\nclass VersionScheme(object):\n    def __init__(self, key, matcher, suggester=None):\n        self.key = key\n        self.matcher = matcher\n        self.suggester = suggester\n\n    def is_valid_version(self, s):\n        try:\n            self.matcher.version_class(s)\n            result = True\n        except UnsupportedVersionError:\n            result = False\n        return result\n\n    def is_valid_matcher(self, s):\n        try:\n            self.matcher(s)\n            result = True\n        except UnsupportedVersionError:\n            result = False\n        return result\n\n    def is_valid_constraint_list(self, s):\n        \"\"\"\n        Used for processing some metadata fields\n        \"\"\"\n        # See issue #140. Be tolerant of a single trailing comma.\n        if s.endswith(','):\n            s = s[:-1]\n        return self.is_valid_matcher('dummy_name (%s)' % s)\n\n    def suggest(self, s):\n        if self.suggester is None:\n            result = None\n        else:\n            result = self.suggester(s)\n        return result\n\n\n_SCHEMES = {\n    'normalized': VersionScheme(_normalized_key, NormalizedMatcher,\n                                _suggest_normalized_version),\n    'legacy': VersionScheme(_legacy_key, LegacyMatcher, lambda self, s: s),\n    'semantic': VersionScheme(_semantic_key, SemanticMatcher,\n                              _suggest_semantic_version),\n}\n\n_SCHEMES['default'] = _SCHEMES['normalized']\n\n\ndef get_scheme(name):\n    if name not in _SCHEMES:\n        raise ValueError('unknown scheme name: %r' % name)\n    return _SCHEMES[name]\n",[],[216,809,810,811,890,891,1958,1686],"096d6b7c-67fc-11f0-a7d9-0224a6c84d84","096d6c44-67fc-11f0-a7d9-0224a6c84d84",338,["D",1753299263574],"#\n# Copyright (C) 2012-2023 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nimport codecs\nfrom collections import deque\nimport contextlib\nimport csv\nfrom glob import iglob as std_iglob\nimport io\nimport json\nimport logging\nimport os\nimport py_compile\nimport re\nimport socket\ntry:\n    import ssl\nexcept ImportError:  # pragma: no cover\n    ssl = None\nimport subprocess\nimport sys\nimport tarfile\nimport tempfile\nimport textwrap\n\ntry:\n    import threading\nexcept ImportError:  # pragma: no cover\n    import dummy_threading as threading\nimport time\n\nfrom . import DistlibException\nfrom .compat import (string_types, text_type, shutil, raw_input, StringIO, cache_from_source, urlopen, urljoin, httplib,\n                     xmlrpclib, HTTPHandler, BaseConfigurator, valid_ident, Container, configparser, URLError, ZipFile,\n                     fsdecode, unquote, urlparse)\n\nlogger = logging.getLogger(__name__)\n\n#\n# Requirement parsing code as per PEP 508\n#\n\nIDENTIFIER = re.compile(r'^([\\w\\.-]+)\\s*')\nVERSION_IDENTIFIER = re.compile(r'^([\\w\\.*+-]+)\\s*')\nCOMPARE_OP = re.compile(r'^(<=?|>=?|={2,3}|[~!]=)\\s*')\nMARKER_OP = re.compile(r'^((<=?)|(>=?)|={2,3}|[~!]=|in|not\\s+in)\\s*')\nOR = re.compile(r'^or\\b\\s*')\nAND = re.compile(r'^and\\b\\s*')\nNON_SPACE = re.compile(r'(\\S+)\\s*')\nSTRING_CHUNK = re.compile(r'([\\s\\w\\.{}()*+#:;,/?!~`@$%^&=|<>\\[\\]-]+)')\n\n\ndef parse_marker(marker_string):\n    \"\"\"\n    Parse a marker string and return a dictionary containing a marker expression.\n\n    The dictionary will contain keys \"op\", \"lhs\" and \"rhs\" for non-terminals in\n    the expression grammar, or strings. A string contained in quotes is to be\n    interpreted as a literal string, and a string not contained in quotes is a\n    variable (such as os_name).\n    \"\"\"\n\n    def marker_var(remaining):\n        # either identifier, or literal string\n        m = IDENTIFIER.match(remaining)\n        if m:\n            result = m.groups()[0]\n            remaining = remaining[m.end():]\n        elif not remaining:\n            raise SyntaxError('unexpected end of input')\n        else:\n            q = remaining[0]\n            if q not in '\\'\"':\n                raise SyntaxError('invalid expression: %s' % remaining)\n            oq = '\\'\"'.replace(q, '')\n            remaining = remaining[1:]\n            parts = [q]\n            while remaining:\n                # either a string chunk, or oq, or q to terminate\n                if remaining[0] == q:\n                    break\n                elif remaining[0] == oq:\n                    parts.append(oq)\n                    remaining = remaining[1:]\n                else:\n                    m = STRING_CHUNK.match(remaining)\n                    if not m:\n                        raise SyntaxError('error in string literal: %s' % remaining)\n                    parts.append(m.groups()[0])\n                    remaining = remaining[m.end():]\n            else:\n                s = ''.join(parts)\n                raise SyntaxError('unterminated string: %s' % s)\n            parts.append(q)\n            result = ''.join(parts)\n            remaining = remaining[1:].lstrip()  # skip past closing quote\n        return result, remaining\n\n    def marker_expr(remaining):\n        if remaining and remaining[0] == '(':\n            result, remaining = marker(remaining[1:].lstrip())\n            if remaining[0] != ')':\n                raise SyntaxError('unterminated parenthesis: %s' % remaining)\n            remaining = remaining[1:].lstrip()\n        else:\n            lhs, remaining = marker_var(remaining)\n            while remaining:\n                m = MARKER_OP.match(remaining)\n                if not m:\n                    break\n                op = m.groups()[0]\n                remaining = remaining[m.end():]\n                rhs, remaining = marker_var(remaining)\n                lhs = {'op': op, 'lhs': lhs, 'rhs': rhs}\n            result = lhs\n        return result, remaining\n\n    def marker_and(remaining):\n        lhs, remaining = marker_expr(remaining)\n        while remaining:\n            m = AND.match(remaining)\n            if not m:\n                break\n            remaining = remaining[m.end():]\n            rhs, remaining = marker_expr(remaining)\n            lhs = {'op': 'and', 'lhs': lhs, 'rhs': rhs}\n        return lhs, remaining\n\n    def marker(remaining):\n        lhs, remaining = marker_and(remaining)\n        while remaining:\n            m = OR.match(remaining)\n            if not m:\n                break\n            remaining = remaining[m.end():]\n            rhs, remaining = marker_and(remaining)\n            lhs = {'op': 'or', 'lhs': lhs, 'rhs': rhs}\n        return lhs, remaining\n\n    return marker(marker_string)\n\n\ndef parse_requirement(req):\n    \"\"\"\n    Parse a requirement passed in as a string. Return a Container\n    whose attributes contain the various parts of the requirement.\n    \"\"\"\n    remaining = req.strip()\n    if not remaining or remaining.startswith('#'):\n        return None\n    m = IDENTIFIER.match(remaining)\n    if not m:\n        raise SyntaxError('name expected: %s' % remaining)\n    distname = m.groups()[0]\n    remaining = remaining[m.end():]\n    extras = mark_expr = versions = uri = None\n    if remaining and remaining[0] == '[':\n        i = remaining.find(']', 1)\n        if i < 0:\n            raise SyntaxError('unterminated extra: %s' % remaining)\n        s = remaining[1:i]\n        remaining = remaining[i + 1:].lstrip()\n        extras = []\n        while s:\n            m = IDENTIFIER.match(s)\n            if not m:\n                raise SyntaxError('malformed extra: %s' % s)\n            extras.append(m.groups()[0])\n            s = s[m.end():]\n            if not s:\n                break\n            if s[0] != ',':\n                raise SyntaxError('comma expected in extras: %s' % s)\n            s = s[1:].lstrip()\n        if not extras:\n            extras = None\n    if remaining:\n        if remaining[0] == '@':\n            # it's a URI\n            remaining = remaining[1:].lstrip()\n            m = NON_SPACE.match(remaining)\n            if not m:\n                raise SyntaxError('invalid URI: %s' % remaining)\n            uri = m.groups()[0]\n            t = urlparse(uri)\n            # there are issues with Python and URL parsing, so this test\n            # is a bit crude. See bpo-20271, bpo-23505. Python doesn't\n            # always parse invalid URLs correctly - it should raise\n            # exceptions for malformed URLs\n            if not (t.scheme and t.netloc):\n                raise SyntaxError('Invalid URL: %s' % uri)\n            remaining = remaining[m.end():].lstrip()\n        else:\n\n            def get_versions(ver_remaining):\n                \"\"\"\n                Return a list of operator, version tuples if any are\n                specified, else None.\n                \"\"\"\n                m = COMPARE_OP.match(ver_remaining)\n                versions = None\n                if m:\n                    versions = []\n                    while True:\n                        op = m.groups()[0]\n                        ver_remaining = ver_remaining[m.end():]\n                        m = VERSION_IDENTIFIER.match(ver_remaining)\n                        if not m:\n                            raise SyntaxError('invalid version: %s' % ver_remaining)\n                        v = m.groups()[0]\n                        versions.append((op, v))\n                        ver_remaining = ver_remaining[m.end():]\n                        if not ver_remaining or ver_remaining[0] != ',':\n                            break\n                        ver_remaining = ver_remaining[1:].lstrip()\n                        # Some packages have a trailing comma which would break things\n                        # See issue #148\n                        if not ver_remaining:\n                            break\n                        m = COMPARE_OP.match(ver_remaining)\n                        if not m:\n                            raise SyntaxError('invalid constraint: %s' % ver_remaining)\n                    if not versions:\n                        versions = None\n                return versions, ver_remaining\n\n            if remaining[0] != '(':\n                versions, remaining = get_versions(remaining)\n            else:\n                i = remaining.find(')', 1)\n                if i < 0:\n                    raise SyntaxError('unterminated parenthesis: %s' % remaining)\n                s = remaining[1:i]\n                remaining = remaining[i + 1:].lstrip()\n                # As a special diversion from PEP 508, allow a version number\n                # a.b.c in parentheses as a synonym for ~= a.b.c (because this\n                # is allowed in earlier PEPs)\n                if COMPARE_OP.match(s):\n                    versions, _ = get_versions(s)\n                else:\n                    m = VERSION_IDENTIFIER.match(s)\n                    if not m:\n                        raise SyntaxError('invalid constraint: %s' % s)\n                    v = m.groups()[0]\n                    s = s[m.end():].lstrip()\n                    if s:\n                        raise SyntaxError('invalid constraint: %s' % s)\n                    versions = [('~=', v)]\n\n    if remaining:\n        if remaining[0] != ';':\n            raise SyntaxError('invalid requirement: %s' % remaining)\n        remaining = remaining[1:].lstrip()\n\n        mark_expr, remaining = parse_marker(remaining)\n\n    if remaining and remaining[0] != '#':\n        raise SyntaxError('unexpected trailing data: %s' % remaining)\n\n    if not versions:\n        rs = distname\n    else:\n        rs = '%s %s' % (distname, ', '.join(['%s %s' % con for con in versions]))\n    return Container(name=distname, extras=extras, constraints=versions, marker=mark_expr, url=uri, requirement=rs)\n\n\ndef get_resources_dests(resources_root, rules):\n    \"\"\"Find destinations for resources files\"\"\"\n\n    def get_rel_path(root, path):\n        # normalizes and returns a lstripped-/-separated path\n        root = root.replace(os.path.sep, '/')\n        path = path.replace(os.path.sep, '/')\n        assert path.startswith(root)\n        return path[len(root):].lstrip('/')\n\n    destinations = {}\n    for base, suffix, dest in rules:\n        prefix = os.path.join(resources_root, base)\n        for abs_base in iglob(prefix):\n            abs_glob = os.path.join(abs_base, suffix)\n            for abs_path in iglob(abs_glob):\n                resource_file = get_rel_path(resources_root, abs_path)\n                if dest is None:  # remove the entry if it was here\n                    destinations.pop(resource_file, None)\n                else:\n                    rel_path = get_rel_path(abs_base, abs_path)\n                    rel_dest = dest.replace(os.path.sep, '/').rstrip('/')\n                    destinations[resource_file] = rel_dest + '/' + rel_path\n    return destinations\n\n\ndef in_venv():\n    if hasattr(sys, 'real_prefix'):\n        # virtualenv venvs\n        result = True\n    else:\n        # PEP 405 venvs\n        result = sys.prefix != getattr(sys, 'base_prefix', sys.prefix)\n    return result\n\n\ndef get_executable():\n    # The __PYVENV_LAUNCHER__ dance is apparently no longer needed, as\n    # changes to the stub launcher mean that sys.executable always points\n    # to the stub on OS X\n    #    if sys.platform == 'darwin' and ('__PYVENV_LAUNCHER__'\n    #                                     in os.environ):\n    #        result =  os.environ['__PYVENV_LAUNCHER__']\n    #    else:\n    #        result = sys.executable\n    #    return result\n    # Avoid normcasing: see issue #143\n    # result = os.path.normcase(sys.executable)\n    result = sys.executable\n    if not isinstance(result, text_type):\n        result = fsdecode(result)\n    return result\n\n\ndef proceed(prompt, allowed_chars, error_prompt=None, default=None):\n    p = prompt\n    while True:\n        s = raw_input(p)\n        p = prompt\n        if not s and default:\n            s = default\n        if s:\n            c = s[0].lower()\n            if c in allowed_chars:\n                break\n            if error_prompt:\n                p = '%c: %s\\n%s' % (c, error_prompt, prompt)\n    return c\n\n\ndef extract_by_key(d, keys):\n    if isinstance(keys, string_types):\n        keys = keys.split()\n    result = {}\n    for key in keys:\n        if key in d:\n            result[key] = d[key]\n    return result\n\n\ndef read_exports(stream):\n    if sys.version_info[0] >= 3:\n        # needs to be a text stream\n        stream = codecs.getreader('utf-8')(stream)\n    # Try to load as JSON, falling back on legacy format\n    data = stream.read()\n    stream = StringIO(data)\n    try:\n        jdata = json.load(stream)\n        result = jdata['extensions']['python.exports']['exports']\n        for group, entries in result.items():\n            for k, v in entries.items():\n                s = '%s = %s' % (k, v)\n                entry = get_export_entry(s)\n                assert entry is not None\n                entries[k] = entry\n        return result\n    except Exception:\n        stream.seek(0, 0)\n\n    def read_stream(cp, stream):\n        if hasattr(cp, 'read_file'):\n            cp.read_file(stream)\n        else:\n            cp.readfp(stream)\n\n    cp = configparser.ConfigParser()\n    try:\n        read_stream(cp, stream)\n    except configparser.MissingSectionHeaderError:\n        stream.close()\n        data = textwrap.dedent(data)\n        stream = StringIO(data)\n        read_stream(cp, stream)\n\n    result = {}\n    for key in cp.sections():\n        result[key] = entries = {}\n        for name, value in cp.items(key):\n            s = '%s = %s' % (name, value)\n            entry = get_export_entry(s)\n            assert entry is not None\n            # entry.dist = self\n            entries[name] = entry\n    return result\n\n\ndef write_exports(exports, stream):\n    if sys.version_info[0] >= 3:\n        # needs to be a text stream\n        stream = codecs.getwriter('utf-8')(stream)\n    cp = configparser.ConfigParser()\n    for k, v in exports.items():\n        # TODO check k, v for valid values\n        cp.add_section(k)\n        for entry in v.values():\n            if entry.suffix is None:\n                s = entry.prefix\n            else:\n                s = '%s:%s' % (entry.prefix, entry.suffix)\n            if entry.flags:\n                s = '%s [%s]' % (s, ', '.join(entry.flags))\n            cp.set(k, entry.name, s)\n    cp.write(stream)\n\n\n@contextlib.contextmanager\ndef tempdir():\n    td = tempfile.mkdtemp()\n    try:\n        yield td\n    finally:\n        shutil.rmtree(td)\n\n\n@contextlib.contextmanager\ndef chdir(d):\n    cwd = os.getcwd()\n    try:\n        os.chdir(d)\n        yield\n    finally:\n        os.chdir(cwd)\n\n\n@contextlib.contextmanager\ndef socket_timeout(seconds=15):\n    cto = socket.getdefaulttimeout()\n    try:\n        socket.setdefaulttimeout(seconds)\n        yield\n    finally:\n        socket.setdefaulttimeout(cto)\n\n\nclass cached_property(object):\n\n    def __init__(self, func):\n        self.func = func\n        # for attr in ('__name__', '__module__', '__doc__'):\n        #     setattr(self, attr, getattr(func, attr, None))\n\n    def __get__(self, obj, cls=None):\n        if obj is None:\n            return self\n        value = self.func(obj)\n        object.__setattr__(obj, self.func.__name__, value)\n        # obj.__dict__[self.func.__name__] = value = self.func(obj)\n        return value\n\n\ndef convert_path(pathname):\n    \"\"\"Return 'pathname' as a name that will work on the native filesystem.\n\n    The path is split on '/' and put back together again using the current\n    directory separator.  Needed because filenames in the setup script are\n    always supplied in Unix style, and have to be converted to the local\n    convention before we can actually use them in the filesystem.  Raises\n    ValueError on non-Unix-ish systems if 'pathname' either starts or\n    ends with a slash.\n    \"\"\"\n    if os.sep == '/':\n        return pathname\n    if not pathname:\n        return pathname\n    if pathname[0] == '/':\n        raise ValueError(\"path '%s' cannot be absolute\" % pathname)\n    if pathname[-1] == '/':\n        raise ValueError(\"path '%s' cannot end with '/'\" % pathname)\n\n    paths = pathname.split('/')\n    while os.curdir in paths:\n        paths.remove(os.curdir)\n    if not paths:\n        return os.curdir\n    return os.path.join(*paths)\n\n\nclass FileOperator(object):\n\n    def __init__(self, dry_run=False):\n        self.dry_run = dry_run\n        self.ensured = set()\n        self._init_record()\n\n    def _init_record(self):\n        self.record = False\n        self.files_written = set()\n        self.dirs_created = set()\n\n    def record_as_written(self, path):\n        if self.record:\n            self.files_written.add(path)\n\n    def newer(self, source, target):\n        \"\"\"Tell if the target is newer than the source.\n\n        Returns true if 'source' exists and is more recently modified than\n        'target', or if 'source' exists and 'target' doesn't.\n\n        Returns false if both exist and 'target' is the same age or younger\n        than 'source'. Raise PackagingFileError if 'source' does not exist.\n\n        Note that this test is not very accurate: files created in the same\n        second will have the same \"age\".\n        \"\"\"\n        if not os.path.exists(source):\n            raise DistlibException(\"file '%r' does not exist\" % os.path.abspath(source))\n        if not os.path.exists(target):\n            return True\n\n        return os.stat(source).st_mtime > os.stat(target).st_mtime\n\n    def copy_file(self, infile, outfile, check=True):\n        \"\"\"Copy a file respecting dry-run and force flags.\n        \"\"\"\n        self.ensure_dir(os.path.dirname(outfile))\n        logger.info('Copying %s to %s', infile, outfile)\n        if not self.dry_run:\n            msg = None\n            if check:\n                if os.path.islink(outfile):\n                    msg = '%s is a symlink' % outfile\n                elif os.path.exists(outfile) and not os.path.isfile(outfile):\n                    msg = '%s is a non-regular file' % outfile\n            if msg:\n                raise ValueError(msg + ' which would be overwritten')\n            shutil.copyfile(infile, outfile)\n        self.record_as_written(outfile)\n\n    def copy_stream(self, instream, outfile, encoding=None):\n        assert not os.path.isdir(outfile)\n        self.ensure_dir(os.path.dirname(outfile))\n        logger.info('Copying stream %s to %s', instream, outfile)\n        if not self.dry_run:\n            if encoding is None:\n                outstream = open(outfile, 'wb')\n            else:\n                outstream = codecs.open(outfile, 'w', encoding=encoding)\n            try:\n                shutil.copyfileobj(instream, outstream)\n            finally:\n                outstream.close()\n        self.record_as_written(outfile)\n\n    def write_binary_file(self, path, data):\n        self.ensure_dir(os.path.dirname(path))\n        if not self.dry_run:\n            if os.path.exists(path):\n                os.remove(path)\n            with open(path, 'wb') as f:\n                f.write(data)\n        self.record_as_written(path)\n\n    def write_text_file(self, path, data, encoding):\n        self.write_binary_file(path, data.encode(encoding))\n\n    def set_mode(self, bits, mask, files):\n        if os.name == 'posix' or (os.name == 'java' and os._name == 'posix'):\n            # Set the executable bits (owner, group, and world) on\n            # all the files specified.\n            for f in files:\n                if self.dry_run:\n                    logger.info(\"changing mode of %s\", f)\n                else:\n                    mode = (os.stat(f).st_mode | bits) & mask\n                    logger.info(\"changing mode of %s to %o\", f, mode)\n                    os.chmod(f, mode)\n\n    set_executable_mode = lambda s, f: s.set_mode(0o555, 0o7777, f)\n\n    def ensure_dir(self, path):\n        path = os.path.abspath(path)\n        if path not in self.ensured and not os.path.exists(path):\n            self.ensured.add(path)\n            d, f = os.path.split(path)\n            self.ensure_dir(d)\n            logger.info('Creating %s' % path)\n            if not self.dry_run:\n                os.mkdir(path)\n            if self.record:\n                self.dirs_created.add(path)\n\n    def byte_compile(self, path, optimize=False, force=False, prefix=None, hashed_invalidation=False):\n        dpath = cache_from_source(path, not optimize)\n        logger.info('Byte-compiling %s to %s', path, dpath)\n        if not self.dry_run:\n            if force or self.newer(path, dpath):\n                if not prefix:\n                    diagpath = None\n                else:\n                    assert path.startswith(prefix)\n                    diagpath = path[len(prefix):]\n            compile_kwargs = {}\n            if hashed_invalidation and hasattr(py_compile, 'PycInvalidationMode'):\n                if not isinstance(hashed_invalidation, py_compile.PycInvalidationMode):\n                    hashed_invalidation = py_compile.PycInvalidationMode.CHECKED_HASH\n                compile_kwargs['invalidation_mode'] = hashed_invalidation\n            py_compile.compile(path, dpath, diagpath, True, **compile_kwargs)  # raise error\n        self.record_as_written(dpath)\n        return dpath\n\n    def ensure_removed(self, path):\n        if os.path.exists(path):\n            if os.path.isdir(path) and not os.path.islink(path):\n                logger.debug('Removing directory tree at %s', path)\n                if not self.dry_run:\n                    shutil.rmtree(path)\n                if self.record:\n                    if path in self.dirs_created:\n                        self.dirs_created.remove(path)\n            else:\n                if os.path.islink(path):\n                    s = 'link'\n                else:\n                    s = 'file'\n                logger.debug('Removing %s %s', s, path)\n                if not self.dry_run:\n                    os.remove(path)\n                if self.record:\n                    if path in self.files_written:\n                        self.files_written.remove(path)\n\n    def is_writable(self, path):\n        result = False\n        while not result:\n            if os.path.exists(path):\n                result = os.access(path, os.W_OK)\n                break\n            parent = os.path.dirname(path)\n            if parent == path:\n                break\n            path = parent\n        return result\n\n    def commit(self):\n        \"\"\"\n        Commit recorded changes, turn off recording, return\n        changes.\n        \"\"\"\n        assert self.record\n        result = self.files_written, self.dirs_created\n        self._init_record()\n        return result\n\n    def rollback(self):\n        if not self.dry_run:\n            for f in list(self.files_written):\n                if os.path.exists(f):\n                    os.remove(f)\n            # dirs should all be empty now, except perhaps for\n            # __pycache__ subdirs\n            # reverse so that subdirs appear before their parents\n            dirs = sorted(self.dirs_created, reverse=True)\n            for d in dirs:\n                flist = os.listdir(d)\n                if flist:\n                    assert flist == ['__pycache__']\n                    sd = os.path.join(d, flist[0])\n                    os.rmdir(sd)\n                os.rmdir(d)  # should fail if non-empty\n        self._init_record()\n\n\ndef resolve(module_name, dotted_path):\n    if module_name in sys.modules:\n        mod = sys.modules[module_name]\n    else:\n        mod = __import__(module_name)\n    if dotted_path is None:\n        result = mod\n    else:\n        parts = dotted_path.split('.')\n        result = getattr(mod, parts.pop(0))\n        for p in parts:\n            result = getattr(result, p)\n    return result\n\n\nclass ExportEntry(object):\n\n    def __init__(self, name, prefix, suffix, flags):\n        self.name = name\n        self.prefix = prefix\n        self.suffix = suffix\n        self.flags = flags\n\n    @cached_property\n    def value(self):\n        return resolve(self.prefix, self.suffix)\n\n    def __repr__(self):  # pragma: no cover\n        return '' % (self.name, self.prefix, self.suffix, self.flags)\n\n    def __eq__(self, other):\n        if not isinstance(other, ExportEntry):\n            result = False\n        else:\n            result = (self.name == other.name and self.prefix == other.prefix and self.suffix == other.suffix and\n                      self.flags == other.flags)\n        return result\n\n    __hash__ = object.__hash__\n\n\nENTRY_RE = re.compile(\n    r'''(?P([^\\[]\\S*))\n                      \\s*=\\s*(?P(\\w+)([:\\.]\\w+)*)\n                      \\s*(\\[\\s*(?P[\\w-]+(=\\w+)?(,\\s*\\w+(=\\w+)?)*)\\s*\\])?\n                      ''', re.VERBOSE)\n\n\ndef get_export_entry(specification):\n    m = ENTRY_RE.search(specification)\n    if not m:\n        result = None\n        if '[' in specification or ']' in specification:\n            raise DistlibException(\"Invalid specification \"\n                                   \"'%s'\" % specification)\n    else:\n        d = m.groupdict()\n        name = d['name']\n        path = d['callable']\n        colons = path.count(':')\n        if colons == 0:\n            prefix, suffix = path, None\n        else:\n            if colons != 1:\n                raise DistlibException(\"Invalid specification \"\n                                       \"'%s'\" % specification)\n            prefix, suffix = path.split(':')\n        flags = d['flags']\n        if flags is None:\n            if '[' in specification or ']' in specification:\n                raise DistlibException(\"Invalid specification \"\n                                       \"'%s'\" % specification)\n            flags = []\n        else:\n            flags = [f.strip() for f in flags.split(',')]\n        result = ExportEntry(name, prefix, suffix, flags)\n    return result\n\n\ndef get_cache_base(suffix=None):\n    \"\"\"\n    Return the default base location for distlib caches. If the directory does\n    not exist, it is created. Use the suffix provided for the base directory,\n    and default to '.distlib' if it isn't provided.\n\n    On Windows, if LOCALAPPDATA is defined in the environment, then it is\n    assumed to be a directory, and will be the parent directory of the result.\n    On POSIX, and on Windows if LOCALAPPDATA is not defined, the user's home\n    directory - using os.expanduser('~') - will be the parent directory of\n    the result.\n\n    The result is just the directory '.distlib' in the parent directory as\n    determined above, or with the name specified with ``suffix``.\n    \"\"\"\n    if suffix is None:\n        suffix = '.distlib'\n    if os.name == 'nt' and 'LOCALAPPDATA' in os.environ:\n        result = os.path.expandvars('$localappdata')\n    else:\n        # Assume posix, or old Windows\n        result = os.path.expanduser('~')\n    # we use 'isdir' instead of 'exists', because we want to\n    # fail if there's a file with that name\n    if os.path.isdir(result):\n        usable = os.access(result, os.W_OK)\n        if not usable:\n            logger.warning('Directory exists but is not writable: %s', result)\n    else:\n        try:\n            os.makedirs(result)\n            usable = True\n        except OSError:\n            logger.warning('Unable to create %s', result, exc_info=True)\n            usable = False\n    if not usable:\n        result = tempfile.mkdtemp()\n        logger.warning('Default location unusable, using %s', result)\n    return os.path.join(result, suffix)\n\n\ndef path_to_cache_dir(path, use_abspath=True):\n    \"\"\"\n    Convert an absolute path to a directory name for use in a cache.\n\n    The algorithm used is:\n\n    #. On Windows, any ``':'`` in the drive is replaced with ``'---'``.\n    #. Any occurrence of ``os.sep`` is replaced with ``'--'``.\n    #. ``'.cache'`` is appended.\n    \"\"\"\n    d, p = os.path.splitdrive(os.path.abspath(path) if use_abspath else path)\n    if d:\n        d = d.replace(':', '---')\n    p = p.replace(os.sep, '--')\n    return d + p + '.cache'\n\n\ndef ensure_slash(s):\n    if not s.endswith('/'):\n        return s + '/'\n    return s\n\n\ndef parse_credentials(netloc):\n    username = password = None\n    if '@' in netloc:\n        prefix, netloc = netloc.rsplit('@', 1)\n        if ':' not in prefix:\n            username = prefix\n        else:\n            username, password = prefix.split(':', 1)\n    if username:\n        username = unquote(username)\n    if password:\n        password = unquote(password)\n    return username, password, netloc\n\n\ndef get_process_umask():\n    result = os.umask(0o22)\n    os.umask(result)\n    return result\n\n\ndef is_string_sequence(seq):\n    result = True\n    i = None\n    for i, s in enumerate(seq):\n        if not isinstance(s, string_types):\n            result = False\n            break\n    assert i is not None\n    return result\n\n\nPROJECT_NAME_AND_VERSION = re.compile('([a-z0-9_]+([.-][a-z_][a-z0-9_]*)*)-'\n                                      '([a-z0-9_.+-]+)', re.I)\nPYTHON_VERSION = re.compile(r'-py(\\d\\.?\\d?)')\n\n\ndef split_filename(filename, project_name=None):\n    \"\"\"\n    Extract name, version, python version from a filename (no extension)\n\n    Return name, version, pyver or None\n    \"\"\"\n    result = None\n    pyver = None\n    filename = unquote(filename).replace(' ', '-')\n    m = PYTHON_VERSION.search(filename)\n    if m:\n        pyver = m.group(1)\n        filename = filename[:m.start()]\n    if project_name and len(filename) > len(project_name) + 1:\n        m = re.match(re.escape(project_name) + r'\\b', filename)\n        if m:\n            n = m.end()\n            result = filename[:n], filename[n + 1:], pyver\n    if result is None:\n        m = PROJECT_NAME_AND_VERSION.match(filename)\n        if m:\n            result = m.group(1), m.group(3), pyver\n    return result\n\n\n# Allow spaces in name because of legacy dists like \"Twisted Core\"\nNAME_VERSION_RE = re.compile(r'(?P[\\w .-]+)\\s*'\n                             r'\\(\\s*(?P[^\\s)]+)\\)$')\n\n\ndef parse_name_and_version(p):\n    \"\"\"\n    A utility method used to get name and version from a string.\n\n    From e.g. a Provides-Dist value.\n\n    :param p: A value in a form 'foo (1.0)'\n    :return: The name and version as a tuple.\n    \"\"\"\n    m = NAME_VERSION_RE.match(p)\n    if not m:\n        raise DistlibException('Ill-formed name/version string: \\'%s\\'' % p)\n    d = m.groupdict()\n    return d['name'].strip().lower(), d['ver']\n\n\ndef get_extras(requested, available):\n    result = set()\n    requested = set(requested or [])\n    available = set(available or [])\n    if '*' in requested:\n        requested.remove('*')\n        result |= available\n    for r in requested:\n        if r == '-':\n            result.add(r)\n        elif r.startswith('-'):\n            unwanted = r[1:]\n            if unwanted not in available:\n                logger.warning('undeclared extra: %s' % unwanted)\n            if unwanted in result:\n                result.remove(unwanted)\n        else:\n            if r not in available:\n                logger.warning('undeclared extra: %s' % r)\n            result.add(r)\n    return result\n\n\n#\n# Extended metadata functionality\n#\n\n\ndef _get_external_data(url):\n    result = {}\n    try:\n        # urlopen might fail if it runs into redirections,\n        # because of Python issue #13696. Fixed in locators\n        # using a custom redirect handler.\n        resp = urlopen(url)\n        headers = resp.info()\n        ct = headers.get('Content-Type')\n        if not ct.startswith('application/json'):\n            logger.debug('Unexpected response for JSON request: %s', ct)\n        else:\n            reader = codecs.getreader('utf-8')(resp)\n            # data = reader.read().decode('utf-8')\n            # result = json.loads(data)\n            result = json.load(reader)\n    except Exception as e:\n        logger.exception('Failed to get external data for %s: %s', url, e)\n    return result\n\n\n_external_data_base_url = 'https://www.red-dove.com/pypi/projects/'\n\n\ndef get_project_data(name):\n    url = '%s/%s/project.json' % (name[0].upper(), name)\n    url = urljoin(_external_data_base_url, url)\n    result = _get_external_data(url)\n    return result\n\n\ndef get_package_data(name, version):\n    url = '%s/%s/package-%s.json' % (name[0].upper(), name, version)\n    url = urljoin(_external_data_base_url, url)\n    return _get_external_data(url)\n\n\nclass Cache(object):\n    \"\"\"\n    A class implementing a cache for resources that need to live in the file system\n    e.g. shared libraries. This class was moved from resources to here because it\n    could be used by other modules, e.g. the wheel module.\n    \"\"\"\n\n    def __init__(self, base):\n        \"\"\"\n        Initialise an instance.\n\n        :param base: The base directory where the cache should be located.\n        \"\"\"\n        # we use 'isdir' instead of 'exists', because we want to\n        # fail if there's a file with that name\n        if not os.path.isdir(base):  # pragma: no cover\n            os.makedirs(base)\n        if (os.stat(base).st_mode & 0o77) != 0:\n            logger.warning('Directory \\'%s\\' is not private', base)\n        self.base = os.path.abspath(os.path.normpath(base))\n\n    def prefix_to_dir(self, prefix, use_abspath=True):\n        \"\"\"\n        Converts a resource prefix to a directory name in the cache.\n        \"\"\"\n        return path_to_cache_dir(prefix, use_abspath=use_abspath)\n\n    def clear(self):\n        \"\"\"\n        Clear the cache.\n        \"\"\"\n        not_removed = []\n        for fn in os.listdir(self.base):\n            fn = os.path.join(self.base, fn)\n            try:\n                if os.path.islink(fn) or os.path.isfile(fn):\n                    os.remove(fn)\n                elif os.path.isdir(fn):\n                    shutil.rmtree(fn)\n            except Exception:\n                not_removed.append(fn)\n        return not_removed\n\n\nclass EventMixin(object):\n    \"\"\"\n    A very simple publish/subscribe system.\n    \"\"\"\n\n    def __init__(self):\n        self._subscribers = {}\n\n    def add(self, event, subscriber, append=True):\n        \"\"\"\n        Add a subscriber for an event.\n\n        :param event: The name of an event.\n        :param subscriber: The subscriber to be added (and called when the\n                           event is published).\n        :param append: Whether to append or prepend the subscriber to an\n                       existing subscriber list for the event.\n        \"\"\"\n        subs = self._subscribers\n        if event not in subs:\n            subs[event] = deque([subscriber])\n        else:\n            sq = subs[event]\n            if append:\n                sq.append(subscriber)\n            else:\n                sq.appendleft(subscriber)\n\n    def remove(self, event, subscriber):\n        \"\"\"\n        Remove a subscriber for an event.\n\n        :param event: The name of an event.\n        :param subscriber: The subscriber to be removed.\n        \"\"\"\n        subs = self._subscribers\n        if event not in subs:\n            raise ValueError('No subscribers: %r' % event)\n        subs[event].remove(subscriber)\n\n    def get_subscribers(self, event):\n        \"\"\"\n        Return an iterator for the subscribers for an event.\n        :param event: The event to return subscribers for.\n        \"\"\"\n        return iter(self._subscribers.get(event, ()))\n\n    def publish(self, event, *args, **kwargs):\n        \"\"\"\n        Publish a event and return a list of values returned by its\n        subscribers.\n\n        :param event: The event to publish.\n        :param args: The positional arguments to pass to the event's\n                     subscribers.\n        :param kwargs: The keyword arguments to pass to the event's\n                       subscribers.