[{"_1":2,"_174":-5,"_175":-5},"loaderData",{"_3":4,"_91":92},"root",{"_5":6,"_34":35,"_64":65},"ctx",{"_7":8,"_23":-5,"_24":25,"_26":27,"_28":20,"_29":20,"_30":20,"_31":32,"_33":20},"auth",{"_9":-5,"_10":-5,"_11":-5,"_12":-5,"_13":-5,"_14":-5,"_15":-5,"_16":-5,"_17":-5,"_18":-5,"_19":20,"_21":22},"sessionClaims","sessionId","sessionStatus","userId","actor","orgId","orgRole","orgSlug","orgPermissions","factorVerificationAge","isAuthenticated",false,"tokenType","session_token","user","preferencesKeybindings","default","preferencesTheme","light","preferencesFixers","preferencesCopilot","preferencesSelectionAi","notificationCount",0,"flagDenols","ENV",{"_36":37,"_38":39,"_40":41,"_42":43,"_44":45,"_46":47,"_48":49,"_50":51,"_52":53,"_54":55,"_56":57,"_58":59,"_60":61,"_62":63},"REACT_APP_SENTRY_DSN","https://586020d86f05489db63a554690acf1e9@o1398359.ingest.sentry.io/6724499","VAL_RUNTIME_NAME","prod","RENDER_GIT_COMMIT","7f439e1a7c8854d0a3e79c4918a7c5fa89d43a5d","RENDER_GIT_BRANCH","main","CLERK_PUBLISHABLE_KEY","pk_live_Y2xlcmsudmFsLnRvd24k","POSTHOG_API_TOKEN","phc_nmoyuAkStEZuUp69rYlg1DZgrIt19Gx0Y4Hwf8tGgJP","POSTHOG_API_HOST","https://wart.val.town","WEB_API_TEMPLATE","https://{val}.web.val.run","APP_URL","https://www.val.town","MODULE_URL","https://esm.town","VANITY_WEB_API_TEMPLATE","https://{label}.val.run/","DENOLS_URL","https://lsp.val.town","NODE_ENV","production","API_URL","https://api.val.town","clerkState",{"_66":67},"__internal_clerk_state",{"_68":69,"_70":45,"_71":72,"_73":72,"_74":20,"_75":72,"_76":72,"_77":72,"_78":72,"_79":80,"_89":20,"_90":20},"__clerk_ssr_state",{"_21":22,"_9":-5,"_10":-5,"_11":-5,"_12":-5,"_13":-5,"_14":-5,"_15":-5,"_16":-5,"_17":-5,"_18":-5,"_19":20},"__publishableKey","__proxyUrl","","__domain","__isSatellite","__signInUrl","__signUpUrl","__afterSignInUrl","__afterSignUpUrl","__clerk_debug",{"_81":20,"_19":20,"_82":72,"_83":84,"_85":72,"_86":45,"_87":20,"_88":72},"isSignedIn","proxyUrl","reason","session-token-and-uat-missing","message","publishableKey","isSatellite","domain","__telemetryDisabled","__telemetryDebug","routes/embed.x.$handle.$name.$",{"_93":94,"_95":96,"_97":98,"_99":100,"_146":147,"_171":172,"_173":-5},"handle","zcpbx","name","MolstarViewer","path","frontend/mesoscale-explorer/data/state.ts","project",{"_101":102,"_95":96,"_103":104,"_105":-5,"_106":20,"_107":108,"_109":-5,"_110":-5,"_12":111,"_112":-5,"_113":20,"_114":-5,"_115":32,"_14":116,"_117":118,"_119":118,"_120":121,"_122":121,"_123":121,"_124":118,"_125":118,"_23":126,"_129":130,"_132":133,"_145":20},"id","4a052a4e-a843-11f0-a0f8-0224a6c84d84","createdAt",["D",1760366740657],"deletedAt","legacyEnvVars","privacy","public","description","imageUrl","3da541a0-40a4-11f0-a359-812261733f73","pinnedFileId","pinPreview","screenshotVersion","likeCount","0942d0eb-af3b-49c4-9f38-74e044019762","userPerm","r","valPerm","blobPerm","rw","emailPerm","sqlitePerm","projectPerm","telemetryPerm",{"_93":94,"_127":128},"profileImageUrl","https://img.clerk.com/eyJ0eXBlIjoicHJveHkiLCJzcmMiOiJodHRwczovL2ltYWdlcy5jbGVyay5kZXYvb2F1dGhfZ2l0aHViL2ltZ18yeTBaUXNBY2E1VVg5MFllM3dISTM5aHV4akUifQ","org",{"_93":94,"_131":128,"_12":111},"avatar","branch",{"_134":135,"_95":43,"_101":136,"_137":102,"_138":-5,"_139":-5,"_140":-5,"_141":-5,"_142":-5,"_143":96,"_144":94},"version",661,"4a057be8-a843-11f0-a0f8-0224a6c84d84","projectId","forkedBranchId","forkedBranchVersion","forkedProjectPrivacy","forkedProjectId","forkedProjectOrgId","projectName","userHandle","isOwned","file",{"_101":148,"_95":149,"_150":151,"_152":153,"_154":136,"_155":156,"_157":158,"_103":159,"_134":160,"_161":162,"_163":164,"_165":20,"_166":-5,"_97":167},"2bc92708-bdcc-11f0-b9bc-42dde27851f2","state.ts","fileId","c790687a-bdb5-11f0-b3e3-42dde27851f2","parentId","2af2b2d6-bdcc-11f0-9c3b-42dde27851f2","branchId","branchVersion",561,"latest",true,["D",1762734505326],5,"fileType","script","content","/**\n * Copyright (c) 2023-2025 mol* contributors, licensed under MIT, See LICENSE file for more info.