\n        \"\"\"\n        result = []\n        for subscriber in self.get_subscribers(event):\n            try:\n                value = subscriber(event, *args, **kwargs)\n            except Exception:\n                logger.exception('Exception during event publication')\n                value = None\n            result.append(value)\n        logger.debug('publish %s: args = %s, kwargs = %s, result = %s', event, args, kwargs, result)\n        return result\n\n\n#\n# Simple sequencing\n#\nclass Sequencer(object):\n\n    def __init__(self):\n        self._preds = {}\n        self._succs = {}\n        self._nodes = set()  # nodes with no preds/succs\n\n    def add_node(self, node):\n        self._nodes.add(node)\n\n    def remove_node(self, node, edges=False):\n        if node in self._nodes:\n            self._nodes.remove(node)\n        if edges:\n            for p in set(self._preds.get(node, ())):\n                self.remove(p, node)\n            for s in set(self._succs.get(node, ())):\n                self.remove(node, s)\n            # Remove empties\n            for k, v in list(self._preds.items()):\n                if not v:\n                    del self._preds[k]\n            for k, v in list(self._succs.items()):\n                if not v:\n                    del self._succs[k]\n\n    def add(self, pred, succ):\n        assert pred != succ\n        self._preds.setdefault(succ, set()).add(pred)\n        self._succs.setdefault(pred, set()).add(succ)\n\n    def remove(self, pred, succ):\n        assert pred != succ\n        try:\n            preds = self._preds[succ]\n            succs = self._succs[pred]\n        except KeyError:  # pragma: no cover\n            raise ValueError('%r not a successor of anything' % succ)\n        try:\n            preds.remove(pred)\n            succs.remove(succ)\n        except KeyError:  # pragma: no cover\n            raise ValueError('%r not a successor of %r' % (succ, pred))\n\n    def is_step(self, step):\n        return (step in self._preds or step in self._succs or step in self._nodes)\n\n    def get_steps(self, final):\n        if not self.is_step(final):\n            raise ValueError('Unknown: %r' % final)\n        result = []\n        todo = []\n        seen = set()\n        todo.append(final)\n        while todo:\n            step = todo.pop(0)\n            if step in seen:\n                # if a step was already seen,\n                # move it to the end (so it will appear earlier\n                # when reversed on return) ... but not for the\n                # final step, as that would be confusing for\n                # users\n                if step != final:\n                    result.remove(step)\n                    result.append(step)\n            else:\n                seen.add(step)\n                result.append(step)\n                preds = self._preds.get(step, ())\n                todo.extend(preds)\n        return reversed(result)\n\n    @property\n    def strong_connections(self):\n        # http://en.wikipedia.org/wiki/Tarjan%27s_strongly_connected_components_algorithm\n        index_counter = [0]\n        stack = []\n        lowlinks = {}\n        index = {}\n        result = []\n\n        graph = self._succs\n\n        def strongconnect(node):\n            # set the depth index for this node to the smallest unused index\n            index[node] = index_counter[0]\n            lowlinks[node] = index_counter[0]\n            index_counter[0] += 1\n            stack.append(node)\n\n            # Consider successors\n            try:\n                successors = graph[node]\n            except Exception:\n                successors = []\n            for successor in successors:\n                if successor not in lowlinks:\n                    # Successor has not yet been visited\n                    strongconnect(successor)\n                    lowlinks[node] = min(lowlinks[node], lowlinks[successor])\n                elif successor in stack:\n                    # the successor is in the stack and hence in the current\n                    # strongly connected component (SCC)\n                    lowlinks[node] = min(lowlinks[node], index[successor])\n\n            # If `node` is a root node, pop the stack and generate an SCC\n            if lowlinks[node] == index[node]:\n                connected_component = []\n\n                while True:\n                    successor = stack.pop()\n                    connected_component.append(successor)\n                    if successor == node:\n                        break\n                component = tuple(connected_component)\n                # storing the result\n                result.append(component)\n\n        for node in graph:\n            if node not in lowlinks:\n                strongconnect(node)\n\n        return result\n\n    @property\n    def dot(self):\n        result = ['digraph G {']\n        for succ in self._preds:\n            preds = self._preds[succ]\n            for pred in preds:\n                result.append('  %s -> %s;' % (pred, succ))\n        for node in self._nodes:\n            result.append('  %s;' % node)\n        result.append('}')\n        return '\\n'.join(result)\n\n\n#\n# Unarchiving functionality for zip, tar, tgz, tbz, whl\n#\n\nARCHIVE_EXTENSIONS = ('.tar.gz', '.tar.bz2', '.tar', '.zip', '.tgz', '.tbz', '.whl')\n\n\ndef unarchive(archive_filename, dest_dir, format=None, check=True):\n\n    def check_path(path):\n        if not isinstance(path, text_type):\n            path = path.decode('utf-8')\n        p = os.path.abspath(os.path.join(dest_dir, path))\n        if not p.startswith(dest_dir) or p[plen] != os.sep:\n            raise ValueError('path outside destination: %r' % p)\n\n    dest_dir = os.path.abspath(dest_dir)\n    plen = len(dest_dir)\n    archive = None\n    if format is None:\n        if archive_filename.endswith(('.zip', '.whl')):\n            format = 'zip'\n        elif archive_filename.endswith(('.tar.gz', '.tgz')):\n            format = 'tgz'\n            mode = 'r:gz'\n        elif archive_filename.endswith(('.tar.bz2', '.tbz')):\n            format = 'tbz'\n            mode = 'r:bz2'\n        elif archive_filename.endswith('.tar'):\n            format = 'tar'\n            mode = 'r'\n        else:  # pragma: no cover\n            raise ValueError('Unknown format for %r' % archive_filename)\n    try:\n        if format == 'zip':\n            archive = ZipFile(archive_filename, 'r')\n            if check:\n                names = archive.namelist()\n                for name in names:\n                    check_path(name)\n        else:\n            archive = tarfile.open(archive_filename, mode)\n            if check:\n                names = archive.getnames()\n                for name in names:\n                    check_path(name)\n        if format != 'zip' and sys.version_info[0] < 3:\n            # See Python issue 17153. If the dest path contains Unicode,\n            # tarfile extraction fails on Python 2.x if a member path name\n            # contains non-ASCII characters - it leads to an implicit\n            # bytes -> unicode conversion using ASCII to decode.\n            for tarinfo in archive.getmembers():\n                if not isinstance(tarinfo.name, text_type):\n                    tarinfo.name = tarinfo.name.decode('utf-8')\n\n        # Limit extraction of dangerous items, if this Python\n        # allows it easily. If not, just trust the input.\n        # See: https://docs.python.org/3/library/tarfile.html#extraction-filters\n        def extraction_filter(member, path):\n            \"\"\"Run tarfile.tar_filter, but raise the expected ValueError\"\"\"\n            # This is only called if the current Python has tarfile filters\n            try:\n                return tarfile.tar_filter(member, path)\n            except tarfile.FilterError as exc:\n                raise ValueError(str(exc))\n\n        archive.extraction_filter = extraction_filter\n\n        archive.extractall(dest_dir)\n\n    finally:\n        if archive:\n            archive.close()\n\n\ndef zip_dir(directory):\n    \"\"\"zip a directory tree into a BytesIO object\"\"\"\n    result = io.BytesIO()\n    dlen = len(directory)\n    with ZipFile(result, \"w\") as zf:\n        for root, dirs, files in os.walk(directory):\n            for name in files:\n                full = os.path.join(root, name)\n                rel = root[dlen:]\n                dest = os.path.join(rel, name)\n                zf.write(full, dest)\n    return result\n\n\n#\n# Simple progress bar\n#\n\nUNITS = ('', 'K', 'M', 'G', 'T', 'P')\n\n\nclass Progress(object):\n    unknown = 'UNKNOWN'\n\n    def __init__(self, minval=0, maxval=100):\n        assert maxval is None or maxval >= minval\n        self.min = self.cur = minval\n        self.max = maxval\n        self.started = None\n        self.elapsed = 0\n        self.done = False\n\n    def update(self, curval):\n        assert self.min <= curval\n        assert self.max is None or curval <= self.max\n        self.cur = curval\n        now = time.time()\n        if self.started is None:\n            self.started = now\n        else:\n            self.elapsed = now - self.started\n\n    def increment(self, incr):\n        assert incr >= 0\n        self.update(self.cur + incr)\n\n    def start(self):\n        self.update(self.min)\n        return self\n\n    def stop(self):\n        if self.max is not None:\n            self.update(self.max)\n        self.done = True\n\n    @property\n    def maximum(self):\n        return self.unknown if self.max is None else self.max\n\n    @property\n    def percentage(self):\n        if self.done:\n            result = '100 %'\n        elif self.max is None:\n            result = ' ?? %'\n        else:\n            v = 100.0 * (self.cur - self.min) / (self.max - self.min)\n            result = '%3d %%' % v\n        return result\n\n    def format_duration(self, duration):\n        if (duration <= 0) and self.max is None or self.cur == self.min:\n            result = '??:??:??'\n        # elif duration < 1:\n        #     result = '--:--:--'\n        else:\n            result = time.strftime('%H:%M:%S', time.gmtime(duration))\n        return result\n\n    @property\n    def ETA(self):\n        if self.done:\n            prefix = 'Done'\n            t = self.elapsed\n            # import pdb; pdb.set_trace()\n        else:\n            prefix = 'ETA '\n            if self.max is None:\n                t = -1\n            elif self.elapsed == 0 or (self.cur == self.min):\n                t = 0\n            else:\n                # import pdb; pdb.set_trace()\n                t = float(self.max - self.min)\n                t /= self.cur - self.min\n                t = (t - 1) * self.elapsed\n        return '%s: %s' % (prefix, self.format_duration(t))\n\n    @property\n    def speed(self):\n        if self.elapsed == 0:\n            result = 0.0\n        else:\n            result = (self.cur - self.min) / self.elapsed\n        for unit in UNITS:\n            if result < 1000:\n                break\n            result /= 1000.0\n        return '%d %sB/s' % (result, unit)\n\n\n#\n# Glob functionality\n#\n\nRICH_GLOB = re.compile(r'\\{([^}]*)\\}')\n_CHECK_RECURSIVE_GLOB = re.compile(r'[^/\\\\,{]\\*\\*|\\*\\*[^/\\\\,}]')\n_CHECK_MISMATCH_SET = re.compile(r'^[^{]*\\}|\\{[^}]*$')\n\n\ndef iglob(path_glob):\n    \"\"\"Extended globbing function that supports ** and {opt1,opt2,opt3}.\"\"\"\n    if _CHECK_RECURSIVE_GLOB.search(path_glob):\n        msg = \"\"\"invalid glob %r: recursive glob \"**\" must be used alone\"\"\"\n        raise ValueError(msg % path_glob)\n    if _CHECK_MISMATCH_SET.search(path_glob):\n        msg = \"\"\"invalid glob %r: mismatching set marker '{' or '}'\"\"\"\n        raise ValueError(msg % path_glob)\n    return _iglob(path_glob)\n\n\ndef _iglob(path_glob):\n    rich_path_glob = RICH_GLOB.split(path_glob, 1)\n    if len(rich_path_glob) > 1:\n        assert len(rich_path_glob) == 3, rich_path_glob\n        prefix, set, suffix = rich_path_glob\n        for item in set.split(','):\n            for path in _iglob(''.join((prefix, item, suffix))):\n                yield path\n    else:\n        if '**' not in path_glob:\n            for item in std_iglob(path_glob):\n                yield item\n        else:\n            prefix, radical = path_glob.split('**', 1)\n            if prefix == '':\n                prefix = '.'\n            if radical == '':\n                radical = '*'\n            else:\n                # we support both\n                radical = radical.lstrip('/')\n                radical = radical.lstrip('\\\\')\n            for path, dir, files in os.walk(prefix):\n                path = os.path.normpath(path)\n                for fn in _iglob(os.path.join(path, radical)):\n                    yield fn\n\n\nif ssl:\n    from .compat import (HTTPSHandler as BaseHTTPSHandler, match_hostname, CertificateError)\n\n    #\n    # HTTPSConnection which verifies certificates/matches domains\n    #\n\n    class HTTPSConnection(httplib.HTTPSConnection):\n        ca_certs = None  # set this to the path to the certs file (.pem)\n        check_domain = True  # only used if ca_certs is not None\n\n        # noinspection PyPropertyAccess\n        def connect(self):\n            sock = socket.create_connection((self.host, self.port), self.timeout)\n            if getattr(self, '_tunnel_host', False):\n                self.sock = sock\n                self._tunnel()\n\n            context = ssl.SSLContext(ssl.PROTOCOL_SSLv23)\n            if hasattr(ssl, 'OP_NO_SSLv2'):\n                context.options |= ssl.OP_NO_SSLv2\n            if getattr(self, 'cert_file', None):\n                context.load_cert_chain(self.cert_file, self.key_file)\n            kwargs = {}\n            if self.ca_certs:\n                context.verify_mode = ssl.CERT_REQUIRED\n                context.load_verify_locations(cafile=self.ca_certs)\n                if getattr(ssl, 'HAS_SNI', False):\n                    kwargs['server_hostname'] = self.host\n\n            self.sock = context.wrap_socket(sock, **kwargs)\n            if self.ca_certs and self.check_domain:\n                try:\n                    match_hostname(self.sock.getpeercert(), self.host)\n                    logger.debug('Host verified: %s', self.host)\n                except CertificateError:  # pragma: no cover\n                    self.sock.shutdown(socket.SHUT_RDWR)\n                    self.sock.close()\n                    raise\n\n    class HTTPSHandler(BaseHTTPSHandler):\n\n        def __init__(self, ca_certs, check_domain=True):\n            BaseHTTPSHandler.__init__(self)\n            self.ca_certs = ca_certs\n            self.check_domain = check_domain\n\n        def _conn_maker(self, *args, **kwargs):\n            \"\"\"\n            This is called to create a connection instance. Normally you'd\n            pass a connection class to do_open, but it doesn't actually check for\n            a class, and just expects a callable. As long as we behave just as a\n            constructor would have, we should be OK. If it ever changes so that\n            we *must* pass a class, we'll create an UnsafeHTTPSConnection class\n            which just sets check_domain to False in the class definition, and\n            choose which one to pass to do_open.\n            \"\"\"\n            result = HTTPSConnection(*args, **kwargs)\n            if self.ca_certs:\n                result.ca_certs = self.ca_certs\n                result.check_domain = self.check_domain\n            return result\n\n        def https_open(self, req):\n            try:\n                return self.do_open(self._conn_maker, req)\n            except URLError as e:\n                if 'certificate verify failed' in str(e.reason):\n                    raise CertificateError('Unable to verify server certificate '\n                                           'for %s' % req.host)\n                else:\n                    raise\n\n    #\n    # To prevent against mixing HTTP traffic with HTTPS (examples: A Man-In-The-\n    # Middle proxy using HTTP listens on port 443, or an index mistakenly serves\n    # HTML containing a http://xyz link when it should be https://xyz),\n    # you can use the following handler class, which does not allow HTTP traffic.\n    #\n    # It works by inheriting from HTTPHandler - so build_opener won't add a\n    # handler for HTTP itself.\n    #\n    class HTTPSOnlyHandler(HTTPSHandler, HTTPHandler):\n\n        def http_open(self, req):\n            raise URLError('Unexpected HTTP request on what should be a secure '\n                           'connection: %s' % req)\n\n\n#\n# XML-RPC with timeouts\n#\nclass Transport(xmlrpclib.Transport):\n\n    def __init__(self, timeout, use_datetime=0):\n        self.timeout = timeout\n        xmlrpclib.Transport.__init__(self, use_datetime)\n\n    def make_connection(self, host):\n        h, eh, x509 = self.get_host_info(host)\n        if not self._connection or host != self._connection[0]:\n            self._extra_headers = eh\n            self._connection = host, httplib.HTTPConnection(h)\n        return self._connection[1]\n\n\nif ssl:\n\n    class SafeTransport(xmlrpclib.SafeTransport):\n\n        def __init__(self, timeout, use_datetime=0):\n            self.timeout = timeout\n            xmlrpclib.SafeTransport.__init__(self, use_datetime)\n\n        def make_connection(self, host):\n            h, eh, kwargs = self.get_host_info(host)\n            if not kwargs:\n                kwargs = {}\n            kwargs['timeout'] = self.timeout\n            if not self._connection or host != self._connection[0]:\n                self._extra_headers = eh\n                self._connection = host, httplib.HTTPSConnection(h, None, **kwargs)\n            return self._connection[1]\n\n\nclass ServerProxy(xmlrpclib.ServerProxy):\n\n    def __init__(self, uri, **kwargs):\n        self.timeout = timeout = kwargs.pop('timeout', None)\n        # The above classes only come into play if a timeout\n        # is specified\n        if timeout is not None:\n            # scheme = splittype(uri)  # deprecated as of Python 3.8\n            scheme = urlparse(uri)[0]\n            use_datetime = kwargs.get('use_datetime', 0)\n            if scheme == 'https':\n                tcls = SafeTransport\n            else:\n                tcls = Transport\n            kwargs['transport'] = t = tcls(timeout, use_datetime=use_datetime)\n            self.transport = t\n        xmlrpclib.ServerProxy.__init__(self, uri, **kwargs)\n\n\n#\n# CSV functionality. This is provided because on 2.x, the csv module can't\n# handle Unicode. However, we need to deal with Unicode in e.g. RECORD files.\n#\n\n\ndef _csv_open(fn, mode, **kwargs):\n    if sys.version_info[0] < 3:\n        mode += 'b'\n    else:\n        kwargs['newline'] = ''\n        # Python 3 determines encoding from locale. Force 'utf-8'\n        # file encoding to match other forced utf-8 encoding\n        kwargs['encoding'] = 'utf-8'\n    return open(fn, mode, **kwargs)\n\n\nclass CSVBase(object):\n    defaults = {\n        'delimiter': str(','),  # The strs are used because we need native\n        'quotechar': str('\"'),  # str in the csv API (2.x won't take\n        'lineterminator': str('\\n')  # Unicode)\n    }\n\n    def __enter__(self):\n        return self\n\n    def __exit__(self, *exc_info):\n        self.stream.close()\n\n\nclass CSVReader(CSVBase):\n\n    def __init__(self, **kwargs):\n        if 'stream' in kwargs:\n            stream = kwargs['stream']\n            if sys.version_info[0] >= 3:\n                # needs to be a text stream\n                stream = codecs.getreader('utf-8')(stream)\n            self.stream = stream\n        else:\n            self.stream = _csv_open(kwargs['path'], 'r')\n        self.reader = csv.reader(self.stream, **self.defaults)\n\n    def __iter__(self):\n        return self\n\n    def next(self):\n        result = next(self.reader)\n        if sys.version_info[0] < 3:\n            for i, item in enumerate(result):\n                if not isinstance(item, text_type):\n                    result[i] = item.decode('utf-8')\n        return result\n\n    __next__ = next\n\n\nclass CSVWriter(CSVBase):\n\n    def __init__(self, fn, **kwargs):\n        self.stream = _csv_open(fn, 'w')\n        self.writer = csv.writer(self.stream, **self.defaults)\n\n    def writerow(self, row):\n        if sys.version_info[0] < 3:\n            r = []\n            for item in row:\n                if isinstance(item, text_type):\n                    item = item.encode('utf-8')\n                r.append(item)\n            row = r\n        self.writer.writerow(row)\n\n\n#\n#   Configurator functionality\n#\n\n\nclass Configurator(BaseConfigurator):\n\n    value_converters = dict(BaseConfigurator.value_converters)\n    value_converters['inc'] = 'inc_convert'\n\n    def __init__(self, config, base=None):\n        super(Configurator, self).__init__(config)\n        self.base = base or os.getcwd()\n\n    def configure_custom(self, config):\n\n        def convert(o):\n            if isinstance(o, (list, tuple)):\n                result = type(o)([convert(i) for i in o])\n            elif isinstance(o, dict):\n                if '()' in o:\n                    result = self.configure_custom(o)\n                else:\n                    result = {}\n                    for k in o:\n                        result[k] = convert(o[k])\n            else:\n                result = self.convert(o)\n            return result\n\n        c = config.pop('()')\n        if not callable(c):\n            c = self.resolve(c)\n        props = config.pop('.', None)\n        # Check for valid identifiers\n        args = config.pop('[]', ())\n        if args:\n            args = tuple([convert(o) for o in args])\n        items = [(k, convert(config[k])) for k in config if valid_ident(k)]\n        kwargs = dict(items)\n        result = c(*args, **kwargs)\n        if props:\n            for n, v in props.items():\n                setattr(result, n, convert(v))\n        return result\n\n    def __getitem__(self, key):\n        result = self.config[key]\n        if isinstance(result, dict) and '()' in result:\n            self.config[key] = result = self.configure_custom(result)\n        return result\n\n    def inc_convert(self, value):\n        \"\"\"Default converter for the inc:// protocol.\"\"\"\n        if not os.path.isabs(value):\n            value = os.path.join(self.base, value)\n        with codecs.open(value, 'r', encoding='utf-8') as f:\n            result = json.load(f)\n        return result\n\n\nclass SubprocessMixin(object):\n    \"\"\"\n    Mixin for running subprocesses and capturing their output\n    \"\"\"\n\n    def __init__(self, verbose=False, progress=None):\n        self.verbose = verbose\n        self.progress = progress\n\n    def reader(self, stream, context):\n        \"\"\"\n        Read lines from a subprocess' output stream and either pass to a progress\n        callable (if specified) or write progress information to sys.stderr.\n        \"\"\"\n        progress = self.progress\n        verbose = self.verbose\n        while True:\n            s = stream.readline()\n            if not s:\n                break\n            if progress is not None:\n                progress(s, context)\n            else:\n                if not verbose:\n                    sys.stderr.write('.')\n                else:\n                    sys.stderr.write(s.decode('utf-8'))\n                sys.stderr.flush()\n        stream.close()\n\n    def run_command(self, cmd, **kwargs):\n        p = subprocess.Popen(cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, **kwargs)\n        t1 = threading.Thread(target=self.reader, args=(p.stdout, 'stdout'))\n        t1.start()\n        t2 = threading.Thread(target=self.reader, args=(p.stderr, 'stderr'))\n        t2.start()\n        p.wait()\n        t1.join()\n        t2.join()\n        if self.progress is not None:\n            self.progress('done.', 'main')\n        elif self.verbose:\n            sys.stderr.write('done.\\n')\n        return p\n\n\ndef normalize_name(name):\n    \"\"\"Normalize a python package name a la PEP 503\"\"\"\n    # https://www.python.org/dev/peps/pep-0503/#normalized-names\n    return re.sub('[-_.]+', '-', name).lower()\n\n\n# def _get_pypirc_command():\n# \"\"\"\n# Get the distutils command for interacting with PyPI configurations.\n# :return: the command.\n# \"\"\"\n# from distutils.core import Distribution\n# from distutils.config import PyPIRCCommand\n# d = Distribution()\n# return PyPIRCCommand(d)\n\n\nclass PyPIRCFile(object):\n\n    DEFAULT_REPOSITORY = 'https://upload.pypi.org/legacy/'\n    DEFAULT_REALM = 'pypi'\n\n    def __init__(self, fn=None, url=None):\n        if fn is None:\n            fn = os.path.join(os.path.expanduser('~'), '.pypirc')\n        self.filename = fn\n        self.url = url\n\n    def read(self):\n        result = {}\n\n        if os.path.exists(self.filename):\n            repository = self.url or self.DEFAULT_REPOSITORY\n\n            config = configparser.RawConfigParser()\n            config.read(self.filename)\n            sections = config.sections()\n            if 'distutils' in sections:\n                # let's get the list of servers\n                index_servers = config.get('distutils', 'index-servers')\n                _servers = [server.strip() for server in index_servers.split('\\n') if server.strip() != '']\n                if _servers == []:\n                    # nothing set, let's try to get the default pypi\n                    if 'pypi' in sections:\n                        _servers = ['pypi']\n                else:\n                    for server in _servers:\n                        result = {'server': server}\n                        result['username'] = config.get(server, 'username')\n\n                        # optional params\n                        for key, default in (('repository', self.DEFAULT_REPOSITORY), ('realm', self.DEFAULT_REALM),\n                                             ('password', None)):\n                            if config.has_option(server, key):\n                                result[key] = config.get(server, key)\n                            else:\n                                result[key] = default\n\n                        # work around people having \"repository\" for the \"pypi\"\n                        # section of their config set to the HTTP (rather than\n                        # HTTPS) URL\n                        if (server == 'pypi' and repository in (self.DEFAULT_REPOSITORY, 'pypi')):\n                            result['repository'] = self.DEFAULT_REPOSITORY\n                        elif (result['server'] != repository and result['repository'] != repository):\n                            result = {}\n            elif 'server-login' in sections:\n                # old format\n                server = 'server-login'\n                if config.has_option(server, 'repository'):\n                    repository = config.get(server, 'repository')\n                else:\n                    repository = self.DEFAULT_REPOSITORY\n                result = {\n                    'username': config.get(server, 'username'),\n                    'password': config.get(server, 'password'),\n                    'repository': repository,\n                    'server': server,\n                    'realm': self.DEFAULT_REALM\n                }\n        return result\n\n    def update(self, username, password):\n        # import pdb; pdb.set_trace()\n        config = configparser.RawConfigParser()\n        fn = self.filename\n        config.read(fn)\n        if not config.has_section('pypi'):\n            config.add_section('pypi')\n        config.set('pypi', 'username', username)\n        config.set('pypi', 'password', password)\n        with open(fn, 'w') as f:\n            config.write(f)\n\n\ndef _load_pypirc(index):\n    \"\"\"\n    Read the PyPI access configuration as supported by distutils.\n    \"\"\"\n    return PyPIRCFile(url=index.url).read()\n\n\ndef _store_pypirc(index):\n    PyPIRCFile().update(index.username, index.password)\n\n\n#\n# get_platform()/get_host_platform() copied from Python 3.10.a0 source, with some minor\n# tweaks\n#\n\n\ndef get_host_platform():\n    \"\"\"Return a string that identifies the current platform.  This is used mainly to\n    distinguish platform-specific build directories and platform-specific built\n    distributions.  Typically includes the OS name and version and the\n    architecture (as supplied by 'os.uname()'), although the exact information\n    included depends on the OS; eg. on Linux, the kernel version isn't\n    particularly important.\n\n    Examples of returned values:\n       linux-i586\n       linux-alpha (?)\n       solaris-2.6-sun4u\n\n    Windows will return one of:\n       win-amd64 (64bit Windows on AMD64 (aka x86_64, Intel64, EM64T, etc)\n       win32 (all others - specifically, sys.platform is returned)\n\n    For other non-POSIX platforms, currently just returns 'sys.platform'.\n\n    \"\"\"\n    if os.name == 'nt':\n        if 'amd64' in sys.version.lower():\n            return 'win-amd64'\n        if '(arm)' in sys.version.lower():\n            return 'win-arm32'\n        if '(arm64)' in sys.version.lower():\n            return 'win-arm64'\n        return sys.platform\n\n    # Set for cross builds explicitly\n    if \"_PYTHON_HOST_PLATFORM\" in os.environ:\n        return os.environ[\"_PYTHON_HOST_PLATFORM\"]\n\n    if os.name != 'posix' or not hasattr(os, 'uname'):\n        # XXX what about the architecture? NT is Intel or Alpha,\n        # Mac OS is M68k or PPC, etc.\n        return sys.platform\n\n    # Try to distinguish various flavours of Unix\n\n    (osname, host, release, version, machine) = os.uname()\n\n    # Convert the OS name to lowercase, remove '/' characters, and translate\n    # spaces (for \"Power Macintosh\")\n    osname = osname.lower().replace('/', '')\n    machine = machine.replace(' ', '_').replace('/', '-')\n\n    if osname[:5] == 'linux':\n        # At least on Linux/Intel, 'machine' is the processor --\n        # i386, etc.\n        # XXX what about Alpha, SPARC, etc?\n        return \"%s-%s\" % (osname, machine)\n\n    elif osname[:5] == 'sunos':\n        if release[0] >= '5':  # SunOS 5 == Solaris 2\n            osname = 'solaris'\n            release = '%d.%s' % (int(release[0]) - 3, release[2:])\n            # We can't use 'platform.architecture()[0]' because a\n            # bootstrap problem. We use a dict to get an error\n            # if some suspicious happens.\n            bitness = {2147483647: '32bit', 9223372036854775807: '64bit'}\n            machine += '.%s' % bitness[sys.maxsize]\n        # fall through to standard osname-release-machine representation\n    elif osname[:3] == 'aix':\n        from _aix_support import aix_platform\n        return aix_platform()\n    elif osname[:6] == 'cygwin':\n        osname = 'cygwin'\n        rel_re = re.compile(r'[\\d.]+', re.ASCII)\n        m = rel_re.match(release)\n        if m:\n            release = m.group()\n    elif osname[:6] == 'darwin':\n        import _osx_support\n        try:\n            from distutils import sysconfig\n        except ImportError:\n            import sysconfig\n        osname, release, machine = _osx_support.get_platform_osx(sysconfig.get_config_vars(), osname, release, machine)\n\n    return '%s-%s-%s' % (osname, release, machine)\n\n\n_TARGET_TO_PLAT = {\n    'x86': 'win32',\n    'x64': 'win-amd64',\n    'arm': 'win-arm32',\n}\n\n\ndef get_platform():\n    if os.name != 'nt':\n        return get_host_platform()\n    cross_compilation_target = os.environ.get('VSCMD_ARG_TGT_ARCH')\n    if cross_compilation_target not in _TARGET_TO_PLAT:\n        return get_host_platform()\n    return _TARGET_TO_PLAT[cross_compilation_target]\n",[],[216,809,810,811,890,891,1958,1461],"0984a3d2-67fc-11f0-aedf-0224a6c84d84","scripts.py","0984a49a-67fc-11f0-aedf-0224a6c84d84",342,["D",1753299263753],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom io import BytesIO\nimport logging\nimport os\nimport re\nimport struct\nimport sys\nimport time\nfrom zipfile import ZipInfo\n\nfrom .compat import sysconfig, detect_encoding, ZipFile\nfrom .resources import finder\nfrom .util import (FileOperator, get_export_entry, convert_path, get_executable, get_platform, in_venv)\n\nlogger = logging.getLogger(__name__)\n\n_DEFAULT_MANIFEST = '''\n\n\n \n\n \n \n \n \n \n \n \n \n'''.strip()\n\n# check if Python is called on the first line with this expression\nFIRST_LINE_RE = re.compile(b'^#!.*pythonw?[0-9.]*([ \\t].*)?$')\nSCRIPT_TEMPLATE = r'''# -*- coding: utf-8 -*-\nimport re\nimport sys\nfrom %(module)s import %(import_name)s\nif __name__ == '__main__':\n    sys.argv[0] = re.sub(r'(-script\\.pyw|\\.exe)?$', '', sys.argv[0])\n    sys.exit(%(func)s())\n'''\n\n# Pre-fetch the contents of all executable wrapper stubs.\n# This is to address https://github.com/pypa/pip/issues/12666.\n# When updating pip, we rename the old pip in place before installing the\n# new version. If we try to fetch a wrapper *after* that rename, the finder\n# machinery will be confused as the package is no longer available at the\n# location where it was imported from. So we load everything into memory in\n# advance.\n\nif os.name == 'nt' or (os.name == 'java' and os._name == 'nt'):\n    # Issue 31: don't hardcode an absolute package name, but\n    # determine it relative to the current package\n    DISTLIB_PACKAGE = __name__.rsplit('.', 1)[0]\n\n    WRAPPERS = {\n        r.name: r.bytes\n        for r in finder(DISTLIB_PACKAGE).iterator(\"\")\n        if r.name.endswith(\".exe\")\n    }\n\n\ndef enquote_executable(executable):\n    if ' ' in executable:\n        # make sure we quote only the executable in case of env\n        # for example /usr/bin/env \"/dir with spaces/bin/jython\"\n        # instead of \"/usr/bin/env /dir with spaces/bin/jython\"\n        # otherwise whole\n        if executable.startswith('/usr/bin/env '):\n            env, _executable = executable.split(' ', 1)\n            if ' ' in _executable and not _executable.startswith('\"'):\n                executable = '%s \"%s\"' % (env, _executable)\n        else:\n            if not executable.startswith('\"'):\n                executable = '\"%s\"' % executable\n    return executable\n\n\n# Keep the old name around (for now), as there is at least one project using it!\n_enquote_executable = enquote_executable\n\n\nclass ScriptMaker(object):\n    \"\"\"\n    A class to copy or create scripts from source scripts or callable\n    specifications.\n    \"\"\"\n    script_template = SCRIPT_TEMPLATE\n\n    executable = None  # for shebangs\n\n    def __init__(self, source_dir, target_dir, add_launchers=True, dry_run=False, fileop=None):\n        self.source_dir = source_dir\n        self.target_dir = target_dir\n        self.add_launchers = add_launchers\n        self.force = False\n        self.clobber = False\n        # It only makes sense to set mode bits on POSIX.\n        self.set_mode = (os.name == 'posix') or (os.name == 'java' and os._name == 'posix')\n        self.variants = set(('', 'X.Y'))\n        self._fileop = fileop or FileOperator(dry_run)\n\n        self._is_nt = os.name == 'nt' or (os.name == 'java' and os._name == 'nt')\n        self.version_info = sys.version_info\n\n    def _get_alternate_executable(self, executable, options):\n        if options.get('gui', False) and self._is_nt:  # pragma: no cover\n            dn, fn = os.path.split(executable)\n            fn = fn.replace('python', 'pythonw')\n            executable = os.path.join(dn, fn)\n        return executable\n\n    if sys.platform.startswith('java'):  # pragma: no cover\n\n        def _is_shell(self, executable):\n            \"\"\"\n            Determine if the specified executable is a script\n            (contains a #! line)\n            \"\"\"\n            try:\n                with open(executable) as fp:\n                    return fp.read(2) == '#!'\n            except (OSError, IOError):\n                logger.warning('Failed to open %s', executable)\n                return False\n\n        def _fix_jython_executable(self, executable):\n            if self._is_shell(executable):\n                # Workaround for Jython is not needed on Linux systems.\n                import java\n\n                if java.lang.System.getProperty('os.name') == 'Linux':\n                    return executable\n            elif executable.lower().endswith('jython.exe'):\n                # Use wrapper exe for Jython on Windows\n                return executable\n            return '/usr/bin/env %s' % executable\n\n    def _build_shebang(self, executable, post_interp):\n        \"\"\"\n        Build a shebang line. In the simple case (on Windows, or a shebang line\n        which is not too long or contains spaces) use a simple formulation for\n        the shebang. Otherwise, use /bin/sh as the executable, with a contrived\n        shebang which allows the script to run either under Python or sh, using\n        suitable quoting. Thanks to Harald Nordgren for his input.\n\n        See also: http://www.in-ulm.de/~mascheck/various/shebang/#length\n                  https://hg.mozilla.org/mozilla-central/file/tip/mach\n        \"\"\"\n        if os.name != 'posix':\n            simple_shebang = True\n        elif getattr(sys, \"cross_compiling\", False):\n            # In a cross-compiling environment, the shebang will likely be a\n            # script; this *must* be invoked with the \"safe\" version of the\n            # shebang, or else using os.exec() to run the entry script will\n            # fail, raising \"OSError 8 [Errno 8] Exec format error\".\n            simple_shebang = False\n        else:\n            # Add 3 for '#!' prefix and newline suffix.\n            shebang_length = len(executable) + len(post_interp) + 3\n            if sys.platform == 'darwin':\n                max_shebang_length = 512\n            else:\n                max_shebang_length = 127\n            simple_shebang = ((b' ' not in executable) and (shebang_length <= max_shebang_length))\n\n        if simple_shebang:\n            result = b'#!' + executable + post_interp + b'\\n'\n        else:\n            result = b'#!/bin/sh\\n'\n            result += b\"'''exec' \" + executable + post_interp + b' \"$0\" \"$@\"\\n'\n            result += b\"' '''\\n\"\n        return result\n\n    def _get_shebang(self, encoding, post_interp=b'', options=None):\n        enquote = True\n        if self.executable:\n            executable = self.executable\n            enquote = False  # assume this will be taken care of\n        elif not sysconfig.is_python_build():\n            executable = get_executable()\n        elif in_venv():  # pragma: no cover\n            executable = os.path.join(sysconfig.get_path('scripts'), 'python%s' % sysconfig.get_config_var('EXE'))\n        else:  # pragma: no cover\n            if os.name == 'nt':\n                # for Python builds from source on Windows, no Python executables with\n                # a version suffix are created, so we use python.exe\n                executable = os.path.join(sysconfig.get_config_var('BINDIR'),\n                                          'python%s' % (sysconfig.get_config_var('EXE')))\n            else:\n                executable = os.path.join(\n                    sysconfig.get_config_var('BINDIR'),\n                    'python%s%s' % (sysconfig.get_config_var('VERSION'), sysconfig.get_config_var('EXE')))\n        if options:\n            executable = self._get_alternate_executable(executable, options)\n\n        if sys.platform.startswith('java'):  # pragma: no cover\n            executable = self._fix_jython_executable(executable)\n\n        # Normalise case for Windows - COMMENTED OUT\n        # executable = os.path.normcase(executable)\n        # N.B. The normalising operation above has been commented out: See\n        # issue #124. Although paths in Windows are generally case-insensitive,\n        # they aren't always. For example, a path containing a ẞ (which is a\n        # LATIN CAPITAL LETTER SHARP S - U+1E9E) is normcased to ß (which is a\n        # LATIN SMALL LETTER SHARP S' - U+00DF). The two are not considered by\n        # Windows as equivalent in path names.\n\n        # If the user didn't specify an executable, it may be necessary to\n        # cater for executable paths with spaces (not uncommon on Windows)\n        if enquote:\n            executable = enquote_executable(executable)\n        # Issue #51: don't use fsencode, since we later try to\n        # check that the shebang is decodable using utf-8.\n        executable = executable.encode('utf-8')\n        # in case of IronPython, play safe and enable frames support\n        if (sys.platform == 'cli' and '-X:Frames' not in post_interp and\n                '-X:FullFrames' not in post_interp):  # pragma: no cover\n            post_interp += b' -X:Frames'\n        shebang = self._build_shebang(executable, post_interp)\n        # Python parser starts to read a script using UTF-8 until\n        # it gets a #coding:xxx cookie. The shebang has to be the\n        # first line of a file, the #coding:xxx cookie cannot be\n        # written before. So the shebang has to be decodable from\n        # UTF-8.\n        try:\n            shebang.decode('utf-8')\n        except UnicodeDecodeError:  # pragma: no cover\n            raise ValueError('The shebang (%r) is not decodable from utf-8' % shebang)\n        # If the script is encoded to a custom encoding (use a\n        # #coding:xxx cookie), the shebang has to be decodable from\n        # the script encoding too.\n        if encoding != 'utf-8':\n            try:\n                shebang.decode(encoding)\n            except UnicodeDecodeError:  # pragma: no cover\n                raise ValueError('The shebang (%r) is not decodable '\n                                 'from the script encoding (%r)' % (shebang, encoding))\n        return shebang\n\n    def _get_script_text(self, entry):\n        return self.script_template % dict(\n            module=entry.prefix, import_name=entry.suffix.split('.')[0], func=entry.suffix)\n\n    manifest = _DEFAULT_MANIFEST\n\n    def get_manifest(self, exename):\n        base = os.path.basename(exename)\n        return self.manifest % base\n\n    def _write_script(self, names, shebang, script_bytes, filenames, ext):\n        use_launcher = self.add_launchers and self._is_nt\n        if not use_launcher:\n            script_bytes = shebang + script_bytes\n        else:  # pragma: no cover\n            if ext == 'py':\n                launcher = self._get_launcher('t')\n            else:\n                launcher = self._get_launcher('w')\n            stream = BytesIO()\n            with ZipFile(stream, 'w') as zf:\n                source_date_epoch = os.environ.get('SOURCE_DATE_EPOCH')\n                if source_date_epoch:\n                    date_time = time.gmtime(int(source_date_epoch))[:6]\n                    zinfo = ZipInfo(filename='__main__.py', date_time=date_time)\n                    zf.writestr(zinfo, script_bytes)\n                else:\n                    zf.writestr('__main__.py', script_bytes)\n            zip_data = stream.getvalue()\n            script_bytes = launcher + shebang + zip_data\n        for name in names:\n            outname = os.path.join(self.target_dir, name)\n            if use_launcher:  # pragma: no cover\n                n, e = os.path.splitext(outname)\n                if e.startswith('.py'):\n                    outname = n\n                outname = '%s.exe' % outname\n                try:\n                    self._fileop.write_binary_file(outname, script_bytes)\n                except Exception:\n                    # Failed writing an executable - it might be in use.\n                    logger.warning('Failed to write executable - trying to '\n                                   'use .deleteme logic')\n                    dfname = '%s.deleteme' % outname\n                    if os.path.exists(dfname):\n                        os.remove(dfname)  # Not allowed to fail here\n                    os.rename(outname, dfname)  # nor here\n                    self._fileop.write_binary_file(outname, script_bytes)\n                    logger.debug('Able to replace executable using '\n                                 '.deleteme logic')\n                    try:\n                        os.remove(dfname)\n                    except Exception:\n                        pass  # still in use - ignore error\n            else:\n                if self._is_nt and not outname.endswith('.' + ext):  # pragma: no cover\n                    outname = '%s.%s' % (outname, ext)\n                if os.path.exists(outname) and not self.clobber:\n                    logger.warning('Skipping existing file %s', outname)\n                    continue\n                self._fileop.write_binary_file(outname, script_bytes)\n                if self.set_mode:\n                    self._fileop.set_executable_mode([outname])\n            filenames.append(outname)\n\n    variant_separator = '-'\n\n    def get_script_filenames(self, name):\n        result = set()\n        if '' in self.variants:\n            result.add(name)\n        if 'X' in self.variants:\n            result.add('%s%s' % (name, self.version_info[0]))\n        if 'X.Y' in self.variants:\n            result.add('%s%s%s.%s' % (name, self.variant_separator, self.version_info[0], self.version_info[1]))\n        return result\n\n    def _make_script(self, entry, filenames, options=None):\n        post_interp = b''\n        if options:\n            args = options.get('interpreter_args', [])\n            if args:\n                args = ' %s' % ' '.join(args)\n                post_interp = args.encode('utf-8')\n        shebang = self._get_shebang('utf-8', post_interp, options=options)\n        script = self._get_script_text(entry).encode('utf-8')\n        scriptnames = self.get_script_filenames(entry.name)\n        if options and options.get('gui', False):\n            ext = 'pyw'\n        else:\n            ext = 'py'\n        self._write_script(scriptnames, shebang, script, filenames, ext)\n\n    def _copy_script(self, script, filenames):\n        adjust = False\n        script = os.path.join(self.source_dir, convert_path(script))\n        outname = os.path.join(self.target_dir, os.path.basename(script))\n        if not self.force and not self._fileop.newer(script, outname):\n            logger.debug('not copying %s (up-to-date)', script)\n            return\n\n        # Always open the file, but ignore failures in dry-run mode --\n        # that way, we'll get accurate feedback if we can read the\n        # script.\n        try:\n            f = open(script, 'rb')\n        except IOError:  # pragma: no cover\n            if not self.dry_run:\n                raise\n            f = None\n        else:\n            first_line = f.readline()\n            if not first_line:  # pragma: no cover\n                logger.warning('%s is an empty file (skipping)', script)\n                return\n\n            match = FIRST_LINE_RE.match(first_line.replace(b'\\r\\n', b'\\n'))\n            if match:\n                adjust = True\n                post_interp = match.group(1) or b''\n\n        if not adjust:\n            if f:\n                f.close()\n            self._fileop.copy_file(script, outname)\n            if self.set_mode:\n                self._fileop.set_executable_mode([outname])\n            filenames.append(outname)\n        else:\n            logger.info('copying and adjusting %s -> %s', script, self.target_dir)\n            if not self._fileop.dry_run:\n                encoding, lines = detect_encoding(f.readline)\n                f.seek(0)\n                shebang = self._get_shebang(encoding, post_interp)\n                if b'pythonw' in first_line:  # pragma: no cover\n                    ext = 'pyw'\n                else:\n                    ext = 'py'\n                n = os.path.basename(outname)\n                self._write_script([n], shebang, f.read(), filenames, ext)\n            if f:\n                f.close()\n\n    @property\n    def dry_run(self):\n        return self._fileop.dry_run\n\n    @dry_run.setter\n    def dry_run(self, value):\n        self._fileop.dry_run = value\n\n    if os.name == 'nt' or (os.name == 'java' and os._name == 'nt'):  # pragma: no cover\n        # Executable launcher support.\n        # Launchers are from https://bitbucket.org/vinay.sajip/simple_launcher/\n\n        def _get_launcher(self, kind):\n            if struct.calcsize('P') == 8:  # 64-bit\n                bits = '64'\n            else:\n                bits = '32'\n            platform_suffix = '-arm' if get_platform() == 'win-arm64' else ''\n            name = '%s%s%s.exe' % (kind, bits, platform_suffix)\n            if name not in WRAPPERS:\n                msg = ('Unable to find resource %s in package %s' %\n                       (name, DISTLIB_PACKAGE))\n                raise ValueError(msg)\n            return WRAPPERS[name]\n\n    # Public API follows\n\n    def make(self, specification, options=None):\n        \"\"\"\n        Make a script.\n\n        :param specification: The specification, which is either a valid export\n                              entry specification (to make a script from a\n                              callable) or a filename (to make a script by\n                              copying from a source location).\n        :param options: A dictionary of options controlling script generation.\n        :return: A list of all absolute pathnames written to.\n        \"\"\"\n        filenames = []\n        entry = get_export_entry(specification)\n        if entry is None:\n            self._copy_script(specification, filenames)\n        else:\n            self._make_script(entry, filenames, options=options)\n        return filenames\n\n    def make_multiple(self, specifications, options=None):\n        \"\"\"\n        Take a list of specifications and make scripts from them,\n        :param specifications: A list of specifications.\n        :return: A list of all absolute pathnames written to,\n        \"\"\"\n        filenames = []\n        for specification in specifications:\n            filenames.extend(self.make(specification, options))\n        return filenames\n",[],[216,809,810,811,890,891,1958,1974],"0980670e-67fc-11f0-bcbe-0224a6c84d84","resources.py","098067c2-67fc-11f0-bcbe-0224a6c84d84",341,["D",1753299263711],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2017 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom __future__ import unicode_literals\n\nimport bisect\nimport io\nimport logging\nimport os\nimport pkgutil\nimport sys\nimport types\nimport zipimport\n\nfrom . import DistlibException\nfrom .util import cached_property, get_cache_base, Cache\n\nlogger = logging.getLogger(__name__)\n\n\ncache = None    # created when needed\n\n\nclass ResourceCache(Cache):\n    def __init__(self, base=None):\n        if base is None:\n            # Use native string to avoid issues on 2.x: see Python #20140.\n            base = os.path.join(get_cache_base(), str('resource-cache'))\n        super(ResourceCache, self).__init__(base)\n\n    def is_stale(self, resource, path):\n        \"\"\"\n        Is the cache stale for the given resource?\n\n        :param resource: The :class:`Resource` being cached.\n        :param path: The path of the resource in the cache.\n        :return: True if the cache is stale.\n        \"\"\"\n        # Cache invalidation is a hard problem :-)\n        return True\n\n    def get(self, resource):\n        \"\"\"\n        Get a resource into the cache,\n\n        :param resource: A :class:`Resource` instance.\n        :return: The pathname of the resource in the cache.\n        \"\"\"\n        prefix, path = resource.finder.get_cache_info(resource)\n        if prefix is None:\n            result = path\n        else:\n            result = os.path.join(self.base, self.prefix_to_dir(prefix), path)\n            dirname = os.path.dirname(result)\n            if not os.path.isdir(dirname):\n                os.makedirs(dirname)\n            if not os.path.exists(result):\n                stale = True\n            else:\n                stale = self.is_stale(resource, path)\n            if stale:\n                # write the bytes of the resource to the cache location\n                with open(result, 'wb') as f:\n                    f.write(resource.bytes)\n        return result\n\n\nclass ResourceBase(object):\n    def __init__(self, finder, name):\n        self.finder = finder\n        self.name = name\n\n\nclass Resource(ResourceBase):\n    \"\"\"\n    A class representing an in-package resource, such as a data file. This is\n    not normally instantiated by user code, but rather by a\n    :class:`ResourceFinder` which manages the resource.\n    \"\"\"\n    is_container = False        # Backwards compatibility\n\n    def as_stream(self):\n        \"\"\"\n        Get the resource as a stream.\n\n        This is not a property to make it obvious that it returns a new stream\n        each time.\n        \"\"\"\n        return self.finder.get_stream(self)\n\n    @cached_property\n    def file_path(self):\n        global cache\n        if cache is None:\n            cache = ResourceCache()\n        return cache.get(self)\n\n    @cached_property\n    def bytes(self):\n        return self.finder.get_bytes(self)\n\n    @cached_property\n    def size(self):\n        return self.finder.get_size(self)\n\n\nclass ResourceContainer(ResourceBase):\n    is_container = True     # Backwards compatibility\n\n    @cached_property\n    def resources(self):\n        return self.finder.get_resources(self)\n\n\nclass ResourceFinder(object):\n    \"\"\"\n    Resource finder for file system resources.\n    \"\"\"\n\n    if sys.platform.startswith('java'):\n        skipped_extensions = ('.pyc', '.pyo', '.class')\n    else:\n        skipped_extensions = ('.pyc', '.pyo')\n\n    def __init__(self, module):\n        self.module = module\n        self.loader = getattr(module, '__loader__', None)\n        self.base = os.path.dirname(getattr(module, '__file__', ''))\n\n    def _adjust_path(self, path):\n        return os.path.realpath(path)\n\n    def _make_path(self, resource_name):\n        # Issue #50: need to preserve type of path on Python 2.x\n        # like os.path._get_sep\n        if isinstance(resource_name, bytes):    # should only happen on 2.x\n            sep = b'/'\n        else:\n            sep = '/'\n        parts = resource_name.split(sep)\n        parts.insert(0, self.base)\n        result = os.path.join(*parts)\n        return self._adjust_path(result)\n\n    def _find(self, path):\n        return os.path.exists(path)\n\n    def get_cache_info(self, resource):\n        return None, resource.path\n\n    def find(self, resource_name):\n        path = self._make_path(resource_name)\n        if not self._find(path):\n            result = None\n        else:\n            if self._is_directory(path):\n                result = ResourceContainer(self, resource_name)\n            else:\n                result = Resource(self, resource_name)\n            result.path = path\n        return result\n\n    def get_stream(self, resource):\n        return open(resource.path, 'rb')\n\n    def get_bytes(self, resource):\n        with open(resource.path, 'rb') as f:\n            return f.read()\n\n    def get_size(self, resource):\n        return os.path.getsize(resource.path)\n\n    def get_resources(self, resource):\n        def allowed(f):\n            return (f != '__pycache__' and not\n                    f.endswith(self.skipped_extensions))\n        return set([f for f in os.listdir(resource.path) if allowed(f)])\n\n    def is_container(self, resource):\n        return self._is_directory(resource.path)\n\n    _is_directory = staticmethod(os.path.isdir)\n\n    def iterator(self, resource_name):\n        resource = self.find(resource_name)\n        if resource is not None:\n            todo = [resource]\n            while todo:\n                resource = todo.pop(0)\n                yield resource\n                if resource.is_container:\n                    rname = resource.name\n                    for name in resource.resources:\n                        if not rname:\n                            new_name = name\n                        else:\n                            new_name = '/'.join([rname, name])\n                        child = self.find(new_name)\n                        if child.is_container:\n                            todo.append(child)\n                        else:\n                            yield child\n\n\nclass ZipResourceFinder(ResourceFinder):\n    \"\"\"\n    Resource finder for resources in .zip files.\n    \"\"\"\n    def __init__(self, module):\n        super(ZipResourceFinder, self).__init__(module)\n        archive = self.loader.archive\n        self.prefix_len = 1 + len(archive)\n        # PyPy doesn't have a _files attr on zipimporter, and you can't set one\n        if hasattr(self.loader, '_files'):\n            self._files = self.loader._files\n        else:\n            self._files = zipimport._zip_directory_cache[archive]\n        self.index = sorted(self._files)\n\n    def _adjust_path(self, path):\n        return path\n\n    def _find(self, path):\n        path = path[self.prefix_len:]\n        if path in self._files:\n            result = True\n        else:\n            if path and path[-1] != os.sep:\n                path = path + os.sep\n            i = bisect.bisect(self.index, path)\n            try:\n                result = self.index[i].startswith(path)\n            except IndexError:\n                result = False\n        if not result:\n            logger.debug('_find failed: %r %r', path, self.loader.prefix)\n        else:\n            logger.debug('_find worked: %r %r', path, self.loader.prefix)\n        return result\n\n    def get_cache_info(self, resource):\n        prefix = self.loader.archive\n        path = resource.path[1 + len(prefix):]\n        return prefix, path\n\n    def get_bytes(self, resource):\n        return self.loader.get_data(resource.path)\n\n    def get_stream(self, resource):\n        return io.BytesIO(self.get_bytes(resource))\n\n    def get_size(self, resource):\n        path = resource.path[self.prefix_len:]\n        return self._files[path][3]\n\n    def get_resources(self, resource):\n        path = resource.path[self.prefix_len:]\n        if path and path[-1] != os.sep:\n            path += os.sep\n        plen = len(path)\n        result = set()\n        i = bisect.bisect(self.index, path)\n        while i < len(self.index):\n            if not self.index[i].startswith(path):\n                break\n            s = self.index[i][plen:]\n            result.add(s.split(os.sep, 1)[0])   # only immediate children\n            i += 1\n        return result\n\n    def _is_directory(self, path):\n        path = path[self.prefix_len:]\n        if path and path[-1] != os.sep:\n            path += os.sep\n        i = bisect.bisect(self.index, path)\n        try:\n            result = self.index[i].startswith(path)\n        except IndexError:\n            result = False\n        return result\n\n\n_finder_registry = {\n    type(None): ResourceFinder,\n    zipimport.zipimporter: ZipResourceFinder\n}\n\ntry:\n    # In Python 3.6, _frozen_importlib -> _frozen_importlib_external\n    try:\n        import _frozen_importlib_external as _fi\n    except ImportError:\n        import _frozen_importlib as _fi\n    _finder_registry[_fi.SourceFileLoader] = ResourceFinder\n    _finder_registry[_fi.FileFinder] = ResourceFinder\n    # See issue #146\n    _finder_registry[_fi.SourcelessFileLoader] = ResourceFinder\n    del _fi\nexcept (ImportError, AttributeError):\n    pass\n\n\ndef register_finder(loader, finder_maker):\n    _finder_registry[type(loader)] = finder_maker\n\n\n_finder_cache = {}\n\n\ndef finder(package):\n    \"\"\"\n    Return a resource finder for a package.\n    :param package: The name of the package.\n    :return: A :class:`ResourceFinder` instance for the package.\n    \"\"\"\n    if package in _finder_cache:\n        result = _finder_cache[package]\n    else:\n        if package not in sys.modules:\n            __import__(package)\n        module = sys.modules[package]\n        path = getattr(module, '__path__', None)\n        if path is None:\n            raise DistlibException('You cannot get a finder for a module, '\n                                   'only for a package')\n        loader = getattr(module, '__loader__', None)\n        finder_maker = _finder_registry.get(type(loader))\n        if finder_maker is None:\n            raise DistlibException('Unable to locate finder for %r' % package)\n        result = finder_maker(module)\n        _finder_cache[package] = result\n    return result\n\n\n_dummy_module = types.ModuleType(str('__dummy__'))\n\n\ndef finder_for_path(path):\n    \"\"\"\n    Return a resource finder for a path, which should represent a container.\n\n    :param path: The path.\n    :return: A :class:`ResourceFinder` instance for the path.\n    \"\"\"\n    result = None\n    # calls any path hooks, gets importer into cache\n    pkgutil.get_importer(path)\n    loader = sys.path_importer_cache.get(path)\n    finder = _finder_registry.get(type(loader))\n    if finder:\n        module = _dummy_module\n        module.__file__ = os.path.join(path, '')\n        module.__loader__ = loader\n        result = finder(module)\n    return result\n",[],[216,809,810,811,890,891,1958,1982],"0962c398-67fc-11f0-bcbe-0224a6c84d84","0962c442-67fc-11f0-bcbe-0224a6c84d84",336,["D",1753299263209],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"Implementation of the Metadata for Python packages PEPs.\n\nSupports all metadata formats (1.0, 1.1, 1.2, 1.3/2.1 and 2.2).\n\"\"\"\nfrom __future__ import unicode_literals\n\nimport codecs\nfrom email import message_from_file\nimport json\nimport logging\nimport re\n\nfrom . import DistlibException, __version__\nfrom .compat import StringIO, string_types, text_type\nfrom .markers import interpret\nfrom .util import extract_by_key, get_extras\nfrom .version import get_scheme, PEP440_VERSION_RE\n\nlogger = logging.getLogger(__name__)\n\n\nclass MetadataMissingError(DistlibException):\n    \"\"\"A required metadata is missing\"\"\"\n\n\nclass MetadataConflictError(DistlibException):\n    \"\"\"Attempt to read or write metadata fields that are conflictual.\"\"\"\n\n\nclass MetadataUnrecognizedVersionError(DistlibException):\n    \"\"\"Unknown metadata version number.\"\"\"\n\n\nclass MetadataInvalidError(DistlibException):\n    \"\"\"A metadata value is invalid\"\"\"\n\n\n# public API of this module\n__all__ = ['Metadata', 'PKG_INFO_ENCODING', 'PKG_INFO_PREFERRED_VERSION']\n\n# Encoding used for the PKG-INFO files\nPKG_INFO_ENCODING = 'utf-8'\n\n# preferred version. Hopefully will be changed\n# to 1.2 once PEP 345 is supported everywhere\nPKG_INFO_PREFERRED_VERSION = '1.1'\n\n_LINE_PREFIX_1_2 = re.compile('\\n       \\\\|')\n_LINE_PREFIX_PRE_1_2 = re.compile('\\n        ')\n_241_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Summary', 'Description', 'Keywords', 'Home-page',\n               'Author', 'Author-email', 'License')\n\n_314_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n               'Keywords', 'Home-page', 'Author', 'Author-email', 'License', 'Classifier', 'Download-URL', 'Obsoletes',\n               'Provides', 'Requires')\n\n_314_MARKERS = ('Obsoletes', 'Provides', 'Requires', 'Classifier', 'Download-URL')\n\n_345_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n               'Keywords', 'Home-page', 'Author', 'Author-email', 'Maintainer', 'Maintainer-email', 'License',\n               'Classifier', 'Download-URL', 'Obsoletes-Dist', 'Project-URL', 'Provides-Dist', 'Requires-Dist',\n               'Requires-Python', 'Requires-External')\n\n_345_MARKERS = ('Provides-Dist', 'Requires-Dist', 'Requires-Python', 'Obsoletes-Dist', 'Requires-External',\n                'Maintainer', 'Maintainer-email', 'Project-URL')\n\n_426_FIELDS = ('Metadata-Version', 'Name', 'Version', 'Platform', 'Supported-Platform', 'Summary', 'Description',\n               'Keywords', 'Home-page', 'Author', 'Author-email', 'Maintainer', 'Maintainer-email', 'License',\n               'Classifier', 'Download-URL', 'Obsoletes-Dist', 'Project-URL', 'Provides-Dist', 'Requires-Dist',\n               'Requires-Python', 'Requires-External', 'Private-Version', 'Obsoleted-By', 'Setup-Requires-Dist',\n               'Extension', 'Provides-Extra')\n\n_426_MARKERS = ('Private-Version', 'Provides-Extra', 'Obsoleted-By', 'Setup-Requires-Dist', 'Extension')\n\n# See issue #106: Sometimes 'Requires' and 'Provides' occur wrongly in\n# the metadata. Include them in the tuple literal below to allow them\n# (for now).\n# Ditto for Obsoletes - see issue #140.\n_566_FIELDS = _426_FIELDS + ('Description-Content-Type', 'Requires', 'Provides', 'Obsoletes')\n\n_566_MARKERS = ('Description-Content-Type', )\n\n_643_MARKERS = ('Dynamic', 'License-File')\n\n_643_FIELDS = _566_FIELDS + _643_MARKERS\n\n_ALL_FIELDS = set()\n_ALL_FIELDS.update(_241_FIELDS)\n_ALL_FIELDS.update(_314_FIELDS)\n_ALL_FIELDS.update(_345_FIELDS)\n_ALL_FIELDS.update(_426_FIELDS)\n_ALL_FIELDS.update(_566_FIELDS)\n_ALL_FIELDS.update(_643_FIELDS)\n\nEXTRA_RE = re.compile(r'''extra\\s*==\\s*(\"([^\"]+)\"|'([^']+)')''')\n\n\ndef _version2fieldlist(version):\n    if version == '1.0':\n        return _241_FIELDS\n    elif version == '1.1':\n        return _314_FIELDS\n    elif version == '1.2':\n        return _345_FIELDS\n    elif version in ('1.3', '2.1'):\n        # avoid adding field names if already there\n        return _345_FIELDS + tuple(f for f in _566_FIELDS if f not in _345_FIELDS)\n    elif version == '2.0':\n        raise ValueError('Metadata 2.0 is withdrawn and not supported')\n        # return _426_FIELDS\n    elif version == '2.2':\n        return _643_FIELDS\n    raise MetadataUnrecognizedVersionError(version)\n\n\ndef _best_version(fields):\n    \"\"\"Detect the best version depending on the fields used.\"\"\"\n\n    def _has_marker(keys, markers):\n        return any(marker in keys for marker in markers)\n\n    keys = [key for key, value in fields.items() if value not in ([], 'UNKNOWN', None)]\n    possible_versions = ['1.0', '1.1', '1.2', '1.3', '2.1', '2.2']  # 2.0 removed\n\n    # first let's try to see if a field is not part of one of the version\n    for key in keys:\n        if key not in _241_FIELDS and '1.0' in possible_versions:\n            possible_versions.remove('1.0')\n            logger.debug('Removed 1.0 due to %s', key)\n        if key not in _314_FIELDS and '1.1' in possible_versions:\n            possible_versions.remove('1.1')\n            logger.debug('Removed 1.1 due to %s', key)\n        if key not in _345_FIELDS and '1.2' in possible_versions:\n            possible_versions.remove('1.2')\n            logger.debug('Removed 1.2 due to %s', key)\n        if key not in _566_FIELDS and '1.3' in possible_versions:\n            possible_versions.remove('1.3')\n            logger.debug('Removed 1.3 due to %s', key)\n        if key not in _566_FIELDS and '2.1' in possible_versions:\n            if key != 'Description':  # In 2.1, description allowed after headers\n                possible_versions.remove('2.1')\n                logger.debug('Removed 2.1 due to %s', key)\n        if key not in _643_FIELDS and '2.2' in possible_versions:\n            possible_versions.remove('2.2')\n            logger.debug('Removed 2.2 due to %s', key)\n        # if key not in _426_FIELDS and '2.0' in possible_versions:\n        # possible_versions.remove('2.0')\n        # logger.debug('Removed 2.0 due to %s', key)\n\n    # possible_version contains qualified versions\n    if len(possible_versions) == 1:\n        return possible_versions[0]  # found !\n    elif len(possible_versions) == 0:\n        logger.debug('Out of options - unknown metadata set: %s', fields)\n        raise MetadataConflictError('Unknown metadata set')\n\n    # let's see if one unique marker is found\n    is_1_1 = '1.1' in possible_versions and _has_marker(keys, _314_MARKERS)\n    is_1_2 = '1.2' in possible_versions and _has_marker(keys, _345_MARKERS)\n    is_2_1 = '2.1' in possible_versions and _has_marker(keys, _566_MARKERS)\n    # is_2_0 = '2.0' in possible_versions and _has_marker(keys, _426_MARKERS)\n    is_2_2 = '2.2' in possible_versions and _has_marker(keys, _643_MARKERS)\n    if int(is_1_1) + int(is_1_2) + int(is_2_1) + int(is_2_2) > 1:\n        raise MetadataConflictError('You used incompatible 1.1/1.2/2.1/2.2 fields')\n\n    # we have the choice, 1.0, or 1.2, 2.1 or 2.2\n    #   - 1.0 has a broken Summary field but works with all tools\n    #   - 1.1 is to avoid\n    #   - 1.2 fixes Summary but has little adoption\n    #   - 2.1 adds more features\n    #   - 2.2 is the latest\n    if not is_1_1 and not is_1_2 and not is_2_1 and not is_2_2:\n        # we couldn't find any specific marker\n        if PKG_INFO_PREFERRED_VERSION in possible_versions:\n            return PKG_INFO_PREFERRED_VERSION\n    if is_1_1:\n        return '1.1'\n    if is_1_2:\n        return '1.2'\n    if is_2_1:\n        return '2.1'\n    # if is_2_2:\n    # return '2.2'\n\n    return '2.2'\n\n\n# This follows the rules about transforming keys as described in\n# https://www.python.org/dev/peps/pep-0566/#id17\n_ATTR2FIELD = {name.lower().replace(\"-\", \"_\"): name for name in _ALL_FIELDS}\n_FIELD2ATTR = {field: attr for attr, field in _ATTR2FIELD.items()}\n\n_PREDICATE_FIELDS = ('Requires-Dist', 'Obsoletes-Dist', 'Provides-Dist')\n_VERSIONS_FIELDS = ('Requires-Python', )\n_VERSION_FIELDS = ('Version', )\n_LISTFIELDS = ('Platform', 'Classifier', 'Obsoletes', 'Requires', 'Provides', 'Obsoletes-Dist', 'Provides-Dist',\n               'Requires-Dist', 'Requires-External', 'Project-URL', 'Supported-Platform', 'Setup-Requires-Dist',\n               'Provides-Extra', 'Extension', 'License-File')\n_LISTTUPLEFIELDS = ('Project-URL', )\n\n_ELEMENTSFIELD = ('Keywords', )\n\n_UNICODEFIELDS = ('Author', 'Maintainer', 'Summary', 'Description')\n\n_MISSING = object()\n\n_FILESAFE = re.compile('[^A-Za-z0-9.]+')\n\n\ndef _get_name_and_version(name, version, for_filename=False):\n    \"\"\"Return the distribution name with version.\n\n    If for_filename is true, return a filename-escaped form.\"\"\"\n    if for_filename:\n        # For both name and version any runs of non-alphanumeric or '.'\n        # characters are replaced with a single '-'.  Additionally any\n        # spaces in the version string become '.'\n        name = _FILESAFE.sub('-', name)\n        version = _FILESAFE.sub('-', version.replace(' ', '.'))\n    return '%s-%s' % (name, version)\n\n\nclass LegacyMetadata(object):\n    \"\"\"The legacy metadata of a release.\n\n    Supports versions 1.0, 1.1, 1.2, 2.0 and 1.3/2.1 (auto-detected). You can\n    instantiate the class with one of these arguments (or none):\n    - *path*, the path to a metadata file\n    - *fileobj* give a file-like object with metadata as content\n    - *mapping* is a dict-like object\n    - *scheme* is a version scheme name\n    \"\"\"\n\n    # TODO document the mapping API and UNKNOWN default key\n\n    def __init__(self, path=None, fileobj=None, mapping=None, scheme='default'):\n        if [path, fileobj, mapping].count(None) < 2:\n            raise TypeError('path, fileobj and mapping are exclusive')\n        self._fields = {}\n        self.requires_files = []\n        self._dependencies = None\n        self.scheme = scheme\n        if path is not None:\n            self.read(path)\n        elif fileobj is not None:\n            self.read_file(fileobj)\n        elif mapping is not None:\n            self.update(mapping)\n            self.set_metadata_version()\n\n    def set_metadata_version(self):\n        self._fields['Metadata-Version'] = _best_version(self._fields)\n\n    def _write_field(self, fileobj, name, value):\n        fileobj.write('%s: %s\\n' % (name, value))\n\n    def __getitem__(self, name):\n        return self.get(name)\n\n    def __setitem__(self, name, value):\n        return self.set(name, value)\n\n    def __delitem__(self, name):\n        field_name = self._convert_name(name)\n        try:\n            del self._fields[field_name]\n        except KeyError:\n            raise KeyError(name)\n\n    def __contains__(self, name):\n        return (name in self._fields or self._convert_name(name) in self._fields)\n\n    def _convert_name(self, name):\n        if name in _ALL_FIELDS:\n            return name\n        name = name.replace('-', '_').lower()\n        return _ATTR2FIELD.get(name, name)\n\n    def _default_value(self, name):\n        if name in _LISTFIELDS or name in _ELEMENTSFIELD:\n            return []\n        return 'UNKNOWN'\n\n    def _remove_line_prefix(self, value):\n        if self.metadata_version in ('1.0', '1.1'):\n            return _LINE_PREFIX_PRE_1_2.sub('\\n', value)\n        else:\n            return _LINE_PREFIX_1_2.sub('\\n', value)\n\n    def __getattr__(self, name):\n        if name in _ATTR2FIELD:\n            return self[name]\n        raise AttributeError(name)\n\n    #\n    # Public API\n    #\n\n    def get_fullname(self, filesafe=False):\n        \"\"\"\n        Return the distribution name with version.\n\n        If filesafe is true, return a filename-escaped form.\n        \"\"\"\n        return _get_name_and_version(self['Name'], self['Version'], filesafe)\n\n    def is_field(self, name):\n        \"\"\"return True if name is a valid metadata key\"\"\"\n        name = self._convert_name(name)\n        return name in _ALL_FIELDS\n\n    def is_multi_field(self, name):\n        name = self._convert_name(name)\n        return name in _LISTFIELDS\n\n    def read(self, filepath):\n        \"\"\"Read the metadata values from a file path.\"\"\"\n        fp = codecs.open(filepath, 'r', encoding='utf-8')\n        try:\n            self.read_file(fp)\n        finally:\n            fp.close()\n\n    def read_file(self, fileob):\n        \"\"\"Read the metadata values from a file object.\"\"\"\n        msg = message_from_file(fileob)\n        self._fields['Metadata-Version'] = msg['metadata-version']\n\n        # When reading, get all the fields we can\n        for field in _ALL_FIELDS:\n            if field not in msg:\n                continue\n            if field in _LISTFIELDS:\n                # we can have multiple lines\n                values = msg.get_all(field)\n                if field in _LISTTUPLEFIELDS and values is not None:\n                    values = [tuple(value.split(',')) for value in values]\n                self.set(field, values)\n            else:\n                # single line\n                value = msg[field]\n                if value is not None and value != 'UNKNOWN':\n                    self.set(field, value)\n\n        # PEP 566 specifies that the body be used for the description, if\n        # available\n        body = msg.get_payload()\n        self[\"Description\"] = body if body else self[\"Description\"]\n        # logger.debug('Attempting to set metadata for %s', self)\n        # self.set_metadata_version()\n\n    def write(self, filepath, skip_unknown=False):\n        \"\"\"Write the metadata fields to filepath.\"\"\"\n        fp = codecs.open(filepath, 'w', encoding='utf-8')\n        try:\n            self.write_file(fp, skip_unknown)\n        finally:\n            fp.close()\n\n    def write_file(self, fileobject, skip_unknown=False):\n        \"\"\"Write the PKG-INFO format data to a file object.\"\"\"\n        self.set_metadata_version()\n\n        for field in _version2fieldlist(self['Metadata-Version']):\n            values = self.get(field)\n            if skip_unknown and values in ('UNKNOWN', [], ['UNKNOWN']):\n                continue\n            if field in _ELEMENTSFIELD:\n                self._write_field(fileobject, field, ','.join(values))\n                continue\n            if field not in _LISTFIELDS:\n                if field == 'Description':\n                    if self.metadata_version in ('1.0', '1.1'):\n                        values = values.replace('\\n', '\\n        ')\n                    else:\n                        values = values.replace('\\n', '\\n       |')\n                values = [values]\n\n            if field in _LISTTUPLEFIELDS:\n                values = [','.join(value) for value in values]\n\n            for value in values:\n                self._write_field(fileobject, field, value)\n\n    def update(self, other=None, **kwargs):\n        \"\"\"Set metadata values from the given iterable `other` and kwargs.\n\n        Behavior is like `dict.update`: If `other` has a ``keys`` method,\n        they are looped over and ``self[key]`` is assigned ``other[key]``.\n        Else, ``other`` is an iterable of ``(key, value)`` iterables.\n\n        Keys that don't match a metadata field or that have an empty value are\n        dropped.\n        \"\"\"\n\n        def _set(key, value):\n            if key in _ATTR2FIELD and value:\n                self.set(self._convert_name(key), value)\n\n        if not other:\n            # other is None or empty container\n            pass\n        elif hasattr(other, 'keys'):\n            for k in other.keys():\n                _set(k, other[k])\n        else:\n            for k, v in other:\n                _set(k, v)\n\n        if kwargs:\n            for k, v in kwargs.items():\n                _set(k, v)\n\n    def set(self, name, value):\n        \"\"\"Control then set a metadata field.\"\"\"\n        name = self._convert_name(name)\n\n        if ((name in _ELEMENTSFIELD or name == 'Platform') and not isinstance(value, (list, tuple))):\n            if isinstance(value, string_types):\n                value = [v.strip() for v in value.split(',')]\n            else:\n                value = []\n        elif (name in _LISTFIELDS and not isinstance(value, (list, tuple))):\n            if isinstance(value, string_types):\n                value = [value]\n            else:\n                value = []\n\n        if logger.isEnabledFor(logging.WARNING):\n            project_name = self['Name']\n\n            scheme = get_scheme(self.scheme)\n            if name in _PREDICATE_FIELDS and value is not None:\n                for v in value:\n                    # check that the values are valid\n                    if not scheme.is_valid_matcher(v.split(';')[0]):\n                        logger.warning(\"'%s': '%s' is not valid (field '%s')\", project_name, v, name)\n            # FIXME this rejects UNKNOWN, is that right?\n            elif name in _VERSIONS_FIELDS and value is not None:\n                if not scheme.is_valid_constraint_list(value):\n                    logger.warning(\"'%s': '%s' is not a valid version (field '%s')\", project_name, value, name)\n            elif name in _VERSION_FIELDS and value is not None:\n                if not scheme.is_valid_version(value):\n                    logger.warning(\"'%s': '%s' is not a valid version (field '%s')\", project_name, value, name)\n\n        if name in _UNICODEFIELDS:\n            if name == 'Description':\n                value = self._remove_line_prefix(value)\n\n        self._fields[name] = value\n\n    def get(self, name, default=_MISSING):\n        \"\"\"Get a metadata field.