\n *\n * @author Alexander Rose \n */\n\nimport { PluginStateObject as PSO, PluginStateTransform } from '../../../mol-plugin-state/objects.ts';\nimport type { PluginContext } from '../../../mol-plugin/context.ts';\nimport { ParamDefinition as PD } from '../../../mol-util/param-definition.ts';\nimport { Task } from '../../../mol-task/index.ts';\nimport { Color } from '../../../mol-util/color/index.ts';\nimport { Spheres } from '../../../mol-geo/geometry/spheres/spheres.ts';\nimport { Clip } from '../../../mol-util/clip.ts';\nimport { escapeRegExp, stringToWords } from '../../../mol-util/string.ts';\nimport { Mat4, Vec3 } from '../../../mol-math/linear-algebra.ts';\nimport { ParamMapping } from '../../../mol-util/param-mapping.ts';\nimport type { EntityNode } from '../ui/entities.tsx';\nimport { distinctColors, type DistinctColorsProps } from '../../../mol-util/color/distinct.ts';\nimport type { Sphere3D } from '../../../mol-math/geometry.ts';\nimport { Hcl } from '../../../mol-util/color/spaces/hcl.ts';\nimport { type StateObjectCell, StateObjectRef, StateSelection } from '../../../mol-state/index.ts';\nimport {\n ShapeRepresentation3D,\n StructureRepresentation3D,\n} from '../../../mol-plugin-state/transforms/representation.ts';\nimport type { SpacefillRepresentationProvider } from '../../../mol-repr/structure/representation/spacefill.ts';\nimport { assertUnreachable } from '../../../mol-util/type-helpers.ts';\nimport type { MesoscaleExplorerState } from '../app.ts';\nimport { saturate } from '../../../mol-math/interpolate.ts';\nimport { Material } from '../../../mol-util/material.ts';\n\nfunction getHueRange(hue: number, variability: number) {\n let min = hue - variability;\n const minOverflow = min < 0 ? -min : 0;\n let max = hue + variability;\n if (max > 360) min -= max - 360;\n max += minOverflow;\n return [Math.max(0, min), Math.min(360, max)] as [number, number];\n}\n\nfunction getGrayscaleColors(count: number, luminance: number, variability: number) {\n const out: Color[] = [];\n for (let i = 0; i < count; ++i) {\n const l = saturate(luminance / 100);\n const v = saturate(variability / 180) * Math.random();\n const s = Math.random() > 0.5 ? 1 : -1;\n const d = Math.abs(l + s * v) % 1;\n out[i] = Color.fromNormalizedRgb(d, d, d);\n }\n return out;\n}\n\nexport function getDistinctGroupColors(\n count: number,\n color: Color,\n variability: number,\n shift: number,\n props?: Partial,\n) {\n const hcl = Hcl.fromColor(Hcl(), color);\n if (isNaN(hcl[0])) {\n return getGrayscaleColors(count, hcl[2], variability);\n }\n\n if (count === 1) {\n hcl[1] = 65;\n hcl[2] = 55;\n return [Hcl.toColor(hcl)];\n }\n\n const colors = distinctColors(count, {\n hue: getHueRange(hcl[0], variability),\n chroma: [30, 100],\n luminance: [50, 100],\n clusteringStepCount: 0,\n minSampleCount: 1000,\n sampleCountFactor: 100,\n sort: 'none',\n ...props,\n });\n\n if (shift !== 0) {\n const offset = Math.floor(shift / 100 * count);\n return [...colors.slice(offset), ...colors.slice(0, offset)];\n } else {\n return colors;\n }\n}\n\nconst Colors = [0x377eb8, 0xe41a1c, 0x4daf4a, 0x984ea3, 0xff7f00, 0xffff33, 0xa65628, 0xf781bf] as Color[];\n\nexport function getDistinctBaseColors(count: number, shift: number, props?: Partial): Color[] {\n let colors: Color[];\n if (count <= Colors.length) {\n colors = Colors.slice(0, count).map((e) => Array.isArray(e) ? e[0] : e);\n } else {\n colors = distinctColors(count, {\n hue: [1, 360],\n chroma: [25, 100],\n luminance: [30, 100],\n clusteringStepCount: 0,\n minSampleCount: 1000,\n sampleCountFactor: 100,\n sort: 'none',\n ...props,\n });\n }\n\n if (shift !