\"\"\"\n        name = self._convert_name(name)\n        if name not in self._fields:\n            if default is _MISSING:\n                default = self._default_value(name)\n            return default\n        if name in _UNICODEFIELDS:\n            value = self._fields[name]\n            return value\n        elif name in _LISTFIELDS:\n            value = self._fields[name]\n            if value is None:\n                return []\n            res = []\n            for val in value:\n                if name not in _LISTTUPLEFIELDS:\n                    res.append(val)\n                else:\n                    # That's for Project-URL\n                    res.append((val[0], val[1]))\n            return res\n\n        elif name in _ELEMENTSFIELD:\n            value = self._fields[name]\n            if isinstance(value, string_types):\n                return value.split(',')\n        return self._fields[name]\n\n    def check(self, strict=False):\n        \"\"\"Check if the metadata is compliant. If strict is True then raise if\n        no Name or Version are provided\"\"\"\n        self.set_metadata_version()\n\n        # XXX should check the versions (if the file was loaded)\n        missing, warnings = [], []\n\n        for attr in ('Name', 'Version'):  # required by PEP 345\n            if attr not in self:\n                missing.append(attr)\n\n        if strict and missing != []:\n            msg = 'missing required metadata: %s' % ', '.join(missing)\n            raise MetadataMissingError(msg)\n\n        for attr in ('Home-page', 'Author'):\n            if attr not in self:\n                missing.append(attr)\n\n        # checking metadata 1.2 (XXX needs to check 1.1, 1.0)\n        if self['Metadata-Version'] != '1.2':\n            return missing, warnings\n\n        scheme = get_scheme(self.scheme)\n\n        def are_valid_constraints(value):\n            for v in value:\n                if not scheme.is_valid_matcher(v.split(';')[0]):\n                    return False\n            return True\n\n        for fields, controller in ((_PREDICATE_FIELDS, are_valid_constraints),\n                                   (_VERSIONS_FIELDS, scheme.is_valid_constraint_list), (_VERSION_FIELDS,\n                                                                                         scheme.is_valid_version)):\n            for field in fields:\n                value = self.get(field, None)\n                if value is not None and not controller(value):\n                    warnings.append(\"Wrong value for '%s': %s\" % (field, value))\n\n        return missing, warnings\n\n    def todict(self, skip_missing=False):\n        \"\"\"Return fields as a dict.\n\n        Field names will be converted to use the underscore-lowercase style\n        instead of hyphen-mixed case (i.e. home_page instead of Home-page).\n        This is as per https://www.python.org/dev/peps/pep-0566/#id17.\n        \"\"\"\n        self.set_metadata_version()\n\n        fields = _version2fieldlist(self['Metadata-Version'])\n\n        data = {}\n\n        for field_name in fields:\n            if not skip_missing or field_name in self._fields:\n                key = _FIELD2ATTR[field_name]\n                if key != 'project_url':\n                    data[key] = self[field_name]\n                else:\n                    data[key] = [','.join(u) for u in self[field_name]]\n\n        return data\n\n    def add_requirements(self, requirements):\n        if self['Metadata-Version'] == '1.1':\n            # we can't have 1.1 metadata *and* Setuptools requires\n            for field in ('Obsoletes', 'Requires', 'Provides'):\n                if field in self:\n                    del self[field]\n        self['Requires-Dist'] += requirements\n\n    # Mapping API\n    # TODO could add iter* variants\n\n    def keys(self):\n        return list(_version2fieldlist(self['Metadata-Version']))\n\n    def __iter__(self):\n        for key in self.keys():\n            yield key\n\n    def values(self):\n        return [self[key] for key in self.keys()]\n\n    def items(self):\n        return [(key, self[key]) for key in self.keys()]\n\n    def __repr__(self):\n        return '<%s %s %s>' % (self.__class__.__name__, self.name, self.version)\n\n\nMETADATA_FILENAME = 'pydist.json'\nWHEEL_METADATA_FILENAME = 'metadata.json'\nLEGACY_METADATA_FILENAME = 'METADATA'\n\n\nclass Metadata(object):\n    \"\"\"\n    The metadata of a release. This implementation uses 2.1\n    metadata where possible. If not possible, it wraps a LegacyMetadata\n    instance which handles the key-value metadata format.\n    \"\"\"\n\n    METADATA_VERSION_MATCHER = re.compile(r'^\\d+(\\.\\d+)*$')\n\n    NAME_MATCHER = re.compile('^[0-9A-Z]([0-9A-Z_.-]*[0-9A-Z])?$', re.I)\n\n    FIELDNAME_MATCHER = re.compile('^[A-Z]([0-9A-Z-]*[0-9A-Z])?$', re.I)\n\n    VERSION_MATCHER = PEP440_VERSION_RE\n\n    SUMMARY_MATCHER = re.compile('.{1,2047}')\n\n    METADATA_VERSION = '2.0'\n\n    GENERATOR = 'distlib (%s)' % __version__\n\n    MANDATORY_KEYS = {\n        'name': (),\n        'version': (),\n        'summary': ('legacy', ),\n    }\n\n    INDEX_KEYS = ('name version license summary description author '\n                  'author_email keywords platform home_page classifiers '\n                  'download_url')\n\n    DEPENDENCY_KEYS = ('extras run_requires test_requires build_requires '\n                       'dev_requires provides meta_requires obsoleted_by '\n                       'supports_environments')\n\n    SYNTAX_VALIDATORS = {\n        'metadata_version': (METADATA_VERSION_MATCHER, ()),\n        'name': (NAME_MATCHER, ('legacy', )),\n        'version': (VERSION_MATCHER, ('legacy', )),\n        'summary': (SUMMARY_MATCHER, ('legacy', )),\n        'dynamic': (FIELDNAME_MATCHER, ('legacy', )),\n    }\n\n    __slots__ = ('_legacy', '_data', 'scheme')\n\n    def __init__(self, path=None, fileobj=None, mapping=None, scheme='default'):\n        if [path, fileobj, mapping].count(None) < 2:\n            raise TypeError('path, fileobj and mapping are exclusive')\n        self._legacy = None\n        self._data = None\n        self.scheme = scheme\n        # import pdb; pdb.set_trace()\n        if mapping is not None:\n            try:\n                self._validate_mapping(mapping, scheme)\n                self._data = mapping\n            except MetadataUnrecognizedVersionError:\n                self._legacy = LegacyMetadata(mapping=mapping, scheme=scheme)\n                self.validate()\n        else:\n            data = None\n            if path:\n                with open(path, 'rb') as f:\n                    data = f.read()\n            elif fileobj:\n                data = fileobj.read()\n            if data is None:\n                # Initialised with no args - to be added\n                self._data = {\n                    'metadata_version': self.METADATA_VERSION,\n                    'generator': self.GENERATOR,\n                }\n            else:\n                if not isinstance(data, text_type):\n                    data = data.decode('utf-8')\n                try:\n                    self._data = json.loads(data)\n                    self._validate_mapping(self._data, scheme)\n                except ValueError:\n                    # Note: MetadataUnrecognizedVersionError does not\n                    # inherit from ValueError (it's a DistlibException,\n                    # which should not inherit from ValueError).\n                    # The ValueError comes from the json.load - if that\n                    # succeeds and we get a validation error, we want\n                    # that to propagate\n                    self._legacy = LegacyMetadata(fileobj=StringIO(data), scheme=scheme)\n                    self.validate()\n\n    common_keys = set(('name', 'version', 'license', 'keywords', 'summary'))\n\n    none_list = (None, list)\n    none_dict = (None, dict)\n\n    mapped_keys = {\n        'run_requires': ('Requires-Dist', list),\n        'build_requires': ('Setup-Requires-Dist', list),\n        'dev_requires': none_list,\n        'test_requires': none_list,\n        'meta_requires': none_list,\n        'extras': ('Provides-Extra', list),\n        'modules': none_list,\n        'namespaces': none_list,\n        'exports': none_dict,\n        'commands': none_dict,\n        'classifiers': ('Classifier', list),\n        'source_url': ('Download-URL', None),\n        'metadata_version': ('Metadata-Version', None),\n    }\n\n    del none_list, none_dict\n\n    def __getattribute__(self, key):\n        common = object.__getattribute__(self, 'common_keys')\n        mapped = object.__getattribute__(self, 'mapped_keys')\n        if key in mapped:\n            lk, maker = mapped[key]\n            if self._legacy:\n                if lk is None:\n                    result = None if maker is None else maker()\n                else:\n                    result = self._legacy.get(lk)\n            else:\n                value = None if maker is None else maker()\n                if key not in ('commands', 'exports', 'modules', 'namespaces', 'classifiers'):\n                    result = self._data.get(key, value)\n                else:\n                    # special cases for PEP 459\n                    sentinel = object()\n                    result = sentinel\n                    d = self._data.get('extensions')\n                    if d:\n                        if key == 'commands':\n                            result = d.get('python.commands', value)\n                        elif key == 'classifiers':\n                            d = d.get('python.details')\n                            if d:\n                                result = d.get(key, value)\n                        else:\n                            d = d.get('python.exports')\n                            if not d:\n                                d = self._data.get('python.exports')\n                            if d:\n                                result = d.get(key, value)\n                    if result is sentinel:\n                        result = value\n        elif key not in common:\n            result = object.__getattribute__(self, key)\n        elif self._legacy:\n            result = self._legacy.get(key)\n        else:\n            result = self._data.get(key)\n        return result\n\n    def _validate_value(self, key, value, scheme=None):\n        if key in self.SYNTAX_VALIDATORS:\n            pattern, exclusions = self.SYNTAX_VALIDATORS[key]\n            if (scheme or self.scheme) not in exclusions:\n                m = pattern.match(value)\n                if not m:\n                    raise MetadataInvalidError(\"'%s' is an invalid value for \"\n                                               \"the '%s' property\" % (value, key))\n\n    def __setattr__(self, key, value):\n        self._validate_value(key, value)\n        common = object.__getattribute__(self, 'common_keys')\n        mapped = object.__getattribute__(self, 'mapped_keys')\n        if key in mapped:\n            lk, _ = mapped[key]\n            if self._legacy:\n                if lk is None:\n                    raise NotImplementedError\n                self._legacy[lk] = value\n            elif key not in ('commands', 'exports', 'modules', 'namespaces', 'classifiers'):\n                self._data[key] = value\n            else:\n                # special cases for PEP 459\n                d = self._data.setdefault('extensions', {})\n                if key == 'commands':\n                    d['python.commands'] = value\n                elif key == 'classifiers':\n                    d = d.setdefault('python.details', {})\n                    d[key] = value\n                else:\n                    d = d.setdefault('python.exports', {})\n                    d[key] = value\n        elif key not in common:\n            object.__setattr__(self, key, value)\n        else:\n            if key == 'keywords':\n                if isinstance(value, string_types):\n                    value = value.strip()\n                    if value:\n                        value = value.split()\n                    else:\n                        value = []\n            if self._legacy:\n                self._legacy[key] = value\n            else:\n                self._data[key] = value\n\n    @property\n    def name_and_version(self):\n        return _get_name_and_version(self.name, self.version, True)\n\n    @property\n    def provides(self):\n        if self._legacy:\n            result = self._legacy['Provides-Dist']\n        else:\n            result = self._data.setdefault('provides', [])\n        s = '%s (%s)' % (self.name, self.version)\n        if s not in result:\n            result.append(s)\n        return result\n\n    @provides.setter\n    def provides(self, value):\n        if self._legacy:\n            self._legacy['Provides-Dist'] = value\n        else:\n            self._data['provides'] = value\n\n    def get_requirements(self, reqts, extras=None, env=None):\n        \"\"\"\n        Base method to get dependencies, given a set of extras\n        to satisfy and an optional environment context.\n        :param reqts: A list of sometimes-wanted dependencies,\n                      perhaps dependent on extras and environment.\n        :param extras: A list of optional components being requested.\n        :param env: An optional environment for marker evaluation.\n        \"\"\"\n        if self._legacy:\n            result = reqts\n        else:\n            result = []\n            extras = get_extras(extras or [], self.extras)\n            for d in reqts:\n                if 'extra' not in d and 'environment' not in d:\n                    # unconditional\n                    include = True\n                else:\n                    if 'extra' not in d:\n                        # Not extra-dependent - only environment-dependent\n                        include = True\n                    else:\n                        include = d.get('extra') in extras\n                    if include:\n                        # Not excluded because of extras, check environment\n                        marker = d.get('environment')\n                        if marker:\n                            include = interpret(marker, env)\n                if include:\n                    result.extend(d['requires'])\n            for key in ('build', 'dev', 'test'):\n                e = ':%s:' % key\n                if e in extras:\n                    extras.remove(e)\n                    # A recursive call, but it should terminate since 'test'\n                    # has been removed from the extras\n                    reqts = self._data.get('%s_requires' % key, [])\n                    result.extend(self.get_requirements(reqts, extras=extras, env=env))\n        return result\n\n    @property\n    def dictionary(self):\n        if self._legacy:\n            return self._from_legacy()\n        return self._data\n\n    @property\n    def dependencies(self):\n        if self._legacy:\n            raise NotImplementedError\n        else:\n            return extract_by_key(self._data, self.DEPENDENCY_KEYS)\n\n    @dependencies.setter\n    def dependencies(self, value):\n        if self._legacy:\n            raise NotImplementedError\n        else:\n            self._data.update(value)\n\n    def _validate_mapping(self, mapping, scheme):\n        if mapping.get('metadata_version') != self.METADATA_VERSION:\n            raise MetadataUnrecognizedVersionError()\n        missing = []\n        for key, exclusions in self.MANDATORY_KEYS.items():\n            if key not in mapping:\n                if scheme not in exclusions:\n                    missing.append(key)\n        if missing:\n            msg = 'Missing metadata items: %s' % ', '.join(missing)\n            raise MetadataMissingError(msg)\n        for k, v in mapping.items():\n            self._validate_value(k, v, scheme)\n\n    def validate(self):\n        if self._legacy:\n            missing, warnings = self._legacy.check(True)\n            if missing or warnings:\n                logger.warning('Metadata: missing: %s, warnings: %s', missing, warnings)\n        else:\n            self._validate_mapping(self._data, self.scheme)\n\n    def todict(self):\n        if self._legacy:\n            return self._legacy.todict(True)\n        else:\n            result = extract_by_key(self._data, self.INDEX_KEYS)\n            return result\n\n    def _from_legacy(self):\n        assert self._legacy and not self._data\n        result = {\n            'metadata_version': self.METADATA_VERSION,\n            'generator': self.GENERATOR,\n        }\n        lmd = self._legacy.todict(True)  # skip missing ones\n        for k in ('name', 'version', 'license', 'summary', 'description', 'classifier'):\n            if k in lmd:\n                if k == 'classifier':\n                    nk = 'classifiers'\n                else:\n                    nk = k\n                result[nk] = lmd[k]\n        kw = lmd.get('Keywords', [])\n        if kw == ['']:\n            kw = []\n        result['keywords'] = kw\n        keys = (('requires_dist', 'run_requires'), ('setup_requires_dist', 'build_requires'))\n        for ok, nk in keys:\n            if ok in lmd and lmd[ok]:\n                result[nk] = [{'requires': lmd[ok]}]\n        result['provides'] = self.provides\n        # author = {}\n        # maintainer = {}\n        return result\n\n    LEGACY_MAPPING = {\n        'name': 'Name',\n        'version': 'Version',\n        ('extensions', 'python.details', 'license'): 'License',\n        'summary': 'Summary',\n        'description': 'Description',\n        ('extensions', 'python.project', 'project_urls', 'Home'): 'Home-page',\n        ('extensions', 'python.project', 'contacts', 0, 'name'): 'Author',\n        ('extensions', 'python.project', 'contacts', 0, 'email'): 'Author-email',\n        'source_url': 'Download-URL',\n        ('extensions', 'python.details', 'classifiers'): 'Classifier',\n    }\n\n    def _to_legacy(self):\n\n        def process_entries(entries):\n            reqts = set()\n            for e in entries:\n                extra = e.get('extra')\n                env = e.get('environment')\n                rlist = e['requires']\n                for r in rlist:\n                    if not env and not extra:\n                        reqts.add(r)\n                    else:\n                        marker = ''\n                        if extra:\n                            marker = 'extra == \"%s\"' % extra\n                        if env:\n                            if marker:\n                                marker = '(%s) and %s' % (env, marker)\n                            else:\n                                marker = env\n                        reqts.add(';'.join((r, marker)))\n            return reqts\n\n        assert self._data and not self._legacy\n        result = LegacyMetadata()\n        nmd = self._data\n        # import pdb; pdb.set_trace()\n        for nk, ok in self.LEGACY_MAPPING.items():\n            if not isinstance(nk, tuple):\n                if nk in nmd:\n                    result[ok] = nmd[nk]\n            else:\n                d = nmd\n                found = True\n                for k in nk:\n                    try:\n                        d = d[k]\n                    except (KeyError, IndexError):\n                        found = False\n                        break\n                if found:\n                    result[ok] = d\n        r1 = process_entries(self.run_requires + self.meta_requires)\n        r2 = process_entries(self.build_requires + self.dev_requires)\n        if self.extras:\n            result['Provides-Extra'] = sorted(self.extras)\n        result['Requires-Dist'] = sorted(r1)\n        result['Setup-Requires-Dist'] = sorted(r2)\n        # TODO: any other fields wanted\n        return result\n\n    def write(self, path=None, fileobj=None, legacy=False, skip_unknown=True):\n        if [path, fileobj].count(None) != 1:\n            raise ValueError('Exactly one of path and fileobj is needed')\n        self.validate()\n        if legacy:\n            if self._legacy:\n                legacy_md = self._legacy\n            else:\n                legacy_md = self._to_legacy()\n            if path:\n                legacy_md.write(path, skip_unknown=skip_unknown)\n            else:\n                legacy_md.write_file(fileobj, skip_unknown=skip_unknown)\n        else:\n            if self._legacy:\n                d = self._from_legacy()\n            else:\n                d = self._data\n            if fileobj:\n                json.dump(d, fileobj, ensure_ascii=True, indent=2, sort_keys=True)\n            else:\n                with codecs.open(path, 'w', 'utf-8') as f:\n                    json.dump(d, f, ensure_ascii=True, indent=2, sort_keys=True)\n\n    def add_requirements(self, requirements):\n        if self._legacy:\n            self._legacy.add_requirements(requirements)\n        else:\n            run_requires = self._data.setdefault('run_requires', [])\n            always = None\n            for entry in run_requires:\n                if 'environment' not in entry and 'extra' not in entry:\n                    always = entry\n                    break\n            if always is None:\n                always = {'requires': requirements}\n                run_requires.insert(0, always)\n            else:\n                rset = set(always['requires']) | set(requirements)\n                always['requires'] = sorted(rset)\n\n    def __repr__(self):\n        name = self.name or '(no name)'\n        version = self.version or 'no version'\n        return '<%s %s %s (%s)>' % (self.__class__.__name__, self.metadata_version, name, version)\n",[],[216,809,810,811,890,891,1958,1727],"097170d2-67fc-11f0-a319-0224a6c84d84","09717190-67fc-11f0-a319-0224a6c84d84",339,["D",1753299263591],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"\nParser for the environment markers micro-language defined in PEP 508.\n\"\"\"\n\n# Note: In PEP 345, the micro-language was Python compatible, so the ast\n# module could be used to parse it. However, PEP 508 introduced operators such\n# as ~= and === which aren't in Python, necessitating a different approach.\n\nimport os\nimport re\nimport sys\nimport platform\n\nfrom .compat import string_types\nfrom .util import in_venv, parse_marker\nfrom .version import LegacyVersion as LV\n\n__all__ = ['interpret']\n\n_VERSION_PATTERN = re.compile(r'((\\d+(\\.\\d+)*\\w*)|\\'(\\d+(\\.\\d+)*\\w*)\\'|\\\"(\\d+(\\.\\d+)*\\w*)\\\")')\n_VERSION_MARKERS = {'python_version', 'python_full_version'}\n\n\ndef _is_version_marker(s):\n    return isinstance(s, string_types) and s in _VERSION_MARKERS\n\n\ndef _is_literal(o):\n    if not isinstance(o, string_types) or not o:\n        return False\n    return o[0] in '\\'\"'\n\n\ndef _get_versions(s):\n    return {LV(m.groups()[0]) for m in _VERSION_PATTERN.finditer(s)}\n\n\nclass Evaluator(object):\n    \"\"\"\n    This class is used to evaluate marker expressions.\n    \"\"\"\n\n    operations = {\n        '==': lambda x, y: x == y,\n        '===': lambda x, y: x == y,\n        '~=': lambda x, y: x == y or x > y,\n        '!=': lambda x, y: x != y,\n        '<': lambda x, y: x < y,\n        '<=': lambda x, y: x == y or x < y,\n        '>': lambda x, y: x > y,\n        '>=': lambda x, y: x == y or x > y,\n        'and': lambda x, y: x and y,\n        'or': lambda x, y: x or y,\n        'in': lambda x, y: x in y,\n        'not in': lambda x, y: x not in y,\n    }\n\n    def evaluate(self, expr, context):\n        \"\"\"\n        Evaluate a marker expression returned by the :func:`parse_requirement`\n        function in the specified context.\n        \"\"\"\n        if isinstance(expr, string_types):\n            if expr[0] in '\\'\"':\n                result = expr[1:-1]\n            else:\n                if expr not in context:\n                    raise SyntaxError('unknown variable: %s' % expr)\n                result = context[expr]\n        else:\n            assert isinstance(expr, dict)\n            op = expr['op']\n            if op not in self.operations:\n                raise NotImplementedError('op not implemented: %s' % op)\n            elhs = expr['lhs']\n            erhs = expr['rhs']\n            if _is_literal(expr['lhs']) and _is_literal(expr['rhs']):\n                raise SyntaxError('invalid comparison: %s %s %s' % (elhs, op, erhs))\n\n            lhs = self.evaluate(elhs, context)\n            rhs = self.evaluate(erhs, context)\n            if ((_is_version_marker(elhs) or _is_version_marker(erhs)) and\n                    op in ('<', '<=', '>', '>=', '===', '==', '!=', '~=')):\n                lhs = LV(lhs)\n                rhs = LV(rhs)\n            elif _is_version_marker(elhs) and op in ('in', 'not in'):\n                lhs = LV(lhs)\n                rhs = _get_versions(rhs)\n            result = self.operations[op](lhs, rhs)\n        return result\n\n\n_DIGITS = re.compile(r'\\d+\\.\\d+')\n\n\ndef default_context():\n\n    def format_full_version(info):\n        version = '%s.%s.%s' % (info.major, info.minor, info.micro)\n        kind = info.releaselevel\n        if kind != 'final':\n            version += kind[0] + str(info.serial)\n        return version\n\n    if hasattr(sys, 'implementation'):\n        implementation_version = format_full_version(sys.implementation.version)\n        implementation_name = sys.implementation.name\n    else:\n        implementation_version = '0'\n        implementation_name = ''\n\n    ppv = platform.python_version()\n    m = _DIGITS.match(ppv)\n    pv = m.group(0)\n    result = {\n        'implementation_name': implementation_name,\n        'implementation_version': implementation_version,\n        'os_name': os.name,\n        'platform_machine': platform.machine(),\n        'platform_python_implementation': platform.python_implementation(),\n        'platform_release': platform.release(),\n        'platform_system': platform.system(),\n        'platform_version': platform.version(),\n        'platform_in_venv': str(in_venv()),\n        'python_full_version': ppv,\n        'python_version': pv,\n        'sys_platform': sys.platform,\n    }\n    return result\n\n\nDEFAULT_CONTEXT = default_context()\ndel default_context\n\nevaluator = Evaluator()\n\n\ndef interpret(marker, execution_context=None):\n    \"\"\"\n    Interpret a marker and return a result depending on environment.\n\n    :param marker: The marker to interpret.\n    :type marker: str\n    :param execution_context: The context used for name lookup.\n    :type execution_context: mapping\n    \"\"\"\n    try:\n        expr, rest = parse_marker(marker)\n    except Exception as e:\n        raise SyntaxError('Unable to interpret marker syntax: %s: %s' % (marker, e))\n    if rest and rest[0] != '#':\n        raise SyntaxError('unexpected trailing data in marker: %s: %s' % (marker, rest))\n    context = dict(DEFAULT_CONTEXT)\n    if execution_context:\n        context.update(execution_context)\n    return evaluator.evaluate(expr, context)\n",[],[216,809,810,811,890,891,1958,1735],"094fd6e8-67fc-11f0-aad3-0224a6c84d84","manifest.py","094fd77e-67fc-11f0-aad3-0224a6c84d84",335,["D",1753299263395],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"\nClass representing the list of files in a distribution.\n\nEquivalent to distutils.filelist, but fixes some problems.\n\"\"\"\nimport fnmatch\nimport logging\nimport os\nimport re\nimport sys\n\nfrom . import DistlibException\nfrom .compat import fsdecode\nfrom .util import convert_path\n\n\n__all__ = ['Manifest']\n\nlogger = logging.getLogger(__name__)\n\n# a \\ followed by some spaces + EOL\n_COLLAPSE_PATTERN = re.compile('\\\\\\\\w*\\n', re.M)\n_COMMENTED_LINE = re.compile('#.*?(?=\\n)|\\n(?=$)', re.M | re.S)\n\n#\n# Due to the different results returned by fnmatch.translate, we need\n# to do slightly different processing for Python 2.7 and 3.2 ... this needed\n# to be brought in for Python 3.6 onwards.\n#\n_PYTHON_VERSION = sys.version_info[:2]\n\n\nclass Manifest(object):\n    \"\"\"\n    A list of files built by exploring the filesystem and filtered by applying various\n    patterns to what we find there.\n    \"\"\"\n\n    def __init__(self, base=None):\n        \"\"\"\n        Initialise an instance.\n\n        :param base: The base directory to explore under.\n        \"\"\"\n        self.base = os.path.abspath(os.path.normpath(base or os.getcwd()))\n        self.prefix = self.base + os.sep\n        self.allfiles = None\n        self.files = set()\n\n    #\n    # Public API\n    #\n\n    def findall(self):\n        \"\"\"Find all files under the base and set ``allfiles`` to the absolute\n        pathnames of files found.\n        \"\"\"\n        from stat import S_ISREG, S_ISDIR, S_ISLNK\n\n        self.allfiles = allfiles = []\n        root = self.base\n        stack = [root]\n        pop = stack.pop\n        push = stack.append\n\n        while stack:\n            root = pop()\n            names = os.listdir(root)\n\n            for name in names:\n                fullname = os.path.join(root, name)\n\n                # Avoid excess stat calls -- just one will do, thank you!\n                stat = os.stat(fullname)\n                mode = stat.st_mode\n                if S_ISREG(mode):\n                    allfiles.append(fsdecode(fullname))\n                elif S_ISDIR(mode) and not S_ISLNK(mode):\n                    push(fullname)\n\n    def add(self, item):\n        \"\"\"\n        Add a file to the manifest.\n\n        :param item: The pathname to add. This can be relative to the base.\n        \"\"\"\n        if not item.startswith(self.prefix):\n            item = os.path.join(self.base, item)\n        self.files.add(os.path.normpath(item))\n\n    def add_many(self, items):\n        \"\"\"\n        Add a list of files to the manifest.\n\n        :param items: The pathnames to add. These can be relative to the base.\n        \"\"\"\n        for item in items:\n            self.add(item)\n\n    def sorted(self, wantdirs=False):\n        \"\"\"\n        Return sorted files in directory order\n        \"\"\"\n\n        def add_dir(dirs, d):\n            dirs.add(d)\n            logger.debug('add_dir added %s', d)\n            if d != self.base:\n                parent, _ = os.path.split(d)\n                assert parent not in ('', '/')\n                add_dir(dirs, parent)\n\n        result = set(self.files)    # make a copy!\n        if wantdirs:\n            dirs = set()\n            for f in result:\n                add_dir(dirs, os.path.dirname(f))\n            result |= dirs\n        return [os.path.join(*path_tuple) for path_tuple in\n                sorted(os.path.split(path) for path in result)]\n\n    def clear(self):\n        \"\"\"Clear all collected files.\"\"\"\n        self.files = set()\n        self.allfiles = []\n\n    def process_directive(self, directive):\n        \"\"\"\n        Process a directive which either adds some files from ``allfiles`` to\n        ``files``, or removes some files from ``files``.\n\n        :param directive: The directive to process. This should be in a format\n                     compatible with distutils ``MANIFEST.in`` files:\n\n                     http://docs.python.org/distutils/sourcedist.html#commands\n        \"\"\"\n        # Parse the line: split it up, make sure the right number of words\n        # is there, and return the relevant words.  'action' is always\n        # defined: it's the first word of the line.  Which of the other\n        # three are defined depends on the action; it'll be either\n        # patterns, (dir and patterns), or (dirpattern).\n        action, patterns, thedir, dirpattern = self._parse_directive(directive)\n\n        # OK, now we know that the action is valid and we have the\n        # right number of words on the line for that action -- so we\n        # can proceed with minimal error-checking.\n        if action == 'include':\n            for pattern in patterns:\n                if not self._include_pattern(pattern, anchor=True):\n                    logger.warning('no files found matching %r', pattern)\n\n        elif action == 'exclude':\n            for pattern in patterns:\n                self._exclude_pattern(pattern, anchor=True)\n\n        elif action == 'global-include':\n            for pattern in patterns:\n                if not self._include_pattern(pattern, anchor=False):\n                    logger.warning('no files found matching %r '\n                                   'anywhere in distribution', pattern)\n\n        elif action == 'global-exclude':\n            for pattern in patterns:\n                self._exclude_pattern(pattern, anchor=False)\n\n        elif action == 'recursive-include':\n            for pattern in patterns:\n                if not self._include_pattern(pattern, prefix=thedir):\n                    logger.warning('no files found matching %r '\n                                   'under directory %r', pattern, thedir)\n\n        elif action == 'recursive-exclude':\n            for pattern in patterns:\n                self._exclude_pattern(pattern, prefix=thedir)\n\n        elif action == 'graft':\n            if not self._include_pattern(None, prefix=dirpattern):\n                logger.warning('no directories found matching %r',\n                               dirpattern)\n\n        elif action == 'prune':\n            if not self._exclude_pattern(None, prefix=dirpattern):\n                logger.warning('no previously-included directories found '\n                               'matching %r', dirpattern)\n        else:   # pragma: no cover\n            # This should never happen, as it should be caught in\n            # _parse_template_line\n            raise DistlibException(\n                'invalid action %r' % action)\n\n    #\n    # Private API\n    #\n\n    def _parse_directive(self, directive):\n        \"\"\"\n        Validate a directive.\n        :param directive: The directive to validate.\n        :return: A tuple of action, patterns, thedir, dir_patterns\n        \"\"\"\n        words = directive.split()\n        if len(words) == 1 and words[0] not in ('include', 'exclude',\n                                                'global-include',\n                                                'global-exclude',\n                                                'recursive-include',\n                                                'recursive-exclude',\n                                                'graft', 'prune'):\n            # no action given, let's use the default 'include'\n            words.insert(0, 'include')\n\n        action = words[0]\n        patterns = thedir = dir_pattern = None\n\n        if action in ('include', 'exclude',\n                      'global-include', 'global-exclude'):\n            if len(words) < 2:\n                raise DistlibException(\n                    '%r expects   ...' % action)\n\n            patterns = [convert_path(word) for word in words[1:]]\n\n        elif action in ('recursive-include', 'recursive-exclude'):\n            if len(words) < 3:\n                raise DistlibException(\n                    '%r expects    ...' % action)\n\n            thedir = convert_path(words[1])\n            patterns = [convert_path(word) for word in words[2:]]\n\n        elif action in ('graft', 'prune'):\n            if len(words) != 2:\n                raise DistlibException(\n                    '%r expects a single ' % action)\n\n            dir_pattern = convert_path(words[1])\n\n        else:\n            raise DistlibException('unknown action %r' % action)\n\n        return action, patterns, thedir, dir_pattern\n\n    def _include_pattern(self, pattern, anchor=True, prefix=None,\n                         is_regex=False):\n        \"\"\"Select strings (presumably filenames) from 'self.files' that\n        match 'pattern', a Unix-style wildcard (glob) pattern.\n\n        Patterns are not quite the same as implemented by the 'fnmatch'\n        module: '*' and '?'  match non-special characters, where \"special\"\n        is platform-dependent: slash on Unix; colon, slash, and backslash on\n        DOS/Windows; and colon on Mac OS.\n\n        If 'anchor' is true (the default), then the pattern match is more\n        stringent: \"*.py\" will match \"foo.py\" but not \"foo/bar.py\".  If\n        'anchor' is false, both of these will match.\n\n        If 'prefix' is supplied, then only filenames starting with 'prefix'\n        (itself a pattern) and ending with 'pattern', with anything in between\n        them, will match.  'anchor' is ignored in this case.\n\n        If 'is_regex' is true, 'anchor' and 'prefix' are ignored, and\n        'pattern' is assumed to be either a string containing a regex or a\n        regex object -- no translation is done, the regex is just compiled\n        and used as-is.\n\n        Selected strings will be added to self.files.\n\n        Return True if files are found.\n        \"\"\"\n        # XXX docstring lying about what the special chars are?\n        found = False\n        pattern_re = self._translate_pattern(pattern, anchor, prefix, is_regex)\n\n        # delayed loading of allfiles list\n        if self.allfiles is None:\n            self.findall()\n\n        for name in self.allfiles:\n            if pattern_re.search(name):\n                self.files.add(name)\n                found = True\n        return found\n\n    def _exclude_pattern(self, pattern, anchor=True, prefix=None,\n                         is_regex=False):\n        \"\"\"Remove strings (presumably filenames) from 'files' that match\n        'pattern'.\n\n        Other parameters are the same as for 'include_pattern()', above.\n        The list 'self.files' is modified in place. Return True if files are\n        found.\n\n        This API is public to allow e.g. exclusion of SCM subdirs, e.g. when\n        packaging source distributions\n        \"\"\"\n        found = False\n        pattern_re = self._translate_pattern(pattern, anchor, prefix, is_regex)\n        for f in list(self.files):\n            if pattern_re.search(f):\n                self.files.remove(f)\n                found = True\n        return found\n\n    def _translate_pattern(self, pattern, anchor=True, prefix=None,\n                           is_regex=False):\n        \"\"\"Translate a shell-like wildcard pattern to a compiled regular\n        expression.\n\n        Return the compiled regex.  If 'is_regex' true,\n        then 'pattern' is directly compiled to a regex (if it's a string)\n        or just returned as-is (assumes it's a regex object).\n        \"\"\"\n        if is_regex:\n            if isinstance(pattern, str):\n                return re.compile(pattern)\n            else:\n                return pattern\n\n        if _PYTHON_VERSION > (3, 2):\n            # ditch start and end characters\n            start, _, end = self._glob_to_re('_').partition('_')\n\n        if pattern:\n            pattern_re = self._glob_to_re(pattern)\n            if _PYTHON_VERSION > (3, 2):\n                assert pattern_re.startswith(start) and pattern_re.endswith(end)\n        else:\n            pattern_re = ''\n\n        base = re.escape(os.path.join(self.base, ''))\n        if prefix is not None:\n            # ditch end of pattern character\n            if _PYTHON_VERSION <= (3, 2):\n                empty_pattern = self._glob_to_re('')\n                prefix_re = self._glob_to_re(prefix)[:-len(empty_pattern)]\n            else:\n                prefix_re = self._glob_to_re(prefix)\n                assert prefix_re.startswith(start) and prefix_re.endswith(end)\n                prefix_re = prefix_re[len(start): len(prefix_re) - len(end)]\n            sep = os.sep\n            if os.sep == '\\\\':\n                sep = r'\\\\'\n            if _PYTHON_VERSION <= (3, 2):\n                pattern_re = '^' + base + sep.join((prefix_re,\n                                                    '.*' + pattern_re))\n            else:\n                pattern_re = pattern_re[len(start): len(pattern_re) - len(end)]\n                pattern_re = r'%s%s%s%s.*%s%s' % (start, base, prefix_re, sep,\n                                                  pattern_re, end)\n        else:  # no prefix -- respect anchor flag\n            if anchor:\n                if _PYTHON_VERSION <= (3, 2):\n                    pattern_re = '^' + base + pattern_re\n                else:\n                    pattern_re = r'%s%s%s' % (start, base, pattern_re[len(start):])\n\n        return re.compile(pattern_re)\n\n    def _glob_to_re(self, pattern):\n        \"\"\"Translate a shell-like glob pattern to a regular expression.\n\n        Return a string containing the regex.  Differs from\n        'fnmatch.translate()' in that '*' does not match \"special characters\"\n        (which are platform-specific).\n        \"\"\"\n        pattern_re = fnmatch.translate(pattern)\n\n        # '?' and '*' in the glob pattern become '.' and '.*' in the RE, which\n        # IMHO is wrong -- '?' and '*' aren't supposed to match slash in Unix,\n        # and by extension they shouldn't match such \"special characters\" under\n        # any OS.  So change all non-escaped dots in the RE to match any\n        # character except the special characters (currently: just os.sep).\n        sep = os.sep\n        if os.sep == '\\\\':\n            # we're using a regex to manipulate a regex, so we need\n            # to escape the backslash twice\n            sep = r'\\\\\\\\'\n        escaped = r'\\1[^%s]' % sep\n        pattern_re = re.sub(r'((? s2:\n                result = url1\n            if result != url2:\n                logger.debug('Not replacing %r with %r', url1, url2)\n            else:\n                logger.debug('Replacing %r with %r', url1, url2)\n        return result\n\n    def split_filename(self, filename, project_name):\n        \"\"\"\n        Attempt to split a filename in project name, version and Python version.\n        \"\"\"\n        return split_filename(filename, project_name)\n\n    def convert_url_to_download_info(self, url, project_name):\n        \"\"\"\n        See if a URL is a candidate for a download URL for a project (the URL\n        has typically been scraped from an HTML page).\n\n        If it is, a dictionary is returned with keys \"name\", \"version\",\n        \"filename\" and \"url\"; otherwise, None is returned.\n        \"\"\"\n\n        def same_project(name1, name2):\n            return normalize_name(name1) == normalize_name(name2)\n\n        result = None\n        scheme, netloc, path, params, query, frag = urlparse(url)\n        if frag.lower().startswith('egg='):  # pragma: no cover\n            logger.debug('%s: version hint in fragment: %r', project_name, frag)\n        m = HASHER_HASH.match(frag)\n        if m:\n            algo, digest = m.groups()\n        else:\n            algo, digest = None, None\n        origpath = path\n        if path and path[-1] == '/':  # pragma: no cover\n            path = path[:-1]\n        if path.endswith('.whl'):\n            try:\n                wheel = Wheel(path)\n                if not is_compatible(wheel, self.wheel_tags):\n                    logger.debug('Wheel not compatible: %s', path)\n                else:\n                    if project_name is None:\n                        include = True\n                    else:\n                        include = same_project(wheel.name, project_name)\n                    if include:\n                        result = {\n                            'name': wheel.name,\n                            'version': wheel.version,\n                            'filename': wheel.filename,\n                            'url': urlunparse((scheme, netloc, origpath, params, query, '')),\n                            'python-version': ', '.join(['.'.join(list(v[2:])) for v in wheel.pyver]),\n                        }\n            except Exception:  # pragma: no cover\n                logger.warning('invalid path for wheel: %s', path)\n        elif not path.endswith(self.downloadable_extensions):  # pragma: no cover\n            logger.debug('Not downloadable: %s', path)\n        else:  # downloadable extension\n            path = filename = posixpath.basename(path)\n            for ext in self.downloadable_extensions:\n                if path.endswith(ext):\n                    path = path[:-len(ext)]\n                    t = self.split_filename(path, project_name)\n                    if not t:  # pragma: no cover\n                        logger.debug('No match for project/version: %s', path)\n                    else:\n                        name, version, pyver = t\n                        if not project_name or same_project(project_name, name):\n                            result = {\n                                'name': name,\n                                'version': version,\n                                'filename': filename,\n                                'url': urlunparse((scheme, netloc, origpath, params, query, '')),\n                            }\n                            if pyver:  # pragma: no cover\n                                result['python-version'] = pyver\n                    break\n        if result and algo:\n            result['%s_digest' % algo] = digest\n        return result\n\n    def _get_digest(self, info):\n        \"\"\"\n        Get a digest from a dictionary by looking at a \"digests\" dictionary\n        or keys of the form 'algo_digest'.\n\n        Returns a 2-tuple (algo, digest) if found, else None. Currently\n        looks only for SHA256, then MD5.\n        \"\"\"\n        result = None\n        if 'digests' in info:\n            digests = info['digests']\n            for algo in ('sha256', 'md5'):\n                if algo in digests:\n                    result = (algo, digests[algo])\n                    break\n        if not result:\n            for algo in ('sha256', 'md5'):\n                key = '%s_digest' % algo\n                if key in info:\n                    result = (algo, info[key])\n                    break\n        return result\n\n    def _update_version_data(self, result, info):\n        \"\"\"\n        Update a result dictionary (the final result from _get_project) with a\n        dictionary for a specific version, which typically holds information\n        gleaned from a filename or URL for an archive for the distribution.\n        \"\"\"\n        name = info.pop('name')\n        version = info.pop('version')\n        if version in result:\n            dist = result[version]\n            md = dist.metadata\n        else:\n            dist = make_dist(name, version, scheme=self.scheme)\n            md = dist.metadata\n        dist.digest = digest = self._get_digest(info)\n        url = info['url']\n        result['digests'][url] = digest\n        if md.source_url != info['url']:\n            md.source_url = self.prefer_url(md.source_url, url)\n            result['urls'].setdefault(version, set()).add(url)\n        dist.locator = self\n        result[version] = dist\n\n    def locate(self, requirement, prereleases=False):\n        \"\"\"\n        Find the most recent distribution which matches the given\n        requirement.\n\n        :param requirement: A requirement of the form 'foo (1.0)' or perhaps\n                            'foo (>= 1.0, < 2.0, != 1.3)'\n        :param prereleases: If ``True``, allow pre-release versions\n                            to be located. Otherwise, pre-release versions\n                            are not returned.\n        :return: A :class:`Distribution` instance, or ``None`` if no such\n                 distribution could be located.\n        \"\"\"\n        result = None\n        r = parse_requirement(requirement)\n        if r is None:  # pragma: no cover\n            raise DistlibException('Not a valid requirement: %r' % requirement)\n        scheme = get_scheme(self.scheme)\n        self.matcher = matcher = scheme.matcher(r.requirement)\n        logger.debug('matcher: %s (%s)', matcher, type(matcher).__name__)\n        versions = self.get_project(r.name)\n        if len(versions) > 2:  # urls and digests keys are present\n            # sometimes, versions are invalid\n            slist = []\n            vcls = matcher.version_class\n            for k in versions:\n                if k in ('urls', 'digests'):\n                    continue\n                try:\n                    if not matcher.match(k):\n                        pass  # logger.debug('%s did not match %r', matcher, k)\n                    else:\n                        if prereleases or not vcls(k).is_prerelease:\n                            slist.append(k)\n                except Exception:  # pragma: no cover\n                    logger.warning('error matching %s with %r', matcher, k)\n                    pass  # slist.append(k)\n            if len(slist) > 1:\n                slist = sorted(slist, key=scheme.key)\n            if slist:\n                logger.debug('sorted list: %s', slist)\n                version = slist[-1]\n                result = versions[version]\n        if result:\n            if r.extras:\n                result.extras = r.extras\n            result.download_urls = versions.get('urls', {}).get(version, set())\n            d = {}\n            sd = versions.get('digests', {})\n            for url in result.download_urls:\n                if url in sd:  # pragma: no cover\n                    d[url] = sd[url]\n            result.digests = d\n        self.matcher = None\n        return result\n\n\nclass PyPIRPCLocator(Locator):\n    \"\"\"\n    This locator uses XML-RPC to locate distributions. It therefore\n    cannot be used with simple mirrors (that only mirror file content).\n    \"\"\"\n\n    def __init__(self, url, **kwargs):\n        \"\"\"\n        Initialise an instance.\n\n        :param url: The URL to use for XML-RPC.\n        :param kwargs: Passed to the superclass constructor.\n        \"\"\"\n        super(PyPIRPCLocator, self).__init__(**kwargs)\n        self.base_url = url\n        self.client = ServerProxy(url, timeout=3.0)\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        return set(self.client.list_packages())\n\n    def _get_project(self, name):\n        result = {'urls': {}, 'digests': {}}\n        versions = self.client.package_releases(name, True)\n        for v in versions:\n            urls = self.client.release_urls(name, v)\n            data = self.client.release_data(name, v)\n            metadata = Metadata(scheme=self.scheme)\n            metadata.name = data['name']\n            metadata.version = data['version']\n            metadata.license = data.get('license')\n            metadata.keywords = data.get('keywords', [])\n            metadata.summary = data.get('summary')\n            dist = Distribution(metadata)\n            if urls:\n                info = urls[0]\n                metadata.source_url = info['url']\n                dist.digest = self._get_digest(info)\n                dist.locator = self\n                result[v] = dist\n                for info in urls:\n                    url = info['url']\n                    digest = self._get_digest(info)\n                    result['urls'].setdefault(v, set()).add(url)\n                    result['digests'][url] = digest\n        return result\n\n\nclass PyPIJSONLocator(Locator):\n    \"\"\"\n    This locator uses PyPI's JSON interface. It's very limited in functionality\n    and probably not worth using.\n    \"\"\"\n\n    def __init__(self, url, **kwargs):\n        super(PyPIJSONLocator, self).__init__(**kwargs)\n        self.base_url = ensure_slash(url)\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        raise NotImplementedError('Not available from this locator')\n\n    def _get_project(self, name):\n        result = {'urls': {}, 'digests': {}}\n        url = urljoin(self.base_url, '%s/json' % quote(name))\n        try:\n            resp = self.opener.open(url)\n            data = resp.read().decode()  # for now\n            d = json.loads(data)\n            md = Metadata(scheme=self.scheme)\n            data = d['info']\n            md.name = data['name']\n            md.version = data['version']\n            md.license = data.get('license')\n            md.keywords = data.get('keywords', [])\n            md.summary = data.get('summary')\n            dist = Distribution(md)\n            dist.locator = self\n            # urls = d['urls']\n            result[md.version] = dist\n            for info in d['urls']:\n                url = info['url']\n                dist.download_urls.add(url)\n                dist.digests[url] = self._get_digest(info)\n                result['urls'].setdefault(md.version, set()).add(url)\n                result['digests'][url] = self._get_digest(info)\n            # Now get other releases\n            for version, infos in d['releases'].items():\n                if version == md.version:\n                    continue  # already done\n                omd = Metadata(scheme=self.scheme)\n                omd.name = md.name\n                omd.version = version\n                odist = Distribution(omd)\n                odist.locator = self\n                result[version] = odist\n                for info in infos:\n                    url = info['url']\n                    odist.download_urls.add(url)\n                    odist.digests[url] = self._get_digest(info)\n                    result['urls'].setdefault(version, set()).add(url)\n                    result['digests'][url] = self._get_digest(info)\n\n\n#            for info in urls:\n#                md.source_url = info['url']\n#                dist.digest = self._get_digest(info)\n#                dist.locator = self\n#                for info in urls:\n#                    url = info['url']\n#                    result['urls'].setdefault(md.version, set()).add(url)\n#                    result['digests'][url] = self._get_digest(info)\n        except Exception as e:\n            self.errors.put(text_type(e))\n            logger.exception('JSON fetch failed: %s', e)\n        return result\n\n\nclass Page(object):\n    \"\"\"\n    This class represents a scraped HTML page.\n    \"\"\"\n    # The following slightly hairy-looking regex just looks for the contents of\n    # an anchor link, which has an attribute \"href\" either immediately preceded\n    # or immediately followed by a \"rel\" attribute. The attribute values can be\n    # declared with double quotes, single quotes or no quotes - which leads to\n    # the length of the expression.\n    _href = re.compile(\n        \"\"\"\n(rel\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*))\\\\s+)?\nhref\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*))\n(\\\\s+rel\\\\s*=\\\\s*(?:\"(?P[^\"]*)\"|'(?P[^']*)'|(?P[^>\\\\s\\n]*)))?\n\"\"\", re.I | re.S | re.X)\n    _base = re.compile(r\"\"\"]+)\"\"\", re.I | re.S)\n\n    def __init__(self, data, url):\n        \"\"\"\n        Initialise an instance with the Unicode page contents and the URL they\n        came from.\n        \"\"\"\n        self.data = data\n        self.base_url = self.url = url\n        m = self._base.search(self.data)\n        if m:\n            self.base_url = m.group(1)\n\n    _clean_re = re.compile(r'[^a-z0-9$&+,/:;=?@.#%_\\\\|-]', re.I)\n\n    @cached_property\n    def links(self):\n        \"\"\"\n        Return the URLs of all the links on a page together with information\n        about their \"rel\" attribute, for determining which ones to treat as\n        downloads and which ones to queue for further scraping.\n        \"\"\"\n\n        def clean(url):\n            \"Tidy up an URL.\"\n            scheme, netloc, path, params, query, frag = urlparse(url)\n            return urlunparse((scheme, netloc, quote(path), params, query, frag))\n\n        result = set()\n        for match in self._href.finditer(self.data):\n            d = match.groupdict('')\n            rel = (d['rel1'] or d['rel2'] or d['rel3'] or d['rel4'] or d['rel5'] or d['rel6'])\n            url = d['url1'] or d['url2'] or d['url3']\n            url = urljoin(self.base_url, url)\n            url = unescape(url)\n            url = self._clean_re.sub(lambda m: '%%%2x' % ord(m.group(0)), url)\n            result.add((url, rel))\n        # We sort the result, hoping to bring the most recent versions\n        # to the front\n        result = sorted(result, key=lambda t: t[0], reverse=True)\n        return result\n\n\nclass SimpleScrapingLocator(Locator):\n    \"\"\"\n    A locator which scrapes HTML pages to locate downloads for a distribution.\n    This runs multiple threads to do the I/O; performance is at least as good\n    as pip's PackageFinder, which works in an analogous fashion.\n    \"\"\"\n\n    # These are used to deal with various Content-Encoding schemes.\n    decoders = {\n        'deflate': zlib.decompress,\n        'gzip': lambda b: gzip.GzipFile(fileobj=BytesIO(b)).read(),\n        'none': lambda b: b,\n    }\n\n    def __init__(self, url, timeout=None, num_workers=10, **kwargs):\n        \"\"\"\n        Initialise an instance.\n        :param url: The root URL to use for scraping.\n        :param timeout: The timeout, in seconds, to be applied to requests.\n                        This defaults to ``None`` (no timeout specified).\n        :param num_workers: The number of worker threads you want to do I/O,\n                            This defaults to 10.\n        :param kwargs: Passed to the superclass.\n        \"\"\"\n        super(SimpleScrapingLocator, self).__init__(**kwargs)\n        self.base_url = ensure_slash(url)\n        self.timeout = timeout\n        self._page_cache = {}\n        self._seen = set()\n        self._to_fetch = queue.Queue()\n        self._bad_hosts = set()\n        self.skip_externals = False\n        self.num_workers = num_workers\n        self._lock = threading.RLock()\n        # See issue #45: we need to be resilient when the locator is used\n        # in a thread, e.g. with concurrent.futures. We can't use self._lock\n        # as it is for coordinating our internal threads - the ones created\n        # in _prepare_threads.\n        self._gplock = threading.RLock()\n        self.platform_check = False  # See issue #112\n\n    def _prepare_threads(self):\n        \"\"\"\n        Threads are created only when get_project is called, and terminate\n        before it returns. They are there primarily to parallelise I/O (i.e.\n        fetching web pages).\n        \"\"\"\n        self._threads = []\n        for i in range(self.num_workers):\n            t = threading.Thread(target=self._fetch)\n            t.daemon = True\n            t.start()\n            self._threads.append(t)\n\n    def _wait_threads(self):\n        \"\"\"\n        Tell all the threads to terminate (by sending a sentinel value) and\n        wait for them to do so.\n        \"\"\"\n        # Note that you need two loops, since you can't say which\n        # thread will get each sentinel\n        for t in self._threads:\n            self._to_fetch.put(None)  # sentinel\n        for t in self._threads:\n            t.join()\n        self._threads = []\n\n    def _get_project(self, name):\n        result = {'urls': {}, 'digests': {}}\n        with self._gplock:\n            self.result = result\n            self.project_name = name\n            url = urljoin(self.base_url, '%s/' % quote(name))\n            self._seen.clear()\n            self._page_cache.clear()\n            self._prepare_threads()\n            try:\n                logger.debug('Queueing %s', url)\n                self._to_fetch.put(url)\n                self._to_fetch.join()\n            finally:\n                self._wait_threads()\n            del self.result\n        return result\n\n    platform_dependent = re.compile(r'\\b(linux_(i\\d86|x86_64|arm\\w+)|'\n                                    r'win(32|_amd64)|macosx_?\\d+)\\b', re.I)\n\n    def _is_platform_dependent(self, url):\n        \"\"\"\n        Does an URL refer to a platform-specific download?\n        \"\"\"\n        return self.platform_dependent.search(url)\n\n    def _process_download(self, url):\n        \"\"\"\n        See if an URL is a suitable download for a project.\n\n        If it is, register information in the result dictionary (for\n        _get_project) about the specific version it's for.\n\n        Note that the return value isn't actually used other than as a boolean\n        value.\n        \"\"\"\n        if self.platform_check and self._is_platform_dependent(url):\n            info = None\n        else:\n            info = self.convert_url_to_download_info(url, self.project_name)\n        logger.debug('process_download: %s -> %s', url, info)\n        if info:\n            with self._lock:  # needed because self.result is shared\n                self._update_version_data(self.result, info)\n        return info\n\n    def _should_queue(self, link, referrer, rel):\n        \"\"\"\n        Determine whether a link URL from a referring page and with a\n        particular \"rel\" attribute should be queued for scraping.\n        \"\"\"\n        scheme, netloc, path, _, _, _ = urlparse(link)\n        if path.endswith(self.source_extensions + self.binary_extensions + self.excluded_extensions):\n            result = False\n        elif self.skip_externals and not link.startswith(self.base_url):\n            result = False\n        elif not referrer.startswith(self.base_url):\n            result = False\n        elif rel not in ('homepage', 'download'):\n            result = False\n        elif scheme not in ('http', 'https', 'ftp'):\n            result = False\n        elif self._is_platform_dependent(link):\n            result = False\n        else:\n            host = netloc.split(':', 1)[0]\n            if host.lower() == 'localhost':\n                result = False\n            else:\n                result = True\n        logger.debug('should_queue: %s (%s) from %s -> %s', link, rel, referrer, result)\n        return result\n\n    def _fetch(self):\n        \"\"\"\n        Get a URL to fetch from the work queue, get the HTML page, examine its\n        links for download candidates and candidates for further scraping.\n\n        This is a handy method to run in a thread.\n        \"\"\"\n        while True:\n            url = self._to_fetch.get()\n            try:\n                if url:\n                    page = self.get_page(url)\n                    if page is None:  # e.g. after an error\n                        continue\n                    for link, rel in page.links:\n                        if link not in self._seen:\n                            try:\n                                self._seen.add(link)\n                                if (not self._process_download(link) and self._should_queue(link, url, rel)):\n                                    logger.debug('Queueing %s from %s', link, url)\n                                    self._to_fetch.put(link)\n                            except MetadataInvalidError:  # e.g. invalid versions\n                                pass\n            except Exception as e:  # pragma: no cover\n                self.errors.put(text_type(e))\n            finally:\n                # always do this, to avoid hangs :-)\n                self._to_fetch.task_done()\n            if not url:\n                # logger.debug('Sentinel seen, quitting.')\n                break\n\n    def get_page(self, url):\n        \"\"\"\n        Get the HTML for an URL, possibly from an in-memory cache.\n\n        XXX TODO Note: this cache is never actually cleared. It's assumed that\n        the data won't get stale over the lifetime of a locator instance (not\n        necessarily true for the default_locator).\n        \"\"\"\n        # http://peak.telecommunity.com/DevCenter/EasyInstall#package-index-api\n        scheme, netloc, path, _, _, _ = urlparse(url)\n        if scheme == 'file' and os.path.isdir(url2pathname(path)):\n            url = urljoin(ensure_slash(url), 'index.html')\n\n        if url in self._page_cache:\n            result = self._page_cache[url]\n            logger.debug('Returning %s from cache: %s', url, result)\n        else:\n            host = netloc.split(':', 1)[0]\n            result = None\n            if host in self._bad_hosts:\n                logger.debug('Skipping %s due to bad host %s', url, host)\n            else:\n                req = Request(url, headers={'Accept-encoding': 'identity'})\n                try:\n                    logger.debug('Fetching %s', url)\n                    resp = self.opener.open(req, timeout=self.timeout)\n                    logger.debug('Fetched %s', url)\n                    headers = resp.info()\n                    content_type = headers.get('Content-Type', '')\n                    if HTML_CONTENT_TYPE.match(content_type):\n                        final_url = resp.geturl()\n                        data = resp.read()\n                        encoding = headers.get('Content-Encoding')\n                        if encoding:\n                            decoder = self.decoders[encoding]  # fail if not found\n                            data = decoder(data)\n                        encoding = 'utf-8'\n                        m = CHARSET.search(content_type)\n                        if m:\n                            encoding = m.group(1)\n                        try:\n                            data = data.decode(encoding)\n                        except UnicodeError:  # pragma: no cover\n                            data = data.decode('latin-1')  # fallback\n                        result = Page(data, final_url)\n                        self._page_cache[final_url] = result\n                except HTTPError as e:\n                    if e.code != 404:\n                        logger.exception('Fetch failed: %s: %s', url, e)\n                except URLError as e:  # pragma: no cover\n                    logger.exception('Fetch failed: %s: %s', url, e)\n                    with self._lock:\n                        self._bad_hosts.add(host)\n                except Exception as e:  # pragma: no cover\n                    logger.exception('Fetch failed: %s: %s', url, e)\n                finally:\n                    self._page_cache[url] = result  # even if None (failure)\n        return result\n\n    _distname_re = re.compile(']*>([^<]+)<')\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        result = set()\n        page = self.get_page(self.base_url)\n        if not page:\n            raise DistlibException('Unable to get %s' % self.base_url)\n        for match in self._distname_re.finditer(page.data):\n            result.add(match.group(1))\n        return result\n\n\nclass DirectoryLocator(Locator):\n    \"\"\"\n    This class locates distributions in a directory tree.\n    \"\"\"\n\n    def __init__(self, path, **kwargs):\n        \"\"\"\n        Initialise an instance.\n        :param path: The root of the directory tree to search.\n        :param kwargs: Passed to the superclass constructor,\n                       except for:\n                       * recursive - if True (the default), subdirectories are\n                         recursed into. If False, only the top-level directory\n                         is searched,\n        \"\"\"\n        self.recursive = kwargs.pop('recursive', True)\n        super(DirectoryLocator, self).__init__(**kwargs)\n        path = os.path.abspath(path)\n        if not os.path.isdir(path):  # pragma: no cover\n            raise DistlibException('Not a directory: %r' % path)\n        self.base_dir = path\n\n    def should_include(self, filename, parent):\n        \"\"\"\n        Should a filename be considered as a candidate for a distribution\n        archive? As well as the filename, the directory which contains it\n        is provided, though not used by the current implementation.\n        \"\"\"\n        return filename.endswith(self.downloadable_extensions)\n\n    def _get_project(self, name):\n        result = {'urls': {}, 'digests': {}}\n        for root, dirs, files in os.walk(self.base_dir):\n            for fn in files:\n                if self.should_include(fn, root):\n                    fn = os.path.join(root, fn)\n                    url = urlunparse(('file', '', pathname2url(os.path.abspath(fn)), '', '', ''))\n                    info = self.convert_url_to_download_info(url, name)\n                    if info:\n                        self._update_version_data(result, info)\n            if not self.recursive:\n                break\n        return result\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        result = set()\n        for root, dirs, files in os.walk(self.base_dir):\n            for fn in files:\n                if self.should_include(fn, root):\n                    fn = os.path.join(root, fn)\n                    url = urlunparse(('file', '', pathname2url(os.path.abspath(fn)), '', '', ''))\n                    info = self.convert_url_to_download_info(url, None)\n                    if info:\n                        result.add(info['name'])\n            if not self.recursive:\n                break\n        return result\n\n\nclass JSONLocator(Locator):\n    \"\"\"\n    This locator uses special extended metadata (not available on PyPI) and is\n    the basis of performant dependency resolution in distlib. Other locators\n    require archive downloads before dependencies can be determined! As you\n    might imagine, that can be slow.\n    \"\"\"\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        raise NotImplementedError('Not available from this locator')\n\n    def _get_project(self, name):\n        result = {'urls': {}, 'digests': {}}\n        data = get_project_data(name)\n        if data:\n            for info in data.get('files', []):\n                if info['ptype'] != 'sdist' or info['pyversion'] != 'source':\n                    continue\n                # We don't store summary in project metadata as it makes\n                # the data bigger for no benefit during dependency\n                # resolution\n                dist = make_dist(data['name'],\n                                 info['version'],\n                                 summary=data.get('summary', 'Placeholder for summary'),\n                                 scheme=self.scheme)\n                md = dist.metadata\n                md.source_url = info['url']\n                # TODO SHA256 digest\n                if 'digest' in info and info['digest']:\n                    dist.digest = ('md5', info['digest'])\n                md.dependencies = info.get('requirements', {})\n                dist.exports = info.get('exports', {})\n                result[dist.version] = dist\n                result['urls'].setdefault(dist.version, set()).add(info['url'])\n        return result\n\n\nclass DistPathLocator(Locator):\n    \"\"\"\n    This locator finds installed distributions in a path. It can be useful for\n    adding to an :class:`AggregatingLocator`.\n    \"\"\"\n\n    def __init__(self, distpath, **kwargs):\n        \"\"\"\n        Initialise an instance.\n\n        :param distpath: A :class:`DistributionPath` instance to search.\n        \"\"\"\n        super(DistPathLocator, self).__init__(**kwargs)\n        assert isinstance(distpath, DistributionPath)\n        self.distpath = distpath\n\n    def _get_project(self, name):\n        dist = self.distpath.get_distribution(name)\n        if dist is None:\n            result = {'urls': {}, 'digests': {}}\n        else:\n            result = {\n                dist.version: dist,\n                'urls': {\n                    dist.version: set([dist.source_url])\n                },\n                'digests': {\n                    dist.version: set([None])\n                }\n            }\n        return result\n\n\nclass AggregatingLocator(Locator):\n    \"\"\"\n    This class allows you to chain and/or merge a list of locators.\n    \"\"\"\n\n    def __init__(self, *locators, **kwargs):\n        \"\"\"\n        Initialise an instance.\n\n        :param locators: The list of locators to search.\n        :param kwargs: Passed to the superclass constructor,\n                       except for:\n                       * merge - if False (the default), the first successful\n                         search from any of the locators is returned. If True,\n                         the results from all locators are merged (this can be\n                         slow).\n        \"\"\"\n        self.merge = kwargs.pop('merge', False)\n        self.locators = locators\n        super(AggregatingLocator, self).__init__(**kwargs)\n\n    def clear_cache(self):\n        super(AggregatingLocator, self).clear_cache()\n        for locator in self.locators:\n            locator.clear_cache()\n\n    def _set_scheme(self, value):\n        self._scheme = value\n        for locator in self.locators:\n            locator.scheme = value\n\n    scheme = property(Locator.scheme.fget, _set_scheme)\n\n    def _get_project(self, name):\n        result = {}\n        for locator in self.locators:\n            d = locator.get_project(name)\n            if d:\n                if self.merge:\n                    files = result.get('urls', {})\n                    digests = result.get('digests', {})\n                    # next line could overwrite result['urls'], result['digests']\n                    result.update(d)\n                    df = result.get('urls')\n                    if files and df:\n                        for k, v in files.items():\n                            if k in df:\n                                df[k] |= v\n                            else:\n                                df[k] = v\n                    dd = result.get('digests')\n                    if digests and dd:\n                        dd.update(digests)\n                else:\n                    # See issue #18. If any dists are found and we're looking\n                    # for specific constraints, we only return something if\n                    # a match is found. For example, if a DirectoryLocator\n                    # returns just foo (1.0) while we're looking for\n                    # foo (>= 2.0), we'll pretend there was nothing there so\n                    # that subsequent locators can be queried. Otherwise we\n                    # would just return foo (1.0) which would then lead to a\n                    # failure to find foo (>= 2.0), because other locators\n                    # weren't searched. Note that this only matters when\n                    # merge=False.\n                    if self.matcher is None:\n                        found = True\n                    else:\n                        found = False\n                        for k in d:\n                            if self.matcher.match(k):\n                                found = True\n                                break\n                    if found:\n                        result = d\n                        break\n        return result\n\n    def get_distribution_names(self):\n        \"\"\"\n        Return all the distribution names known to this locator.\n        \"\"\"\n        result = set()\n        for locator in self.locators:\n            try:\n                result |= locator.get_distribution_names()\n            except NotImplementedError:\n                pass\n        return result\n\n\n# We use a legacy scheme simply because most of the dists on PyPI use legacy\n# versions which don't conform to PEP 440.\ndefault_locator = AggregatingLocator(\n    # JSONLocator(), # don't use as PEP 426 is withdrawn\n    SimpleScrapingLocator('https://pypi.org/simple/', timeout=3.0),\n    scheme='legacy')\n\nlocate = default_locator.locate\n\n\nclass DependencyFinder(object):\n    \"\"\"\n    Locate dependencies for distributions.\n    \"\"\"\n\n    def __init__(self, locator=None):\n        \"\"\"\n        Initialise an instance, using the specified locator\n        to locate distributions.\n        \"\"\"\n        self.locator = locator or default_locator\n        self.scheme = get_scheme(self.locator.scheme)\n\n    def add_distribution(self, dist):\n        \"\"\"\n        Add a distribution to the finder. This will update internal information\n        about who provides what.\n        :param dist: The distribution to add.\n        \"\"\"\n        logger.debug('adding distribution %s', dist)\n        name = dist.key\n        self.dists_by_name[name] = dist\n        self.dists[(name, dist.version)] = dist\n        for p in dist.provides:\n            name, version = parse_name_and_version(p)\n            logger.debug('Add to provided: %s, %s, %s', name, version, dist)\n            self.provided.setdefault(name, set()).add((version, dist))\n\n    def remove_distribution(self, dist):\n        \"\"\"\n        Remove a distribution from the finder. This will update internal\n        information about who provides what.\n        :param dist: The distribution to remove.\n        \"\"\"\n        logger.debug('removing distribution %s', dist)\n        name = dist.key\n        del self.dists_by_name[name]\n        del self.dists[(name, dist.version)]\n        for p in dist.provides:\n            name, version = parse_name_and_version(p)\n            logger.debug('Remove from provided: %s, %s, %s', name, version, dist)\n            s = self.provided[name]\n            s.remove((version, dist))\n            if not s:\n                del self.provided[name]\n\n    def get_matcher(self, reqt):\n        \"\"\"\n        Get a version matcher for a requirement.\n        :param reqt: The requirement\n        :type reqt: str\n        :return: A version matcher (an instance of\n                 :class:`distlib.version.Matcher`).\n        \"\"\"\n        try:\n            matcher = self.scheme.matcher(reqt)\n        except UnsupportedVersionError:  # pragma: no cover\n            # XXX compat-mode if cannot read the version\n            name = reqt.split()[0]\n            matcher = self.scheme.matcher(name)\n        return matcher\n\n    def find_providers(self, reqt):\n        \"\"\"\n        Find the distributions which can fulfill a requirement.\n\n        :param reqt: The requirement.