== 0) {\n const offset = Math.floor(shift / 100 * count);\n return [...colors.slice(offset), ...colors.slice(0, offset)];\n } else {\n return colors;\n }\n}\n\nexport const ColorParams = {\n type: PD.Select('generate', PD.arrayToOptions(['generate', 'uniform', 'custom'])),\n illustrative: PD.Boolean(false, { description: 'Illustrative style', hideIf: (p) => p.type === 'custom' }),\n value: PD.Color(Color(0xFFFFFF), { hideIf: (p) => p.type === 'custom' }),\n variability: PD.Numeric(20, { min: 1, max: 180, step: 1 }, { hideIf: (p) => p.type !== 'generate' }),\n shift: PD.Numeric(0, { min: 0, max: 100, step: 1 }, { hideIf: (p) => !p.type.includes('generate') }),\n lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }, { hideIf: (p) => p.type === 'custom' }),\n alpha: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }, { hideIf: (p) => p.type === 'custom' }),\n emissive: PD.Numeric(0, { min: 0, max: 1, step: 0.01 }, { hideIf: (p) => p.type === 'custom' }),\n};\nexport type ColorProps = PD.Values;\n\nexport const ColorValueParam = PD.Color(Color(0xFFFFFF));\n\nexport const RootParams = {\n type: PD.Select('custom', PD.arrayToOptions(['group-generate', 'group-uniform', 'generate', 'uniform', 'custom'])),\n illustrative: PD.Boolean(false, { description: 'Illustrative style', hideIf: (p) => p.type === 'custom' }),\n value: PD.Color(Color(0xFFFFFF), { hideIf: (p) => p.type !== 'uniform' }),\n variability: PD.Numeric(20, { min: 1, max: 180, step: 1 }, { hideIf: (p) => p.type !== 'group-generate' }),\n shift: PD.Numeric(0, { min: 0, max: 100, step: 1 }, { hideIf: (p) => !p.type.includes('generate') }),\n lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }, { hideIf: (p) => p.type === 'custom' }),\n alpha: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }, { hideIf: (p) => p.type === 'custom' }),\n emissive: PD.Numeric(0, { min: 0, max: 1, step: 0.01 }, { hideIf: (p) => p.type === 'custom' }),\n};\n\nexport const LightnessParams = {\n lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }),\n};\nexport const DimLightness = 6;\n\nexport const IllustrativeParams = {\n illustrative: PD.Boolean(false, { description: 'Illustrative style' }),\n};\n\nexport const OpacityParams = {\n alpha: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }),\n};\n\nexport const EmissiveParams = {\n emissive: PD.Numeric(0, { min: 0, max: 1, step: 0.01 }),\n};\n\nexport const celShaded = {\n celShaded: PD.Boolean(false, { description: 'Cel Shading light for stylized rendering of representations' }),\n};\n\nexport type celShadedProps = PD.Values;\n\nexport const PatternParams = {\n frequency: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }),\n amplitude: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }),\n};\n\nexport const StyleParams = {\n ignoreLight: PD.Boolean(false, { description: 'Ignore light for stylized rendering of representations' }),\n materialStyle: Material.getParam(),\n celShaded: PD.Boolean(false, { description: 'Cel Shading light for stylized rendering of representations' }),\n};\n\nexport const LodParams = {\n lodLevels: Spheres.Params.lodLevels,\n cellSize: Spheres.Params.cellSize,\n batchSize: Spheres.Params.batchSize,\n approximate: Spheres.Params.approximate,\n};\n\nexport const SimpleClipParams = {\n type: PD.Select('none', PD.objectToOptions(Clip.Type, (t) => stringToWords(t))),\n invert: PD.Boolean(false),\n position: PD.Group({\n x: PD.Numeric(0, { min: -100, max: 100, step: 1 }, { immediateUpdate: true }),\n y: PD.Numeric(0, { min: -100, max: 100, step: 1 }, { immediateUpdate: true }),\n z: PD.Numeric(0, { min: -100, max: 100, step: 1 }, { immediateUpdate: true }),\n }, { hideIf: (g) => g.type === 'none', isExpanded: true }),\n rotation: PD.Group({\n axis: PD.Vec3(Vec3.create(1, 0, 0)),\n angle: PD.Numeric(0, { min: -180, max: 180, step: 1 }, { immediateUpdate: true }),\n }, { hideIf: (g) => g.type === 'none', isExpanded: true }),\n scale: PD.Group({\n x: PD.Numeric(100, { min: 0, max: 100, step: 1 }, { immediateUpdate: true }),\n y: PD.Numeric(100, { min: 0, max: 100, step: 1 }, { immediateUpdate: true }),\n z: PD.Numeric(100, { min: 0, max: 100, step: 1 }, { immediateUpdate: true }),\n }, { hideIf: (g) => ['none', 'plane'].includes(g.type), isExpanded: true }),\n};\nexport type SimpleClipParams = typeof SimpleClipParams;\nexport type SimpleClipProps = PD.Values;\n\nexport function getClipObjects(values: SimpleClipProps, boundingSphere: Sphere3D): Clip.Props['objects'] {\n const { center, radius } = boundingSphere;\n\n const position = Vec3.clone(center);\n Vec3.add(\n position,\n position,\n Vec3.create(\n radius * values.position.x / 100,\n radius * values.position.y / 100,\n radius * values.position.z / 100,\n ),\n );\n\n const scale = Vec3.create(values.scale.x, values.scale.y, values.scale.z);\n Vec3.scale(scale, scale, 2 * radius / 100);\n\n return [{\n type: values.type,\n invert: values.invert,\n position,\n scale,\n rotation: values.rotation,\n transform: Mat4.identity(),\n }];\n}\n\nexport function createClipMapping(node: EntityNode) {\n return ParamMapping({\n params: SimpleClipParams,\n target: (ctx: PluginContext) => {\n return node.clipValue;\n },\n })({\n values(props, ctx) {\n if (!props || props.objects.length === 0) {\n return {\n type: 'none',\n invert: false,\n position: { x: 0, y: 0, z: 0 },\n rotation: { axis: Vec3.create(1, 0, 0), angle: 0 },\n scale: { x: 100, y: 100, z: 100 },\n };\n }\n\n const { center, radius } = node.plugin.canvas3d!.boundingSphere;\n const { invert, position, scale, rotation, type } = props.objects[0];\n\n const p = Vec3.clone(position);\n Vec3.sub(p, p, center);\n Vec3.scale(p, p, 100 / radius);\n Vec3.round(p, p);\n\n const s = Vec3.clone(scale);\n Vec3.scale(s, s, 100 / radius / 2);\n Vec3.round(s, s);\n\n return {\n type,\n invert,\n position: { x: p[0], y: p[1], z: p[2] },\n rotation,\n scale: { x: s[0], y: s[1], z: s[2] },\n };\n },\n update: (s, props) => {\n if (!props) return;\n\n const clipObjects = getClipObjects(s, node.plugin.canvas3d!.boundingSphere);\n props.objects = clipObjects;\n },\n apply: async (props, ctx) => {\n if (props) node.updateClip(props);\n },\n });\n}\n\nexport const MesoscaleGroupParams = {\n root: PD.Value(false, { isHidden: true }),\n index: PD.Value(-1, { isHidden: true }),\n tag: PD.Value('', { isHidden: true }),\n label: PD.Value('', { isHidden: true }),\n description: PD.Value('', { isHidden: true }),\n hidden: PD.Boolean(false),\n color: PD.Group(RootParams),\n lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }),\n alpha: PD.Numeric(1, { min: 0, max: 1, step: 0.01 }),\n emissive: PD.Numeric(0, { min: 0, max: 1, step: 0.01 }),\n lod: PD.Group(LodParams),\n clip: PD.Group(SimpleClipParams),\n};\nexport type MesoscaleGroupProps = PD.Values;\n\nexport class MesoscaleGroupObject extends PSO.Create({ name: 'Mesoscale Group', typeClass: 'Object' }) {}\n\nexport const MesoscaleGroup = PluginStateTransform.BuiltIn({\n name: 'mesoscale-group',\n display: { name: 'Mesoscale Group' },\n from: [PSO.Root, MesoscaleGroupObject],\n to: MesoscaleGroupObject,\n params: MesoscaleGroupParams,\n})({\n apply({ a, params }, plugin: PluginContext) {\n return Task.create('Apply Mesoscale Group', async () => {\n return new MesoscaleGroupObject({}, { label: params.label, description: params.description });\n });\n },\n});\n\nexport function getMesoscaleGroupParams(graphicsMode: GraphicsMode): MesoscaleGroupProps {\n const groupParams = PD.getDefaultValues(MesoscaleGroupParams);\n if (graphicsMode === 'custom') return groupParams;\n\n return {\n ...groupParams,\n lod: {\n ...groupParams.lod,\n ...getGraphicsModeProps(graphicsMode),\n },\n };\n}\n\n//\n\nexport type LodLevels = typeof SpacefillRepresentationProvider.defaultValues['lodLevels'];\n\nexport function getLodLevels(graphicsMode: Exclude): LodLevels {\n switch (graphicsMode) {\n case 'performance':\n return [\n { minDistance: 1, maxDistance: 300, overlap: 0, stride: 1, scaleBias: 1 },\n { minDistance: 300, maxDistance: 2000, overlap: 0, stride: 40, scaleBias: 3 },\n { minDistance: 2000, maxDistance: 6000, overlap: 0, stride: 150, scaleBias: 3 },\n { minDistance: 6000, maxDistance: 10000000, overlap: 0, stride: 300, scaleBias: 2.5 },\n ];\n case 'balanced':\n return [\n { minDistance: 1, maxDistance: 500, overlap: 0, stride: 1, scaleBias: 1 },\n { minDistance: 500, maxDistance: 2000, overlap: 0, stride: 15, scaleBias: 3 },\n { minDistance: 2000, maxDistance: 6000, overlap: 0, stride: 70, scaleBias: 2.7 },\n { minDistance: 6000, maxDistance: 10000000, overlap: 0, stride: 200, scaleBias: 2.5 },\n ];\n case 'quality':\n return [\n { minDistance: 1, maxDistance: 1000, overlap: 0, stride: 1, scaleBias: 1 },\n { minDistance: 1000, maxDistance: 4000, overlap: 0, stride: 10, scaleBias: 3 },\n { minDistance: 4000, maxDistance: 10000, overlap: 0, stride: 50, scaleBias: 2.7 },\n { minDistance: 10000, maxDistance: 10000000, overlap: 0, stride: 200, scaleBias: 2.3 },\n ];\n case 'ultra':\n return [\n { minDistance: 1, maxDistance: 5000, overlap: 0, stride: 1, scaleBias: 1 },\n { minDistance: 5000, maxDistance: 10000, overlap: 0, stride: 10, scaleBias: 3 },\n { minDistance: 10000, maxDistance: 30000, overlap: 0, stride: 50, scaleBias: 2.5 },\n { minDistance: 30000, maxDistance: 10000000, overlap: 0, stride: 200, scaleBias: 2 },\n ];\n default:\n assertUnreachable(graphicsMode);\n }\n}\n\nexport type GraphicsMode = 'ultra' | 'quality' | 'balanced' | 'performance' | 'custom';\n\nexport function getGraphicsModeProps(graphicsMode: Exclude) {\n return {\n lodLevels: getLodLevels(graphicsMode),\n approximate: graphicsMode !== 'quality' && graphicsMode !== 'ultra',\n alphaThickness: graphicsMode === 'performance' ? 15 : 12,\n };\n}\n\nexport function setGraphicsCanvas3DProps(ctx: PluginContext, graphics: GraphicsMode) {\n const pixelScale = graphics === 'balanced' ? 0.75 : graphics === 'performance' ? 0.5 : 1;\n\n ctx.canvas3dContext?.setProps({ pixelScale });\n\n ctx.canvas3d?.setProps({\n postprocessing: {\n sharpening: pixelScale < 1\n ? {\n name: 'on',\n params: { sharpness: 0.5, denoise: true },\n }\n : { name: 'off', params: {} },\n },\n });\n}\n\n//\n\nexport const MesoscaleStateParams = {\n filter: PD.Value('', { isHidden: true }),\n graphics: PD.Select(\n 'quality',\n PD.arrayToOptions(['ultra', 'quality', 'balanced', 'performance', 'custom'] as GraphicsMode[]),\n ),\n description: PD.Value('', { isHidden: true }),\n focusInfo: PD.Value('', { isHidden: true }),\n link: PD.Value('', { isHidden: true }),\n textSizeDescription: PD.Numeric(14, { min: 1, max: 100, step: 1 }, { isHidden: true }),\n index: PD.Value(-1, { isHidden: true }),\n};\n\nexport class MesoscaleStateObject\n extends PSO.Create({ name: 'Mesoscale State', typeClass: 'Object' }) {}\n\nconst