\n         :type reqt: str\n        :return: A set of distribution which can fulfill the requirement.\n        \"\"\"\n        matcher = self.get_matcher(reqt)\n        name = matcher.key  # case-insensitive\n        result = set()\n        provided = self.provided\n        if name in provided:\n            for version, provider in provided[name]:\n                try:\n                    match = matcher.match(version)\n                except UnsupportedVersionError:\n                    match = False\n\n                if match:\n                    result.add(provider)\n                    break\n        return result\n\n    def try_to_replace(self, provider, other, problems):\n        \"\"\"\n        Attempt to replace one provider with another. This is typically used\n        when resolving dependencies from multiple sources, e.g. A requires\n        (B >= 1.0) while C requires (B >= 1.1).\n\n        For successful replacement, ``provider`` must meet all the requirements\n        which ``other`` fulfills.\n\n        :param provider: The provider we are trying to replace with.\n        :param other: The provider we're trying to replace.\n        :param problems: If False is returned, this will contain what\n                         problems prevented replacement. This is currently\n                         a tuple of the literal string 'cantreplace',\n                         ``provider``, ``other``  and the set of requirements\n                         that ``provider`` couldn't fulfill.\n        :return: True if we can replace ``other`` with ``provider``, else\n                 False.\n        \"\"\"\n        rlist = self.reqts[other]\n        unmatched = set()\n        for s in rlist:\n            matcher = self.get_matcher(s)\n            if not matcher.match(provider.version):\n                unmatched.add(s)\n        if unmatched:\n            # can't replace other with provider\n            problems.add(('cantreplace', provider, other, frozenset(unmatched)))\n            result = False\n        else:\n            # can replace other with provider\n            self.remove_distribution(other)\n            del self.reqts[other]\n            for s in rlist:\n                self.reqts.setdefault(provider, set()).add(s)\n            self.add_distribution(provider)\n            result = True\n        return result\n\n    def find(self, requirement, meta_extras=None, prereleases=False):\n        \"\"\"\n        Find a distribution and all distributions it depends on.\n\n        :param requirement: The requirement specifying the distribution to\n                            find, or a Distribution instance.\n        :param meta_extras: A list of meta extras such as :test:, :build: and\n                            so on.\n        :param prereleases: If ``True``, allow pre-release versions to be\n                            returned - otherwise, don't return prereleases\n                            unless they're all that's available.\n\n        Return a set of :class:`Distribution` instances and a set of\n        problems.\n\n        The distributions returned should be such that they have the\n        :attr:`required` attribute set to ``True`` if they were\n        from the ``requirement`` passed to ``find()``, and they have the\n        :attr:`build_time_dependency` attribute set to ``True`` unless they\n        are post-installation dependencies of the ``requirement``.\n\n        The problems should be a tuple consisting of the string\n        ``'unsatisfied'`` and the requirement which couldn't be satisfied\n        by any distribution known to the locator.\n        \"\"\"\n\n        self.provided = {}\n        self.dists = {}\n        self.dists_by_name = {}\n        self.reqts = {}\n\n        meta_extras = set(meta_extras or [])\n        if ':*:' in meta_extras:\n            meta_extras.remove(':*:')\n            # :meta: and :run: are implicitly included\n            meta_extras |= set([':test:', ':build:', ':dev:'])\n\n        if isinstance(requirement, Distribution):\n            dist = odist = requirement\n            logger.debug('passed %s as requirement', odist)\n        else:\n            dist = odist = self.locator.locate(requirement, prereleases=prereleases)\n            if dist is None:\n                raise DistlibException('Unable to locate %r' % requirement)\n            logger.debug('located %s', odist)\n        dist.requested = True\n        problems = set()\n        todo = set([dist])\n        install_dists = set([odist])\n        while todo:\n            dist = todo.pop()\n            name = dist.key  # case-insensitive\n            if name not in self.dists_by_name:\n                self.add_distribution(dist)\n            else:\n                # import pdb; pdb.set_trace()\n                other = self.dists_by_name[name]\n                if other != dist:\n                    self.try_to_replace(dist, other, problems)\n\n            ireqts = dist.run_requires | dist.meta_requires\n            sreqts = dist.build_requires\n            ereqts = set()\n            if meta_extras and dist in install_dists:\n                for key in ('test', 'build', 'dev'):\n                    e = ':%s:' % key\n                    if e in meta_extras:\n                        ereqts |= getattr(dist, '%s_requires' % key)\n            all_reqts = ireqts | sreqts | ereqts\n            for r in all_reqts:\n                providers = self.find_providers(r)\n                if not providers:\n                    logger.debug('No providers found for %r', r)\n                    provider = self.locator.locate(r, prereleases=prereleases)\n                    # If no provider is found and we didn't consider\n                    # prereleases, consider them now.\n                    if provider is None and not prereleases:\n                        provider = self.locator.locate(r, prereleases=True)\n                    if provider is None:\n                        logger.debug('Cannot satisfy %r', r)\n                        problems.add(('unsatisfied', r))\n                    else:\n                        n, v = provider.key, provider.version\n                        if (n, v) not in self.dists:\n                            todo.add(provider)\n                        providers.add(provider)\n                        if r in ireqts and dist in install_dists:\n                            install_dists.add(provider)\n                            logger.debug('Adding %s to install_dists', provider.name_and_version)\n                for p in providers:\n                    name = p.key\n                    if name not in self.dists_by_name:\n                        self.reqts.setdefault(p, set()).add(r)\n                    else:\n                        other = self.dists_by_name[name]\n                        if other != p:\n                            # see if other can be replaced by p\n                            self.try_to_replace(p, other, problems)\n\n        dists = set(self.dists.values())\n        for dist in dists:\n            dist.build_time_dependency = dist not in install_dists\n            if dist.build_time_dependency:\n                logger.debug('%s is a build-time dependency only.', dist.name_and_version)\n        logger.debug('find done for %s', odist)\n        return dists, problems\n",[],[216,809,810,811,890,891,1958,2012],"094c8f88-67fc-11f0-8791-0224a6c84d84","index.py","094c9028-67fc-11f0-8791-0224a6c84d84",334,["D",1753299263384],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2023 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nimport hashlib\nimport logging\nimport os\nimport shutil\nimport subprocess\nimport tempfile\ntry:\n    from threading import Thread\nexcept ImportError:  # pragma: no cover\n    from dummy_threading import Thread\n\nfrom . import DistlibException\nfrom .compat import (HTTPBasicAuthHandler, Request, HTTPPasswordMgr,\n                     urlparse, build_opener, string_types)\nfrom .util import zip_dir, ServerProxy\n\nlogger = logging.getLogger(__name__)\n\nDEFAULT_INDEX = 'https://pypi.org/pypi'\nDEFAULT_REALM = 'pypi'\n\n\nclass PackageIndex(object):\n    \"\"\"\n    This class represents a package index compatible with PyPI, the Python\n    Package Index.\n    \"\"\"\n\n    boundary = b'----------ThIs_Is_tHe_distlib_index_bouNdaRY_$'\n\n    def __init__(self, url=None):\n        \"\"\"\n        Initialise an instance.\n\n        :param url: The URL of the index. If not specified, the URL for PyPI is\n                    used.\n        \"\"\"\n        self.url = url or DEFAULT_INDEX\n        self.read_configuration()\n        scheme, netloc, path, params, query, frag = urlparse(self.url)\n        if params or query or frag or scheme not in ('http', 'https'):\n            raise DistlibException('invalid repository: %s' % self.url)\n        self.password_handler = None\n        self.ssl_verifier = None\n        self.gpg = None\n        self.gpg_home = None\n        with open(os.devnull, 'w') as sink:\n            # Use gpg by default rather than gpg2, as gpg2 insists on\n            # prompting for passwords\n            for s in ('gpg', 'gpg2'):\n                try:\n                    rc = subprocess.check_call([s, '--version'], stdout=sink,\n                                               stderr=sink)\n                    if rc == 0:\n                        self.gpg = s\n                        break\n                except OSError:\n                    pass\n\n    def _get_pypirc_command(self):\n        \"\"\"\n        Get the distutils command for interacting with PyPI configurations.\n        :return: the command.\n        \"\"\"\n        from .util import _get_pypirc_command as cmd\n        return cmd()\n\n    def read_configuration(self):\n        \"\"\"\n        Read the PyPI access configuration as supported by distutils. This populates\n        ``username``, ``password``, ``realm`` and ``url`` attributes from the\n        configuration.\n        \"\"\"\n        from .util import _load_pypirc\n        cfg = _load_pypirc(self)\n        self.username = cfg.get('username')\n        self.password = cfg.get('password')\n        self.realm = cfg.get('realm', 'pypi')\n        self.url = cfg.get('repository', self.url)\n\n    def save_configuration(self):\n        \"\"\"\n        Save the PyPI access configuration. You must have set ``username`` and\n        ``password`` attributes before calling this method.\n        \"\"\"\n        self.check_credentials()\n        from .util import _store_pypirc\n        _store_pypirc(self)\n\n    def check_credentials(self):\n        \"\"\"\n        Check that ``username`` and ``password`` have been set, and raise an\n        exception if not.\n        \"\"\"\n        if self.username is None or self.password is None:\n            raise DistlibException('username and password must be set')\n        pm = HTTPPasswordMgr()\n        _, netloc, _, _, _, _ = urlparse(self.url)\n        pm.add_password(self.realm, netloc, self.username, self.password)\n        self.password_handler = HTTPBasicAuthHandler(pm)\n\n    def register(self, metadata):  # pragma: no cover\n        \"\"\"\n        Register a distribution on PyPI, using the provided metadata.\n\n        :param metadata: A :class:`Metadata` instance defining at least a name\n                         and version number for the distribution to be\n                         registered.\n        :return: The HTTP response received from PyPI upon submission of the\n                request.\n        \"\"\"\n        self.check_credentials()\n        metadata.validate()\n        d = metadata.todict()\n        d[':action'] = 'verify'\n        request = self.encode_request(d.items(), [])\n        self.send_request(request)\n        d[':action'] = 'submit'\n        request = self.encode_request(d.items(), [])\n        return self.send_request(request)\n\n    def _reader(self, name, stream, outbuf):\n        \"\"\"\n        Thread runner for reading lines of from a subprocess into a buffer.\n\n        :param name: The logical name of the stream (used for logging only).\n        :param stream: The stream to read from. This will typically a pipe\n                       connected to the output stream of a subprocess.\n        :param outbuf: The list to append the read lines to.\n        \"\"\"\n        while True:\n            s = stream.readline()\n            if not s:\n                break\n            s = s.decode('utf-8').rstrip()\n            outbuf.append(s)\n            logger.debug('%s: %s' % (name, s))\n        stream.close()\n\n    def get_sign_command(self, filename, signer, sign_password, keystore=None):  # pragma: no cover\n        \"\"\"\n        Return a suitable command for signing a file.\n\n        :param filename: The pathname to the file to be signed.\n        :param signer: The identifier of the signer of the file.\n        :param sign_password: The passphrase for the signer's\n                              private key used for signing.\n        :param keystore: The path to a directory which contains the keys\n                         used in verification. If not specified, the\n                         instance's ``gpg_home`` attribute is used instead.\n        :return: The signing command as a list suitable to be\n                 passed to :class:`subprocess.Popen`.\n        \"\"\"\n        cmd = [self.gpg, '--status-fd', '2', '--no-tty']\n        if keystore is None:\n            keystore = self.gpg_home\n        if keystore:\n            cmd.extend(['--homedir', keystore])\n        if sign_password is not None:\n            cmd.extend(['--batch', '--passphrase-fd', '0'])\n        td = tempfile.mkdtemp()\n        sf = os.path.join(td, os.path.basename(filename) + '.asc')\n        cmd.extend(['--detach-sign', '--armor', '--local-user',\n                    signer, '--output', sf, filename])\n        logger.debug('invoking: %s', ' '.join(cmd))\n        return cmd, sf\n\n    def run_command(self, cmd, input_data=None):\n        \"\"\"\n        Run a command in a child process , passing it any input data specified.\n\n        :param cmd: The command to run.\n        :param input_data: If specified, this must be a byte string containing\n                           data to be sent to the child process.\n        :return: A tuple consisting of the subprocess' exit code, a list of\n                 lines read from the subprocess' ``stdout``, and a list of\n                 lines read from the subprocess' ``stderr``.\n        \"\"\"\n        kwargs = {\n            'stdout': subprocess.PIPE,\n            'stderr': subprocess.PIPE,\n        }\n        if input_data is not None:\n            kwargs['stdin'] = subprocess.PIPE\n        stdout = []\n        stderr = []\n        p = subprocess.Popen(cmd, **kwargs)\n        # We don't use communicate() here because we may need to\n        # get clever with interacting with the command\n        t1 = Thread(target=self._reader, args=('stdout', p.stdout, stdout))\n        t1.start()\n        t2 = Thread(target=self._reader, args=('stderr', p.stderr, stderr))\n        t2.start()\n        if input_data is not None:\n            p.stdin.write(input_data)\n            p.stdin.close()\n\n        p.wait()\n        t1.join()\n        t2.join()\n        return p.returncode, stdout, stderr\n\n    def sign_file(self, filename, signer, sign_password, keystore=None):  # pragma: no cover\n        \"\"\"\n        Sign a file.\n\n        :param filename: The pathname to the file to be signed.\n        :param signer: The identifier of the signer of the file.\n        :param sign_password: The passphrase for the signer's\n                              private key used for signing.\n        :param keystore: The path to a directory which contains the keys\n                         used in signing. If not specified, the instance's\n                         ``gpg_home`` attribute is used instead.\n        :return: The absolute pathname of the file where the signature is\n                 stored.\n        \"\"\"\n        cmd, sig_file = self.get_sign_command(filename, signer, sign_password,\n                                              keystore)\n        rc, stdout, stderr = self.run_command(cmd,\n                                              sign_password.encode('utf-8'))\n        if rc != 0:\n            raise DistlibException('sign command failed with error '\n                                   'code %s' % rc)\n        return sig_file\n\n    def upload_file(self, metadata, filename, signer=None, sign_password=None,\n                    filetype='sdist', pyversion='source', keystore=None):\n        \"\"\"\n        Upload a release file to the index.\n\n        :param metadata: A :class:`Metadata` instance defining at least a name\n                         and version number for the file to be uploaded.\n        :param filename: The pathname of the file to be uploaded.\n        :param signer: The identifier of the signer of the file.\n        :param sign_password: The passphrase for the signer's\n                              private key used for signing.\n        :param filetype: The type of the file being uploaded. This is the\n                        distutils command which produced that file, e.g.\n                        ``sdist`` or ``bdist_wheel``.\n        :param pyversion: The version of Python which the release relates\n                          to. For code compatible with any Python, this would\n                          be ``source``, otherwise it would be e.g. ``3.2``.\n        :param keystore: The path to a directory which contains the keys\n                         used in signing. If not specified, the instance's\n                         ``gpg_home`` attribute is used instead.\n        :return: The HTTP response received from PyPI upon submission of the\n                request.\n        \"\"\"\n        self.check_credentials()\n        if not os.path.exists(filename):\n            raise DistlibException('not found: %s' % filename)\n        metadata.validate()\n        d = metadata.todict()\n        sig_file = None\n        if signer:\n            if not self.gpg:\n                logger.warning('no signing program available - not signed')\n            else:\n                sig_file = self.sign_file(filename, signer, sign_password,\n                                          keystore)\n        with open(filename, 'rb') as f:\n            file_data = f.read()\n        md5_digest = hashlib.md5(file_data).hexdigest()\n        sha256_digest = hashlib.sha256(file_data).hexdigest()\n        d.update({\n            ':action': 'file_upload',\n            'protocol_version': '1',\n            'filetype': filetype,\n            'pyversion': pyversion,\n            'md5_digest': md5_digest,\n            'sha256_digest': sha256_digest,\n        })\n        files = [('content', os.path.basename(filename), file_data)]\n        if sig_file:\n            with open(sig_file, 'rb') as f:\n                sig_data = f.read()\n            files.append(('gpg_signature', os.path.basename(sig_file),\n                         sig_data))\n            shutil.rmtree(os.path.dirname(sig_file))\n        request = self.encode_request(d.items(), files)\n        return self.send_request(request)\n\n    def upload_documentation(self, metadata, doc_dir):  # pragma: no cover\n        \"\"\"\n        Upload documentation to the index.\n\n        :param metadata: A :class:`Metadata` instance defining at least a name\n                         and version number for the documentation to be\n                         uploaded.\n        :param doc_dir: The pathname of the directory which contains the\n                        documentation. This should be the directory that\n                        contains the ``index.html`` for the documentation.\n        :return: The HTTP response received from PyPI upon submission of the\n                request.\n        \"\"\"\n        self.check_credentials()\n        if not os.path.isdir(doc_dir):\n            raise DistlibException('not a directory: %r' % doc_dir)\n        fn = os.path.join(doc_dir, 'index.html')\n        if not os.path.exists(fn):\n            raise DistlibException('not found: %r' % fn)\n        metadata.validate()\n        name, version = metadata.name, metadata.version\n        zip_data = zip_dir(doc_dir).getvalue()\n        fields = [(':action', 'doc_upload'),\n                  ('name', name), ('version', version)]\n        files = [('content', name, zip_data)]\n        request = self.encode_request(fields, files)\n        return self.send_request(request)\n\n    def get_verify_command(self, signature_filename, data_filename,\n                           keystore=None):\n        \"\"\"\n        Return a suitable command for verifying a file.\n\n        :param signature_filename: The pathname to the file containing the\n                                   signature.\n        :param data_filename: The pathname to the file containing the\n                              signed data.\n        :param keystore: The path to a directory which contains the keys\n                         used in verification. If not specified, the\n                         instance's ``gpg_home`` attribute is used instead.\n        :return: The verifying command as a list suitable to be\n                 passed to :class:`subprocess.Popen`.\n        \"\"\"\n        cmd = [self.gpg, '--status-fd', '2', '--no-tty']\n        if keystore is None:\n            keystore = self.gpg_home\n        if keystore:\n            cmd.extend(['--homedir', keystore])\n        cmd.extend(['--verify', signature_filename, data_filename])\n        logger.debug('invoking: %s', ' '.join(cmd))\n        return cmd\n\n    def verify_signature(self, signature_filename, data_filename,\n                         keystore=None):\n        \"\"\"\n        Verify a signature for a file.\n\n        :param signature_filename: The pathname to the file containing the\n                                   signature.\n        :param data_filename: The pathname to the file containing the\n                              signed data.\n        :param keystore: The path to a directory which contains the keys\n                         used in verification. If not specified, the\n                         instance's ``gpg_home`` attribute is used instead.\n        :return: True if the signature was verified, else False.\n        \"\"\"\n        if not self.gpg:\n            raise DistlibException('verification unavailable because gpg '\n                                   'unavailable')\n        cmd = self.get_verify_command(signature_filename, data_filename,\n                                      keystore)\n        rc, stdout, stderr = self.run_command(cmd)\n        if rc not in (0, 1):\n            raise DistlibException('verify command failed with error code %s' % rc)\n        return rc == 0\n\n    def download_file(self, url, destfile, digest=None, reporthook=None):\n        \"\"\"\n        This is a convenience method for downloading a file from an URL.\n        Normally, this will be a file from the index, though currently\n        no check is made for this (i.e. a file can be downloaded from\n        anywhere).\n\n        The method is just like the :func:`urlretrieve` function in the\n        standard library, except that it allows digest computation to be\n        done during download and checking that the downloaded data\n        matched any expected value.\n\n        :param url: The URL of the file to be downloaded (assumed to be\n                    available via an HTTP GET request).\n        :param destfile: The pathname where the downloaded file is to be\n                         saved.\n        :param digest: If specified, this must be a (hasher, value)\n                       tuple, where hasher is the algorithm used (e.g.\n                       ``'md5'``) and ``value`` is the expected value.\n        :param reporthook: The same as for :func:`urlretrieve` in the\n                           standard library.\n        \"\"\"\n        if digest is None:\n            digester = None\n            logger.debug('No digest specified')\n        else:\n            if isinstance(digest, (list, tuple)):\n                hasher, digest = digest\n            else:\n                hasher = 'md5'\n            digester = getattr(hashlib, hasher)()\n            logger.debug('Digest specified: %s' % digest)\n        # The following code is equivalent to urlretrieve.\n        # We need to do it this way so that we can compute the\n        # digest of the file as we go.\n        with open(destfile, 'wb') as dfp:\n            # addinfourl is not a context manager on 2.x\n            # so we have to use try/finally\n            sfp = self.send_request(Request(url))\n            try:\n                headers = sfp.info()\n                blocksize = 8192\n                size = -1\n                read = 0\n                blocknum = 0\n                if \"content-length\" in headers:\n                    size = int(headers[\"Content-Length\"])\n                if reporthook:\n                    reporthook(blocknum, blocksize, size)\n                while True:\n                    block = sfp.read(blocksize)\n                    if not block:\n                        break\n                    read += len(block)\n                    dfp.write(block)\n                    if digester:\n                        digester.update(block)\n                    blocknum += 1\n                    if reporthook:\n                        reporthook(blocknum, blocksize, size)\n            finally:\n                sfp.close()\n\n        # check that we got the whole file, if we can\n        if size >= 0 and read < size:\n            raise DistlibException(\n                'retrieval incomplete: got only %d out of %d bytes'\n                % (read, size))\n        # if we have a digest, it must match.\n        if digester:\n            actual = digester.hexdigest()\n            if digest != actual:\n                raise DistlibException('%s digest mismatch for %s: expected '\n                                       '%s, got %s' % (hasher, destfile,\n                                                       digest, actual))\n            logger.debug('Digest verified: %s', digest)\n\n    def send_request(self, req):\n        \"\"\"\n        Send a standard library :class:`Request` to PyPI and return its\n        response.\n\n        :param req: The request to send.\n        :return: The HTTP response from PyPI (a standard library HTTPResponse).\n        \"\"\"\n        handlers = []\n        if self.password_handler:\n            handlers.append(self.password_handler)\n        if self.ssl_verifier:\n            handlers.append(self.ssl_verifier)\n        opener = build_opener(*handlers)\n        return opener.open(req)\n\n    def encode_request(self, fields, files):\n        \"\"\"\n        Encode fields and files for posting to an HTTP server.\n\n        :param fields: The fields to send as a list of (fieldname, value)\n                       tuples.\n        :param files: The files to send as a list of (fieldname, filename,\n                      file_bytes) tuple.\n        \"\"\"\n        # Adapted from packaging, which in turn was adapted from\n        # http://code.activestate.com/recipes/146306\n\n        parts = []\n        boundary = self.boundary\n        for k, values in fields:\n            if not isinstance(values, (list, tuple)):\n                values = [values]\n\n            for v in values:\n                parts.extend((\n                    b'--' + boundary,\n                    ('Content-Disposition: form-data; name=\"%s\"' %\n                     k).encode('utf-8'),\n                    b'',\n                    v.encode('utf-8')))\n        for key, filename, value in files:\n            parts.extend((\n                b'--' + boundary,\n                ('Content-Disposition: form-data; name=\"%s\"; filename=\"%s\"' %\n                 (key, filename)).encode('utf-8'),\n                b'',\n                value))\n\n        parts.extend((b'--' + boundary + b'--', b''))\n\n        body = b'\\r\\n'.join(parts)\n        ct = b'multipart/form-data; boundary=' + boundary\n        headers = {\n            'Content-type': ct,\n            'Content-length': str(len(body))\n        }\n        return Request(self.url, body, headers)\n\n    def search(self, terms, operator=None):  # pragma: no cover\n        if isinstance(terms, string_types):\n            terms = {'name': terms}\n        rpc_proxy = ServerProxy(self.url, timeout=3.0)\n        try:\n            return rpc_proxy.search(terms, operator or 'and')\n        finally:\n            rpc_proxy('close')()\n",[],[216,809,810,811,890,891,1958,2020],"097befb2-67fc-11f0-a99a-0224a6c84d84","database.py","097bf052-67fc-11f0-a99a-0224a6c84d84",340,["D",1753299263533],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2012-2023 The Python Software Foundation.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\n\"\"\"PEP 376 implementation.\"\"\"\n\nfrom __future__ import unicode_literals\n\nimport base64\nimport codecs\nimport contextlib\nimport hashlib\nimport logging\nimport os\nimport posixpath\nimport sys\nimport zipimport\n\nfrom . import DistlibException, resources\nfrom .compat import StringIO\nfrom .version import get_scheme, UnsupportedVersionError\nfrom .metadata import (Metadata, METADATA_FILENAME, WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME)\nfrom .util import (parse_requirement, cached_property, parse_name_and_version, read_exports, write_exports, CSVReader,\n                   CSVWriter)\n\n__all__ = [\n    'Distribution', 'BaseInstalledDistribution', 'InstalledDistribution', 'EggInfoDistribution', 'DistributionPath'\n]\n\nlogger = logging.getLogger(__name__)\n\nEXPORTS_FILENAME = 'pydist-exports.json'\nCOMMANDS_FILENAME = 'pydist-commands.json'\n\nDIST_FILES = ('INSTALLER', METADATA_FILENAME, 'RECORD', 'REQUESTED', 'RESOURCES', EXPORTS_FILENAME, 'SHARED')\n\nDISTINFO_EXT = '.dist-info'\n\n\nclass _Cache(object):\n    \"\"\"\n    A simple cache mapping names and .dist-info paths to distributions\n    \"\"\"\n\n    def __init__(self):\n        \"\"\"\n        Initialise an instance. There is normally one for each DistributionPath.\n        \"\"\"\n        self.name = {}\n        self.path = {}\n        self.generated = False\n\n    def clear(self):\n        \"\"\"\n        Clear the cache, setting it to its initial state.\n        \"\"\"\n        self.name.clear()\n        self.path.clear()\n        self.generated = False\n\n    def add(self, dist):\n        \"\"\"\n        Add a distribution to the cache.\n        :param dist: The distribution to add.\n        \"\"\"\n        if dist.path not in self.path:\n            self.path[dist.path] = dist\n            self.name.setdefault(dist.key, []).append(dist)\n\n\nclass DistributionPath(object):\n    \"\"\"\n    Represents a set of distributions installed on a path (typically sys.path).\n    \"\"\"\n\n    def __init__(self, path=None, include_egg=False):\n        \"\"\"\n        Create an instance from a path, optionally including legacy (distutils/\n        setuptools/distribute) distributions.\n        :param path: The path to use, as a list of directories. If not specified,\n                     sys.path is used.\n        :param include_egg: If True, this instance will look for and return legacy\n                            distributions as well as those based on PEP 376.\n        \"\"\"\n        if path is None:\n            path = sys.path\n        self.path = path\n        self._include_dist = True\n        self._include_egg = include_egg\n\n        self._cache = _Cache()\n        self._cache_egg = _Cache()\n        self._cache_enabled = True\n        self._scheme = get_scheme('default')\n\n    def _get_cache_enabled(self):\n        return self._cache_enabled\n\n    def _set_cache_enabled(self, value):\n        self._cache_enabled = value\n\n    cache_enabled = property(_get_cache_enabled, _set_cache_enabled)\n\n    def clear_cache(self):\n        \"\"\"\n        Clears the internal cache.\n        \"\"\"\n        self._cache.clear()\n        self._cache_egg.clear()\n\n    def _yield_distributions(self):\n        \"\"\"\n        Yield .dist-info and/or .egg(-info) distributions.\n        \"\"\"\n        # We need to check if we've seen some resources already, because on\n        # some Linux systems (e.g. some Debian/Ubuntu variants) there are\n        # symlinks which alias other files in the environment.\n        seen = set()\n        for path in self.path:\n            finder = resources.finder_for_path(path)\n            if finder is None:\n                continue\n            r = finder.find('')\n            if not r or not r.is_container:\n                continue\n            rset = sorted(r.resources)\n            for entry in rset:\n                r = finder.find(entry)\n                if not r or r.path in seen:\n                    continue\n                try:\n                    if self._include_dist and entry.endswith(DISTINFO_EXT):\n                        possible_filenames = [METADATA_FILENAME, WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME]\n                        for metadata_filename in possible_filenames:\n                            metadata_path = posixpath.join(entry, metadata_filename)\n                            pydist = finder.find(metadata_path)\n                            if pydist:\n                                break\n                        else:\n                            continue\n\n                        with contextlib.closing(pydist.as_stream()) as stream:\n                            metadata = Metadata(fileobj=stream, scheme='legacy')\n                        logger.debug('Found %s', r.path)\n                        seen.add(r.path)\n                        yield new_dist_class(r.path, metadata=metadata, env=self)\n                    elif self._include_egg and entry.endswith(('.egg-info', '.egg')):\n                        logger.debug('Found %s', r.path)\n                        seen.add(r.path)\n                        yield old_dist_class(r.path, self)\n                except Exception as e:\n                    msg = 'Unable to read distribution at %s, perhaps due to bad metadata: %s'\n                    logger.warning(msg, r.path, e)\n                    import warnings\n                    warnings.warn(msg % (r.path, e), stacklevel=2)\n\n    def _generate_cache(self):\n        \"\"\"\n        Scan the path for distributions and populate the cache with\n        those that are found.\n        \"\"\"\n        gen_dist = not self._cache.generated\n        gen_egg = self._include_egg and not self._cache_egg.generated\n        if gen_dist or gen_egg:\n            for dist in self._yield_distributions():\n                if isinstance(dist, InstalledDistribution):\n                    self._cache.add(dist)\n                else:\n                    self._cache_egg.add(dist)\n\n            if gen_dist:\n                self._cache.generated = True\n            if gen_egg:\n                self._cache_egg.generated = True\n\n    @classmethod\n    def distinfo_dirname(cls, name, version):\n        \"\"\"\n        The *name* and *version* parameters are converted into their\n        filename-escaped form, i.e. any ``'-'`` characters are replaced\n        with ``'_'`` other than the one in ``'dist-info'`` and the one\n        separating the name from the version number.\n\n        :parameter name: is converted to a standard distribution name by replacing\n                         any runs of non- alphanumeric characters with a single\n                         ``'-'``.\n        :type name: string\n        :parameter version: is converted to a standard version string. Spaces\n                            become dots, and all other non-alphanumeric characters\n                            (except dots) become dashes, with runs of multiple\n                            dashes condensed to a single dash.\n        :type version: string\n        :returns: directory name\n        :rtype: string\"\"\"\n        name = name.replace('-', '_')\n        return '-'.join([name, version]) + DISTINFO_EXT\n\n    def get_distributions(self):\n        \"\"\"\n        Provides an iterator that looks for distributions and returns\n        :class:`InstalledDistribution` or\n        :class:`EggInfoDistribution` instances for each one of them.\n\n        :rtype: iterator of :class:`InstalledDistribution` and\n                :class:`EggInfoDistribution` instances\n        \"\"\"\n        if not self._cache_enabled:\n            for dist in self._yield_distributions():\n                yield dist\n        else:\n            self._generate_cache()\n\n            for dist in self._cache.path.values():\n                yield dist\n\n            if self._include_egg:\n                for dist in self._cache_egg.path.values():\n                    yield dist\n\n    def get_distribution(self, name):\n        \"\"\"\n        Looks for a named distribution on the path.\n\n        This function only returns the first result found, as no more than one\n        value is expected. If nothing is found, ``None`` is returned.\n\n        :rtype: :class:`InstalledDistribution`, :class:`EggInfoDistribution`\n                or ``None``\n        \"\"\"\n        result = None\n        name = name.lower()\n        if not self._cache_enabled:\n            for dist in self._yield_distributions():\n                if dist.key == name:\n                    result = dist\n                    break\n        else:\n            self._generate_cache()\n\n            if name in self._cache.name:\n                result = self._cache.name[name][0]\n            elif self._include_egg and name in self._cache_egg.name:\n                result = self._cache_egg.name[name][0]\n        return result\n\n    def provides_distribution(self, name, version=None):\n        \"\"\"\n        Iterates over all distributions to find which distributions provide *name*.\n        If a *version* is provided, it will be used to filter the results.\n\n        This function only returns the first result found, since no more than\n        one values are expected. If the directory is not found, returns ``None``.\n\n        :parameter version: a version specifier that indicates the version\n                            required, conforming to the format in ``PEP-345``\n\n        :type name: string\n        :type version: string\n        \"\"\"\n        matcher = None\n        if version is not None:\n            try:\n                matcher = self._scheme.matcher('%s (%s)' % (name, version))\n            except ValueError:\n                raise DistlibException('invalid name or version: %r, %r' % (name, version))\n\n        for dist in self.get_distributions():\n            # We hit a problem on Travis where enum34 was installed and doesn't\n            # have a provides attribute ...\n            if not hasattr(dist, 'provides'):\n                logger.debug('No \"provides\": %s', dist)\n            else:\n                provided = dist.provides\n\n                for p in provided:\n                    p_name, p_ver = parse_name_and_version(p)\n                    if matcher is None:\n                        if p_name == name:\n                            yield dist\n                            break\n                    else:\n                        if p_name == name and matcher.match(p_ver):\n                            yield dist\n                            break\n\n    def get_file_path(self, name, relative_path):\n        \"\"\"\n        Return the path to a resource file.\n        \"\"\"\n        dist = self.get_distribution(name)\n        if dist is None:\n            raise LookupError('no distribution named %r found' % name)\n        return dist.get_resource_path(relative_path)\n\n    def get_exported_entries(self, category, name=None):\n        \"\"\"\n        Return all of the exported entries in a particular category.\n\n        :param category: The category to search for entries.\n        :param name: If specified, only entries with that name are returned.\n        \"\"\"\n        for dist in self.get_distributions():\n            r = dist.exports\n            if category in r:\n                d = r[category]\n                if name is not None:\n                    if name in d:\n                        yield d[name]\n                else:\n                    for v in d.values():\n                        yield v\n\n\nclass Distribution(object):\n    \"\"\"\n    A base class for distributions, whether installed or from indexes.\n    Either way, it must have some metadata, so that's all that's needed\n    for construction.\n    \"\"\"\n\n    build_time_dependency = False\n    \"\"\"\n    Set to True if it's known to be only a build-time dependency (i.e.\n    not needed after installation).\n    \"\"\"\n\n    requested = False\n    \"\"\"A boolean that indicates whether the ``REQUESTED`` metadata file is\n    present (in other words, whether the package was installed by user\n    request or it was installed as a dependency).\"\"\"\n\n    def __init__(self, metadata):\n        \"\"\"\n        Initialise an instance.\n        :param metadata: The instance of :class:`Metadata` describing this\n        distribution.\n        \"\"\"\n        self.metadata = metadata\n        self.name = metadata.name\n        self.key = self.name.lower()  # for case-insensitive comparisons\n        self.version = metadata.version\n        self.locator = None\n        self.digest = None\n        self.extras = None  # additional features requested\n        self.context = None  # environment marker overrides\n        self.download_urls = set()\n        self.digests = {}\n\n    @property\n    def source_url(self):\n        \"\"\"\n        The source archive download URL for this distribution.\n        \"\"\"\n        return self.metadata.source_url\n\n    download_url = source_url  # Backward compatibility\n\n    @property\n    def name_and_version(self):\n        \"\"\"\n        A utility property which displays the name and version in parentheses.\n        \"\"\"\n        return '%s (%s)' % (self.name, self.version)\n\n    @property\n    def provides(self):\n        \"\"\"\n        A set of distribution names and versions provided by this distribution.\n        :return: A set of \"name (version)\" strings.\n        \"\"\"\n        plist = self.metadata.provides\n        s = '%s (%s)' % (self.name, self.version)\n        if s not in plist:\n            plist.append(s)\n        return plist\n\n    def _get_requirements(self, req_attr):\n        md = self.metadata\n        reqts = getattr(md, req_attr)\n        logger.debug('%s: got requirements %r from metadata: %r', self.name, req_attr, reqts)\n        return set(md.get_requirements(reqts, extras=self.extras, env=self.context))\n\n    @property\n    def run_requires(self):\n        return self._get_requirements('run_requires')\n\n    @property\n    def meta_requires(self):\n        return self._get_requirements('meta_requires')\n\n    @property\n    def build_requires(self):\n        return self._get_requirements('build_requires')\n\n    @property\n    def test_requires(self):\n        return self._get_requirements('test_requires')\n\n    @property\n    def dev_requires(self):\n        return self._get_requirements('dev_requires')\n\n    def matches_requirement(self, req):\n        \"\"\"\n        Say if this instance matches (fulfills) a requirement.\n        :param req: The requirement to match.\n        :rtype req: str\n        :return: True if it matches, else False.\n        \"\"\"\n        # Requirement may contain extras - parse to lose those\n        # from what's passed to the matcher\n        r = parse_requirement(req)\n        scheme = get_scheme(self.metadata.scheme)\n        try:\n            matcher = scheme.matcher(r.requirement)\n        except UnsupportedVersionError:\n            # XXX compat-mode if cannot read the version\n            logger.warning('could not read version %r - using name only', req)\n            name = req.split()[0]\n            matcher = scheme.matcher(name)\n\n        name = matcher.key  # case-insensitive\n\n        result = False\n        for p in self.provides:\n            p_name, p_ver = parse_name_and_version(p)\n            if p_name != name:\n                continue\n            try:\n                result = matcher.match(p_ver)\n                break\n            except UnsupportedVersionError:\n                pass\n        return result\n\n    def __repr__(self):\n        \"\"\"\n        Return a textual representation of this instance,\n        \"\"\"\n        if self.source_url:\n            suffix = ' [%s]' % self.source_url\n        else:\n            suffix = ''\n        return '' % (self.name, self.version, suffix)\n\n    def __eq__(self, other):\n        \"\"\"\n        See if this distribution is the same as another.\n        :param other: The distribution to compare with. To be equal to one\n                      another. distributions must have the same type, name,\n                      version and source_url.\n        :return: True if it is the same, else False.\n        \"\"\"\n        if type(other) is not type(self):\n            result = False\n        else:\n            result = (self.name == other.name and self.version == other.version and self.source_url == other.source_url)\n        return result\n\n    def __hash__(self):\n        \"\"\"\n        Compute hash in a way which matches the equality test.\n        \"\"\"\n        return hash(self.name) + hash(self.version) + hash(self.source_url)\n\n\nclass BaseInstalledDistribution(Distribution):\n    \"\"\"\n    This is the base class for installed distributions (whether PEP 376 or\n    legacy).\n    \"\"\"\n\n    hasher = None\n\n    def __init__(self, metadata, path, env=None):\n        \"\"\"\n        Initialise an instance.\n        :param metadata: An instance of :class:`Metadata` which describes the\n                         distribution. This will normally have been initialised\n                         from a metadata file in the ``path``.\n        :param path:     The path of the ``.dist-info`` or ``.egg-info``\n                         directory for the distribution.\n        :param env:      This is normally the :class:`DistributionPath`\n                         instance where this distribution was found.\n        \"\"\"\n        super(BaseInstalledDistribution, self).__init__(metadata)\n        self.path = path\n        self.dist_path = env\n\n    def get_hash(self, data, hasher=None):\n        \"\"\"\n        Get the hash of some data, using a particular hash algorithm, if\n        specified.\n\n        :param data: The data to be hashed.\n        :type data: bytes\n        :param hasher: The name of a hash implementation, supported by hashlib,\n                       or ``None``. Examples of valid values are ``'sha1'``,\n                       ``'sha224'``, ``'sha384'``, '``sha256'``, ``'md5'`` and\n                       ``'sha512'``. If no hasher is specified, the ``hasher``\n                       attribute of the :class:`InstalledDistribution` instance\n                       is used. If the hasher is determined to be ``None``, MD5\n                       is used as the hashing algorithm.\n        :returns: The hash of the data. If a hasher was explicitly specified,\n                  the returned hash will be prefixed with the specified hasher\n                  followed by '='.\n        :rtype: str\n        \"\"\"\n        if hasher is None:\n            hasher = self.hasher\n        if hasher is None:\n            hasher = hashlib.md5\n            prefix = ''\n        else:\n            hasher = getattr(hashlib, hasher)\n            prefix = '%s=' % self.hasher\n        digest = hasher(data).digest()\n        digest = base64.urlsafe_b64encode(digest).rstrip(b'=').decode('ascii')\n        return '%s%s' % (prefix, digest)\n\n\nclass InstalledDistribution(BaseInstalledDistribution):\n    \"\"\"\n    Created with the *path* of the ``.dist-info`` directory provided to the\n    constructor. It reads the metadata contained in ``pydist.json`` when it is\n    instantiated., or uses a passed in Metadata instance (useful for when\n    dry-run mode is being used).\n    \"\"\"\n\n    hasher = 'sha256'\n\n    def __init__(self, path, metadata=None, env=None):\n        self.modules = []\n        self.finder = finder = resources.finder_for_path(path)\n        if finder is None:\n            raise ValueError('finder unavailable for %s' % path)\n        if env and env._cache_enabled and path in env._cache.path:\n            metadata = env._cache.path[path].metadata\n        elif metadata is None:\n            r = finder.find(METADATA_FILENAME)\n            # Temporary - for Wheel 0.23 support\n            if r is None:\n                r = finder.find(WHEEL_METADATA_FILENAME)\n            # Temporary - for legacy support\n            if r is None:\n                r = finder.find(LEGACY_METADATA_FILENAME)\n            if r is None:\n                raise ValueError('no %s found in %s' % (METADATA_FILENAME, path))\n            with contextlib.closing(r.as_stream()) as stream:\n                metadata = Metadata(fileobj=stream, scheme='legacy')\n\n        super(InstalledDistribution, self).__init__(metadata, path, env)\n\n        if env and env._cache_enabled:\n            env._cache.add(self)\n\n        r = finder.find('REQUESTED')\n        self.requested = r is not None\n        p = os.path.join(path, 'top_level.txt')\n        if os.path.exists(p):\n            with open(p, 'rb') as f:\n                data = f.read().decode('utf-8')\n            self.modules = data.splitlines()\n\n    def __repr__(self):\n        return '' % (self.name, self.version, self.path)\n\n    def __str__(self):\n        return \"%s %s\" % (self.name, self.version)\n\n    def _get_records(self):\n        \"\"\"\n        Get the list of installed files for the distribution\n        :return: A list of tuples of path, hash and size. Note that hash and\n                 size might be ``None`` for some entries. The path is exactly\n                 as stored in the file (which is as in PEP 376).\n        \"\"\"\n        results = []\n        r = self.get_distinfo_resource('RECORD')\n        with contextlib.closing(r.as_stream()) as stream:\n            with CSVReader(stream=stream) as record_reader:\n                # Base location is parent dir of .dist-info dir\n                # base_location = os.path.dirname(self.path)\n                # base_location = os.path.abspath(base_location)\n                for row in record_reader:\n                    missing = [None for i in range(len(row), 3)]\n                    path, checksum, size = row + missing\n                    # if not os.path.isabs(path):\n                    #     path = path.replace('/', os.sep)\n                    #     path = os.path.join(base_location, path)\n                    results.append((path, checksum, size))\n        return results\n\n    @cached_property\n    def exports(self):\n        \"\"\"\n        Return the information exported by this distribution.\n        :return: A dictionary of exports, mapping an export category to a dict\n                 of :class:`ExportEntry` instances describing the individual\n                 export entries, and keyed by name.\n        \"\"\"\n        result = {}\n        r = self.get_distinfo_resource(EXPORTS_FILENAME)\n        if r:\n            result = self.read_exports()\n        return result\n\n    def read_exports(self):\n        \"\"\"\n        Read exports data from a file in .ini format.\n\n        :return: A dictionary of exports, mapping an export category to a list\n                 of :class:`ExportEntry` instances describing the individual\n                 export entries.\n        \"\"\"\n        result = {}\n        r = self.get_distinfo_resource(EXPORTS_FILENAME)\n        if r:\n            with contextlib.closing(r.as_stream()) as stream:\n                result = read_exports(stream)\n        return result\n\n    def write_exports(self, exports):\n        \"\"\"\n        Write a dictionary of exports to a file in .ini format.\n        :param exports: A dictionary of exports, mapping an export category to\n                        a list of :class:`ExportEntry` instances describing the\n                        individual export entries.\n        \"\"\"\n        rf = self.get_distinfo_file(EXPORTS_FILENAME)\n        with open(rf, 'w') as f:\n            write_exports(exports, f)\n\n    def get_resource_path(self, relative_path):\n        \"\"\"\n        NOTE: This API may change in the future.\n\n        Return the absolute path to a resource file with the given relative\n        path.\n\n        :param relative_path: The path, relative to .dist-info, of the resource\n                              of interest.\n        :return: The absolute path where the resource is to be found.\n        \"\"\"\n        r = self.get_distinfo_resource('RESOURCES')\n        with contextlib.closing(r.as_stream()) as stream:\n            with CSVReader(stream=stream) as resources_reader:\n                for relative, destination in resources_reader:\n                    if relative == relative_path:\n                        return destination\n        raise KeyError('no resource file with relative path %r '\n                       'is installed' % relative_path)\n\n    def list_installed_files(self):\n        \"\"\"\n        Iterates over the ``RECORD`` entries and returns a tuple\n        ``(path, hash, size)`` for each line.\n\n        :returns: iterator of (path, hash, size)\n        \"\"\"\n        for result in self._get_records():\n            yield result\n\n    def write_installed_files(self, paths, prefix, dry_run=False):\n        \"\"\"\n        Writes the ``RECORD`` file, using the ``paths`` iterable passed in. Any\n        existing ``RECORD`` file is silently overwritten.\n\n        prefix is used to determine when to write absolute paths.\n        \"\"\"\n        prefix = os.path.join(prefix, '')\n        base = os.path.dirname(self.path)\n        base_under_prefix = base.startswith(prefix)\n        base = os.path.join(base, '')\n        record_path = self.get_distinfo_file('RECORD')\n        logger.info('creating %s', record_path)\n        if dry_run:\n            return None\n        with CSVWriter(record_path) as writer:\n            for path in paths:\n                if os.path.isdir(path) or path.endswith(('.pyc', '.pyo')):\n                    # do not put size and hash, as in PEP-376\n                    hash_value = size = ''\n                else:\n                    size = '%d' % os.path.getsize(path)\n                    with open(path, 'rb') as fp:\n                        hash_value = self.get_hash(fp.read())\n                if path.startswith(base) or (base_under_prefix and path.startswith(prefix)):\n                    path = os.path.relpath(path, base)\n                writer.writerow((path, hash_value, size))\n\n            # add the RECORD file itself\n            if record_path.startswith(base):\n                record_path = os.path.relpath(record_path, base)\n            writer.writerow((record_path, '', ''))\n        return record_path\n\n    def check_installed_files(self):\n        \"\"\"\n        Checks that the hashes and sizes of the files in ``RECORD`` are\n        matched by the files themselves. Returns a (possibly empty) list of\n        mismatches. Each entry in the mismatch list will be a tuple consisting\n        of the path, 'exists', 'size' or 'hash' according to what didn't match\n        (existence is checked first, then size, then hash), the expected\n        value and the actual value.\n        \"\"\"\n        mismatches = []\n        base = os.path.dirname(self.path)\n        record_path = self.get_distinfo_file('RECORD')\n        for path, hash_value, size in self.list_installed_files():\n            if not os.path.isabs(path):\n                path = os.path.join(base, path)\n            if path == record_path:\n                continue\n            if not os.path.exists(path):\n                mismatches.append((path, 'exists', True, False))\n            elif os.path.isfile(path):\n                actual_size = str(os.path.getsize(path))\n                if size and actual_size != size:\n                    mismatches.append((path, 'size', size, actual_size))\n                elif hash_value:\n                    if '=' in hash_value:\n                        hasher = hash_value.split('=', 1)[0]\n                    else:\n                        hasher = None\n\n                    with open(path, 'rb') as f:\n                        actual_hash = self.get_hash(f.read(), hasher)\n                        if actual_hash != hash_value:\n                            mismatches.append((path, 'hash', hash_value, actual_hash))\n        return mismatches\n\n    @cached_property\n    def shared_locations(self):\n        \"\"\"\n        A dictionary of shared locations whose keys are in the set 'prefix',\n        'purelib', 'platlib', 'scripts', 'headers', 'data' and 'namespace'.\n        The corresponding value is the absolute path of that category for\n        this distribution, and takes into account any paths selected by the\n        user at installation time (e.g. via command-line arguments). In the\n        case of the 'namespace' key, this would be a list of absolute paths\n        for the roots of namespace packages in this distribution.\n\n        The first time this property is accessed, the relevant information is\n        read from the SHARED file in the .dist-info directory.\n        \"\"\"\n        result = {}\n        shared_path = os.path.join(self.path, 'SHARED')\n        if os.path.isfile(shared_path):\n            with codecs.open(shared_path, 'r', encoding='utf-8') as f:\n                lines = f.read().splitlines()\n            for line in lines:\n                key, value = line.split('=', 1)\n                if key == 'namespace':\n                    result.setdefault(key, []).append(value)\n                else:\n                    result[key] = value\n        return result\n\n    def write_shared_locations(self, paths, dry_run=False):\n        \"\"\"\n        Write shared location information to the SHARED file in .dist-info.\n        :param paths: A dictionary as described in the documentation for\n        :meth:`shared_locations`.\n        :param dry_run: If True, the action is logged but no file is actually\n                        written.\n        :return: The path of the file written to.\n        \"\"\"\n        shared_path = os.path.join(self.path, 'SHARED')\n        logger.info('creating %s', shared_path)\n        if dry_run:\n            return None\n        lines = []\n        for key in ('prefix', 'lib', 'headers', 'scripts', 'data'):\n            path = paths[key]\n            if os.path.isdir(paths[key]):\n                lines.append('%s=%s' % (key, path))\n        for ns in paths.get('namespace', ()):\n            lines.append('namespace=%s' % ns)\n\n        with codecs.open(shared_path, 'w', encoding='utf-8') as f:\n            f.write('\\n'.join(lines))\n        return shared_path\n\n    def get_distinfo_resource(self, path):\n        if path not in DIST_FILES:\n            raise DistlibException('invalid path for a dist-info file: '\n                                   '%r at %r' % (path, self.path))\n        finder = resources.finder_for_path(self.path)\n        if finder is None:\n            raise DistlibException('Unable to get a finder for %s' % self.path)\n        return finder.find(path)\n\n    def get_distinfo_file(self, path):\n        \"\"\"\n        Returns a path located under the ``.dist-info`` directory. Returns a\n        string representing the path.\n\n        :parameter path: a ``'/'``-separated path relative to the\n                         ``.dist-info`` directory or an absolute path;\n                         If *path* is an absolute path and doesn't start\n                         with the ``.dist-info`` directory path,\n                         a :class:`DistlibException` is raised\n        :type path: str\n        :rtype: str\n        \"\"\"\n        # Check if it is an absolute path  # XXX use relpath, add tests\n        if path.find(os.sep) >= 0:\n            # it's an absolute path?\n            distinfo_dirname, path = path.split(os.sep)[-2:]\n            if distinfo_dirname != self.path.split(os.sep)[-1]:\n                raise DistlibException('dist-info file %r does not belong to the %r %s '\n                                       'distribution' % (path, self.name, self.version))\n\n        # The file must be relative\n        if path not in DIST_FILES:\n            raise DistlibException('invalid path for a dist-info file: '\n                                   '%r at %r' % (path, self.path))\n\n        return os.path.join(self.path, path)\n\n    def list_distinfo_files(self):\n        \"\"\"\n        Iterates over the ``RECORD`` entries and returns paths for each line if\n        the path is pointing to a file located in the ``.dist-info`` directory\n        or one of its subdirectories.\n\n        :returns: iterator of paths\n        \"\"\"\n        base = os.path.dirname(self.path)\n        for path, checksum, size in self._get_records():\n            # XXX add separator or use real relpath algo\n            if not os.path.isabs(path):\n                path = os.path.join(base, path)\n            if path.startswith(self.path):\n                yield path\n\n    def __eq__(self, other):\n        return (isinstance(other, InstalledDistribution) and self.path == other.path)\n\n    # See http://docs.python.org/reference/datamodel#object.__hash__\n    __hash__ = object.__hash__\n\n\nclass EggInfoDistribution(BaseInstalledDistribution):\n    \"\"\"Created with the *path* of the ``.egg-info`` directory or file provided\n    to the constructor. It reads the metadata contained in the file itself, or\n    if the given path happens to be a directory, the metadata is read from the\n    file ``PKG-INFO`` under that directory.\"\"\"\n\n    requested = True  # as we have no way of knowing, assume it was\n    shared_locations = {}\n\n    def __init__(self, path, env=None):\n\n        def set_name_and_version(s, n, v):\n            s.name = n\n            s.key = n.lower()  # for case-insensitive comparisons\n            s.version = v\n\n        self.path = path\n        self.dist_path = env\n        if env and env._cache_enabled and path in env._cache_egg.path:\n            metadata = env._cache_egg.path[path].metadata\n            set_name_and_version(self, metadata.name, metadata.version)\n        else:\n            metadata = self._get_metadata(path)\n\n            # Need to be set before caching\n            set_name_and_version(self, metadata.name, metadata.version)\n\n            if env and env._cache_enabled:\n                env._cache_egg.add(self)\n        super(EggInfoDistribution, self).__init__(metadata, path, env)\n\n    def _get_metadata(self, path):\n        requires = None\n\n        def parse_requires_data(data):\n            \"\"\"Create a list of dependencies from a requires.txt file.\n\n            *data*: the contents of a setuptools-produced requires.txt file.\n            \"\"\"\n            reqs = []\n            lines = data.splitlines()\n            for line in lines:\n                line = line.strip()\n                # sectioned files have bare newlines (separating sections)\n                if not line:  # pragma: no cover\n                    continue\n                if line.startswith('['):  # pragma: no cover\n                    logger.warning('Unexpected line: quitting requirement scan: %r', line)\n                    break\n                r = parse_requirement(line)\n                if not r:  # pragma: no cover\n                    logger.warning('Not recognised as a requirement: %r', line)\n                    continue\n                if r.extras:  # pragma: no cover\n                    logger.warning('extra requirements in requires.txt are '\n                                   'not supported')\n                if not r.constraints:\n                    reqs.append(r.name)\n                else:\n                    cons = ', '.join('%s%s' % c for c in r.constraints)\n                    reqs.append('%s (%s)' % (r.name, cons))\n            return reqs\n\n        def parse_requires_path(req_path):\n            \"\"\"Create a list of dependencies from a requires.txt file.\n\n            *req_path*: the path to a setuptools-produced requires.txt file.\n            \"\"\"\n\n            reqs = []\n            try:\n                with codecs.open(req_path, 'r', 'utf-8') as fp:\n                    reqs = parse_requires_data(fp.read())\n            except IOError:\n                pass\n            return reqs\n\n        tl_path = tl_data = None\n        if path.endswith('.egg'):\n            if os.path.isdir(path):\n                p = os.path.join(path, 'EGG-INFO')\n                meta_path = os.path.join(p, 'PKG-INFO')\n                metadata = Metadata(path=meta_path, scheme='legacy')\n                req_path = os.path.join(p, 'requires.txt')\n                tl_path = os.path.join(p, 'top_level.txt')\n                requires = parse_requires_path(req_path)\n            else:\n                # FIXME handle the case where zipfile is not available\n                zipf = zipimport.zipimporter(path)\n                fileobj = StringIO(zipf.get_data('EGG-INFO/PKG-INFO').decode('utf8'))\n                metadata = Metadata(fileobj=fileobj, scheme='legacy')\n                try:\n                    data = zipf.get_data('EGG-INFO/requires.txt')\n                    tl_data = zipf.get_data('EGG-INFO/top_level.txt').decode('utf-8')\n                    requires = parse_requires_data(data.decode('utf-8'))\n                except IOError:\n                    requires = None\n        elif path.endswith('.egg-info'):\n            if os.path.isdir(path):\n                req_path = os.path.join(path, 'requires.txt')\n                requires = parse_requires_path(req_path)\n                path = os.path.join(path, 'PKG-INFO')\n                tl_path = os.path.join(path, 'top_level.txt')\n            metadata = Metadata(path=path, scheme='legacy')\n        else:\n            raise DistlibException('path must end with .egg-info or .egg, '\n                                   'got %r' % path)\n\n        if requires:\n            metadata.add_requirements(requires)\n        # look for top-level modules in top_level.txt, if present\n        if tl_data is None:\n            if tl_path is not None and os.path.exists(tl_path):\n                with open(tl_path, 'rb') as f:\n                    tl_data = f.read().decode('utf-8')\n        if not tl_data:\n            tl_data = []\n        else:\n            tl_data = tl_data.splitlines()\n        self.modules = tl_data\n        return metadata\n\n    def __repr__(self):\n        return '' % (self.name, self.version, self.path)\n\n    def __str__(self):\n        return \"%s %s\" % (self.name, self.version)\n\n    def check_installed_files(self):\n        \"\"\"\n        Checks that the hashes and sizes of the files in ``RECORD`` are\n        matched by the files themselves. Returns a (possibly empty) list of\n        mismatches. Each entry in the mismatch list will be a tuple consisting\n        of the path, 'exists', 'size' or 'hash' according to what didn't match\n        (existence is checked first, then size, then hash), the expected\n        value and the actual value.\n        \"\"\"\n        mismatches = []\n        record_path = os.path.join(self.path, 'installed-files.txt')\n        if os.path.exists(record_path):\n            for path, _, _ in self.list_installed_files():\n                if path == record_path:\n                    continue\n                if not os.path.exists(path):\n                    mismatches.append((path, 'exists', True, False))\n        return mismatches\n\n    def list_installed_files(self):\n        \"\"\"\n        Iterates over the ``installed-files.txt`` entries and returns a tuple\n        ``(path, hash, size)`` for each line.\n\n        :returns: a list of (path, hash, size)\n        \"\"\"\n\n        def _md5(path):\n            f = open(path, 'rb')\n            try:\n                content = f.read()\n            finally:\n                f.close()\n            return hashlib.md5(content).hexdigest()\n\n        def _size(path):\n            return os.stat(path).st_size\n\n        record_path = os.path.join(self.path, 'installed-files.txt')\n        result = []\n        if os.path.exists(record_path):\n            with codecs.open(record_path, 'r', encoding='utf-8') as f:\n                for line in f:\n                    line = line.strip()\n                    p = os.path.normpath(os.path.join(self.path, line))\n                    # \"./\" is present as a marker between installed files\n                    # and installation metadata files\n                    if not os.path.exists(p):\n                        logger.warning('Non-existent file: %s', p)\n                        if p.endswith(('.pyc', '.pyo')):\n                            continue\n                        # otherwise fall through and fail\n                    if not os.path.isdir(p):\n                        result.append((p, _md5(p), _size(p)))\n            result.append((record_path, None, None))\n        return result\n\n    def list_distinfo_files(self, absolute=False):\n        \"\"\"\n        Iterates over the ``installed-files.txt`` entries and returns paths for\n        each line if the path is pointing to a file located in the\n        ``.egg-info`` directory or one of its subdirectories.\n\n        :parameter absolute: If *absolute* is ``True``, each returned path is\n                          transformed into a local absolute path. Otherwise the\n                          raw value from ``installed-files.txt`` is returned.\n        :type absolute: boolean\n        :returns: iterator of paths\n        \"\"\"\n        record_path = os.path.join(self.path, 'installed-files.txt')\n        if os.path.exists(record_path):\n            skip = True\n            with codecs.open(record_path, 'r', encoding='utf-8') as f:\n                for line in f:\n                    line = line.strip()\n                    if line == './':\n                        skip = False\n                        continue\n                    if not skip:\n                        p = os.path.normpath(os.path.join(self.path, line))\n                        if p.startswith(self.path):\n                            if absolute:\n                                yield p\n                            else:\n                                yield line\n\n    def __eq__(self, other):\n        return (isinstance(other, EggInfoDistribution) and self.path == other.path)\n\n    # See http://docs.python.org/reference/datamodel#object.__hash__\n    __hash__ = object.__hash__\n\n\nnew_dist_class = InstalledDistribution\nold_dist_class = EggInfoDistribution\n\n\nclass DependencyGraph(object):\n    \"\"\"\n    Represents a dependency graph between distributions.\n\n    The dependency relationships are stored in an ``adjacency_list`` that maps\n    distributions to a list of ``(other, label)`` tuples where  ``other``\n    is a distribution and the edge is labeled with ``label`` (i.e. the version\n    specifier, if such was provided). Also, for more efficient traversal, for\n    every distribution ``x``, a list of predecessors is kept in\n    ``reverse_list[x]``. An edge from distribution ``a`` to\n    distribution ``b`` means that ``a`` depends on ``b``. If any missing\n    dependencies are found, they are stored in ``missing``, which is a\n    dictionary that maps distributions to a list of requirements that were not\n    provided by any other distributions.\n    \"\"\"\n\n    def __init__(self):\n        self.adjacency_list = {}\n        self.reverse_list = {}\n        self.missing = {}\n\n    def add_distribution(self, distribution):\n        \"\"\"Add the *distribution* to the graph.\n\n        :type distribution: :class:`distutils2.database.InstalledDistribution`\n                            or :class:`distutils2.database.EggInfoDistribution`\n        \"\"\"\n        self.adjacency_list[distribution] = []\n        self.reverse_list[distribution] = []\n        # self.missing[distribution] = []\n\n    def add_edge(self, x, y, label=None):\n        \"\"\"Add an edge from distribution *x* to distribution *y* with the given\n        *label*.\n\n        :type x: :class:`distutils2.database.InstalledDistribution` or\n                 :class:`distutils2.database.EggInfoDistribution`\n        :type y: :class:`distutils2.database.InstalledDistribution` or\n                 :class:`distutils2.database.EggInfoDistribution`\n        :type label: ``str`` or ``None``\n        \"\"\"\n        self.adjacency_list[x].append((y, label))\n        # multiple edges are allowed, so be careful\n        if x not in self.reverse_list[y]:\n            self.reverse_list[y].append(x)\n\n    def add_missing(self, distribution, requirement):\n        \"\"\"\n        Add a missing *requirement* for the given *distribution*.\n\n        :type distribution: :class:`distutils2.database.InstalledDistribution`\n                            or :class:`distutils2.database.EggInfoDistribution`\n        :type requirement: ``str``\n        \"\"\"\n        logger.debug('%s missing %r', distribution, requirement)\n        self.missing.setdefault(distribution, []).append(requirement)\n\n    def _repr_dist(self, dist):\n        return '%s %s' % (dist.name, dist.version)\n\n    def repr_node(self, dist, level=1):\n        \"\"\"Prints only a subgraph\"\"\"\n        output = [self._repr_dist(dist)]\n        for other, label in self.adjacency_list[dist]:\n            dist = self._repr_dist(other)\n            if label is not None:\n                dist = '%s [%s]' % (dist, label)\n            output.append('    ' * level + str(dist))\n            suboutput = self.repr_node(other, level + 1)\n            subs = suboutput.split('\\n')\n            output.extend(subs[1:])\n        return '\\n'.join(output)\n\n    def to_dot(self, f, skip_disconnected=True):\n        \"\"\"Writes a DOT output for the graph to the provided file *f*.\n\n        If *skip_disconnected* is set to ``True``, then all distributions\n        that are not dependent on any other distribution are skipped.\n\n        :type f: has to support ``file``-like operations\n        :type skip_disconnected: ``bool``\n        \"\"\"\n        disconnected = []\n\n        f.write(\"digraph dependencies {\\n\")\n        for dist, adjs in self.adjacency_list.items():\n            if len(adjs) == 0 and not skip_disconnected:\n                disconnected.append(dist)\n            for other, label in adjs:\n                if label is not None:\n                    f.write('\"%s\" -> \"%s\" [label=\"%s\"]\\n' % (dist.name, other.name, label))\n                else:\n                    f.write('\"%s\" -> \"%s\"\\n' % (dist.name, other.name))\n        if not skip_disconnected and len(disconnected) > 0:\n            f.write('subgraph disconnected {\\n')\n            f.write('label = \"Disconnected\"\\n')\n            f.write('bgcolor = red\\n')\n\n            for dist in disconnected:\n                f.write('\"%s\"' % dist.name)\n                f.write('\\n')\n            f.write('}\\n')\n        f.write('}\\n')\n\n    def topological_sort(self):\n        \"\"\"\n        Perform a topological sort of the graph.\n        :return: A tuple, the first element of which is a topologically sorted\n                 list of distributions, and the second element of which is a\n                 list of distributions that cannot be sorted because they have\n                 circular dependencies and so form a cycle.\n        \"\"\"\n        result = []\n        # Make a shallow copy of the adjacency list\n        alist = {}\n        for k, v in self.adjacency_list.items():\n            alist[k] = v[:]\n        while True:\n            # See what we can remove in this run\n            to_remove = []\n            for k, v in list(alist.items())[:]:\n                if not v:\n                    to_remove.append(k)\n                    del alist[k]\n            if not to_remove:\n                # What's left in alist (if anything) is a cycle.\n                break\n            # Remove from the adjacency list of others\n            for k, v in alist.items():\n                alist[k] = [(d, r) for d, r in v if d not in to_remove]\n            logger.debug('Moving to result: %s', ['%s (%s)' % (d.name, d.version) for d in to_remove])\n            result.extend(to_remove)\n        return result, list(alist.keys())\n\n    def __repr__(self):\n        \"\"\"Representation of the graph\"\"\"\n        output = []\n        for dist, adjs in self.adjacency_list.items():\n            output.append(self.repr_node(dist))\n        return '\\n'.join(output)\n\n\ndef make_graph(dists, scheme='default'):\n    \"\"\"Makes a dependency graph from the given distributions.\n\n    :parameter dists: a list of distributions\n    :type dists: list of :class:`distutils2.database.InstalledDistribution` and\n                 :class:`distutils2.database.EggInfoDistribution` instances\n    :rtype: a :class:`DependencyGraph` instance\n    \"\"\"\n    scheme = get_scheme(scheme)\n    graph = DependencyGraph()\n    provided = {}  # maps names to lists of (version, dist) tuples\n\n    # first, build the graph and find out what's provided\n    for dist in dists:\n        graph.add_distribution(dist)\n\n        for p in dist.provides:\n            name, version = parse_name_and_version(p)\n            logger.debug('Add to provided: %s, %s, %s', name, version, dist)\n            provided.setdefault(name, []).append((version, dist))\n\n    # now make the edges\n    for dist in dists:\n        requires = (dist.run_requires | dist.meta_requires | dist.build_requires | dist.dev_requires)\n        for req in requires:\n            try:\n                matcher = scheme.matcher(req)\n            except UnsupportedVersionError:\n                # XXX compat-mode if cannot read the version\n                logger.warning('could not read version %r - using name only', req)\n                name = req.split()[0]\n                matcher = scheme.matcher(name)\n\n            name = matcher.key  # case-insensitive\n\n            matched = False\n            if name in provided:\n                for version, provider in provided[name]:\n                    try:\n                        match = matcher.match(version)\n                    except UnsupportedVersionError:\n                        match = False\n\n                    if match:\n                        graph.add_edge(dist, provider, req)\n                        matched = True\n                        break\n            if not matched:\n                graph.add_missing(dist, req)\n    return graph\n\n\ndef get_dependent_dists(dists, dist):\n    \"\"\"Recursively generate a list of distributions from *dists* that are\n    dependent on *dist*.