MesoscaleStateTransform = PluginStateTransform.BuiltIn({\n name: 'mesoscale-state',\n display: { name: 'Mesoscale State' },\n from: PSO.Root,\n to: MesoscaleStateObject,\n params: MesoscaleStateParams,\n})({\n apply({ a, params }, plugin: PluginContext) {\n return Task.create('Apply Mesoscale State', async () => {\n return new MesoscaleStateObject(params);\n });\n },\n});\n\nexport { MesoscaleState };\ntype MesoscaleState = PD.Values;\nconst MesoscaleState = {\n async init(ctx: PluginContext) {\n const cell = ctx.state.data.selectQ((q) => q.ofType(MesoscaleStateObject))[0];\n if (cell) throw new Error('MesoscaleState already initialized');\n\n const customState = ctx.customState as MesoscaleExplorerState;\n const state = await ctx.state.data.build().toRoot().apply(MesoscaleStateTransform, {\n filter: '',\n graphics: customState.graphicsMode,\n }).commit();\n customState.stateRef = state.ref;\n },\n get(ctx: PluginContext): MesoscaleState {\n const ref = this.ref(ctx);\n return ctx.state.data.tryGetCellData(ref);\n },\n async set(ctx: PluginContext, props: Partial) {\n const ref = this.ref(ctx);\n await ctx.state.data.build().to(ref).update(MesoscaleStateTransform, (old) => Object.assign(old, props))\n .commit();\n },\n ref(ctx: PluginContext): string {\n const ref = (ctx.customState as MesoscaleExplorerState).stateRef;\n if (!ref) throw new Error('MesoscaleState not initialized');\n return ref;\n },\n has(ctx: PluginContext): boolean {\n const ref = (ctx.customState as MesoscaleExplorerState).stateRef || '';\n return ctx.state.data.cells.has(ref) ? true : false;\n },\n};\n\n//\n\nexport function getRoots(plugin: PluginContext): StateSelection.CellSeq> {\n const s = plugin.customState as MesoscaleExplorerState;\n if (!s.stateCache.roots) {\n s.stateCache.roots = plugin.state.data.select(StateSelection.Generators.rootsOfType(MesoscaleGroupObject));\n }\n return s.stateCache.roots;\n}\n\nexport function getGroups(\n plugin: PluginContext,\n tag?: string,\n): StateSelection.CellSeq> {\n const s = plugin.customState as MesoscaleExplorerState;\n const k = `groups-${tag || ''}`;\n if (!s.stateCache[k]) {\n const selector = tag !== undefined\n ? StateSelection.Generators.ofTransformer(MesoscaleGroup).withTag(tag)\n : StateSelection.Generators.ofTransformer(MesoscaleGroup);\n s.stateCache[k] = plugin.state.data.select(selector);\n }\n return s.stateCache[k];\n}\n\nfunction _getAllGroups(plugin: PluginContext, tag: string | undefined, list: StateObjectCell[]) {\n const groups = getGroups(plugin, tag);\n list.push(...groups);\n for (const g of groups) {\n _getAllGroups(plugin, g.params?.values.tag, list);\n }\n return list;\n}\n\nexport function getAllGroups(plugin: PluginContext, tag?: string) {\n return _getAllGroups(plugin, tag, []);\n}\n\nexport function getAllLeafGroups(plugin: PluginContext, tag: string) {\n const allGroups = getAllGroups(plugin, tag);\n allGroups.sort((a, b) => a.params?.values.index - b.params?.values.index);\n return allGroups.filter((g) => {\n return getEntities(plugin, g.params?.values.tag).length > 0;\n });\n}\n\ntype EntityCells = StateSelection.CellSeq<\n StateObjectCell\n>;\n\nexport function getEntities(plugin: PluginContext, tag?: string): EntityCells {\n const s = plugin.customState as MesoscaleExplorerState;\n const k = `entities-${tag || ''}`;\n if (!s.stateCache[k]) {\n const structureSelector = tag !== undefined\n ? StateSelection.Generators.ofTransformer(StructureRepresentation3D).withTag(tag)\n : StateSelection.Generators.ofTransformer(StructureRepresentation3D);\n const shapeSelector = tag !