\n\n    :param dists: a list of distributions\n    :param dist: a distribution, member of *dists* for which we are interested\n    \"\"\"\n    if dist not in dists:\n        raise DistlibException('given distribution %r is not a member '\n                               'of the list' % dist.name)\n    graph = make_graph(dists)\n\n    dep = [dist]  # dependent distributions\n    todo = graph.reverse_list[dist]  # list of nodes we should inspect\n\n    while todo:\n        d = todo.pop()\n        dep.append(d)\n        for succ in graph.reverse_list[d]:\n            if succ not in dep:\n                todo.append(succ)\n\n    dep.pop(0)  # remove dist from dep, was there to prevent infinite loops\n    return dep\n\n\ndef get_required_dists(dists, dist):\n    \"\"\"Recursively generate a list of distributions from *dists* that are\n    required by *dist*.\n\n    :param dists: a list of distributions\n    :param dist: a distribution, member of *dists* for which we are interested\n                 in finding the dependencies.\n    \"\"\"\n    if dist not in dists:\n        raise DistlibException('given distribution %r is not a member '\n                               'of the list' % dist.name)\n    graph = make_graph(dists)\n\n    req = set()  # required distributions\n    todo = graph.adjacency_list[dist]  # list of nodes we should inspect\n    seen = set(t[0] for t in todo)  # already added to todo\n\n    while todo:\n        d = todo.pop()[0]\n        req.add(d)\n        pred_list = graph.adjacency_list[d]\n        for pred in pred_list:\n            d = pred[0]\n            if d not in req and d not in seen:\n                seen.add(d)\n                todo.append(pred)\n    return req\n\n\ndef make_dist(name, version, **kwargs):\n    \"\"\"\n    A convenience method for making a dist given just a name and version.\n    \"\"\"\n    summary = kwargs.pop('summary', 'Placeholder for summary')\n    md = Metadata(**kwargs)\n    md.name = name\n    md.version = version\n    md.summary = summary or 'Placeholder for summary'\n    return Distribution(md)\n",[],[216,809,810,811,890,891,1958,2028],"0947a388-67fc-11f0-9ad5-0224a6c84d84","0947a482-67fc-11f0-9ad5-0224a6c84d84",333,["D",1753299263351],"# -*- coding: utf-8 -*-\n#\n# Copyright (C) 2013-2017 Vinay Sajip.\n# Licensed to the Python Software Foundation under a contributor agreement.\n# See LICENSE.txt and CONTRIBUTORS.txt.\n#\nfrom __future__ import absolute_import\n\nimport os\nimport re\nimport shutil\nimport sys\n\ntry:\n    import ssl\nexcept ImportError:  # pragma: no cover\n    ssl = None\n\nif sys.version_info[0] < 3:  # pragma: no cover\n    from StringIO import StringIO\n    string_types = basestring,\n    text_type = unicode\n    from types import FileType as file_type\n    import __builtin__ as builtins\n    import ConfigParser as configparser\n    from urlparse import urlparse, urlunparse, urljoin, urlsplit, urlunsplit\n    from urllib import (urlretrieve, quote as _quote, unquote, url2pathname,\n                        pathname2url, ContentTooShortError, splittype)\n\n    def quote(s):\n        if isinstance(s, unicode):\n            s = s.encode('utf-8')\n        return _quote(s)\n\n    import urllib2\n    from urllib2 import (Request, urlopen, URLError, HTTPError,\n                         HTTPBasicAuthHandler, HTTPPasswordMgr, HTTPHandler,\n                         HTTPRedirectHandler, build_opener)\n    if ssl:\n        from urllib2 import HTTPSHandler\n    import httplib\n    import xmlrpclib\n    import Queue as queue\n    from HTMLParser import HTMLParser\n    import htmlentitydefs\n    raw_input = raw_input\n    from itertools import ifilter as filter\n    from itertools import ifilterfalse as filterfalse\n\n    # Leaving this around for now, in case it needs resurrecting in some way\n    # _userprog = None\n    # def splituser(host):\n    # \"\"\"splituser('user[:passwd]@host[:port]') --> 'user[:passwd]', 'host[:port]'.\"\"\"\n    # global _userprog\n    # if _userprog is None:\n    # import re\n    # _userprog = re.compile('^(.*)@(.*)$')\n\n    # match = _userprog.match(host)\n    # if match: return match.group(1, 2)\n    # return None, host\n\nelse:  # pragma: no cover\n    from io import StringIO\n    string_types = str,\n    text_type = str\n    from io import TextIOWrapper as file_type\n    import builtins\n    import configparser\n    from urllib.parse import (urlparse, urlunparse, urljoin, quote, unquote,\n                              urlsplit, urlunsplit, splittype)\n    from urllib.request import (urlopen, urlretrieve, Request, url2pathname,\n                                pathname2url, HTTPBasicAuthHandler,\n                                HTTPPasswordMgr, HTTPHandler,\n                                HTTPRedirectHandler, build_opener)\n    if ssl:\n        from urllib.request import HTTPSHandler\n    from urllib.error import HTTPError, URLError, ContentTooShortError\n    import http.client as httplib\n    import urllib.request as urllib2\n    import xmlrpc.client as xmlrpclib\n    import queue\n    from html.parser import HTMLParser\n    import html.entities as htmlentitydefs\n    raw_input = input\n    from itertools import filterfalse\n    filter = filter\n\ntry:\n    from ssl import match_hostname, CertificateError\nexcept ImportError:  # pragma: no cover\n\n    class CertificateError(ValueError):\n        pass\n\n    def _dnsname_match(dn, hostname, max_wildcards=1):\n        \"\"\"Matching according to RFC 6125, section 6.4.3\n\n        http://tools.ietf.org/html/rfc6125#section-6.4.3\n        \"\"\"\n        pats = []\n        if not dn:\n            return False\n\n        parts = dn.split('.')\n        leftmost, remainder = parts[0], parts[1:]\n\n        wildcards = leftmost.count('*')\n        if wildcards > max_wildcards:\n            # Issue #17980: avoid denials of service by refusing more\n            # than one wildcard per fragment.  A survey of established\n            # policy among SSL implementations showed it to be a\n            # reasonable choice.\n            raise CertificateError(\n                \"too many wildcards in certificate DNS name: \" + repr(dn))\n\n        # speed up common case w/o wildcards\n        if not wildcards:\n            return dn.lower() == hostname.lower()\n\n        # RFC 6125, section 6.4.3, subitem 1.\n        # The client SHOULD NOT attempt to match a presented identifier in which\n        # the wildcard character comprises a label other than the left-most label.\n        if leftmost == '*':\n            # When '*' is a fragment by itself, it matches a non-empty dotless\n            # fragment.\n            pats.append('[^.]+')\n        elif leftmost.startswith('xn--') or hostname.startswith('xn--'):\n            # RFC 6125, section 6.4.3, subitem 3.\n            # The client SHOULD NOT attempt to match a presented identifier\n            # where the wildcard character is embedded within an A-label or\n            # U-label of an internationalized domain name.\n            pats.append(re.escape(leftmost))\n        else:\n            # Otherwise, '*' matches any dotless string, e.g. www*\n            pats.append(re.escape(leftmost).replace(r'\\*', '[^.]*'))\n\n        # add the remaining fragments, ignore any wildcards\n        for frag in remainder:\n            pats.append(re.escape(frag))\n\n        pat = re.compile(r'\\A' + r'\\.'.join(pats) + r'\\Z', re.IGNORECASE)\n        return pat.match(hostname)\n\n    def match_hostname(cert, hostname):\n        \"\"\"Verify that *cert* (in decoded format as returned by\n        SSLSocket.getpeercert()) matches the *hostname*.  RFC 2818 and RFC 6125\n        rules are followed, but IP addresses are not accepted for *hostname*.\n\n        CertificateError is raised on failure. On success, the function\n        returns nothing.\n        \"\"\"\n        if not cert:\n            raise ValueError(\"empty or no certificate, match_hostname needs a \"\n                             \"SSL socket or SSL context with either \"\n                             \"CERT_OPTIONAL or CERT_REQUIRED\")\n        dnsnames = []\n        san = cert.get('subjectAltName', ())\n        for key, value in san:\n            if key == 'DNS':\n                if _dnsname_match(value, hostname):\n                    return\n                dnsnames.append(value)\n        if not dnsnames:\n            # The subject is only checked when there is no dNSName entry\n            # in subjectAltName\n            for sub in cert.get('subject', ()):\n                for key, value in sub:\n                    # XXX according to RFC 2818, the most specific Common Name\n                    # must be used.\n                    if key == 'commonName':\n                        if _dnsname_match(value, hostname):\n                            return\n                        dnsnames.append(value)\n        if len(dnsnames) > 1:\n            raise CertificateError(\"hostname %r \"\n                                   \"doesn't match either of %s\" %\n                                   (hostname, ', '.join(map(repr, dnsnames))))\n        elif len(dnsnames) == 1:\n            raise CertificateError(\"hostname %r \"\n                                   \"doesn't match %r\" %\n                                   (hostname, dnsnames[0]))\n        else:\n            raise CertificateError(\"no appropriate commonName or \"\n                                   \"subjectAltName fields were found\")\n\n\ntry:\n    from types import SimpleNamespace as Container\nexcept ImportError:  # pragma: no cover\n\n    class Container(object):\n        \"\"\"\n        A generic container for when multiple values need to be returned\n        \"\"\"\n\n        def __init__(self, **kwargs):\n            self.__dict__.update(kwargs)\n\n\ntry:\n    from shutil import which\nexcept ImportError:  # pragma: no cover\n    # Implementation from Python 3.3\n    def which(cmd, mode=os.F_OK | os.X_OK, path=None):\n        \"\"\"Given a command, mode, and a PATH string, return the path which\n        conforms to the given mode on the PATH, or None if there is no such\n        file.\n\n        `mode` defaults to os.F_OK | os.X_OK. `path` defaults to the result\n        of os.environ.get(\"PATH\"), or can be overridden with a custom search\n        path.\n\n        \"\"\"\n\n        # Check that a given file can be accessed with the correct mode.\n        # Additionally check that `file` is not a directory, as on Windows\n        # directories pass the os.access check.\n        def _access_check(fn, mode):\n            return (os.path.exists(fn) and os.access(fn, mode) and not os.path.isdir(fn))\n\n        # If we're given a path with a directory part, look it up directly rather\n        # than referring to PATH directories. This includes checking relative to the\n        # current directory, e.g. ./script\n        if os.path.dirname(cmd):\n            if _access_check(cmd, mode):\n                return cmd\n            return None\n\n        if path is None:\n            path = os.environ.get(\"PATH\", os.defpath)\n        if not path:\n            return None\n        path = path.split(os.pathsep)\n\n        if sys.platform == \"win32\":\n            # The current directory takes precedence on Windows.\n            if os.curdir not in path:\n                path.insert(0, os.curdir)\n\n            # PATHEXT is necessary to check on Windows.\n            pathext = os.environ.get(\"PATHEXT\", \"\").split(os.pathsep)\n            # See if the given file matches any of the expected path extensions.\n            # This will allow us to short circuit when given \"python.exe\".\n            # If it does match, only test that one, otherwise we have to try\n            # others.\n            if any(cmd.lower().endswith(ext.lower()) for ext in pathext):\n                files = [cmd]\n            else:\n                files = [cmd + ext for ext in pathext]\n        else:\n            # On other platforms you don't have things like PATHEXT to tell you\n            # what file suffixes are executable, so just pass on cmd as-is.\n            files = [cmd]\n\n        seen = set()\n        for dir in path:\n            normdir = os.path.normcase(dir)\n            if normdir not in seen:\n                seen.add(normdir)\n                for thefile in files:\n                    name = os.path.join(dir, thefile)\n                    if _access_check(name, mode):\n                        return name\n        return None\n\n\n# ZipFile is a context manager in 2.7, but not in 2.6\n\nfrom zipfile import ZipFile as BaseZipFile\n\nif hasattr(BaseZipFile, '__enter__'):  # pragma: no cover\n    ZipFile = BaseZipFile\nelse:  # pragma: no cover\n    from zipfile import ZipExtFile as BaseZipExtFile\n\n    class ZipExtFile(BaseZipExtFile):\n\n        def __init__(self, base):\n            self.__dict__.update(base.__dict__)\n\n        def __enter__(self):\n            return self\n\n        def __exit__(self, *exc_info):\n            self.close()\n            # return None, so if an exception occurred, it will propagate\n\n    class ZipFile(BaseZipFile):\n\n        def __enter__(self):\n            return self\n\n        def __exit__(self, *exc_info):\n            self.close()\n            # return None, so if an exception occurred, it will propagate\n\n        def open(self, *args, **kwargs):\n            base = BaseZipFile.open(self, *args, **kwargs)\n            return ZipExtFile(base)\n\n\ntry:\n    from platform import python_implementation\nexcept ImportError:  # pragma: no cover\n\n    def python_implementation():\n        \"\"\"Return a string identifying the Python implementation.\"\"\"\n        if 'PyPy' in sys.version:\n            return 'PyPy'\n        if os.name == 'java':\n            return 'Jython'\n        if sys.version.startswith('IronPython'):\n            return 'IronPython'\n        return 'CPython'\n\n\nimport sysconfig\n\ntry:\n    callable = callable\nexcept NameError:  # pragma: no cover\n    from collections.abc import Callable\n\n    def callable(obj):\n        return isinstance(obj, Callable)\n\n\ntry:\n    fsencode = os.fsencode\n    fsdecode = os.fsdecode\nexcept AttributeError:  # pragma: no cover\n    # Issue #99: on some systems (e.g. containerised),\n    # sys.getfilesystemencoding() returns None, and we need a real value,\n    # so fall back to utf-8. From the CPython 2.7 docs relating to Unix and\n    # sys.getfilesystemencoding(): the return value is \"the user’s preference\n    # according to the result of nl_langinfo(CODESET), or None if the\n    # nl_langinfo(CODESET) failed.\"\n    _fsencoding = sys.getfilesystemencoding() or 'utf-8'\n    if _fsencoding == 'mbcs':\n        _fserrors = 'strict'\n    else:\n        _fserrors = 'surrogateescape'\n\n    def fsencode(filename):\n        if isinstance(filename, bytes):\n            return filename\n        elif isinstance(filename, text_type):\n            return filename.encode(_fsencoding, _fserrors)\n        else:\n            raise TypeError(\"expect bytes or str, not %s\" %\n                            type(filename).__name__)\n\n    def fsdecode(filename):\n        if isinstance(filename, text_type):\n            return filename\n        elif isinstance(filename, bytes):\n            return filename.decode(_fsencoding, _fserrors)\n        else:\n            raise TypeError(\"expect bytes or str, not %s\" %\n                            type(filename).__name__)\n\n\ntry:\n    from tokenize import detect_encoding\nexcept ImportError:  # pragma: no cover\n    from codecs import BOM_UTF8, lookup\n\n    cookie_re = re.compile(r\"coding[:=]\\s*([-\\w.]+)\")\n\n    def _get_normal_name(orig_enc):\n        \"\"\"Imitates get_normal_name in tokenizer.c.\"\"\"\n        # Only care about the first 12 characters.\n        enc = orig_enc[:12].lower().replace(\"_\", \"-\")\n        if enc == \"utf-8\" or enc.startswith(\"utf-8-\"):\n            return \"utf-8\"\n        if enc in (\"latin-1\", \"iso-8859-1\", \"iso-latin-1\") or \\\n           enc.startswith((\"latin-1-\", \"iso-8859-1-\", \"iso-latin-1-\")):\n            return \"iso-8859-1\"\n        return orig_enc\n\n    def detect_encoding(readline):\n        \"\"\"\n        The detect_encoding() function is used to detect the encoding that should\n        be used to decode a Python source file.  It requires one argument, readline,\n        in the same way as the tokenize() generator.\n\n        It will call readline a maximum of twice, and return the encoding used\n        (as a string) and a list of any lines (left as bytes) it has read in.\n\n        It detects the encoding from the presence of a utf-8 bom or an encoding\n        cookie as specified in pep-0263.  If both a bom and a cookie are present,\n        but disagree, a SyntaxError will be raised.  If the encoding cookie is an\n        invalid charset, raise a SyntaxError.  Note that if a utf-8 bom is found,\n        'utf-8-sig' is returned.\n\n        If no encoding is specified, then the default of 'utf-8' will be returned.\n        \"\"\"\n        try:\n            filename = readline.__self__.name\n        except AttributeError:\n            filename = None\n        bom_found = False\n        encoding = None\n        default = 'utf-8'\n\n        def read_or_stop():\n            try:\n                return readline()\n            except StopIteration:\n                return b''\n\n        def find_cookie(line):\n            try:\n                # Decode as UTF-8. Either the line is an encoding declaration,\n                # in which case it should be pure ASCII, or it must be UTF-8\n                # per default encoding.\n                line_string = line.decode('utf-8')\n            except UnicodeDecodeError:\n                msg = \"invalid or missing encoding declaration\"\n                if filename is not None:\n                    msg = '{} for {!r}'.format(msg, filename)\n                raise SyntaxError(msg)\n\n            matches = cookie_re.findall(line_string)\n            if not matches:\n                return None\n            encoding = _get_normal_name(matches[0])\n            try:\n                codec = lookup(encoding)\n            except LookupError:\n                # This behaviour mimics the Python interpreter\n                if filename is None:\n                    msg = \"unknown encoding: \" + encoding\n                else:\n                    msg = \"unknown encoding for {!r}: {}\".format(\n                        filename, encoding)\n                raise SyntaxError(msg)\n\n            if bom_found:\n                if codec.name != 'utf-8':\n                    # This behaviour mimics the Python interpreter\n                    if filename is None:\n                        msg = 'encoding problem: utf-8'\n                    else:\n                        msg = 'encoding problem for {!r}: utf-8'.format(\n                            filename)\n                    raise SyntaxError(msg)\n                encoding += '-sig'\n            return encoding\n\n        first = read_or_stop()\n        if first.startswith(BOM_UTF8):\n            bom_found = True\n            first = first[3:]\n            default = 'utf-8-sig'\n        if not first:\n            return default, []\n\n        encoding = find_cookie(first)\n        if encoding:\n            return encoding, [first]\n\n        second = read_or_stop()\n        if not second:\n            return default, [first]\n\n        encoding = find_cookie(second)\n        if encoding:\n            return encoding, [first, second]\n\n        return default, [first, second]\n\n\n# For converting & <-> & etc.\ntry:\n    from html import escape\nexcept ImportError:\n    from cgi import escape\nif sys.version_info[:2] < (3, 4):\n    unescape = HTMLParser().unescape\nelse:\n    from html import unescape\n\ntry:\n    from collections import ChainMap\nexcept ImportError:  # pragma: no cover\n    from collections import MutableMapping\n\n    try:\n        from reprlib import recursive_repr as _recursive_repr\n    except ImportError:\n\n        def _recursive_repr(fillvalue='...'):\n            '''\n            Decorator to make a repr function return fillvalue for a recursive\n            call\n            '''\n\n            def decorating_function(user_function):\n                repr_running = set()\n\n                def wrapper(self):\n                    key = id(self), get_ident()\n                    if key in repr_running:\n                        return fillvalue\n                    repr_running.add(key)\n                    try:\n                        result = user_function(self)\n                    finally:\n                        repr_running.discard(key)\n                    return result\n\n                # Can't use functools.wraps() here because of bootstrap issues\n                wrapper.__module__ = getattr(user_function, '__module__')\n                wrapper.__doc__ = getattr(user_function, '__doc__')\n                wrapper.__name__ = getattr(user_function, '__name__')\n                wrapper.__annotations__ = getattr(user_function,\n                                                  '__annotations__', {})\n                return wrapper\n\n            return decorating_function\n\n    class ChainMap(MutableMapping):\n        '''\n        A ChainMap groups multiple dicts (or other mappings) together\n        to create a single, updateable view.\n\n        The underlying mappings are stored in a list.  That list is public and can\n        accessed or updated using the *maps* attribute.  There is no other state.\n\n        Lookups search the underlying mappings successively until a key is found.\n        In contrast, writes, updates, and deletions only operate on the first\n        mapping.\n        '''\n\n        def __init__(self, *maps):\n            '''Initialize a ChainMap by setting *maps* to the given mappings.\n            If no mappings are provided, a single empty dictionary is used.\n\n            '''\n            self.maps = list(maps) or [{}]  # always at least one map\n\n        def __missing__(self, key):\n            raise KeyError(key)\n\n        def __getitem__(self, key):\n            for mapping in self.maps:\n                try:\n                    return mapping[\n                        key]  # can't use 'key in mapping' with defaultdict\n                except KeyError:\n                    pass\n            return self.__missing__(\n                key)  # support subclasses that define __missing__\n\n        def get(self, key, default=None):\n            return self[key] if key in self else default\n\n        def __len__(self):\n            return len(set().union(\n                *self.maps))  # reuses stored hash values if possible\n\n        def __iter__(self):\n            return iter(set().union(*self.maps))\n\n        def __contains__(self, key):\n            return any(key in m for m in self.maps)\n\n        def __bool__(self):\n            return any(self.maps)\n\n        @_recursive_repr()\n        def __repr__(self):\n            return '{0.__class__.__name__}({1})'.format(\n                self, ', '.join(map(repr, self.maps)))\n\n        @classmethod\n        def fromkeys(cls, iterable, *args):\n            'Create a ChainMap with a single dict created from the iterable.'\n            return cls(dict.fromkeys(iterable, *args))\n\n        def copy(self):\n            'New ChainMap or subclass with a new copy of maps[0] and refs to maps[1:]'\n            return self.__class__(self.maps[0].copy(), *self.maps[1:])\n\n        __copy__ = copy\n\n        def new_child(self):  # like Django's Context.push()\n            'New ChainMap with a new dict followed by all previous maps.'\n            return self.__class__({}, *self.maps)\n\n        @property\n        def parents(self):  # like Django's Context.pop()\n            'New ChainMap from maps[1:].'\n            return self.__class__(*self.maps[1:])\n\n        def __setitem__(self, key, value):\n            self.maps[0][key] = value\n\n        def __delitem__(self, key):\n            try:\n                del self.maps[0][key]\n            except KeyError:\n                raise KeyError(\n                    'Key not found in the first mapping: {!r}'.format(key))\n\n        def popitem(self):\n            'Remove and return an item pair from maps[0]. Raise KeyError is maps[0] is empty.'\n            try:\n                return self.maps[0].popitem()\n            except KeyError:\n                raise KeyError('No keys found in the first mapping.')\n\n        def pop(self, key, *args):\n            'Remove *key* from maps[0] and return its value. Raise KeyError if *key* not in maps[0].'\n            try:\n                return self.maps[0].pop(key, *args)\n            except KeyError:\n                raise KeyError(\n                    'Key not found in the first mapping: {!r}'.format(key))\n\n        def clear(self):\n            'Clear maps[0], leaving maps[1:] intact.'\n            self.maps[0].clear()\n\n\ntry:\n    from importlib.util import cache_from_source  # Python >= 3.4\nexcept ImportError:  # pragma: no cover\n\n    def cache_from_source(path, debug_override=None):\n        assert path.endswith('.py')\n        if debug_override is None:\n            debug_override = __debug__\n        if debug_override:\n            suffix = 'c'\n        else:\n            suffix = 'o'\n        return path + suffix\n\n\ntry:\n    from collections import OrderedDict\nexcept ImportError:  # pragma: no cover\n    # {{{ http://code.activestate.com/recipes/576693/ (r9)\n    # Backport of OrderedDict() class that runs on Python 2.4, 2.5, 2.6, 2.7 and pypy.\n    # Passes Python2.7's test suite and incorporates all the latest updates.\n    try:\n        from thread import get_ident as _get_ident\n    except ImportError:\n        from dummy_thread import get_ident as _get_ident\n\n    try:\n        from _abcoll import KeysView, ValuesView, ItemsView\n    except ImportError:\n        pass\n\n    class OrderedDict(dict):\n        'Dictionary that remembers insertion order'\n\n        # An inherited dict maps keys to values.\n        # The inherited dict provides __getitem__, __len__, __contains__, and get.\n        # The remaining methods are order-aware.\n        # Big-O running times for all methods are the same as for regular dictionaries.\n\n        # The internal self.__map dictionary maps keys to links in a doubly linked list.\n        # The circular doubly linked list starts and ends with a sentinel element.\n        # The sentinel element never gets deleted (this simplifies the algorithm).\n        # Each link is stored as a list of length three:  [PREV, NEXT, KEY].\n\n        def __init__(self, *args, **kwds):\n            '''Initialize an ordered dictionary.  Signature is the same as for\n            regular dictionaries, but keyword arguments are not recommended\n            because their insertion order is arbitrary.\n\n            '''\n            if len(args) > 1:\n                raise TypeError('expected at most 1 arguments, got %d' %\n                                len(args))\n            try:\n                self.__root\n            except AttributeError:\n                self.__root = root = []  # sentinel node\n                root[:] = [root, root, None]\n                self.__map = {}\n            self.__update(*args, **kwds)\n\n        def __setitem__(self, key, value, dict_setitem=dict.__setitem__):\n            'od.__setitem__(i, y) <==> od[i]=y'\n            # Setting a new item creates a new link which goes at the end of the linked\n            # list, and the inherited dictionary is updated with the new key/value pair.\n            if key not in self:\n                root = self.__root\n                last = root[0]\n                last[1] = root[0] = self.__map[key] = [last, root, key]\n            dict_setitem(self, key, value)\n\n        def __delitem__(self, key, dict_delitem=dict.__delitem__):\n            'od.__delitem__(y) <==> del od[y]'\n            # Deleting an existing item uses self.__map to find the link which is\n            # then removed by updating the links in the predecessor and successor nodes.\n            dict_delitem(self, key)\n            link_prev, link_next, key = self.__map.pop(key)\n            link_prev[1] = link_next\n            link_next[0] = link_prev\n\n        def __iter__(self):\n            'od.__iter__() <==> iter(od)'\n            root = self.__root\n            curr = root[1]\n            while curr is not root:\n                yield curr[2]\n                curr = curr[1]\n\n        def __reversed__(self):\n            'od.__reversed__() <==> reversed(od)'\n            root = self.__root\n            curr = root[0]\n            while curr is not root:\n                yield curr[2]\n                curr = curr[0]\n\n        def clear(self):\n            'od.clear() -> None.  Remove all items from od.'\n            try:\n                for node in self.__map.itervalues():\n                    del node[:]\n                root = self.__root\n                root[:] = [root, root, None]\n                self.__map.clear()\n            except AttributeError:\n                pass\n            dict.clear(self)\n\n        def popitem(self, last=True):\n            '''od.popitem() -> (k, v), return and remove a (key, value) pair.\n            Pairs are returned in LIFO order if last is true or FIFO order if false.\n\n            '''\n            if not self:\n                raise KeyError('dictionary is empty')\n            root = self.__root\n            if last:\n                link = root[0]\n                link_prev = link[0]\n                link_prev[1] = root\n                root[0] = link_prev\n            else:\n                link = root[1]\n                link_next = link[1]\n                root[1] = link_next\n                link_next[0] = root\n            key = link[2]\n            del self.__map[key]\n            value = dict.pop(self, key)\n            return key, value\n\n        # -- the following methods do not depend on the internal structure --\n\n        def keys(self):\n            'od.keys() -> list of keys in od'\n            return list(self)\n\n        def values(self):\n            'od.values() -> list of values in od'\n            return [self[key] for key in self]\n\n        def items(self):\n            'od.items() -> list of (key, value) pairs in od'\n            return [(key, self[key]) for key in self]\n\n        def iterkeys(self):\n            'od.iterkeys() -> an iterator over the keys in od'\n            return iter(self)\n\n        def itervalues(self):\n            'od.itervalues -> an iterator over the values in od'\n            for k in self:\n                yield self[k]\n\n        def iteritems(self):\n            'od.iteritems -> an iterator over the (key, value) items in od'\n            for k in self:\n                yield (k, self[k])\n\n        def update(*args, **kwds):\n            '''od.update(E, **F) -> None.  Update od from dict/iterable E and F.\n\n            If E is a dict instance, does:           for k in E: od[k] = E[k]\n            If E has a .keys() method, does:         for k in E.keys(): od[k] = E[k]\n            Or if E is an iterable of items, does:   for k, v in E: od[k] = v\n            In either case, this is followed by:     for k, v in F.items(): od[k] = v\n\n            '''\n            if len(args) > 2:\n                raise TypeError('update() takes at most 2 positional '\n                                'arguments (%d given)' % (len(args), ))\n            elif not args:\n                raise TypeError('update() takes at least 1 argument (0 given)')\n            self = args[0]\n            # Make progressively weaker assumptions about \"other\"\n            other = ()\n            if len(args) == 2:\n                other = args[1]\n            if isinstance(other, dict):\n                for key in other:\n                    self[key] = other[key]\n            elif hasattr(other, 'keys'):\n                for key in other.keys():\n                    self[key] = other[key]\n            else:\n                for key, value in other:\n                    self[key] = value\n            for key, value in kwds.items():\n                self[key] = value\n\n        __update = update  # let subclasses override update without breaking __init__\n\n        __marker = object()\n\n        def pop(self, key, default=__marker):\n            '''od.pop(k[,d]) -> v, remove specified key and return the corresponding value.\n            If key is not found, d is returned if given, otherwise KeyError is raised.\n\n            '''\n            if key in self:\n                result = self[key]\n                del self[key]\n                return result\n            if default is self.__marker:\n                raise KeyError(key)\n            return default\n\n        def setdefault(self, key, default=None):\n            'od.setdefault(k[,d]) -> od.get(k,d), also set od[k]=d if k not in od'\n            if key in self:\n                return self[key]\n            self[key] = default\n            return default\n\n        def __repr__(self, _repr_running=None):\n            'od.__repr__() <==> repr(od)'\n            if not _repr_running:\n                _repr_running = {}\n            call_key = id(self), _get_ident()\n            if call_key in _repr_running:\n                return '...'\n            _repr_running[call_key] = 1\n            try:\n                if not self:\n                    return '%s()' % (self.__class__.__name__, )\n                return '%s(%r)' % (self.__class__.__name__, self.items())\n            finally:\n                del _repr_running[call_key]\n\n        def __reduce__(self):\n            'Return state information for pickling'\n            items = [[k, self[k]] for k in self]\n            inst_dict = vars(self).copy()\n            for k in vars(OrderedDict()):\n                inst_dict.pop(k, None)\n            if inst_dict:\n                return (self.__class__, (items, ), inst_dict)\n            return self.__class__, (items, )\n\n        def copy(self):\n            'od.copy() -> a shallow copy of od'\n            return self.__class__(self)\n\n        @classmethod\n        def fromkeys(cls, iterable, value=None):\n            '''OD.fromkeys(S[, v]) -> New ordered dictionary with keys from S\n            and values equal to v (which defaults to None).\n\n            '''\n            d = cls()\n            for key in iterable:\n                d[key] = value\n            return d\n\n        def __eq__(self, other):\n            '''od.__eq__(y) <==> od==y.  Comparison to another OD is order-sensitive\n            while comparison to a regular mapping is order-insensitive.\n\n            '''\n            if isinstance(other, OrderedDict):\n                return len(self) == len(\n                    other) and self.items() == other.items()\n            return dict.__eq__(self, other)\n\n        def __ne__(self, other):\n            return not self == other\n\n        # -- the following methods are only used in Python 2.7 --\n\n        def viewkeys(self):\n            \"od.viewkeys() -> a set-like object providing a view on od's keys\"\n            return KeysView(self)\n\n        def viewvalues(self):\n            \"od.viewvalues() -> an object providing a view on od's values\"\n            return ValuesView(self)\n\n        def viewitems(self):\n            \"od.viewitems() -> a set-like object providing a view on od's items\"\n            return ItemsView(self)\n\n\ntry:\n    from logging.config import BaseConfigurator, valid_ident\nexcept ImportError:  # pragma: no cover\n    IDENTIFIER = re.compile('^[a-z_][a-z0-9_]*$', re.I)\n\n    def valid_ident(s):\n        m = IDENTIFIER.match(s)\n        if not m:\n            raise ValueError('Not a valid Python identifier: %r' % s)\n        return True\n\n    # The ConvertingXXX classes are wrappers around standard Python containers,\n    # and they serve to convert any suitable values in the container. The\n    # conversion converts base dicts, lists and tuples to their wrapped\n    # equivalents, whereas strings which match a conversion format are converted\n    # appropriately.\n    #\n    # Each wrapper should have a configurator attribute holding the actual\n    # configurator to use for conversion.\n\n    class ConvertingDict(dict):\n        \"\"\"A converting dictionary wrapper.\"\"\"\n\n        def __getitem__(self, key):\n            value = dict.__getitem__(self, key)\n            result = self.configurator.convert(value)\n            # If the converted value is different, save for next time\n            if value is not result:\n                self[key] = result\n                if type(result) in (ConvertingDict, ConvertingList,\n                                    ConvertingTuple):\n                    result.parent = self\n                    result.key = key\n            return result\n\n        def get(self, key, default=None):\n            value = dict.get(self, key, default)\n            result = self.configurator.convert(value)\n            # If the converted value is different, save for next time\n            if value is not result:\n                self[key] = result\n                if type(result) in (ConvertingDict, ConvertingList,\n                                    ConvertingTuple):\n                    result.parent = self\n                    result.key = key\n            return result\n\n    def pop(self, key, default=None):\n        value = dict.pop(self, key, default)\n        result = self.configurator.convert(value)\n        if value is not result:\n            if type(result) in (ConvertingDict, ConvertingList,\n                                ConvertingTuple):\n                result.parent = self\n                result.key = key\n        return result\n\n    class ConvertingList(list):\n        \"\"\"A converting list wrapper.\"\"\"\n\n        def __getitem__(self, key):\n            value = list.__getitem__(self, key)\n            result = self.configurator.convert(value)\n            # If the converted value is different, save for next time\n            if value is not result:\n                self[key] = result\n                if type(result) in (ConvertingDict, ConvertingList,\n                                    ConvertingTuple):\n                    result.parent = self\n                    result.key = key\n            return result\n\n        def pop(self, idx=-1):\n

Diff · v421