== undefined\n ? StateSelection.Generators.ofTransformer(ShapeRepresentation3D).withTag(tag)\n : StateSelection.Generators.ofTransformer(ShapeRepresentation3D);\n s.stateCache[k] = [\n ...plugin.state.data.select(structureSelector).filter((c) => c.obj!.data.sourceData.elementCount > 0),\n ...plugin.state.data.select(shapeSelector),\n ];\n }\n return s.stateCache[k];\n}\n\nfunction getFilterMatcher(filter: string) {\n return filter.startsWith('\"') && filter.endsWith('\"')\n ? new RegExp(`^${escapeRegExp(filter.substring(1, filter.length - 1))}$`, 'g')\n : new RegExp(escapeRegExp(filter), 'gi');\n}\n\nexport function getFilteredEntities(plugin: PluginContext, tag: string, filter: string) {\n if (!filter) return getEntities(plugin, tag);\n const matcher = getFilterMatcher(filter);\n return getEntities(plugin, tag).filter((c) => getEntityLabel(plugin, c).match(matcher) !== null);\n}\n\nfunction _getAllEntities(plugin: PluginContext, tag: string | undefined, list: EntityCells) {\n list.push(...getEntities(plugin, tag));\n for (const g of getGroups(plugin, tag)) {\n _getAllEntities(plugin, g.params?.values.tag, list);\n }\n return list;\n}\n\nexport function getAllEntities(plugin: PluginContext, tag?: string) {\n return _getAllEntities(plugin, tag, []);\n}\n\nexport function getAllFilteredEntities(plugin: PluginContext, tag: string, filter: string) {\n if (!filter) return getAllEntities(plugin, tag);\n const matcher = getFilterMatcher(filter);\n return getAllEntities(plugin, tag).filter((c) => getEntityLabel(plugin, c).match(matcher) !== null);\n}\n\nexport function getEveryEntity(plugin: PluginContext, filter?: string, tag?: string) {\n if (filter) {\n const matcher = getFilterMatcher(filter);\n return getAllEntities(plugin, tag).filter((c) => getEntityLabel(plugin, c).match(matcher) !== null);\n } else {\n return getAllEntities(plugin, tag);\n }\n}\n\nexport function getEntityLabel(plugin: PluginContext, cell: StateObjectCell) {\n return StateObjectRef.resolve(plugin.state.data, cell.transform.parent)?.obj?.label || 'Entity';\n}\n\nexport function getCellDescription(cell: StateObjectCell) {\n // markdown style for description\n return '**' + cell?.obj?.label + '**\\n\\n' + cell?.obj?.description;\n}\n\nexport function getEntityDescription(plugin: PluginContext, cell: StateObjectCell) {\n const s = StateObjectRef.resolve(plugin.state.data, cell.transform.parent);\n const d = getCellDescription(s!);\n return d;\n}\n\nexport async function updateStyle(\n plugin: PluginContext,\n options: { ignoreLight: boolean; material: Material; celShaded: boolean; illustrative: boolean },\n) {\n const update = plugin.state.data.build();\n const { ignoreLight, material, celShaded, illustrative } = options;\n\n const entities = getAllEntities(plugin);\n\n for (let j = 0; j < entities.length; ++j) {\n update.to(entities[j]).update((old) => {\n if (old.type) {\n const value = old.colorTheme.name === 'illustrative'\n ? old.colorTheme.params.style.params.value\n : old.colorTheme.params.value;\n const lightness = old.colorTheme.name === 'illustrative'\n ? old.colorTheme.params.style.params.lightness\n : old.colorTheme.params.lightness;\n if (illustrative) {\n old.colorTheme = {\n name: 'illustrative',\n params: { style: { name: 'uniform', params: { value, lightness } } },\n };\n } else {\n old.colorTheme = { name: 'uniform', params: { value, lightness } };\n }\n old.type.params.ignoreLight = ignoreLight;\n old.type.params.material = material;\n old.type.params.celShaded = celShaded;\n }\n });\n }\n\n await update.commit();\n}\n\nexport async function updateColors(plugin: PluginContext, values: PD.Values, tag: string, filter: string) {\n const update = plugin.state.data.build();\n const { type, illustrative, value, shift, lightness, alpha, emissive } = values;\n if (type === 'group-generate' || type === 'group-uniform') {\n const leafGroups = getAllLeafGroups(plugin, tag);\n const rootLeafGroups = getRoots(plugin).filter((g) =>\n g.params?.values.tag === tag && getEntities(plugin, g.params?.values.tag).length > 0\n );\n const groups = [...leafGroups, ...rootLeafGroups];\n const baseColors = getDistinctBaseColors(groups.length, shift);\n\n for (let i = 0; i < groups.length; ++i) {\n const g = groups[i];\n const entities = getFilteredEntities(plugin, g.params?.values.tag, filter);\n let groupColors: Color[] = [];\n\n if (type === 'group-generate') {\n const c = g.params?.values.color;\n groupColors = getDistinctGroupColors(entities.length, baseColors[i], c.variability, c.shift);\n }\n\n for (let j = 0; j < entities.length; ++j) {\n const c = type === 'group-generate' ? groupColors[j] : baseColors[i];\n update.to(entities[j]).update((old) => {\n if (old.type) {\n if (illustrative) {\n old.colorTheme = {\n name: 'illustrative',\n params: { style: { name: 'uniform', params: { value: c, lightness: lightness } } },\n };\n } else {\n old.colorTheme = { name: 'uniform', params: { value: c, lightness: lightness } };\n }\n old.type.params.alpha = alpha;\n old.type.params.xrayShaded = alpha < 1 ? 'inverted' : false;\n old.type.params.emissive = emissive;\n } else if (old.coloring) {\n old.coloring.params.color = c;\n old.coloring.params.lightness = lightness;\n old.alpha = alpha;\n old.xrayShaded = alpha < 1 ? true : false;\n old.emissive = emissive;\n }\n });\n }\n\n update.to(g.transform.ref).update((old) => {\n old.color.type = type === 'group-generate' ? 'generate' : 'uniform';\n old.color.illustrative = illustrative;\n old.color.value = baseColors[i];\n old.color.lightness = lightness;\n old.color.alpha = alpha;\n old.color.emissive = emissive;\n });\n }\n } else if (type === 'generate' || type === 'uniform') {\n const entities = getAllFilteredEntities(plugin, tag, filter);\n let groupColors: Color[] = [];\n\n if (type === 'generate') {\n groupColors = getDistinctBaseColors(entities.length, shift);\n }\n\n for (let j = 0; j < entities.length; ++j) {\n const c = type === 'generate' ? groupColors[j] : value;\n update.to(entities[j]).update((old) => {\n if (old.type) {\n if (illustrative) {\n old.colorTheme = {\n name: 'illustrative',\n params: { style: { name: 'uniform', params: { value: c, lightness: lightness } } },\n };\n } else {\n old.colorTheme = { name: 'uniform', params: { value: c, lightness: lightness } };\n }\n old.type.params.alpha = alpha;\n old.type.params.xrayShaded = alpha < 1 ? 'inverted' : false;\n old.type.params.emissive = emissive;\n } else if (old.coloring) {\n old.coloring.params.color = c;\n old.coloring.params.lightness = lightness;\n old.alpha = alpha;\n old.xrayShaded = alpha < 1 ? true : false;\n old.emissive = emissive;\n }\n });\n }\n\n const others = getAllLeafGroups(plugin, tag);\n for (const o of others) {\n update.to(o).update((old) => {\n old.color.type = type === 'generate' ? 'custom' : 'uniform';\n old.color.illustrative = illustrative;\n old.color.value = value;\n old.color.lightness = lightness;\n old.color.alpha = alpha;\n old.color.emissive = emissive;\n });\n }\n }\n\n await update.commit();\n}\n\nexport function expandAllGroups(plugin: PluginContext) {\n for (const g of getAllGroups(plugin)) {\n if (g.state.isCollapsed) {\n plugin.state.data.updateCellState(g.transform.ref, { isCollapsed: false });\n }\n }\n}\n","deleted","label",[168,169,170,149],"frontend","mesoscale-explorer","data","permalink","https://www.val.town/x/zcpbx/MolstarViewer/code/frontend/mesoscale-explorer/data/state.ts","extension","actionData","errors"]